CA2479906C - Carbamic acid compounds comprising a piperazine linkage as hdac inhibitors - Google Patents
Carbamic acid compounds comprising a piperazine linkage as hdac inhibitors Download PDFInfo
- Publication number
- CA2479906C CA2479906C CA2479906A CA2479906A CA2479906C CA 2479906 C CA2479906 C CA 2479906C CA 2479906 A CA2479906 A CA 2479906A CA 2479906 A CA2479906 A CA 2479906A CA 2479906 C CA2479906 C CA 2479906C
- Authority
- CA
- Canada
- Prior art keywords
- independently
- optionally substituted
- compound according
- group
- 7alkylene
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- KXDHJXZQYSOELW-UHFFFAOYSA-N Carbamic acid Chemical class NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 title abstract description 32
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 title description 40
- 239000003276 histone deacetylase inhibitor Substances 0.000 title description 21
- 150000001875 compounds Chemical class 0.000 claims abstract description 491
- -1 piperazin-1,4-diyl group Chemical group 0.000 claims abstract description 189
- 239000000203 mixture Substances 0.000 claims abstract description 81
- 108090000353 Histone deacetylase Proteins 0.000 claims abstract description 80
- 102000003964 Histone deacetylase Human genes 0.000 claims abstract description 79
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims abstract description 50
- 238000011282 treatment Methods 0.000 claims abstract description 50
- 206010028980 Neoplasm Diseases 0.000 claims abstract description 37
- 150000002148 esters Chemical class 0.000 claims abstract description 34
- 201000011510 cancer Diseases 0.000 claims abstract description 23
- 150000003839 salts Chemical class 0.000 claims abstract description 21
- 230000002062 proliferating effect Effects 0.000 claims abstract description 18
- 201000004681 Psoriasis Diseases 0.000 claims abstract description 16
- 230000001404 mediated effect Effects 0.000 claims abstract description 16
- 239000012453 solvate Substances 0.000 claims abstract description 14
- 125000004429 atom Chemical group 0.000 claims description 97
- 125000001424 substituent group Chemical group 0.000 claims description 80
- 125000002947 alkylene group Chemical group 0.000 claims description 65
- 125000006413 ring segment Chemical group 0.000 claims description 42
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 39
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 34
- 125000004432 carbon atom Chemical group C* 0.000 claims description 33
- 229910052799 carbon Inorganic materials 0.000 claims description 30
- 229920006395 saturated elastomer Polymers 0.000 claims description 29
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 25
- 125000000623 heterocyclic group Chemical group 0.000 claims description 23
- 125000001931 aliphatic group Chemical group 0.000 claims description 21
- 125000000217 alkyl group Chemical group 0.000 claims description 20
- 125000002723 alicyclic group Chemical group 0.000 claims description 19
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 18
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 claims description 18
- 239000003814 drug Substances 0.000 claims description 15
- 229910052757 nitrogen Inorganic materials 0.000 claims description 15
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 claims description 13
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 12
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 12
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 11
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 11
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 11
- 125000003368 amide group Chemical group 0.000 claims description 10
- 241001465754 Metazoa Species 0.000 claims description 9
- 125000002837 carbocyclic group Chemical group 0.000 claims description 9
- 125000002252 acyl group Chemical group 0.000 claims description 8
- 150000001717 carbocyclic compounds Chemical class 0.000 claims description 8
- 150000002430 hydrocarbons Chemical class 0.000 claims description 8
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 8
- 238000004519 manufacturing process Methods 0.000 claims description 7
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 claims description 7
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 6
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 6
- 125000004452 carbocyclyl group Chemical group 0.000 claims description 6
- 150000002391 heterocyclic compounds Chemical class 0.000 claims description 6
- 229910052760 oxygen Inorganic materials 0.000 claims description 6
- 239000001301 oxygen Substances 0.000 claims description 6
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 claims description 6
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 5
- 239000003937 drug carrier Substances 0.000 claims description 5
- 125000005420 sulfonamido group Chemical group S(=O)(=O)(N*)* 0.000 claims description 5
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 claims description 4
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 3
- 229910006074 SO2NH2 Inorganic materials 0.000 claims description 3
- 125000001624 naphthyl group Chemical group 0.000 claims description 3
- 125000004193 piperazinyl group Chemical group 0.000 claims description 3
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Natural products C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 claims description 2
- 239000005864 Sulphur Substances 0.000 claims description 2
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 claims description 2
- JSPLKZUTYZBBKA-UHFFFAOYSA-N trioxidane Chemical compound OOO JSPLKZUTYZBBKA-UHFFFAOYSA-N 0.000 claims description 2
- 125000001475 halogen functional group Chemical group 0.000 claims 3
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims 2
- 125000001041 indolyl group Chemical group 0.000 claims 2
- 125000000641 acridinyl group Chemical group C1(=CC=CC2=NC3=CC=CC=C3C=C12)* 0.000 claims 1
- 125000005073 adamantyl group Chemical group C12(CC3CC(CC(C1)C3)C2)* 0.000 claims 1
- 125000002785 azepinyl group Chemical group 0.000 claims 1
- 125000002393 azetidinyl group Chemical group 0.000 claims 1
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 claims 1
- 125000000609 carbazolyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3NC12)* 0.000 claims 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims 1
- 125000002243 cyclohexanonyl group Chemical group *C1(*)C(=O)C(*)(*)C(*)(*)C(*)(*)C1(*)* 0.000 claims 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims 1
- 125000003983 fluorenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3CC12)* 0.000 claims 1
- 125000002541 furyl group Chemical group 0.000 claims 1
- 125000002636 imidazolinyl group Chemical group 0.000 claims 1
- 125000002883 imidazolyl group Chemical group 0.000 claims 1
- 125000002757 morpholinyl group Chemical group 0.000 claims 1
- 125000002868 norbornyl group Chemical group C12(CCC(CC1)C2)* 0.000 claims 1
- 125000003386 piperidinyl group Chemical group 0.000 claims 1
- 125000003373 pyrazinyl group Chemical group 0.000 claims 1
- 125000004076 pyridyl group Chemical group 0.000 claims 1
- 125000000714 pyrimidinyl group Chemical group 0.000 claims 1
- 125000000168 pyrrolyl group Chemical group 0.000 claims 1
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 claims 1
- 125000001412 tetrahydropyranyl group Chemical group 0.000 claims 1
- 239000002253 acid Substances 0.000 abstract description 49
- 230000000694 effects Effects 0.000 abstract description 49
- 125000004122 cyclic group Chemical group 0.000 abstract description 44
- 239000000651 prodrug Substances 0.000 abstract description 13
- 229940002612 prodrug Drugs 0.000 abstract description 13
- 150000001408 amides Chemical class 0.000 abstract description 12
- 238000001727 in vivo Methods 0.000 abstract description 12
- 238000000338 in vitro Methods 0.000 abstract description 11
- 239000008194 pharmaceutical composition Substances 0.000 abstract description 10
- 238000000034 method Methods 0.000 description 261
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 246
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 200
- UQEAIHBTYFGYIE-UHFFFAOYSA-N hexamethyldisiloxane Chemical compound C[Si](C)(C)O[Si](C)(C)C UQEAIHBTYFGYIE-UHFFFAOYSA-N 0.000 description 143
- 229910052739 hydrogen Inorganic materials 0.000 description 129
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 93
- 238000005160 1H NMR spectroscopy Methods 0.000 description 92
- 229910001868 water Inorganic materials 0.000 description 92
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 87
- 239000012535 impurity Substances 0.000 description 84
- 239000012071 phase Substances 0.000 description 80
- 238000004128 high performance liquid chromatography Methods 0.000 description 76
- 238000005481 NMR spectroscopy Methods 0.000 description 72
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 66
- 239000008363 phosphate buffer Substances 0.000 description 65
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 58
- 239000000243 solution Substances 0.000 description 58
- 210000004027 cell Anatomy 0.000 description 53
- 239000012043 crude product Substances 0.000 description 50
- 125000006701 (C1-C7) alkyl group Chemical group 0.000 description 45
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 45
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 39
- 230000015572 biosynthetic process Effects 0.000 description 39
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 36
- 238000003786 synthesis reaction Methods 0.000 description 34
- 235000019439 ethyl acetate Nutrition 0.000 description 31
- 238000009472 formulation Methods 0.000 description 31
- IRLXDBWFFKLKOD-UHFFFAOYSA-N methyl 3-(3-chlorosulfonylphenyl)prop-2-enoate Chemical compound COC(=O)C=CC1=CC=CC(S(Cl)(=O)=O)=C1 IRLXDBWFFKLKOD-UHFFFAOYSA-N 0.000 description 30
- 239000011541 reaction mixture Substances 0.000 description 30
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 29
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 29
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 27
- GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 description 26
- 101150065749 Churc1 gene Proteins 0.000 description 26
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 26
- 102100038239 Protein Churchill Human genes 0.000 description 26
- 239000012267 brine Substances 0.000 description 26
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 26
- SHGAZHPCJJPHSC-YCNIQYBTSA-N all-trans-retinoic acid Chemical compound OC(=O)\C=C(/C)\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C SHGAZHPCJJPHSC-YCNIQYBTSA-N 0.000 description 25
- 239000002904 solvent Substances 0.000 description 24
- NEAQRZUHTPSBBM-UHFFFAOYSA-N 2-hydroxy-3,3-dimethyl-7-nitro-4h-isoquinolin-1-one Chemical class C1=C([N+]([O-])=O)C=C2C(=O)N(O)C(C)(C)CC2=C1 NEAQRZUHTPSBBM-UHFFFAOYSA-N 0.000 description 23
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 23
- 239000000725 suspension Substances 0.000 description 23
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical compound C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 22
- 238000006243 chemical reaction Methods 0.000 description 22
- KCFVQEAPUOVXTH-UHFFFAOYSA-N 8-ethoxy-8-oxooctanoic acid Chemical compound CCOC(=O)CCCCCCC(O)=O KCFVQEAPUOVXTH-UHFFFAOYSA-N 0.000 description 21
- 108010033040 Histones Proteins 0.000 description 21
- 125000003277 amino group Chemical group 0.000 description 20
- 230000004663 cell proliferation Effects 0.000 description 20
- FFUAGWLWBBFQJT-UHFFFAOYSA-N hexamethyldisilazane Chemical compound C[Si](C)(C)N[Si](C)(C)C FFUAGWLWBBFQJT-UHFFFAOYSA-N 0.000 description 20
- 125000003118 aryl group Chemical group 0.000 description 19
- 238000002360 preparation method Methods 0.000 description 18
- 229930002330 retinoic acid Natural products 0.000 description 18
- 229960001727 tretinoin Drugs 0.000 description 18
- NQYXFXWKKYGBNL-UHFFFAOYSA-N 7-ethoxy-7-oxoheptanoic acid Chemical compound CCOC(=O)CCCCCC(O)=O NQYXFXWKKYGBNL-UHFFFAOYSA-N 0.000 description 17
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 17
- 125000005842 heteroatom Chemical group 0.000 description 17
- RTKIYFITIVXBLE-QEQCGCAPSA-N trichostatin A Chemical compound ONC(=O)/C=C/C(/C)=C/[C@@H](C)C(=O)C1=CC=C(N(C)C)C=C1 RTKIYFITIVXBLE-QEQCGCAPSA-N 0.000 description 17
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 16
- 239000000284 extract Substances 0.000 description 16
- 239000007788 liquid Substances 0.000 description 16
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 15
- 239000001257 hydrogen Substances 0.000 description 15
- 230000002401 inhibitory effect Effects 0.000 description 15
- 108090000623 proteins and genes Proteins 0.000 description 15
- 239000000741 silica gel Substances 0.000 description 15
- 229910002027 silica gel Inorganic materials 0.000 description 15
- 229960001866 silicon dioxide Drugs 0.000 description 15
- YKARYQAMZRADMW-UHFFFAOYSA-N 7-oxo-7-(phenylmethoxyamino)heptanoic acid Chemical compound OC(=O)CCCCCC(=O)NOCC1=CC=CC=C1 YKARYQAMZRADMW-UHFFFAOYSA-N 0.000 description 14
- 239000005977 Ethylene Substances 0.000 description 14
- RTKIYFITIVXBLE-UHFFFAOYSA-N Trichostatin A Natural products ONC(=O)C=CC(C)=CC(C)C(=O)C1=CC=C(N(C)C)C=C1 RTKIYFITIVXBLE-UHFFFAOYSA-N 0.000 description 14
- 239000003112 inhibitor Substances 0.000 description 14
- 239000003921 oil Substances 0.000 description 14
- KOVPXZDUVJGGFU-UHFFFAOYSA-N 8-methoxy-8-oxooctanoic acid Chemical compound COC(=O)CCCCCCC(O)=O KOVPXZDUVJGGFU-UHFFFAOYSA-N 0.000 description 13
- 102000006947 Histones Human genes 0.000 description 13
- 238000003556 assay Methods 0.000 description 13
- 239000003795 chemical substances by application Substances 0.000 description 13
- 125000002950 monocyclic group Chemical group 0.000 description 13
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 12
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 12
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 12
- 239000003480 eluent Substances 0.000 description 12
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 12
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 12
- 239000000047 product Substances 0.000 description 12
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 12
- RHXABKLEBVKAQJ-UHFFFAOYSA-N 8-oxo-8-(phenylmethoxyamino)octanoic acid Chemical compound OC(=O)CCCCCCC(=O)NOCC1=CC=CC=C1 RHXABKLEBVKAQJ-UHFFFAOYSA-N 0.000 description 11
- 239000006260 foam Substances 0.000 description 11
- 125000000524 functional group Chemical group 0.000 description 11
- 125000005843 halogen group Chemical group 0.000 description 11
- 239000007787 solid Substances 0.000 description 11
- 238000002560 therapeutic procedure Methods 0.000 description 11
- 102100039999 Histone deacetylase 2 Human genes 0.000 description 10
- 101001035011 Homo sapiens Histone deacetylase 2 Proteins 0.000 description 10
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 10
- 241000699670 Mus sp. Species 0.000 description 10
- 150000001923 cyclic compounds Chemical class 0.000 description 10
- UREBWPXBXRYXRJ-UHFFFAOYSA-N ethyl acetate;methanol Chemical compound OC.CCOC(C)=O UREBWPXBXRYXRJ-UHFFFAOYSA-N 0.000 description 10
- 235000011187 glycerol Nutrition 0.000 description 10
- 230000005764 inhibitory process Effects 0.000 description 10
- 235000019198 oils Nutrition 0.000 description 10
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 10
- 125000003258 trimethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])[*:1] 0.000 description 10
- 102000004190 Enzymes Human genes 0.000 description 9
- 108090000790 Enzymes Proteins 0.000 description 9
- 125000002777 acetyl group Chemical class [H]C([H])([H])C(*)=O 0.000 description 9
- 150000001721 carbon Chemical group 0.000 description 9
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 9
- 125000002843 carboxylic acid group Chemical group 0.000 description 9
- 229940088598 enzyme Drugs 0.000 description 9
- 230000014509 gene expression Effects 0.000 description 9
- 150000002431 hydrogen Chemical class 0.000 description 9
- 239000004615 ingredient Substances 0.000 description 9
- 239000003826 tablet Substances 0.000 description 9
- 238000012360 testing method Methods 0.000 description 9
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 8
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 8
- 102100039996 Histone deacetylase 1 Human genes 0.000 description 8
- 101001035024 Homo sapiens Histone deacetylase 1 Proteins 0.000 description 8
- ISAKRJDGNUQOIC-UHFFFAOYSA-N Uracil Chemical compound O=C1C=CNC(=O)N1 ISAKRJDGNUQOIC-UHFFFAOYSA-N 0.000 description 8
- 230000001028 anti-proliverative effect Effects 0.000 description 8
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 8
- 239000007795 chemical reaction product Substances 0.000 description 8
- 239000006071 cream Substances 0.000 description 8
- 125000000753 cycloalkyl group Chemical group 0.000 description 8
- 229940079593 drug Drugs 0.000 description 8
- 125000001072 heteroaryl group Chemical group 0.000 description 8
- 230000001965 increasing effect Effects 0.000 description 8
- GRVDJDISBSALJP-UHFFFAOYSA-N methyloxidanyl Chemical compound [O]C GRVDJDISBSALJP-UHFFFAOYSA-N 0.000 description 8
- GHCAUEMXBSLMGU-UHFFFAOYSA-N oxadiazole;1,2,5-oxadiazole Chemical compound C=1C=NON=1.C1=CON=N1 GHCAUEMXBSLMGU-UHFFFAOYSA-N 0.000 description 8
- WAEXFXRVDQXREF-UHFFFAOYSA-N vorinostat Chemical compound ONC(=O)CCCCCCC(=O)NC1=CC=CC=C1 WAEXFXRVDQXREF-UHFFFAOYSA-N 0.000 description 8
- 229960000237 vorinostat Drugs 0.000 description 8
- VHFVKMTVMIZMIK-UHFFFAOYSA-N 1-(3-chlorophenyl)piperazine Chemical compound ClC1=CC=CC(N2CCNCC2)=C1 VHFVKMTVMIZMIK-UHFFFAOYSA-N 0.000 description 7
- ZGGPGWYMMZNPOY-UHFFFAOYSA-N 3-(4-chlorosulfonylphenyl)prop-2-enoic acid Chemical compound OC(=O)C=CC1=CC=C(S(Cl)(=O)=O)C=C1 ZGGPGWYMMZNPOY-UHFFFAOYSA-N 0.000 description 7
- MRXZEDMLQMDMGB-UHFFFAOYSA-N 3-formylbenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC(C=O)=C1 MRXZEDMLQMDMGB-UHFFFAOYSA-N 0.000 description 7
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 7
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 7
- 125000003342 alkenyl group Chemical group 0.000 description 7
- 125000001118 alkylidene group Chemical group 0.000 description 7
- 230000006907 apoptotic process Effects 0.000 description 7
- 125000000732 arylene group Chemical group 0.000 description 7
- 239000000969 carrier Substances 0.000 description 7
- 239000000460 chlorine Substances 0.000 description 7
- NWVNXDKZIQLBNM-UHFFFAOYSA-N diphenylmethylpiperazine Chemical compound C1CNCCN1C(C=1C=CC=CC=1)C1=CC=CC=C1 NWVNXDKZIQLBNM-UHFFFAOYSA-N 0.000 description 7
- 201000010099 disease Diseases 0.000 description 7
- 239000006196 drop Substances 0.000 description 7
- 239000000706 filtrate Substances 0.000 description 7
- 239000012634 fragment Substances 0.000 description 7
- VANNPISTIUFMLH-UHFFFAOYSA-N glutaric anhydride Chemical compound O=C1CCCC(=O)O1 VANNPISTIUFMLH-UHFFFAOYSA-N 0.000 description 7
- UECLLNWSQFMPQF-OUKQBFOZSA-N methyl (e)-3-[3-[4-(2-naphthalen-1-yloxyethyl)piperazin-1-yl]sulfonylphenyl]prop-2-enoate Chemical compound COC(=O)\C=C\C1=CC=CC(S(=O)(=O)N2CCN(CCOC=3C4=CC=CC=C4C=CC=3)CC2)=C1 UECLLNWSQFMPQF-OUKQBFOZSA-N 0.000 description 7
- 239000012074 organic phase Substances 0.000 description 7
- 239000000546 pharmaceutical excipient Substances 0.000 description 7
- YZTJYBJCZXZGCT-UHFFFAOYSA-N phenylpiperazine Chemical compound C1CNCCN1C1=CC=CC=C1 YZTJYBJCZXZGCT-UHFFFAOYSA-N 0.000 description 7
- 239000002244 precipitate Substances 0.000 description 7
- 239000011369 resultant mixture Substances 0.000 description 7
- 102000003702 retinoic acid receptors Human genes 0.000 description 7
- 108090000064 retinoic acid receptors Proteins 0.000 description 7
- 241000894007 species Species 0.000 description 7
- CWXPZXBSDSIRCS-UHFFFAOYSA-N tert-butyl piperazine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCNCC1 CWXPZXBSDSIRCS-UHFFFAOYSA-N 0.000 description 7
- IJYSEULJMYISME-RMKNXTFCSA-N (e)-3-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]sulfonylphenyl]prop-2-enoyl chloride Chemical compound FC(F)(F)C1=CC=CC(N2CCN(CC2)S(=O)(=O)C=2C=CC(\C=C\C(Cl)=O)=CC=2)=C1 IJYSEULJMYISME-RMKNXTFCSA-N 0.000 description 6
- MYDBEGKFQCKBCU-LZWSPWQCSA-N (e)-3-[4-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]sulfonylphenyl]prop-2-enoyl chloride Chemical compound C1=CC(F)=CC=C1C(C=1C=CC(F)=CC=1)N1CCN(S(=O)(=O)C=2C=CC(\C=C\C(Cl)=O)=CC=2)CC1 MYDBEGKFQCKBCU-LZWSPWQCSA-N 0.000 description 6
- PWZDJIUQHUGFRJ-UHFFFAOYSA-N 1-(2-chlorophenyl)piperazine Chemical compound ClC1=CC=CC=C1N1CCNCC1 PWZDJIUQHUGFRJ-UHFFFAOYSA-N 0.000 description 6
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- 108020004414 DNA Proteins 0.000 description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 6
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 6
- 208000033826 Promyelocytic Acute Leukemia Diseases 0.000 description 6
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 6
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 230000021736 acetylation Effects 0.000 description 6
- 238000006640 acetylation reaction Methods 0.000 description 6
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 6
- 239000003085 diluting agent Substances 0.000 description 6
- 239000000839 emulsion Substances 0.000 description 6
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 description 6
- 239000003925 fat Substances 0.000 description 6
- 235000019197 fats Nutrition 0.000 description 6
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 6
- 125000001841 imino group Chemical group [H]N=* 0.000 description 6
- 239000011159 matrix material Substances 0.000 description 6
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 6
- 239000000843 powder Substances 0.000 description 6
- 238000002810 primary assay Methods 0.000 description 6
- 102000004169 proteins and genes Human genes 0.000 description 6
- 238000000746 purification Methods 0.000 description 6
- 230000002829 reductive effect Effects 0.000 description 6
- 235000017557 sodium bicarbonate Nutrition 0.000 description 6
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- 229940124530 sulfonamide Drugs 0.000 description 6
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 6
- RWQNBRDOKXIBIV-UHFFFAOYSA-N thymine Chemical compound CC1=CNC(=O)NC1=O RWQNBRDOKXIBIV-UHFFFAOYSA-N 0.000 description 6
- 210000004881 tumor cell Anatomy 0.000 description 6
- DDMVHGULHRJOEC-UHFFFAOYSA-N 1-(2-methoxyphenyl)piperazin-1-ium;chloride Chemical compound Cl.COC1=CC=CC=C1N1CCNCC1 DDMVHGULHRJOEC-UHFFFAOYSA-N 0.000 description 5
- SIYDJAYNPQOVOK-UHFFFAOYSA-N 1-(2-naphthalen-2-yloxyethyl)piperazine Chemical compound C=1C=C2C=CC=CC2=CC=1OCCN1CCNCC1 SIYDJAYNPQOVOK-UHFFFAOYSA-N 0.000 description 5
- RTGKSCWZVIFQSC-UHFFFAOYSA-N 2-(5-methoxy-1h-indol-3-yl)-1-piperazin-1-ylethanone Chemical compound C12=CC(OC)=CC=C2NC=C1CC(=O)N1CCNCC1 RTGKSCWZVIFQSC-UHFFFAOYSA-N 0.000 description 5
- XWCZKNNOWDHUEC-UHFFFAOYSA-N 3-(3-methoxy-3-oxoprop-1-enyl)benzenesulfonic acid Chemical compound COC(=O)C=CC1=CC=CC(S(O)(=O)=O)=C1 XWCZKNNOWDHUEC-UHFFFAOYSA-N 0.000 description 5
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 5
- RGSFGYAAUTVSQA-UHFFFAOYSA-N Cyclopentane Chemical compound C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 description 5
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 5
- 101000899282 Homo sapiens Histone deacetylase 3 Proteins 0.000 description 5
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 5
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical group CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 5
- 239000008351 acetate buffer Substances 0.000 description 5
- ORILYTVJVMAKLC-UHFFFAOYSA-N adamantane Chemical compound C1C(C2)CC3CC1CC2C3 ORILYTVJVMAKLC-UHFFFAOYSA-N 0.000 description 5
- 239000000853 adhesive Substances 0.000 description 5
- 230000001070 adhesive effect Effects 0.000 description 5
- MGSKVZWGBWPBTF-UHFFFAOYSA-N aebsf Chemical compound NCCC1=CC=C(S(F)(=O)=O)C=C1 MGSKVZWGBWPBTF-UHFFFAOYSA-N 0.000 description 5
- 125000000304 alkynyl group Chemical group 0.000 description 5
- 150000001413 amino acids Chemical class 0.000 description 5
- 239000002246 antineoplastic agent Substances 0.000 description 5
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 5
- 230000006369 cell cycle progression Effects 0.000 description 5
- 230000024245 cell differentiation Effects 0.000 description 5
- 230000004069 differentiation Effects 0.000 description 5
- 208000035475 disorder Diseases 0.000 description 5
- 239000003995 emulsifying agent Substances 0.000 description 5
- SSKSNPLOYGQNNJ-UHFFFAOYSA-N ethyl 8-[4-[4-(dimethylamino)benzoyl]piperazin-1-yl]-8-oxooctanoate Chemical compound C1CN(C(=O)CCCCCCC(=O)OCC)CCN1C(=O)C1=CC=C(N(C)C)C=C1 SSKSNPLOYGQNNJ-UHFFFAOYSA-N 0.000 description 5
- 229940121372 histone deacetylase inhibitor Drugs 0.000 description 5
- 230000003993 interaction Effects 0.000 description 5
- 125000000468 ketone group Chemical group 0.000 description 5
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 5
