CA2449256A1 - Modulators of peroxisome proliferator activated receptors - Google Patents
Modulators of peroxisome proliferator activated receptors Download PDFInfo
- Publication number
- CA2449256A1 CA2449256A1 CA002449256A CA2449256A CA2449256A1 CA 2449256 A1 CA2449256 A1 CA 2449256A1 CA 002449256 A CA002449256 A CA 002449256A CA 2449256 A CA2449256 A CA 2449256A CA 2449256 A1 CA2449256 A1 CA 2449256A1
- Authority
- CA
- Canada
- Prior art keywords
- phenyl
- methoxy
- compound
- propionic acid
- phenoxy
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Abandoned
Links
- 102000003728 Peroxisome Proliferator-Activated Receptors Human genes 0.000 title claims description 38
- 108090000029 Peroxisome Proliferator-Activated Receptors Proteins 0.000 title claims description 38
- 150000001875 compounds Chemical class 0.000 claims abstract description 789
- 125000003118 aryl group Chemical group 0.000 claims abstract description 106
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 66
- 125000001931 aliphatic group Chemical group 0.000 claims abstract description 61
- 125000001424 substituent group Chemical group 0.000 claims abstract description 35
- 229910052799 carbon Inorganic materials 0.000 claims abstract description 31
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims abstract description 30
- 125000004474 heteroalkylene group Chemical group 0.000 claims abstract description 22
- 125000002947 alkylene group Chemical group 0.000 claims abstract description 20
- 125000005647 linker group Chemical group 0.000 claims abstract description 18
- 125000004429 atom Chemical group 0.000 claims abstract description 15
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 14
- 125000001188 haloalkyl group Chemical group 0.000 claims abstract description 9
- 229940124530 sulfonamide Drugs 0.000 claims abstract description 9
- 150000003456 sulfonamides Chemical class 0.000 claims abstract description 9
- 150000003536 tetrazoles Chemical class 0.000 claims abstract description 8
- 150000003857 carboxamides Chemical class 0.000 claims abstract description 4
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Substances CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 claims description 253
- 238000000034 method Methods 0.000 claims description 143
- -1 trifluoromethylphenyl Chemical group 0.000 claims description 122
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 111
- NOESYZHRGYRDHS-UHFFFAOYSA-N insulin Chemical compound N1C(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(NC(=O)CN)C(C)CC)CSSCC(C(NC(CO)C(=O)NC(CC(C)C)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CCC(N)=O)C(=O)NC(CC(C)C)C(=O)NC(CCC(O)=O)C(=O)NC(CC(N)=O)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CSSCC(NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2C=CC(O)=CC=2)NC(=O)C(CC(C)C)NC(=O)C(C)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2NC=NC=2)NC(=O)C(CO)NC(=O)CNC2=O)C(=O)NCC(=O)NC(CCC(O)=O)C(=O)NC(CCCNC(N)=N)C(=O)NCC(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC(O)=CC=3)C(=O)NC(C(C)O)C(=O)N3C(CCC3)C(=O)NC(CCCCN)C(=O)NC(C)C(O)=O)C(=O)NC(CC(N)=O)C(O)=O)=O)NC(=O)C(C(C)CC)NC(=O)C(CO)NC(=O)C(C(C)O)NC(=O)C1CSSCC2NC(=O)C(CC(C)C)NC(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CC(N)=O)NC(=O)C(NC(=O)C(N)CC=1C=CC=CC=1)C(C)C)CC1=CN=CN1 NOESYZHRGYRDHS-UHFFFAOYSA-N 0.000 claims description 76
- 102000004877 Insulin Human genes 0.000 claims description 38
- 108090001061 Insulin Proteins 0.000 claims description 38
- 229940125396 insulin Drugs 0.000 claims description 38
- 125000000217 alkyl group Chemical group 0.000 claims description 36
- 150000003839 salts Chemical class 0.000 claims description 36
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims description 35
- 208000001072 type 2 diabetes mellitus Diseases 0.000 claims description 32
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims description 31
- 201000010099 disease Diseases 0.000 claims description 30
- 239000011734 sodium Substances 0.000 claims description 24
- 206010022489 Insulin Resistance Diseases 0.000 claims description 20
- 102000005962 receptors Human genes 0.000 claims description 20
- 108020003175 receptors Proteins 0.000 claims description 20
- 208000024172 Cardiovascular disease Diseases 0.000 claims description 18
- 206010012601 diabetes mellitus Diseases 0.000 claims description 18
- 208000011580 syndromic disease Diseases 0.000 claims description 17
- 239000003814 drug Substances 0.000 claims description 15
- 229940121710 HMGCoA reductase inhibitor Drugs 0.000 claims description 14
- 239000002471 hydroxymethylglutaryl coenzyme A reductase inhibitor Substances 0.000 claims description 14
- 239000008194 pharmaceutical composition Substances 0.000 claims description 14
- 239000012453 solvate Substances 0.000 claims description 14
- 125000006615 aromatic heterocyclic group Chemical group 0.000 claims description 13
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 12
- 206010020772 Hypertension Diseases 0.000 claims description 12
- 208000008589 Obesity Diseases 0.000 claims description 12
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 12
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 12
- 150000004677 hydrates Chemical class 0.000 claims description 12
- 230000001404 mediated effect Effects 0.000 claims description 12
- 235000020824 obesity Nutrition 0.000 claims description 12
- 208000032928 Dyslipidaemia Diseases 0.000 claims description 11
- 208000035150 Hypercholesterolemia Diseases 0.000 claims description 11
- 208000031226 Hyperlipidaemia Diseases 0.000 claims description 11
- 208000017170 Lipid metabolism disease Diseases 0.000 claims description 11
- 229940100389 Sulfonylurea Drugs 0.000 claims description 11
- 229940123464 Thiazolidinedione Drugs 0.000 claims description 11
- 239000008103 glucose Substances 0.000 claims description 11
- 229910052739 hydrogen Inorganic materials 0.000 claims description 11
- 150000001467 thiazolidinediones Chemical class 0.000 claims description 11
- 229940123208 Biguanide Drugs 0.000 claims description 10
- 206010067584 Type 1 diabetes mellitus Diseases 0.000 claims description 10
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 10
- 150000004283 biguanides Chemical class 0.000 claims description 10
- 229940125753 fibrate Drugs 0.000 claims description 10
- 239000001257 hydrogen Substances 0.000 claims description 10
- 201000001421 hyperglycemia Diseases 0.000 claims description 10
- 239000003112 inhibitor Substances 0.000 claims description 10
- 239000007858 starting material Substances 0.000 claims description 10
- 208000000103 Anorexia Nervosa Diseases 0.000 claims description 9
- 208000032841 Bulimia Diseases 0.000 claims description 9
- 206010006550 Bulimia nervosa Diseases 0.000 claims description 9
- 206010019280 Heart failures Diseases 0.000 claims description 9
- 206010036049 Polycystic ovaries Diseases 0.000 claims description 9
- 208000006575 hypertriglyceridemia Diseases 0.000 claims description 9
- 201000010065 polycystic ovary syndrome Diseases 0.000 claims description 9
- 206010070901 Diabetic dyslipidaemia Diseases 0.000 claims description 8
- 229940122355 Insulin sensitizer Drugs 0.000 claims description 8
- 239000003529 anticholesteremic agent Substances 0.000 claims description 8
- 229910052736 halogen Inorganic materials 0.000 claims description 8
- 229940124597 therapeutic agent Drugs 0.000 claims description 8
- JTVLOESLFUNHOP-DEOSSOPVSA-N (2s)-2-methoxy-3-[4-[3-(9-oxofluoren-2-yl)oxyprop-1-ynyl]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1C#CCOC1=CC=C(C=2C(=CC=CC=2)C2=O)C2=C1 JTVLOESLFUNHOP-DEOSSOPVSA-N 0.000 claims description 7
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 claims description 7
- 239000004131 EU approved raising agent Substances 0.000 claims description 7
- 229960001138 acetylsalicylic acid Drugs 0.000 claims description 7
- 125000002252 acyl group Chemical group 0.000 claims description 7
- 239000002404 acyltransferase inhibitor Substances 0.000 claims description 7
- 208000022531 anorexia Diseases 0.000 claims description 7
- 230000003579 anti-obesity Effects 0.000 claims description 7
- 239000003524 antilipemic agent Substances 0.000 claims description 7
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 7
- 230000027455 binding Effects 0.000 claims description 7
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 7
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 7
- 206010061428 decreased appetite Diseases 0.000 claims description 7
- 239000003937 drug carrier Substances 0.000 claims description 7
- 125000000524 functional group Chemical group 0.000 claims description 7
- 150000002367 halogens Chemical class 0.000 claims description 7
- 229940096701 plain lipid modifying drug hmg coa reductase inhibitors Drugs 0.000 claims description 7
- 229940088594 vitamin Drugs 0.000 claims description 7
- 239000011782 vitamin Substances 0.000 claims description 7
- 235000013343 vitamin Nutrition 0.000 claims description 7
- 229930003231 vitamin Natural products 0.000 claims description 7
- JNRWXSZWQCIZQM-MHZLTWQESA-N (2s)-2-methoxy-3-[4-[3-(4-oxo-2-phenylchromen-7-yl)oxyprop-1-ynyl]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1C#CCOC1=CC=C2C(=O)C=C(C=3C=CC=CC=3)OC2=C1 JNRWXSZWQCIZQM-MHZLTWQESA-N 0.000 claims description 6
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 6
- 239000005977 Ethylene Substances 0.000 claims description 6
- 108010016731 PPAR gamma Proteins 0.000 claims description 6
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 6
- 229910052708 sodium Inorganic materials 0.000 claims description 6
- LBBWNQRWWVERQX-QFIPXVFZSA-N (2s)-2-methoxy-3-[4-[3-(5,6,7,8-tetrahydronaphthalen-2-yloxy)propoxy]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=C(CCCC2)C2=C1 LBBWNQRWWVERQX-QFIPXVFZSA-N 0.000 claims description 5
- 125000000008 (C1-C10) alkyl group Chemical group 0.000 claims description 5
- QGMKLFTYMSXDGA-UHFFFAOYSA-N 2-methoxy-3-[3-[3-(4-phenylphenoxy)propoxy]phenyl]propanoic acid Chemical compound COC(C(O)=O)CC1=CC=CC(OCCCOC=2C=CC(=CC=2)C=2C=CC=CC=2)=C1 QGMKLFTYMSXDGA-UHFFFAOYSA-N 0.000 claims description 5
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 5
- 238000012360 testing method Methods 0.000 claims description 5
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 5
- IHTNLIQRRZWXPI-QHCPKHFHSA-N (2s)-2-methoxy-3-[4-[2-(4-phenylphenoxy)ethoxy]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCOC1=CC=C(C=2C=CC=CC=2)C=C1 IHTNLIQRRZWXPI-QHCPKHFHSA-N 0.000 claims description 4
- LHOBFIFGJMJKLP-SANMLTNESA-N (2s)-2-methoxy-3-[4-[5-(4-phenylphenoxy)pentanoyl]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1C(=O)CCCCOC1=CC=C(C=2C=CC=CC=2)C=C1 LHOBFIFGJMJKLP-SANMLTNESA-N 0.000 claims description 4
- ONPSUOOPYWPISK-DEOSSOPVSA-N (2s)-3-[4-[3-(4-benzoylphenoxy)propoxy]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=C(C(=O)C=2C=CC=CC=2)C=C1 ONPSUOOPYWPISK-DEOSSOPVSA-N 0.000 claims description 4
- ULHMYSITFNNFCF-VWLOTQADSA-N (2s)-3-[4-[3-(4-benzylphenoxy)propoxy]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC(C=C1)=CC=C1CC1=CC=CC=C1 ULHMYSITFNNFCF-VWLOTQADSA-N 0.000 claims description 4
- RUZMFRVKJHDPGO-QFIPXVFZSA-N (2s)-3-[4-[3-(4-butylphenoxy)propoxy]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(CCCC)=CC=C1OCCCOC1=CC=C(C[C@H](OC)C(O)=O)C=C1 RUZMFRVKJHDPGO-QFIPXVFZSA-N 0.000 claims description 4
- WRDRSTYCGZZUHX-DEOSSOPVSA-N (2s)-3-[4-[3-[4-(4-fluorobenzoyl)phenoxy]propoxy]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=C(C(=O)C=2C=CC(F)=CC=2)C=C1 WRDRSTYCGZZUHX-DEOSSOPVSA-N 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 125000000732 arylene group Chemical group 0.000 claims description 4
- 239000004305 biphenyl Substances 0.000 claims description 4
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 4
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 4
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 claims description 4
- 229910052757 nitrogen Inorganic materials 0.000 claims description 4
- 125000003107 substituted aryl group Chemical group 0.000 claims description 4
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 claims description 4
- FIQYBODNCLDXCA-SANMLTNESA-N (2s)-2-methoxy-3-[4-[3-[4-(2-phenylacetyl)phenoxy]propoxy]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=C(C(=O)CC=2C=CC=CC=2)C=C1 FIQYBODNCLDXCA-SANMLTNESA-N 0.000 claims description 3
- OZALPJGJNKMBKA-SANMLTNESA-N (2s)-3-[4-[3-(4-benzylphenoxy)propoxy]phenyl]-2-ethoxypropanoic acid Chemical compound C1=CC(C[C@H](OCC)C(O)=O)=CC=C1OCCCOC(C=C1)=CC=C1CC1=CC=CC=C1 OZALPJGJNKMBKA-SANMLTNESA-N 0.000 claims description 3
- VRQBRUCGPYEDQT-DEOSSOPVSA-N (2s)-3-[4-[3-[4-(4-hydroxyphenyl)phenoxy]propoxy]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=C(C=2C=CC(O)=CC=2)C=C1 VRQBRUCGPYEDQT-DEOSSOPVSA-N 0.000 claims description 3
- ZXVKVZHFWBHAAB-VWLOTQADSA-N (2s)-3-[4-[4-(4-benzoylphenoxy)but-1-ynyl]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1C#CCCOC1=CC=C(C(=O)C=2C=CC=CC=2)C=C1 ZXVKVZHFWBHAAB-VWLOTQADSA-N 0.000 claims description 3
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 claims description 3
- 125000000171 (C1-C6) haloalkyl group Chemical group 0.000 claims description 3
- GWQRMQDREIBEJB-UHFFFAOYSA-N 2-methoxy-3-[2-methoxy-4-[3-(4-phenoxyphenoxy)propoxy]phenyl]propanoic acid Chemical compound C1=C(OC)C(CC(OC)C(O)=O)=CC=C1OCCCOC(C=C1)=CC=C1OC1=CC=CC=C1 GWQRMQDREIBEJB-UHFFFAOYSA-N 0.000 claims description 3
- MOJOXRWSSSIPOI-UHFFFAOYSA-N 3-[4-[3-(4-benzoylphenoxy)propoxy]-2-chlorophenyl]-2-methoxypropanoic acid Chemical compound C1=C(Cl)C(CC(OC)C(O)=O)=CC=C1OCCCOC1=CC=C(C(=O)C=2C=CC=CC=2)C=C1 MOJOXRWSSSIPOI-UHFFFAOYSA-N 0.000 claims description 3
- QJVZTISOVSCUBL-DEOSSOPVSA-N 4-[4-[3-[4-[(2s)-2-carboxy-2-methoxyethyl]phenoxy]propoxy]phenyl]benzoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=C(C=2C=CC(=CC=2)C(O)=O)C=C1 QJVZTISOVSCUBL-DEOSSOPVSA-N 0.000 claims description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 3
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 claims description 3
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 claims description 3
- KNNHPJKYTMZLEP-SANMLTNESA-N (2s)-2-methoxy-3-[4-[5-(4-phenoxyphenoxy)pent-1-ynyl]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1C#CCCCOC(C=C1)=CC=C1OC1=CC=CC=C1 KNNHPJKYTMZLEP-SANMLTNESA-N 0.000 claims description 2
- JSEATZKVXFMXJI-SANMLTNESA-N (2s)-2-methoxy-3-[4-[5-(4-phenylphenoxy)pent-1-ynyl]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1C#CCCCOC1=CC=C(C=2C=CC=CC=2)C=C1 JSEATZKVXFMXJI-SANMLTNESA-N 0.000 claims description 2
- XCEWRRYOVDOTDM-SANMLTNESA-N (2s)-3-[4-[5-(4-benzoylphenoxy)pent-1-ynyl]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1C#CCCCOC1=CC=C(C(=O)C=2C=CC=CC=2)C=C1 XCEWRRYOVDOTDM-SANMLTNESA-N 0.000 claims description 2
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 claims description 2
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 claims description 2
- 125000001589 carboacyl group Chemical group 0.000 claims description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical group C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 claims description 2