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 5
- UNEIHNMKASENIG-UHFFFAOYSA-N para-chlorophenylpiperazine Chemical compound C1=CC(Cl)=CC=C1N1CCNCC1 UNEIHNMKASENIG-UHFFFAOYSA-N 0.000 description 5
- 235000010603 pastilles Nutrition 0.000 description 5
- 235000011007 phosphoric acid Nutrition 0.000 description 5
- GZRKXKUVVPSREJ-UHFFFAOYSA-N pyridinylpiperazine Chemical compound C1CNCCN1C1=CC=CC=N1 GZRKXKUVVPSREJ-UHFFFAOYSA-N 0.000 description 5
- 239000003381 stabilizer Substances 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- 229910052717 sulfur Inorganic materials 0.000 description 5
- 230000001225 therapeutic effect Effects 0.000 description 5
- 238000013518 transcription Methods 0.000 description 5
- 230000035897 transcription Effects 0.000 description 5
- PWRCVRVAAZEYAZ-CCEZHUSRSA-N (e)-3-[3-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]prop-2-enoyl chloride Chemical compound ClC(=O)\C=C\C1=CC=CC(S(=O)(=O)N2CCN(CC2)C(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1 PWRCVRVAAZEYAZ-CCEZHUSRSA-N 0.000 description 4
- SPRZQBBQQYAIBT-MDZDMXLPSA-N (e)-3-[3-(4-phenylpiperazin-1-yl)sulfonylphenyl]prop-2-enoyl chloride Chemical compound ClC(=O)\C=C\C1=CC=CC(S(=O)(=O)N2CCN(CC2)C=2C=CC=CC=2)=C1 SPRZQBBQQYAIBT-MDZDMXLPSA-N 0.000 description 4
- RQZXJCOLBUMMJP-RUDMXATFSA-N (e)-3-[3-[4-(4-chlorophenyl)piperazin-1-yl]sulfonylphenyl]prop-2-enoyl chloride Chemical compound ClC(=O)\C=C\C1=CC=CC(S(=O)(=O)N2CCN(CC2)C=2C=CC(Cl)=CC=2)=C1 RQZXJCOLBUMMJP-RUDMXATFSA-N 0.000 description 4
- DUAOHYZCXBABRR-RMKNXTFCSA-N (e)-3-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]sulfonylphenyl]prop-2-enoic acid Chemical compound C1=CC(/C=C/C(=O)O)=CC=C1S(=O)(=O)N1CCN(C=2C=C(C=CC=2)C(F)(F)F)CC1 DUAOHYZCXBABRR-RMKNXTFCSA-N 0.000 description 4
- ZJFFBHWUZGJAQD-LZWSPWQCSA-N (e)-3-[4-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]sulfonylphenyl]prop-2-enoic acid Chemical compound C1=CC(/C=C/C(=O)O)=CC=C1S(=O)(=O)N1CCN(C(C=2C=CC(F)=CC=2)C=2C=CC(F)=CC=2)CC1 ZJFFBHWUZGJAQD-LZWSPWQCSA-N 0.000 description 4
- VWOJSRICSKDKAW-UHFFFAOYSA-N 1-(4-nitrophenyl)piperazine Chemical compound C1=CC([N+](=O)[O-])=CC=C1N1CCNCC1 VWOJSRICSKDKAW-UHFFFAOYSA-N 0.000 description 4
- FCEHBMOGCRZNNI-UHFFFAOYSA-N 1-benzothiophene Chemical compound C1=CC=C2SC=CC2=C1 FCEHBMOGCRZNNI-UHFFFAOYSA-N 0.000 description 4
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Chemical compound C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 description 4
- RKRBHGFPHNBILW-UHFFFAOYSA-N 2-(1-benzothiophen-3-yl)-1-piperazin-1-ylethanone Chemical compound C=1SC2=CC=CC=C2C=1CC(=O)N1CCNCC1 RKRBHGFPHNBILW-UHFFFAOYSA-N 0.000 description 4
- JKMHFZQWWAIEOD-UHFFFAOYSA-N 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid Chemical compound OCC[NH+]1CCN(CCS([O-])(=O)=O)CC1 JKMHFZQWWAIEOD-UHFFFAOYSA-N 0.000 description 4
- BUGOSOINZUJAEJ-UHFFFAOYSA-N 2-naphthalen-1-yloxy-1-piperazin-1-ylethanone Chemical compound C=1C=CC2=CC=CC=C2C=1OCC(=O)N1CCNCC1 BUGOSOINZUJAEJ-UHFFFAOYSA-N 0.000 description 4
- CPHFYPIHYVHCAM-UHFFFAOYSA-N 2-naphthalen-2-yloxy-1-piperazin-1-ylethanone Chemical compound C=1C=C2C=CC=CC2=CC=1OCC(=O)N1CCNCC1 CPHFYPIHYVHCAM-UHFFFAOYSA-N 0.000 description 4
- GRXZLAUCZFNHDF-UHFFFAOYSA-N 3-(1h-indol-3-yl)-1-piperazin-1-ylpropan-1-one Chemical compound C=1NC2=CC=CC=C2C=1CCC(=O)N1CCNCC1 GRXZLAUCZFNHDF-UHFFFAOYSA-N 0.000 description 4
- OHPXFCRAXVGJOH-UHFFFAOYSA-N 5-methoxy-3-(2-piperazin-1-ylethyl)-1h-indole Chemical compound C12=CC(OC)=CC=C2NC=C1CCN1CCNCC1 OHPXFCRAXVGJOH-UHFFFAOYSA-N 0.000 description 4
- UJOBWOGCFQCDNV-UHFFFAOYSA-N 9H-carbazole Chemical compound C1=CC=C2C3=CC=CC=C3NC2=C1 UJOBWOGCFQCDNV-UHFFFAOYSA-N 0.000 description 4
- 102100028728 Bone morphogenetic protein 1 Human genes 0.000 description 4
- 108090000654 Bone morphogenetic protein 1 Proteins 0.000 description 4
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 4
- WBYWAXJHAXSJNI-SREVYHEPSA-N Cinnamic acid Chemical compound OC(=O)\C=C/C1=CC=CC=C1 WBYWAXJHAXSJNI-SREVYHEPSA-N 0.000 description 4
- 102100027995 Collagenase 3 Human genes 0.000 description 4
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical class C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 4
- 239000007995 HEPES buffer Substances 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- 229930194542 Keto Natural products 0.000 description 4
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 4
- 229910017912 NH2OH Inorganic materials 0.000 description 4
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 4
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 4
- XNELEOAVITVYRL-UHFFFAOYSA-N [4-(dimethylamino)phenyl]-piperazin-1-ylmethanone Chemical compound C1=CC(N(C)C)=CC=C1C(=O)N1CCNCC1 XNELEOAVITVYRL-UHFFFAOYSA-N 0.000 description 4
- DZBUGLKDJFMEHC-UHFFFAOYSA-N acridine Chemical compound C1=CC=CC2=CC3=CC=CC=C3N=C21 DZBUGLKDJFMEHC-UHFFFAOYSA-N 0.000 description 4
- 230000009471 action Effects 0.000 description 4
- 239000000443 aerosol Substances 0.000 description 4
- 150000001409 amidines Chemical class 0.000 description 4
- 125000000129 anionic group Chemical group 0.000 description 4
- 239000008346 aqueous phase Substances 0.000 description 4
- 239000012300 argon atmosphere Substances 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- 230000008901 benefit Effects 0.000 description 4
- 239000000872 buffer Substances 0.000 description 4
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 4
- 125000005488 carboaryl group Chemical group 0.000 description 4
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 4
- BGTOWKSIORTVQH-UHFFFAOYSA-N cyclopentanone Chemical compound O=C1CCCC1 BGTOWKSIORTVQH-UHFFFAOYSA-N 0.000 description 4
- OPTASPLRGRRNAP-UHFFFAOYSA-N cytosine Chemical compound NC=1C=CNC(=O)N=1 OPTASPLRGRRNAP-UHFFFAOYSA-N 0.000 description 4
- NNBZCPXTIHJBJL-UHFFFAOYSA-N decalin Chemical compound C1CCCC2CCCCC21 NNBZCPXTIHJBJL-UHFFFAOYSA-N 0.000 description 4
- INVTYAOGFAGBOE-UHFFFAOYSA-N entinostat Chemical compound NC1=CC=CC=C1NC(=O)C(C=C1)=CC=C1CNC(=O)OCC1=CC=CN=C1 INVTYAOGFAGBOE-UHFFFAOYSA-N 0.000 description 4
- 125000004185 ester group Chemical group 0.000 description 4
- UWBWUZKAJJCWMJ-UHFFFAOYSA-N ethyl 7-(4-benzhydrylpiperazin-1-yl)-7-oxoheptanoate Chemical compound C1CN(C(=O)CCCCCC(=O)OCC)CCN1C(C=1C=CC=CC=1)C1=CC=CC=C1 UWBWUZKAJJCWMJ-UHFFFAOYSA-N 0.000 description 4
- PJNWEHVROPMDGS-UHFFFAOYSA-N ethyl 7-[4-(2-chlorophenyl)piperazin-1-yl]-7-oxoheptanoate Chemical compound C1CN(C(=O)CCCCCC(=O)OCC)CCN1C1=CC=CC=C1Cl PJNWEHVROPMDGS-UHFFFAOYSA-N 0.000 description 4
- ZFBINFRXVNVTKM-UHFFFAOYSA-N ethyl 7-[4-(4-chlorophenyl)piperazin-1-yl]-7-oxoheptanoate Chemical compound C1CN(C(=O)CCCCCC(=O)OCC)CCN1C1=CC=C(Cl)C=C1 ZFBINFRXVNVTKM-UHFFFAOYSA-N 0.000 description 4
- QTOLGYJCBNECAR-UHFFFAOYSA-N ethyl 7-[4-(4-fluorophenyl)piperazin-1-yl]-7-oxoheptanoate Chemical compound C1CN(C(=O)CCCCCC(=O)OCC)CCN1C1=CC=C(F)C=C1 QTOLGYJCBNECAR-UHFFFAOYSA-N 0.000 description 4
- SPRKZRJKWORAMX-UHFFFAOYSA-N ethyl 7-oxo-7-(4-phenylpiperazin-1-yl)heptanoate Chemical compound C1CN(C(=O)CCCCCC(=O)OCC)CCN1C1=CC=CC=C1 SPRKZRJKWORAMX-UHFFFAOYSA-N 0.000 description 4
- VXNXIPPLKYOSMP-UHFFFAOYSA-N ethyl 8-(4-benzoylpiperazin-1-yl)-8-oxooctanoate Chemical compound C1CN(C(=O)CCCCCCC(=O)OCC)CCN1C(=O)C1=CC=CC=C1 VXNXIPPLKYOSMP-UHFFFAOYSA-N 0.000 description 4
- BKRDYFSLYOMWHU-UHFFFAOYSA-N ethyl 8-[4-(2-naphthalen-1-yloxyacetyl)piperazin-1-yl]-8-oxooctanoate Chemical compound C1CN(C(=O)CCCCCCC(=O)OCC)CCN1C(=O)COC1=CC=CC2=CC=CC=C12 BKRDYFSLYOMWHU-UHFFFAOYSA-N 0.000 description 4
- IDBPZDJHBMUZID-UHFFFAOYSA-N ethyl 8-[4-(3-methoxyphenyl)piperazin-1-yl]-8-oxooctanoate Chemical compound C1CN(C(=O)CCCCCCC(=O)OCC)CCN1C1=CC=CC(OC)=C1 IDBPZDJHBMUZID-UHFFFAOYSA-N 0.000 description 4
- DFXHHJJHRXDTHI-UHFFFAOYSA-N ethyl 8-[4-[2-(1-benzothiophen-3-yl)acetyl]piperazin-1-yl]-8-oxooctanoate Chemical compound C1CN(C(=O)CCCCCCC(=O)OCC)CCN1C(=O)CC1=CSC2=CC=CC=C12 DFXHHJJHRXDTHI-UHFFFAOYSA-N 0.000 description 4
- 239000000499 gel Substances 0.000 description 4
- 239000008187 granular material Substances 0.000 description 4
- UYTPUPDQBNUYGX-UHFFFAOYSA-N guanine Chemical compound O=C1NC(N)=NC2=C1N=CN2 UYTPUPDQBNUYGX-UHFFFAOYSA-N 0.000 description 4
- DMEGYFMYUHOHGS-UHFFFAOYSA-N heptamethylene Natural products C1CCCCCC1 DMEGYFMYUHOHGS-UHFFFAOYSA-N 0.000 description 4
- MSQACBWWAIBWIC-UHFFFAOYSA-N hydron;piperazine;chloride Chemical class Cl.C1CNCCN1 MSQACBWWAIBWIC-UHFFFAOYSA-N 0.000 description 4
- PQNFLJBBNBOBRQ-UHFFFAOYSA-N indane Chemical compound C1=CC=C2CCCC2=C1 PQNFLJBBNBOBRQ-UHFFFAOYSA-N 0.000 description 4
- 239000007924 injection Substances 0.000 description 4
- 238000002347 injection Methods 0.000 description 4
- 239000000543 intermediate Substances 0.000 description 4
- 238000007912 intraperitoneal administration Methods 0.000 description 4
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 4
- 230000000155 isotopic effect Effects 0.000 description 4
- 210000002510 keratinocyte Anatomy 0.000 description 4
- 208000032839 leukemia Diseases 0.000 description 4
- 125000005647 linker group Chemical group 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 238000005259 measurement Methods 0.000 description 4
- 239000002609 medium Substances 0.000 description 4
- YOLMGBQFFWFIGW-FOCLMDBBSA-N methyl (e)-3-[3-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]prop-2-enoate Chemical compound COC(=O)\C=C\C1=CC=CC(S(=O)(=O)N2CCN(CC2)C(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1 YOLMGBQFFWFIGW-FOCLMDBBSA-N 0.000 description 4
- XJXUFDXAFZRGGW-ZHACJKMWSA-N methyl (e)-3-[3-(4-phenylpiperazin-1-yl)sulfonylphenyl]prop-2-enoate Chemical compound COC(=O)\C=C\C1=CC=CC(S(=O)(=O)N2CCN(CC2)C=2C=CC=CC=2)=C1 XJXUFDXAFZRGGW-ZHACJKMWSA-N 0.000 description 4
- FQKBRRBAQGMUTR-ZHACJKMWSA-N methyl (e)-3-[3-[4-(2-methoxyphenyl)piperazin-1-yl]sulfonylphenyl]prop-2-enoate Chemical compound COC(=O)\C=C\C1=CC=CC(S(=O)(=O)N2CCN(CC2)C=2C(=CC=CC=2)OC)=C1 FQKBRRBAQGMUTR-ZHACJKMWSA-N 0.000 description 4
- UZRZHCGYMAUHOJ-UHFFFAOYSA-N methyl 8-(4-benzhydrylpiperazin-1-yl)-8-oxooctanoate Chemical compound C1CN(C(=O)CCCCCCC(=O)OC)CCN1C(C=1C=CC=CC=1)C1=CC=CC=C1 UZRZHCGYMAUHOJ-UHFFFAOYSA-N 0.000 description 4
- SJEMUVZPYHXSGZ-UHFFFAOYSA-N methyl 8-[4-(2-naphthalen-2-yloxyethyl)piperazin-1-yl]-8-oxooctanoate Chemical compound C1CN(C(=O)CCCCCCC(=O)OC)CCN1CCOC1=CC=C(C=CC=C2)C2=C1 SJEMUVZPYHXSGZ-UHFFFAOYSA-N 0.000 description 4
- QJYAXHAMRHWEIC-UHFFFAOYSA-N methyl 8-[4-[2-(5-methoxy-1h-indol-3-yl)ethyl]piperazin-1-yl]-8-oxooctanoate Chemical compound C1CN(C(=O)CCCCCCC(=O)OC)CCN1CCC1=CNC2=CC=C(OC)C=C12 QJYAXHAMRHWEIC-UHFFFAOYSA-N 0.000 description 4
- ZXQZRQMAOAYWOC-UHFFFAOYSA-N methyl 8-oxo-8-(4-phenylpiperazin-1-yl)octanoate Chemical compound C1CN(C(=O)CCCCCCC(=O)OC)CCN1C1=CC=CC=C1 ZXQZRQMAOAYWOC-UHFFFAOYSA-N 0.000 description 4
- PDACPSPIKHBIPB-UHFFFAOYSA-N methyl 8-oxo-8-(phenylmethoxyamino)octanoate Chemical compound COC(=O)CCCCCCC(=O)NOCC1=CC=CC=C1 PDACPSPIKHBIPB-UHFFFAOYSA-N 0.000 description 4
- 239000002324 mouth wash Substances 0.000 description 4
- AVNWRHYYFFLLRK-UHFFFAOYSA-N naphthalen-2-yl(piperazin-1-yl)methanone Chemical compound C=1C=C2C=CC=CC2=CC=1C(=O)N1CCNCC1 AVNWRHYYFFLLRK-UHFFFAOYSA-N 0.000 description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 description 4
- WPHGSKGZRAQSGP-UHFFFAOYSA-N norcarane Chemical compound C1CCCC2CC21 WPHGSKGZRAQSGP-UHFFFAOYSA-N 0.000 description 4
- 239000002674 ointment Substances 0.000 description 4
- KDLHZDBZIXYQEI-UHFFFAOYSA-N palladium Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- MRDGZSKYFPGAKP-UHFFFAOYSA-N para-methoxyphenylpiperazine Chemical compound C1=CC(OC)=CC=C1N1CCNCC1 MRDGZSKYFPGAKP-UHFFFAOYSA-N 0.000 description 4
- 239000006072 paste Substances 0.000 description 4
- 229910052698 phosphorus Inorganic materials 0.000 description 4
- 159000000000 sodium salts Chemical class 0.000 description 4
- 239000011593 sulfur Substances 0.000 description 4
- 239000000829 suppository Substances 0.000 description 4
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 4
- 150000003568 thioethers Chemical class 0.000 description 4
- 125000003396 thiol group Chemical group [H]S* 0.000 description 4
- KJAMZCVTJDTESW-UHFFFAOYSA-N tiracizine Chemical compound C1CC2=CC=CC=C2N(C(=O)CN(C)C)C2=CC(NC(=O)OCC)=CC=C21 KJAMZCVTJDTESW-UHFFFAOYSA-N 0.000 description 4
- 239000013598 vector Substances 0.000 description 4
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 4
- RILQIUVJCWQRIB-CCEZHUSRSA-N (e)-3-[3-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]prop-2-enoic acid Chemical compound OC(=O)\C=C\C1=CC=CC(S(=O)(=O)N2CCN(CC2)C(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1 RILQIUVJCWQRIB-CCEZHUSRSA-N 0.000 description 3
- IWTFVSMTDZJTGK-MDZDMXLPSA-N (e)-3-[3-(4-phenylpiperazin-1-yl)sulfonylphenyl]prop-2-enoic acid Chemical compound OC(=O)\C=C\C1=CC=CC(S(=O)(=O)N2CCN(CC2)C=2C=CC=CC=2)=C1 IWTFVSMTDZJTGK-MDZDMXLPSA-N 0.000 description 3
- JUHAGAURMWILHG-BQYQJAHWSA-N (e)-3-[3-(4-pyridin-2-ylpiperazin-1-yl)sulfonylphenyl]prop-2-enoic acid Chemical compound OC(=O)\C=C\C1=CC=CC(S(=O)(=O)N2CCN(CC2)C=2N=CC=CC=2)=C1 JUHAGAURMWILHG-BQYQJAHWSA-N 0.000 description 3
- YXOZBBCBSQKWPV-BQYQJAHWSA-N (e)-3-[3-(4-pyridin-2-ylpiperazin-1-yl)sulfonylphenyl]prop-2-enoyl chloride Chemical compound ClC(=O)\C=C\C1=CC=CC(S(=O)(=O)N2CCN(CC2)C=2N=CC=CC=2)=C1 YXOZBBCBSQKWPV-BQYQJAHWSA-N 0.000 description 3
- MNSVMPCILMURFM-CMDGGOBGSA-N (e)-3-[3-[4-(2-chlorophenyl)piperazin-1-yl]sulfonylphenyl]prop-2-enoic acid Chemical compound OC(=O)\C=C\C1=CC=CC(S(=O)(=O)N2CCN(CC2)C=2C(=CC=CC=2)Cl)=C1 MNSVMPCILMURFM-CMDGGOBGSA-N 0.000 description 3
- MLQYEZWOPZUFTP-CMDGGOBGSA-N (e)-3-[3-[4-(2-chlorophenyl)piperazin-1-yl]sulfonylphenyl]prop-2-enoyl chloride Chemical compound ClC(=O)\C=C\C1=CC=CC(S(=O)(=O)N2CCN(CC2)C=2C(=CC=CC=2)Cl)=C1 MLQYEZWOPZUFTP-CMDGGOBGSA-N 0.000 description 3
- TVJMEJSGULEDSX-MDZDMXLPSA-N (e)-3-[3-[4-(2-methoxyphenyl)piperazin-1-yl]sulfonylphenyl]prop-2-enoic acid Chemical compound COC1=CC=CC=C1N1CCN(S(=O)(=O)C=2C=C(\C=C\C(O)=O)C=CC=2)CC1 TVJMEJSGULEDSX-MDZDMXLPSA-N 0.000 description 3
- YHQJXBFWIFYXEV-MDZDMXLPSA-N (e)-3-[3-[4-(2-methoxyphenyl)piperazin-1-yl]sulfonylphenyl]prop-2-enoyl chloride Chemical compound COC1=CC=CC=C1N1CCN(S(=O)(=O)C=2C=C(\C=C\C(Cl)=O)C=CC=2)CC1 YHQJXBFWIFYXEV-MDZDMXLPSA-N 0.000 description 3
- CIUGEGKAOUVJDC-DHZHZOJOSA-N (e)-3-[3-[4-(2-naphthalen-2-yloxyethyl)piperazin-1-yl]sulfonylphenyl]prop-2-enoic acid Chemical compound OC(=O)\C=C\C1=CC=CC(S(=O)(=O)N2CCN(CCOC=3C=C4C=CC=CC4=CC=3)CC2)=C1 CIUGEGKAOUVJDC-DHZHZOJOSA-N 0.000 description 3
- XJWSSPLWZKQTLT-QPJJXVBHSA-N (e)-3-[3-[4-(3,4-dichlorophenyl)piperazin-1-yl]sulfonylphenyl]prop-2-enoic acid Chemical compound OC(=O)\C=C\C1=CC=CC(S(=O)(=O)N2CCN(CC2)C=2C=C(Cl)C(Cl)=CC=2)=C1 XJWSSPLWZKQTLT-QPJJXVBHSA-N 0.000 description 3
- FHJIZCJBWFJVGT-BQYQJAHWSA-N (e)-3-[3-[4-(3-chlorophenyl)piperazin-1-yl]sulfonylphenyl]prop-2-enoic acid Chemical compound OC(=O)\C=C\C1=CC=CC(S(=O)(=O)N2CCN(CC2)C=2C=C(Cl)C=CC=2)=C1 FHJIZCJBWFJVGT-BQYQJAHWSA-N 0.000 description 3
- WRMCRZOKIJNFKN-BQYQJAHWSA-N (e)-3-[3-[4-(3-chlorophenyl)piperazin-1-yl]sulfonylphenyl]prop-2-enoyl chloride Chemical compound ClC(=O)\C=C\C1=CC=CC(S(=O)(=O)N2CCN(CC2)C=2C=C(Cl)C=CC=2)=C1 WRMCRZOKIJNFKN-BQYQJAHWSA-N 0.000 description 3
- VKXCNQDYZPAFTC-RUDMXATFSA-N (e)-3-[3-[4-(4-chlorophenyl)piperazin-1-yl]sulfonylphenyl]prop-2-enoic acid Chemical compound OC(=O)\C=C\C1=CC=CC(S(=O)(=O)N2CCN(CC2)C=2C=CC(Cl)=CC=2)=C1 VKXCNQDYZPAFTC-RUDMXATFSA-N 0.000 description 3
- XMPVHBSERMQSEY-DHZHZOJOSA-N (e)-3-[3-[4-[2-[4-(dimethylamino)phenyl]ethyl]piperazin-1-yl]sulfonylphenyl]prop-2-enoic acid Chemical compound C1=CC(N(C)C)=CC=C1CCN1CCN(S(=O)(=O)C=2C=C(\C=C\C(O)=O)C=CC=2)CC1 XMPVHBSERMQSEY-DHZHZOJOSA-N 0.000 description 3
- FDCHBBSFEZFKPH-DHZHZOJOSA-N (e)-3-[3-[4-[2-[4-(dimethylamino)phenyl]ethyl]piperazin-1-yl]sulfonylphenyl]prop-2-enoyl chloride Chemical compound C1=CC(N(C)C)=CC=C1CCN1CCN(S(=O)(=O)C=2C=C(\C=C\C(Cl)=O)C=CC=2)CC1 FDCHBBSFEZFKPH-DHZHZOJOSA-N 0.000 description 3
- PXFJLKKZSWWVRX-UHFFFAOYSA-N 1-(3,4-dichlorophenyl)piperazine Chemical compound C1=C(Cl)C(Cl)=CC=C1N1CCNCC1 PXFJLKKZSWWVRX-UHFFFAOYSA-N 0.000 description 3
- SFLNVAVCCYTHCQ-UHFFFAOYSA-N 1-(3,4-dimethylphenyl)piperazine Chemical compound C1=C(C)C(C)=CC=C1N1CCNCC1 SFLNVAVCCYTHCQ-UHFFFAOYSA-N 0.000 description 3
- AVJKDKWRVSSJPK-UHFFFAOYSA-N 1-(4-fluorophenyl)piperazine Chemical compound C1=CC(F)=CC=C1N1CCNCC1 AVJKDKWRVSSJPK-UHFFFAOYSA-N 0.000 description 3
- GJUUAUFWQSSZIO-UHFFFAOYSA-N 3-(3-piperazin-1-ylpropyl)-1h-indole Chemical compound C=1NC2=CC=CC=C2C=1CCCN1CCNCC1 GJUUAUFWQSSZIO-UHFFFAOYSA-N 0.000 description 3
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 3
- DIAXYBAIVPIEGQ-UHFFFAOYSA-N 4-(piperazine-1-carbonyl)benzonitrile Chemical compound C=1C=C(C#N)C=CC=1C(=O)N1CCNCC1 DIAXYBAIVPIEGQ-UHFFFAOYSA-N 0.000 description 3
- KTKCOXZDSSKGPT-UHFFFAOYSA-N 7-[4-(1h-indole-3-carbonyl)piperazin-1-yl]-7-oxo-n-phenylmethoxyheptanamide Chemical compound C1CN(C(=O)C=2C3=CC=CC=C3NC=2)CCN1C(=O)CCCCCC(=O)NOCC1=CC=CC=C1 KTKCOXZDSSKGPT-UHFFFAOYSA-N 0.000 description 3
- PAXAWEQEDZKPEA-UHFFFAOYSA-N 7-[4-(3,4-dimethylphenyl)piperazin-1-yl]-7-oxo-n-phenylmethoxyheptanamide Chemical compound C1=C(C)C(C)=CC=C1N1CCN(C(=O)CCCCCC(=O)NOCC=2C=CC=CC=2)CC1 PAXAWEQEDZKPEA-UHFFFAOYSA-N 0.000 description 3
- CBOQTFGLGVBNPJ-UHFFFAOYSA-N 7-[4-[3-(1h-indol-3-yl)propyl]piperazin-1-yl]-7-oxo-n-phenylmethoxyheptanamide Chemical compound C1CN(CCCC=2C3=CC=CC=C3NC=2)CCN1C(=O)CCCCCC(=O)NOCC1=CC=CC=C1 CBOQTFGLGVBNPJ-UHFFFAOYSA-N 0.000 description 3
- XETSJCOFIPCIQM-UHFFFAOYSA-N 7-oxo-n-phenylmethoxy-7-(4-pyridin-2-ylpiperazin-1-yl)heptanamide Chemical compound C=1C=CC=CC=1CONC(=O)CCCCCC(=O)N(CC1)CCN1C1=CC=CC=N1 XETSJCOFIPCIQM-UHFFFAOYSA-N 0.000 description 3
- INOSZSXYJRPRDS-UHFFFAOYSA-N 8-[4-(2-naphthalen-2-yloxyacetyl)piperazin-1-yl]-8-oxo-n-phenylmethoxyoctanamide Chemical compound C1CN(C(=O)COC=2C=C3C=CC=CC3=CC=2)CCN1C(=O)CCCCCCC(=O)NOCC1=CC=CC=C1 INOSZSXYJRPRDS-UHFFFAOYSA-N 0.000 description 3
- BOJNXLGIEFOWKR-UHFFFAOYSA-N 8-[4-(4-cyanobenzoyl)piperazin-1-yl]-8-oxo-n-phenylmethoxyoctanamide Chemical compound C=1C=CC=CC=1CONC(=O)CCCCCCC(=O)N(CC1)CCN1C(=O)C1=CC=C(C#N)C=C1 BOJNXLGIEFOWKR-UHFFFAOYSA-N 0.000 description 3
- HHEVXIHXRSWMJE-UHFFFAOYSA-N 8-[4-[2-[4-(dimethylamino)phenyl]acetyl]piperazin-1-yl]-8-oxo-n-phenylmethoxyoctanamide Chemical compound C1=CC(N(C)C)=CC=C1CC(=O)N1CCN(C(=O)CCCCCCC(=O)NOCC=2C=CC=CC=2)CC1 HHEVXIHXRSWMJE-UHFFFAOYSA-N 0.000 description 3
- WVOVYUWSFNIBMI-UHFFFAOYSA-N 8-[4-[2-[4-(dimethylamino)phenyl]acetyl]piperazin-1-yl]-n-hydroxy-8-oxooctanamide Chemical compound C1=CC(N(C)C)=CC=C1CC(=O)N1CCN(C(=O)CCCCCCC(=O)NO)CC1 WVOVYUWSFNIBMI-UHFFFAOYSA-N 0.000 description 3
- KGYFPDWEGBGYFK-UHFFFAOYSA-N 8-[4-[3-[3-(dimethylamino)phenyl]propyl]piperazin-1-yl]-8-oxo-n-phenylmethoxyoctanamide Chemical compound CN(C)C1=CC=CC(CCCN2CCN(CC2)C(=O)CCCCCCC(=O)NOCC=2C=CC=CC=2)=C1 KGYFPDWEGBGYFK-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 3
- 241000251468 Actinopterygii Species 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- 108050005238 Collagenase 3 Proteins 0.000 description 3
- 241000238557 Decapoda Species 0.000 description 3
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 3
- 241000196324 Embryophyta Species 0.000 description 3
- 230000010337 G2 phase Effects 0.000 description 3
- 241000237858 Gastropoda Species 0.000 description 3
- 102000003893 Histone acetyltransferases Human genes 0.000 description 3
- 108090000246 Histone acetyltransferases Proteins 0.000 description 3
- 102100021455 Histone deacetylase 3 Human genes 0.000 description 3
- 101001032118 Homo sapiens Histone deacetylase 8 Proteins 0.000 description 3
- 206010061218 Inflammation Diseases 0.000 description 3
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 3
- 240000007472 Leucaena leucocephala Species 0.000 description 3
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 3
- 239000004472 Lysine Substances 0.000 description 3
- 102000005741 Metalloproteases Human genes 0.000 description 3
- 108010006035 Metalloproteases Proteins 0.000 description 3
- 108700020796 Oncogene Proteins 0.000 description 3
- PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Natural products C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 description 3
- 241000700159 Rattus Species 0.000 description 3
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 3
- 210000001744 T-lymphocyte Anatomy 0.000 description 3
- 102100040247 Tumor necrosis factor Human genes 0.000 description 3
- 150000001299 aldehydes Chemical class 0.000 description 3
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 description 3
- 230000033115 angiogenesis Effects 0.000 description 3
- 239000003242 anti bacterial agent Substances 0.000 description 3
- 230000001093 anti-cancer Effects 0.000 description 3
- 150000001491 aromatic compounds Chemical class 0.000 description 3
- 210000000481 breast Anatomy 0.000 description 3
- 239000002775 capsule Substances 0.000 description 3
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 3
- 125000002091 cationic group Chemical group 0.000 description 3
- 150000001768 cations Chemical class 0.000 description 3
- 230000025084 cell cycle arrest Effects 0.000 description 3
- 238000001516 cell proliferation assay Methods 0.000 description 3
- 230000001413 cellular effect Effects 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- 208000019425 cirrhosis of liver Diseases 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 238000010511 deprotection reaction Methods 0.000 description 3
- 238000011161 development Methods 0.000 description 3
- 230000018109 developmental process Effects 0.000 description 3
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 3
- HFHPCZCSVYFYEJ-UHFFFAOYSA-N ethyl 7-[4-(3,4-dichlorophenyl)piperazin-1-yl]-7-oxoheptanoate Chemical compound C1CN(C(=O)CCCCCC(=O)OCC)CCN1C1=CC=C(Cl)C(Cl)=C1 HFHPCZCSVYFYEJ-UHFFFAOYSA-N 0.000 description 3
- PKAKHADMJIFKOX-UHFFFAOYSA-N ethyl 7-oxo-7-(phenylmethoxyamino)heptanoate Chemical compound CCOC(=O)CCCCCC(=O)NOCC1=CC=CC=C1 PKAKHADMJIFKOX-UHFFFAOYSA-N 0.000 description 3
- BKFKIINRHONYEI-UHFFFAOYSA-N ethyl 8-[4-(4-nitrophenyl)piperazin-1-yl]-8-oxooctanoate Chemical compound C1CN(C(=O)CCCCCCC(=O)OCC)CCN1C1=CC=C([N+]([O-])=O)C=C1 BKFKIINRHONYEI-UHFFFAOYSA-N 0.000 description 3
- IIWPSYRAMUMIKX-UHFFFAOYSA-N ethyl 8-[4-(naphthalene-2-carbonyl)piperazin-1-yl]-8-oxooctanoate Chemical compound C1CN(C(=O)CCCCCCC(=O)OCC)CCN1C(=O)C1=CC=C(C=CC=C2)C2=C1 IIWPSYRAMUMIKX-UHFFFAOYSA-N 0.000 description 3
- POJHBPMHPXAXBI-UHFFFAOYSA-N ethyl 8-oxo-8-(phenylmethoxyamino)octanoate Chemical compound CCOC(=O)CCCCCCC(=O)NOCC1=CC=CC=C1 POJHBPMHPXAXBI-UHFFFAOYSA-N 0.000 description 3
- 235000019688 fish Nutrition 0.000 description 3
- 239000000796 flavoring agent Substances 0.000 description 3
- RMBPEFMHABBEKP-UHFFFAOYSA-N fluorene Chemical compound C1=CC=C2C3=C[CH]C=CC3=CC2=C1 RMBPEFMHABBEKP-UHFFFAOYSA-N 0.000 description 3
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 3
- 238000010914 gene-directed enzyme pro-drug therapy Methods 0.000 description 3
- 150000002373 hemiacetals Chemical class 0.000 description 3
- 230000006197 histone deacetylation Effects 0.000 description 3
- DOUHZFSGSXMPIE-UHFFFAOYSA-N hydroxidooxidosulfur(.) Chemical compound [O]SO DOUHZFSGSXMPIE-UHFFFAOYSA-N 0.000 description 3
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 3
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 3
- 230000004054 inflammatory process Effects 0.000 description 3
- 229910010272 inorganic material Inorganic materials 0.000 description 3
- 239000011147 inorganic material Substances 0.000 description 3
- 229910052740 iodine Inorganic materials 0.000 description 3
- 239000010410 layer Substances 0.000 description 3
- 239000006210 lotion Substances 0.000 description 3
- 230000003211 malignant effect Effects 0.000 description 3
- 230000000873 masking effect Effects 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 239000003475 metalloproteinase inhibitor Substances 0.000 description 3
- CWNDITHRENCOKM-CMDGGOBGSA-N methyl (e)-3-[3-(4-pyridin-2-ylpiperazin-1-yl)sulfonylphenyl]prop-2-enoate Chemical compound COC(=O)\C=C\C1=CC=CC(S(=O)(=O)N2CCN(CC2)C=2N=CC=CC=2)=C1 CWNDITHRENCOKM-CMDGGOBGSA-N 0.000 description 3
- PTGBAPLNPNLGDJ-MDZDMXLPSA-N methyl (e)-3-[3-[4-(2-chlorophenyl)piperazin-1-yl]sulfonylphenyl]prop-2-enoate Chemical compound COC(=O)\C=C\C1=CC=CC(S(=O)(=O)N2CCN(CC2)C=2C(=CC=CC=2)Cl)=C1 PTGBAPLNPNLGDJ-MDZDMXLPSA-N 0.000 description 3
- QWQBVFAJQQLRMK-VMPITWQZSA-N methyl (e)-3-[3-[4-(3,4-dichlorophenyl)piperazin-1-yl]sulfonylphenyl]prop-2-enoate Chemical compound COC(=O)\C=C\C1=CC=CC(S(=O)(=O)N2CCN(CC2)C=2C=C(Cl)C(Cl)=CC=2)=C1 QWQBVFAJQQLRMK-VMPITWQZSA-N 0.000 description 3
- PZEGVPVEBIXAGE-FMIVXFBMSA-N methyl (e)-3-[3-[4-[2-[4-(dimethylamino)phenyl]ethyl]piperazin-1-yl]sulfonylphenyl]prop-2-enoate Chemical compound COC(=O)\C=C\C1=CC=CC(S(=O)(=O)N2CCN(CCC=3C=CC(=CC=3)N(C)C)CC2)=C1 PZEGVPVEBIXAGE-FMIVXFBMSA-N 0.000 description 3
- YDRGUPUUVKIKQI-UHFFFAOYSA-N methyl 8-[4-[2-(5-methoxy-1h-indol-3-yl)acetyl]piperazin-1-yl]-8-oxooctanoate Chemical compound C1CN(C(=O)CCCCCCC(=O)OC)CCN1C(=O)CC1=CNC2=CC=C(OC)C=C12 YDRGUPUUVKIKQI-UHFFFAOYSA-N 0.000 description 3
- VMGAPWLDMVPYIA-HIDZBRGKSA-N n'-amino-n-iminomethanimidamide Chemical compound N\N=C\N=N VMGAPWLDMVPYIA-HIDZBRGKSA-N 0.000 description 3
- UMRZSTCPUPJPOJ-KNVOCYPGSA-N norbornane Chemical compound C1C[C@H]2CC[C@@H]1C2 UMRZSTCPUPJPOJ-KNVOCYPGSA-N 0.000 description 3
- XYEOALKITRFCJJ-UHFFFAOYSA-N o-benzylhydroxylamine Chemical compound NOCC1=CC=CC=C1 XYEOALKITRFCJJ-UHFFFAOYSA-N 0.000 description 3
- NIHNNTQXNPWCJQ-UHFFFAOYSA-N o-biphenylenemethane Natural products C1=CC=C2CC3=CC=CC=C3C2=C1 NIHNNTQXNPWCJQ-UHFFFAOYSA-N 0.000 description 3
- 239000012044 organic layer Substances 0.000 description 3
- VUNXBQRNMNVUMV-UHFFFAOYSA-N phenyl(piperazin-1-yl)methanone Chemical compound C=1C=CC=CC=1C(=O)N1CCNCC1 VUNXBQRNMNVUMV-UHFFFAOYSA-N 0.000 description 3
- 239000006187 pill Substances 0.000 description 3
- IVXQBCUBSIPQGU-UHFFFAOYSA-N piperazine-1-carboxamide Chemical compound NC(=O)N1CCNCC1 IVXQBCUBSIPQGU-UHFFFAOYSA-N 0.000 description 3
- DWXLVZSMXXCSMJ-UHFFFAOYSA-N piperazine-1-sulfonamide Chemical class NS(=O)(=O)N1CCNCC1 DWXLVZSMXXCSMJ-UHFFFAOYSA-N 0.000 description 3
- 239000011505 plaster Substances 0.000 description 3
- 125000003367 polycyclic group Chemical group 0.000 description 3
- GNSKLFRGEWLPPA-UHFFFAOYSA-M potassium dihydrogen phosphate Chemical compound [K+].OP(O)([O-])=O GNSKLFRGEWLPPA-UHFFFAOYSA-M 0.000 description 3
- 239000003755 preservative agent Substances 0.000 description 3
- 108090000765 processed proteins & peptides Proteins 0.000 description 3
- 125000006239 protecting group Chemical group 0.000 description 3
- CPNGPNLZQNNVQM-UHFFFAOYSA-N pteridine Chemical compound N1=CN=CC2=NC=CN=C21 CPNGPNLZQNNVQM-UHFFFAOYSA-N 0.000 description 3
- UFZNZKGKBWOSJG-UHFFFAOYSA-N purin-2-one Chemical compound O=C1N=CC2=NC=NC2=N1 UFZNZKGKBWOSJG-UHFFFAOYSA-N 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- XSCHRSMBECNVNS-UHFFFAOYSA-N quinoxaline Chemical compound N1=CC=NC2=CC=CC=C21 XSCHRSMBECNVNS-UHFFFAOYSA-N 0.000 description 3
- 230000001105 regulatory effect Effects 0.000 description 3
- BOLDJAUMGUJJKM-LSDHHAIUSA-N renifolin D Natural products CC(=C)[C@@H]1Cc2c(O)c(O)ccc2[C@H]1CC(=O)c3ccc(O)cc3O BOLDJAUMGUJJKM-LSDHHAIUSA-N 0.000 description 3
- 230000002441 reversible effect Effects 0.000 description 3
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- JUJBNYBVVQSIOU-UHFFFAOYSA-M sodium;4-[2-(4-iodophenyl)-3-(4-nitrophenyl)tetrazol-2-ium-5-yl]benzene-1,3-disulfonate Chemical compound [Na+].C1=CC([N+](=O)[O-])=CC=C1N1[N+](C=2C=CC(I)=CC=2)=NC(C=2C(=CC(=CC=2)S([O-])(=O)=O)S([O-])(=O)=O)=N1 JUJBNYBVVQSIOU-UHFFFAOYSA-M 0.000 description 3
- 239000007921 spray Substances 0.000 description 3
- 238000006467 substitution reaction Methods 0.000 description 3
- IWOKCMBOJXYDEE-UHFFFAOYSA-N sulfinylmethane Chemical compound C=S=O IWOKCMBOJXYDEE-UHFFFAOYSA-N 0.000 description 3
- 239000006188 syrup Substances 0.000 description 3
- 235000020357 syrup Nutrition 0.000 description 3
- AWCWKIIMNWGBRM-UHFFFAOYSA-N tert-butyl 4-(4-cyanobenzoyl)piperazine-1-carboxylate Chemical compound C1CN(C(=O)OC(C)(C)C)CCN1C(=O)C1=CC=C(C#N)C=C1 AWCWKIIMNWGBRM-UHFFFAOYSA-N 0.000 description 3
- NVVBXKXSMPJUEZ-UHFFFAOYSA-N tert-butyl 4-[2-[4-(dimethylamino)phenyl]acetyl]piperazine-1-carboxylate Chemical compound C1=CC(N(C)C)=CC=C1CC(=O)N1CCN(C(=O)OC(C)(C)C)CC1 NVVBXKXSMPJUEZ-UHFFFAOYSA-N 0.000 description 3
- YOZLBJXUJHNUOW-UHFFFAOYSA-N tert-butyl 4-benzoylpiperazine-1-carboxylate Chemical compound C1CN(C(=O)OC(C)(C)C)CCN1C(=O)C1=CC=CC=C1 YOZLBJXUJHNUOW-UHFFFAOYSA-N 0.000 description 3
- 229940113082 thymine Drugs 0.000 description 3
- 238000012546 transfer Methods 0.000 description 3
- 241000701447 unidentified baculovirus Species 0.000 description 3
- 229940035893 uracil Drugs 0.000 description 3
- PUPZLCDOIYMWBV-UHFFFAOYSA-N (+/-)-1,3-Butanediol Chemical compound CC(O)CCO PUPZLCDOIYMWBV-UHFFFAOYSA-N 0.000 description 2
- SODJWKLYYZMITR-VAWYXSNFSA-N (e)-3-[3-[4-(2-naphthalen-1-yloxyethyl)piperazin-1-yl]sulfonylphenyl]prop-2-enoyl chloride Chemical compound ClC(=O)\C=C\C1=CC=CC(S(=O)(=O)N2CCN(CCOC=3C4=CC=CC=C4C=CC=3)CC2)=C1 SODJWKLYYZMITR-VAWYXSNFSA-N 0.000 description 2
- RMOUBRKASZOGFQ-QPJJXVBHSA-N (e)-3-[3-[4-(3,4-dichlorophenyl)piperazin-1-yl]sulfonylphenyl]prop-2-enoyl chloride Chemical compound ClC(=O)\C=C\C1=CC=CC(S(=O)(=O)N2CCN(CC2)C=2C=C(Cl)C(Cl)=CC=2)=C1 RMOUBRKASZOGFQ-QPJJXVBHSA-N 0.000 description 2
- YDJHNYWBLYFSGZ-BJMVGYQFSA-N (e)-3-[3-[4-(4-acetylphenyl)piperazin-1-yl]sulfonylphenyl]prop-2-enoic acid Chemical compound C1=CC(C(=O)C)=CC=C1N1CCN(S(=O)(=O)C=2C=C(\C=C\C(O)=O)C=CC=2)CC1 YDJHNYWBLYFSGZ-BJMVGYQFSA-N 0.000 description 2
- IIROFDXBCLQFFG-BJMVGYQFSA-N (e)-3-[3-[4-[4-(1-chloroethenyl)phenyl]piperazin-1-yl]sulfonylphenyl]prop-2-enoyl chloride Chemical compound ClC(=O)\C=C\C1=CC=CC(S(=O)(=O)N2CCN(CC2)C=2C=CC(=CC=2)C(Cl)=C)=C1 IIROFDXBCLQFFG-BJMVGYQFSA-N 0.000 description 2
- QRPSQQUYPMFERG-LFYBBSHMSA-N (e)-5-[3-(benzenesulfonamido)phenyl]-n-hydroxypent-2-en-4-ynamide Chemical compound ONC(=O)\C=C\C#CC1=CC=CC(NS(=O)(=O)C=2C=CC=CC=2)=C1 QRPSQQUYPMFERG-LFYBBSHMSA-N 0.000 description 2
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 2
- KCOPAESEGCGTKM-UHFFFAOYSA-N 1,3-oxazol-4-one Chemical compound O=C1COC=N1 KCOPAESEGCGTKM-UHFFFAOYSA-N 0.000 description 2
- MRBFGEHILMYPTF-UHFFFAOYSA-N 1-(2-Pyrimidyl)piperazine Chemical compound C1CNCCN1C1=NC=CC=N1 MRBFGEHILMYPTF-UHFFFAOYSA-N 0.000 description 2
- PZIBVWUXWNYTNL-UHFFFAOYSA-N 1-(3-methoxyphenyl)piperazine Chemical compound COC1=CC=CC(N2CCNCC2)=C1 PZIBVWUXWNYTNL-UHFFFAOYSA-N 0.000 description 2
- IANQTJSKSUMEQM-UHFFFAOYSA-N 1-benzofuran Chemical compound C1=CC=C2OC=CC2=C1 IANQTJSKSUMEQM-UHFFFAOYSA-N 0.000 description 2
- VBICKXHEKHSIBG-UHFFFAOYSA-N 1-monostearoylglycerol Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC(O)CO VBICKXHEKHSIBG-UHFFFAOYSA-N 0.000 description 2
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical compound C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 description 2
- AWBOSXFRPFZLOP-UHFFFAOYSA-N 2,1,3-benzoxadiazole Chemical compound C1=CC=CC2=NON=C21 AWBOSXFRPFZLOP-UHFFFAOYSA-N 0.000 description 2
- VEPOHXYIFQMVHW-XOZOLZJESA-N 2,3-dihydroxybutanedioic acid (2S,3S)-3,4-dimethyl-2-phenylmorpholine Chemical compound OC(C(O)C(O)=O)C(O)=O.C[C@H]1[C@@H](OCCN1C)c1ccccc1 VEPOHXYIFQMVHW-XOZOLZJESA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- ASSKVPFEZFQQNQ-UHFFFAOYSA-N 2-benzoxazolinone Chemical compound C1=CC=C2OC(O)=NC2=C1 ASSKVPFEZFQQNQ-UHFFFAOYSA-N 0.000 description 2
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 2
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 2
- JMTMSDXUXJISAY-UHFFFAOYSA-N 2H-benzotriazol-4-ol Chemical compound OC1=CC=CC2=C1N=NN2 JMTMSDXUXJISAY-UHFFFAOYSA-N 0.000 description 2
- JZIBVTUXIVIFGC-UHFFFAOYSA-N 2H-pyrrole Chemical compound C1C=CC=N1 JZIBVTUXIVIFGC-UHFFFAOYSA-N 0.000 description 2
- GOLXRNDWAUTYKT-UHFFFAOYSA-N 3-(1H-indol-3-yl)propanoic acid Chemical compound C1=CC=C2C(CCC(=O)O)=CNC2=C1 GOLXRNDWAUTYKT-UHFFFAOYSA-N 0.000 description 2
- ZTNAIHGOFCMOPJ-UHFFFAOYSA-N 3-(piperazin-1-ylmethyl)-1h-indole Chemical compound C=1NC2=CC=CC=C2C=1CN1CCNCC1 ZTNAIHGOFCMOPJ-UHFFFAOYSA-N 0.000 description 2
- OKEAMBAZBICIFP-UHFFFAOYSA-N 3-oxido-2,1,3-benzoxadiazol-3-ium Chemical compound C1=CC=CC2=[N+]([O-])ON=C21 OKEAMBAZBICIFP-UHFFFAOYSA-N 0.000 description 2
- JVQIKJMSUIMUDI-UHFFFAOYSA-N 3-pyrroline Chemical compound C1NCC=C1 JVQIKJMSUIMUDI-UHFFFAOYSA-N 0.000 description 2
- NJBMMMJOXRZENQ-UHFFFAOYSA-N 6H-pyrrolo[2,3-f]quinoline Chemical compound c1cc2ccc3[nH]cccc3c2n1 NJBMMMJOXRZENQ-UHFFFAOYSA-N 0.000 description 2
- HBJDIGIBUHAJIA-UHFFFAOYSA-N 7-[4-(1h-indol-3-ylmethyl)piperazin-1-yl]-7-oxo-n-phenylmethoxyheptanamide Chemical compound C1CN(CC=2C3=CC=CC=C3NC=2)CCN1C(=O)CCCCCC(=O)NOCC1=CC=CC=C1 HBJDIGIBUHAJIA-UHFFFAOYSA-N 0.000 description 2
- DKTYWSJDCLRVNU-UHFFFAOYSA-N 7-[4-[3-(1h-indol-3-yl)propanoyl]piperazin-1-yl]-7-oxo-n-phenylmethoxyheptanamide Chemical compound C1CN(C(=O)CCC=2C3=CC=CC=C3NC=2)CCN1C(=O)CCCCCC(=O)NOCC1=CC=CC=C1 DKTYWSJDCLRVNU-UHFFFAOYSA-N 0.000 description 2
- 102100026802 72 kDa type IV collagenase Human genes 0.000 description 2
- KDCGOANMDULRCW-UHFFFAOYSA-N 7H-purine Chemical compound N1=CNC2=NC=NC2=C1 KDCGOANMDULRCW-UHFFFAOYSA-N 0.000 description 2
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 2
- 229920000936 Agarose Polymers 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- 241000243818 Annelida Species 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- 241000238421 Arthropoda Species 0.000 description 2
- 241000416162 Astragalus gummifer Species 0.000 description 2
- 201000001320 Atherosclerosis Diseases 0.000 description 2
- 241000894006 Bacteria Species 0.000 description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 2
- 241000283690 Bos taurus Species 0.000 description 2
- 241000238366 Cephalopoda Species 0.000 description 2
- 241000282693 Cercopithecidae Species 0.000 description 2
- 241000258920 Chilopoda Species 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- 241000251556 Chordata Species 0.000 description 2
- 108010077544 Chromatin Proteins 0.000 description 2
- 102000029816 Collagenase Human genes 0.000 description 2
- 108060005980 Collagenase Proteins 0.000 description 2
- 206010009944 Colon cancer Diseases 0.000 description 2
- 241000218631 Coniferophyta Species 0.000 description 2
- PMPVIKIVABFJJI-UHFFFAOYSA-N Cyclobutane Chemical compound C1CCC1 PMPVIKIVABFJJI-UHFFFAOYSA-N 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- LVZWSLJZHVFIQJ-UHFFFAOYSA-N Cyclopropane Chemical compound C1CC1 LVZWSLJZHVFIQJ-UHFFFAOYSA-N 0.000 description 2
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 2
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 2
- UBJVUCKUDDKUJF-UHFFFAOYSA-N Diallyl sulfide Chemical compound C=CCSCC=C UBJVUCKUDDKUJF-UHFFFAOYSA-N 0.000 description 2
- BWGNESOTFCXPMA-UHFFFAOYSA-N Dihydrogen disulfide Chemical compound SS BWGNESOTFCXPMA-UHFFFAOYSA-N 0.000 description 2
- 241000258963 Diplopoda Species 0.000 description 2
- 241000792859 Enema Species 0.000 description 2
- 241000283073 Equus caballus Species 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- 241000206602 Eukaryota Species 0.000 description 2
- 206010016654 Fibrosis Diseases 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- 230000010190 G1 phase Effects 0.000 description 2
- 108010010803 Gelatin Proteins 0.000 description 2
- 241000238631 Hexapoda Species 0.000 description 2
- 102100034523 Histone H4 Human genes 0.000 description 2
- 102100038720 Histone deacetylase 9 Human genes 0.000 description 2
- 101000882390 Homo sapiens Histone acetyltransferase p300 Proteins 0.000 description 2
- 241000270322 Lepidosauria Species 0.000 description 2
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 2
- 206010058467 Lung neoplasm malignant Diseases 0.000 description 2
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 2
- 241000124008 Mammalia Species 0.000 description 2
- 108010016165 Matrix Metalloproteinase 2 Proteins 0.000 description 2
- 102000002274 Matrix Metalloproteinases Human genes 0.000 description 2
- 108010000684 Matrix Metalloproteinases Proteins 0.000 description 2
- 241000699666 Mus <mouse, genus> Species 0.000 description 2
- HSHXDCVZWHOWCS-UHFFFAOYSA-N N'-hexadecylthiophene-2-carbohydrazide Chemical compound CCCCCCCCCCCCCCCCNNC(=O)c1cccs1 HSHXDCVZWHOWCS-UHFFFAOYSA-N 0.000 description 2
- WHNWPMSKXPGLAX-UHFFFAOYSA-N N-Vinyl-2-pyrrolidone Chemical compound C=CN1CCCC1=O WHNWPMSKXPGLAX-UHFFFAOYSA-N 0.000 description 2
- 241000244206 Nematoda Species 0.000 description 2
- 108010047956 Nucleosomes Proteins 0.000 description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 2
- 241000242594 Platyhelminthes Species 0.000 description 2
- 241000243142 Porifera Species 0.000 description 2
- KYQCOXFCLRTKLS-UHFFFAOYSA-N Pyrazine Chemical compound C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 description 2
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 2
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 2
- 229930006000 Sucrose Natural products 0.000 description 2
- YPWFISCTZQNZAU-UHFFFAOYSA-N Thiane Chemical compound C1CCSCC1 YPWFISCTZQNZAU-UHFFFAOYSA-N 0.000 description 2
- 229920001615 Tragacanth Polymers 0.000 description 2
- 108060008682 Tumor Necrosis Factor Proteins 0.000 description 2
- 241000700605 Viruses Species 0.000 description 2
- 238000002835 absorbance Methods 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- CWRYPZZKDGJXCA-UHFFFAOYSA-N acenaphthene Chemical compound C1=CC(CC2)=C3C2=CC=CC3=C1 CWRYPZZKDGJXCA-UHFFFAOYSA-N 0.000 description 2
- 125000004036 acetal group Chemical group 0.000 description 2
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 125000004423 acyloxy group Chemical group 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- MWPLVEDNUUSJAV-UHFFFAOYSA-N anthracene Chemical compound C1=CC=CC2=CC3=CC=CC=C3C=C21 MWPLVEDNUUSJAV-UHFFFAOYSA-N 0.000 description 2
- 238000010913 antigen-directed enzyme pro-drug therapy Methods 0.000 description 2
- 239000003963 antioxidant agent Substances 0.000 description 2
- 235000006708 antioxidants Nutrition 0.000 description 2
- XYOVOXDWRFGKEX-UHFFFAOYSA-N azepine Chemical compound N1C=CC=CC=C1 XYOVOXDWRFGKEX-UHFFFAOYSA-N 0.000 description 2
- HONIICLYMWZJFZ-UHFFFAOYSA-N azetidine Chemical compound C1CNC1 HONIICLYMWZJFZ-UHFFFAOYSA-N 0.000 description 2
- CUFNKYGDVFVPHO-UHFFFAOYSA-N azulene Chemical compound C1=CC=CC2=CC=CC2=C1 CUFNKYGDVFVPHO-UHFFFAOYSA-N 0.000 description 2
- 239000011324 bead Substances 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- 150000003936 benzamides Chemical class 0.000 description 2
- IOJUPLGTWVMSFF-UHFFFAOYSA-N benzothiazole Chemical compound C1=CC=C2SC=NC2=C1 IOJUPLGTWVMSFF-UHFFFAOYSA-N 0.000 description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 2
- LUFPJJNWMYZRQE-UHFFFAOYSA-N benzylsulfanylmethylbenzene Chemical compound C=1C=CC=CC=1CSCC1=CC=CC=C1 LUFPJJNWMYZRQE-UHFFFAOYSA-N 0.000 description 2
- 238000010256 biochemical assay Methods 0.000 description 2
- 230000033228 biological regulation Effects 0.000 description 2
- 230000000903 blocking effect Effects 0.000 description 2
- 210000004369 blood Anatomy 0.000 description 2
- 239000008280 blood Substances 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 235000010216 calcium carbonate Nutrition 0.000 description 2
- 229910000019 calcium carbonate Inorganic materials 0.000 description 2
- CRPUJAZIXJMDBK-UHFFFAOYSA-N camphene Chemical compound C1CC2C(=C)C(C)(C)C1C2 CRPUJAZIXJMDBK-UHFFFAOYSA-N 0.000 description 2
- BWRHOYDPVJPXMF-UHFFFAOYSA-N carane Chemical compound C1C(C)CCC2C(C)(C)C12 BWRHOYDPVJPXMF-UHFFFAOYSA-N 0.000 description 2
- 125000001951 carbamoylamino group Chemical group C(N)(=O)N* 0.000 description 2
- 229910002092 carbon dioxide Inorganic materials 0.000 description 2
- 235000011089 carbon dioxide Nutrition 0.000 description 2
- SKOLWUPSYHWYAM-UHFFFAOYSA-N carbonodithioic O,S-acid Chemical compound SC(S)=O SKOLWUPSYHWYAM-UHFFFAOYSA-N 0.000 description 2
- 150000007942 carboxylates Chemical class 0.000 description 2
- 230000022131 cell cycle Effects 0.000 description 2
- 230000011712 cell development Effects 0.000 description 2
- 230000003833 cell viability Effects 0.000 description 2
- 238000012512 characterization method Methods 0.000 description 2
- PBAYDYUZOSNJGU-UHFFFAOYSA-N chelidonic acid Natural products OC(=O)C1=CC(=O)C=C(C(O)=O)O1 PBAYDYUZOSNJGU-UHFFFAOYSA-N 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 150000001805 chlorine compounds Chemical class 0.000 description 2
- SKCNIGRBPJIUBQ-UHFFFAOYSA-N chloroform;ethyl acetate Chemical compound ClC(Cl)Cl.CCOC(C)=O SKCNIGRBPJIUBQ-UHFFFAOYSA-N 0.000 description 2
- XTHPWXDJESJLNJ-UHFFFAOYSA-M chlorosulfate Chemical compound [O-]S(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-M 0.000 description 2
- XTHPWXDJESJLNJ-UHFFFAOYSA-N chlorosulfonic acid Substances OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 2
- 210000003483 chromatin Anatomy 0.000 description 2
- OTAFHZMPRISVEM-UHFFFAOYSA-N chromone Chemical compound C1=CC=C2C(=O)C=COC2=C1 OTAFHZMPRISVEM-UHFFFAOYSA-N 0.000 description 2
- WCZVZNOTHYJIEI-UHFFFAOYSA-N cinnoline Chemical compound N1=NC=CC2=CC=CC=C21 WCZVZNOTHYJIEI-UHFFFAOYSA-N 0.000 description 2
- 229960002424 collagenase Drugs 0.000 description 2
- 239000002442 collagenase inhibitor Substances 0.000 description 2
- 210000001072 colon Anatomy 0.000 description 2
- 238000002648 combination therapy Methods 0.000 description 2
- 230000000295 complement effect Effects 0.000 description 2
- RWGFKTVRMDUZSP-UHFFFAOYSA-N cumene Chemical compound CC(C)C1=CC=CC=C1 RWGFKTVRMDUZSP-UHFFFAOYSA-N 0.000 description 2
- HGCIXCUEYOPUTN-UHFFFAOYSA-N cyclohexene Chemical compound C1CCC=CC1 HGCIXCUEYOPUTN-UHFFFAOYSA-N 0.000 description 2
- 125000005725 cyclohexenylene group Chemical group 0.000 description 2
- 125000004956 cyclohexylene group Chemical group 0.000 description 2
- LPIQUOYDBNQMRZ-UHFFFAOYSA-N cyclopentene Chemical compound C1CC=CC1 LPIQUOYDBNQMRZ-UHFFFAOYSA-N 0.000 description 2
- 125000004979 cyclopentylene group Chemical group 0.000 description 2
- 229940104302 cytosine Drugs 0.000 description 2
- 229940127089 cytotoxic agent Drugs 0.000 description 2
- 230000003013 cytotoxicity Effects 0.000 description 2
- 231100000135 cytotoxicity Toxicity 0.000 description 2
- 230000006196 deacetylation Effects 0.000 description 2
- 238000003381 deacetylation reaction Methods 0.000 description 2
- 230000002939 deleterious effect Effects 0.000 description 2
- 238000001514 detection method Methods 0.000 description 2
- TXCDCPKCNAJMEE-UHFFFAOYSA-N dibenzofuran Chemical compound C1=CC=C2C3=CC=CC=C3OC2=C1 TXCDCPKCNAJMEE-UHFFFAOYSA-N 0.000 description 2
- IYYZUPMFVPLQIF-UHFFFAOYSA-N dibenzothiophene Chemical compound C1=CC=C2C3=CC=CC=C3SC2=C1 IYYZUPMFVPLQIF-UHFFFAOYSA-N 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 239000012895 dilution Substances 0.000 description 2
- ZZVUWRFHKOJYTH-UHFFFAOYSA-N diphenhydramine Chemical group C=1C=CC=CC=1C(OCCN(C)C)C1=CC=CC=C1 ZZVUWRFHKOJYTH-UHFFFAOYSA-N 0.000 description 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 2
- 125000002228 disulfide group Chemical group 0.000 description 2
- VHJLVAABSRFDPM-QWWZWVQMSA-N dithiothreitol Chemical compound SC[C@@H](O)[C@H](O)CS VHJLVAABSRFDPM-QWWZWVQMSA-N 0.000 description 2
- 239000002552 dosage form Substances 0.000 description 2
- SQNZJJAZBFDUTD-UHFFFAOYSA-N durene Chemical compound CC1=CC(C)=C(C)C=C1C SQNZJJAZBFDUTD-UHFFFAOYSA-N 0.000 description 2
- 239000012149 elution buffer Substances 0.000 description 2
- 239000007920 enema Substances 0.000 description 2
- 229940095399 enema Drugs 0.000 description 2
- 239000003623 enhancer Substances 0.000 description 2
- 125000002587 enol group Chemical group 0.000 description 2
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 2
- 125000002573 ethenylidene group Chemical group [*]=C=C([H])[H] 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- GRZLXTTVEOLMFF-UHFFFAOYSA-N ethyl 7-[4-(3-chlorophenyl)piperazin-1-yl]-7-oxoheptanoate Chemical compound C1CN(C(=O)CCCCCC(=O)OCC)CCN1C1=CC=CC(Cl)=C1 GRZLXTTVEOLMFF-UHFFFAOYSA-N 0.000 description 2
- YAOKWICENFGVOC-UHFFFAOYSA-N ethyl 8-[4-(3-chlorophenyl)piperazin-1-yl]-8-oxooctanoate Chemical compound C1CN(C(=O)CCCCCCC(=O)OCC)CCN1C1=CC=CC(Cl)=C1 YAOKWICENFGVOC-UHFFFAOYSA-N 0.000 description 2
- FZEKWOSZJDDSRW-UHFFFAOYSA-N ethyl 8-[4-(4-methoxyphenyl)piperazin-1-yl]-8-oxooctanoate Chemical compound C1CN(C(=O)CCCCCCC(=O)OCC)CCN1C1=CC=C(OC)C=C1 FZEKWOSZJDDSRW-UHFFFAOYSA-N 0.000 description 2
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 2
- 230000007717 exclusion Effects 0.000 description 2
- 239000003889 eye drop Substances 0.000 description 2
- 229940012356 eye drops Drugs 0.000 description 2
- 210000002950 fibroblast Anatomy 0.000 description 2
- 230000000893 fibroproliferative effect Effects 0.000 description 2
- 230000004761 fibrosis Effects 0.000 description 2
- 239000000945 filler Substances 0.000 description 2
- 235000019634 flavors Nutrition 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 125000001153 fluoro group Chemical group F* 0.000 description 2
- 230000037406 food intake Effects 0.000 description 2
- 235000003599 food sweetener Nutrition 0.000 description 2
- 230000004927 fusion Effects 0.000 description 2
- 108020001507 fusion proteins Proteins 0.000 description 2
- 102000037865 fusion proteins Human genes 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 229920000159 gelatin Polymers 0.000 description 2
- 239000008273 gelatin Substances 0.000 description 2
- 235000019322 gelatine Nutrition 0.000 description 2
- 235000011852 gelatine desserts Nutrition 0.000 description 2
- 230000012010 growth Effects 0.000 description 2
- 125000001976 hemiacetal group Chemical group 0.000 description 2
- 230000002440 hepatic effect Effects 0.000 description 2
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 description 2
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 2
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 description 2
- MTNDZQHUAFNZQY-UHFFFAOYSA-N imidazoline Chemical compound C1CN=CN1 MTNDZQHUAFNZQY-UHFFFAOYSA-N 0.000 description 2
- 150000002466 imines Chemical class 0.000 description 2
- 238000011534 incubation Methods 0.000 description 2
- IQZZFVDIZRWADY-UHFFFAOYSA-N isocoumarin Chemical compound C1=CC=C2C(=O)OC=CC2=C1 IQZZFVDIZRWADY-UHFFFAOYSA-N 0.000 description 2
- 125000000654 isopropylidene group Chemical group C(C)(C)=* 0.000 description 2
- AWJUIBRHMBBTKR-UHFFFAOYSA-N isoquinoline Chemical compound C1=NC=CC2=CC=CC=C21 AWJUIBRHMBBTKR-UHFFFAOYSA-N 0.000 description 2
- 239000002502 liposome Substances 0.000 description 2
- 239000000314 lubricant Substances 0.000 description 2
- 210000004072 lung Anatomy 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- 201000001441 melanoma Diseases 0.000 description 2
- CKJNUZNMWOVDFN-UHFFFAOYSA-N methanone Chemical compound O=[CH-] CKJNUZNMWOVDFN-UHFFFAOYSA-N 0.000 description 2
- JSAZWQTZAPZSDR-FMIVXFBMSA-N methyl (e)-3-[3-[4-(2-naphthalen-2-yloxyethyl)piperazin-1-yl]sulfonylphenyl]prop-2-enoate Chemical compound COC(=O)\C=C\C1=CC=CC(S(=O)(=O)N2CCN(CCOC=3C=C4C=CC=CC4=CC=3)CC2)=C1 JSAZWQTZAPZSDR-FMIVXFBMSA-N 0.000 description 2
- ZLFOZEQDISIDQS-IZZDOVSWSA-N methyl (e)-3-[3-[4-(4-acetylphenyl)piperazin-1-yl]sulfonylphenyl]prop-2-enoate Chemical compound COC(=O)\C=C\C1=CC=CC(S(=O)(=O)N2CCN(CC2)C=2C=CC(=CC=2)C(C)=O)=C1 ZLFOZEQDISIDQS-IZZDOVSWSA-N 0.000 description 2
- KXEFUMLHZXDVSC-BJMVGYQFSA-N methyl (e)-3-[3-[4-(4-chlorophenyl)piperazin-1-yl]sulfonylphenyl]prop-2-enoate Chemical compound COC(=O)\C=C\C1=CC=CC(S(=O)(=O)N2CCN(CC2)C=2C=CC(Cl)=CC=2)=C1 KXEFUMLHZXDVSC-BJMVGYQFSA-N 0.000 description 2
- GZYQQGOVUMFQID-UHFFFAOYSA-N methyl 8-[4-(2-methoxyphenyl)piperazin-1-yl]-8-oxooctanoate Chemical compound C1CN(C(=O)CCCCCCC(=O)OC)CCN1C1=CC=CC=C1OC GZYQQGOVUMFQID-UHFFFAOYSA-N 0.000 description 2
- WBYWAXJHAXSJNI-UHFFFAOYSA-N methyl p-hydroxycinnamate Natural products OC(=O)C=CC1=CC=CC=C1 WBYWAXJHAXSJNI-UHFFFAOYSA-N 0.000 description 2
- MGJXBDMLVWIYOQ-UHFFFAOYSA-N methylazanide Chemical compound [NH-]C MGJXBDMLVWIYOQ-UHFFFAOYSA-N 0.000 description 2
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 2
- 238000000465 moulding Methods 0.000 description 2
- DCIGVCVTOWDUBQ-UHFFFAOYSA-N n,n-dimethyl-4-(2-piperazin-1-ylethyl)aniline Chemical compound C1=CC(N(C)C)=CC=C1CCN1CCNCC1 DCIGVCVTOWDUBQ-UHFFFAOYSA-N 0.000 description 2
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 2
- 229940097496 nasal spray Drugs 0.000 description 2
- 239000007922 nasal spray Substances 0.000 description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 2
- 210000001623 nucleosome Anatomy 0.000 description 2
- UBAOFCNBCAZEBL-UHFFFAOYSA-N octanamide Chemical compound CCCCCCCC(N)=O.CCCCCCCC(N)=O UBAOFCNBCAZEBL-UHFFFAOYSA-N 0.000 description 2
- 239000003883 ointment base Substances 0.000 description 2
- 150000002891 organic anions Chemical class 0.000 description 2
- GEVPUGOOGXGPIO-UHFFFAOYSA-N oxalic acid;dihydrate Chemical compound O.O.OC(=O)C(O)=O GEVPUGOOGXGPIO-UHFFFAOYSA-N 0.000 description 2
- 238000004806 packaging method and process Methods 0.000 description 2
- 230000035515 penetration Effects 0.000 description 2
- YNPNZTXNASCQKK-UHFFFAOYSA-N phenanthrene Chemical compound C1=CC=C2C3=CC=CC=C3C=CC2=C1 YNPNZTXNASCQKK-UHFFFAOYSA-N 0.000 description 2
- RDOWQLZANAYVLL-UHFFFAOYSA-N phenanthridine Chemical compound C1=CC=C2C3=CC=CC=C3C=NC2=C1 RDOWQLZANAYVLL-UHFFFAOYSA-N 0.000 description 2
- 125000002467 phosphate group Chemical group [H]OP(=O)(O[H])O[*] 0.000 description 2
- 239000011574 phosphorus Substances 0.000 description 2
- XOKSLPVRUOBDEW-UHFFFAOYSA-N pinane Chemical compound CC1CCC2C(C)(C)C1C2 XOKSLPVRUOBDEW-UHFFFAOYSA-N 0.000 description 2
- JTHRRMFZHSDGNJ-UHFFFAOYSA-N piperazine-2,3-dione Chemical compound O=C1NCCNC1=O JTHRRMFZHSDGNJ-UHFFFAOYSA-N 0.000 description 2