- 125000004185 ester group Chemical group 0.000 claims description 2
- 229910052731 fluorine Inorganic materials 0.000 claims description 2
- 230000003301 hydrolyzing effect Effects 0.000 claims description 2
- 108020001756 ligand binding domains Proteins 0.000 claims description 2
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 claims description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 2
- 230000009870 specific binding Effects 0.000 claims description 2
- 102000001494 Sterol O-Acyltransferase Human genes 0.000 claims 6
- 108010054082 Sterol O-acyltransferase Proteins 0.000 claims 6
- 102000000536 PPAR gamma Human genes 0.000 claims 3
- CFJFKSKRLAYDHM-DEOSSOPVSA-N (2s)-2-methoxy-3-[4-[3-(4-phenylphenoxy)propoxy]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=C(C=2C=CC=CC=2)C=C1 CFJFKSKRLAYDHM-DEOSSOPVSA-N 0.000 claims 2
- 125000006527 (C1-C5) alkyl group Chemical group 0.000 claims 2
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 claims 2
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 claims 2
- 235000014347 soups Nutrition 0.000 claims 2
- OKJHGOPITGTTIM-XMMPIXPASA-N (2r)-2-methoxy-3-[4-[3-(4-phenoxyphenoxy)propoxy]phenyl]propanoic acid Chemical compound C1=CC(C[C@@H](OC)C(O)=O)=CC=C1OCCCOC(C=C1)=CC=C1OC1=CC=CC=C1 OKJHGOPITGTTIM-XMMPIXPASA-N 0.000 claims 1
- JQCDIOCVFRCTDF-DEOSSOPVSA-N (2s)-2-ethoxy-3-[4-[2-(4-phenylphenoxy)ethoxy]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OCC)C(O)=O)=CC=C1OCCOC1=CC=C(C=2C=CC=CC=2)C=C1 JQCDIOCVFRCTDF-DEOSSOPVSA-N 0.000 claims 1
- GWQRMQDREIBEJB-VWLOTQADSA-N (2s)-2-methoxy-3-[2-methoxy-4-[3-(4-phenoxyphenoxy)propoxy]phenyl]propanoic acid Chemical compound C1=C(OC)C(C[C@H](OC)C(O)=O)=CC=C1OCCCOC(C=C1)=CC=C1OC1=CC=CC=C1 GWQRMQDREIBEJB-VWLOTQADSA-N 0.000 claims 1
- IUORCUOWVWRBDQ-VWLOTQADSA-N (2s)-2-methoxy-3-[3-methoxy-4-[3-(4-phenoxyphenoxy)propoxy]phenyl]propanoic acid Chemical compound COC1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC(C=C1)=CC=C1OC1=CC=CC=C1 IUORCUOWVWRBDQ-VWLOTQADSA-N 0.000 claims 1
- NUVVLNMPNTXRLX-VWLOTQADSA-N (2s)-2-methoxy-3-[3-methoxy-4-[3-(4-phenylphenoxy)propoxy]phenyl]propanoic acid Chemical compound COC1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=C(C=2C=CC=CC=2)C=C1 NUVVLNMPNTXRLX-VWLOTQADSA-N 0.000 claims 1
- PYLAXRHNCOEKFN-VWLOTQADSA-N (2s)-2-methoxy-3-[3-methoxy-4-[3-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propoxy]phenyl]propanoic acid Chemical compound COC1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC(C=C1)=CC=C1OC1=CC=C(C(F)(F)F)C=C1 PYLAXRHNCOEKFN-VWLOTQADSA-N 0.000 claims 1
- SCESHHIZKIZHLG-QHCPKHFHSA-N (2s)-2-methoxy-3-[4-[2-(4-phenoxyphenoxy)ethoxy]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCOC(C=C1)=CC=C1OC1=CC=CC=C1 SCESHHIZKIZHLG-QHCPKHFHSA-N 0.000 claims 1
- NGBDEPKVJPUCGK-QFIPXVFZSA-N (2s)-2-methoxy-3-[4-[3-(4-morpholin-4-ylphenoxy)propoxy]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=C(N2CCOCC2)C=C1 NGBDEPKVJPUCGK-QFIPXVFZSA-N 0.000 claims 1
- FQXWRKJBAFNMNO-DEOSSOPVSA-N (2s)-2-methoxy-3-[4-[3-(4-phenoxyphenoxy)prop-1-ynyl]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1C#CCOC(C=C1)=CC=C1OC1=CC=CC=C1 FQXWRKJBAFNMNO-DEOSSOPVSA-N 0.000 claims 1
- BDKJFRYEWUMYHB-WNMGUVTHSA-N (2s)-2-methoxy-3-[4-[3-(4-phenylphenoxy)cyclopentyl]oxyphenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OC1CC(OC=2C=CC(=CC=2)C=2C=CC=CC=2)CC1 BDKJFRYEWUMYHB-WNMGUVTHSA-N 0.000 claims 1
- WXIVTYDFEHWLEO-DEOSSOPVSA-N (2s)-2-methoxy-3-[4-[3-(4-phenylphenoxy)prop-1-ynyl]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1C#CCOC1=CC=C(C=2C=CC=CC=2)C=C1 WXIVTYDFEHWLEO-DEOSSOPVSA-N 0.000 claims 1
- ZFCWEJYIVSDUIK-QHCPKHFHSA-N (2s)-2-methoxy-3-[4-[3-(4-pyridin-4-ylphenoxy)propoxy]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=C(C=2C=CN=CC=2)C=C1 ZFCWEJYIVSDUIK-QHCPKHFHSA-N 0.000 claims 1
- NVZXQCHGTVWLHW-SANMLTNESA-N (2s)-2-methoxy-3-[4-[3-(4-quinolin-8-ylphenoxy)propoxy]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=C(C=2C3=NC=CC=C3C=CC=2)C=C1 NVZXQCHGTVWLHW-SANMLTNESA-N 0.000 claims 1
- WBWVKPVLJHWHSC-SANMLTNESA-N (2s)-2-methoxy-3-[4-[3-[4-(2-phenylethoxy)phenoxy]propoxy]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC(C=C1)=CC=C1OCCC1=CC=CC=C1 WBWVKPVLJHWHSC-SANMLTNESA-N 0.000 claims 1
- KBUMRZDHHWZVLY-QHCPKHFHSA-N (2s)-2-methoxy-3-[4-[3-[4-(3-methylbutoxy)phenoxy]propoxy]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=C(OCCC(C)C)C=C1 KBUMRZDHHWZVLY-QHCPKHFHSA-N 0.000 claims 1
- NBCNXIGHQPZPBX-MHZLTWQESA-N (2s)-2-methoxy-3-[4-[3-[4-(3-phenylpropanoyl)phenoxy]propoxy]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=C(C(=O)CCC=2C=CC=CC=2)C=C1 NBCNXIGHQPZPBX-MHZLTWQESA-N 0.000 claims 1
- FKWVELYKGZZUTF-VWLOTQADSA-N (2s)-2-methoxy-3-[4-[3-[4-(4-methylbenzoyl)phenoxy]propoxy]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=C(C(=O)C=2C=CC(C)=CC=2)C=C1 FKWVELYKGZZUTF-VWLOTQADSA-N 0.000 claims 1
- QNXVJCAPCDOUAH-NDEPHWFRSA-N (2s)-2-methoxy-3-[4-[3-[4-(naphthalene-1-carbonyl)phenoxy]propoxy]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=C(C(=O)C=2C3=CC=CC=C3C=CC=2)C=C1 QNXVJCAPCDOUAH-NDEPHWFRSA-N 0.000 claims 1
- LEWCDXLDLKZAGV-DEOSSOPVSA-N (2s)-2-methoxy-3-[4-[3-[4-[4-(2h-tetrazol-5-yl)phenyl]phenoxy]propoxy]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=C(C=2C=CC(=CC=2)C=2NN=NN=2)C=C1 LEWCDXLDLKZAGV-DEOSSOPVSA-N 0.000 claims 1
- PXPYSVWYMMGIEN-VWLOTQADSA-N (2s)-2-methoxy-3-[4-[4-(4-phenoxyphenoxy)but-1-ynyl]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1C#CCCOC(C=C1)=CC=C1OC1=CC=CC=C1 PXPYSVWYMMGIEN-VWLOTQADSA-N 0.000 claims 1
- UFNMVXXURDBYIT-VWLOTQADSA-N (2s)-2-methoxy-3-[4-[4-(4-phenylphenoxy)but-1-ynyl]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1C#CCCOC1=CC=C(C=2C=CC=CC=2)C=C1 UFNMVXXURDBYIT-VWLOTQADSA-N 0.000 claims 1
- NKWMXBJKSAZVSE-MHZLTWQESA-N (2s)-3-[3-chloro-4-[3-(4-oxo-2-phenylchromen-6-yl)oxypropoxy]phenyl]-2-methoxypropanoic acid Chemical compound ClC1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=C(OC(=CC2=O)C=3C=CC=CC=3)C2=C1 NKWMXBJKSAZVSE-MHZLTWQESA-N 0.000 claims 1
- UJEQNNMYMQBSFD-VWLOTQADSA-N (2s)-3-[4-[2-(4-phenylphenoxy)ethoxy]phenyl]-2-propoxypropanoic acid Chemical compound C1=CC(C[C@H](OCCC)C(O)=O)=CC=C1OCCOC1=CC=C(C=2C=CC=CC=2)C=C1 UJEQNNMYMQBSFD-VWLOTQADSA-N 0.000 claims 1
- KWZYHCGJAIWBPL-WNMGUVTHSA-N (2s)-3-[4-[2-[4-(4-fluorobenzoyl)phenoxy]cyclopentyl]oxyphenyl]-2-methoxypropanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OC1C(OC=2C=CC(=CC=2)C(=O)C=2C=CC(F)=CC=2)CCC1 KWZYHCGJAIWBPL-WNMGUVTHSA-N 0.000 claims 1
- QSYMCIFNEYSDNR-DEOSSOPVSA-N (2s)-3-[4-[3-(4-benzoylphenoxy)prop-1-ynyl]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1C#CCOC1=CC=C(C(=O)C=2C=CC=CC=2)C=C1 QSYMCIFNEYSDNR-DEOSSOPVSA-N 0.000 claims 1
- MOJOXRWSSSIPOI-DEOSSOPVSA-N (2s)-3-[4-[3-(4-benzoylphenoxy)propoxy]-2-chlorophenyl]-2-methoxypropanoic acid Chemical compound C1=C(Cl)C(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=C(C(=O)C=2C=CC=CC=2)C=C1 MOJOXRWSSSIPOI-DEOSSOPVSA-N 0.000 claims 1
- OLJLZXNKZSHOFP-VWLOTQADSA-N (2s)-3-[4-[3-(4-benzoylphenoxy)propoxy]-3-chlorophenyl]-2-ethoxypropanoic acid Chemical compound ClC1=CC(C[C@H](OCC)C(O)=O)=CC=C1OCCCOC1=CC=C(C(=O)C=2C=CC=CC=2)C=C1 OLJLZXNKZSHOFP-VWLOTQADSA-N 0.000 claims 1
- KKCJUZAZCZTNLM-PMERELPUSA-N (2s)-3-[4-[3-(4-dibenzofuran-2-ylphenoxy)propoxy]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=C(C=2C=C3C4=CC=CC=C4OC3=CC=2)C=C1 KKCJUZAZCZTNLM-PMERELPUSA-N 0.000 claims 1
- GBFOGOYFYKDJDA-SANMLTNESA-N (2s)-3-[4-[3-(4-phenoxyphenoxy)propoxy]phenyl]-2-propan-2-yloxypropanoic acid Chemical compound C1=CC(C[C@H](OC(C)C)C(O)=O)=CC=C1OCCCOC(C=C1)=CC=C1OC1=CC=CC=C1 GBFOGOYFYKDJDA-SANMLTNESA-N 0.000 claims 1
- MYSPBVDXQFAINT-SANMLTNESA-N (2s)-3-[4-[3-[4-(2,4-dimethoxybenzoyl)phenoxy]propoxy]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=C(C(=O)C=2C(=CC(OC)=CC=2)OC)C=C1 MYSPBVDXQFAINT-SANMLTNESA-N 0.000 claims 1
- MTSDGNHHKOTRMS-DEOSSOPVSA-N (2s)-3-[4-[3-[4-(4-hydroxybenzoyl)phenoxy]propoxy]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=C(C(=O)C=2C=CC(O)=CC=2)C=C1 MTSDGNHHKOTRMS-DEOSSOPVSA-N 0.000 claims 1
- DCQLFDFFRYZYLG-MHZLTWQESA-N (2s)-3-[4-[3-[4-(4-tert-butylphenyl)phenoxy]propoxy]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=C(C=2C=CC(=CC=2)C(C)(C)C)C=C1 DCQLFDFFRYZYLG-MHZLTWQESA-N 0.000 claims 1
- ISHARVPNLFDQFW-VWLOTQADSA-N (2s)-3-[4-[4-(4-benzoylphenoxy)butanoyl]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1C(=O)CCCOC1=CC=C(C(=O)C=2C=CC=CC=2)C=C1 ISHARVPNLFDQFW-VWLOTQADSA-N 0.000 claims 1
- FLZYBHURKQRCHY-LJAQVGFWSA-N 2-(dimethylamino)ethyl (2s)-2-methoxy-3-[2-methoxy-4-[3-(4-phenoxyphenoxy)propoxy]phenyl]propanoate Chemical compound C1=C(OC)C(C[C@H](OC)C(=O)OCCN(C)C)=CC=C1OCCCOC(C=C1)=CC=C1OC1=CC=CC=C1 FLZYBHURKQRCHY-LJAQVGFWSA-N 0.000 claims 1
- BYRXZTWSCITKTR-UHFFFAOYSA-N 2-methoxy-3-[4-[3-(4-phenoxyphenoxy)butan-2-yloxy]phenyl]propanoic acid Chemical compound C1=CC(CC(OC)C(O)=O)=CC=C1OC(C)C(C)OC(C=C1)=CC=C1OC1=CC=CC=C1 BYRXZTWSCITKTR-UHFFFAOYSA-N 0.000 claims 1
- PDQGIPIPIASTKV-UHFFFAOYSA-N 2-methoxy-3-[4-[3-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propoxy]phenyl]propanoic acid Chemical compound C1=CC(CC(OC)C(O)=O)=CC=C1OCCCOC(C=C1)=CC=C1OC1=CC=C(C(F)(F)F)C=C1 PDQGIPIPIASTKV-UHFFFAOYSA-N 0.000 claims 1
- HHLIVAUNQMTUME-UHFFFAOYSA-N 3-[4-[3-(4-benzoylphenoxy)propoxy]phenyl]-2-ethoxypropanoic acid Chemical compound C1=CC(CC(OCC)C(O)=O)=CC=C1OCCCOC1=CC=C(C(=O)C=2C=CC=CC=2)C=C1 HHLIVAUNQMTUME-UHFFFAOYSA-N 0.000 claims 1
- YATGYNCFNIBVAA-UHFFFAOYSA-N 3-[4-[3-(4-phenoxyphenoxy)propoxy]phenyl]-2-propoxypropanoic acid Chemical compound C1=CC(CC(OCCC)C(O)=O)=CC=C1OCCCOC(C=C1)=CC=C1OC1=CC=CC=C1 YATGYNCFNIBVAA-UHFFFAOYSA-N 0.000 claims 1
- RFAIABVTCPMETJ-UHFFFAOYSA-N 3-[4-[4-[4-(n-hydroxy-c-phenylcarbonimidoyl)phenoxy]but-1-ynyl]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(CC(OC)C(O)=O)=CC=C1C#CCCOC1=CC=C(C(=NO)C=2C=CC=CC=2)C=C1 RFAIABVTCPMETJ-UHFFFAOYSA-N 0.000 claims 1
- OKJHGOPITGTTIM-DEOSSOPVSA-N Naveglitazar Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC(C=C1)=CC=C1OC1=CC=CC=C1 OKJHGOPITGTTIM-DEOSSOPVSA-N 0.000 claims 1
- YZCKVEUIGOORGS-NJFSPNSNSA-N Tritium Chemical group [3H] YZCKVEUIGOORGS-NJFSPNSNSA-N 0.000 claims 1
- WQLBDNUEPGOVGH-GFOSTYPZSA-M [Na+].C1=CC(C[C@H](OC)C([O-])=O)=CC=C1OC1CC(OC=2C=CC(=CC=2)C(=O)CC=2C=CC=CC=2)CC1 Chemical compound [Na+].C1=CC(C[C@H](OC)C([O-])=O)=CC=C1OC1CC(OC=2C=CC(=CC=2)C(=O)CC=2C=CC=CC=2)CC1 WQLBDNUEPGOVGH-GFOSTYPZSA-M 0.000 claims 1
- HIDHUNIYHVJZJU-CTMAVYGASA-M [Na+].C1=CC(C[C@H](OC)C([O-])=O)=CC=C1OC1CC(OC=2C=CC(=CC=2)C=2C=CC=CC=2)CCC1 Chemical compound [Na+].C1=CC(C[C@H](OC)C([O-])=O)=CC=C1OC1CC(OC=2C=CC(=CC=2)C=2C=CC=CC=2)CCC1 HIDHUNIYHVJZJU-CTMAVYGASA-M 0.000 claims 1
- NZJWDSADSAKMIY-FERBBOLQSA-M [Na+].C1=CC(C[C@H](OC)C([O-])=O)=CC=C1OCCCOC1=CC=CC=C1C(O)=O Chemical compound [Na+].C1=CC(C[C@H](OC)C([O-])=O)=CC=C1OCCCOC1=CC=CC=C1C(O)=O NZJWDSADSAKMIY-FERBBOLQSA-M 0.000 claims 1
- UZCJQQPAGFOJKS-JIDHJSLPSA-M [Na+].ClC1=CC(C[C@H](OC)C([O-])=O)=CC=C1OCCCOC1=CC=C(C(=O)C=2C=CC=CC=2)C=C1 Chemical compound [Na+].ClC1=CC(C[C@H](OC)C([O-])=O)=CC=C1OCCCOC1=CC=C(C(=O)C=2C=CC=CC=2)C=C1 UZCJQQPAGFOJKS-JIDHJSLPSA-M 0.000 claims 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 1
- MVJWAKSDOGPRNC-UQIIZPHYSA-M sodium;(2s)-2-ethoxy-3-[4-[3-(4-phenoxyphenoxy)propoxy]phenyl]propanoate Chemical compound [Na+].C1=CC(C[C@H](OCC)C([O-])=O)=CC=C1OCCCOC(C=C1)=CC=C1OC1=CC=CC=C1 MVJWAKSDOGPRNC-UQIIZPHYSA-M 0.000 claims 1
- IPSUOKJFZFZLRX-YNMZEGNTSA-M sodium;(2s)-2-methoxy-3-[3-(2-methoxyphenyl)-4-[3-(4-phenylphenoxy)propoxy]phenyl]propanoate Chemical compound [Na+].C=1C=CC=C(OC)C=1C1=CC(C[C@H](OC)C([O-])=O)=CC=C1OCCCOC(C=C1)=CC=C1C1=CC=CC=C1 IPSUOKJFZFZLRX-YNMZEGNTSA-M 0.000 claims 1
- LCSGIOLTTDJSIP-JIDHJSLPSA-M sodium;(2s)-2-methoxy-3-[4-[3-[4-[4-(trifluoromethyl)phenoxy]phenoxy]prop-1-ynyl]phenyl]propanoate Chemical compound [Na+].C1=CC(C[C@H](OC)C([O-])=O)=CC=C1C#CCOC(C=C1)=CC=C1OC1=CC=C(C(F)(F)F)C=C1 LCSGIOLTTDJSIP-JIDHJSLPSA-M 0.000 claims 1
- QGKRQEZYYKVBFW-YCBFMBTMSA-M sodium;(2s)-2-methoxy-3-[4-[6-(4-phenoxyphenoxy)hex-1-ynyl]phenyl]propanoate Chemical compound [Na+].C1=CC(C[C@H](OC)C([O-])=O)=CC=C1C#CCCCCOC(C=C1)=CC=C1OC1=CC=CC=C1 QGKRQEZYYKVBFW-YCBFMBTMSA-M 0.000 claims 1
- KWPMINKQFZMPIY-YCBFMBTMSA-M sodium;(2s)-2-methoxy-3-[4-[6-(4-phenoxyphenoxy)hexanoyl]phenyl]propanoate Chemical compound [Na+].C1=CC(C[C@H](OC)C([O-])=O)=CC=C1C(=O)CCCCCOC(C=C1)=CC=C1OC1=CC=CC=C1 KWPMINKQFZMPIY-YCBFMBTMSA-M 0.000 claims 1
- TUAWRMCWKFJEPD-YCBFMBTMSA-M sodium;(2s)-2-methoxy-3-[4-[6-(4-phenylphenoxy)hex-1-ynyl]phenyl]propanoate Chemical compound [Na+].C1=CC(C[C@H](OC)C([O-])=O)=CC=C1C#CCCCCOC1=CC=C(C=2C=CC=CC=2)C=C1 TUAWRMCWKFJEPD-YCBFMBTMSA-M 0.000 claims 1
- ZPWXVAXFJSKWJY-JIDHJSLPSA-M sodium;(2s)-3-[4-[3-[4-(2-fluorobenzoyl)phenoxy]propoxy]phenyl]-2-methoxypropanoate Chemical compound [Na+].C1=CC(C[C@H](OC)C([O-])=O)=CC=C1OCCCOC1=CC=C(C(=O)C=2C(=CC=CC=2)F)C=C1 ZPWXVAXFJSKWJY-JIDHJSLPSA-M 0.000 claims 1
- QJQWJCHJFNZQTG-PQHVFQCZSA-M sodium;(2s)-3-[4-[3-[4-[(4-fluorophenyl)-hydroxymethyl]phenoxy]propoxy]phenyl]-2-methoxypropanoate Chemical compound [Na+].C1=CC(C[C@H](OC)C([O-])=O)=CC=C1OCCCOC1=CC=C(C(O)C=2C=CC(F)=CC=2)C=C1 QJQWJCHJFNZQTG-PQHVFQCZSA-M 0.000 claims 1
- VYABLEVIFPLJRZ-UQIIZPHYSA-M sodium;(2s)-3-[4-[4-(4-benzoylphenoxy)but-1-ynyl]phenyl]-2-methoxypropanoate Chemical compound [Na+].C1=CC(C[C@H](OC)C([O-])=O)=CC=C1C#CCCOC1=CC=C(C(=O)C=2C=CC=CC=2)C=C1 VYABLEVIFPLJRZ-UQIIZPHYSA-M 0.000 claims 1
- INNSJIWLCMRRNC-YCBFMBTMSA-M sodium;(2s)-3-[4-[6-(4-benzoylphenoxy)hex-1-ynyl]phenyl]-2-methoxypropanoate Chemical compound [Na+].C1=CC(C[C@H](OC)C([O-])=O)=CC=C1C#CCCCCOC1=CC=C(C(=O)C=2C=CC=CC=2)C=C1 INNSJIWLCMRRNC-YCBFMBTMSA-M 0.000 claims 1
- PHMYIGONNINCMJ-UHFFFAOYSA-M sodium;3-[4-[3-(4-benzoylphenoxy)propoxy]phenyl]-2-methoxypropanoate Chemical compound [Na+].C1=CC(CC(OC)C([O-])=O)=CC=C1OCCCOC1=CC=C(C(=O)C=2C=CC=CC=2)C=C1 PHMYIGONNINCMJ-UHFFFAOYSA-M 0.000 claims 1
- 229910052722 tritium Inorganic materials 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 206
- 239000000203 mixture Substances 0.000 description 169
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 138
- 239000000243 solution Substances 0.000 description 132
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 126
- 239000011347 resin Substances 0.000 description 109
- 229920005989 resin Polymers 0.000 description 109
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 104
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 98
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 95
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical class CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 88
- 239000002253 acid Substances 0.000 description 82
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 75
- 238000010561 standard procedure Methods 0.000 description 75
- 238000006243 chemical reaction Methods 0.000 description 73
- 238000005160 1H NMR spectroscopy Methods 0.000 description 72
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 70
- 235000019439 ethyl acetate Nutrition 0.000 description 69
- 235000019260 propionic acid Nutrition 0.000 description 69
- 229940093499 ethyl acetate Drugs 0.000 description 68