- XUWHAWMETYGRKB-UHFFFAOYSA-N piperidin-2-one Chemical compound O=C1CCCCN1 XUWHAWMETYGRKB-UHFFFAOYSA-N 0.000 description 2
- 229920005862 polyol Polymers 0.000 description 2
- 150000003077 polyols Chemical class 0.000 description 2
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 2
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 230000003389 potentiating effect Effects 0.000 description 2
- 229940069328 povidone Drugs 0.000 description 2
- 230000008569 process Effects 0.000 description 2
- 230000001737 promoting effect Effects 0.000 description 2
- 230000000069 prophylactic effect Effects 0.000 description 2
- 210000002307 prostate Anatomy 0.000 description 2
- 230000002685 pulmonary effect Effects 0.000 description 2
- BBEAQIROQSPTKN-UHFFFAOYSA-N pyrene Chemical compound C1=CC=C2C=CC3=CC=CC4=CC=C1C2=C43 BBEAQIROQSPTKN-UHFFFAOYSA-N 0.000 description 2
- 230000002285 radioactive effect Effects 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 206010039073 rheumatoid arthritis Diseases 0.000 description 2
- 229910052710 silicon Inorganic materials 0.000 description 2
- 239000010703 silicon Substances 0.000 description 2
- 210000003491 skin Anatomy 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 2
- 239000000600 sorbitol Substances 0.000 description 2
- 235000010356 sorbitol Nutrition 0.000 description 2
- 125000003003 spiro group Chemical group 0.000 description 2
- KZNICNPSHKQLFF-UHFFFAOYSA-N succinimide Chemical compound O=C1CCC(=O)N1 KZNICNPSHKQLFF-UHFFFAOYSA-N 0.000 description 2
- 239000005720 sucrose Substances 0.000 description 2
- 150000003456 sulfonamides Chemical class 0.000 description 2
- 125000001273 sulfonato group Chemical group [O-]S(*)(=O)=O 0.000 description 2
- 150000003457 sulfones Chemical class 0.000 description 2
- 239000006228 supernatant Substances 0.000 description 2
- 239000003765 sweetening agent Substances 0.000 description 2
- ZXEVCXHMRLPDFL-UHFFFAOYSA-N tert-butyl 4-[4-(dimethylamino)benzoyl]piperazine-1-carboxylate Chemical compound C1=CC(N(C)C)=CC=C1C(=O)N1CCN(C(=O)OC(C)(C)C)CC1 ZXEVCXHMRLPDFL-UHFFFAOYSA-N 0.000 description 2
- HLZKNKRTKFSKGZ-UHFFFAOYSA-N tetradecan-1-ol Chemical compound CCCCCCCCCCCCCCO HLZKNKRTKFSKGZ-UHFFFAOYSA-N 0.000 description 2
- RWRDLPDLKQPQOW-UHFFFAOYSA-N tetrahydropyrrole Substances C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 2
- 125000003831 tetrazolyl group Chemical group 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- GCTNBVHDRFKLLK-UHFFFAOYSA-N thujane Chemical compound CC1CCC2(C(C)C)C1C2 GCTNBVHDRFKLLK-UHFFFAOYSA-N 0.000 description 2
- 239000000196 tragacanth Substances 0.000 description 2
- 235000010487 tragacanth Nutrition 0.000 description 2
- 229940116362 tragacanth Drugs 0.000 description 2
- 230000002103 transcriptional effect Effects 0.000 description 2
- 230000014616 translation Effects 0.000 description 2
- 230000005945 translocation Effects 0.000 description 2
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 2
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- 230000004614 tumor growth Effects 0.000 description 2
- 239000001993 wax Substances 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- VCGRFBXVSFAGGA-UHFFFAOYSA-N (1,1-dioxo-1,4-thiazinan-4-yl)-[6-[[3-(4-fluorophenyl)-5-methyl-1,2-oxazol-4-yl]methoxy]pyridin-3-yl]methanone Chemical compound CC=1ON=C(C=2C=CC(F)=CC=2)C=1COC(N=C1)=CC=C1C(=O)N1CCS(=O)(=O)CC1 VCGRFBXVSFAGGA-UHFFFAOYSA-N 0.000 description 1
- MAYZWDRUFKUGGP-VIFPVBQESA-N (3s)-1-[5-tert-butyl-3-[(1-methyltetrazol-5-yl)methyl]triazolo[4,5-d]pyrimidin-7-yl]pyrrolidin-3-ol Chemical compound CN1N=NN=C1CN1C2=NC(C(C)(C)C)=NC(N3C[C@@H](O)CC3)=C2N=N1 MAYZWDRUFKUGGP-VIFPVBQESA-N 0.000 description 1
- UJALMIJJHLWAGQ-WVLIHFOGSA-N (e)-3-[2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-4-ium-1-yl]sulfonylphenyl]-n-hydroxyprop-2-enamide;dihydrogen phosphate Chemical compound OP(O)([O-])=O.ONC(=O)\C=C\C1=CC=CC=C1S(=O)(=O)N1CC[NH+](CC=2C=C3OCOC3=CC=2)CC1 UJALMIJJHLWAGQ-WVLIHFOGSA-N 0.000 description 1
- DHRCQVRGGWCGCS-CCEZHUSRSA-N (e)-3-[3-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]-n-hydroxyprop-2-enamide Chemical compound ONC(=O)\C=C\C1=CC=CC(S(=O)(=O)N2CCN(CC2)C(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1 DHRCQVRGGWCGCS-CCEZHUSRSA-N 0.000 description 1
- XPLBWFTXOZMMOH-MDZDMXLPSA-N (e)-3-[3-(4-benzylpiperazin-1-yl)sulfonylphenyl]-n-hydroxyprop-2-enamide Chemical compound ONC(=O)\C=C\C1=CC=CC(S(=O)(=O)N2CCN(CC=3C=CC=CC=3)CC2)=C1 XPLBWFTXOZMMOH-MDZDMXLPSA-N 0.000 description 1
- UNPCCNLKOJYZNM-CCEZHUSRSA-N (e)-3-[3-[4-(2,2-diphenylethyl)piperazin-1-yl]sulfonylphenyl]-n-hydroxyprop-2-enamide Chemical compound ONC(=O)\C=C\C1=CC=CC(S(=O)(=O)N2CCN(CC(C=3C=CC=CC=3)C=3C=CC=CC=3)CC2)=C1 UNPCCNLKOJYZNM-CCEZHUSRSA-N 0.000 description 1
- AFQVEPXLTDWOBX-CMDGGOBGSA-N (e)-3-[3-[4-(2-chlorophenyl)piperazin-1-yl]sulfonylphenyl]-n-hydroxyprop-2-enamide Chemical compound ONC(=O)\C=C\C1=CC=CC(S(=O)(=O)N2CCN(CC2)C=2C(=CC=CC=2)Cl)=C1 AFQVEPXLTDWOBX-CMDGGOBGSA-N 0.000 description 1
- PDBOVVKJYVWGQA-CMDGGOBGSA-N (e)-3-[3-[4-(2-fluorophenyl)piperazin-1-yl]sulfonylphenyl]-n-hydroxyprop-2-enamide Chemical compound ONC(=O)\C=C\C1=CC=CC(S(=O)(=O)N2CCN(CC2)C=2C(=CC=CC=2)F)=C1 PDBOVVKJYVWGQA-CMDGGOBGSA-N 0.000 description 1
- CVYMSMDJOZHHRS-VAWYXSNFSA-N (e)-3-[3-[4-(2-naphthalen-1-yloxyethyl)piperazin-1-yl]sulfonylphenyl]prop-2-enoic acid Chemical compound OC(=O)\C=C\C1=CC=CC(S(=O)(=O)N2CCN(CCOC=3C4=CC=CC=C4C=CC=3)CC2)=C1 CVYMSMDJOZHHRS-VAWYXSNFSA-N 0.000 description 1
- SDSSNIXRTUOLGL-QPJJXVBHSA-N (e)-3-[3-[4-(3,4-dichlorophenyl)piperazin-1-yl]sulfonylphenyl]-n-hydroxyprop-2-enamide Chemical compound ONC(=O)\C=C\C1=CC=CC(S(=O)(=O)N2CCN(CC2)C=2C=C(Cl)C(Cl)=CC=2)=C1 SDSSNIXRTUOLGL-QPJJXVBHSA-N 0.000 description 1
- CWSOCWAMOUJLOD-BQYQJAHWSA-N (e)-3-[3-[4-(3-chlorophenyl)piperazin-1-yl]sulfonylphenyl]-n-hydroxyprop-2-enamide Chemical compound ONC(=O)\C=C\C1=CC=CC(S(=O)(=O)N2CCN(CC2)C=2C=C(Cl)C=CC=2)=C1 CWSOCWAMOUJLOD-BQYQJAHWSA-N 0.000 description 1
- ATHKHCYLAVTBPK-RUDMXATFSA-N (e)-3-[3-[4-(4-chlorophenyl)piperazin-1-yl]sulfonylphenyl]-n-hydroxyprop-2-enamide Chemical compound ONC(=O)\C=C\C1=CC=CC(S(=O)(=O)N2CCN(CC2)C=2C=CC(Cl)=CC=2)=C1 ATHKHCYLAVTBPK-RUDMXATFSA-N 0.000 description 1
- QGHHGESBNPZUDR-DHZHZOJOSA-N (e)-3-[3-[4-[2-[4-(dimethylamino)phenyl]ethyl]piperazin-1-yl]sulfonylphenyl]-n-hydroxyprop-2-enamide Chemical compound C1=CC(N(C)C)=CC=C1CCN1CCN(S(=O)(=O)C=2C=C(\C=C\C(=O)NO)C=CC=2)CC1 QGHHGESBNPZUDR-DHZHZOJOSA-N 0.000 description 1
- KLAZDUIONOEVFN-BJMVGYQFSA-N (e)-3-[3-[4-[4-(1-chloroethenyl)phenyl]piperazin-1-yl]sulfonylphenyl]-n-hydroxyprop-2-enamide Chemical compound ONC(=O)\C=C\C1=CC=CC(S(=O)(=O)N2CCN(CC2)C=2C=CC(=CC=2)C(Cl)=C)=C1 KLAZDUIONOEVFN-BJMVGYQFSA-N 0.000 description 1
- RZOHJJYMTRTQIW-YIXHJXPBSA-N (e)-3-[3-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]sulfonylphenyl]-n-hydroxyprop-2-enamide Chemical compound ONC(=O)\C=C\C1=CC=CC(S(=O)(=O)N2CCN(CC2)C(C=2C=CC(F)=CC=2)C=2C=CC(F)=CC=2)=C1 RZOHJJYMTRTQIW-YIXHJXPBSA-N 0.000 description 1
- JISVTBKJTHDBHA-JXMROGBWSA-N (e)-3-[4-[4-(2-fluorophenyl)piperazin-1-yl]sulfonylphenyl]-n-hydroxyprop-2-enamide Chemical compound C1=CC(/C=C/C(=O)NO)=CC=C1S(=O)(=O)N1CCN(C=2C(=CC=CC=2)F)CC1 JISVTBKJTHDBHA-JXMROGBWSA-N 0.000 description 1
- SNMCGLLJFKECDB-LZWSPWQCSA-N (e)-3-[4-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]sulfonylphenyl]-n-hydroxyprop-2-enamide Chemical compound C1=CC(/C=C/C(=O)NO)=CC=C1S(=O)(=O)N1CCN(C(C=2C=CC(F)=CC=2)C=2C=CC(F)=CC=2)CC1 SNMCGLLJFKECDB-LZWSPWQCSA-N 0.000 description 1
- ZGYIXVSQHOKQRZ-COIATFDQSA-N (e)-n-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-3-cyano-7-[(3s)-oxolan-3-yl]oxyquinolin-6-yl]-4-(dimethylamino)but-2-enamide Chemical compound N#CC1=CN=C2C=C(O[C@@H]3COCC3)C(NC(=O)/C=C/CN(C)C)=CC2=C1NC(C=C1Cl)=CC=C1OCC1=CC=CC=N1 ZGYIXVSQHOKQRZ-COIATFDQSA-N 0.000 description 1
- CBKGZQAVXZQSHA-MDZDMXLPSA-N (e)-n-hydroxy-3-[3-(4-phenylpiperazin-1-yl)sulfonylphenyl]prop-2-enamide Chemical compound ONC(=O)\C=C\C1=CC=CC(S(=O)(=O)N2CCN(CC2)C=2C=CC=CC=2)=C1 CBKGZQAVXZQSHA-MDZDMXLPSA-N 0.000 description 1
- DLMFHCAVVCMQKD-BQYQJAHWSA-N (e)-n-hydroxy-3-[3-(4-pyridin-2-ylpiperazin-1-yl)sulfonylphenyl]prop-2-enamide Chemical compound ONC(=O)\C=C\C1=CC=CC(S(=O)(=O)N2CCN(CC2)C=2N=CC=CC=2)=C1 DLMFHCAVVCMQKD-BQYQJAHWSA-N 0.000 description 1
- JRJZPKJIRHUYNP-AATRIKPKSA-N (e)-n-hydroxy-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)sulfonylphenyl]prop-2-enamide Chemical compound ONC(=O)\C=C\C1=CC=CC(S(=O)(=O)N2CCN(CC2)C=2N=CC=CN=2)=C1 JRJZPKJIRHUYNP-AATRIKPKSA-N 0.000 description 1
- VTTLBYALWITSMM-DHZHZOJOSA-N (e)-n-hydroxy-3-[3-[3-methyl-4-(4-methylphenyl)piperazin-1-yl]sulfonylphenyl]prop-2-enamide Chemical compound CC1CN(S(=O)(=O)C=2C=C(\C=C\C(=O)NO)C=CC=2)CCN1C1=CC=C(C)C=C1 VTTLBYALWITSMM-DHZHZOJOSA-N 0.000 description 1
- ZGAUTSMGIROLQJ-MDZDMXLPSA-N (e)-n-hydroxy-3-[3-[4-(2-methoxyphenyl)piperazin-1-yl]sulfonylphenyl]prop-2-enamide Chemical compound COC1=CC=CC=C1N1CCN(S(=O)(=O)C=2C=C(\C=C\C(=O)NO)C=CC=2)CC1 ZGAUTSMGIROLQJ-MDZDMXLPSA-N 0.000 description 1
- QYCHIJSIUHOAKS-VAWYXSNFSA-N (e)-n-hydroxy-3-[3-[4-(2-naphthalen-1-yloxyethyl)piperazin-1-yl]sulfonylphenyl]prop-2-enamide Chemical compound ONC(=O)\C=C\C1=CC=CC(S(=O)(=O)N2CCN(CCOC=3C4=CC=CC=C4C=CC=3)CC2)=C1 QYCHIJSIUHOAKS-VAWYXSNFSA-N 0.000 description 1
- AHHQCAPUXYPYQC-PKNBQFBNSA-N (e)-n-hydroxy-3-[3-[4-(2-naphthalen-2-ylethyl)piperazin-1-yl]sulfonylphenyl]prop-2-enamide Chemical compound ONC(=O)\C=C\C1=CC=CC(S(=O)(=O)N2CCN(CCC=3C=C4C=CC=CC4=CC=3)CC2)=C1 AHHQCAPUXYPYQC-PKNBQFBNSA-N 0.000 description 1
- HENWDHFNNWWGGO-CMDGGOBGSA-N (e)-n-hydroxy-3-[3-[4-(3-methoxyphenyl)piperazin-1-yl]sulfonylphenyl]prop-2-enamide Chemical compound COC1=CC=CC(N2CCN(CC2)S(=O)(=O)C=2C=C(\C=C\C(=O)NO)C=CC=2)=C1 HENWDHFNNWWGGO-CMDGGOBGSA-N 0.000 description 1
- QRZLPNQXTVQKLA-BQYQJAHWSA-N (e)-n-hydroxy-3-[3-[4-(3-nitrophenyl)piperazin-1-yl]sulfonylphenyl]prop-2-enamide Chemical compound ONC(=O)\C=C\C1=CC=CC(S(=O)(=O)N2CCN(CC2)C=2C=C(C=CC=2)[N+]([O-])=O)=C1 QRZLPNQXTVQKLA-BQYQJAHWSA-N 0.000 description 1
- UPIWQKZYNWDFBS-BJMVGYQFSA-N (e)-n-hydroxy-3-[3-[4-(4-methoxyphenyl)piperazin-1-yl]sulfonylphenyl]prop-2-enamide Chemical compound C1=CC(OC)=CC=C1N1CCN(S(=O)(=O)C=2C=C(\C=C\C(=O)NO)C=CC=2)CC1 UPIWQKZYNWDFBS-BJMVGYQFSA-N 0.000 description 1
- GSKKOJSJLXJARP-LCXVDEDSSA-N (e)-n-hydroxy-3-[3-[4-[(e)-3-phenylprop-2-enyl]piperazin-1-yl]sulfonylphenyl]prop-2-enamide Chemical compound ONC(=O)\C=C\C1=CC=CC(S(=O)(=O)N2CCN(C\C=C\C=3C=CC=CC=3)CC2)=C1 GSKKOJSJLXJARP-LCXVDEDSSA-N 0.000 description 1
- RHDBKOFBYHZAOO-BQYQJAHWSA-N (e)-n-hydroxy-3-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]sulfonylphenyl]prop-2-enamide Chemical compound ONC(=O)\C=C\C1=CC=CC(S(=O)(=O)N2CCN(CC2)C=2C=C(C=CC=2)C(F)(F)F)=C1 RHDBKOFBYHZAOO-BQYQJAHWSA-N 0.000 description 1
- DUBPEJVIWMGDFC-DHZHZOJOSA-N (e)-n-hydroxy-3-[4-[4-(2-methoxyphenyl)piperazin-1-yl]sulfonylphenyl]prop-2-enamide Chemical compound COC1=CC=CC=C1N1CCN(S(=O)(=O)C=2C=CC(\C=C\C(=O)NO)=CC=2)CC1 DUBPEJVIWMGDFC-DHZHZOJOSA-N 0.000 description 1
- IUFGAYOCGWMBJD-JXMROGBWSA-N (e)-n-hydroxy-3-[4-[4-(3-methoxyphenyl)piperazin-1-yl]sulfonylphenyl]prop-2-enamide Chemical compound COC1=CC=CC(N2CCN(CC2)S(=O)(=O)C=2C=CC(\C=C\C(=O)NO)=CC=2)=C1 IUFGAYOCGWMBJD-JXMROGBWSA-N 0.000 description 1
- FWEVNZOWMLLFGT-RMKNXTFCSA-N (e)-n-hydroxy-3-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]sulfonylphenyl]prop-2-enamide Chemical compound C1=CC(/C=C/C(=O)NO)=CC=C1S(=O)(=O)N1CCN(C=2C=C(C=CC=2)C(F)(F)F)CC1 FWEVNZOWMLLFGT-RMKNXTFCSA-N 0.000 description 1
- MOWXJLUYGFNTAL-DEOSSOPVSA-N (s)-[2-chloro-4-fluoro-5-(7-morpholin-4-ylquinazolin-4-yl)phenyl]-(6-methoxypyridazin-3-yl)methanol Chemical compound N1=NC(OC)=CC=C1[C@@H](O)C1=CC(C=2C3=CC=C(C=C3N=CN=2)N2CCOCC2)=C(F)C=C1Cl MOWXJLUYGFNTAL-DEOSSOPVSA-N 0.000 description 1
- WBYWAXJHAXSJNI-VOTSOKGWSA-M .beta-Phenylacrylic acid Natural products [O-]C(=O)\C=C\C1=CC=CC=C1 WBYWAXJHAXSJNI-VOTSOKGWSA-M 0.000 description 1
- FNQJDLTXOVEEFB-UHFFFAOYSA-N 1,2,3-benzothiadiazole Chemical compound C1=CC=C2SN=NC2=C1 FNQJDLTXOVEEFB-UHFFFAOYSA-N 0.000 description 1
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical compound C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 description 1
- QMMJWQMCMRUYTG-UHFFFAOYSA-N 1,2,4,5-tetrachloro-3-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=C(Cl)C(Cl)=CC(Cl)=C1Cl QMMJWQMCMRUYTG-UHFFFAOYSA-N 0.000 description 1
- KTZQTRPPVKQPFO-UHFFFAOYSA-N 1,2-benzoxazole Chemical compound C1=CC=C2C=NOC2=C1 KTZQTRPPVKQPFO-UHFFFAOYSA-N 0.000 description 1
- RFHNRBUNYAPJAE-UHFFFAOYSA-N 1,2-dihydropyrazol-3-one;pyrazol-3-one Chemical compound O=C1C=CN=N1.O=C1C=CNN1 RFHNRBUNYAPJAE-UHFFFAOYSA-N 0.000 description 1
- CIISBYKBBMFLEZ-UHFFFAOYSA-N 1,2-oxazolidine Chemical compound C1CNOC1 CIISBYKBBMFLEZ-UHFFFAOYSA-N 0.000 description 1
- JLHMJWHSBYZWJJ-UHFFFAOYSA-N 1,2-thiazole 1-oxide Chemical compound O=S1C=CC=N1 JLHMJWHSBYZWJJ-UHFFFAOYSA-N 0.000 description 1
- BGJSXRVXTHVRSN-UHFFFAOYSA-N 1,3,5-trioxane Chemical compound C1OCOCO1 BGJSXRVXTHVRSN-UHFFFAOYSA-N 0.000 description 1
- FTNJQNQLEGKTGD-UHFFFAOYSA-N 1,3-benzodioxole Chemical compound C1=CC=C2OCOC2=C1 FTNJQNQLEGKTGD-UHFFFAOYSA-N 0.000 description 1
- BCMCBBGGLRIHSE-UHFFFAOYSA-N 1,3-benzoxazole Chemical compound C1=CC=C2OC=NC2=C1 BCMCBBGGLRIHSE-UHFFFAOYSA-N 0.000 description 1
- WNXJIVFYUVYPPR-UHFFFAOYSA-N 1,3-dioxolane Chemical compound C1COCO1 WNXJIVFYUVYPPR-UHFFFAOYSA-N 0.000 description 1
- IHDKBHLTKNUCCW-UHFFFAOYSA-N 1,3-thiazole 1-oxide Chemical compound O=S1C=CN=C1 IHDKBHLTKNUCCW-UHFFFAOYSA-N 0.000 description 1
- OGYGFUAIIOPWQD-UHFFFAOYSA-N 1,3-thiazolidine Chemical compound C1CSCN1 OGYGFUAIIOPWQD-UHFFFAOYSA-N 0.000 description 1
- YNGDWRXWKFWCJY-UHFFFAOYSA-N 1,4-Dihydropyridine Chemical compound C1C=CNC=C1 YNGDWRXWKFWCJY-UHFFFAOYSA-N 0.000 description 1
- VMLKTERJLVWEJJ-UHFFFAOYSA-N 1,5-naphthyridine Chemical compound C1=CC=NC2=CC=CN=C21 VMLKTERJLVWEJJ-UHFFFAOYSA-N 0.000 description 1
- FLBAYUMRQUHISI-UHFFFAOYSA-N 1,8-naphthyridine Chemical compound N1=CC=CC2=CC=CN=C21 FLBAYUMRQUHISI-UHFFFAOYSA-N 0.000 description 1
- APWRZPQBPCAXFP-UHFFFAOYSA-N 1-(1-oxo-2H-isoquinolin-5-yl)-5-(trifluoromethyl)-N-[2-(trifluoromethyl)pyridin-4-yl]pyrazole-4-carboxamide Chemical compound O=C1NC=CC2=C(C=CC=C12)N1N=CC(=C1C(F)(F)F)C(=O)NC1=CC(=NC=C1)C(F)(F)F APWRZPQBPCAXFP-UHFFFAOYSA-N 0.000 description 1
- GUTWDZXWTKMXPI-UHFFFAOYSA-N 1-(2-chlorophenyl)piperazin-4-ium;chloride Chemical compound Cl.ClC1=CC=CC=C1N1CCNCC1 GUTWDZXWTKMXPI-UHFFFAOYSA-N 0.000 description 1
- OHELUTBQEZLZQB-UHFFFAOYSA-N 1-(2-naphthalen-1-yloxyethyl)piperazine Chemical compound C=1C=CC2=CC=CC=C2C=1OCCN1CCNCC1 OHELUTBQEZLZQB-UHFFFAOYSA-N 0.000 description 1
- KPXVKKBJROCIJB-UHFFFAOYSA-N 1-(4-piperazin-1-ylphenyl)ethanone Chemical compound C1=CC(C(=O)C)=CC=C1N1CCNCC1 KPXVKKBJROCIJB-UHFFFAOYSA-N 0.000 description 1
- ZUUTVNALBPGIMJ-UHFFFAOYSA-N 1-(piperidine-1-carbonyl)pyrrolidine-2,5-dione Chemical class C1CCCCN1C(=O)N1C(=O)CCC1=O ZUUTVNALBPGIMJ-UHFFFAOYSA-N 0.000 description 1
- TUSDEZXZIZRFGC-UHFFFAOYSA-N 1-O-galloyl-3,6-(R)-HHDP-beta-D-glucose Natural products OC1C(O2)COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC1C(O)C2OC(=O)C1=CC(O)=C(O)C(O)=C1 TUSDEZXZIZRFGC-UHFFFAOYSA-N 0.000 description 1
- ABDDQTDRAHXHOC-QMMMGPOBSA-N 1-[(7s)-5,7-dihydro-4h-thieno[2,3-c]pyran-7-yl]-n-methylmethanamine Chemical compound CNC[C@@H]1OCCC2=C1SC=C2 ABDDQTDRAHXHOC-QMMMGPOBSA-N 0.000 description 1
- TTXIFFYPVGWLSE-UHFFFAOYSA-N 1-[bis(4-fluorophenyl)methyl]piperazine Chemical compound C1=CC(F)=CC=C1C(C=1C=CC(F)=CC=1)N1CCNCC1 TTXIFFYPVGWLSE-UHFFFAOYSA-N 0.000 description 1
- JOPVWOSAQDKQJQ-UHFFFAOYSA-N 1-ethoxy-n,n-dimethyl-4-piperazin-1-ylcyclohexa-2,4-dien-1-amine Chemical compound C1=CC(OCC)(N(C)C)CC=C1N1CCNCC1 JOPVWOSAQDKQJQ-UHFFFAOYSA-N 0.000 description 1
- GHRYSOFWKRRLMI-UHFFFAOYSA-N 1-naphthyloxyacetic acid Chemical compound C1=CC=C2C(OCC(=O)O)=CC=CC2=C1 GHRYSOFWKRRLMI-UHFFFAOYSA-N 0.000 description 1
- 125000006017 1-propenyl group Chemical group 0.000 description 1
- XHLHPRDBBAGVEG-UHFFFAOYSA-N 1-tetralone Chemical compound C1=CC=C2C(=O)CCCC2=C1 XHLHPRDBBAGVEG-UHFFFAOYSA-N 0.000 description 1
- WJFKNYWRSNBZNX-UHFFFAOYSA-N 10H-phenothiazine Chemical compound C1=CC=C2NC3=CC=CC=C3SC2=C1 WJFKNYWRSNBZNX-UHFFFAOYSA-N 0.000 description 1
- TZMSYXZUNZXBOL-UHFFFAOYSA-N 10H-phenoxazine Chemical compound C1=CC=C2NC3=CC=CC=C3OC2=C1 TZMSYXZUNZXBOL-UHFFFAOYSA-N 0.000 description 1
- NDVAMUMVOJRAJV-UHFFFAOYSA-N 10h-phenanthren-9-one Chemical compound C1=CC=C2C(=O)CC3=CC=CC=C3C2=C1 NDVAMUMVOJRAJV-UHFFFAOYSA-N 0.000 description 1
- LGEZTMRIZWCDLW-UHFFFAOYSA-N 14-methylpentadecyl octadecanoate Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCCCCCCCCCCCCCC(C)C LGEZTMRIZWCDLW-UHFFFAOYSA-N 0.000 description 1
- BAXOFTOLAUCFNW-UHFFFAOYSA-N 1H-indazole Chemical compound C1=CC=C2C=NNC2=C1 BAXOFTOLAUCFNW-UHFFFAOYSA-N 0.000 description 1
- MFJCPDOGFAYSTF-UHFFFAOYSA-N 1H-isochromene Chemical compound C1=CC=C2COC=CC2=C1 MFJCPDOGFAYSTF-UHFFFAOYSA-N 0.000 description 1
- AAQTWLBJPNLKHT-UHFFFAOYSA-N 1H-perimidine Chemical compound N1C=NC2=CC=CC3=CC=CC1=C32 AAQTWLBJPNLKHT-UHFFFAOYSA-N 0.000 description 1
- IEMAOEFPZAIMCN-UHFFFAOYSA-N 1H-pyrazole Chemical compound C=1C=NNC=1.C=1C=NNC=1 IEMAOEFPZAIMCN-UHFFFAOYSA-N 0.000 description 1
- MREIFUWKYMNYTK-UHFFFAOYSA-N 1H-pyrrole Chemical compound C=1C=CNC=1.C=1C=CNC=1 MREIFUWKYMNYTK-UHFFFAOYSA-N 0.000 description 1
- HUEXNHSMABCRTH-UHFFFAOYSA-N 1h-imidazole Chemical compound C1=CNC=N1.C1=CNC=N1 HUEXNHSMABCRTH-UHFFFAOYSA-N 0.000 description 1
- FBXWDVALKBNEJV-UHFFFAOYSA-N 1h-indol-3-yl(piperazin-1-yl)methanone Chemical compound C=1NC2=CC=CC=C2C=1C(=O)N1CCNCC1 FBXWDVALKBNEJV-UHFFFAOYSA-N 0.000 description 1
- AAILEWXSEQLMNI-UHFFFAOYSA-N 1h-pyridazin-6-one Chemical compound OC1=CC=CN=N1 AAILEWXSEQLMNI-UHFFFAOYSA-N 0.000 description 1
- SDQJTWBNWQABLE-UHFFFAOYSA-N 1h-quinazoline-2,4-dione Chemical compound C1=CC=C2C(=O)NC(=O)NC2=C1 SDQJTWBNWQABLE-UHFFFAOYSA-N 0.000 description 1
- FJRPOHLDJUJARI-UHFFFAOYSA-N 2,3-dihydro-1,2-oxazole Chemical compound C1NOC=C1 FJRPOHLDJUJARI-UHFFFAOYSA-N 0.000 description 1
- ZABMHLDQFJHDSC-UHFFFAOYSA-N 2,3-dihydro-1,3-oxazole Chemical compound C1NC=CO1 ZABMHLDQFJHDSC-UHFFFAOYSA-N 0.000 description 1
- FLNPFFMWAPTGOT-UHFFFAOYSA-N 2,3-dihydro-1h-pyrazole Chemical compound C1NNC=C1.C1NNC=C1 FLNPFFMWAPTGOT-UHFFFAOYSA-N 0.000 description 1
- JKTCBAGSMQIFNL-UHFFFAOYSA-N 2,3-dihydrofuran Chemical compound C1CC=CO1 JKTCBAGSMQIFNL-UHFFFAOYSA-N 0.000 description 1
- GPWNWKWQOLEVEQ-UHFFFAOYSA-N 2,4-diaminopyrimidine-5-carbaldehyde Chemical compound NC1=NC=C(C=O)C(N)=N1 GPWNWKWQOLEVEQ-UHFFFAOYSA-N 0.000 description 1
- VFZQJKXVHYZXMM-UHFFFAOYSA-N 2-(1-benzothiophen-3-yl)acetic acid Chemical compound C1=CC=C2C(CC(=O)O)=CSC2=C1 VFZQJKXVHYZXMM-UHFFFAOYSA-N 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- FALRKNHUBBKYCC-UHFFFAOYSA-N 2-(chloromethyl)pyridine-3-carbonitrile Chemical compound ClCC1=NC=CC=C1C#N FALRKNHUBBKYCC-UHFFFAOYSA-N 0.000 description 1
- IZXIZTKNFFYFOF-UHFFFAOYSA-N 2-Oxazolidone Chemical compound O=C1NCCO1 IZXIZTKNFFYFOF-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- ACSRAHCPYKYBFT-UHFFFAOYSA-N 2-[4-(dimethylamino)phenyl]-1-piperazin-1-ylethanone Chemical compound C1=CC(N(C)C)=CC=C1CC(=O)N1CCNCC1 ACSRAHCPYKYBFT-UHFFFAOYSA-N 0.000 description 1
- KQGHTOZUPICELS-UHFFFAOYSA-N 2-[4-(dimethylamino)phenyl]acetic acid Chemical compound CN(C)C1=CC=C(CC(O)=O)C=C1 KQGHTOZUPICELS-UHFFFAOYSA-N 0.000 description 1
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 description 1
- UXGVMFHEKMGWMA-UHFFFAOYSA-N 2-benzofuran Chemical compound C1=CC=CC2=COC=C21 UXGVMFHEKMGWMA-UHFFFAOYSA-N 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- SFAAOBGYWOUHLU-UHFFFAOYSA-N 2-ethylhexyl hexadecanoate Chemical compound CCCCCCCCCCCCCCCC(=O)OCC(CC)CCCC SFAAOBGYWOUHLU-UHFFFAOYSA-N 0.000 description 1
- UPHOPMSGKZNELG-UHFFFAOYSA-N 2-hydroxynaphthalene-1-carboxylic acid Chemical compound C1=CC=C2C(C(=O)O)=C(O)C=CC2=C1 UPHOPMSGKZNELG-UHFFFAOYSA-N 0.000 description 1
- 229940080296 2-naphthalenesulfonate Drugs 0.000 description 1
- UOBYKYZJUGYBDK-UHFFFAOYSA-N 2-naphthoic acid Chemical compound C1=CC=CC2=CC(C(=O)O)=CC=C21 UOBYKYZJUGYBDK-UHFFFAOYSA-N 0.000 description 1
- RZCJYMOBWVJQGV-UHFFFAOYSA-N 2-naphthyloxyacetic acid Chemical compound C1=CC=CC2=CC(OCC(=O)O)=CC=C21 RZCJYMOBWVJQGV-UHFFFAOYSA-N 0.000 description 1
- LGDKJMXNVIFAHE-UHFFFAOYSA-N 2-oxodecanal Chemical compound CCCCCCCCC(=O)C=O LGDKJMXNVIFAHE-UHFFFAOYSA-N 0.000 description 1
- VSWICNJIUPRZIK-UHFFFAOYSA-N 2-piperideine Chemical compound C1CNC=CC1 VSWICNJIUPRZIK-UHFFFAOYSA-N 0.000 description 1
- RSEBUVRVKCANEP-UHFFFAOYSA-N 2-pyrroline Chemical compound C1CC=CN1 RSEBUVRVKCANEP-UHFFFAOYSA-N 0.000 description 1
- BQTJMKIHKULPCZ-UHFFFAOYSA-N 2H-indene Chemical compound C1=CC=CC2=CCC=C21 BQTJMKIHKULPCZ-UHFFFAOYSA-N 0.000 description 1
- VHMICKWLTGFITH-UHFFFAOYSA-N 2H-isoindole Chemical compound C1=CC=CC2=CNC=C21 VHMICKWLTGFITH-UHFFFAOYSA-N 0.000 description 1
- MGADZUXDNSDTHW-UHFFFAOYSA-N 2H-pyran Chemical compound C1OC=CC=C1 MGADZUXDNSDTHW-UHFFFAOYSA-N 0.000 description 1
- ZPSJGADGUYYRKE-UHFFFAOYSA-N 2H-pyran-2-one Chemical compound O=C1C=CC=CO1 ZPSJGADGUYYRKE-UHFFFAOYSA-N 0.000 description 1
- CMLFRMDBDNHMRA-UHFFFAOYSA-N 2h-1,2-benzoxazine Chemical compound C1=CC=C2C=CNOC2=C1 CMLFRMDBDNHMRA-UHFFFAOYSA-N 0.000 description 1
- QMEQBOSUJUOXMX-UHFFFAOYSA-N 2h-oxadiazine Chemical compound N1OC=CC=N1 QMEQBOSUJUOXMX-UHFFFAOYSA-N 0.000 description 1
- BCHZICNRHXRCHY-UHFFFAOYSA-N 2h-oxazine Chemical compound N1OC=CC=C1 BCHZICNRHXRCHY-UHFFFAOYSA-N 0.000 description 1
- BOLMDIXLULGTBD-UHFFFAOYSA-N 3,4-dihydro-2h-oxazine Chemical compound C1CC=CON1 BOLMDIXLULGTBD-UHFFFAOYSA-N 0.000 description 1
- GOLORTLGFDVFDW-UHFFFAOYSA-N 3-(1h-benzimidazol-2-yl)-7-(diethylamino)chromen-2-one Chemical compound C1=CC=C2NC(C3=CC4=CC=C(C=C4OC3=O)N(CC)CC)=NC2=C1 GOLORTLGFDVFDW-UHFFFAOYSA-N 0.000 description 1
- HCDMJFOHIXMBOV-UHFFFAOYSA-N 3-(2,6-difluoro-3,5-dimethoxyphenyl)-1-ethyl-8-(morpholin-4-ylmethyl)-4,7-dihydropyrrolo[4,5]pyrido[1,2-d]pyrimidin-2-one Chemical compound C=1C2=C3N(CC)C(=O)N(C=4C(=C(OC)C=C(OC)C=4F)F)CC3=CN=C2NC=1CN1CCOCC1 HCDMJFOHIXMBOV-UHFFFAOYSA-N 0.000 description 1
- BYHQTRFJOGIQAO-GOSISDBHSA-N 3-(4-bromophenyl)-8-[(2R)-2-hydroxypropyl]-1-[(3-methoxyphenyl)methyl]-1,3,8-triazaspiro[4.5]decan-2-one Chemical compound C[C@H](CN1CCC2(CC1)CN(C(=O)N2CC3=CC(=CC=C3)OC)C4=CC=C(C=C4)Br)O BYHQTRFJOGIQAO-GOSISDBHSA-N 0.000 description 1
- WNEODWDFDXWOLU-QHCPKHFHSA-N 3-[3-(hydroxymethyl)-4-[1-methyl-5-[[5-[(2s)-2-methyl-4-(oxetan-3-yl)piperazin-1-yl]pyridin-2-yl]amino]-6-oxopyridin-3-yl]pyridin-2-yl]-7,7-dimethyl-1,2,6,8-tetrahydrocyclopenta[3,4]pyrrolo[3,5-b]pyrazin-4-one Chemical compound C([C@@H](N(CC1)C=2C=NC(NC=3C(N(C)C=C(C=3)C=3C(=C(N4C(C5=CC=6CC(C)(C)CC=6N5CC4)=O)N=CC=3)CO)=O)=CC=2)C)N1C1COC1 WNEODWDFDXWOLU-QHCPKHFHSA-N 0.000 description 1
- SRVXSISGYBMIHR-UHFFFAOYSA-N 3-[3-[3-(2-amino-2-oxoethyl)phenyl]-5-chlorophenyl]-3-(5-methyl-1,3-thiazol-2-yl)propanoic acid Chemical compound S1C(C)=CN=C1C(CC(O)=O)C1=CC(Cl)=CC(C=2C=C(CC(N)=O)C=CC=2)=C1 SRVXSISGYBMIHR-UHFFFAOYSA-N 0.000 description 1
- BYBPZYSCYQLVAE-UHFFFAOYSA-N 3-[4-[4-(3-chlorophenyl)piperazin-1-yl]sulfonylphenyl]-n-hydroxyprop-2-enamide Chemical compound C1=CC(C=CC(=O)NO)=CC=C1S(=O)(=O)N1CCN(C=2C=C(Cl)C=CC=2)CC1 BYBPZYSCYQLVAE-UHFFFAOYSA-N 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- VXIKDBJPBRMXBP-UHFFFAOYSA-N 3H-pyrrole Chemical compound C1C=CN=C1 VXIKDBJPBRMXBP-UHFFFAOYSA-N 0.000 description 1
- WFFZGYRTVIPBFN-UHFFFAOYSA-N 3h-indene-1,2-dione Chemical compound C1=CC=C2C(=O)C(=O)CC2=C1 WFFZGYRTVIPBFN-UHFFFAOYSA-N 0.000 description 1
- RELAJOWOFXGXHI-UHFFFAOYSA-N 3h-oxathiole Chemical compound C1SOC=C1 RELAJOWOFXGXHI-UHFFFAOYSA-N 0.000 description 1
- ZBWXZZIIMVVCNZ-UHFFFAOYSA-N 4,5-dihydroacephenanthrylene Chemical compound C1=CC(CC2)=C3C2=CC2=CC=CC=C2C3=C1 ZBWXZZIIMVVCNZ-UHFFFAOYSA-N 0.000 description 1
- YDIYEOMDOWUDTJ-UHFFFAOYSA-N 4-(dimethylamino)benzoic acid Chemical compound CN(C)C1=CC=C(C(O)=O)C=C1 YDIYEOMDOWUDTJ-UHFFFAOYSA-N 0.000 description 1
- YFCIFWOJYYFDQP-PTWZRHHISA-N 4-[3-amino-6-[(1S,3S,4S)-3-fluoro-4-hydroxycyclohexyl]pyrazin-2-yl]-N-[(1S)-1-(3-bromo-5-fluorophenyl)-2-(methylamino)ethyl]-2-fluorobenzamide Chemical compound CNC[C@@H](NC(=O)c1ccc(cc1F)-c1nc(cnc1N)[C@H]1CC[C@H](O)[C@@H](F)C1)c1cc(F)cc(Br)c1 YFCIFWOJYYFDQP-PTWZRHHISA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- KVCQTKNUUQOELD-UHFFFAOYSA-N 4-amino-n-[1-(3-chloro-2-fluoroanilino)-6-methylisoquinolin-5-yl]thieno[3,2-d]pyrimidine-7-carboxamide Chemical compound N=1C=CC2=C(NC(=O)C=3C4=NC=NC(N)=C4SC=3)C(C)=CC=C2C=1NC1=CC=CC(Cl)=C1F KVCQTKNUUQOELD-UHFFFAOYSA-N 0.000 description 1
- ADCUEPOHPCPMCE-UHFFFAOYSA-N 4-cyanobenzoic acid Chemical compound OC(=O)C1=CC=C(C#N)C=C1 ADCUEPOHPCPMCE-UHFFFAOYSA-N 0.000 description 1
- MBVFRSJFKMJRHA-UHFFFAOYSA-N 4-fluoro-1-benzofuran-7-carbaldehyde Chemical compound FC1=CC=C(C=O)C2=C1C=CO2 MBVFRSJFKMJRHA-UHFFFAOYSA-N 0.000 description 1