- 239000007787 solid Substances 0.000 description 56
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 54
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 51
- 238000005859 coupling reaction Methods 0.000 description 50
- 101150041968 CDC13 gene Proteins 0.000 description 49
- 230000008878 coupling Effects 0.000 description 47
- 238000010168 coupling process Methods 0.000 description 47
- 238000006460 hydrolysis reaction Methods 0.000 description 47
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 45
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 44
- 238000003776 cleavage reaction Methods 0.000 description 43
- 230000007017 scission Effects 0.000 description 40
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 37
- 229910001868 water Inorganic materials 0.000 description 35
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 34
- 239000012044 organic layer Substances 0.000 description 34
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 34
- 239000000741 silica gel Substances 0.000 description 33
- 229910002027 silica gel Inorganic materials 0.000 description 33
- 229960001866 silicon dioxide Drugs 0.000 description 33
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 32
- 238000010898 silica gel chromatography Methods 0.000 description 32
- 239000012267 brine Substances 0.000 description 31
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 31
- 230000007062 hydrolysis Effects 0.000 description 30
- 239000003921 oil Substances 0.000 description 28
- 235000019198 oils Nutrition 0.000 description 28
- 238000011282 treatment Methods 0.000 description 28
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 27
- XACMGFVTTFFMKP-LBPRGKRZSA-N (2s)-3-[4-(3-hydroxypropoxy)phenyl]-2-methoxypropanoic acid Chemical compound CO[C@H](C(O)=O)CC1=CC=C(OCCCO)C=C1 XACMGFVTTFFMKP-LBPRGKRZSA-N 0.000 description 26
- 239000002904 solvent Substances 0.000 description 26
- 239000004480 active ingredient Substances 0.000 description 25
- 238000005481 NMR spectroscopy Methods 0.000 description 24
- 239000000047 product Substances 0.000 description 24
- 239000002585 base Substances 0.000 description 23
- 229960004132 diethyl ether Drugs 0.000 description 23
- YXVFYQXJAXKLAK-UHFFFAOYSA-N biphenyl-4-ol Chemical compound C1=CC(O)=CC=C1C1=CC=CC=C1 YXVFYQXJAXKLAK-UHFFFAOYSA-N 0.000 description 22
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 21
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 20
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 20
- 150000001721 carbon Chemical group 0.000 description 20
- 150000002148 esters Chemical class 0.000 description 20
- 238000009472 formulation Methods 0.000 description 19
- ZSBDGXGICLIJGD-UHFFFAOYSA-N 4-phenoxyphenol Chemical compound C1=CC(O)=CC=C1OC1=CC=CC=C1 ZSBDGXGICLIJGD-UHFFFAOYSA-N 0.000 description 18
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 18
- 230000015572 biosynthetic process Effects 0.000 description 17
- UKWHYYKOEPRTIC-UHFFFAOYSA-N mercury(II) oxide Inorganic materials [Hg]=O UKWHYYKOEPRTIC-UHFFFAOYSA-N 0.000 description 17
- 239000003826 tablet Substances 0.000 description 17
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 16
- 239000007864 aqueous solution Substances 0.000 description 16
- FAMRKDQNMBBFBR-BQYQJAHWSA-N diethyl azodicarboxylate Substances CCOC(=O)\N=N\C(=O)OCC FAMRKDQNMBBFBR-BQYQJAHWSA-N 0.000 description 16
- 239000010410 layer Substances 0.000 description 16
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 16
- 150000002923 oximes Chemical class 0.000 description 15
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 15
- 229920006395 saturated elastomer Polymers 0.000 description 15
- 238000003786 synthesis reaction Methods 0.000 description 15
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 14
- 239000011541 reaction mixture Substances 0.000 description 14
- 238000004587 chromatography analysis Methods 0.000 description 13
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 12
- 239000003153 chemical reaction reagent Substances 0.000 description 12
- HVYWMOMLDIMFJA-DPAQBDIFSA-N cholesterol Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 HVYWMOMLDIMFJA-DPAQBDIFSA-N 0.000 description 12
- 125000004494 ethyl ester group Chemical group 0.000 description 12
- 238000002360 preparation method Methods 0.000 description 12
- NPFYZDNDJHZQKY-UHFFFAOYSA-N 4-Hydroxybenzophenone Chemical compound C1=CC(O)=CC=C1C(=O)C1=CC=CC=C1 NPFYZDNDJHZQKY-UHFFFAOYSA-N 0.000 description 11
- YNPNZTXNASCQKK-UHFFFAOYSA-N Phenanthrene Natural products C1=CC=C2C3=CC=CC=C3C=CC2=C1 YNPNZTXNASCQKK-UHFFFAOYSA-N 0.000 description 11
- 229920002472 Starch Polymers 0.000 description 11
- FAMRKDQNMBBFBR-UHFFFAOYSA-N ethyl n-ethoxycarbonyliminocarbamate Chemical compound CCOC(=O)N=NC(=O)OCC FAMRKDQNMBBFBR-UHFFFAOYSA-N 0.000 description 11
- 229910052763 palladium Inorganic materials 0.000 description 11
- 239000008107 starch Substances 0.000 description 11
- 235000019698 starch Nutrition 0.000 description 11
- FPGGTKZVZWFYPV-UHFFFAOYSA-M tetrabutylammonium fluoride Chemical compound [F-].CCCC[N+](CCCC)(CCCC)CCCC FPGGTKZVZWFYPV-UHFFFAOYSA-M 0.000 description 11
- ITMCEJHCFYSIIV-UHFFFAOYSA-M triflate Chemical compound [O-]S(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-M 0.000 description 11
- 239000007788 liquid Substances 0.000 description 10
- 238000004809 thin layer chromatography Methods 0.000 description 10
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 9
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 9
- DGEZNRSVGBDHLK-UHFFFAOYSA-N [1,10]phenanthroline Chemical compound C1=CN=C2C3=NC=CC=C3C=CC2=C1 DGEZNRSVGBDHLK-UHFFFAOYSA-N 0.000 description 9
- 239000008346 aqueous phase Substances 0.000 description 9
- 239000002775 capsule Substances 0.000 description 9
- 230000000694 effects Effects 0.000 description 9
- PRDTYFBVDYRIEN-AWEZNQCLSA-N ethyl (2s)-3-[4-(3-chloroprop-1-ynyl)phenyl]-2-methoxypropanoate Chemical compound CCOC(=O)[C@@H](OC)CC1=CC=C(C#CCCl)C=C1 PRDTYFBVDYRIEN-AWEZNQCLSA-N 0.000 description 9
- UTXMOQOJNXCRTI-UHFFFAOYSA-N ethyl 3-[4-(5-bromopent-1-ynyl)phenyl]-2-methoxypropanoate Chemical compound CCOC(=O)C(OC)CC1=CC=C(C#CCCCBr)C=C1 UTXMOQOJNXCRTI-UHFFFAOYSA-N 0.000 description 9
- FKRCODPIKNYEAC-UHFFFAOYSA-N ethyl propionate Chemical compound CCOC(=O)CC FKRCODPIKNYEAC-UHFFFAOYSA-N 0.000 description 9
- 239000000843 powder Substances 0.000 description 9
- 229910000104 sodium hydride Inorganic materials 0.000 description 9
- MQGPSCMMNJKMHQ-UHFFFAOYSA-N 7-hydroxyflavone Chemical compound C=1C(O)=CC=C(C(C=2)=O)C=1OC=2C1=CC=CC=C1 MQGPSCMMNJKMHQ-UHFFFAOYSA-N 0.000 description 8
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 8
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 8
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 8
- 241001442654 Percnon planissimum Species 0.000 description 8
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 8
- 239000004743 Polypropylene Substances 0.000 description 8
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 8
- 230000002378 acidificating effect Effects 0.000 description 8
- 239000013543 active substance Substances 0.000 description 8
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 8
- 238000004296 chiral HPLC Methods 0.000 description 8
- 235000019359 magnesium stearate Nutrition 0.000 description 8
- 229920001155 polypropylene Polymers 0.000 description 8
- 239000000651 prodrug Substances 0.000 description 8
- 229940002612 prodrug Drugs 0.000 description 8
- 239000003795 chemical substances by application Substances 0.000 description 7
- 238000004440 column chromatography Methods 0.000 description 7
- 238000010931 ester hydrolysis Methods 0.000 description 7
- LNOZNXQUSWMNOX-NSHDSACASA-N ethyl (2s)-2-methoxy-3-[4-(trifluoromethylsulfonyloxy)phenyl]propanoate Chemical compound CCOC(=O)[C@@H](OC)CC1=CC=C(OS(=O)(=O)C(F)(F)F)C=C1 LNOZNXQUSWMNOX-NSHDSACASA-N 0.000 description 7
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 7
- 229910000029 sodium carbonate Inorganic materials 0.000 description 7
- 239000000725 suspension Substances 0.000 description 7
- 229920002554 vinyl polymer Polymers 0.000 description 7
- LMDZBCPBFSXMTL-UHFFFAOYSA-N 1-Ethyl-3-(3-dimethylaminopropyl)carbodiimide Substances CCN=C=NCCCN(C)C LMDZBCPBFSXMTL-UHFFFAOYSA-N 0.000 description 6
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 6
- 229960000549 4-dimethylaminophenol Drugs 0.000 description 6
- GPZYYYGYCRFPBU-UHFFFAOYSA-N 6-Hydroxyflavone Chemical compound C=1C(=O)C2=CC(O)=CC=C2OC=1C1=CC=CC=C1 GPZYYYGYCRFPBU-UHFFFAOYSA-N 0.000 description 6
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 6
- 201000001320 Atherosclerosis Diseases 0.000 description 6
- 239000005711 Benzoic acid Substances 0.000 description 6
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 6
- 241000124008 Mammalia Species 0.000 description 6
- 101150014691 PPARA gene Proteins 0.000 description 6
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- 239000003054 catalyst Substances 0.000 description 6
- 235000012000 cholesterol Nutrition 0.000 description 6
- 239000012230 colorless oil Substances 0.000 description 6
- 238000002425 crystallisation Methods 0.000 description 6
- 230000008025 crystallization Effects 0.000 description 6
- 235000014113 dietary fatty acids Nutrition 0.000 description 6
- 239000003085 diluting agent Substances 0.000 description 6
- PHLDCXRQEWWKNG-AWEZNQCLSA-N ethyl (2s)-3-[4-(3-hydroxyprop-1-ynyl)phenyl]-2-methoxypropanoate Chemical compound CCOC(=O)[C@@H](OC)CC1=CC=C(C#CCO)C=C1 PHLDCXRQEWWKNG-AWEZNQCLSA-N 0.000 description 6
- FJWFFBUXJSETHX-UHFFFAOYSA-N ethyl 3-[4-(6-hydroxyhex-1-ynyl)phenyl]-2-methoxypropanoate Chemical compound CCOC(=O)C(OC)CC1=CC=C(C#CCCCCO)C=C1 FJWFFBUXJSETHX-UHFFFAOYSA-N 0.000 description 6
- 239000000194 fatty acid Substances 0.000 description 6
- 229930195729 fatty acid Natural products 0.000 description 6
- 150000004665 fatty acids Chemical class 0.000 description 6
- 150000004820 halides Chemical class 0.000 description 6
- 125000001072 heteroaryl group Chemical group 0.000 description 6
- 238000000589 high-performance liquid chromatography-mass spectrometry Methods 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- 238000011321 prophylaxis Methods 0.000 description 6
- 230000002829 reductive effect Effects 0.000 description 6
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 6
- 208000024891 symptom Diseases 0.000 description 6
- 230000001225 therapeutic effect Effects 0.000 description 6
- 229940086542 triethylamine Drugs 0.000 description 6
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 6
- XMIIGOLPHOKFCH-UHFFFAOYSA-N 3-phenylpropionic acid Chemical compound OC(=O)CCC1=CC=CC=C1 XMIIGOLPHOKFCH-UHFFFAOYSA-N 0.000 description 5
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 5
- 108010010803 Gelatin Proteins 0.000 description 5
- 102000015779 HDL Lipoproteins Human genes 0.000 description 5
- 108010010234 HDL Lipoproteins Proteins 0.000 description 5
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 5
- 239000000443 aerosol Substances 0.000 description 5
- 150000001345 alkine derivatives Chemical class 0.000 description 5
- 150000001503 aryl iodides Chemical class 0.000 description 5
- 125000001246 bromo group Chemical group Br* 0.000 description 5
- STOASOOVVADOKH-UHFFFAOYSA-N but-3-ynyl 4-methylbenzenesulfonate Chemical compound CC1=CC=C(S(=O)(=O)OCCC#C)C=C1 STOASOOVVADOKH-UHFFFAOYSA-N 0.000 description 5
- 229910000024 caesium carbonate Inorganic materials 0.000 description 5
- 210000004027 cell Anatomy 0.000 description 5
- 150000002009 diols Chemical class 0.000 description 5
- 230000008034 disappearance Effects 0.000 description 5
- 208000035475 disorder Diseases 0.000 description 5
- 230000032050 esterification Effects 0.000 description 5
- 238000005886 esterification reaction Methods 0.000 description 5
- 239000000284 extract Substances 0.000 description 5
- 239000008273 gelatin Substances 0.000 description 5
- 229920000159 gelatin Polymers 0.000 description 5
- 235000019322 gelatine Nutrition 0.000 description 5
- 235000011852 gelatine desserts Nutrition 0.000 description 5
- 125000005843 halogen group Chemical group 0.000 description 5
- 125000000623 heterocyclic group Chemical group 0.000 description 5
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 5
- 239000004615 ingredient Substances 0.000 description 5
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 5
- PVNIIMVLHYAWGP-UHFFFAOYSA-N nicotinic acid Natural products OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 5
- 229960003424 phenylacetic acid Drugs 0.000 description 5
- 239000003279 phenylacetic acid Substances 0.000 description 5
- 229910000027 potassium carbonate Inorganic materials 0.000 description 5
- 239000006188 syrup Substances 0.000 description 5
- 235000020357 syrup Nutrition 0.000 description 5
- 150000003626 triacylglycerols Chemical class 0.000 description 5
- UIQXCQNXLAGBSQ-GEVKEYJPSA-N (2s)-2-methoxy-3-[4-[3-[(4-oxo-2-phenyl-2,3-dihydrochromen-6-yl)oxy]propoxy]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=C(OC(CC2=O)C=3C=CC=CC=3)C2=C1 UIQXCQNXLAGBSQ-GEVKEYJPSA-N 0.000 description 4
- BBPJBBSXHSIVBB-SFHVURJKSA-N (2s)-2-methoxy-3-[4-[3-[3-(trifluoromethyl)phenoxy]propoxy]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=CC(C(F)(F)F)=C1 BBPJBBSXHSIVBB-SFHVURJKSA-N 0.000 description 4
- ICPWFHKNYYRBSZ-UHFFFAOYSA-N 2-methoxypropanoic acid Chemical compound COC(C)C(O)=O ICPWFHKNYYRBSZ-UHFFFAOYSA-N 0.000 description 4
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 4
- 241000282412 Homo Species 0.000 description 4
- 102000007330 LDL Lipoproteins Human genes 0.000 description 4
- 108010007622 LDL Lipoproteins Proteins 0.000 description 4
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 4
- 241001465754 Metazoa Species 0.000 description 4
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical compound CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 4
- 239000000556 agonist Substances 0.000 description 4
- 235000001014 amino acid Nutrition 0.000 description 4
- 150000001413 amino acids Chemical class 0.000 description 4
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 4
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 4
- 239000011575 calcium Substances 0.000 description 4
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 4
- 238000010511 deprotection reaction Methods 0.000 description 4
- HGJMVBBKLSYWCM-INIZCTEOSA-N ethyl (2s)-3-[4-(5-hydroxypent-1-ynyl)phenyl]-2-methoxypropanoate Chemical compound CCOC(=O)[C@@H](OC)CC1=CC=C(C#CCCCO)C=C1 HGJMVBBKLSYWCM-INIZCTEOSA-N 0.000 description 4
- WHRLOJCOIKOQGL-UHFFFAOYSA-N ethyl 2-methoxypropanoate Chemical compound CCOC(=O)C(C)OC WHRLOJCOIKOQGL-UHFFFAOYSA-N 0.000 description 4
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Substances C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 4
- PQNFLJBBNBOBRQ-UHFFFAOYSA-N indane Chemical compound C1=CC=C2CCCC2=C1 PQNFLJBBNBOBRQ-UHFFFAOYSA-N 0.000 description 4
- 150000002576 ketones Chemical group 0.000 description 4
- 239000008101 lactose Substances 0.000 description 4
- 210000004185 liver Anatomy 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 239000002609 medium Substances 0.000 description 4
- 239000004533 oil dispersion Substances 0.000 description 4
- 229910052760 oxygen Inorganic materials 0.000 description 4
- VVWRJUBEIPHGQF-MDZDMXLPSA-N propan-2-yl (ne)-n-propan-2-yloxycarbonyliminocarbamate Chemical compound CC(C)OC(=O)\N=N\C(=O)OC(C)C VVWRJUBEIPHGQF-MDZDMXLPSA-N 0.000 description 4
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 4
- 230000009467 reduction Effects 0.000 description 4
- 210000002966 serum Anatomy 0.000 description 4
- 239000012312 sodium hydride Substances 0.000 description 4
- 238000003860 storage Methods 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 239000000454 talc Substances 0.000 description 4
- 229910052623 talc Inorganic materials 0.000 description 4
- 235000012222 talc Nutrition 0.000 description 4
- DNIAPMSPPWPWGF-VKHMYHEASA-N (+)-propylene glycol Chemical compound C[C@H](O)CO DNIAPMSPPWPWGF-VKHMYHEASA-N 0.000 description 3
- VKDKDAQGMUDFFU-AEFFLSMTSA-N (1r,3s)-3-(4-phenylphenoxy)cyclohexan-1-ol Chemical compound C1[C@H](O)CCC[C@@H]1OC1=CC=C(C=2C=CC=CC=2)C=C1 VKDKDAQGMUDFFU-AEFFLSMTSA-N 0.000 description 3
- OGNVQLDIPUXYDH-ZPKKHLQPSA-N (2R,3R,4S)-3-(2-methylpropanoylamino)-4-(4-phenyltriazol-1-yl)-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid Chemical compound CC(C)C(=O)N[C@H]1[C@H]([C@H](O)[C@H](O)CO)OC(C(O)=O)=C[C@@H]1N1N=NC(C=2C=CC=CC=2)=C1 OGNVQLDIPUXYDH-ZPKKHLQPSA-N 0.000 description 3
- HIQUOBYFGJXSSL-VWLOTQADSA-N (2s)-2-methoxy-2-[4-[2-oxo-3-(4-phenoxyphenoxy)propoxy]phenyl]propanoic acid Chemical compound C1=CC([C@@](C)(C(O)=O)OC)=CC=C1OCC(=O)COC(C=C1)=CC=C1OC1=CC=CC=C1 HIQUOBYFGJXSSL-VWLOTQADSA-N 0.000 description 3
- IORRPQPSXRLRSK-NRFANRHFSA-N (2s)-2-methoxy-3-[4-(3-quinolin-6-yloxypropoxy)phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=C(N=CC=C2)C2=C1 IORRPQPSXRLRSK-NRFANRHFSA-N 0.000 description 3
- HATCAMFALJZWCN-DEOSSOPVSA-N (2s)-2-methoxy-3-[4-[3-(2-phenylphenoxy)propoxy]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=CC=C1C1=CC=CC=C1 HATCAMFALJZWCN-DEOSSOPVSA-N 0.000 description 3
- BCCIZYAQOOQVIC-QFIPXVFZSA-N (2s)-2-methoxy-3-[4-[3-(3-morpholin-4-ylphenoxy)propoxy]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=CC(N2CCOCC2)=C1 BCCIZYAQOOQVIC-QFIPXVFZSA-N 0.000 description 3
- JPZLRFIYTMIIAY-MHZLTWQESA-N (2s)-2-methoxy-3-[4-[3-(4-phenoxyphenoxy)phenoxy]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OC1=CC=CC(OC=2C=CC(OC=3C=CC=CC=3)=CC=2)=C1 JPZLRFIYTMIIAY-MHZLTWQESA-N 0.000 description 3
- OQBPMLLJJXRYNN-DEOSSOPVSA-N (2s)-2-methoxy-3-[4-[3-(9-oxofluoren-2-yl)oxypropoxy]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=C(C=2C(=CC=CC=2)C2=O)C2=C1 OQBPMLLJJXRYNN-DEOSSOPVSA-N 0.000 description 3
- QTLJGHHCHFGSIX-GPNIZQGCSA-N (2s)-2-methoxy-3-[4-[3-[(4-oxo-2-phenyl-2,3-dihydrochromen-7-yl)oxy]propoxy]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=C(C(=O)CC(O2)C=3C=CC=CC=3)C2=C1 QTLJGHHCHFGSIX-GPNIZQGCSA-N 0.000 description 3
- MZNWEZSTWXRNAH-QFIPXVFZSA-N (2s)-2-methoxy-3-[4-[3-[(5-oxo-7,8-dihydro-6h-naphthalen-2-yl)oxy]propoxy]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=C(C(=O)CCC2)C2=C1 MZNWEZSTWXRNAH-QFIPXVFZSA-N 0.000 description 3
- JJBITQMBHWFHDH-SFHVURJKSA-N (2s)-2-methoxy-3-[4-[3-[4-(trifluoromethyl)phenoxy]propoxy]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=C(C(F)(F)F)C=C1 JJBITQMBHWFHDH-SFHVURJKSA-N 0.000 description 3
- OLPJWPDRVOURMQ-DEOSSOPVSA-N (2s)-2-methoxy-3-[4-[3-[4-[4-(trifluoromethyl)phenoxy]phenoxy]prop-1-ynyl]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1C#CCOC(C=C1)=CC=C1OC1=CC=C(C(F)(F)F)C=C1 OLPJWPDRVOURMQ-DEOSSOPVSA-N 0.000 description 3
- PDQGIPIPIASTKV-DEOSSOPVSA-N (2s)-2-methoxy-3-[4-[3-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propoxy]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC(C=C1)=CC=C1OC1=CC=C(C(F)(F)F)C=C1 PDQGIPIPIASTKV-DEOSSOPVSA-N 0.000 description 3
- AZNMJUMEMBFWKZ-VWLOTQADSA-N (2s)-2-methoxy-3-[4-[4-(4-phenoxyphenoxy)butanoyl]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1C(=O)CCCOC(C=C1)=CC=C1OC1=CC=CC=C1 AZNMJUMEMBFWKZ-VWLOTQADSA-N 0.000 description 3
- OHBISTNOKDTWDW-NRFANRHFSA-N (2s)-3-[4-(3-isoquinolin-5-yloxypropoxy)phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=CC2=CN=CC=C12 OHBISTNOKDTWDW-NRFANRHFSA-N 0.000 description 3
- PGZKIZDZAUFODK-SFHVURJKSA-N (2s)-3-[4-[3-(2,4-difluorophenoxy)propoxy]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=C(F)C=C1F PGZKIZDZAUFODK-SFHVURJKSA-N 0.000 description 3
- HRVBWBSUBQFGRZ-QFIPXVFZSA-N (2s)-3-[4-[3-(4-butylphenoxy)prop-1-ynyl]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(CCCC)=CC=C1OCC#CC1=CC=C(C[C@H](OC)C(O)=O)C=C1 HRVBWBSUBQFGRZ-QFIPXVFZSA-N 0.000 description 3
- PEHZNDNZMZVYAT-NDEPHWFRSA-N (2s)-3-[4-[3-[(3-benzoylphenoxy)methyl]phenyl]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1C1=CC=CC(COC=2C=C(C=CC=2)C(=O)C=2C=CC=CC=2)=C1 PEHZNDNZMZVYAT-NDEPHWFRSA-N 0.000 description 3
- AVNSRCOTLGPODP-NDEPHWFRSA-N (2s)-3-[4-[4-[(4-benzoylphenoxy)methyl]phenyl]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1C(C=C1)=CC=C1COC1=CC=C(C(=O)C=2C=CC=CC=2)C=C1 AVNSRCOTLGPODP-NDEPHWFRSA-N 0.000 description 3
- BDNKZNFMNDZQMI-UHFFFAOYSA-N 1,3-diisopropylcarbodiimide Chemical compound CC(C)N=C=NC(C)C BDNKZNFMNDZQMI-UHFFFAOYSA-N 0.000 description 3
- YPFDHNVEDLHUCE-UHFFFAOYSA-N 1,3-propanediol Substances OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 description 3
- 229940035437 1,3-propanediol Drugs 0.000 description 3
- JBQTZLNCDIFCCO-UHFFFAOYSA-N 1-(4-hydroxyphenyl)-2-phenylethan-1-one Chemical compound C1=CC(O)=CC=C1C(=O)CC1=CC=CC=C1 JBQTZLNCDIFCCO-UHFFFAOYSA-N 0.000 description 3
- ZZLQHXCRRMUGQJ-UHFFFAOYSA-N 2'-Hydroxyflavone Natural products OC1=CC=CC=C1C1=CC(=O)C2=CC=CC=C2O1 ZZLQHXCRRMUGQJ-UHFFFAOYSA-N 0.000 description 3
- GXUBPHMYNSICJC-UHFFFAOYSA-N 2-hydroxyfluoren-9-one Chemical compound C1=CC=C2C(=O)C3=CC(O)=CC=C3C2=C1 GXUBPHMYNSICJC-UHFFFAOYSA-N 0.000 description 3
- HNBAEAOAKVMVTB-UHFFFAOYSA-N 2-methoxy-3-[4-[3-(4-phenylmethoxycarbonylphenoxy)propoxy]phenyl]propanoic acid Chemical compound C1=CC(CC(OC)C(O)=O)=CC=C1OCCCOC1=CC=C(C(=O)OCC=2C=CC=CC=2)C=C1 HNBAEAOAKVMVTB-UHFFFAOYSA-N 0.000 description 3
- NJISOZFQJSBGHE-UHFFFAOYSA-N 3-(4-hydroxy-3-methoxyphenyl)-2-methoxypropanoic acid Chemical compound COC(C(O)=O)CC1=CC=C(O)C(OC)=C1 NJISOZFQJSBGHE-UHFFFAOYSA-N 0.000 description 3
- NDACNGSDAFKTGE-UHFFFAOYSA-N 3-hydroxydiphenylamine Chemical compound OC1=CC=CC(NC=2C=CC=CC=2)=C1 NDACNGSDAFKTGE-UHFFFAOYSA-N 0.000 description 3
- YHZQOKUDQQISEW-UHFFFAOYSA-N 4-Cumylphenol Natural products C1=CC(C(C)C)=CC=C1C1=CC=C(O)C=C1 YHZQOKUDQQISEW-UHFFFAOYSA-N 0.000 description 3
- HJSPWKGEPDZNLK-UHFFFAOYSA-N 4-benzylphenol Chemical compound C1=CC(O)=CC=C1CC1=CC=CC=C1 HJSPWKGEPDZNLK-UHFFFAOYSA-N 0.000 description 3
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- VOPWNXZWBYDODV-UHFFFAOYSA-N Chlorodifluoromethane Chemical compound FC(F)Cl VOPWNXZWBYDODV-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 3
- BDAGIHXWWSANSR-UHFFFAOYSA-N Formic acid Chemical compound OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 3
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 3
- 101100513046 Neurospora crassa (strain ATCC 24698 / 74-OR23-1A / CBS 708.71 / DSM 1257 / FGSC 987) eth-1 gene Proteins 0.000 description 3
- 101100030361 Neurospora crassa (strain ATCC 24698 / 74-OR23-1A / CBS 708.71 / DSM 1257 / FGSC 987) pph-3 gene Proteins 0.000 description 3
- 108020005497 Nuclear hormone receptor Proteins 0.000 description 3
- 102100038824 Peroxisome proliferator-activated receptor delta Human genes 0.000 description 3
- 102100038825 Peroxisome proliferator-activated receptor gamma Human genes 0.000 description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 3
- 210000000577 adipose tissue Anatomy 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 230000008901 benefit Effects 0.000 description 3
- RWCCWEUUXYIKHB-UHFFFAOYSA-N benzophenone Chemical compound C=1C=CC=CC=1C(=O)C1=CC=CC=C1 RWCCWEUUXYIKHB-UHFFFAOYSA-N 0.000 description 3
- 239000011230 binding agent Substances 0.000 description 3
- LLEMOWNGBBNAJR-UHFFFAOYSA-N biphenyl-2-ol Chemical compound OC1=CC=CC=C1C1=CC=CC=C1 LLEMOWNGBBNAJR-UHFFFAOYSA-N 0.000 description 3
- 210000004369 blood Anatomy 0.000 description 3
- 239000008280 blood Substances 0.000 description 3
- 239000001913 cellulose Substances 0.000 description 3
- 229920002678 cellulose Polymers 0.000 description 3
- 235000010980 cellulose Nutrition 0.000 description 3
- 239000007810 chemical reaction solvent Substances 0.000 description 3
- 238000002648 combination therapy Methods 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- 125000004122 cyclic group Chemical group 0.000 description 3
- XCIXKGXIYUWCLL-UHFFFAOYSA-N cyclopentanol Chemical compound OC1CCCC1 XCIXKGXIYUWCLL-UHFFFAOYSA-N 0.000 description 3
- PXBRQCKWGAHEHS-UHFFFAOYSA-N dichlorodifluoromethane Chemical compound FC(F)(Cl)Cl PXBRQCKWGAHEHS-UHFFFAOYSA-N 0.000 description 3
- 239000006185 dispersion Substances 0.000 description 3
- 239000002552 dosage form Substances 0.000 description 3
- 229940079593 drug Drugs 0.000 description 3
- 239000012467 final product Substances 0.000 description 3
- 239000000796 flavoring agent Substances 0.000 description 3
- 230000002641 glycemic effect Effects 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 125000005842 heteroatom Chemical group 0.000 description 3
- 229910052740 iodine Inorganic materials 0.000 description 3
- 150000002632 lipids Chemical class 0.000 description 3
- 239000000314 lubricant Substances 0.000 description 3
- DUWWHGPELOTTOE-UHFFFAOYSA-N n-(5-chloro-2,4-dimethoxyphenyl)-3-oxobutanamide Chemical compound COC1=CC(OC)=C(NC(=O)CC(C)=O)C=C1Cl DUWWHGPELOTTOE-UHFFFAOYSA-N 0.000 description 3
- 108020004017 nuclear receptors Proteins 0.000 description 3
- 238000007254 oxidation reaction Methods 0.000 description 3
- QBDSZLJBMIMQRS-UHFFFAOYSA-N p-Cumylphenol Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=CC=C1 QBDSZLJBMIMQRS-UHFFFAOYSA-N 0.000 description 3
- 125000004115 pentoxy group Chemical group [*]OC([H])([H])C([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 3
- 239000000546 pharmaceutical excipient Substances 0.000 description 3
- 239000006187 pill Substances 0.000 description 3
- 229920001223 polyethylene glycol Polymers 0.000 description 3
- 229920000166 polytrimethylene carbonate Polymers 0.000 description 3
- 229910052700 potassium Inorganic materials 0.000 description 3
- 239000011591 potassium Substances 0.000 description 3
- 101150075122 ppard gene Proteins 0.000 description 3
- 125000006239 protecting group Chemical group 0.000 description 3
- 239000000377 silicon dioxide Substances 0.000 description 3
- HELHAJAZNSDZJO-OLXYHTOASA-L sodium L-tartrate Chemical compound [Na+].[Na+].[O-]C(=O)[C@H](O)[C@@H](O)C([O-])=O HELHAJAZNSDZJO-OLXYHTOASA-L 0.000 description 3
- 239000012279 sodium borohydride Substances 0.000 description 3
- 229910000033 sodium borohydride Inorganic materials 0.000 description 3
- 239000001433 sodium tartrate Substances 0.000 description 3
- 229960002167 sodium tartrate Drugs 0.000 description 3
- 235000011004 sodium tartrates Nutrition 0.000 description 3
- 238000010532 solid phase synthesis reaction Methods 0.000 description 3
- 239000007921 spray Substances 0.000 description 3
- 230000004936 stimulating effect Effects 0.000 description 3
- 239000000829 suppository Substances 0.000 description 3
- BCNZYOJHNLTNEZ-UHFFFAOYSA-N tert-butyldimethylsilyl chloride Chemical compound CC(C)(C)[Si](C)(C)Cl BCNZYOJHNLTNEZ-UHFFFAOYSA-N 0.000 description 3
- 238000002560 therapeutic procedure Methods 0.000 description 3
- NWYNLOMOKHYWMY-RDJZCZTQSA-N (1s,3s)-3-(4-phenylphenoxy)cyclopentan-1-ol Chemical compound C1[C@@H](O)CC[C@@H]1OC1=CC=C(C=2C=CC=CC=2)C=C1 NWYNLOMOKHYWMY-RDJZCZTQSA-N 0.000 description 2
- FHFDJJWFCDGBEM-UHFFFAOYSA-N (2-fluorophenyl)-(4-hydroxyphenyl)methanone Chemical compound C1=CC(O)=CC=C1C(=O)C1=CC=CC=C1F FHFDJJWFCDGBEM-UHFFFAOYSA-N 0.000 description 2
- FHWUVJDRWFVWOU-XMMPIXPASA-N (2r)-2-ethoxy-3-[4-[2-(4-phenoxyphenoxy)ethoxy]phenyl]propanoic acid Chemical compound C1=CC(C[C@@H](OCC)C(O)=O)=CC=C1OCCOC(C=C1)=CC=C1OC1=CC=CC=C1 FHWUVJDRWFVWOU-XMMPIXPASA-N 0.000 description 2
- GTCCGKPBSJZVRZ-RFZPGFLSSA-N (2r,4r)-pentane-2,4-diol Chemical compound C[C@@H](O)C[C@@H](C)O GTCCGKPBSJZVRZ-RFZPGFLSSA-N 0.000 description 2
- DTPXQPPBCSRQCT-HKBQPEDESA-N (2s)-2-methoxy-3-[3-(4-methoxyphenyl)-4-[3-(4-phenylphenoxy)propoxy]phenyl]propanoic acid Chemical compound C=1C=C(OC)C=CC=1C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC(C=C1)=CC=C1C1=CC=CC=C1 DTPXQPPBCSRQCT-HKBQPEDESA-N 0.000 description 2
- JGKRKWDSRRHLQH-NRFANRHFSA-N (2s)-2-methoxy-3-[4-(2-naphthalen-2-yloxyethoxy)phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCOC1=CC=C(C=CC=C2)C2=C1 JGKRKWDSRRHLQH-NRFANRHFSA-N 0.000 description 2
- VQCMFWNRILUGME-KRWDZBQOSA-N (2s)-2-methoxy-3-[4-(2-phenoxyethoxy)phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCOC1=CC=CC=C1 VQCMFWNRILUGME-KRWDZBQOSA-N 0.000 description 2
- BRMKKACTGUBUGT-FQEVSTJZSA-N (2s)-2-methoxy-3-[4-(2-quinolin-6-yloxyethoxy)phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCOC1=CC=C(N=CC=C2)C2=C1 BRMKKACTGUBUGT-FQEVSTJZSA-N 0.000 description 2
- VTWGCTQGXMECKB-SFHVURJKSA-N (2s)-2-methoxy-3-[4-(3-phenoxypropoxy)phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=CC=C1 VTWGCTQGXMECKB-SFHVURJKSA-N 0.000 description 2
- YCOGBTQPMKJZBB-NRFANRHFSA-N (2s)-2-methoxy-3-[4-(5-phenylmethoxypentoxy)phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCCCOCC1=CC=CC=C1 YCOGBTQPMKJZBB-NRFANRHFSA-N 0.000 description 2
- ABPTYUWIDJCVHV-QHCPKHFHSA-N (2s)-2-methoxy-3-[4-[(3-phenylmethoxyphenyl)methoxy]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCC1=CC=CC(OCC=2C=CC=CC=2)=C1 ABPTYUWIDJCVHV-QHCPKHFHSA-N 0.000 description 2
- QHAPCTZMOBKCAK-HNNXBMFYSA-N (2s)-2-methoxy-3-[4-[2-(2,3,6-trifluorophenoxy)ethoxy]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCOC1=C(F)C=CC(F)=C1F QHAPCTZMOBKCAK-HNNXBMFYSA-N 0.000 description 2
- NLTWKDNPJQKRRU-SFHVURJKSA-N (2s)-2-methoxy-3-[4-[2-(2-methoxyphenoxy)ethoxy]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCOC1=CC=CC=C1OC NLTWKDNPJQKRRU-SFHVURJKSA-N 0.000 description 2
- KHZIAERAYVEOOY-QHCPKHFHSA-N (2s)-2-methoxy-3-[4-[2-(2-phenylphenoxy)ethoxy]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCOC1=CC=CC=C1C1=CC=CC=C1 KHZIAERAYVEOOY-QHCPKHFHSA-N 0.000 description 2
- IJHUIBJXMJWTIA-FQEVSTJZSA-N (2s)-2-methoxy-3-[4-[2-(2-propan-2-ylphenoxy)ethoxy]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCOC1=CC=CC=C1C(C)C IJHUIBJXMJWTIA-FQEVSTJZSA-N 0.000 description 2
- XVQBVIIHJYGOMF-NRFANRHFSA-N (2s)-2-methoxy-3-[4-[2-(2-pyrrolidin-1-ylphenoxy)ethoxy]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCOC1=CC=CC=C1N1CCCC1 XVQBVIIHJYGOMF-NRFANRHFSA-N 0.000 description 2
- GVCCHGJHKPYDOV-SFHVURJKSA-N (2s)-2-methoxy-3-[4-[2-(3-methoxyphenoxy)ethoxy]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCOC1=CC=CC(OC)=C1 GVCCHGJHKPYDOV-SFHVURJKSA-N 0.000 description 2
- LVILYJZJNNYORH-NRFANRHFSA-N (2s)-2-methoxy-3-[4-[2-(3-morpholin-4-ylphenoxy)ethoxy]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCOC1=CC=CC(N2CCOCC2)=C1 LVILYJZJNNYORH-NRFANRHFSA-N 0.000 description 2