- HIQIXEFWDLTDED-UHFFFAOYSA-N 4-hydroxy-1-piperidin-4-ylpyrrolidin-2-one Chemical compound O=C1CC(O)CN1C1CCNCC1 HIQIXEFWDLTDED-UHFFFAOYSA-N 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- UQRONKZLYKUEMO-UHFFFAOYSA-N 4-methyl-1-(2,4,6-trimethylphenyl)pent-4-en-2-one Chemical group CC(=C)CC(=O)Cc1c(C)cc(C)cc1C UQRONKZLYKUEMO-UHFFFAOYSA-N 0.000 description 1
- 125000006418 4-methylphenylsulfonyl group Chemical group 0.000 description 1
- OBKXEAXTFZPCHS-UHFFFAOYSA-N 4-phenylbutyric acid Chemical compound OC(=O)CCCC1=CC=CC=C1 OBKXEAXTFZPCHS-UHFFFAOYSA-N 0.000 description 1
- GDRVFDDBLLKWRI-UHFFFAOYSA-N 4H-quinolizine Chemical compound C1=CC=CN2CC=CC=C21 GDRVFDDBLLKWRI-UHFFFAOYSA-N 0.000 description 1
- BBEQQKBWUHCIOU-UHFFFAOYSA-N 5-(dimethylamino)-1-naphthalenesulfonic acid(dansyl acid) Chemical compound C1=CC=C2C(N(C)C)=CC=CC2=C1S(O)(=O)=O BBEQQKBWUHCIOU-UHFFFAOYSA-N 0.000 description 1
- IRPVABHDSJVBNZ-RTHVDDQRSA-N 5-[1-(cyclopropylmethyl)-5-[(1R,5S)-3-(oxetan-3-yl)-3-azabicyclo[3.1.0]hexan-6-yl]pyrazol-3-yl]-3-(trifluoromethyl)pyridin-2-amine Chemical compound C1=C(C(F)(F)F)C(N)=NC=C1C1=NN(CC2CC2)C(C2[C@@H]3CN(C[C@@H]32)C2COC2)=C1 IRPVABHDSJVBNZ-RTHVDDQRSA-N 0.000 description 1
- COCNDHOPIHDTHK-UHFFFAOYSA-N 5-methoxyindole-3-acetic acid Chemical compound COC1=CC=C2NC=C(CC(O)=O)C2=C1 COCNDHOPIHDTHK-UHFFFAOYSA-N 0.000 description 1
- 101710149636 50S ribosomal protein L18, chloroplastic Proteins 0.000 description 1
- KCBWAFJCKVKYHO-UHFFFAOYSA-N 6-(4-cyclopropyl-6-methoxypyrimidin-5-yl)-1-[[4-[1-propan-2-yl-4-(trifluoromethyl)imidazol-2-yl]phenyl]methyl]pyrazolo[3,4-d]pyrimidine Chemical compound C1(CC1)C1=NC=NC(=C1C1=NC=C2C(=N1)N(N=C2)CC1=CC=C(C=C1)C=1N(C=C(N=1)C(F)(F)F)C(C)C)OC KCBWAFJCKVKYHO-UHFFFAOYSA-N 0.000 description 1
- ZQGVMGUPRXIDFH-UHFFFAOYSA-N 7-(4-benzhydrylpiperazin-1-yl)-n-hydroxy-7-oxoheptanamide Chemical compound C1CN(C(=O)CCCCCC(=O)NO)CCN1C(C=1C=CC=CC=1)C1=CC=CC=C1 ZQGVMGUPRXIDFH-UHFFFAOYSA-N 0.000 description 1
- FLWNRZKDFJVJKA-UHFFFAOYSA-N 7-[4-(2-chlorophenyl)piperazin-1-yl]-n-hydroxy-7-oxoheptanamide Chemical compound C1CN(C(=O)CCCCCC(=O)NO)CCN1C1=CC=CC=C1Cl FLWNRZKDFJVJKA-UHFFFAOYSA-N 0.000 description 1
- AECLQSZYMRKGRC-UHFFFAOYSA-N 7-[4-(3,4-dichlorophenyl)piperazin-1-yl]-n-hydroxy-7-oxoheptanamide Chemical compound C1CN(C(=O)CCCCCC(=O)NO)CCN1C1=CC=C(Cl)C(Cl)=C1 AECLQSZYMRKGRC-UHFFFAOYSA-N 0.000 description 1
- VSUFXFVRDQTERY-UHFFFAOYSA-N 7-[4-(3,4-dimethylphenyl)piperazin-1-yl]-n-hydroxy-7-oxoheptanamide Chemical compound C1=C(C)C(C)=CC=C1N1CCN(C(=O)CCCCCC(=O)NO)CC1 VSUFXFVRDQTERY-UHFFFAOYSA-N 0.000 description 1
- WDNABKULSMBZNP-UHFFFAOYSA-N 7-[4-(3-chlorophenyl)piperazin-1-yl]-n-hydroxy-7-oxoheptanamide Chemical compound C1CN(C(=O)CCCCCC(=O)NO)CCN1C1=CC=CC(Cl)=C1 WDNABKULSMBZNP-UHFFFAOYSA-N 0.000 description 1
- BDLMNNJPRBOXKL-UHFFFAOYSA-N 7-[4-(4-chlorophenyl)piperazin-1-yl]-n-hydroxy-7-oxoheptanamide Chemical compound C1CN(C(=O)CCCCCC(=O)NO)CCN1C1=CC=C(Cl)C=C1 BDLMNNJPRBOXKL-UHFFFAOYSA-N 0.000 description 1
- BWVDIERVCMXHCJ-UHFFFAOYSA-N 7-[4-(4-fluorophenyl)piperazin-1-yl]-n-hydroxy-7-oxoheptanamide Chemical compound C1CN(C(=O)CCCCCC(=O)NO)CCN1C1=CC=C(F)C=C1 BWVDIERVCMXHCJ-UHFFFAOYSA-N 0.000 description 1
- 101710151806 72 kDa type IV collagenase Proteins 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- CYJRNFFLTBEQSQ-UHFFFAOYSA-N 8-(3-methyl-1-benzothiophen-5-yl)-N-(4-methylsulfonylpyridin-3-yl)quinoxalin-6-amine Chemical compound CS(=O)(=O)C1=C(C=NC=C1)NC=1C=C2N=CC=NC2=C(C=1)C=1C=CC2=C(C(=CS2)C)C=1 CYJRNFFLTBEQSQ-UHFFFAOYSA-N 0.000 description 1
- PTCVLWHFUIIVDQ-UHFFFAOYSA-N 8-(4-benzoylpiperazin-1-yl)-n-hydroxy-8-oxooctanamide Chemical compound C1CN(C(=O)CCCCCCC(=O)NO)CCN1C(=O)C1=CC=CC=C1 PTCVLWHFUIIVDQ-UHFFFAOYSA-N 0.000 description 1
- ICNAHJFOUTTWBO-UHFFFAOYSA-N 8-[4-(2,2-diphenylacetyl)piperazin-1-yl]-n-hydroxy-8-oxooctanamide Chemical compound C1CN(C(=O)CCCCCCC(=O)NO)CCN1C(=O)C(C=1C=CC=CC=1)C1=CC=CC=C1 ICNAHJFOUTTWBO-UHFFFAOYSA-N 0.000 description 1
- HHMYGERMNNADOD-UHFFFAOYSA-N 8-[4-(2,2-diphenylethyl)piperazin-1-yl]-n-hydroxy-8-oxooctanamide Chemical compound C1CN(C(=O)CCCCCCC(=O)NO)CCN1CC(C=1C=CC=CC=1)C1=CC=CC=C1 HHMYGERMNNADOD-UHFFFAOYSA-N 0.000 description 1
- CHKOEDAUEIROFT-UHFFFAOYSA-N 8-[4-(2-chlorophenyl)piperazin-1-yl]-n-hydroxy-8-oxooctanamide Chemical compound C1CN(C(=O)CCCCCCC(=O)NO)CCN1C1=CC=CC=C1Cl CHKOEDAUEIROFT-UHFFFAOYSA-N 0.000 description 1
- RJPROOIZYLSLFQ-UHFFFAOYSA-N 8-[4-(3-chlorophenyl)piperazin-1-yl]-n-hydroxy-8-oxooctanamide Chemical compound C1CN(C(=O)CCCCCCC(=O)NO)CCN1C1=CC=CC(Cl)=C1 RJPROOIZYLSLFQ-UHFFFAOYSA-N 0.000 description 1
- HKTHHZHPFRVBOC-UHFFFAOYSA-N 8-[4-(3-fluorophenyl)piperazin-1-yl]-n-hydroxy-8-oxooctanamide Chemical compound C1CN(C(=O)CCCCCCC(=O)NO)CCN1C1=CC=CC(F)=C1 HKTHHZHPFRVBOC-UHFFFAOYSA-N 0.000 description 1
- UBPURLJDDAWFIM-UHFFFAOYSA-N 8-[4-(4-acetylphenyl)piperazin-1-yl]-n-hydroxy-8-oxooctanamide;propan-2-one Chemical compound CC(C)=O.C1=CC(C(=O)C)=CC=C1N1CCN(C(=O)CCCCCCC(=O)NO)CC1 UBPURLJDDAWFIM-UHFFFAOYSA-N 0.000 description 1
- AWWHJMNDNYIDNT-UHFFFAOYSA-N 8-[4-(4-cyanobenzoyl)piperazin-1-yl]-n-hydroxy-8-oxooctanamide Chemical compound C1CN(C(=O)CCCCCCC(=O)NO)CCN1C(=O)C1=CC=C(C#N)C=C1 AWWHJMNDNYIDNT-UHFFFAOYSA-N 0.000 description 1
- WUCHQSOLNFUFKL-UHFFFAOYSA-N 8-[4-[2-(1-benzothiophen-3-yl)acetyl]piperazin-1-yl]-n-hydroxy-8-oxooctanamide Chemical compound C1CN(C(=O)CCCCCCC(=O)NO)CCN1C(=O)CC1=CSC2=CC=CC=C12 WUCHQSOLNFUFKL-UHFFFAOYSA-N 0.000 description 1
- WNNXJDUTKMYCFZ-UHFFFAOYSA-N 8-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-n-hydroxy-8-oxooctanamide Chemical compound C1CN(C(=O)CCCCCCC(=O)NO)CCN1C(C=1C=CC(F)=CC=1)C1=CC=C(F)C=C1 WNNXJDUTKMYCFZ-UHFFFAOYSA-N 0.000 description 1
- JRLTTZUODKEYDH-UHFFFAOYSA-N 8-methylquinoline Chemical group C1=CN=C2C(C)=CC=CC2=C1 JRLTTZUODKEYDH-UHFFFAOYSA-N 0.000 description 1
- PWNCMKJPKIXCJT-UHFFFAOYSA-N 8-oxo-n-phenylmethoxy-8-(4-pyrimidin-2-ylpiperazin-1-yl)octanamide Chemical compound C=1C=CC=CC=1CONC(=O)CCCCCCC(=O)N(CC1)CCN1C1=NC=CC=N1 PWNCMKJPKIXCJT-UHFFFAOYSA-N 0.000 description 1
- PQJUJGAVDBINPI-UHFFFAOYSA-N 9H-thioxanthene Chemical compound C1=CC=C2CC3=CC=CC=C3SC2=C1 PQJUJGAVDBINPI-UHFFFAOYSA-N 0.000 description 1
- GJCOSYZMQJWQCA-UHFFFAOYSA-N 9H-xanthene Chemical compound C1=CC=C2CC3=CC=CC=C3OC2=C1 GJCOSYZMQJWQCA-UHFFFAOYSA-N 0.000 description 1
- 241000238876 Acari Species 0.000 description 1
- ZSLZBFCDCINBPY-ZSJPKINUSA-N Acetyl-CoA Natural products O[C@@H]1[C@H](OP(O)(O)=O)[C@@H](COP(O)(=O)OP(O)(=O)OCC(C)(C)[C@@H](O)C(=O)NCCC(=O)NCCSC(=O)C)O[C@H]1N1C2=NC=NC(N)=C2N=C1 ZSLZBFCDCINBPY-ZSJPKINUSA-N 0.000 description 1
- 108010013043 Acetylesterase Proteins 0.000 description 1
- 239000005964 Acibenzolar-S-methyl Substances 0.000 description 1
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 1
- 241000242759 Actiniaria Species 0.000 description 1
- 102000007469 Actins Human genes 0.000 description 1
- 108010085238 Actins Proteins 0.000 description 1
- 208000036762 Acute promyelocytic leukaemia Diseases 0.000 description 1
- 206010001052 Acute respiratory distress syndrome Diseases 0.000 description 1
- GFFGJBXGBJISGV-UHFFFAOYSA-N Adenine Chemical compound NC1=NC=NC2=C1N=CN2 GFFGJBXGBJISGV-UHFFFAOYSA-N 0.000 description 1
- 229930024421 Adenine Natural products 0.000 description 1
- 206010001197 Adenocarcinoma of the cervix Diseases 0.000 description 1
- 208000034246 Adenocarcinoma of the cervix uteri Diseases 0.000 description 1
- YCIPQJTZJGUXND-UHFFFAOYSA-N Aglaia odorata Alkaloid Natural products C1=CC(OC)=CC=C1C1(C(C=2C(=O)N3CCCC3=NC=22)C=3C=CC=CC=3)C2(O)C2=C(OC)C=C(OC)C=C2O1 YCIPQJTZJGUXND-UHFFFAOYSA-N 0.000 description 1
- 244000307697 Agrimonia eupatoria Species 0.000 description 1
- 235000016626 Agrimonia eupatoria Nutrition 0.000 description 1
- 241000242757 Anthozoa Species 0.000 description 1
- 241000269350 Anura Species 0.000 description 1
- 101100123574 Arabidopsis thaliana HDA19 gene Proteins 0.000 description 1
- 241000239223 Arachnida Species 0.000 description 1
- 241000239290 Araneae Species 0.000 description 1
- 241000243812 Arenicola marina Species 0.000 description 1
- 239000004475 Arginine Substances 0.000 description 1
- 206010003210 Arteriosclerosis Diseases 0.000 description 1
- 241000258957 Asteroidea Species 0.000 description 1
- 241000972773 Aulopiformes Species 0.000 description 1
- 241000271566 Aves Species 0.000 description 1
- NOWKCMXCCJGMRR-UHFFFAOYSA-N Aziridine Chemical compound C1CN1 NOWKCMXCCJGMRR-UHFFFAOYSA-N 0.000 description 1
- 208000035143 Bacterial infection Diseases 0.000 description 1
- 241000237519 Bivalvia Species 0.000 description 1
- 206010005003 Bladder cancer Diseases 0.000 description 1
- 208000020084 Bone disease Diseases 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- 208000003174 Brain Neoplasms Diseases 0.000 description 1
- 206010006187 Breast cancer Diseases 0.000 description 1
- 208000026310 Breast neoplasm Diseases 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 241000269420 Bufonidae Species 0.000 description 1
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 1
- 239000004358 Butane-1, 3-diol Substances 0.000 description 1
- 125000006519 CCH3 Chemical group 0.000 description 1
- 101150041968 CDC13 gene Proteins 0.000 description 1
- 101100294106 Caenorhabditis elegans nhr-3 gene Proteins 0.000 description 1
- 241000282465 Canis Species 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 208000005623 Carcinogenesis Diseases 0.000 description 1
- 235000014653 Carica parviflora Nutrition 0.000 description 1
- 241000399988 Carinoma Species 0.000 description 1
- 241000700199 Cavia porcellus Species 0.000 description 1
- 206010008025 Cerebellar ataxia Diseases 0.000 description 1
- 241000242722 Cestoda Species 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 241000251730 Chondrichthyes Species 0.000 description 1
- 241000243321 Cnidaria Species 0.000 description 1
- 244000060011 Cocos nucifera Species 0.000 description 1
- 235000013162 Cocos nucifera Nutrition 0.000 description 1
- 241000254173 Coleoptera Species 0.000 description 1
- 108020004635 Complementary DNA Proteins 0.000 description 1
- 241000699800 Cricetinae Species 0.000 description 1
- 241000270722 Crocodylidae Species 0.000 description 1
- 229920002785 Croscarmellose sodium Polymers 0.000 description 1
- 241000238424 Crustacea Species 0.000 description 1
- 241000218916 Cycas Species 0.000 description 1
- BZKFMUIJRXWWQK-UHFFFAOYSA-N Cyclopentenone Chemical compound O=C1CCC=C1 BZKFMUIJRXWWQK-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-CBPJZXOFSA-N D-Gulose Chemical compound OC[C@H]1OC(O)[C@H](O)[C@H](O)[C@H]1O WQZGKKKJIJFFOK-CBPJZXOFSA-N 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- WQZGKKKJIJFFOK-WHZQZERISA-N D-aldose Chemical compound OC[C@H]1OC(O)[C@@H](O)[C@@H](O)[C@H]1O WQZGKKKJIJFFOK-WHZQZERISA-N 0.000 description 1
- WQZGKKKJIJFFOK-IVMDWMLBSA-N D-allopyranose Chemical compound OC[C@H]1OC(O)[C@H](O)[C@H](O)[C@@H]1O WQZGKKKJIJFFOK-IVMDWMLBSA-N 0.000 description 1
- HMFHBZSHGGEWLO-AGQMPKSLSA-N D-lyxofuranose Chemical compound OC[C@H]1OC(O)[C@@H](O)[C@H]1O HMFHBZSHGGEWLO-AGQMPKSLSA-N 0.000 description 1
- WQZGKKKJIJFFOK-QTVWNMPRSA-N D-mannopyranose Chemical compound OC[C@H]1OC(O)[C@@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-QTVWNMPRSA-N 0.000 description 1
- HMFHBZSHGGEWLO-SOOFDHNKSA-N D-ribofuranose Chemical compound OC[C@H]1OC(O)[C@H](O)[C@@H]1O HMFHBZSHGGEWLO-SOOFDHNKSA-N 0.000 description 1
- 241000411536 Dangond Species 0.000 description 1
- 108020005199 Dehydrogenases Proteins 0.000 description 1
- DLVJMFOLJOOWFS-UHFFFAOYSA-N Depudecin Natural products CC(O)C1OC1C=CC1C(C(O)C=C)O1 DLVJMFOLJOOWFS-UHFFFAOYSA-N 0.000 description 1
- 206010012438 Dermatitis atopic Diseases 0.000 description 1
- 206010012689 Diabetic retinopathy Diseases 0.000 description 1
- 239000004338 Dichlorodifluoromethane Substances 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical compound C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- XTAHYROJKCXMOF-UHFFFAOYSA-N Dihydroaceanthrylene Chemical compound C1=CC=C2C(CCC3=CC=C4)=C3C4=CC2=C1 XTAHYROJKCXMOF-UHFFFAOYSA-N 0.000 description 1
- BUDQDWGNQVEFAC-UHFFFAOYSA-N Dihydropyran Chemical compound C1COC=CC1 BUDQDWGNQVEFAC-UHFFFAOYSA-N 0.000 description 1
- 241000251475 Dipnoi Species 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- 239000004150 EU approved colour Substances 0.000 description 1
- 241000258955 Echinodermata Species 0.000 description 1
- 241000257465 Echinoidea Species 0.000 description 1
- 241000195955 Equisetum hyemale Species 0.000 description 1
- 241000588724 Escherichia coli Species 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- KMTRUDSVKNLOMY-UHFFFAOYSA-N Ethylene carbonate Chemical compound O=C1OCCO1 KMTRUDSVKNLOMY-UHFFFAOYSA-N 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 241000289695 Eutheria Species 0.000 description 1
- 239000001263 FEMA 3042 Substances 0.000 description 1
- 241000282324 Felis Species 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- 206010017533 Fungal infection Diseases 0.000 description 1
- 241000233866 Fungi Species 0.000 description 1
- 201000003741 Gastrointestinal carcinoma Diseases 0.000 description 1
- 206010017993 Gastrointestinal neoplasms Diseases 0.000 description 1
- 102000004878 Gelsolin Human genes 0.000 description 1
- 108090001064 Gelsolin Proteins 0.000 description 1
- 235000011201 Ginkgo Nutrition 0.000 description 1
- 244000194101 Ginkgo biloba Species 0.000 description 1
- 235000008100 Ginkgo biloba Nutrition 0.000 description 1
- 208000032612 Glial tumor Diseases 0.000 description 1
- 206010018338 Glioma Diseases 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Chemical compound OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 241000282575 Gorilla Species 0.000 description 1
- 101150083200 HDA1 gene Proteins 0.000 description 1
- 108091005772 HDAC11 Proteins 0.000 description 1
- 108700010412 HOS1 Proteins 0.000 description 1
- 101150089323 HOS1 gene Proteins 0.000 description 1
- 101150079884 HOS3 gene Proteins 0.000 description 1
- 208000006968 Helminthiasis Diseases 0.000 description 1
- 241000545744 Hirudinea Species 0.000 description 1
- 108010023981 Histone Deacetylase 2 Proteins 0.000 description 1
- 102100038885 Histone acetyltransferase p300 Human genes 0.000 description 1
- 102100039385 Histone deacetylase 11 Human genes 0.000 description 1
- 102100021454 Histone deacetylase 4 Human genes 0.000 description 1
- 102100021453 Histone deacetylase 5 Human genes 0.000 description 1
- 102100022537 Histone deacetylase 6 Human genes 0.000 description 1
- 102100038715 Histone deacetylase 8 Human genes 0.000 description 1
- 101000899259 Homo sapiens Histone deacetylase 4 Proteins 0.000 description 1
- 101000899255 Homo sapiens Histone deacetylase 5 Proteins 0.000 description 1
- 101000899330 Homo sapiens Histone deacetylase 6 Proteins 0.000 description 1
- 101001032113 Homo sapiens Histone deacetylase 7 Proteins 0.000 description 1
- 101001032092 Homo sapiens Histone deacetylase 9 Proteins 0.000 description 1
- 101001035694 Homo sapiens Polyamine deacetylase HDAC10 Proteins 0.000 description 1
- 101000964425 Homo sapiens Zinc finger and BTB domain-containing protein 16 Proteins 0.000 description 1
- 208000023105 Huntington disease Diseases 0.000 description 1
- 241001504070 Huperzia Species 0.000 description 1
- LELOWRISYMNNSU-UHFFFAOYSA-N Hydrocyanic acid Natural products N#C LELOWRISYMNNSU-UHFFFAOYSA-N 0.000 description 1
- 241000282620 Hylobates sp. Species 0.000 description 1
- 241000235789 Hyperoartia Species 0.000 description 1
- 206010020751 Hypersensitivity Diseases 0.000 description 1
- WQZGKKKJIJFFOK-YIDFTEPTSA-N IDOSE Chemical compound OC[C@H]1OC(O)[C@@H](O)[C@H](O)[C@H]1O WQZGKKKJIJFFOK-YIDFTEPTSA-N 0.000 description 1
- WRYCSMQKUKOKBP-UHFFFAOYSA-N Imidazolidine Chemical compound C1CNCN1 WRYCSMQKUKOKBP-UHFFFAOYSA-N 0.000 description 1
- 238000012404 In vitro experiment Methods 0.000 description 1
- 208000022559 Inflammatory bowel disease Diseases 0.000 description 1
- 102100020873 Interleukin-2 Human genes 0.000 description 1
- 108010002350 Interleukin-2 Proteins 0.000 description 1
- 239000007836 KH2PO4 Substances 0.000 description 1
- 208000007766 Kaposi sarcoma Diseases 0.000 description 1
- 208000008839 Kidney Neoplasms Diseases 0.000 description 1
- WQZGKKKJIJFFOK-VSOAQEOCSA-N L-altropyranose Chemical compound OC[C@@H]1OC(O)[C@H](O)[C@@H](O)[C@H]1O WQZGKKKJIJFFOK-VSOAQEOCSA-N 0.000 description 1
- HMFHBZSHGGEWLO-HWQSCIPKSA-N L-arabinofuranose Chemical compound OC[C@@H]1OC(O)[C@H](O)[C@H]1O HMFHBZSHGGEWLO-HWQSCIPKSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 241000283953 Lagomorpha Species 0.000 description 1
- 241000255777 Lepidoptera Species 0.000 description 1
- 241000209510 Liliopsida Species 0.000 description 1
- 108091036060 Linker DNA Proteins 0.000 description 1
- 229940124761 MMP inhibitor Drugs 0.000 description 1
- 241000289581 Macropus sp. Species 0.000 description 1
- 241000218922 Magnoliophyta Species 0.000 description 1
- PEEHTFAAVSWFBL-UHFFFAOYSA-N Maleimide Chemical compound O=C1NC(=O)C=C1 PEEHTFAAVSWFBL-UHFFFAOYSA-N 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- 108010076503 Matrix Metalloproteinase 13 Proteins 0.000 description 1
- 206010027476 Metastases Diseases 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-M Methanesulfonate Chemical compound CS([O-])(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-M 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 1
- 241000237852 Mollusca Species 0.000 description 1
- 241000289390 Monotremata Species 0.000 description 1
- 108010085220 Multiprotein Complexes Proteins 0.000 description 1
- 102000007474 Multiprotein Complexes Human genes 0.000 description 1
- 241001529936 Murinae Species 0.000 description 1
- 101100506425 Mus musculus Hdac2 gene Proteins 0.000 description 1
- 101000978776 Mus musculus Neurogenic locus notch homolog protein 1 Proteins 0.000 description 1
- 208000031888 Mycoses Diseases 0.000 description 1
- 241000237536 Mytilus edulis Species 0.000 description 1
- 241000251752 Myxine glutinosa Species 0.000 description 1
- AYCPARAPKDAOEN-LJQANCHMSA-N N-[(1S)-2-(dimethylamino)-1-phenylethyl]-6,6-dimethyl-3-[(2-methyl-4-thieno[3,2-d]pyrimidinyl)amino]-1,4-dihydropyrrolo[3,4-c]pyrazole-5-carboxamide Chemical compound C1([C@H](NC(=O)N2C(C=3NN=C(NC=4C=5SC=CC=5N=C(C)N=4)C=3C2)(C)C)CN(C)C)=CC=CC=C1 AYCPARAPKDAOEN-LJQANCHMSA-N 0.000 description 1
- WWGBHDIHIVGYLZ-UHFFFAOYSA-N N-[4-[3-[[[7-(hydroxyamino)-7-oxoheptyl]amino]-oxomethyl]-5-isoxazolyl]phenyl]carbamic acid tert-butyl ester Chemical compound C1=CC(NC(=O)OC(C)(C)C)=CC=C1C1=CC(C(=O)NCCCCCCC(=O)NO)=NO1 WWGBHDIHIVGYLZ-UHFFFAOYSA-N 0.000 description 1
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 1
- 150000001204 N-oxides Chemical class 0.000 description 1
- 102000007399 Nuclear hormone receptor Human genes 0.000 description 1
- 108020005497 Nuclear hormone receptor Proteins 0.000 description 1
- VYEAHXRPWKOEMY-UHFFFAOYSA-N O-(9H-fluoren-9-ylmethyl)hydroxylamine Chemical compound C1=CC=C2C(CON)C3=CC=CC=C3C2=C1 VYEAHXRPWKOEMY-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- BHVRCUAHXVLSNX-UHFFFAOYSA-N O-[(4,5-dimethoxy-2-nitrophenyl)methyl]hydroxylamine Chemical compound COC1=CC(CON)=C([N+]([O-])=O)C=C1OC BHVRCUAHXVLSNX-UHFFFAOYSA-N 0.000 description 1
- SJSOWFHBJSVQDL-UHFFFAOYSA-N O=C1NCCN1.O=C1NCCN1 Chemical compound O=C1NCCN1.O=C1NCCN1 SJSOWFHBJSVQDL-UHFFFAOYSA-N 0.000 description 1
- IDRGFNPZDVBSSE-UHFFFAOYSA-N OCCN1CCN(CC1)c1ccc(Nc2ncc3cccc(-c4cccc(NC(=O)C=C)c4)c3n2)c(F)c1F Chemical compound OCCN1CCN(CC1)c1ccc(Nc2ncc3cccc(-c4cccc(NC(=O)C=C)c4)c3n2)c(F)c1F IDRGFNPZDVBSSE-UHFFFAOYSA-N 0.000 description 1
- PCKPVGOLPKLUHR-UHFFFAOYSA-N OH-Indolxyl Natural products C1=CC=C2C(O)=CNC2=C1 PCKPVGOLPKLUHR-UHFFFAOYSA-N 0.000 description 1
- 101150022822 OSH15 gene Proteins 0.000 description 1
- 241000257458 Ophiuroidea Species 0.000 description 1
- 241000289371 Ornithorhynchus anatinus Species 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- 241000237502 Ostreidae Species 0.000 description 1
- 206010033128 Ovarian cancer Diseases 0.000 description 1
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 1
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical compound C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 description 1
- WYNCHZVNFNFDNH-UHFFFAOYSA-N Oxazolidine Chemical compound C1COCN1 WYNCHZVNFNFDNH-UHFFFAOYSA-N 0.000 description 1
- 238000012408 PCR amplification Methods 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 241000282577 Pan troglodytes Species 0.000 description 1
- 206010061902 Pancreatic neoplasm Diseases 0.000 description 1
- 241001504519 Papio ursinus Species 0.000 description 1
- 208000030852 Parasitic disease Diseases 0.000 description 1
- 241001494479 Pecora Species 0.000 description 1
- LRBQNJMCXXYXIU-PPKXGCFTSA-N Penta-digallate-beta-D-glucose Natural products OC1=C(O)C(O)=CC(C(=O)OC=2C(=C(O)C=C(C=2)C(=O)OC[C@@H]2[C@H]([C@H](OC(=O)C=3C=C(OC(=O)C=4C=C(O)C(O)=C(O)C=4)C(O)=C(O)C=3)[C@@H](OC(=O)C=3C=C(OC(=O)C=4C=C(O)C(O)=C(O)C=4)C(O)=C(O)C=3)[C@H](OC(=O)C=3C=C(OC(=O)C=4C=C(O)C(O)=C(O)C=4)C(O)=C(O)C=3)O2)OC(=O)C=2C=C(OC(=O)C=3C=C(O)C(O)=C(O)C=3)C(O)=C(O)C=2)O)=C1 LRBQNJMCXXYXIU-PPKXGCFTSA-N 0.000 description 1
- 108010026809 Peptide deformylase Proteins 0.000 description 1
- 241000269907 Pleuronectes platessa Species 0.000 description 1
- 101150016155 Pml gene Proteins 0.000 description 1
- 102100039388 Polyamine deacetylase HDAC10 Human genes 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 229920001214 Polysorbate 60 Polymers 0.000 description 1
- PXRCIOIWVGAZEP-UHFFFAOYSA-N Primaeres Camphenhydrat Natural products C1CC2C(O)(C)C(C)(C)C1C2 PXRCIOIWVGAZEP-UHFFFAOYSA-N 0.000 description 1
- 241000288906 Primates Species 0.000 description 1
- 206010060862 Prostate cancer Diseases 0.000 description 1
- 208000000236 Prostatic Neoplasms Diseases 0.000 description 1
- 206010037075 Protozoal infections Diseases 0.000 description 1
- 241000382353 Pupa Species 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 1
- GIIWGCBLYNDKBO-UHFFFAOYSA-N Quinoline 1-oxide Chemical compound C1=CC=C2[N+]([O-])=CC=CC2=C1 GIIWGCBLYNDKBO-UHFFFAOYSA-N 0.000 description 1
- 102000007056 Recombinant Fusion Proteins Human genes 0.000 description 1
- 108010008281 Recombinant Fusion Proteins Proteins 0.000 description 1
- 206010038389 Renal cancer Diseases 0.000 description 1
- 208000013616 Respiratory Distress Syndrome Diseases 0.000 description 1
- 108050002653 Retinoblastoma protein Proteins 0.000 description 1
- 206010039085 Rhinitis allergic Diseases 0.000 description 1
- 239000008156 Ringer's lactate solution Substances 0.000 description 1
- 241000283984 Rodentia Species 0.000 description 1
- 230000018199 S phase Effects 0.000 description 1
- GNSXDDLDAGAXTL-UHFFFAOYSA-N S1OCCCC1.O1SCCCC1 Chemical compound S1OCCCC1.O1SCCCC1 GNSXDDLDAGAXTL-UHFFFAOYSA-N 0.000 description 1
- 229910006069 SO3H Inorganic materials 0.000 description 1
- 101100395456 Saccharomyces cerevisiae (strain ATCC 204508 / S288c) HOS2 gene Proteins 0.000 description 1
- 206010039491 Sarcoma Diseases 0.000 description 1
- 101100330413 Schizosaccharomyces pombe (strain 972 / ATCC 24843) dad2 gene Proteins 0.000 description 1
- 101100297422 Schizosaccharomyces pombe (strain 972 / ATCC 24843) phd1 gene Proteins 0.000 description 1
- 101100364665 Schizosaccharomyces pombe (strain 972 / ATCC 24843) ryh1 gene Proteins 0.000 description 1
- 208000034189 Sclerosis Diseases 0.000 description 1
- 241000239226 Scorpiones Species 0.000 description 1
- 241000242583 Scyphozoa Species 0.000 description 1
- 229940124639 Selective inhibitor Drugs 0.000 description 1
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 description 1
- 229920005654 Sephadex Polymers 0.000 description 1
- 239000012507 Sephadex™ Substances 0.000 description 1
- 241000270295 Serpentes Species 0.000 description 1
- 208000000453 Skin Neoplasms Diseases 0.000 description 1
- 206010041067 Small cell lung cancer Diseases 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 239000004141 Sodium laurylsulphate Substances 0.000 description 1
- NWGKJDSIEKMTRX-AAZCQSIUSA-N Sorbitan monooleate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O NWGKJDSIEKMTRX-AAZCQSIUSA-N 0.000 description 1
- 208000010112 Spinocerebellar Degenerations Diseases 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- 108700025695 Suppressor Genes Proteins 0.000 description 1
- 208000024313 Testicular Neoplasms Diseases 0.000 description 1
- 206010057644 Testis cancer Diseases 0.000 description 1
- DHXVGJBLRPWPCS-UHFFFAOYSA-N Tetrahydropyran Chemical compound C1CCOCC1 DHXVGJBLRPWPCS-UHFFFAOYSA-N 0.000 description 1
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 1
- 241001061127 Thione Species 0.000 description 1
- 102000040945 Transcription factor Human genes 0.000 description 1
- 108091023040 Transcription factor Proteins 0.000 description 1
- 229930189037 Trapoxin Natural products 0.000 description 1
- 241000242541 Trematoda Species 0.000 description 1
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 1