- KYNAPHHHEVGAOC-QHCPKHFHSA-N (2s)-2-methoxy-3-[4-[2-(3-phenylphenoxy)ethoxy]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCOC1=CC=CC(C=2C=CC=CC=2)=C1 KYNAPHHHEVGAOC-QHCPKHFHSA-N 0.000 description 2
- XFIIAKUNLKRIJF-QFIPXVFZSA-N (2s)-2-methoxy-3-[4-[2-[4-(pyridine-3-carbonylamino)phenoxy]ethoxy]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCOC(C=C1)=CC=C1NC(=O)C1=CC=CN=C1 XFIIAKUNLKRIJF-QFIPXVFZSA-N 0.000 description 2
- WISDNCNUWPHGSL-IBGZPJMESA-N (2s)-2-methoxy-3-[4-[3-(2-methoxyphenoxy)propoxy]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=CC=C1OC WISDNCNUWPHGSL-IBGZPJMESA-N 0.000 description 2
- LNCDJWXDEHRVPP-NRFANRHFSA-N (2s)-2-methoxy-3-[4-[3-(2-propan-2-ylphenoxy)propoxy]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=CC=C1C(C)C LNCDJWXDEHRVPP-NRFANRHFSA-N 0.000 description 2
- SWJDBXXUQFTVQJ-DEOSSOPVSA-N (2s)-2-methoxy-3-[4-[3-(3-phenylphenoxy)propoxy]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=CC(C=2C=CC=CC=2)=C1 SWJDBXXUQFTVQJ-DEOSSOPVSA-N 0.000 description 2
- CUTXURNLCSLSPL-SANMLTNESA-N (2s)-2-methoxy-3-[4-[3-(4-octylphenoxy)propoxy]phenyl]propanoic acid Chemical compound C1=CC(CCCCCCCC)=CC=C1OCCCOC1=CC=C(C[C@H](OC)C(O)=O)C=C1 CUTXURNLCSLSPL-SANMLTNESA-N 0.000 description 2
- OZOIBFJFJLMTDE-MHZLTWQESA-N (2s)-2-methoxy-3-[4-[3-(4-phenoxy-2-propylphenoxy)propoxy]phenyl]propanoic acid Chemical compound C=1C=C(OCCCOC=2C=CC(C[C@H](OC)C(O)=O)=CC=2)C(CCC)=CC=1OC1=CC=CC=C1 OZOIBFJFJLMTDE-MHZLTWQESA-N 0.000 description 2
- ZGBSWXDYCVHFKG-MHZLTWQESA-N (2s)-2-methoxy-3-[4-[3-(4-phenoxyphenoxy)propoxy]-3-propylphenyl]propanoic acid Chemical compound CCCC1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC(C=C1)=CC=C1OC1=CC=CC=C1 ZGBSWXDYCVHFKG-MHZLTWQESA-N 0.000 description 2
- PAONATDOLYDBAK-MHZLTWQESA-N (2s)-2-methoxy-3-[4-[3-(4-phenyl-2-propylphenoxy)propoxy]phenyl]propanoic acid Chemical compound CCCC1=CC(C=2C=CC=CC=2)=CC=C1OCCCOC1=CC=C(C[C@H](OC)C(O)=O)C=C1 PAONATDOLYDBAK-MHZLTWQESA-N 0.000 description 2
- JLTTWCIDRZTTCK-VWLOTQADSA-N (2s)-2-methoxy-3-[4-[3-(4-phenylmethoxyphenoxy)propoxy]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC(C=C1)=CC=C1OCC1=CC=CC=C1 JLTTWCIDRZTTCK-VWLOTQADSA-N 0.000 description 2
- KGAARJXLZCBRRS-IBGZPJMESA-N (2s)-2-methoxy-3-[4-[3-[4-(2,2,3,3-tetrafluoropropoxy)phenoxy]propoxy]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=C(OCC(F)(F)C(F)F)C=C1 KGAARJXLZCBRRS-IBGZPJMESA-N 0.000 description 2
- JSAJJWFLZUYBEV-PMERELPUSA-N (2s)-2-methoxy-3-[4-[3-[4-(4-phenoxyphenyl)phenoxy]propoxy]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=C(C=2C=CC(OC=3C=CC=CC=3)=CC=2)C=C1 JSAJJWFLZUYBEV-PMERELPUSA-N 0.000 description 2
- APSIBJYEBMJTPA-VWLOTQADSA-N (2s)-2-methoxy-3-[4-[4-(4-phenoxyphenoxy)butoxy]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCCOC(C=C1)=CC=C1OC1=CC=CC=C1 APSIBJYEBMJTPA-VWLOTQADSA-N 0.000 description 2
- FJUACDARCVZYOJ-VIFPVBQESA-N (2s)-3-(4-hydroxyphenyl)-2-methoxypropanoic acid Chemical compound CO[C@H](C(O)=O)CC1=CC=C(O)C=C1 FJUACDARCVZYOJ-VIFPVBQESA-N 0.000 description 2
- NYXYBYOZAIKJIE-DEOSSOPVSA-N (2s)-3-[4-(3-dibenzofuran-2-yloxypropoxy)phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=C(OC=2C3=CC=CC=2)C3=C1 NYXYBYOZAIKJIE-DEOSSOPVSA-N 0.000 description 2
- BSVHQNIUUSWNBI-AWEZNQCLSA-N (2s)-3-[4-(5-hydroxypent-1-ynyl)phenyl]-2-methoxypropanoic acid Chemical compound CO[C@H](C(O)=O)CC1=CC=C(C#CCCCO)C=C1 BSVHQNIUUSWNBI-AWEZNQCLSA-N 0.000 description 2
- JUYYQIAYWJNBCI-FQEVSTJZSA-N (2s)-3-[4-[2-(2,3-dihydro-1h-inden-5-yloxy)ethoxy]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCOC1=CC=C(CCC2)C2=C1 JUYYQIAYWJNBCI-FQEVSTJZSA-N 0.000 description 2
- VGCRCBMEJCBVQT-SFHVURJKSA-N (2s)-3-[4-[2-(2-cyanophenoxy)ethoxy]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCOC1=CC=CC=C1C#N VGCRCBMEJCBVQT-SFHVURJKSA-N 0.000 description 2
- CAWFBEMFNOEWCA-SFHVURJKSA-N (2s)-3-[4-[2-(3-cyanophenoxy)ethoxy]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCOC1=CC=CC(C#N)=C1 CAWFBEMFNOEWCA-SFHVURJKSA-N 0.000 description 2
- QNTUZXJEEDULEE-QHCPKHFHSA-N (2s)-3-[4-[2-(4-benzoylphenoxy)acetyl]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1C(=O)COC1=CC=C(C(=O)C=2C=CC=CC=2)C=C1 QNTUZXJEEDULEE-QHCPKHFHSA-N 0.000 description 2
- PPXXAYWMEKYUTC-RCSZBHJWSA-N (2s)-3-[4-[2-(4-benzoylphenoxy)cyclohexyl]oxyphenyl]-2-methoxypropanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OC1C(OC=2C=CC(=CC=2)C(=O)C=2C=CC=CC=2)CCCC1 PPXXAYWMEKYUTC-RCSZBHJWSA-N 0.000 description 2
- RILKPVAABXBRJR-QHCPKHFHSA-N (2s)-3-[4-[2-[4-(2-fluorophenyl)phenoxy]ethoxy]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCOC1=CC=C(C=2C(=CC=CC=2)F)C=C1 RILKPVAABXBRJR-QHCPKHFHSA-N 0.000 description 2
- IMTYWBIZCOSWQL-RCSZBHJWSA-N (2s)-3-[4-[2-[4-(4-fluorobenzoyl)phenoxy]cyclohexyl]oxyphenyl]-2-methoxypropanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OC1C(OC=2C=CC(=CC=2)C(=O)C=2C=CC(F)=CC=2)CCCC1 IMTYWBIZCOSWQL-RCSZBHJWSA-N 0.000 description 2
- LLXXDDFYKZCCJJ-IBGZPJMESA-N (2s)-3-[4-[3-(1,3-benzodioxol-5-yloxy)propoxy]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=C(OCO2)C2=C1 LLXXDDFYKZCCJJ-IBGZPJMESA-N 0.000 description 2
- QRRWXWVFPTXSPV-IBGZPJMESA-N (2s)-3-[4-[3-(1h-indol-7-yloxy)propoxy]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=CC2=C1NC=C2 QRRWXWVFPTXSPV-IBGZPJMESA-N 0.000 description 2
- KJEPLXWTUNOTTI-NRFANRHFSA-N (2s)-3-[4-[3-(2,3-dihydro-1h-inden-5-yloxy)propoxy]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=C(CCC2)C2=C1 KJEPLXWTUNOTTI-NRFANRHFSA-N 0.000 description 2
- CLTQPNGGOOAKBG-IBGZPJMESA-N (2s)-3-[4-[3-(2-cyanophenoxy)propoxy]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=CC=C1C#N CLTQPNGGOOAKBG-IBGZPJMESA-N 0.000 description 2
- WAEWEPPXRQNSQV-SFHVURJKSA-N (2s)-3-[4-[3-(3,5-difluorophenoxy)propoxy]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC(F)=CC(F)=C1 WAEWEPPXRQNSQV-SFHVURJKSA-N 0.000 description 2
- YPXRKGYTQVKZDI-SFHVURJKSA-N (2s)-3-[4-[3-(3-fluorophenoxy)propoxy]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=CC(F)=C1 YPXRKGYTQVKZDI-SFHVURJKSA-N 0.000 description 2
- HHLIVAUNQMTUME-VWLOTQADSA-N (2s)-3-[4-[3-(4-benzoylphenoxy)propoxy]phenyl]-2-ethoxypropanoic acid Chemical compound C1=CC(C[C@H](OCC)C(O)=O)=CC=C1OCCCOC1=CC=C(C(=O)C=2C=CC=CC=2)C=C1 HHLIVAUNQMTUME-VWLOTQADSA-N 0.000 description 2
- AYVGGQNJTVBLAM-QFIPXVFZSA-N (2s)-3-[4-[3-(4-butoxyphenoxy)propoxy]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(OCCCC)=CC=C1OCCCOC1=CC=C(C[C@H](OC)C(O)=O)C=C1 AYVGGQNJTVBLAM-QFIPXVFZSA-N 0.000 description 2
- LTYACAYPKNAGPM-QHCPKHFHSA-N (2s)-3-[4-[3-(4-cyclopentylphenoxy)propoxy]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=C(C2CCCC2)C=C1 LTYACAYPKNAGPM-QHCPKHFHSA-N 0.000 description 2
- PQMSRANERHUJRN-LJAQVGFWSA-N (2s)-3-[4-[3-(4-dibenzofuran-4-ylphenoxy)propoxy]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=C(C=2C=3OC4=CC=CC=C4C=3C=CC=2)C=C1 PQMSRANERHUJRN-LJAQVGFWSA-N 0.000 description 2
- MKPAPOHCWDLMAP-NDEPHWFRSA-N (2s)-3-[4-[3-(4-dibenzothiophen-4-ylphenoxy)propoxy]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=C(C=2C=3SC4=CC=CC=C4C=3C=CC=2)C=C1 MKPAPOHCWDLMAP-NDEPHWFRSA-N 0.000 description 2
- KDEPZYLVZWATOU-SFHVURJKSA-N (2s)-3-[4-[3-(4-fluorophenoxy)prop-1-ynyl]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1C#CCOC1=CC=C(F)C=C1 KDEPZYLVZWATOU-SFHVURJKSA-N 0.000 description 2
- OPQJQURUTXKYDW-VWLOTQADSA-N (2s)-3-[4-[3-(4-heptoxyphenoxy)propoxy]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(OCCCCCCC)=CC=C1OCCCOC1=CC=C(C[C@H](OC)C(O)=O)C=C1 OPQJQURUTXKYDW-VWLOTQADSA-N 0.000 description 2
- PDXZEJYXAMSEMG-PMERELPUSA-N (2s)-3-[4-[3-(4-phenoxyphenoxy)propoxy]phenyl]-2-phenylmethoxypropanoic acid Chemical compound C([C@@H](C(=O)O)OCC=1C=CC=CC=1)C(C=C1)=CC=C1OCCCOC(C=C1)=CC=C1OC1=CC=CC=C1 PDXZEJYXAMSEMG-PMERELPUSA-N 0.000 description 2
- HACKQGOTMSNVFB-NDEPHWFRSA-N (2s)-3-[4-[3-(6-benzoylnaphthalen-2-yl)oxypropoxy]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=C(C=C(C=C2)C(=O)C=3C=CC=CC=3)C2=C1 HACKQGOTMSNVFB-NDEPHWFRSA-N 0.000 description 2
- PEBNAGNEOOPPJD-VWLOTQADSA-N (2s)-3-[4-[3-(9h-fluoren-2-yloxy)propoxy]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=C2C3=CC=CC=C3CC2=C1 PEBNAGNEOOPPJD-VWLOTQADSA-N 0.000 description 2
- ZKUCOGDZQLLMJK-DEOSSOPVSA-N (2s)-3-[4-[3-[4-(2-fluorobenzoyl)phenoxy]prop-1-ynyl]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1C#CCOC1=CC=C(C(=O)C=2C(=CC=CC=2)F)C=C1 ZKUCOGDZQLLMJK-DEOSSOPVSA-N 0.000 description 2
- CAWOLOSPRONVJJ-DEOSSOPVSA-N (2s)-3-[4-[3-[4-(4-chlorophenyl)phenoxy]propoxy]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=C(C=2C=CC(Cl)=CC=2)C=C1 CAWOLOSPRONVJJ-DEOSSOPVSA-N 0.000 description 2
- AEBKMFXSZKRQPW-DEOSSOPVSA-N (2s)-3-[4-[3-[4-(4-fluorophenyl)phenoxy]propoxy]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=C(C=2C=CC(F)=CC=2)C=C1 AEBKMFXSZKRQPW-DEOSSOPVSA-N 0.000 description 2
- LZLBUYSYKKNESK-DEOSSOPVSA-N (2s)-3-[4-[3-[4-[3,5-bis(trifluoromethyl)phenyl]phenoxy]propoxy]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=C(C=2C=C(C=C(C=2)C(F)(F)F)C(F)(F)F)C=C1 LZLBUYSYKKNESK-DEOSSOPVSA-N 0.000 description 2
- WWPLBQGABFNDJE-DEOSSOPVSA-N (2s)-3-[4-[3-[4-[c-(4-fluorophenyl)-n-hydroxycarbonimidoyl]phenoxy]propoxy]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=C(C(=NO)C=2C=CC(F)=CC=2)C=C1 WWPLBQGABFNDJE-DEOSSOPVSA-N 0.000 description 2
- NTUJILMKRIPRON-SANMLTNESA-N (2s)-3-[4-[3-[[3-(4-fluorophenyl)-1-benzofuran-6-yl]oxy]propoxy]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=C(C(=CO2)C=3C=CC(F)=CC=3)C2=C1 NTUJILMKRIPRON-SANMLTNESA-N 0.000 description 2
- HZKLLWZPWXZTNQ-VWLOTQADSA-N (2s)-3-[4-[4-(4-benzoylphenoxy)butoxy]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCCOC1=CC=C(C(=O)C=2C=CC=CC=2)C=C1 HZKLLWZPWXZTNQ-VWLOTQADSA-N 0.000 description 2
- UFQJBLSFAWRIEV-SANMLTNESA-N (2s)-3-[4-[5-[4-(2-fluorobenzoyl)phenoxy]pent-1-ynyl]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1C#CCCCOC1=CC=C(C(=O)C=2C(=CC=CC=2)F)C=C1 UFQJBLSFAWRIEV-SANMLTNESA-N 0.000 description 2
- WGVBPCVBGXBZGT-AWEZNQCLSA-N (2s)-3-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-2-methoxypropanoic acid Chemical compound CO[C@H](C(O)=O)CC1=CC=C(O[Si](C)(C)C(C)(C)C)C=C1 WGVBPCVBGXBZGT-AWEZNQCLSA-N 0.000 description 2
- OHMBHFSEKCCCBW-LWOQYNTDSA-N (5r)-hexane-2,5-diol Chemical compound CC(O)CC[C@@H](C)O OHMBHFSEKCCCBW-LWOQYNTDSA-N 0.000 description 2
- DIOHEXPTUTVCNX-UHFFFAOYSA-N 1,1,1-trifluoro-n-phenyl-n-(trifluoromethylsulfonyl)methanesulfonamide Chemical compound FC(F)(F)S(=O)(=O)N(S(=O)(=O)C(F)(F)F)C1=CC=CC=C1 DIOHEXPTUTVCNX-UHFFFAOYSA-N 0.000 description 2
- FPIRBHDGWMWJEP-UHFFFAOYSA-N 1-hydroxy-7-azabenzotriazole Chemical compound C1=CN=C2N(O)N=NC2=C1 FPIRBHDGWMWJEP-UHFFFAOYSA-N 0.000 description 2
- HBEDSQVIWPRPAY-UHFFFAOYSA-N 2,3-dihydrobenzofuran Chemical compound C1=CC=C2OCCC2=C1 HBEDSQVIWPRPAY-UHFFFAOYSA-N 0.000 description 2
- OVSKIKFHRZPJSS-UHFFFAOYSA-N 2,4-D Chemical compound OC(=O)COC1=CC=C(Cl)C=C1Cl OVSKIKFHRZPJSS-UHFFFAOYSA-N 0.000 description 2
- FSKKRVYTNVMAHG-SFHVURJKSA-N 2-[3-[4-[(2s)-2-carboxy-2-methoxyethyl]phenoxy]propoxy]benzoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=CC=C1C(O)=O FSKKRVYTNVMAHG-SFHVURJKSA-N 0.000 description 2
- NYXGGJYQOHBGJG-UHFFFAOYSA-N 2-methoxy-3-[2-methoxy-4-[3-(4-phenylphenoxy)propoxy]phenyl]propanoic acid Chemical compound C1=C(OC)C(CC(OC)C(O)=O)=CC=C1OCCCOC1=CC=C(C=2C=CC=CC=2)C=C1 NYXGGJYQOHBGJG-UHFFFAOYSA-N 0.000 description 2
- ATFUBHGDLBZQJD-UHFFFAOYSA-N 2-methoxy-3-[3-(3-phenoxypropoxy)phenyl]propanoic acid Chemical compound COC(C(O)=O)CC1=CC=CC(OCCCOC=2C=CC=CC=2)=C1 ATFUBHGDLBZQJD-UHFFFAOYSA-N 0.000 description 2
- IACQHCDSBDFXMS-UHFFFAOYSA-N 2-methoxy-3-[3-[3-(2-methoxyphenoxy)propoxy]phenyl]propanoic acid Chemical compound COC(C(O)=O)CC1=CC=CC(OCCCOC=2C(=CC=CC=2)OC)=C1 IACQHCDSBDFXMS-UHFFFAOYSA-N 0.000 description 2
- FSIMPVZLRPTPEG-UHFFFAOYSA-N 2-methoxy-3-[3-[3-(2-propan-2-ylphenoxy)propoxy]phenyl]propanoic acid Chemical compound COC(C(O)=O)CC1=CC=CC(OCCCOC=2C(=CC=CC=2)C(C)C)=C1 FSIMPVZLRPTPEG-UHFFFAOYSA-N 0.000 description 2
- SANHIAQSEQSUIX-UHFFFAOYSA-N 2-methoxy-3-[3-[3-(3-phenylphenoxy)propoxy]phenyl]propanoic acid Chemical compound COC(C(O)=O)CC1=CC=CC(OCCCOC=2C=C(C=CC=2)C=2C=CC=CC=2)=C1 SANHIAQSEQSUIX-UHFFFAOYSA-N 0.000 description 2
- FFALNITVXZMVKO-UHFFFAOYSA-N 2-methoxy-3-[3-[3-(4-phenoxyphenoxy)propoxy]phenyl]propanoic acid Chemical compound COC(C(O)=O)CC1=CC=CC(OCCCOC=2C=CC(OC=3C=CC=CC=3)=CC=2)=C1 FFALNITVXZMVKO-UHFFFAOYSA-N 0.000 description 2
- DBQWJDZZNNCIAU-UHFFFAOYSA-N 2-methoxy-3-[3-[5-(4-phenoxyphenoxy)pentanoyl]phenyl]propanoic acid Chemical compound COC(C(O)=O)CC1=CC=CC(C(=O)CCCCOC=2C=CC(OC=3C=CC=CC=3)=CC=2)=C1 DBQWJDZZNNCIAU-UHFFFAOYSA-N 0.000 description 2
- WHMIFNLDVKYILP-UHFFFAOYSA-N 2-methoxy-3-[3-[5-(4-phenoxyphenoxy)pentyl]phenyl]propanoic acid Chemical compound COC(C(O)=O)CC1=CC=CC(CCCCCOC=2C=CC(OC=3C=CC=CC=3)=CC=2)=C1 WHMIFNLDVKYILP-UHFFFAOYSA-N 0.000 description 2
- MESRRCNZVZXMLG-UHFFFAOYSA-N 2-methoxy-3-[3-methoxy-4-[3-[4-(2-phenylacetyl)phenoxy]propoxy]phenyl]propanoic acid Chemical compound COC1=CC(CC(OC)C(O)=O)=CC=C1OCCCOC1=CC=C(C(=O)CC=2C=CC=CC=2)C=C1 MESRRCNZVZXMLG-UHFFFAOYSA-N 0.000 description 2
- WLTVTEYMFNRYEC-UHFFFAOYSA-N 2-methoxy-3-[3-methyl-4-[3-(4-phenoxyphenoxy)propoxy]phenyl]propanoic acid Chemical compound CC1=CC(CC(OC)C(O)=O)=CC=C1OCCCOC(C=C1)=CC=C1OC1=CC=CC=C1 WLTVTEYMFNRYEC-UHFFFAOYSA-N 0.000 description 2
- FZMPPIFYGKXDMW-UHFFFAOYSA-N 2-methoxy-3-[3-methyl-4-[3-(4-phenylphenoxy)propoxy]phenyl]propanoic acid Chemical compound CC1=CC(CC(OC)C(O)=O)=CC=C1OCCCOC1=CC=C(C=2C=CC=CC=2)C=C1 FZMPPIFYGKXDMW-UHFFFAOYSA-N 0.000 description 2
- LSSGYZWJGXAAEH-UHFFFAOYSA-N 2-phenoxy-3-[4-[3-(4-phenoxyphenoxy)propoxy]phenyl]propanoic acid Chemical compound C=1C=CC=CC=1OC(C(=O)O)CC(C=C1)=CC=C1OCCCOC(C=C1)=CC=C1OC1=CC=CC=C1 LSSGYZWJGXAAEH-UHFFFAOYSA-N 0.000 description 2
- CVJLKOYJLAMJQD-UHFFFAOYSA-N 3-(4-fluorophenyl)-1-benzofuran-6-ol Chemical compound C=1OC2=CC(O)=CC=C2C=1C1=CC=C(F)C=C1 CVJLKOYJLAMJQD-UHFFFAOYSA-N 0.000 description 2
- YJPBNLFSDXFYDG-KRWDZBQOSA-N 3-[2-[4-[(2s)-2-carboxy-2-methoxyethyl]phenoxy]ethoxy]benzoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCOC1=CC=CC(C(O)=O)=C1 YJPBNLFSDXFYDG-KRWDZBQOSA-N 0.000 description 2
- PMULZRUQFXIQMK-UHFFFAOYSA-N 3-[2-chloro-4-[3-(4-phenoxyphenoxy)propoxy]phenyl]-2-methoxypropanoic acid Chemical compound C1=C(Cl)C(CC(OC)C(O)=O)=CC=C1OCCCOC(C=C1)=CC=C1OC1=CC=CC=C1 PMULZRUQFXIQMK-UHFFFAOYSA-N 0.000 description 2
- UUIYQIYBUWJHNF-UHFFFAOYSA-N 3-[3-[3-(2-cyanophenoxy)propoxy]phenyl]-2-methoxypropanoic acid Chemical compound COC(C(O)=O)CC1=CC=CC(OCCCOC=2C(=CC=CC=2)C#N)=C1 UUIYQIYBUWJHNF-UHFFFAOYSA-N 0.000 description 2
- ZPZPPQRWBMTPKM-UHFFFAOYSA-N 3-[3-[3-(3-cyanophenoxy)propoxy]phenyl]-2-methoxypropanoic acid Chemical compound COC(C(O)=O)CC1=CC=CC(OCCCOC=2C=C(C=CC=2)C#N)=C1 ZPZPPQRWBMTPKM-UHFFFAOYSA-N 0.000 description 2
- WQHSCEBBFSZUNZ-SFHVURJKSA-N 3-[3-[4-[(2s)-2-carboxy-2-methoxyethyl]phenoxy]propoxy]benzoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=CC(C(O)=O)=C1 WQHSCEBBFSZUNZ-SFHVURJKSA-N 0.000 description 2
- QMNWSVHHHQOJCV-UHFFFAOYSA-N 3-[4-(3-hydroxypropoxy)-3-methoxyphenyl]-2-methoxypropanoic acid Chemical compound COC(C(O)=O)CC1=CC=C(OCCCO)C(OC)=C1 QMNWSVHHHQOJCV-UHFFFAOYSA-N 0.000 description 2
- YYCRBOZAXIEQLQ-UHFFFAOYSA-N 3-[4-[3-(4-benzoylphenoxy)propoxy]-2-chlorophenyl]-2-ethoxypropanoic acid Chemical compound C1=C(Cl)C(CC(OCC)C(O)=O)=CC=C1OCCCOC1=CC=C(C(=O)C=2C=CC=CC=2)C=C1 YYCRBOZAXIEQLQ-UHFFFAOYSA-N 0.000 description 2
- AMEKVGNQWWXZRD-UHFFFAOYSA-N 3-[4-[3-(4-benzoylphenoxy)propoxy]-2-methoxyphenyl]-2-methoxypropanoic acid Chemical compound C1=C(OC)C(CC(OC)C(O)=O)=CC=C1OCCCOC1=CC=C(C(=O)C=2C=CC=CC=2)C=C1 AMEKVGNQWWXZRD-UHFFFAOYSA-N 0.000 description 2
- PVGWHHDPYABJPZ-UHFFFAOYSA-N 3-[4-[3-(4-benzoylphenoxy)propoxy]-3-methylphenyl]-2-methoxypropanoic acid Chemical compound CC1=CC(CC(OC)C(O)=O)=CC=C1OCCCOC1=CC=C(C(=O)C=2C=CC=CC=2)C=C1 PVGWHHDPYABJPZ-UHFFFAOYSA-N 0.000 description 2
- KIJZXDXUUKLNGX-UHFFFAOYSA-N 3-[4-[3-[4-[hydroxy(phenyl)methyl]phenoxy]propoxy]-3-(2-phenylethyl)phenyl]-2-methoxypropanoic acid Chemical compound C=1C=CC=CC=1CCC1=CC(CC(OC)C(O)=O)=CC=C1OCCCOC(C=C1)=CC=C1C(O)C1=CC=CC=C1 KIJZXDXUUKLNGX-UHFFFAOYSA-N 0.000 description 2
- ATVJXMYDOSMEPO-UHFFFAOYSA-N 3-prop-2-enoxyprop-1-ene Chemical compound C=CCOCC=C ATVJXMYDOSMEPO-UHFFFAOYSA-N 0.000 description 2
- KEAHSDOVONADLC-SFHVURJKSA-N 4-[3-[4-[(2s)-2-carboxy-2-methoxyethyl]phenoxy]propoxy]benzoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=C(C(O)=O)C=C1 KEAHSDOVONADLC-SFHVURJKSA-N 0.000 description 2
- BFXHJFKKRGVUMU-UHFFFAOYSA-N 4-fluorobenzenesulfonyl chloride Chemical compound FC1=CC=C(S(Cl)(=O)=O)C=C1 BFXHJFKKRGVUMU-UHFFFAOYSA-N 0.000 description 2
- CYYZDBDROVLTJU-UHFFFAOYSA-N 4-n-Butylphenol Chemical compound CCCCC1=CC=C(O)C=C1 CYYZDBDROVLTJU-UHFFFAOYSA-N 0.000 description 2
- NNJMFJSKMRYHSR-UHFFFAOYSA-N 4-phenylbenzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1C1=CC=CC=C1 NNJMFJSKMRYHSR-UHFFFAOYSA-N 0.000 description 2
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 2
- SWAJPHCXKPCPQZ-UHFFFAOYSA-N 7-hydroxyflavanone Chemical compound O1C2=CC(O)=CC=C2C(=O)CC1C1=CC=CC=C1 SWAJPHCXKPCPQZ-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- 241001553178 Arachis glabrata Species 0.000 description 2
- 241000416162 Astragalus gummifer Species 0.000 description 2
- 229930188012 Bromoether Natural products 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- 238000005821 Claisen rearrangement reaction Methods 0.000 description 2
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 2
- 208000018522 Gastrointestinal disease Diseases 0.000 description 2
- HEMJJKBWTPKOJG-UHFFFAOYSA-N Gemfibrozil Chemical compound CC1=CC=C(C)C(OCCCC(C)(C)C(O)=O)=C1 HEMJJKBWTPKOJG-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical class Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- 206010021000 Hypoglycaemic coma Diseases 0.000 description 2
- 206010061218 Inflammation Diseases 0.000 description 2
- 238000008214 LDL Cholesterol Methods 0.000 description 2
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 2
- 240000007472 Leucaena leucocephala Species 0.000 description 2
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 2
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 2
- 238000006751 Mitsunobu reaction Methods 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 2
- 239000002202 Polyethylene glycol Substances 0.000 description 2
- ZTHYODDOHIVTJV-UHFFFAOYSA-N Propyl gallate Chemical compound CCCOC(=O)C1=CC(O)=C(O)C(O)=C1 ZTHYODDOHIVTJV-UHFFFAOYSA-N 0.000 description 2
- LOUPRKONTZGTKE-WZBLMQSHSA-N Quinine Chemical compound C([C@H]([C@H](C1)C=C)C2)C[N@@]1[C@@H]2[C@H](O)C1=CC=NC2=CC=C(OC)C=C21 LOUPRKONTZGTKE-WZBLMQSHSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- 102000034527 Retinoid X Receptors Human genes 0.000 description 2
- 108010038912 Retinoid X Receptors Proteins 0.000 description 2
- 235000021355 Stearic acid Nutrition 0.000 description 2
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 2
- 229930006000 Sucrose Natural products 0.000 description 2
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric Acid Chemical class [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 2
- JLRGJRBPOGGCBT-UHFFFAOYSA-N Tolbutamide Chemical compound CCCCNC(=O)NS(=O)(=O)C1=CC=C(C)C=C1 JLRGJRBPOGGCBT-UHFFFAOYSA-N 0.000 description 2
- 229920001615 Tragacanth Polymers 0.000 description 2
- 239000003875 Wang resin Substances 0.000 description 2
- NERFNHBZJXXFGY-UHFFFAOYSA-N [4-[(4-methylphenyl)methoxy]phenyl]methanol Chemical compound C1=CC(C)=CC=C1COC1=CC=C(CO)C=C1 NERFNHBZJXXFGY-UHFFFAOYSA-N 0.000 description 2
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 2
- UGAPHEBNTGUMBB-UHFFFAOYSA-N acetic acid;ethyl acetate Chemical compound CC(O)=O.CCOC(C)=O UGAPHEBNTGUMBB-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 235000010443 alginic acid Nutrition 0.000 description 2
- 239000000783 alginic acid Substances 0.000 description 2
- 229920000615 alginic acid Polymers 0.000 description 2
- 229960001126 alginic acid Drugs 0.000 description 2
- 150000004781 alginic acids Chemical class 0.000 description 2
- 125000003342 alkenyl group Chemical group 0.000 description 2
- 125000005262 alkoxyamine group Chemical group 0.000 description 2
- 150000001350 alkyl halides Chemical class 0.000 description 2
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 150000001543 aryl boronic acids Chemical class 0.000 description 2
- 235000010233 benzoic acid Nutrition 0.000 description 2
- 125000002619 bicyclic group Chemical group 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 239000001506 calcium phosphate Substances 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- 239000001768 carboxy methyl cellulose Substances 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 238000006555 catalytic reaction Methods 0.000 description 2
- 239000003638 chemical reducing agent Substances 0.000 description 2
- 229960001214 clofibrate Drugs 0.000 description 2
- KNHUKKLJHYUCFP-UHFFFAOYSA-N clofibrate Chemical compound CCOC(=O)C(C)(C)OC1=CC=C(Cl)C=C1 KNHUKKLJHYUCFP-UHFFFAOYSA-N 0.000 description 2
- 229940110456 cocoa butter Drugs 0.000 description 2
- 235000019868 cocoa butter Nutrition 0.000 description 2
- 229940125904 compound 1 Drugs 0.000 description 2
- 229940125898 compound 5 Drugs 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- QTMDXZNDVAMKGV-UHFFFAOYSA-L copper(ii) bromide Chemical compound [Cu+2].[Br-].[Br-] QTMDXZNDVAMKGV-UHFFFAOYSA-L 0.000 description 2
- 208000029078 coronary artery disease Diseases 0.000 description 2
- TXCDCPKCNAJMEE-UHFFFAOYSA-N dibenzofuran Chemical compound C1=CC=C2C3=CC=CC=C3OC2=C1 TXCDCPKCNAJMEE-UHFFFAOYSA-N 0.000 description 2
- IYYZUPMFVPLQIF-UHFFFAOYSA-N dibenzothiophene Chemical compound C1=CC=C2C3=CC=CC=C3SC2=C1 IYYZUPMFVPLQIF-UHFFFAOYSA-N 0.000 description 2
- 235000005911 diet Nutrition 0.000 description 2
- 230000037213 diet Effects 0.000 description 2
- 208000010643 digestive system disease Diseases 0.000 description 2
- BGRWYRAHAFMIBJ-UHFFFAOYSA-N diisopropylcarbodiimide Natural products CC(C)NC(=O)NC(C)C BGRWYRAHAFMIBJ-UHFFFAOYSA-N 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- ZLNOFZACKANYIS-MHZLTWQESA-N ethyl (2s)-2-methoxy-3-[4-[4-(4-phenylphenoxy)but-1-ynyl]phenyl]propanoate Chemical compound C1=CC(C[C@@H](C(=O)OCC)OC)=CC=C1C#CCCOC1=CC=C(C=2C=CC=CC=2)C=C1 ZLNOFZACKANYIS-MHZLTWQESA-N 0.000 description 2
- SFTYDROGLAWTKI-NSHDSACASA-N ethyl (2s)-3-(4-hydroxyphenyl)-2-methoxypropanoate Chemical compound CCOC(=O)[C@@H](OC)CC1=CC=C(O)C=C1 SFTYDROGLAWTKI-NSHDSACASA-N 0.000 description 2
- VDHGYZNQPMTAEK-ZDUSSCGKSA-N ethyl (2s)-3-[4-(2-bromoacetyl)phenyl]-2-methoxypropanoate Chemical compound CCOC(=O)[C@@H](OC)CC1=CC=C(C(=O)CBr)C=C1 VDHGYZNQPMTAEK-ZDUSSCGKSA-N 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 235000019197 fats Nutrition 0.000 description 2
- 229960002297 fenofibrate Drugs 0.000 description 2
- YMTINGFKWWXKFG-UHFFFAOYSA-N fenofibrate Chemical compound C1=CC(OC(C)(C)C(=O)OC(C)C)=CC=C1C(=O)C1=CC=C(Cl)C=C1 YMTINGFKWWXKFG-UHFFFAOYSA-N 0.000 description 2
- 235000019634 flavors Nutrition 0.000 description 2
- NIHNNTQXNPWCJQ-UHFFFAOYSA-N fluorene Chemical compound C1=CC=C2CC3=CC=CC=C3C2=C1 NIHNNTQXNPWCJQ-UHFFFAOYSA-N 0.000 description 2
- 235000003599 food sweetener Nutrition 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 230000006870 function Effects 0.000 description 2
- 238000001030 gas--liquid chromatography Methods 0.000 description 2
- 208000018685 gastrointestinal system disease Diseases 0.000 description 2
- 229960003627 gemfibrozil Drugs 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 238000004128 high performance liquid chromatography Methods 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 230000004054 inflammatory process Effects 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 238000007918 intramuscular administration Methods 0.000 description 2
- 238000001990 intravenous administration Methods 0.000 description 2
- 125000002346 iodo group Chemical group I* 0.000 description 2
- 239000003446 ligand Substances 0.000 description 2
- 230000037356 lipid metabolism Effects 0.000 description 2
- 238000004811 liquid chromatography Methods 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 2
- 229960003105 metformin Drugs 0.000 description 2
- XZWYZXLIPXDOLR-UHFFFAOYSA-N metformin Chemical compound CN(C)C(=N)NC(N)=N XZWYZXLIPXDOLR-UHFFFAOYSA-N 0.000 description 2
- TWXDDNPPQUTEOV-FVGYRXGTSA-N methamphetamine hydrochloride Chemical compound Cl.CN[C@@H](C)CC1=CC=CC=C1 TWXDDNPPQUTEOV-FVGYRXGTSA-N 0.000 description 2
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 2
- WFDAPIWUKUJZTF-UHFFFAOYSA-N methyl 3-(4-hydroxy-3-methoxyphenyl)-2-methoxypropanoate Chemical compound COC(=O)C(OC)CC1=CC=C(O)C(OC)=C1 WFDAPIWUKUJZTF-UHFFFAOYSA-N 0.000 description 2
- 229940016286 microcrystalline cellulose Drugs 0.000 description 2
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 2
- 239000008108 microcrystalline cellulose Substances 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 125000002950 monocyclic group Chemical group 0.000 description 2
- 210000003205 muscle Anatomy 0.000 description 2
- PSHKMPUSSFXUIA-UHFFFAOYSA-N n,n-dimethylpyridin-2-amine Chemical compound CN(C)C1=CC=CC=N1 PSHKMPUSSFXUIA-UHFFFAOYSA-N 0.000 description 2
- 229960003512 nicotinic acid Drugs 0.000 description 2
- 235000001968 nicotinic acid Nutrition 0.000 description 2
- 239000011664 nicotinic acid Substances 0.000 description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 2
- 239000012038 nucleophile Substances 0.000 description 2
- 230000000269 nucleophilic effect Effects 0.000 description 2
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 2
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 239000003614 peroxisome proliferator Substances 0.000 description 2
- 229960003243 phenformin Drugs 0.000 description 2
- ICFJFFQQTFMIBG-UHFFFAOYSA-N phenformin Chemical compound NC(=N)NC(=N)NCCC1=CC=CC=C1 ICFJFFQQTFMIBG-UHFFFAOYSA-N 0.000 description 2
- HYAFETHFCAUJAY-UHFFFAOYSA-N pioglitazone Chemical compound N1=CC(CC)=CC=C1CCOC(C=C1)=CC=C1CC1C(=O)NC(=O)S1 HYAFETHFCAUJAY-UHFFFAOYSA-N 0.000 description 2
- 125000003367 polycyclic group Chemical group 0.000 description 2
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 2
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 2
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 2
- 239000003755 preservative agent Substances 0.000 description 2
- VVWRJUBEIPHGQF-UHFFFAOYSA-N propan-2-yl n-propan-2-yloxycarbonyliminocarbamate Chemical compound CC(C)OC(=O)N=NC(=O)OC(C)C VVWRJUBEIPHGQF-UHFFFAOYSA-N 0.000 description 2
- 239000003380 propellant Substances 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- YBCAZPLXEGKKFM-UHFFFAOYSA-K ruthenium(iii) chloride Chemical compound [Cl-].[Cl-].[Cl-].[Ru+3] YBCAZPLXEGKKFM-UHFFFAOYSA-K 0.000 description 2
- 239000012047 saturated solution Substances 0.000 description 2
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 2
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 2
- 235000009518 sodium iodide Nutrition 0.000 description 2
- JQWHASGSAFIOCM-UHFFFAOYSA-M sodium periodate Chemical compound [Na+].[O-]I(=O)(=O)=O JQWHASGSAFIOCM-UHFFFAOYSA-M 0.000 description 2
- 238000004611 spectroscopical analysis Methods 0.000 description 2
- 239000008117 stearic acid Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- 239000005720 sucrose Substances 0.000 description 2
- 235000000346 sugar Nutrition 0.000 description 2
- 125000000565 sulfonamide group Chemical group 0.000 description 2
- 239000003765 sweetening agent Substances 0.000 description 2
- FGTJJHCZWOVVNH-UHFFFAOYSA-N tert-butyl-[tert-butyl(dimethyl)silyl]oxy-dimethylsilane Chemical compound CC(C)(C)[Si](C)(C)O[Si](C)(C)C(C)(C)C FGTJJHCZWOVVNH-UHFFFAOYSA-N 0.000 description 2
- HJUGFYREWKUQJT-UHFFFAOYSA-N tetrabromomethane Chemical compound BrC(Br)(Br)Br HJUGFYREWKUQJT-UHFFFAOYSA-N 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- 210000001519 tissue Anatomy 0.000 description 2
- 229960005371 tolbutamide Drugs 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- GXPHKUHSUJUWKP-UHFFFAOYSA-N troglitazone Chemical compound C1CC=2C(C)=C(O)C(C)=C(C)C=2OC1(C)COC(C=C1)=CC=C1CC1SC(=O)NC1=O GXPHKUHSUJUWKP-UHFFFAOYSA-N 0.000 description 2
- 229960001641 troglitazone Drugs 0.000 description 2
- GXPHKUHSUJUWKP-NTKDMRAZSA-N troglitazone Natural products C([C@@]1(OC=2C(C)=C(C(=C(C)C=2CC1)O)C)C)OC(C=C1)=CC=C1C[C@H]1SC(=O)NC1=O GXPHKUHSUJUWKP-NTKDMRAZSA-N 0.000 description 2
- 229910052721 tungsten Inorganic materials 0.000 description 2
- 238000005303 weighing Methods 0.000 description 2
- DBGIVFWFUFKIQN-VIFPVBQESA-N (+)-Fenfluramine Chemical compound CCN[C@@H](C)CC1=CC=CC(C(F)(F)F)=C1 DBGIVFWFUFKIQN-VIFPVBQESA-N 0.000 description 1
- DBGIVFWFUFKIQN-UHFFFAOYSA-N (+-)-Fenfluramine Chemical compound CCNC(C)CC1=CC=CC(C(F)(F)F)=C1 DBGIVFWFUFKIQN-UHFFFAOYSA-N 0.000 description 1
- VCGRFBXVSFAGGA-UHFFFAOYSA-N (1,1-dioxo-1,4-thiazinan-4-yl)-[6-[[3-(4-fluorophenyl)-5-methyl-1,2-oxazol-4-yl]methoxy]pyridin-3-yl]methanone Chemical compound CC=1ON=C(C=2C=CC(F)=CC=2)C=1COC(N=C1)=CC=C1C(=O)N1CCS(=O)(=O)CC1 VCGRFBXVSFAGGA-UHFFFAOYSA-N 0.000 description 1
- ASGMFNBUXDJWJJ-JLCFBVMHSA-N (1R,3R)-3-[[3-bromo-1-[4-(5-methyl-1,3,4-thiadiazol-2-yl)phenyl]pyrazolo[3,4-d]pyrimidin-6-yl]amino]-N,1-dimethylcyclopentane-1-carboxamide Chemical compound BrC1=NN(C2=NC(=NC=C21)N[C@H]1C[C@@](CC1)(C(=O)NC)C)C1=CC=C(C=C1)C=1SC(=NN=1)C ASGMFNBUXDJWJJ-JLCFBVMHSA-N 0.000 description 1
- UAOUIVVJBYDFKD-XKCDOFEDSA-N (1R,9R,10S,11R,12R,15S,18S,21R)-10,11,21-trihydroxy-8,8-dimethyl-14-methylidene-4-(prop-2-enylamino)-20-oxa-5-thia-3-azahexacyclo[9.7.2.112,15.01,9.02,6.012,18]henicosa-2(6),3-dien-13-one Chemical compound C([C@@H]1[C@@H](O)[C@@]23C(C1=C)=O)C[C@H]2[C@]12C(N=C(NCC=C)S4)=C4CC(C)(C)[C@H]1[C@H](O)[C@]3(O)OC2 UAOUIVVJBYDFKD-XKCDOFEDSA-N 0.000 description 1
- AOSZTAHDEDLTLQ-AZKQZHLXSA-N (1S,2S,4R,8S,9S,11S,12R,13S,19S)-6-[(3-chlorophenyl)methyl]-12,19-difluoro-11-hydroxy-8-(2-hydroxyacetyl)-9,13-dimethyl-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one Chemical compound C([C@@H]1C[C@H]2[C@H]3[C@]([C@]4(C=CC(=O)C=C4[C@@H](F)C3)C)(F)[C@@H](O)C[C@@]2([C@@]1(C1)C(=O)CO)C)N1CC1=CC=CC(Cl)=C1 AOSZTAHDEDLTLQ-AZKQZHLXSA-N 0.000 description 1