- 239000007983 Tris buffer Substances 0.000 description 1
- 241000397921 Turbellaria Species 0.000 description 1
- 206010067584 Type 1 diabetes mellitus Diseases 0.000 description 1
- 208000007097 Urinary Bladder Neoplasms Diseases 0.000 description 1
- 241000251539 Vertebrata <Metazoa> Species 0.000 description 1
- 208000036142 Viral infection Diseases 0.000 description 1
- 241000289674 Vombatidae Species 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000007244 Zea mays Nutrition 0.000 description 1
- 102100040314 Zinc finger and BTB domain-containing protein 16 Human genes 0.000 description 1
- LXRZVMYMQHNYJB-UNXOBOICSA-N [(1R,2S,4R)-4-[[5-[4-[(1R)-7-chloro-1,2,3,4-tetrahydroisoquinolin-1-yl]-5-methylthiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl]methyl sulfamate Chemical compound CC1=C(C=C(S1)C(=O)C1=C(N[C@H]2C[C@H](O)[C@@H](COS(N)(=O)=O)C2)N=CN=C1)[C@@H]1NCCC2=C1C=C(Cl)C=C2 LXRZVMYMQHNYJB-UNXOBOICSA-N 0.000 description 1
- DGEZNRSVGBDHLK-UHFFFAOYSA-N [1,10]phenanthroline Chemical compound C1=CN=C2C3=NC=CC=C3C=CC2=C1 DGEZNRSVGBDHLK-UHFFFAOYSA-N 0.000 description 1
- GXVKHKJETWAWRR-UHFFFAOYSA-N a805143 Chemical compound C1CCNC1.C1CCNC1 GXVKHKJETWAWRR-UHFFFAOYSA-N 0.000 description 1
- 230000001594 aberrant effect Effects 0.000 description 1
- 230000002159 abnormal effect Effects 0.000 description 1
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 description 1
- HXGDTGSAIMULJN-UHFFFAOYSA-N acetnaphthylene Natural products C1=CC(C=C2)=C3C2=CC=CC3=C1 HXGDTGSAIMULJN-UHFFFAOYSA-N 0.000 description 1
- PBCJIPOGFJYBJE-UHFFFAOYSA-N acetonitrile;hydrate Chemical compound O.CC#N PBCJIPOGFJYBJE-UHFFFAOYSA-N 0.000 description 1
- 150000008062 acetophenones Chemical class 0.000 description 1
- 229940100228 acetyl coenzyme a Drugs 0.000 description 1
- ZSLZBFCDCINBPY-ZSJPKINUSA-J acetyl-CoA(4-) Chemical compound O[C@@H]1[C@H](OP([O-])([O-])=O)[C@@H](COP([O-])(=O)OP([O-])(=O)OCC(C)(C)[C@@H](O)C(=O)NCCC(=O)NCCSC(=O)C)O[C@H]1N1C2=NC=NC(N)=C2N=C1 ZSLZBFCDCINBPY-ZSJPKINUSA-J 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- 108020002494 acetyltransferase Proteins 0.000 description 1
- 102000005421 acetyltransferase Human genes 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000008186 active pharmaceutical agent Substances 0.000 description 1
- 125000002015 acyclic group Chemical group 0.000 description 1
- 150000001266 acyl halides Chemical class 0.000 description 1
- 125000004442 acylamino group Chemical group 0.000 description 1
- 125000005042 acyloxymethyl group Chemical group 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 229960000643 adenine Drugs 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 201000000028 adult respiratory distress syndrome Diseases 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910001413 alkali metal ion Inorganic materials 0.000 description 1
- 125000004450 alkenylene group Chemical group 0.000 description 1
- 125000005119 alkyl cycloalkyl group Chemical group 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 125000004419 alkynylene group Chemical group 0.000 description 1
- 208000026935 allergic disease Diseases 0.000 description 1
- 201000010105 allergic rhinitis Diseases 0.000 description 1
- 230000007815 allergy Effects 0.000 description 1
- WQZGKKKJIJFFOK-PHYPRBDBSA-N alpha-D-galactose Chemical compound OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@H]1O WQZGKKKJIJFFOK-PHYPRBDBSA-N 0.000 description 1
- XCPQUQHBVVXMRQ-UHFFFAOYSA-N alpha-Fenchene Natural products C1CC2C(=C)CC1C2(C)C XCPQUQHBVVXMRQ-UHFFFAOYSA-N 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 125000000320 amidine group Chemical group 0.000 description 1
- ZXKINMCYCKHYFR-UHFFFAOYSA-N aminooxidanide Chemical compound [O-]N ZXKINMCYCKHYFR-UHFFFAOYSA-N 0.000 description 1
- 230000003321 amplification Effects 0.000 description 1
- 208000007502 anemia Diseases 0.000 description 1
- 229910052925 anhydrite Inorganic materials 0.000 description 1
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- 150000001449 anionic compounds Chemical class 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- RJGDLRCDCYRQOQ-UHFFFAOYSA-N anthrone Chemical compound C1=CC=C2C(=O)C3=CC=CC=C3CC2=C1 RJGDLRCDCYRQOQ-UHFFFAOYSA-N 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 230000000259 anti-tumor effect Effects 0.000 description 1
- 229940019748 antifibrinolytic proteinase inhibitors Drugs 0.000 description 1
- 229940030999 antipsoriatics Drugs 0.000 description 1
- 238000003782 apoptosis assay Methods 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000003125 aqueous solvent Substances 0.000 description 1
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 1
- 125000000637 arginyl group Chemical group N[C@@H](CCCNC(N)=N)C(=O)* 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 208000011775 arteriosclerosis disease Diseases 0.000 description 1
- 206010003246 arthritis Diseases 0.000 description 1
- 239000012131 assay buffer Substances 0.000 description 1
- 238000003149 assay kit Methods 0.000 description 1
- 208000006673 asthma Diseases 0.000 description 1
- 238000011914 asymmetric synthesis Methods 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 201000008937 atopic dermatitis Diseases 0.000 description 1
- 230000003416 augmentation Effects 0.000 description 1
- 208000022362 bacterial infectious disease Diseases 0.000 description 1
- HNYOPLTXPVRDBG-UHFFFAOYSA-N barbituric acid Chemical compound O=C1CC(=O)NC(=O)N1 HNYOPLTXPVRDBG-UHFFFAOYSA-N 0.000 description 1
- RTEXIPZMMDUXMR-UHFFFAOYSA-N benzene;ethyl acetate Chemical compound CCOC(C)=O.C1=CC=CC=C1 RTEXIPZMMDUXMR-UHFFFAOYSA-N 0.000 description 1
- BNBQRQQYDMDJAH-UHFFFAOYSA-N benzodioxan Chemical compound C1=CC=C2OCCOC2=C1 BNBQRQQYDMDJAH-UHFFFAOYSA-N 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid group Chemical group C(C1=CC=CC=C1)(=O)O WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- QRUDEWIWKLJBPS-UHFFFAOYSA-N benzotriazole Chemical compound C1=CC=C2N[N][N]C2=C1 QRUDEWIWKLJBPS-UHFFFAOYSA-N 0.000 description 1
- 239000012964 benzotriazole Substances 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- 125000000649 benzylidene group Chemical group [H]C(=[*])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- MDHYEMXUFSJLGV-UHFFFAOYSA-N beta-phenethyl acetate Natural products CC(=O)OCCC1=CC=CC=C1 MDHYEMXUFSJLGV-UHFFFAOYSA-N 0.000 description 1
- SHOMMGQAMRXRRK-UHFFFAOYSA-N bicyclo[3.1.1]heptane Chemical compound C1C2CC1CCC2 SHOMMGQAMRXRRK-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000003115 biocidal effect Effects 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 239000012503 blood component Substances 0.000 description 1
- 210000004204 blood vessel Anatomy 0.000 description 1
- 210000001124 body fluid Anatomy 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- BEWYHVAWEKZDPP-UHFFFAOYSA-N bornane Chemical compound C1CC2(C)CCC1C2(C)C BEWYHVAWEKZDPP-UHFFFAOYSA-N 0.000 description 1
- 229930006742 bornane Natural products 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- 210000004556 brain Anatomy 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 125000004799 bromophenyl group Chemical group 0.000 description 1
- 125000003865 brosyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Br)S(*)(=O)=O 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- RHDGNLCLDBVESU-UHFFFAOYSA-N but-3-en-4-olide Chemical compound O=C1CC=CO1 RHDGNLCLDBVESU-UHFFFAOYSA-N 0.000 description 1
- 235000019437 butane-1,3-diol Nutrition 0.000 description 1
- 150000004648 butanoic acid derivatives Chemical class 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- FUFJGUQYACFECW-UHFFFAOYSA-L calcium hydrogenphosphate Chemical compound [Ca+2].OP([O-])([O-])=O FUFJGUQYACFECW-UHFFFAOYSA-L 0.000 description 1
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 1
- BPKIGYQJPYCAOW-FFJTTWKXSA-I calcium;potassium;disodium;(2s)-2-hydroxypropanoate;dichloride;dihydroxide;hydrate Chemical compound O.[OH-].[OH-].[Na+].[Na+].[Cl-].[Cl-].[K+].[Ca+2].C[C@H](O)C([O-])=O BPKIGYQJPYCAOW-FFJTTWKXSA-I 0.000 description 1
- 229930006739 camphene Natural products 0.000 description 1
- ZYPYEBYNXWUCEA-UHFFFAOYSA-N camphenilone Natural products C1CC2C(=O)C(C)(C)C1C2 ZYPYEBYNXWUCEA-UHFFFAOYSA-N 0.000 description 1
- 230000036952 cancer formation Effects 0.000 description 1
- 229930006741 carane Natural products 0.000 description 1
- AIXAANGOTKPUOY-UHFFFAOYSA-N carbachol Chemical group [Cl-].C[N+](C)(C)CCOC(N)=O AIXAANGOTKPUOY-UHFFFAOYSA-N 0.000 description 1
- 150000001715 carbamic acids Chemical class 0.000 description 1
- 235000013877 carbamide Nutrition 0.000 description 1
- 125000003739 carbamimidoyl group Chemical group C(N)(=N)* 0.000 description 1
- 150000001720 carbohydrates Chemical group 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 231100000504 carcinogenesis Toxicity 0.000 description 1
- 239000003183 carcinogenic agent Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 150000001767 cationic compounds Chemical class 0.000 description 1
- 238000000423 cell based assay Methods 0.000 description 1
- 238000004113 cell culture Methods 0.000 description 1
- 230000010261 cell growth Effects 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 201000006662 cervical adenocarcinoma Diseases 0.000 description 1
- 229940082500 cetostearyl alcohol Drugs 0.000 description 1
- 238000002512 chemotherapy Methods 0.000 description 1
- WORJEOGGNQDSOE-UHFFFAOYSA-N chloroform;methanol Chemical compound OC.ClC(Cl)Cl WORJEOGGNQDSOE-UHFFFAOYSA-N 0.000 description 1
- WGXZDYPGLJYBJW-UHFFFAOYSA-N chloroform;propan-2-ol Chemical compound CC(C)O.ClC(Cl)Cl WGXZDYPGLJYBJW-UHFFFAOYSA-N 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- OEYIOHPDSNJKLS-UHFFFAOYSA-N choline Chemical compound C[N+](C)(C)CCO OEYIOHPDSNJKLS-UHFFFAOYSA-N 0.000 description 1
- 229960001231 choline Drugs 0.000 description 1
- VZWXIQHBIQLMPN-UHFFFAOYSA-N chromane Chemical compound C1=CC=C2CCCOC2=C1 VZWXIQHBIQLMPN-UHFFFAOYSA-N 0.000 description 1
- QZHPTGXQGDFGEN-UHFFFAOYSA-N chromene Chemical compound C1=CC=C2C=C[CH]OC2=C1 QZHPTGXQGDFGEN-UHFFFAOYSA-N 0.000 description 1
- 210000000349 chromosome Anatomy 0.000 description 1
- 230000001684 chronic effect Effects 0.000 description 1
- 235000013985 cinnamic acid Nutrition 0.000 description 1
- 229930016911 cinnamic acid Natural products 0.000 description 1
- 125000000490 cinnamyl group Chemical group C(C=CC1=CC=CC=C1)* 0.000 description 1
- 235000020639 clam Nutrition 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 229940110456 cocoa butter Drugs 0.000 description 1
- 235000019868 cocoa butter Nutrition 0.000 description 1
- 208000029742 colonic neoplasm Diseases 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 238000011284 combination treatment Methods 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 239000002299 complementary DNA Substances 0.000 description 1
- 239000000306 component Substances 0.000 description 1
- 239000007891 compressed tablet Substances 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 210000002808 connective tissue Anatomy 0.000 description 1
- 238000013270 controlled release Methods 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000002537 cosmetic Substances 0.000 description 1
- 239000001767 crosslinked sodium carboxy methyl cellulose Substances 0.000 description 1
- 235000010947 crosslinked sodium carboxy methyl cellulose Nutrition 0.000 description 1
- 210000004748 cultured cell Anatomy 0.000 description 1
- 125000002592 cumenyl group Chemical group C1(=C(C=CC=C1)*)C(C)C 0.000 description 1
- 125000001651 cyanato group Chemical class [*]OC#N 0.000 description 1
- 150000003950 cyclic amides Chemical class 0.000 description 1
- 150000005676 cyclic carbonates Chemical class 0.000 description 1
- 125000000392 cycloalkenyl group Chemical group 0.000 description 1
- 125000002993 cycloalkylene group Chemical group 0.000 description 1
- 125000001047 cyclobutenyl group Chemical group C1(=CCC1)* 0.000 description 1
- FWFSEYBSWVRWGL-UHFFFAOYSA-N cyclohex-2-enone Chemical compound O=C1CCCC=C1 FWFSEYBSWVRWGL-UHFFFAOYSA-N 0.000 description 1
- WQPDQJCBHQPNCZ-UHFFFAOYSA-N cyclohexa-2,4-dien-1-one Chemical compound O=C1CC=CC=C1 WQPDQJCBHQPNCZ-UHFFFAOYSA-N 0.000 description 1
- 239000004914 cyclooctane Substances 0.000 description 1
- FQQOMPOPYZIROF-UHFFFAOYSA-N cyclopenta-2,4-dien-1-one Chemical compound O=C1C=CC=C1 FQQOMPOPYZIROF-UHFFFAOYSA-N 0.000 description 1
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 1
- 125000000298 cyclopropenyl group Chemical group [H]C1=C([H])C1([H])* 0.000 description 1
- 239000002254 cytotoxic agent Substances 0.000 description 1
- 231100000599 cytotoxic agent Toxicity 0.000 description 1
- 125000001295 dansyl group Chemical group [H]C1=C([H])C(N(C([H])([H])[H])C([H])([H])[H])=C2C([H])=C([H])C([H])=C(C2=C1[H])S(*)(=O)=O 0.000 description 1
- 230000034994 death Effects 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- SASYSVUEVMOWPL-NXVVXOECSA-N decyl oleate Chemical compound CCCCCCCCCCOC(=O)CCCCCCC\C=C/CCCCCCCC SASYSVUEVMOWPL-NXVVXOECSA-N 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- DLVJMFOLJOOWFS-INMLLLKOSA-N depudecin Chemical compound C[C@@H](O)[C@@H]1O[C@H]1\C=C\[C@H]1[C@H]([C@H](O)C=C)O1 DLVJMFOLJOOWFS-INMLLLKOSA-N 0.000 description 1
- 231100000223 dermal penetration Toxicity 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- AQEFLFZSWDEAIP-UHFFFAOYSA-N di-tert-butyl ether Chemical compound CC(C)(C)OC(C)(C)C AQEFLFZSWDEAIP-UHFFFAOYSA-N 0.000 description 1
- 235000019700 dicalcium phosphate Nutrition 0.000 description 1
- ZFTFAPZRGNKQPU-UHFFFAOYSA-N dicarbonic acid Chemical compound OC(=O)OC(O)=O ZFTFAPZRGNKQPU-UHFFFAOYSA-N 0.000 description 1
- PXBRQCKWGAHEHS-UHFFFAOYSA-N dichlorodifluoromethane Chemical compound FC(F)(Cl)Cl PXBRQCKWGAHEHS-UHFFFAOYSA-N 0.000 description 1
- 235000019404 dichlorodifluoromethane Nutrition 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- HGGNZMUHOHGHBJ-UHFFFAOYSA-N dioxepane Chemical compound C1CCOOCC1 HGGNZMUHOHGHBJ-UHFFFAOYSA-N 0.000 description 1
- 125000005982 diphenylmethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000003828 downregulation Effects 0.000 description 1
- 241001233061 earthworms Species 0.000 description 1
- XUZICJHIIJCKQQ-ZDUSSCGKSA-N eclitasertib Chemical compound C(C1=CC=CC=C1)C=1NC(=NN=1)C(=O)N[C@@H]1C(N(C2=C(OC1)C=CC=N2)C)=O XUZICJHIIJCKQQ-ZDUSSCGKSA-N 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 239000008387 emulsifying waxe Substances 0.000 description 1
- 150000002081 enamines Chemical class 0.000 description 1
- 230000002708 enhancing effect Effects 0.000 description 1
- 150000002085 enols Chemical class 0.000 description 1
- 239000002702 enteric coating Substances 0.000 description 1
- 238000009505 enteric coating Methods 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- RQIFXTOWUNAUJC-UHFFFAOYSA-N ethanesulfinic acid Chemical compound CCS(O)=O RQIFXTOWUNAUJC-UHFFFAOYSA-N 0.000 description 1
- BEFDCLMNVWHSGT-UHFFFAOYSA-N ethenylcyclopentane Chemical compound C=CC1CCCC1 BEFDCLMNVWHSGT-UHFFFAOYSA-N 0.000 description 1
- 125000005678 ethenylene group Chemical group [H]C([*:1])=C([H])[*:2] 0.000 description 1
- 125000001033 ether group Chemical group 0.000 description 1
- SRCZQMGIVIYBBJ-UHFFFAOYSA-N ethoxyethane;ethyl acetate Chemical compound CCOCC.CCOC(C)=O SRCZQMGIVIYBBJ-UHFFFAOYSA-N 0.000 description 1
- QNEYJSXWCBTRNP-UHFFFAOYSA-N ethyl 8-[4-(2-chlorophenyl)piperazin-1-yl]-8-oxooctanoate Chemical compound C1CN(C(=O)CCCCCCC(=O)OCC)CCN1C1=CC=CC=C1Cl QNEYJSXWCBTRNP-UHFFFAOYSA-N 0.000 description 1
- 125000000219 ethylidene group Chemical group [H]C(=[*])C([H])([H])[H] 0.000 description 1
- 125000004705 ethylthio group Chemical group C(C)S* 0.000 description 1
- 241001233957 eudicotyledons Species 0.000 description 1
- 210000003527 eukaryotic cell Anatomy 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 230000005284 excitation Effects 0.000 description 1
- 230000029142 excretion Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000011536 extraction buffer Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 230000003176 fibrotic effect Effects 0.000 description 1
- GVEPBJHOBDJJJI-UHFFFAOYSA-N fluoranthrene Natural products C1=CC(C2=CC=CC=C22)=C3C2=CC=CC3=C1 GVEPBJHOBDJJJI-UHFFFAOYSA-N 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 125000001207 fluorophenyl group Chemical group 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- WCVXAYSKMJJPLO-UHFFFAOYSA-N furan Chemical compound C=1C=COC=1.C=1C=COC=1 WCVXAYSKMJJPLO-UHFFFAOYSA-N 0.000 description 1
- 150000002243 furanoses Chemical class 0.000 description 1
- 229960003082 galactose Drugs 0.000 description 1
- 206010017758 gastric cancer Diseases 0.000 description 1
- 208000010749 gastric carcinoma Diseases 0.000 description 1
- 230000002496 gastric effect Effects 0.000 description 1
- 210000001035 gastrointestinal tract Anatomy 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 238000001415 gene therapy Methods 0.000 description 1
- 102000034356 gene-regulatory proteins Human genes 0.000 description 1
- 108091006104 gene-regulatory proteins Proteins 0.000 description 1
- 230000002068 genetic effect Effects 0.000 description 1
- 229940075507 glyceryl monostearate Drugs 0.000 description 1
- 229930182470 glycoside Natural products 0.000 description 1
- 150000002338 glycosides Chemical class 0.000 description 1
- 239000001963 growth medium Substances 0.000 description 1
- 125000002795 guanidino group Chemical group C(N)(=N)N* 0.000 description 1
- 230000003394 haemopoietic effect Effects 0.000 description 1
- 125000004997 halocarbonyl group Chemical group 0.000 description 1
- 125000005067 haloformyl group Chemical group 0.000 description 1
- 125000005059 halophenyl group Chemical group 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- 230000011132 hemopoiesis Effects 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000002390 heteroarenes Chemical class 0.000 description 1
- 125000005549 heteroarylene group Chemical group 0.000 description 1
- UBHWBODXJBSFLH-UHFFFAOYSA-N hexadecan-1-ol;octadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCO.CCCCCCCCCCCCCCCCCCO UBHWBODXJBSFLH-UHFFFAOYSA-N 0.000 description 1
- 125000006038 hexenyl group Chemical group 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000006195 histone acetylation Effects 0.000 description 1
- 102000047036 human HDAC2 Human genes 0.000 description 1
- BHEPBYXIRTUNPN-UHFFFAOYSA-N hydridophosphorus(.) (triplet) Chemical compound [PH] BHEPBYXIRTUNPN-UHFFFAOYSA-N 0.000 description 1
- 125000001183 hydrocarbyl group Chemical group 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000008309 hydrophilic cream Substances 0.000 description 1
- NPZTUJOABDZTLV-UHFFFAOYSA-N hydroxybenzotriazole Substances O=C1C=CC=C2NNN=C12 NPZTUJOABDZTLV-UHFFFAOYSA-N 0.000 description 1
- LVWBCSKGNSTMNO-UHFFFAOYSA-N hydroxylamine;oxalic acid Chemical compound ON.OC(=O)C(O)=O LVWBCSKGNSTMNO-UHFFFAOYSA-N 0.000 description 1
- UWYVPFMHMJIBHE-OWOJBTEDSA-N hydroxymaleic acid group Chemical group O/C(/C(=O)O)=C/C(=O)O UWYVPFMHMJIBHE-OWOJBTEDSA-N 0.000 description 1
- CBOIHMRHGLHBPB-UHFFFAOYSA-N hydroxymethyl Chemical compound O[CH2] CBOIHMRHGLHBPB-UHFFFAOYSA-N 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 206010020718 hyperplasia Diseases 0.000 description 1
- 230000002390 hyperplastic effect Effects 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 125000002140 imidazol-4-yl group Chemical group [H]N1C([H])=NC([*])=C1[H] 0.000 description 1
- YAMHXTCMCPHKLN-UHFFFAOYSA-N imidazolidin-2-one Chemical compound O=C1NCCN1 YAMHXTCMCPHKLN-UHFFFAOYSA-N 0.000 description 1
- 150000003949 imides Chemical class 0.000 description 1
- 230000008102 immune modulation Effects 0.000 description 1
- 238000009169 immunotherapy Methods 0.000 description 1
- 239000007943 implant Substances 0.000 description 1
- 238000000099 in vitro assay Methods 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 125000000814 indol-3-yl group Chemical group [H]C1=C([H])C([H])=C2N([H])C([H])=C([*])C2=C1[H] 0.000 description 1
- JYGFTBXVXVMTGB-UHFFFAOYSA-N indolin-2-one Chemical compound C1=CC=C2NC(=O)CC2=C1 JYGFTBXVXVMTGB-UHFFFAOYSA-N 0.000 description 1
- HOBCFUWDNJPFHB-UHFFFAOYSA-N indolizine Chemical compound C1=CC=CN2C=CC=C21 HOBCFUWDNJPFHB-UHFFFAOYSA-N 0.000 description 1
- 239000000411 inducer Substances 0.000 description 1
- 208000027866 inflammatory disease Diseases 0.000 description 1
- 238000011081 inoculation Methods 0.000 description 1
- 229910001412 inorganic anion Inorganic materials 0.000 description 1
- 229910001411 inorganic cation Inorganic materials 0.000 description 1
- 201000002313 intestinal cancer Diseases 0.000 description 1
- 238000001361 intraarterial administration Methods 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000007913 intrathecal administration Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 230000009545 invasion Effects 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 125000006303 iodophenyl group Chemical group 0.000 description 1
- 230000007794 irritation Effects 0.000 description 1
- 125000002510 isobutoxy group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])O* 0.000 description 1
- 229940078545 isocetyl stearate Drugs 0.000 description 1
- HEBMCVBCEDMUOF-UHFFFAOYSA-N isochromane Chemical compound C1=CC=C2COCCC2=C1 HEBMCVBCEDMUOF-UHFFFAOYSA-N 0.000 description 1
- 125000001261 isocyanato group Chemical group *N=C=O 0.000 description 1
- 125000002462 isocyano group Chemical group *[N+]#[C-] 0.000 description 1
- GWVMLCQWXVFZCN-UHFFFAOYSA-N isoindoline Chemical compound C1=CC=C2CNCC2=C1 GWVMLCQWXVFZCN-UHFFFAOYSA-N 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 229960004592 isopropanol Drugs 0.000 description 1
- 125000000555 isopropenyl group Chemical group [H]\C([H])=C(\*)C([H])([H])[H] 0.000 description 1
- 125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 description 1
- XUGNVMKQXJXZCD-UHFFFAOYSA-N isopropyl palmitate Chemical compound CCCCCCCCCCCCCCCC(=O)OC(C)C XUGNVMKQXJXZCD-UHFFFAOYSA-N 0.000 description 1
- ZLTPDFXIESTBQG-UHFFFAOYSA-N isothiazole Chemical compound C=1C=NSC=1 ZLTPDFXIESTBQG-UHFFFAOYSA-N 0.000 description 1
- 125000001810 isothiocyanato group Chemical group *N=C=S 0.000 description 1
- CTAPFRYPJLPFDF-UHFFFAOYSA-N isoxazole Chemical compound C=1C=NOC=1 CTAPFRYPJLPFDF-UHFFFAOYSA-N 0.000 description 1
- 210000003734 kidney Anatomy 0.000 description 1
- 201000010982 kidney cancer Diseases 0.000 description 1
- 150000003951 lactams Chemical class 0.000 description 1
- 150000002596 lactones Chemical class 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 201000010901 lateral sclerosis Diseases 0.000 description 1
- QDLAGTHXVHQKRE-UHFFFAOYSA-N lichenxanthone Natural products COC1=CC(O)=C2C(=O)C3=C(C)C=C(OC)C=C3OC2=C1 QDLAGTHXVHQKRE-UHFFFAOYSA-N 0.000 description 1
- 239000003446 ligand Substances 0.000 description 1
- 150000002632 lipids Chemical class 0.000 description 1
- 229940057995 liquid paraffin Drugs 0.000 description 1
- 210000004185 liver Anatomy 0.000 description 1
- 201000007270 liver cancer Diseases 0.000 description 1
- 208000014018 liver neoplasm Diseases 0.000 description 1
- 201000005202 lung cancer Diseases 0.000 description 1
- 201000005296 lung carcinoma Diseases 0.000 description 1
- 208000020816 lung neoplasm Diseases 0.000 description 1
- 208000037841 lung tumor Diseases 0.000 description 1
- 206010025135 lupus erythematosus Diseases 0.000 description 1
- 125000003588 lysine group Chemical group [H]N([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])(N([H])[H])C(*)=O 0.000 description 1
- 239000012139 lysis buffer Substances 0.000 description 1
- 229910001629 magnesium chloride Inorganic materials 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 201000004792 malaria Diseases 0.000 description 1
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 1
- 125000005439 maleimidyl group Chemical group C1(C=CC(N1*)=O)=O 0.000 description 1
- 208000015486 malignant pancreatic neoplasm Diseases 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 239000003550 marker Substances 0.000 description 1
- 241001515942 marmosets Species 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 229960003194 meglumine Drugs 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- AUHZEENZYGFFBQ-UHFFFAOYSA-N mesitylene Substances CC1=CC(C)=CC(C)=C1 AUHZEENZYGFFBQ-UHFFFAOYSA-N 0.000 description 1
- 125000001827 mesitylenyl group Chemical group [H]C1=C(C(*)=C(C([H])=C1C([H])([H])[H])C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 230000002503 metabolic effect Effects 0.000 description 1
- 230000004060 metabolic process Effects 0.000 description 1
- 230000009401 metastasis Effects 0.000 description 1
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical group C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 1
- XNEFVTBPCXGIRX-UHFFFAOYSA-N methanesulfinic acid Chemical compound CS(O)=O XNEFVTBPCXGIRX-UHFFFAOYSA-N 0.000 description 1