- ABJSOROVZZKJGI-OCYUSGCXSA-N (1r,2r,4r)-2-(4-bromophenyl)-n-[(4-chlorophenyl)-(2-fluoropyridin-4-yl)methyl]-4-morpholin-4-ylcyclohexane-1-carboxamide Chemical compound C1=NC(F)=CC(C(NC(=O)[C@H]2[C@@H](C[C@@H](CC2)N2CCOCC2)C=2C=CC(Br)=CC=2)C=2C=CC(Cl)=CC=2)=C1 ABJSOROVZZKJGI-OCYUSGCXSA-N 0.000 description 1
- VKDKDAQGMUDFFU-SJLPKXTDSA-N (1r,3r)-3-(4-phenylphenoxy)cyclohexan-1-ol Chemical compound C1[C@H](O)CCC[C@H]1OC1=CC=C(C=2C=CC=CC=2)C=C1 VKDKDAQGMUDFFU-SJLPKXTDSA-N 0.000 description 1
- NLXIOZRBFNUITF-NXEZZACHSA-N (1r,3r)-3-[tert-butyl(dimethyl)silyl]oxycyclopentan-1-ol Chemical compound CC(C)(C)[Si](C)(C)O[C@@H]1CC[C@@H](O)C1 NLXIOZRBFNUITF-NXEZZACHSA-N 0.000 description 1
- NLXIOZRBFNUITF-ZJUUUORDSA-N (1r,3s)-3-[tert-butyl(dimethyl)silyl]oxycyclopentan-1-ol Chemical compound CC(C)(C)[Si](C)(C)O[C@H]1CC[C@@H](O)C1 NLXIOZRBFNUITF-ZJUUUORDSA-N 0.000 description 1
- GLGNXYJARSMNGJ-VKTIVEEGSA-N (1s,2s,3r,4r)-3-[[5-chloro-2-[(1-ethyl-6-methoxy-2-oxo-4,5-dihydro-3h-1-benzazepin-7-yl)amino]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide Chemical compound CCN1C(=O)CCCC2=C(OC)C(NC=3N=C(C(=CN=3)Cl)N[C@H]3[C@H]([C@@]4([H])C[C@@]3(C=C4)[H])C(N)=O)=CC=C21 GLGNXYJARSMNGJ-VKTIVEEGSA-N 0.000 description 1
- SZUVGFMDDVSKSI-WIFOCOSTSA-N (1s,2s,3s,5r)-1-(carboxymethyl)-3,5-bis[(4-phenoxyphenyl)methyl-propylcarbamoyl]cyclopentane-1,2-dicarboxylic acid Chemical compound O=C([C@@H]1[C@@H]([C@](CC(O)=O)([C@H](C(=O)N(CCC)CC=2C=CC(OC=3C=CC=CC=3)=CC=2)C1)C(O)=O)C(O)=O)N(CCC)CC(C=C1)=CC=C1OC1=CC=CC=C1 SZUVGFMDDVSKSI-WIFOCOSTSA-N 0.000 description 1
- XPIDMAMNCOCNCE-UHFFFAOYSA-N (2-fluoro-4-hydroxyphenyl)-phenylmethanone Chemical compound FC1=CC(O)=CC=C1C(=O)C1=CC=CC=C1 XPIDMAMNCOCNCE-UHFFFAOYSA-N 0.000 description 1
- UOTWKQHDGYWIRT-UHFFFAOYSA-N (2-hydroxy-4-phenylphenyl)-phenylmethanone Chemical compound OC1=CC(C=2C=CC=CC=2)=CC=C1C(=O)C1=CC=CC=C1 UOTWKQHDGYWIRT-UHFFFAOYSA-N 0.000 description 1
- XUFXOAAUWZOOIT-SXARVLRPSA-N (2R,3R,4R,5S,6R)-5-[[(2R,3R,4R,5S,6R)-5-[[(2R,3R,4S,5S,6R)-3,4-dihydroxy-6-methyl-5-[[(1S,4R,5S,6S)-4,5,6-trihydroxy-3-(hydroxymethyl)-1-cyclohex-2-enyl]amino]-2-oxanyl]oxy]-3,4-dihydroxy-6-(hydroxymethyl)-2-oxanyl]oxy]-6-(hydroxymethyl)oxane-2,3,4-triol Chemical compound O([C@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O[C@H]1O[C@@H]([C@H]([C@H](O)[C@H]1O)N[C@@H]1[C@@H]([C@@H](O)[C@H](O)C(CO)=C1)O)C)[C@@H]1[C@@H](CO)O[C@@H](O)[C@H](O)[C@H]1O XUFXOAAUWZOOIT-SXARVLRPSA-N 0.000 description 1
- GHYOCDFICYLMRF-UTIIJYGPSA-N (2S,3R)-N-[(2S)-3-(cyclopenten-1-yl)-1-[(2R)-2-methyloxiran-2-yl]-1-oxopropan-2-yl]-3-hydroxy-3-(4-methoxyphenyl)-2-[[(2S)-2-[(2-morpholin-4-ylacetyl)amino]propanoyl]amino]propanamide Chemical compound C1(=CCCC1)C[C@@H](C(=O)[C@@]1(OC1)C)NC([C@H]([C@@H](C1=CC=C(C=C1)OC)O)NC([C@H](C)NC(CN1CCOCC1)=O)=O)=O GHYOCDFICYLMRF-UTIIJYGPSA-N 0.000 description 1
- GCTFTMWXZFLTRR-GFCCVEGCSA-N (2r)-2-amino-n-[3-(difluoromethoxy)-4-(1,3-oxazol-5-yl)phenyl]-4-methylpentanamide Chemical compound FC(F)OC1=CC(NC(=O)[C@H](N)CC(C)C)=CC=C1C1=CN=CO1 GCTFTMWXZFLTRR-GFCCVEGCSA-N 0.000 description 1
- IUSARDYWEPUTPN-OZBXUNDUSA-N (2r)-n-[(2s,3r)-4-[[(4s)-6-(2,2-dimethylpropyl)spiro[3,4-dihydropyrano[2,3-b]pyridine-2,1'-cyclobutane]-4-yl]amino]-3-hydroxy-1-[3-(1,3-thiazol-2-yl)phenyl]butan-2-yl]-2-methoxypropanamide Chemical compound C([C@H](NC(=O)[C@@H](C)OC)[C@H](O)CN[C@@H]1C2=CC(CC(C)(C)C)=CN=C2OC2(CCC2)C1)C(C=1)=CC=CC=1C1=NC=CS1 IUSARDYWEPUTPN-OZBXUNDUSA-N 0.000 description 1
- YJLIKUSWRSEPSM-WGQQHEPDSA-N (2r,3r,4s,5r)-2-[6-amino-8-[(4-phenylphenyl)methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol Chemical compound C=1C=C(C=2C=CC=CC=2)C=CC=1CNC1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O YJLIKUSWRSEPSM-WGQQHEPDSA-N 0.000 description 1
- BEBRHJZKEOVXTO-JTQLQIEISA-N (2s)-2-(3-hydroxyphenyl)-2-methoxypropanoic acid Chemical compound CO[C@](C)(C(O)=O)C1=CC=CC(O)=C1 BEBRHJZKEOVXTO-JTQLQIEISA-N 0.000 description 1
- VIJSPAIQWVPKQZ-BLECARSGSA-N (2s)-2-[[(2s)-2-[[(2s)-2-[[(2s)-2-[[(2s)-2-[[(2s)-2-acetamido-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoyl]amino]-4,4-dimethylpentanoyl]amino]-4-methylpentanoyl]amino]propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid Chemical compound NC(=N)NCCC[C@@H](C(O)=O)NC(=O)[C@H](C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCNC(N)=N)NC(C)=O VIJSPAIQWVPKQZ-BLECARSGSA-N 0.000 description 1
- WWTBZEKOSBFBEM-SPWPXUSOSA-N (2s)-2-[[2-benzyl-3-[hydroxy-[(1r)-2-phenyl-1-(phenylmethoxycarbonylamino)ethyl]phosphoryl]propanoyl]amino]-3-(1h-indol-3-yl)propanoic acid Chemical compound N([C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)O)C(=O)C(CP(O)(=O)[C@H](CC=1C=CC=CC=1)NC(=O)OCC=1C=CC=CC=1)CC1=CC=CC=C1 WWTBZEKOSBFBEM-SPWPXUSOSA-N 0.000 description 1
- ZYANNHCCSJCFFD-SANMLTNESA-N (2s)-2-methoxy-2-[4-[2-[(4-phenoxyphenoxy)methyl]prop-2-enoxy]phenyl]propanoic acid Chemical compound C1=CC([C@@](C)(C(O)=O)OC)=CC=C1OCC(=C)COC(C=C1)=CC=C1OC1=CC=CC=C1 ZYANNHCCSJCFFD-SANMLTNESA-N 0.000 description 1
- UVIBHEZQYXICCU-VWLOTQADSA-N (2s)-2-methoxy-3-[2-[4-(4-phenylphenoxy)butanoyl]phenyl]propanoic acid Chemical compound CO[C@H](C(O)=O)CC1=CC=CC=C1C(=O)CCCOC1=CC=C(C=2C=CC=CC=2)C=C1 UVIBHEZQYXICCU-VWLOTQADSA-N 0.000 description 1
- GPXZLTYLZLIOTD-QFIPXVFZSA-N (2s)-2-methoxy-3-[4-(3-naphthalen-1-yloxypropoxy)phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=CC2=CC=CC=C12 GPXZLTYLZLIOTD-QFIPXVFZSA-N 0.000 description 1
- GSBYXSZXCYGOSV-MHZLTWQESA-N (2s)-2-methoxy-3-[4-[3-(4-oxo-2-phenylchromen-6-yl)oxyprop-1-ynyl]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1C#CCOC1=CC=C(OC(=CC2=O)C=3C=CC=CC=3)C2=C1 GSBYXSZXCYGOSV-MHZLTWQESA-N 0.000 description 1
- SBDPRKLSXWMYQG-MHZLTWQESA-N (2s)-2-methoxy-3-[4-[3-(4-oxo-2-phenylchromen-7-yl)oxypropoxy]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=C2C(=O)C=C(C=3C=CC=CC=3)OC2=C1 SBDPRKLSXWMYQG-MHZLTWQESA-N 0.000 description 1
- CIKNFOFNTIUQHG-IBGZPJMESA-N (2s)-2-methoxy-3-[4-[3-[(2-methyl-1,3-benzothiazol-5-yl)oxy]propoxy]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=C(SC(C)=N2)C2=C1 CIKNFOFNTIUQHG-IBGZPJMESA-N 0.000 description 1
- KGZZKHMPHCYHIU-SANMLTNESA-N (2s)-2-methoxy-3-[4-[3-[(3-phenyl-1-benzofuran-6-yl)oxy]prop-1-ynyl]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1C#CCOC1=CC=C(C(=CO2)C=3C=CC=CC=3)C2=C1 KGZZKHMPHCYHIU-SANMLTNESA-N 0.000 description 1
- UWKXMETXFVZXMQ-SANMLTNESA-N (2s)-2-methoxy-3-[4-[3-[4-(2-phenylacetyl)phenoxy]prop-1-ynyl]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1C#CCOC1=CC=C(C(=O)CC=2C=CC=CC=2)C=C1 UWKXMETXFVZXMQ-SANMLTNESA-N 0.000 description 1
- AWZKAJCLCAITBA-SANMLTNESA-N (2s)-2-methoxy-3-[4-[3-[4-(2-phenylpropan-2-yl)phenoxy]prop-1-ynyl]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1C#CCOC1=CC=C(C(C)(C)C=2C=CC=CC=2)C=C1 AWZKAJCLCAITBA-SANMLTNESA-N 0.000 description 1
- MBXURYKUBCUIJF-SFHVURJKSA-N (2s)-2-methoxy-3-[4-[3-[4-(trifluoromethoxy)phenoxy]propoxy]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=C(OC(F)(F)F)C=C1 MBXURYKUBCUIJF-SFHVURJKSA-N 0.000 description 1
- QDTIZEACIBUXQP-NDEPHWFRSA-N (2s)-2-methoxy-3-[4-[4-(4-oxo-2-phenylchromen-7-yl)oxybut-1-ynyl]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1C#CCCOC1=CC=C2C(=O)C=C(C=3C=CC=CC=3)OC2=C1 QDTIZEACIBUXQP-NDEPHWFRSA-N 0.000 description 1
- OPHUOAPFTLHMDA-VWLOTQADSA-N (2s)-2-methoxy-3-[4-[4-(4-phenylphenoxy)butoxy]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCCOC1=CC=C(C=2C=CC=CC=2)C=C1 OPHUOAPFTLHMDA-VWLOTQADSA-N 0.000 description 1
- YIDJQFDFRNEYGF-LJAQVGFWSA-N (2s)-2-methoxy-3-[4-[5-(4-oxo-2-phenylchromen-7-yl)oxypent-1-ynyl]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1C#CCCCOC1=CC=C2C(=O)C=C(C=3C=CC=CC=3)OC2=C1 YIDJQFDFRNEYGF-LJAQVGFWSA-N 0.000 description 1
- LHWHNDBOIQMLAO-SANMLTNESA-N (2s)-2-methoxy-3-[4-[5-(4-phenoxyphenoxy)pentanoyl]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1C(=O)CCCCOC(C=C1)=CC=C1OC1=CC=CC=C1 LHWHNDBOIQMLAO-SANMLTNESA-N 0.000 description 1
- WWBZUQOUGULQOZ-SANMLTNESA-N (2s)-2-methoxy-3-[4-[5-(9-oxofluoren-2-yl)oxypent-1-ynyl]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1C#CCCCOC1=CC=C2C3=CC=CC=C3C(=O)C2=C1 WWBZUQOUGULQOZ-SANMLTNESA-N 0.000 description 1
- RQWDYVNOXPXWSM-NDEPHWFRSA-N (2s)-2-methoxy-3-[4-[5-[(3-phenyl-1-benzofuran-6-yl)oxy]pent-1-ynyl]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1C#CCCCOC1=CC=C(C(=CO2)C=3C=CC=CC=3)C2=C1 RQWDYVNOXPXWSM-NDEPHWFRSA-N 0.000 description 1
- VUJNAMAFHITPHY-NDEPHWFRSA-N (2s)-2-methoxy-3-[4-[5-[4-(2-phenylacetyl)phenoxy]pent-1-ynyl]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1C#CCCCOC1=CC=C(C(=O)CC=2C=CC=CC=2)C=C1 VUJNAMAFHITPHY-NDEPHWFRSA-N 0.000 description 1
- HXSBGYLCOBTXIB-NDEPHWFRSA-N (2s)-2-methoxy-3-[4-[5-[4-(2-phenylpropan-2-yl)phenoxy]pent-1-ynyl]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1C#CCCCOC1=CC=C(C(C)(C)C=2C=CC=CC=2)C=C1 HXSBGYLCOBTXIB-NDEPHWFRSA-N 0.000 description 1
- ZUJKBCJGAWFGPF-SANMLTNESA-N (2s)-2-methoxy-3-[4-[5-[4-[4-(trifluoromethyl)phenoxy]phenoxy]pent-1-ynyl]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1C#CCCCOC(C=C1)=CC=C1OC1=CC=C(C(F)(F)F)C=C1 ZUJKBCJGAWFGPF-SANMLTNESA-N 0.000 description 1
- BEKQWXIYKWVMPB-MHZLTWQESA-N (2s)-2-methoxy-3-[4-[6-(4-phenoxyphenoxy)hex-1-ynyl]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1C#CCCCCOC(C=C1)=CC=C1OC1=CC=CC=C1 BEKQWXIYKWVMPB-MHZLTWQESA-N 0.000 description 1
- WLDHUYNFJMCACE-MHZLTWQESA-N (2s)-2-methoxy-3-[4-[6-(4-phenoxyphenoxy)hexanoyl]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1C(=O)CCCCCOC(C=C1)=CC=C1OC1=CC=CC=C1 WLDHUYNFJMCACE-MHZLTWQESA-N 0.000 description 1
- BUBRMWKJNVNRNS-MHZLTWQESA-N (2s)-2-methoxy-3-[4-[6-(4-phenylphenoxy)hex-1-ynyl]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1C#CCCCCOC1=CC=C(C=2C=CC=CC=2)C=C1 BUBRMWKJNVNRNS-MHZLTWQESA-N 0.000 description 1
- AMKVIGJKHUJFFN-QHCPKHFHSA-N (2s)-3-[4-[2-(4-benzoylphenoxy)ethoxy]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCOC1=CC=C(C(=O)C=2C=CC=CC=2)C=C1 AMKVIGJKHUJFFN-QHCPKHFHSA-N 0.000 description 1
- HSDBWTGWJQIRQV-DEOSSOPVSA-N (2s)-3-[4-[3-(3-anilinophenoxy)prop-1-ynyl]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1C#CCOC1=CC=CC(NC=2C=CC=CC=2)=C1 HSDBWTGWJQIRQV-DEOSSOPVSA-N 0.000 description 1
- CVNOEVFCXHZHFJ-VWLOTQADSA-N (2s)-3-[4-[3-(4-benzylphenoxy)prop-1-ynyl]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1C#CCOC(C=C1)=CC=C1CC1=CC=CC=C1 CVNOEVFCXHZHFJ-VWLOTQADSA-N 0.000 description 1
- PTTGWJHZSGBIKK-IBGZPJMESA-N (2s)-3-[4-[3-(4-cyano-3-fluorophenoxy)propoxy]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=C(C#N)C(F)=C1 PTTGWJHZSGBIKK-IBGZPJMESA-N 0.000 description 1
- KMEBVZVXTAAEIU-DEOSSOPVSA-N (2s)-3-[4-[3-[4-(2-fluorobenzoyl)phenoxy]propoxy]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=C(C(=O)C=2C(=CC=CC=2)F)C=C1 KMEBVZVXTAAEIU-DEOSSOPVSA-N 0.000 description 1
- SUTGZLXHOQWKRI-DEOSSOPVSA-N (2s)-3-[4-[3-[4-(4-fluorobenzoyl)phenoxy]prop-1-ynyl]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1C#CCOC1=CC=C(C(=O)C=2C=CC(F)=CC=2)C=C1 SUTGZLXHOQWKRI-DEOSSOPVSA-N 0.000 description 1
- POQRIROSUQYRIE-DEOSSOPVSA-N (2s)-3-[4-[3-[4-(n-hydroxy-c-phenylcarbonimidoyl)phenoxy]prop-1-ynyl]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1C#CCOC1=CC=C(C(=NO)C=2C=CC=CC=2)C=C1 POQRIROSUQYRIE-DEOSSOPVSA-N 0.000 description 1
- NWUOFHSBJLYBEW-SANMLTNESA-N (2s)-3-[4-[3-[4-[4-(2-hydroxyethoxy)benzoyl]phenoxy]propoxy]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCCOC1=CC=C(C(=O)C=2C=CC(OCCO)=CC=2)C=C1 NWUOFHSBJLYBEW-SANMLTNESA-N 0.000 description 1
- KELUSVBOFHHOPY-DEOSSOPVSA-N (2s)-3-[4-[3-[4-[c-(2-fluorophenyl)-n-hydroxycarbonimidoyl]phenoxy]prop-1-ynyl]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1C#CCOC1=CC=C(C(=NO)C=2C(=CC=CC=2)F)C=C1 KELUSVBOFHHOPY-DEOSSOPVSA-N 0.000 description 1
- JNOFUHFUGLCZSR-DEOSSOPVSA-N (2s)-3-[4-[3-[4-[c-(4-fluorophenyl)-n-hydroxycarbonimidoyl]phenoxy]prop-1-ynyl]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1C#CCOC1=CC=C(C(=NO)C=2C=CC(F)=CC=2)C=C1 JNOFUHFUGLCZSR-DEOSSOPVSA-N 0.000 description 1
- FMHQDHCCGRVDHT-SANMLTNESA-N (2s)-3-[4-[3-[[3-(4-fluorophenyl)-1-benzofuran-6-yl]oxy]prop-1-ynyl]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1C#CCOC1=CC=C(C(=CO2)C=3C=CC(F)=CC=3)C2=C1 FMHQDHCCGRVDHT-SANMLTNESA-N 0.000 description 1
- UVXXWRBZGXPBOR-SANMLTNESA-N (2s)-3-[4-[5-(3-anilinophenoxy)pent-1-ynyl]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1C#CCCCOC1=CC=CC(NC=2C=CC=CC=2)=C1 UVXXWRBZGXPBOR-SANMLTNESA-N 0.000 description 1
- KISZHXKXASQTNR-SANMLTNESA-N (2s)-3-[4-[5-(4-benzoylphenoxy)pentanoyl]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1C(=O)CCCCOC1=CC=C(C(=O)C=2C=CC=CC=2)C=C1 KISZHXKXASQTNR-SANMLTNESA-N 0.000 description 1
- FTONRAABSJVSJE-MHZLTWQESA-N (2s)-3-[4-[5-(4-benzylphenoxy)pent-1-ynyl]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1C#CCCCOC(C=C1)=CC=C1CC1=CC=CC=C1 FTONRAABSJVSJE-MHZLTWQESA-N 0.000 description 1
- KUFGOFMXNCDHPX-DEOSSOPVSA-N (2s)-3-[4-[5-(4-butylphenoxy)pent-1-ynyl]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(CCCC)=CC=C1OCCCC#CC1=CC=C(C[C@H](OC)C(O)=O)C=C1 KUFGOFMXNCDHPX-DEOSSOPVSA-N 0.000 description 1
- YAIRKNPFJTWIHK-SANMLTNESA-N (2s)-3-[4-[5-[4-(4-fluorobenzoyl)phenoxy]pent-1-ynyl]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1C#CCCCOC1=CC=C(C(=O)C=2C=CC(F)=CC=2)C=C1 YAIRKNPFJTWIHK-SANMLTNESA-N 0.000 description 1
- DRNFLHZXDBOOPM-MHZLTWQESA-N (2s)-3-[4-[6-(4-benzoylphenoxy)hex-1-ynyl]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1C#CCCCCOC1=CC=C(C(=O)C=2C=CC=CC=2)C=C1 DRNFLHZXDBOOPM-MHZLTWQESA-N 0.000 description 1
- PYQOAKFOUTXGRB-SANMLTNESA-N (2s)-3-[4-[n-hydroxy-c-[4-(4-phenylphenoxy)butyl]carbonimidoyl]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1C(=NO)CCCCOC1=CC=C(C=2C=CC=CC=2)C=C1 PYQOAKFOUTXGRB-SANMLTNESA-N 0.000 description 1
- STBLNCCBQMHSRC-BATDWUPUSA-N (2s)-n-[(3s,4s)-5-acetyl-7-cyano-4-methyl-1-[(2-methylnaphthalen-1-yl)methyl]-2-oxo-3,4-dihydro-1,5-benzodiazepin-3-yl]-2-(methylamino)propanamide Chemical compound O=C1[C@@H](NC(=O)[C@H](C)NC)[C@H](C)N(C(C)=O)C2=CC(C#N)=CC=C2N1CC1=C(C)C=CC2=CC=CC=C12 STBLNCCBQMHSRC-BATDWUPUSA-N 0.000 description 1
- GTCCGKPBSJZVRZ-WHFBIAKZSA-N (2s,4s)-pentane-2,4-diol Chemical compound C[C@H](O)C[C@H](C)O GTCCGKPBSJZVRZ-WHFBIAKZSA-N 0.000 description 1
- HJBGZJMKTOMQRR-UHFFFAOYSA-N (3-formylphenyl)boronic acid Chemical compound OB(O)C1=CC=CC(C=O)=C1 HJBGZJMKTOMQRR-UHFFFAOYSA-N 0.000 description 1
- ZGGHKIMDNBDHJB-NRFPMOEYSA-M (3R,5S)-fluvastatin sodium Chemical compound [Na+].C12=CC=CC=C2N(C(C)C)C(\C=C\[C@@H](O)C[C@@H](O)CC([O-])=O)=C1C1=CC=C(F)C=C1 ZGGHKIMDNBDHJB-NRFPMOEYSA-M 0.000 description 1
- QFLWZFQWSBQYPS-AWRAUJHKSA-N (3S)-3-[[(2S)-2-[[(2S)-2-[5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]-3-methylbutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-[1-bis(4-chlorophenoxy)phosphorylbutylamino]-4-oxobutanoic acid Chemical compound CCCC(NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](NC(=O)CCCCC1SC[C@@H]2NC(=O)N[C@H]12)C(C)C)P(=O)(Oc1ccc(Cl)cc1)Oc1ccc(Cl)cc1 QFLWZFQWSBQYPS-AWRAUJHKSA-N 0.000 description 1