- GRWIABMEEKERFV-UHFFFAOYSA-N methanol;oxolane Chemical compound OC.C1CCOC1 GRWIABMEEKERFV-UHFFFAOYSA-N 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- OUOQASJQWCNORS-CMDGGOBGSA-N methyl (e)-3-[3-[4-(3-chlorophenyl)piperazin-1-yl]sulfonylphenyl]prop-2-enoate Chemical compound COC(=O)\C=C\C1=CC=CC(S(=O)(=O)N2CCN(CC2)C=2C=C(Cl)C=CC=2)=C1 OUOQASJQWCNORS-CMDGGOBGSA-N 0.000 description 1
- SIGOIUCRXKUEIG-UHFFFAOYSA-N methyl 2-dimethoxyphosphorylacetate Chemical compound COC(=O)CP(=O)(OC)OC SIGOIUCRXKUEIG-UHFFFAOYSA-N 0.000 description 1
- 125000006431 methyl cyclopropyl group Chemical group 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 239000004292 methyl p-hydroxybenzoate Substances 0.000 description 1
- 235000010270 methyl p-hydroxybenzoate Nutrition 0.000 description 1
- 230000011987 methylation Effects 0.000 description 1
- 238000007069 methylation reaction Methods 0.000 description 1
- 125000001442 methylidyne group Chemical group [H]C#[*] 0.000 description 1
- LXCFILQKKLGQFO-UHFFFAOYSA-N methylparaben Chemical compound COC(=O)C1=CC=C(O)C=C1 LXCFILQKKLGQFO-UHFFFAOYSA-N 0.000 description 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 1
- 229940016286 microcrystalline cellulose Drugs 0.000 description 1
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 1
- 239000008108 microcrystalline cellulose Substances 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 230000002438 mitochondrial effect Effects 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 239000007932 molded tablet Substances 0.000 description 1
- 238000000329 molecular dynamics simulation Methods 0.000 description 1
- 239000001788 mono and diglycerides of fatty acids Substances 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- 229910000402 monopotassium phosphate Inorganic materials 0.000 description 1
- 235000019796 monopotassium phosphate Nutrition 0.000 description 1
- 235000019799 monosodium phosphate Nutrition 0.000 description 1
- ZKWFSTHEYLJLEL-UHFFFAOYSA-N morpholine-4-carboxamide Chemical class NC(=O)N1CCOCC1 ZKWFSTHEYLJLEL-UHFFFAOYSA-N 0.000 description 1
- 125000006518 morpholino carbonyl group Chemical group [H]C1([H])OC([H])([H])C([H])([H])N(C(*)=O)C1([H])[H] 0.000 description 1
- 230000000877 morphologic effect Effects 0.000 description 1
- 208000005264 motor neuron disease Diseases 0.000 description 1
- 201000006417 multiple sclerosis Diseases 0.000 description 1
- 235000020638 mussel Nutrition 0.000 description 1
- 229940043348 myristyl alcohol Drugs 0.000 description 1
- 125000001421 myristyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- GIWJVACTWSJBEB-UHFFFAOYSA-N n,n-dimethyl-3-(3-piperazin-1-ylpropyl)aniline Chemical compound CN(C)C1=CC=CC(CCCN2CCNCC2)=C1 GIWJVACTWSJBEB-UHFFFAOYSA-N 0.000 description 1
- MRHQBBSKCLIMRH-UHFFFAOYSA-N n-(acetamidomethoxymethyl)acetamide Chemical compound CC(=O)NCOCNC(C)=O MRHQBBSKCLIMRH-UHFFFAOYSA-N 0.000 description 1
- GTWJETSWSUWSEJ-UHFFFAOYSA-N n-benzylaniline Chemical compound C=1C=CC=CC=1CNC1=CC=CC=C1 GTWJETSWSUWSEJ-UHFFFAOYSA-N 0.000 description 1
- 125000006606 n-butoxy group Chemical group 0.000 description 1
- 125000003136 n-heptyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- OYKBQNOPCSXWBL-SNAWJCMRSA-N n-hydroxy-3-[(e)-3-(hydroxyamino)-3-oxoprop-1-enyl]benzamide Chemical compound ONC(=O)\C=C\C1=CC=CC(C(=O)NO)=C1 OYKBQNOPCSXWBL-SNAWJCMRSA-N 0.000 description 1
- CRKCWJLTEKTNIQ-UHFFFAOYSA-N n-hydroxy-3-[4-(4-pyrimidin-2-ylpiperazin-1-yl)sulfonylphenyl]prop-2-enamide Chemical compound C1=CC(C=CC(=O)NO)=CC=C1S(=O)(=O)N1CCN(C=2N=CC=CN=2)CC1 CRKCWJLTEKTNIQ-UHFFFAOYSA-N 0.000 description 1
- JZKWAQMHMQGYOV-UHFFFAOYSA-N n-hydroxy-3-[4-[3-methyl-4-(3-methylphenyl)piperazin-1-yl]sulfonylphenyl]prop-2-enamide Chemical compound CC1CN(S(=O)(=O)C=2C=CC(C=CC(=O)NO)=CC=2)CCN1C1=CC=CC(C)=C1 JZKWAQMHMQGYOV-UHFFFAOYSA-N 0.000 description 1
- YKNWOJOWNPOJRJ-UHFFFAOYSA-N n-hydroxy-7-[4-(1h-indol-3-ylmethyl)piperazin-1-yl]-7-oxoheptanamide Chemical compound C1CN(C(=O)CCCCCC(=O)NO)CCN1CC1=CNC2=CC=CC=C12 YKNWOJOWNPOJRJ-UHFFFAOYSA-N 0.000 description 1
- GFKZSJGNPVEKLM-UHFFFAOYSA-N n-hydroxy-7-[4-(1h-indole-3-carbonyl)piperazin-1-yl]-7-oxoheptanamide Chemical compound C1CN(C(=O)CCCCCC(=O)NO)CCN1C(=O)C1=CNC2=CC=CC=C12 GFKZSJGNPVEKLM-UHFFFAOYSA-N 0.000 description 1
- LLZKQVUPKJCKER-UHFFFAOYSA-N n-hydroxy-7-[4-[3-(1h-indol-3-yl)propanoyl]piperazin-1-yl]-7-oxoheptanamide Chemical compound C1CN(C(=O)CCCCCC(=O)NO)CCN1C(=O)CCC1=CNC2=CC=CC=C12 LLZKQVUPKJCKER-UHFFFAOYSA-N 0.000 description 1
- IFQGKXGYDZJACN-UHFFFAOYSA-N n-hydroxy-7-[4-[3-(1h-indol-3-yl)propyl]piperazin-1-yl]-7-oxoheptanamide Chemical compound C1CN(C(=O)CCCCCC(=O)NO)CCN1CCCC1=CNC2=CC=CC=C12 IFQGKXGYDZJACN-UHFFFAOYSA-N 0.000 description 1
- QKZQWBSFIZGLFP-UHFFFAOYSA-N n-hydroxy-7-oxo-7-(4-phenylpiperazin-1-yl)heptanamide Chemical compound C1CN(C(=O)CCCCCC(=O)NO)CCN1C1=CC=CC=C1 QKZQWBSFIZGLFP-UHFFFAOYSA-N 0.000 description 1
- TVKSKLQJDQOECA-UHFFFAOYSA-N n-hydroxy-8-[3-methyl-4-(3-methylphenyl)piperazin-1-yl]-8-oxooctanamide Chemical compound CC1CN(C(=O)CCCCCCC(=O)NO)CCN1C1=CC=CC(C)=C1 TVKSKLQJDQOECA-UHFFFAOYSA-N 0.000 description 1
- DXFYJZMEGUHELW-UHFFFAOYSA-N n-hydroxy-8-[4-(2-methoxyphenyl)piperazin-1-yl]-8-oxooctanamide Chemical compound COC1=CC=CC=C1N1CCN(C(=O)CCCCCCC(=O)NO)CC1 DXFYJZMEGUHELW-UHFFFAOYSA-N 0.000 description 1
- IBLNTSITXDUZMX-UHFFFAOYSA-N n-hydroxy-8-[4-(2-naphthalen-1-yloxyacetyl)piperazin-1-yl]-8-oxooctanamide Chemical compound C1CN(C(=O)CCCCCCC(=O)NO)CCN1C(=O)COC1=CC=CC2=CC=CC=C12 IBLNTSITXDUZMX-UHFFFAOYSA-N 0.000 description 1
- UOTGEYPTEFDSKZ-UHFFFAOYSA-N n-hydroxy-8-[4-(2-naphthalen-2-ylacetyl)piperazin-1-yl]-8-oxooctanamide Chemical compound C1CN(C(=O)CCCCCCC(=O)NO)CCN1C(=O)CC1=CC=C(C=CC=C2)C2=C1 UOTGEYPTEFDSKZ-UHFFFAOYSA-N 0.000 description 1
- YIIZCEGLLUNJFS-UHFFFAOYSA-N n-hydroxy-8-[4-(2-naphthalen-2-ylethyl)piperazin-1-yl]-8-oxooctanamide Chemical compound C1CN(C(=O)CCCCCCC(=O)NO)CCN1CCC1=CC=C(C=CC=C2)C2=C1 YIIZCEGLLUNJFS-UHFFFAOYSA-N 0.000 description 1
- KSFIMSZMTCGVGC-UHFFFAOYSA-N n-hydroxy-8-[4-(2-naphthalen-2-yloxyacetyl)piperazin-1-yl]-8-oxooctanamide Chemical compound C1CN(C(=O)CCCCCCC(=O)NO)CCN1C(=O)COC1=CC=C(C=CC=C2)C2=C1 KSFIMSZMTCGVGC-UHFFFAOYSA-N 0.000 description 1
- NQOUXDNAZHJDHV-UHFFFAOYSA-N n-hydroxy-8-[4-(2-naphthalen-2-yloxyethyl)piperazin-1-yl]-8-oxooctanamide Chemical compound C1CN(C(=O)CCCCCCC(=O)NO)CCN1CCOC1=CC=C(C=CC=C2)C2=C1 NQOUXDNAZHJDHV-UHFFFAOYSA-N 0.000 description 1
- HMVHXQKUDLGYJO-UHFFFAOYSA-N n-hydroxy-8-[4-(3-methoxyphenyl)piperazin-1-yl]-8-oxooctanamide Chemical compound COC1=CC=CC(N2CCN(CC2)C(=O)CCCCCCC(=O)NO)=C1 HMVHXQKUDLGYJO-UHFFFAOYSA-N 0.000 description 1
- ISWKIRSBHCTXTH-UHFFFAOYSA-N n-hydroxy-8-[4-(4-methoxyphenyl)piperazin-1-yl]-8-oxooctanamide Chemical compound C1=CC(OC)=CC=C1N1CCN(C(=O)CCCCCCC(=O)NO)CC1 ISWKIRSBHCTXTH-UHFFFAOYSA-N 0.000 description 1
- HFVZTMQQAGRPBO-UHFFFAOYSA-N n-hydroxy-8-[4-(4-nitrophenyl)piperazin-1-yl]-8-oxooctanamide Chemical compound C1CN(C(=O)CCCCCCC(=O)NO)CCN1C1=CC=C([N+]([O-])=O)C=C1 HFVZTMQQAGRPBO-UHFFFAOYSA-N 0.000 description 1
- IQBRIIIXKAIALX-UHFFFAOYSA-N n-hydroxy-8-[4-(naphthalene-2-carbonyl)piperazin-1-yl]-8-oxooctanamide Chemical compound C1CN(C(=O)CCCCCCC(=O)NO)CCN1C(=O)C1=CC=C(C=CC=C2)C2=C1 IQBRIIIXKAIALX-UHFFFAOYSA-N 0.000 description 1
- MJJYFFPJBGSWCB-UHFFFAOYSA-N n-hydroxy-8-[4-[2-(1h-indol-3-yl)acetyl]piperazin-1-yl]-8-oxooctanamide Chemical compound C1CN(C(=O)CCCCCCC(=O)NO)CCN1C(=O)CC1=CNC2=CC=CC=C12 MJJYFFPJBGSWCB-UHFFFAOYSA-N 0.000 description 1
- YRWQZPFQDREIKF-UHFFFAOYSA-N n-hydroxy-8-[4-[2-(5-methoxy-1h-indol-3-yl)acetyl]piperazin-1-yl]-8-oxooctanamide Chemical compound C12=CC(OC)=CC=C2NC=C1CC(=O)N1CCN(C(=O)CCCCCCC(=O)NO)CC1 YRWQZPFQDREIKF-UHFFFAOYSA-N 0.000 description 1
- DNNJJKDFQRXPKP-UHFFFAOYSA-N n-hydroxy-8-[4-[2-(5-methoxy-1h-indol-3-yl)ethyl]piperazin-1-yl]-8-oxooctanamide;oxalic acid Chemical compound OC(=O)C(O)=O.C12=CC(OC)=CC=C2NC=C1CCN1CCN(C(=O)CCCCCCC(=O)NO)CC1 DNNJJKDFQRXPKP-UHFFFAOYSA-N 0.000 description 1
- PGRJTTHYVFXAJA-UHFFFAOYSA-N n-hydroxy-8-[4-[4-(n-hydroxy-c-methylcarbonimidoyl)phenyl]piperazin-1-yl]-8-oxooctanamide Chemical compound C1=CC(C(=NO)C)=CC=C1N1CCN(C(=O)CCCCCCC(=O)NO)CC1 PGRJTTHYVFXAJA-UHFFFAOYSA-N 0.000 description 1
- DBOAADHIKCNHJC-UHFFFAOYSA-N n-hydroxy-8-oxo-8-(4-phenylpiperazin-1-yl)octanamide Chemical compound C1CN(C(=O)CCCCCCC(=O)NO)CCN1C1=CC=CC=C1 DBOAADHIKCNHJC-UHFFFAOYSA-N 0.000 description 1
- LFALSEJEAFBUDV-UHFFFAOYSA-N n-hydroxy-8-oxo-8-(4-pyrimidin-2-ylpiperazin-1-yl)octanamide Chemical compound C1CN(C(=O)CCCCCCC(=O)NO)CCN1C1=NC=CC=N1 LFALSEJEAFBUDV-UHFFFAOYSA-N 0.000 description 1
- RXSNHWVHCNWSRB-UHFFFAOYSA-N n-hydroxy-8-oxo-8-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]octanamide Chemical compound C1CN(C(=O)CCCCCCC(=O)NO)CCN1C1=CC=CC(C(F)(F)F)=C1 RXSNHWVHCNWSRB-UHFFFAOYSA-N 0.000 description 1
- KDGKTJGPFXIBEB-UHFFFAOYSA-N n-hydroxyformamide Chemical class ONC=O KDGKTJGPFXIBEB-UHFFFAOYSA-N 0.000 description 1
- 125000003506 n-propoxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 1
- KVBGVZZKJNLNJU-UHFFFAOYSA-M naphthalene-2-sulfonate Chemical compound C1=CC=CC2=CC(S(=O)(=O)[O-])=CC=C21 KVBGVZZKJNLNJU-UHFFFAOYSA-M 0.000 description 1
- 239000007923 nasal drop Substances 0.000 description 1
- 229940100662 nasal drops Drugs 0.000 description 1
- 230000014399 negative regulation of angiogenesis Effects 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 230000001613 neoplastic effect Effects 0.000 description 1
- 230000001537 neural effect Effects 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 125000000018 nitroso group Chemical group N(=O)* 0.000 description 1
- GQPLMRYTRLFLPF-UHFFFAOYSA-N nitrous oxide Inorganic materials [O-][N+]#N GQPLMRYTRLFLPF-UHFFFAOYSA-N 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001736 nosyl group Chemical group S(=O)(=O)(C1=CC=C([N+](=O)[O-])C=C1)* 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 108020004017 nuclear receptors Proteins 0.000 description 1
- 238000003199 nucleic acid amplification method Methods 0.000 description 1
- 102000039446 nucleic acids Human genes 0.000 description 1
- 108020004707 nucleic acids Proteins 0.000 description 1
- 150000007523 nucleic acids Chemical class 0.000 description 1
- 210000004940 nucleus Anatomy 0.000 description 1
- LUHFJLLCZSYACL-UHFFFAOYSA-N o-(2,2,2-trichloroethyl)hydroxylamine Chemical compound NOCC(Cl)(Cl)Cl LUHFJLLCZSYACL-UHFFFAOYSA-N 0.000 description 1
- GWCBVFMHGHMALR-UHFFFAOYSA-N o-(2-trimethylsilylethyl)hydroxylamine Chemical compound C[Si](C)(C)CCON GWCBVFMHGHMALR-UHFFFAOYSA-N 0.000 description 1
- HYDZPXNVHXJHBG-UHFFFAOYSA-N o-benzylhydroxylamine;hydron;chloride Chemical compound Cl.NOCC1=CC=CC=C1 HYDZPXNVHXJHBG-UHFFFAOYSA-N 0.000 description 1
- KKVUFSINQFSJNK-UHFFFAOYSA-N o-tert-butylhydroxylamine Chemical compound CC(C)(C)ON KKVUFSINQFSJNK-UHFFFAOYSA-N 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid group Chemical group C(CCCCCCC\C=C/CCCCCCCC)(=O)O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- 229940006093 opthalmologic coloring agent diagnostic Drugs 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000002892 organic cations Chemical class 0.000 description 1
- 201000008482 osteoarthritis Diseases 0.000 description 1
- 208000008798 osteoma Diseases 0.000 description 1
- 201000008968 osteosarcoma Diseases 0.000 description 1
- 229940127084 other anti-cancer agent Drugs 0.000 description 1
- 230000002611 ovarian Effects 0.000 description 1
- GUVKYQNSMXSMMU-UHFFFAOYSA-N oxane Chemical compound C1CCOCC1.C1CCOCC1 GUVKYQNSMXSMMU-UHFFFAOYSA-N 0.000 description 1
- NFBOHOGPQUYFRF-UHFFFAOYSA-N oxanthrene Chemical compound C1=CC=C2OC3=CC=CC=C3OC2=C1 NFBOHOGPQUYFRF-UHFFFAOYSA-N 0.000 description 1
- AZHVQJLDOFKHPZ-UHFFFAOYSA-N oxathiazine Chemical compound O1SN=CC=C1 AZHVQJLDOFKHPZ-UHFFFAOYSA-N 0.000 description 1
- CQDAMYNQINDRQC-UHFFFAOYSA-N oxatriazole Chemical compound C1=NN=NO1 CQDAMYNQINDRQC-UHFFFAOYSA-N 0.000 description 1
- ATYBXHSAIOKLMG-UHFFFAOYSA-N oxepin Chemical compound O1C=CC=CC=C1 ATYBXHSAIOKLMG-UHFFFAOYSA-N 0.000 description 1
- AHHWIHXENZJRFG-UHFFFAOYSA-N oxetane Chemical compound C1COC1 AHHWIHXENZJRFG-UHFFFAOYSA-N 0.000 description 1
- 150000002923 oximes Chemical class 0.000 description 1
- 125000004043 oxo group Chemical group O=* 0.000 description 1
- 125000005740 oxycarbonyl group Chemical group [*:1]OC([*:2])=O 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 235000020636 oyster Nutrition 0.000 description 1
- CFJYNSNXFXLKNS-UHFFFAOYSA-N p-menthane Chemical compound CC(C)C1CCC(C)CC1 CFJYNSNXFXLKNS-UHFFFAOYSA-N 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- IPCSVZSSVZVIGE-UHFFFAOYSA-N palmitic acid group Chemical group C(CCCCCCCCCCCCCCC)(=O)O IPCSVZSSVZVIGE-UHFFFAOYSA-N 0.000 description 1
- 210000000496 pancreas Anatomy 0.000 description 1
- 208000008443 pancreatic carcinoma Diseases 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- RUVINXPYWBROJD-UHFFFAOYSA-N para-methoxyphenyl Natural products COC1=CC=C(C=CC)C=C1 RUVINXPYWBROJD-UHFFFAOYSA-N 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 208000014837 parasitic helminthiasis infectious disease Diseases 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000011236 particulate material Substances 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 125000002958 pentadecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002255 pentenyl group Chemical group C(=CCCC)* 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000000081 peptide deformylase inhibitor Substances 0.000 description 1
- 239000000137 peptide hydrolase inhibitor Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000008251 pharmaceutical emulsion Substances 0.000 description 1
- 229940124531 pharmaceutical excipient Drugs 0.000 description 1
- NQFOGDIWKQWFMN-UHFFFAOYSA-N phenalene Chemical compound C1=CC([CH]C=C2)=C3C2=CC=CC3=C1 NQFOGDIWKQWFMN-UHFFFAOYSA-N 0.000 description 1
- 229950000688 phenothiazine Drugs 0.000 description 1
- GJSGGHOYGKMUPT-UHFFFAOYSA-N phenoxathiine Chemical compound C1=CC=C2OC3=CC=CC=C3SC2=C1 GJSGGHOYGKMUPT-UHFFFAOYSA-N 0.000 description 1
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical compound OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 1
- 229950009215 phenylbutanoic acid Drugs 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 230000026731 phosphorylation Effects 0.000 description 1
- 238000006366 phosphorylation reaction Methods 0.000 description 1
- 238000002428 photodynamic therapy Methods 0.000 description 1
- LFSXCDWNBUNEEM-UHFFFAOYSA-N phthalazine Chemical compound C1=NN=CC2=CC=CC=C21 LFSXCDWNBUNEEM-UHFFFAOYSA-N 0.000 description 1
- XKJCHHZQLQNZHY-UHFFFAOYSA-N phthalimide Chemical compound C1=CC=C2C(=O)NC(=O)C2=C1 XKJCHHZQLQNZHY-UHFFFAOYSA-N 0.000 description 1
- 125000005545 phthalimidyl group Chemical group 0.000 description 1
- 229930006728 pinane Natural products 0.000 description 1
- IYPZRUYMFDWKSS-UHFFFAOYSA-N piperazin-1-amine Chemical class NN1CCNCC1 IYPZRUYMFDWKSS-UHFFFAOYSA-N 0.000 description 1
- IWELDVXSEVIIGI-UHFFFAOYSA-N piperazin-2-one Chemical compound O=C1CNCCN1 IWELDVXSEVIIGI-UHFFFAOYSA-N 0.000 description 1
- 150000004885 piperazines Chemical class 0.000 description 1
- LVEAYTYVOHMNSV-UHFFFAOYSA-N piperidin-2-one Chemical compound OC1=NCCCC1.O=C1CCCCN1 LVEAYTYVOHMNSV-UHFFFAOYSA-N 0.000 description 1
- CNMOHEDUVVUVPP-UHFFFAOYSA-N piperidine-2,3-dione Chemical compound O=C1CCCNC1=O CNMOHEDUVVUVPP-UHFFFAOYSA-N 0.000 description 1
- KNCYXPMJDCCGSJ-UHFFFAOYSA-N piperidine-2,6-dione Chemical compound O=C1CCCC(=O)N1 KNCYXPMJDCCGSJ-UHFFFAOYSA-N 0.000 description 1
- 239000013612 plasmid Substances 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 230000029279 positive regulation of transcription, DNA-dependent Effects 0.000 description 1
- 230000001323 posttranslational effect Effects 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 150000003138 primary alcohols Chemical class 0.000 description 1
- 230000005522 programmed cell death Effects 0.000 description 1
- 230000035755 proliferation Effects 0.000 description 1
- 125000006238 prop-1-en-1-yl group Chemical group [H]\C(*)=C(/[H])C([H])([H])[H] 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 238000011321 prophylaxis Methods 0.000 description 1
- 229960000380 propiolactone Drugs 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000004405 propyl p-hydroxybenzoate Substances 0.000 description 1
- 235000010232 propyl p-hydroxybenzoate Nutrition 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- RUOJZAUFBMNUDX-UHFFFAOYSA-N propylene carbonate Chemical compound CC1COC(=O)O1 RUOJZAUFBMNUDX-UHFFFAOYSA-N 0.000 description 1
- 235000013772 propylene glycol Nutrition 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- QELSKZZBTMNZEB-UHFFFAOYSA-N propylparaben Chemical compound CCCOC(=O)C1=CC=C(O)C=C1 QELSKZZBTMNZEB-UHFFFAOYSA-N 0.000 description 1
- 150000003215 pyranoses Chemical class 0.000 description 1
- CRTBNOWPBHJICM-UHFFFAOYSA-N pyrazine Chemical compound C1=CN=CC=N1.C1=CN=CC=N1 CRTBNOWPBHJICM-UHFFFAOYSA-N 0.000 description 1
- 125000004289 pyrazol-3-yl group Chemical group [H]N1N=C(*)C([H])=C1[H] 0.000 description 1
- UBRJWPDONDYLLX-UHFFFAOYSA-N pyrazolidine Chemical compound C1CNNC1.C1CNNC1 UBRJWPDONDYLLX-UHFFFAOYSA-N 0.000 description 1
- IOXGEAHHEGTLMQ-UHFFFAOYSA-N pyridazine Chemical compound C1=CC=NN=C1.C1=CC=NN=C1 IOXGEAHHEGTLMQ-UHFFFAOYSA-N 0.000 description 1
- ILVXOBCQQYKLDS-UHFFFAOYSA-N pyridine N-oxide Chemical compound [O-][N+]1=CC=CC=C1 ILVXOBCQQYKLDS-UHFFFAOYSA-N 0.000 description 1
- VTGOHKSTWXHQJK-UHFFFAOYSA-N pyrimidin-2-ol Chemical compound OC1=NC=CC=N1 VTGOHKSTWXHQJK-UHFFFAOYSA-N 0.000 description 1
- YMXFJTUQQVLJEN-UHFFFAOYSA-N pyrimidine Chemical compound C1=CN=CN=C1.C1=CN=CN=C1 YMXFJTUQQVLJEN-UHFFFAOYSA-N 0.000 description 1
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical compound O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 description 1
- DHERNFAJQNHYBM-UHFFFAOYSA-N pyrrolidin-2-one Chemical compound O=C1CCCN1.O=C1CCCN1 DHERNFAJQNHYBM-UHFFFAOYSA-N 0.000 description 1
- ZVJHJDDKYZXRJI-UHFFFAOYSA-N pyrroline Natural products C1CC=NC1 ZVJHJDDKYZXRJI-UHFFFAOYSA-N 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- JWVCLYRUEFBMGU-UHFFFAOYSA-N quinazoline Chemical compound N1=CN=CC2=CC=CC=C21 JWVCLYRUEFBMGU-UHFFFAOYSA-N 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 238000001959 radiotherapy Methods 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 230000025053 regulation of cell proliferation Effects 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 230000004043 responsiveness Effects 0.000 description 1
- 208000037803 restenosis Diseases 0.000 description 1
- 238000012552 review Methods 0.000 description 1
- OHRURASPPZQGQM-GCCNXGTGSA-N romidepsin Chemical compound O1C(=O)[C@H](C(C)C)NC(=O)C(=C/C)/NC(=O)[C@H]2CSSCC\C=C\[C@@H]1CC(=O)N[C@H](C(C)C)C(=O)N2 OHRURASPPZQGQM-GCCNXGTGSA-N 0.000 description 1
- YGSDEFSMJLZEOE-UHFFFAOYSA-M salicylate Chemical compound OC1=CC=CC=C1C([O-])=O YGSDEFSMJLZEOE-UHFFFAOYSA-M 0.000 description 1
- 229960001860 salicylate Drugs 0.000 description 1
- 235000019515 salmon Nutrition 0.000 description 1
- 238000003345 scintillation counting Methods 0.000 description 1
- 238000012216 screening Methods 0.000 description 1
- 125000005920 sec-butoxy group Chemical group 0.000 description 1
- 238000002805 secondary assay Methods 0.000 description 1
- 239000011669 selenium Substances 0.000 description 1
- 229910052711 selenium Inorganic materials 0.000 description 1
- XIIOFHFUYBLOLW-UHFFFAOYSA-N selpercatinib Chemical compound OC(COC=1C=C(C=2N(C=1)N=CC=2C#N)C=1C=NC(=CC=1)N1CC2N(C(C1)C2)CC=1C=NC(=CC=1)OC)(C)C XIIOFHFUYBLOLW-UHFFFAOYSA-N 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 125000003607 serino group Chemical group [H]N([H])[C@]([H])(C(=O)[*])C(O[H])([H])[H] 0.000 description 1
- 238000007493 shaping process Methods 0.000 description 1
- 208000007056 sickle cell anemia Diseases 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- XGVXKJKTISMIOW-ZDUSSCGKSA-N simurosertib Chemical compound N1N=CC(C=2SC=3C(=O)NC(=NC=3C=2)[C@H]2N3CCC(CC3)C2)=C1C XGVXKJKTISMIOW-ZDUSSCGKSA-N 0.000 description 1
- 238000001542 size-exclusion chromatography Methods 0.000 description 1
- 201000000849 skin cancer Diseases 0.000 description 1
- 208000017520 skin disease Diseases 0.000 description 1
- 208000000587 small cell lung carcinoma Diseases 0.000 description 1
- 210000002460 smooth muscle Anatomy 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- MFBOGIVSZKQAPD-UHFFFAOYSA-M sodium butyrate Chemical compound [Na+].CCCC([O-])=O MFBOGIVSZKQAPD-UHFFFAOYSA-M 0.000 description 1
- 235000017550 sodium carbonate Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000008354 sodium chloride injection Substances 0.000 description 1
- AJPJDKMHJJGVTQ-UHFFFAOYSA-M sodium dihydrogen phosphate Chemical compound [Na+].OP(O)([O-])=O AJPJDKMHJJGVTQ-UHFFFAOYSA-M 0.000 description 1
- 229910000162 sodium phosphate Inorganic materials 0.000 description 1
- 239000008109 sodium starch glycolate Substances 0.000 description 1
- 229940079832 sodium starch glycolate Drugs 0.000 description 1
- 229920003109 sodium starch glycolate Polymers 0.000 description 1
- 239000002594 sorbent Substances 0.000 description 1
- 239000004334 sorbic acid Substances 0.000 description 1
- 235000010199 sorbic acid Nutrition 0.000 description 1
- 229940075582 sorbic acid Drugs 0.000 description 1
- LBJQKYPPYSCCBH-UHFFFAOYSA-N spiro[3.3]heptane Chemical compound C1CCC21CCC2 LBJQKYPPYSCCBH-UHFFFAOYSA-N 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- 210000002784 stomach Anatomy 0.000 description 1
- 201000000498 stomach carcinoma Diseases 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 125000005504 styryl group Chemical group 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 229940014800 succinic anhydride Drugs 0.000 description 1
- 229960002317 succinimide Drugs 0.000 description 1
- 150000005846 sugar alcohols Polymers 0.000 description 1
- BUUPQKDIAURBJP-UHFFFAOYSA-N sulfinic acid Chemical compound OS=O BUUPQKDIAURBJP-UHFFFAOYSA-N 0.000 description 1
- 125000001010 sulfinic acid amide group Chemical group 0.000 description 1
- 150000003451 sulfinic acid amides Chemical class 0.000 description 1
- 150000003453 sulfinic acid esters Chemical class 0.000 description 1
- 125000000213 sulfino group Chemical group [H]OS(*)=O 0.000 description 1
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 description 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 125000001174 sulfone group Chemical group 0.000 description 1
- 150000003459 sulfonic acid esters Chemical class 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 238000001356 surgical procedure Methods 0.000 description 1
- 230000004083 survival effect Effects 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 238000013268 sustained release Methods 0.000 description 1
- 239000012730 sustained-release form Substances 0.000 description 1
- 210000000225 synapse Anatomy 0.000 description 1
- 238000001308 synthesis method Methods 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- LRBQNJMCXXYXIU-NRMVVENXSA-N tannic acid Chemical compound OC1=C(O)C(O)=CC(C(=O)OC=2C(=C(O)C=C(C=2)C(=O)OC[C@@H]2[C@H]([C@H](OC(=O)C=3C=C(OC(=O)C=4C=C(O)C(O)=C(O)C=4)C(O)=C(O)C=3)[C@@H](OC(=O)C=3C=C(OC(=O)C=4C=C(O)C(O)=C(O)C=4)C(O)=C(O)C=3)[C@@H](OC(=O)C=3C=C(OC(=O)C=4C=C(O)C(O)=C(O)C=4)C(O)=C(O)C=3)O2)OC(=O)C=2C=C(OC(=O)C=3C=C(O)C(O)=C(O)C=3)C(O)=C(O)C=2)O)=C1 LRBQNJMCXXYXIU-NRMVVENXSA-N 0.000 description 1
- 235000015523 tannic acid Nutrition 0.000 description 1
- 229920002258 tannic acid Polymers 0.000 description 1
- 229940033123 tannic acid Drugs 0.000 description 1
- 125000003666 tauryl group Chemical group [H]N([H])C([H])([H])C([H])([H])S(*)(=O)=O 0.000 description 1
- 125000004213 tert-butoxy group Chemical group [H]C([H])([H])C(O*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- FGTJJHCZWOVVNH-UHFFFAOYSA-N tert-butyl-[tert-butyl(dimethyl)silyl]oxy-dimethylsilane Chemical compound CC(C)(C)[Si](C)(C)O[Si](C)(C)C(C)(C)C FGTJJHCZWOVVNH-UHFFFAOYSA-N 0.000 description 1
- 201000003120 testicular cancer Diseases 0.000 description 1
- IFLREYGFSNHWGE-UHFFFAOYSA-N tetracene Chemical compound C1=CC=CC2=CC3=CC4=CC=CC=C4C=C3C=C21 IFLREYGFSNHWGE-UHFFFAOYSA-N 0.000 description 1
- KHVCOYGKHDJPBZ-WDCZJNDASA-N tetrahydrooxazine Chemical compound OC[C@H]1ONC[C@@H](O)[C@@H]1O KHVCOYGKHDJPBZ-WDCZJNDASA-N 0.000 description 1
- OULAJFUGPPVRBK-UHFFFAOYSA-N tetratriacontyl alcohol Natural products CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCO OULAJFUGPPVRBK-UHFFFAOYSA-N 0.000 description 1
- 150000003536 tetrazoles Chemical class 0.000 description 1
- 238000010257 thawing Methods 0.000 description 1
- GVIJJXMXTUZIOD-UHFFFAOYSA-N thianthrene Chemical compound C1=CC=C2SC3=CC=CC=C3SC2=C1 GVIJJXMXTUZIOD-UHFFFAOYSA-N 0.000 description 1
- CBDKQYKMCICBOF-UHFFFAOYSA-N thiazoline Chemical compound C1CN=CS1 CBDKQYKMCICBOF-UHFFFAOYSA-N 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- JWCVYQRPINPYQJ-UHFFFAOYSA-N thiepane Chemical compound C1CCCSCC1 JWCVYQRPINPYQJ-UHFFFAOYSA-N 0.000 description 1
- XSROQCDVUIHRSI-UHFFFAOYSA-N thietane Chemical compound C1CSC1 XSROQCDVUIHRSI-UHFFFAOYSA-N 0.000 description 1
- VOVUARRWDCVURC-UHFFFAOYSA-N thiirane Chemical compound C1CS1 VOVUARRWDCVURC-UHFFFAOYSA-N 0.000 description 1
- 125000005300 thiocarboxy group Chemical group C(=S)(O)* 0.000 description 1
- 150000003566 thiocarboxylic acids Chemical class 0.000 description 1
- BQAJJINKFRRSFO-UHFFFAOYSA-N thiolane Chemical compound C1CCSC1.C1CCSC1 BQAJJINKFRRSFO-UHFFFAOYSA-N 0.000 description 1
- BRNULMACUQOKMR-UHFFFAOYSA-N thiomorpholine Chemical compound C1CSCCN1 BRNULMACUQOKMR-UHFFFAOYSA-N 0.000 description 1
- 125000005505 thiomorpholino group Chemical group 0.000 description 1
- WEMNATFLVGEPEW-UHFFFAOYSA-N thiophene Chemical compound C=1C=CSC=1.C=1C=CSC=1 WEMNATFLVGEPEW-UHFFFAOYSA-N 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 239000012049 topical pharmaceutical composition Substances 0.000 description 1
- 125000002088 tosyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])S(*)(=O)=O 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- WBYWAXJHAXSJNI-VOTSOKGWSA-N trans-cinnamic acid Chemical compound OC(=O)\C=C\C1=CC=CC=C1 WBYWAXJHAXSJNI-VOTSOKGWSA-N 0.000 description 1
- 108091006108 transcriptional coactivators Proteins 0.000 description 1
- 230000037426 transcriptional repression Effects 0.000 description 1
- 108091006107 transcriptional repressors Proteins 0.000 description 1
- 238000001890 transfection Methods 0.000 description 1
- 230000001131 transforming effect Effects 0.000 description 1
- 108010060597 trapoxin A Proteins 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- CYRMSUTZVYGINF-UHFFFAOYSA-N trichlorofluoromethane Chemical compound FC(Cl)(Cl)Cl CYRMSUTZVYGINF-UHFFFAOYSA-N 0.000 description 1
- 229940029284 trichlorofluoromethane Drugs 0.000 description 1
- 125000002889 tridecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001889 triflyl group Chemical group FC(F)(F)S(*)(=O)=O 0.000 description 1
- 150000004684 trihydrates Chemical class 0.000 description 1
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 229960000281 trometamol Drugs 0.000 description 1
- 201000002311 trypanosomiasis Diseases 0.000 description 1
- 125000002948 undecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 210000003932 urinary bladder Anatomy 0.000 description 1
- 201000005112 urinary bladder cancer Diseases 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- PXXNTAGJWPJAGM-UHFFFAOYSA-N vertaline Natural products C1C2C=3C=C(OC)C(OC)=CC=3OC(C=C3)=CC=C3CCC(=O)OC1CC1N2CCCC1 PXXNTAGJWPJAGM-UHFFFAOYSA-N 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 230000009385 viral infection Effects 0.000 description 1
- 239000003039 volatile agent Substances 0.000 description 1
- 239000011534 wash buffer Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000008215 water for injection Substances 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 125000005023 xylyl group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/74—Amino or imino radicals substituted by hydrocarbon or substituted hydrocarbon radicals
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P17/00—Drugs for dermatological disorders
- A61P17/06—Antipsoriatics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/14—Drugs for disorders of the nervous system for treating abnormal movements, e.g. chorea, dyskinesia
- A61P25/16—Anti-Parkinson drugs
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/28—Drugs for disorders of the nervous system for treating neurodegenerative disorders of the central nervous system, e.g. nootropic agents, cognition enhancers, drugs for treating Alzheimer's disease or other forms of dementia
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/32—One oxygen, sulfur or nitrogen atom
- C07D239/42—One nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/16—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms
- C07D295/18—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms by radicals derived from carboxylic acids, or sulfur or nitrogen analogues thereof
- C07D295/182—Radicals derived from carboxylic acids
- C07D295/185—Radicals derived from carboxylic acids from aliphatic carboxylic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/16—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms
- C07D295/18—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms by radicals derived from carboxylic acids, or sulfur or nitrogen analogues thereof
- C07D295/182—Radicals derived from carboxylic acids
- C07D295/192—Radicals derived from carboxylic acids from aromatic carboxylic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/22—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with hetero atoms directly attached to ring nitrogen atoms
- C07D295/26—Sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/44—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D317/46—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems condensed with one six-membered ring
- C07D317/48—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring
- C07D317/50—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to atoms of the carbocyclic ring
- C07D317/58—Radicals substituted by nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/50—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom condensed with carbocyclic rings or ring systems
- C07D333/52—Benzo[b]thiophenes; Hydrogenated benzo[b]thiophenes
- C07D333/54—Benzo[b]thiophenes; Hydrogenated benzo[b]thiophenes with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to carbon atoms of the hetero ring
- C07D333/60—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Engineering & Computer Science (AREA)
- Pharmacology & Pharmacy (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Medicinal Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- General Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Neurosurgery (AREA)
- Neurology (AREA)
- Biomedical Technology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Psychiatry (AREA)
- Psychology (AREA)
- Dermatology (AREA)
- Hospice & Palliative Care (AREA)
- Plural Heterocyclic Compounds (AREA)
- Heterocyclic Compounds That Contain Two Or More Ring Oxygen Atoms (AREA)
- Indole Compounds (AREA)
- Pyridine Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Hydrogenated Pyridines (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US36933702P | 2002-04-03 | 2002-04-03 | |
| US60/369,337 | 2002-04-03 | ||
| PCT/GB2003/001463 WO2003082288A1 (en) | 2002-04-03 | 2003-04-03 | Carbamic acid compounds comprising a piperazine linkage as hdac inhibitors |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| CA2479906A1 CA2479906A1 (en) | 2003-10-09 |
| CA2479906C true CA2479906C (en) | 2011-02-08 |
Family
ID=28675576
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA2479906A Expired - Fee Related CA2479906C (en) | 2002-04-03 | 2003-04-03 | Carbamic acid compounds comprising a piperazine linkage as hdac inhibitors |
Country Status (13)
| Country | Link |
|---|---|
| US (3) | US7629343B2 (enExample) |
| EP (1) | EP1492534B1 (enExample) |
| JP (1) | JP4606027B2 (enExample) |
| AT (1) | ATE399012T1 (enExample) |
| AU (1) | AU2003229883B2 (enExample) |
| BR (1) | BR0308908A (enExample) |
| CA (1) | CA2479906C (enExample) |
| DE (1) | DE60321775D1 (enExample) |
| ES (1) | ES2309313T3 (enExample) |
| MX (1) | MXPA04009490A (enExample) |
| NO (1) | NO329942B1 (enExample) |
| NZ (1) | NZ536116A (enExample) |
| WO (1) | WO2003082288A1 (enExample) |
Families Citing this family (75)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US7517884B2 (en) | 1998-03-30 | 2009-04-14 | Kalypsys Inc. | Sulfonyl-substituted bicyclic compounds as modulators of PPAR |
| ES2347544T3 (es) | 2002-03-13 | 2010-11-02 | Janssen Pharmaceutica Nv | Inhibidores de histona-desacetilasas. |
| PL208401B1 (pl) | 2002-03-13 | 2011-04-29 | Janssen Pharmaceutica Nv | Pochodne piperazynylowe, piperydynylowe i morfolinylowe, sposób ich wytwarzania, kompozycja je zawierająca oraz ich zastosowanie |
| NZ534771A (en) | 2002-03-13 | 2006-04-28 | Janssen Pharmaceutica Nv | Sulfonylamino-derivatives as novel inhibitors of histone deacetylase |
| ES2306858T3 (es) | 2002-03-13 | 2008-11-16 | Janssen Pharmaceutica Nv | Derivados de carbonilamino como nuevos inhibidores de las histonadesacetilasas. |
| EP1492534B1 (en) * | 2002-04-03 | 2008-06-25 | TopoTarget UK Limited | Carbamic acid compounds comprising a piperazine linkage as hdac inhibitors |
| US7154002B1 (en) | 2002-10-08 | 2006-12-26 | Takeda San Diego, Inc. | Histone deacetylase inhibitors |
| US7250514B1 (en) | 2002-10-21 | 2007-07-31 | Takeda San Diego, Inc. | Histone deacetylase inhibitors |
| US7135493B2 (en) * | 2003-01-13 | 2006-11-14 | Astellas Pharma Inc. | HDAC inhibitor |
| JP4790594B2 (ja) | 2003-02-25 | 2011-10-12 | トポターゲット ユーケー リミテッド | Hdacインヒビターとしての、二環式ヘテロアリール基を含むヒドロキサム酸化合物 |
| US7169801B2 (en) | 2003-03-17 | 2007-01-30 | Takeda San Diego, Inc. | Histone deacetylase inhibitors |
| EP1694329A4 (en) * | 2003-11-26 | 2009-06-03 | Aton Pharma Inc | DIAMOND AND IMINODIACETIC ACID HYDROXAMINIC DERIVATIVES |
| GB0401876D0 (en) | 2004-01-28 | 2004-03-03 | Vereniging Het Nl Kanker I | New use for cancer antigen |
| WO2006017215A2 (en) * | 2004-07-12 | 2006-02-16 | Merck & Co., Inc. | Histone deacetylase inhibitors |
| KR101261305B1 (ko) | 2004-07-28 | 2013-05-08 | 얀센 파마슈티카 엔.브이. | 히스톤 디아세틸라제의 신규한 저해제로의 치환된 인돌릴알킬 아미노 유도체 |
| DK1776358T3 (da) * | 2004-07-28 | 2009-09-07 | Janssen Pharmaceutica Nv | Substituerede propenylpiperazinderivater som nye inhibitorer af histondeacetylase |
| UA86066C2 (ru) | 2004-07-28 | 2009-03-25 | Янссен Фармацевтика Н.В. | Производные замещенного пропенилпиперазина как ингибиторы гистондеацетилазы |
| GB2417682A (en) * | 2004-08-18 | 2006-03-08 | Univ East Anglia | Histone deacetylse inhibitor for treating connective tissue disorders |
| DK1805158T3 (en) | 2004-10-29 | 2018-08-06 | Kalypsys Inc | SULFONYL-SUBSTITUTED BICYCLIC COMPOUNDS AS MODULATORS OF PPAR |
| US7642275B2 (en) | 2004-12-16 | 2010-01-05 | Takeda San Diego, Inc. | Histone deacetylase inhibitors |
| US20090042901A1 (en) * | 2005-02-02 | 2009-02-12 | Kowa Co., Ltd. | Agent for prevention/therapy of disease caused by keratinocyte growth |
| ITFI20050041A1 (it) * | 2005-03-15 | 2006-09-16 | Menarini Internat Operations Luxembourg Sa | Idrossammati come inibitori dell'istone deacelitasi, loro preparazione e formulazioni farmaceutiche che li contengono |
| GB0509225D0 (en) | 2005-05-05 | 2005-06-15 | Chroma Therapeutics Ltd | Inhibitors of enzymatic activity |
| GB0509223D0 (en) | 2005-05-05 | 2005-06-15 | Chroma Therapeutics Ltd | Enzyme inhibitors |
| US7642253B2 (en) | 2005-05-11 | 2010-01-05 | Takeda San Diego, Inc. | Histone deacetylase inhibitors |
| EA023400B1 (ru) | 2005-05-13 | 2016-05-31 | Топотаргет Юкей Лимитед | Фармацевтические составы, содержащие ингибиторы деацетилазы гистонов |
| WO2006122926A1 (en) | 2005-05-18 | 2006-11-23 | Janssen Pharmaceutica N.V. | Substituted aminopropenyl piperidine or morpholine derivatives as novel inhibitors of histone deacetylase |
| AU2006270322A1 (en) | 2005-07-14 | 2007-01-25 | Takeda San Diego, Inc. | Histone deacetylase inhibitors |
| EP2258359A3 (en) | 2005-08-26 | 2011-04-06 | Braincells, Inc. | Neurogenesis by muscarinic receptor modulation with sabcomelin |
| US7678363B2 (en) | 2005-08-26 | 2010-03-16 | Braincells Inc | Methods of treating psychiatric conditions comprising administration of muscarinic agents in combination with SSRIs |
| WO2007038459A2 (en) * | 2005-09-27 | 2007-04-05 | Novartis Ag | Carboxyamine compounds and their use in the treatment of hdac dependent diseases |
| US20070088043A1 (en) * | 2005-10-18 | 2007-04-19 | Orchid Research Laboratories Limited. | Novel HDAC inhibitors |
| WO2007047978A2 (en) | 2005-10-21 | 2007-04-26 | Braincells, Inc. | Modulation of neurogenesis by pde inhibition |
| WO2007051095A1 (en) | 2005-10-25 | 2007-05-03 | Kalypsys, Inc. | Salts of modulators of ppar and methods of treating metabolic disorders |
| CA2623360C (en) | 2005-10-27 | 2014-04-22 | Janssen Pharmaceutica N.V. | Squaric acid derivatives as inhibitors of histone deacetylase |
| AU2006308889A1 (en) | 2005-10-31 | 2007-05-10 | Braincells, Inc. | GABA receptor mediated modulation of neurogenesis |
| US8828392B2 (en) | 2005-11-10 | 2014-09-09 | Topotarget Uk Limited | Histone deacetylase (HDAC) inhibitors (PXD101) for the treatment of cancer alone or in combination with chemotherapeutic agent |
| CA2632027A1 (en) | 2005-12-14 | 2007-06-21 | Amgen Inc. | Diaza heterocyclic sulfonamide derivatives and their uses |
| AU2007206950B2 (en) | 2006-01-19 | 2012-02-02 | Janssen Pharmaceutica N.V. | Substituted indolyl-alkyl-amino-derivatives as inhibitors of histone deacetylase |
| DK1981871T3 (da) | 2006-01-19 | 2012-02-13 | Janssen Pharmaceutica Nv | Heterocyclylalkylderivater som hidtil ukendte inhibitorer af histondeacetylase |
| CA2633100C (en) | 2006-01-19 | 2014-12-09 | Janssen Pharmaceutica N.V. | Pyridine and pyrimidine derivatives as inhibitors of histone deacetylase |
| WO2007082876A1 (en) | 2006-01-19 | 2007-07-26 | Janssen Pharmaceutica N.V. | Pyridine and pyrimidine derivatives as inhibitors of histone deacetylase |
| ES2327972T3 (es) | 2006-01-19 | 2009-11-05 | Janssen Pharmaceutica, N.V. | Derivados de aminofenil como nuevos inhibidores de histona deacetilasa. |
| AU2007206942B2 (en) | 2006-01-19 | 2012-08-23 | Janssen Pharmaceutica N.V. | Pyridine and pyrimidine derivatives as inhibitors of histone deacetylase |
| CN101379059A (zh) | 2006-02-07 | 2009-03-04 | 安斯泰来制药有限公司 | N-羟基丙烯酰胺化合物 |
| US20100216734A1 (en) | 2006-03-08 | 2010-08-26 | Braincells, Inc. | Modulation of neurogenesis by nootropic agents |
| CA2651813A1 (en) | 2006-05-09 | 2007-11-22 | Braincells, Inc. | Neurogenesis by modulating angiotensin |
| WO2007134077A2 (en) | 2006-05-09 | 2007-11-22 | Braincells, Inc. | 5 ht receptor mediated neurogenesis |
| CA2662491A1 (en) | 2006-09-08 | 2008-03-13 | Braincells, Inc. | Combinations containing a 4-acylaminopyridine derivative |
| US20100184806A1 (en) | 2006-09-19 | 2010-07-22 | Braincells, Inc. | Modulation of neurogenesis by ppar agents |
| GB0619753D0 (en) | 2006-10-06 | 2006-11-15 | Chroma Therapeutics Ltd | Enzyme inhibitors |
| BRPI0622100A2 (pt) | 2006-10-30 | 2011-12-27 | Chroma Therapeutics Ltd | hidroxamatos como inibidores de desacetilase de histona |
| WO2008091863A1 (en) | 2007-01-23 | 2008-07-31 | Kalypsys, Inc. | Sulfonyl-substituted bicyclic compounds as ppar modulators for the treatment of non-alcoholic steatohepatitis |
| EP2203421B1 (en) | 2007-09-25 | 2014-05-07 | TopoTarget UK Limited | Methods of synthesis of certain n-hydroxy-3-(3-phenylsulfamoyl-phenyl)-acrylamide compounds |
| AU2008338631A1 (en) | 2007-12-14 | 2009-06-25 | Georgetown University | Histone deacetylase inhibitors |
| ES2395347T3 (es) | 2008-03-27 | 2013-02-12 | Janssen Pharmaceutica, N.V. | Derivados de indolilalquilamino sustituidos con aza-biciclohexilo como inhibidores novedosos de histona desacetilasa |
| WO2010001366A1 (en) * | 2008-07-04 | 2010-01-07 | Institut National De La Sante Et De La Recherche Medicale (Inserm) | Piperazines derivatives as proteasome modulators |
| WO2010099217A1 (en) | 2009-02-25 | 2010-09-02 | Braincells, Inc. | Modulation of neurogenesis using d-cycloserine combinations |
| GB0903480D0 (en) | 2009-02-27 | 2009-04-08 | Chroma Therapeutics Ltd | Enzyme Inhibitors |
| SG186885A1 (en) | 2010-06-04 | 2013-02-28 | Albany Molecular Res Inc | Glycine transporter-1 inhibitors, methods of making them, and uses thereof |
| US8609672B2 (en) | 2010-08-27 | 2013-12-17 | University Of The Pacific | Piperazinylpyrimidine analogues as protein kinase inhibitors |
| US8546397B2 (en) * | 2010-12-20 | 2013-10-01 | The Ohio State University Research Foundation | DNA methylation inhibitors |
| CN102260225B (zh) * | 2011-06-02 | 2013-08-21 | 蒋杰 | 用于抑制肿瘤转移和肿瘤血管生长的苯基哌嗪类衍生物 |
| WO2013066831A1 (en) * | 2011-10-31 | 2013-05-10 | Glaxosmithkline Llc | Compounds and methods |
| EP2797875A4 (en) * | 2011-12-29 | 2015-09-02 | Pharmacyclics Inc | CINNAMIC ACID HYDROXYAMIDES AS HISTONE DEACETYLASE INHIBITORS 8 |
| SG11201507320QA (en) | 2013-03-15 | 2015-10-29 | Global Blood Therapeutics Inc | Compounds and uses thereof for the modulation of hemoglobin |
| EP3062783B1 (en) | 2013-10-18 | 2020-08-12 | The General Hospital Corporation | Imaging histone deacetylases with a radiotracer using positron emission tomography |
| EA201992707A1 (ru) | 2013-11-18 | 2020-06-30 | Глобал Блад Терапьютикс, Инк. | Соединения и их применения для модуляции гемоглобина |
| EP3116859B1 (en) * | 2014-03-12 | 2018-08-01 | Chong Kun Dang Pharmaceutical Corp. | Novel compounds as histone deacetylase 6 inhibitors and pharmaceutical compositions comprising the same |
| US10478431B2 (en) | 2014-11-26 | 2019-11-19 | The J. David Gladstone Institutes | Methods for treating a cytomegalovirus infection |
| CA2979391C (en) | 2015-03-13 | 2023-10-17 | Forma Therapeutics, Inc. | Alpha-cinnamide compounds and compositions as hdac8 inhibitors |
| PL3297992T3 (pl) * | 2015-05-22 | 2020-07-27 | Chong Kun Dang Pharmaceutical Corp. | Heterocykloalkilowe związki pochodne jako selektywne inhibitory deacetylazy histonowej oraz zawierające je kompozycje farmaceutyczne |
| WO2018165520A1 (en) | 2017-03-10 | 2018-09-13 | Vps-3, Inc. | Metalloenzyme inhibitor compounds |
| WO2020186101A1 (en) | 2019-03-12 | 2020-09-17 | The Broad Institute, Inc. | Detection means, compositions and methods for modulating synovial sarcoma cells |
| EP4281449A1 (en) * | 2021-01-20 | 2023-11-29 | Lightox Limited | Protected hdac (histone deacetylase) inhibitors |
Family Cites Families (37)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5318964A (en) | 1992-06-11 | 1994-06-07 | Hoffmann-La Roche Inc. | Hydroxamic derivatives and pharmaceutical compositions |
| JPH0775593A (ja) * | 1993-09-08 | 1995-03-20 | Suntory Ltd | 蛋白質の製造方法 |
| JPH07278086A (ja) * | 1993-11-08 | 1995-10-24 | Terumo Corp | ヒドロキサム酸誘導体およびそれを含有する医薬製剤 |
| GB9501737D0 (en) | 1994-04-25 | 1995-03-22 | Hoffmann La Roche | Hydroxamic acid derivatives |
| EP0827742A1 (en) | 1996-09-04 | 1998-03-11 | Vrije Universiteit Brussel | Use of histone deacetylase inhibitors for treating fribosis or cirrhosis |
| WO1998032748A1 (en) * | 1997-01-23 | 1998-07-30 | F. Hoffmann-La Roche Ag | Sulfamide-metalloprotease inhibitors |
| CN1254337A (zh) * | 1997-03-04 | 2000-05-24 | 孟山都公司 | N-羟基4-磺酰基丁酰胺化合物 |
| US6696449B2 (en) * | 1997-03-04 | 2004-02-24 | Pharmacia Corporation | Sulfonyl aryl hydroxamates and their use as matrix metalloprotease inhibitors |
| US7115632B1 (en) * | 1999-05-12 | 2006-10-03 | G. D. Searle & Co. | Sulfonyl aryl or heteroaryl hydroxamic acid compounds |
| JP2001500533A (ja) | 1997-07-10 | 2001-01-16 | フアルマシア・エ・アツプジヨン・エツセ・ピー・アー | マトリックスメタロプロテイナーゼ・インヒビター |
| DK1030836T3 (da) | 1997-11-12 | 2003-05-26 | Darwin Discovery Ltd | Hydroxam- og carboxylsyrederivater der har MMP- og TNF-inhiberende aktivitet |
| PL346011A1 (en) * | 1998-07-21 | 2002-01-14 | Warner Lambert Co | Coadministration of acat and mmp inhibitors for the treatment of atherosclerotic lesions |
| JP2002523492A (ja) | 1998-08-29 | 2002-07-30 | ブリティッシュ バイオテック ファーマシューティカルズ リミテッド | タンパク質分解酵素阻害剤としてのヒドロキサム酸誘導体 |
| GB9919776D0 (en) | 1998-08-31 | 1999-10-27 | Zeneca Ltd | Compoujnds |
| US6492394B1 (en) * | 1998-12-22 | 2002-12-10 | Syntex (U.S.A.) Llc | Sulfonamide hydroxamates |
| EP1149072B1 (en) | 1998-12-22 | 2004-06-30 | F. Hoffmann-La Roche Ag | Sulfonamide hydroxamates |
| JP2002536373A (ja) | 1999-02-08 | 2002-10-29 | ジー・ディー・サール・アンド・カンパニー | スルファメトヒドロキサム酸メタロプロテアーゼ阻害剤 |
| JP2003525203A (ja) * | 1999-03-22 | 2003-08-26 | ダーウィン・ディスカバリー・リミテッド | ヒドロキサムおよびカルボン酸誘導体 |
| GB9911073D0 (en) | 1999-05-12 | 1999-07-14 | Darwin Discovery Ltd | Hydroxamic and carboxylic acid derivatives |
| CA2373500A1 (en) * | 1999-05-12 | 2000-11-23 | G.D. Searle & Co. | Hydroxamic acid derivatives as matrix metalloprotease inhibitors |
| CA2379061C (en) | 1999-08-10 | 2008-12-09 | British Biotech Pharmaceuticals Limited | Antibacterial agents |
| KR20070053362A (ko) * | 1999-11-23 | 2007-05-23 | 메틸진, 인크. | 히스톤 디아세틸라제의 억제제 |
| AU2268401A (en) * | 1999-12-17 | 2001-06-25 | Versicor Inc | Novel succinate compounds, compositions and methods of use and preparation |
| GB9929979D0 (en) | 1999-12-17 | 2000-02-09 | Darwin Discovery Ltd | Hydroxamic acid derivatives |
| US6797820B2 (en) * | 1999-12-17 | 2004-09-28 | Vicuron Pharmaceuticals Inc. | Succinate compounds, compositions and methods of use and preparation |
| US6852752B2 (en) * | 1999-12-17 | 2005-02-08 | Vicuron Pharmaceuticals Inc. | Urea compounds, compositions and methods of use and preparation |
| US6495677B1 (en) * | 2000-02-15 | 2002-12-17 | Kanda S. Ramasamy | Nucleoside compounds |
| US20030139419A1 (en) | 2000-02-21 | 2003-07-24 | Bernard Barlaam | Arylpiperazines and arylpiperidines and their use as metalloproteinase inhibiting agents |
| JP2003533521A (ja) | 2000-05-15 | 2003-11-11 | ダーウィン・ディスカバリー・リミテッド | ヒドロキサム酸誘導体 |
| PE20020354A1 (es) | 2000-09-01 | 2002-06-12 | Novartis Ag | Compuestos de hidroxamato como inhibidores de histona-desacetilasa (hda) |
| WO2002028829A2 (en) | 2000-09-25 | 2002-04-11 | Questcor Pharmaceuticals, Inc. | Peptide deformylase inhibitors |
| NZ525439A (en) | 2000-09-29 | 2004-11-26 | Topotarget Uk Ltd | Carbamic acid compounds comprising a sulfonamide linkage as HDAC inhibitors |
| EP1335898B1 (en) | 2000-09-29 | 2005-11-23 | TopoTarget UK Limited | Carbamic acid compounds comprising an amide linkage as hdac inhibitors |
| GB0023983D0 (en) | 2000-09-29 | 2000-11-15 | Prolifix Ltd | Therapeutic compounds |
| US6784173B2 (en) * | 2001-06-15 | 2004-08-31 | Hoffmann-La Roche Inc. | Aromatic dicarboxylic acid derivatives |
| US6683078B2 (en) * | 2001-07-19 | 2004-01-27 | Pharmacia Corporation | Use of sulfonyl aryl or heteroaryl hydroxamic acids and derivatives thereof as aggrecanase inhibitors |
| EP1492534B1 (en) * | 2002-04-03 | 2008-06-25 | TopoTarget UK Limited | Carbamic acid compounds comprising a piperazine linkage as hdac inhibitors |
-
2003
- 2003-04-03 EP EP03722719A patent/EP1492534B1/en not_active Expired - Lifetime
- 2003-04-03 AU AU2003229883A patent/AU2003229883B2/en not_active Ceased
- 2003-04-03 NZ NZ536116A patent/NZ536116A/en not_active IP Right Cessation
- 2003-04-03 BR BR0308908-8A patent/BR0308908A/pt not_active IP Right Cessation
- 2003-04-03 DE DE60321775T patent/DE60321775D1/de not_active Expired - Lifetime
- 2003-04-03 AT AT03722719T patent/ATE399012T1/de not_active IP Right Cessation
- 2003-04-03 ES ES03722719T patent/ES2309313T3/es not_active Expired - Lifetime
- 2003-04-03 US US10/509,732 patent/US7629343B2/en not_active Expired - Fee Related
- 2003-04-03 JP JP2003579825A patent/JP4606027B2/ja not_active Expired - Fee Related
- 2003-04-03 MX MXPA04009490A patent/MXPA04009490A/es active IP Right Grant
- 2003-04-03 WO PCT/GB2003/001463 patent/WO2003082288A1/en not_active Ceased
- 2003-04-03 CA CA2479906A patent/CA2479906C/en not_active Expired - Fee Related
-
2004
- 2004-11-02 NO NO20044744A patent/NO329942B1/no not_active IP Right Cessation
-
2008
- 2008-07-01 US US12/165,686 patent/US7981895B2/en not_active Expired - Lifetime
-
2011
- 2011-07-18 US US13/184,869 patent/US20110275810A1/en not_active Abandoned
Also Published As
| Publication number | Publication date |
|---|---|
| NZ536116A (en) | 2007-01-26 |
| US7981895B2 (en) | 2011-07-19 |
| AU2003229883A1 (en) | 2003-10-13 |
| BR0308908A (pt) | 2005-01-04 |
| US20080269237A1 (en) | 2008-10-30 |
| NO329942B1 (no) | 2011-01-24 |
| US20050143385A1 (en) | 2005-06-30 |
| ES2309313T3 (es) | 2008-12-16 |
| JP4606027B2 (ja) | 2011-01-05 |
| AU2003229883B2 (en) | 2009-06-11 |
| NO20044744L (no) | 2004-11-02 |
| WO2003082288A1 (en) | 2003-10-09 |
| EP1492534B1 (en) | 2008-06-25 |
| MXPA04009490A (es) | 2005-06-08 |
| US20110275810A1 (en) | 2011-11-10 |
| US7629343B2 (en) | 2009-12-08 |
| CA2479906A1 (en) | 2003-10-09 |
| EP1492534A1 (en) | 2005-01-05 |
| ATE399012T1 (de) | 2008-07-15 |
| JP2005527556A (ja) | 2005-09-15 |
| DE60321775D1 (de) | 2008-08-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA2479906C (en) | Carbamic acid compounds comprising a piperazine linkage as hdac inhibitors | |
| EP1335898B1 (en) | Carbamic acid compounds comprising an amide linkage as hdac inhibitors | |
| US6888027B2 (en) | Carbamic acid compounds comprising a sulfonamide linkage as HDAC inhibitors | |
| US7465719B2 (en) | Carbamic acid compounds comprising an ester or ketone linkage as HDAC inhibitors | |
| US20040198830A1 (en) | Carbamic acid compounds comprising an ether linkage as hdac inhibitors | |
| AU2001290131A1 (en) | Carbamic acid compounds comprising a sulfonamide linkage as HDAC inhibitors | |
| NZ535065A (en) | Carbamic acid compounds comprising a sulfonamide linkage as HDAC inhibitors | |
| CA2765409A1 (en) | Hydroxamic acid compounds comprising a sulfonamide linkage as hdac inhibitors |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| EEER | Examination request | ||
| MKLA | Lapsed |
Effective date: 20160404 |