- FNHHVPPSBFQMEL-KQHDFZBMSA-N (3S)-5-N-[(1S,5R)-3-hydroxy-6-bicyclo[3.1.0]hexanyl]-7-N,3-dimethyl-3-phenyl-2H-1-benzofuran-5,7-dicarboxamide Chemical compound CNC(=O)c1cc(cc2c1OC[C@@]2(C)c1ccccc1)C(=O)NC1[C@H]2CC(O)C[C@@H]12 FNHHVPPSBFQMEL-KQHDFZBMSA-N 0.000 description 1
- IWZSHWBGHQBIML-ZGGLMWTQSA-N (3S,8S,10R,13S,14S,17S)-17-isoquinolin-7-yl-N,N,10,13-tetramethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-amine Chemical compound CN(C)[C@H]1CC[C@]2(C)C3CC[C@@]4(C)[C@@H](CC[C@@H]4c4ccc5ccncc5c4)[C@@H]3CC=C2C1 IWZSHWBGHQBIML-ZGGLMWTQSA-N 0.000 description 1
- UDQTXCHQKHIQMH-KYGLGHNPSA-N (3ar,5s,6s,7r,7ar)-5-(difluoromethyl)-2-(ethylamino)-5,6,7,7a-tetrahydro-3ah-pyrano[3,2-d][1,3]thiazole-6,7-diol Chemical compound S1C(NCC)=N[C@H]2[C@@H]1O[C@H](C(F)F)[C@@H](O)[C@@H]2O UDQTXCHQKHIQMH-KYGLGHNPSA-N 0.000 description 1
- OOKAZRDERJMRCJ-KOUAFAAESA-N (3r)-7-[(1s,2s,4ar,6s,8s)-2,6-dimethyl-8-[(2s)-2-methylbutanoyl]oxy-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-3-hydroxy-5-oxoheptanoic acid Chemical compound C1=C[C@H](C)[C@H](CCC(=O)C[C@@H](O)CC(O)=O)C2[C@@H](OC(=O)[C@@H](C)CC)C[C@@H](C)C[C@@H]21 OOKAZRDERJMRCJ-KOUAFAAESA-N 0.000 description 1
- HUWSZNZAROKDRZ-RRLWZMAJSA-N (3r,4r)-3-azaniumyl-5-[[(2s,3r)-1-[(2s)-2,3-dicarboxypyrrolidin-1-yl]-3-methyl-1-oxopentan-2-yl]amino]-5-oxo-4-sulfanylpentane-1-sulfonate Chemical compound OS(=O)(=O)CC[C@@H](N)[C@@H](S)C(=O)N[C@@H]([C@H](C)CC)C(=O)N1CCC(C(O)=O)[C@H]1C(O)=O HUWSZNZAROKDRZ-RRLWZMAJSA-N 0.000 description 1
- MPDDTAJMJCESGV-CTUHWIOQSA-M (3r,5r)-7-[2-(4-fluorophenyl)-5-[methyl-[(1r)-1-phenylethyl]carbamoyl]-4-propan-2-ylpyrazol-3-yl]-3,5-dihydroxyheptanoate Chemical compound C1([C@@H](C)N(C)C(=O)C2=NN(C(CC[C@@H](O)C[C@@H](O)CC([O-])=O)=C2C(C)C)C=2C=CC(F)=CC=2)=CC=CC=C1 MPDDTAJMJCESGV-CTUHWIOQSA-M 0.000 description 1
- YNWGHGSFCGMYHH-UHFFFAOYSA-N (4-but-3-ynoxyphenyl)-(4-fluorophenyl)methanone Chemical compound C1=CC(F)=CC=C1C(=O)C1=CC=C(OCCC#C)C=C1 YNWGHGSFCGMYHH-UHFFFAOYSA-N 0.000 description 1
- LUAKVGLYSWFEEH-UHFFFAOYSA-N (4-but-3-ynoxyphenyl)-phenylmethanone Chemical compound C=1C=C(OCCC#C)C=CC=1C(=O)C1=CC=CC=C1 LUAKVGLYSWFEEH-UHFFFAOYSA-N 0.000 description 1
- WYNOGGGSXSGVQM-UHFFFAOYSA-N (4-fluoro-2-hydroxyphenyl)-phenylmethanone Chemical compound OC1=CC(F)=CC=C1C(=O)C1=CC=CC=C1 WYNOGGGSXSGVQM-UHFFFAOYSA-N 0.000 description 1
- YQOLEILXOBUDMU-KRWDZBQOSA-N (4R)-5-[(6-bromo-3-methyl-2-pyrrolidin-1-ylquinoline-4-carbonyl)amino]-4-(2-chlorophenyl)pentanoic acid Chemical compound CC1=C(C2=C(C=CC(=C2)Br)N=C1N3CCCC3)C(=O)NC[C@H](CCC(=O)O)C4=CC=CC=C4Cl YQOLEILXOBUDMU-KRWDZBQOSA-N 0.000 description 1
- STPKWKPURVSAJF-LJEWAXOPSA-N (4r,5r)-5-[4-[[4-(1-aza-4-azoniabicyclo[2.2.2]octan-4-ylmethyl)phenyl]methoxy]phenyl]-3,3-dibutyl-7-(dimethylamino)-1,1-dioxo-4,5-dihydro-2h-1$l^{6}-benzothiepin-4-ol Chemical compound O[C@H]1C(CCCC)(CCCC)CS(=O)(=O)C2=CC=C(N(C)C)C=C2[C@H]1C(C=C1)=CC=C1OCC(C=C1)=CC=C1C[N+]1(CC2)CCN2CC1 STPKWKPURVSAJF-LJEWAXOPSA-N 0.000 description 1
- OIIOPWHTJZYKIL-PMACEKPBSA-N (5S)-5-[[[5-[2-chloro-3-[2-chloro-3-[6-methoxy-5-[[[(2S)-5-oxopyrrolidin-2-yl]methylamino]methyl]pyrazin-2-yl]phenyl]phenyl]-3-methoxypyrazin-2-yl]methylamino]methyl]pyrrolidin-2-one Chemical compound C1(=C(N=C(C2=C(C(C3=CC=CC(=C3Cl)C3=NC(OC)=C(N=C3)CNC[C@H]3NC(=O)CC3)=CC=C2)Cl)C=N1)OC)CNC[C@H]1NC(=O)CC1 OIIOPWHTJZYKIL-PMACEKPBSA-N 0.000 description 1
- OWBTYPJTUOEWEK-QWWZWVQMSA-N (R,R)-butane-2,3-diol Chemical compound C[C@@H](O)[C@@H](C)O OWBTYPJTUOEWEK-QWWZWVQMSA-N 0.000 description 1
- DEVSOMFAQLZNKR-RJRFIUFISA-N (z)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-n'-pyrazin-2-ylprop-2-enehydrazide Chemical compound FC(F)(F)C1=CC(C(F)(F)F)=CC(C2=NN(\C=C/C(=O)NNC=3N=CC=NC=3)C=N2)=C1 DEVSOMFAQLZNKR-RJRFIUFISA-N 0.000 description 1
- OXDSKEQSEGDAFN-UHFFFAOYSA-N 1,1,1-trifluoro-n-phenylmethanesulfonamide Chemical compound FC(F)(F)S(=O)(=O)NC1=CC=CC=C1 OXDSKEQSEGDAFN-UHFFFAOYSA-N 0.000 description 1
- BWKMGYQJPOAASG-UHFFFAOYSA-N 1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid Chemical compound C1=CC=C2CNC(C(=O)O)CC2=C1 BWKMGYQJPOAASG-UHFFFAOYSA-N 0.000 description 1
- DDMOUSALMHHKOS-UHFFFAOYSA-N 1,2-dichloro-1,1,2,2-tetrafluoroethane Chemical compound FC(F)(Cl)C(F)(F)Cl DDMOUSALMHHKOS-UHFFFAOYSA-N 0.000 description 1
- QACMXJJLQXUOPQ-UHFFFAOYSA-N 1,2-dichloroethane;3-(ethyliminomethylideneamino)-n,n-dimethylpropan-1-amine Chemical compound ClCCCl.CCN=C=NCCCN(C)C QACMXJJLQXUOPQ-UHFFFAOYSA-N 0.000 description 1
- OQCFWECOQNPQCG-UHFFFAOYSA-N 1,3,4,8-tetrahydropyrimido[4,5-c]oxazin-7-one Chemical compound C1CONC2=C1C=NC(=O)N2 OQCFWECOQNPQCG-UHFFFAOYSA-N 0.000 description 1
- FTNJQNQLEGKTGD-UHFFFAOYSA-N 1,3-benzodioxole Chemical compound C1=CC=C2OCOC2=C1 FTNJQNQLEGKTGD-UHFFFAOYSA-N 0.000 description 1
- KKHFRAFPESRGGD-UHFFFAOYSA-N 1,3-dimethyl-7-[3-(n-methylanilino)propyl]purine-2,6-dione Chemical compound C1=NC=2N(C)C(=O)N(C)C(=O)C=2N1CCCN(C)C1=CC=CC=C1 KKHFRAFPESRGGD-UHFFFAOYSA-N 0.000 description 1
- MHSLDASSAFCCDO-UHFFFAOYSA-N 1-(5-tert-butyl-2-methylpyrazol-3-yl)-3-(4-pyridin-4-yloxyphenyl)urea Chemical compound CN1N=C(C(C)(C)C)C=C1NC(=O)NC(C=C1)=CC=C1OC1=CC=NC=C1 MHSLDASSAFCCDO-UHFFFAOYSA-N 0.000 description 1
- KQZLRWGGWXJPOS-NLFPWZOASA-N 1-[(1R)-1-(2,4-dichlorophenyl)ethyl]-6-[(4S,5R)-4-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-5-methylcyclohexen-1-yl]pyrazolo[3,4-b]pyrazine-3-carbonitrile Chemical compound ClC1=C(C=CC(=C1)Cl)[C@@H](C)N1N=C(C=2C1=NC(=CN=2)C1=CC[C@@H]([C@@H](C1)C)N1[C@@H](CCC1)CO)C#N KQZLRWGGWXJPOS-NLFPWZOASA-N 0.000 description 1
- WZZBNLYBHUDSHF-DHLKQENFSA-N 1-[(3s,4s)-4-[8-(2-chloro-4-pyrimidin-2-yloxyphenyl)-7-fluoro-2-methylimidazo[4,5-c]quinolin-1-yl]-3-fluoropiperidin-1-yl]-2-hydroxyethanone Chemical compound CC1=NC2=CN=C3C=C(F)C(C=4C(=CC(OC=5N=CC=CN=5)=CC=4)Cl)=CC3=C2N1[C@H]1CCN(C(=O)CO)C[C@@H]1F WZZBNLYBHUDSHF-DHLKQENFSA-N 0.000 description 1
- ABDDQTDRAHXHOC-QMMMGPOBSA-N 1-[(7s)-5,7-dihydro-4h-thieno[2,3-c]pyran-7-yl]-n-methylmethanamine Chemical compound CNC[C@@H]1OCCC2=C1SC=C2 ABDDQTDRAHXHOC-QMMMGPOBSA-N 0.000 description 1
- ONBQEOIKXPHGMB-VBSBHUPXSA-N 1-[2-[(2s,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-4,6-dihydroxyphenyl]-3-(4-hydroxyphenyl)propan-1-one Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1OC1=CC(O)=CC(O)=C1C(=O)CCC1=CC=C(O)C=C1 ONBQEOIKXPHGMB-VBSBHUPXSA-N 0.000 description 1
- FXIFXTLQQSHLQV-UHFFFAOYSA-N 1-but-3-ynoxy-4-phenoxybenzene Chemical compound C1=CC(OCCC#C)=CC=C1OC1=CC=CC=C1 FXIFXTLQQSHLQV-UHFFFAOYSA-N 0.000 description 1
- KRJLXVBHBJGTLX-UHFFFAOYSA-N 1-but-3-ynoxy-4-phenylbenzene Chemical group C1=CC(OCCC#C)=CC=C1C1=CC=CC=C1 KRJLXVBHBJGTLX-UHFFFAOYSA-N 0.000 description 1
- JZUMPNUYDJBTNO-UHFFFAOYSA-N 1-hydroxybenzotriazole;hydrate Chemical compound O.C1=CC=C2N(O)N=NC2=C1.C1=CC=C2N(O)N=NC2=C1 JZUMPNUYDJBTNO-UHFFFAOYSA-N 0.000 description 1
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 description 1
- IRUFLAAZAAOXHM-UHFFFAOYSA-N 1-tert-butyl-2-phenylbenzene Chemical group CC(C)(C)C1=CC=CC=C1C1=CC=CC=C1 IRUFLAAZAAOXHM-UHFFFAOYSA-N 0.000 description 1
- MEKOFIRRDATTAG-UHFFFAOYSA-N 2,2,5,8-tetramethyl-3,4-dihydrochromen-6-ol Chemical compound C1CC(C)(C)OC2=C1C(C)=C(O)C=C2C MEKOFIRRDATTAG-UHFFFAOYSA-N 0.000 description 1
- NVWVWEWVLBKPSM-UHFFFAOYSA-N 2,4-difluorophenol Chemical compound OC1=CC=C(F)C=C1F NVWVWEWVLBKPSM-UHFFFAOYSA-N 0.000 description 1
- WGFNXGPBPIJYLI-UHFFFAOYSA-N 2,6-difluoro-3-[(3-fluorophenyl)sulfonylamino]-n-(3-methoxy-1h-pyrazolo[3,4-b]pyridin-5-yl)benzamide Chemical compound C1=C2C(OC)=NNC2=NC=C1NC(=O)C(C=1F)=C(F)C=CC=1NS(=O)(=O)C1=CC=CC(F)=C1 WGFNXGPBPIJYLI-UHFFFAOYSA-N 0.000 description 1
- FQMZXMVHHKXGTM-UHFFFAOYSA-N 2-(1-adamantyl)-n-[2-[2-(2-hydroxyethylamino)ethylamino]quinolin-5-yl]acetamide Chemical compound C1C(C2)CC(C3)CC2CC13CC(=O)NC1=CC=CC2=NC(NCCNCCO)=CC=C21 FQMZXMVHHKXGTM-UHFFFAOYSA-N 0.000 description 1
- VCUXVXLUOHDHKK-UHFFFAOYSA-N 2-(2-aminopyrimidin-4-yl)-4-(2-chloro-4-methoxyphenyl)-1,3-thiazole-5-carboxamide Chemical compound ClC1=CC(OC)=CC=C1C1=C(C(N)=O)SC(C=2N=C(N)N=CC=2)=N1 VCUXVXLUOHDHKK-UHFFFAOYSA-N 0.000 description 1
- QEBYEVQKHRUYPE-UHFFFAOYSA-N 2-(2-chlorophenyl)-5-[(1-methylpyrazol-3-yl)methyl]-4-[[methyl(pyridin-3-ylmethyl)amino]methyl]-1h-pyrazolo[4,3-c]pyridine-3,6-dione Chemical compound C1=CN(C)N=C1CN1C(=O)C=C2NN(C=3C(=CC=CC=3)Cl)C(=O)C2=C1CN(C)CC1=CC=CN=C1 QEBYEVQKHRUYPE-UHFFFAOYSA-N 0.000 description 1
- SYULRPAQEBKROC-UHFFFAOYSA-N 2-(4-phenylphenoxy)ethanol Chemical compound C1=CC(OCCO)=CC=C1C1=CC=CC=C1 SYULRPAQEBKROC-UHFFFAOYSA-N 0.000 description 1
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 1
- QTMAZYGAVHCKKX-UHFFFAOYSA-N 2-[(4-amino-5-bromopyrrolo[2,3-d]pyrimidin-7-yl)methoxy]propane-1,3-diol Chemical compound NC1=NC=NC2=C1C(Br)=CN2COC(CO)CO QTMAZYGAVHCKKX-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- MDFXJBQEWLCGHP-MFOYZWKCSA-N 2-[2-[(z)-(pyridine-4-carbonylhydrazinylidene)methyl]phenoxy]acetic acid Chemical compound OC(=O)COC1=CC=CC=C1\C=N/NC(=O)C1=CC=NC=C1 MDFXJBQEWLCGHP-MFOYZWKCSA-N 0.000 description 1
- VKLKCIQOMLTCNJ-KRWDZBQOSA-N 2-[2-[4-[(2s)-2-carboxy-2-methoxyethyl]phenoxy]ethoxy]benzoic acid Chemical compound C1=CC(C[C@H](OC)C(O)=O)=CC=C1OCCOC1=CC=CC=C1C(O)=O VKLKCIQOMLTCNJ-KRWDZBQOSA-N 0.000 description 1
- PYRKKGOKRMZEIT-UHFFFAOYSA-N 2-[6-(2-cyclopropylethoxy)-9-(2-hydroxy-2-methylpropyl)-1h-phenanthro[9,10-d]imidazol-2-yl]-5-fluorobenzene-1,3-dicarbonitrile Chemical compound C1=C2C3=CC(CC(C)(O)C)=CC=C3C=3NC(C=4C(=CC(F)=CC=4C#N)C#N)=NC=3C2=CC=C1OCCC1CC1 PYRKKGOKRMZEIT-UHFFFAOYSA-N 0.000 description 1
- FMKGJQHNYMWDFJ-CVEARBPZSA-N 2-[[4-(2,2-difluoropropoxy)pyrimidin-5-yl]methylamino]-4-[[(1R,4S)-4-hydroxy-3,3-dimethylcyclohexyl]amino]pyrimidine-5-carbonitrile Chemical compound FC(COC1=NC=NC=C1CNC1=NC=C(C(=N1)N[C@H]1CC([C@H](CC1)O)(C)C)C#N)(C)F FMKGJQHNYMWDFJ-CVEARBPZSA-N 0.000 description 1
- PAYROHWFGZADBR-UHFFFAOYSA-N 2-[[4-amino-5-(5-iodo-4-methoxy-2-propan-2-ylphenoxy)pyrimidin-2-yl]amino]propane-1,3-diol Chemical compound C1=C(I)C(OC)=CC(C(C)C)=C1OC1=CN=C(NC(CO)CO)N=C1N PAYROHWFGZADBR-UHFFFAOYSA-N 0.000 description 1
- VVCMGAUPZIKYTH-VGHSCWAPSA-N 2-acetyloxybenzoic acid;[(2s,3r)-4-(dimethylamino)-3-methyl-1,2-diphenylbutan-2-yl] propanoate;1,3,7-trimethylpurine-2,6-dione Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O.CN1C(=O)N(C)C(=O)C2=C1N=CN2C.C([C@](OC(=O)CC)([C@H](C)CN(C)C)C=1C=CC=CC=1)C1=CC=CC=C1 VVCMGAUPZIKYTH-VGHSCWAPSA-N 0.000 description 1
- YSUIQYOGTINQIN-UZFYAQMZSA-N 2-amino-9-[(1S,6R,8R,9S,10R,15R,17R,18R)-8-(6-aminopurin-9-yl)-9,18-difluoro-3,12-dihydroxy-3,12-bis(sulfanylidene)-2,4,7,11,13,16-hexaoxa-3lambda5,12lambda5-diphosphatricyclo[13.2.1.06,10]octadecan-17-yl]-1H-purin-6-one Chemical compound NC1=NC2=C(N=CN2[C@@H]2O[C@@H]3COP(S)(=O)O[C@@H]4[C@@H](COP(S)(=O)O[C@@H]2[C@@H]3F)O[C@H]([C@H]4F)N2C=NC3=C2N=CN=C3N)C(=O)N1 YSUIQYOGTINQIN-UZFYAQMZSA-N 0.000 description 1
- TVTJUIAKQFIXCE-HUKYDQBMSA-N 2-amino-9-[(2R,3S,4S,5R)-4-fluoro-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-prop-2-ynyl-1H-purine-6,8-dione Chemical compound NC=1NC(C=2N(C(N(C=2N=1)[C@@H]1O[C@@H]([C@H]([C@H]1O)F)CO)=O)CC#C)=O TVTJUIAKQFIXCE-HUKYDQBMSA-N 0.000 description 1
- RGHQKFQZGLKBCF-UHFFFAOYSA-N 2-bromoethyl acetate Chemical compound CC(=O)OCCBr RGHQKFQZGLKBCF-UHFFFAOYSA-N 0.000 description 1
- HSTBYCCXJAUVSU-UHFFFAOYSA-N 2-ethoxy-3-[3-[3-(4-phenylphenoxy)propoxy]phenyl]propanoic acid Chemical compound CCOC(C(O)=O)CC1=CC=CC(OCCCOC=2C=CC(=CC=2)C=2C=CC=CC=2)=C1 HSTBYCCXJAUVSU-UHFFFAOYSA-N 0.000 description 1
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- RXBIUALLGWRBQK-UHFFFAOYSA-N 2-methoxy-3-[2-methyl-4-[3-(4-phenylphenoxy)propoxy]phenyl]prop-2-enoic acid Chemical compound C1=C(C)C(C=C(OC)C(O)=O)=CC=C1OCCCOC1=CC=C(C=2C=CC=CC=2)C=C1 RXBIUALLGWRBQK-UHFFFAOYSA-N 0.000 description 1
- FBDLSDZQDTYBMP-UHFFFAOYSA-N 2-methoxy-3-[2-methyl-4-[3-(4-phenylphenoxy)propoxy]phenyl]propanoic acid Chemical compound C1=C(C)C(CC(OC)C(O)=O)=CC=C1OCCCOC1=CC=C(C=2C=CC=CC=2)C=C1 FBDLSDZQDTYBMP-UHFFFAOYSA-N 0.000 description 1
- HSDNKJRKBYIEFD-UHFFFAOYSA-N 2-methoxy-3-[3-(2-methoxyphenyl)-4-[3-(4-phenylphenoxy)propoxy]phenyl]propanoic acid Chemical compound C=1C=CC=C(OC)C=1C1=CC(CC(OC)C(O)=O)=CC=C1OCCCOC(C=C1)=CC=C1C1=CC=CC=C1 HSDNKJRKBYIEFD-UHFFFAOYSA-N 0.000 description 1
- RDCQHENHQUDMAB-UHFFFAOYSA-N 2-methoxy-3-[3-(3-naphthalen-2-yloxypropoxy)phenyl]propanoic acid Chemical compound COC(C(O)=O)CC1=CC=CC(OCCCOC=2C=C3C=CC=CC3=CC=2)=C1 RDCQHENHQUDMAB-UHFFFAOYSA-N 0.000 description 1
- GFHOLUSWJZQDKY-UHFFFAOYSA-N 2-methoxy-3-[3-(3-quinolin-6-yloxypropoxy)phenyl]propanoic acid Chemical compound COC(C(O)=O)CC1=CC=CC(OCCCOC=2C=C3C=CC=NC3=CC=2)=C1 GFHOLUSWJZQDKY-UHFFFAOYSA-N 0.000 description 1
- DOLCTHSYDIOYAD-UHFFFAOYSA-N 2-methoxy-3-[3-[2-(3-methoxyphenoxy)ethoxy]phenyl]propanoic acid Chemical compound COC(C(O)=O)CC1=CC=CC(OCCOC=2C=C(OC)C=CC=2)=C1 DOLCTHSYDIOYAD-UHFFFAOYSA-N 0.000 description 1
- RUSPTQLXURRONQ-UHFFFAOYSA-N 2-methoxy-3-[3-[2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)ethoxy]phenyl]propanoic acid Chemical compound COC(C(O)=O)CC1=CC=CC(OCCOC=2C=C3CCCCC3=CC=2)=C1 RUSPTQLXURRONQ-UHFFFAOYSA-N 0.000 description 1
- JHPIZJYDMNNORM-UHFFFAOYSA-N 2-methoxy-3-[3-[3-(3-methoxyphenoxy)propoxy]phenyl]propanoic acid Chemical compound COC(C(O)=O)CC1=CC=CC(OCCCOC=2C=C(OC)C=CC=2)=C1 JHPIZJYDMNNORM-UHFFFAOYSA-N 0.000 description 1
- LFOIDLOIBZFWDO-UHFFFAOYSA-N 2-methoxy-6-[6-methoxy-4-[(3-phenylmethoxyphenyl)methoxy]-1-benzofuran-2-yl]imidazo[2,1-b][1,3,4]thiadiazole Chemical compound N1=C2SC(OC)=NN2C=C1C(OC1=CC(OC)=C2)=CC1=C2OCC(C=1)=CC=CC=1OCC1=CC=CC=C1 LFOIDLOIBZFWDO-UHFFFAOYSA-N 0.000 description 1
- ICPWFHKNYYRBSZ-UHFFFAOYSA-M 2-methoxypropanoate Chemical compound COC(C)C([O-])=O ICPWFHKNYYRBSZ-UHFFFAOYSA-M 0.000 description 1
- LAKVUPMDDFICNR-UHFFFAOYSA-N 2-methyl-1,3-benzothiazol-5-ol Chemical compound OC1=CC=C2SC(C)=NC2=C1 LAKVUPMDDFICNR-UHFFFAOYSA-N 0.000 description 1
- ILPUOPPYSQEBNJ-UHFFFAOYSA-N 2-methyl-2-phenoxypropanoic acid Chemical class OC(=O)C(C)(C)OC1=CC=CC=C1 ILPUOPPYSQEBNJ-UHFFFAOYSA-N 0.000 description 1
- JFFYKITVXPZLQS-UHFFFAOYSA-N 2-methylidenepropane-1,3-diol Chemical compound OCC(=C)CO JFFYKITVXPZLQS-UHFFFAOYSA-N 0.000 description 1
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 1
- TYMVVQKMPXRTMP-UHFFFAOYSA-N 2-phenoxy-3-(trifluoromethyl)phenol Chemical compound OC1=CC=CC(C(F)(F)F)=C1OC1=CC=CC=C1 TYMVVQKMPXRTMP-UHFFFAOYSA-N 0.000 description 1
- KDTZBYPBMTXCSO-UHFFFAOYSA-N 2-phenoxyphenol Chemical compound OC1=CC=CC=C1OC1=CC=CC=C1 KDTZBYPBMTXCSO-UHFFFAOYSA-N 0.000 description 1
- 229940061334 2-phenylphenol Drugs 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- HJSSBIMVTMYKPD-UHFFFAOYSA-N 3,5-difluorophenol Chemical compound OC1=CC(F)=CC(F)=C1 HJSSBIMVTMYKPD-UHFFFAOYSA-N 0.000 description 1
- DFRAKBCRUYUFNT-UHFFFAOYSA-N 3,8-dicyclohexyl-2,4,7,9-tetrahydro-[1,3]oxazino[5,6-h][1,3]benzoxazine Chemical compound C1CCCCC1N1CC(C=CC2=C3OCN(C2)C2CCCCC2)=C3OC1 DFRAKBCRUYUFNT-UHFFFAOYSA-N 0.000 description 1
- HCDMJFOHIXMBOV-UHFFFAOYSA-N 3-(2,6-difluoro-3,5-dimethoxyphenyl)-1-ethyl-8-(morpholin-4-ylmethyl)-4,7-dihydropyrrolo[4,5]pyrido[1,2-d]pyrimidin-2-one Chemical compound C=1C2=C3N(CC)C(=O)N(C=4C(=C(OC)C=C(OC)C=4F)F)CC3=CN=C2NC=1CN1CCOCC1 HCDMJFOHIXMBOV-UHFFFAOYSA-N 0.000 description 1
- NWYNLOMOKHYWMY-UHFFFAOYSA-N 3-(4-phenylphenoxy)cyclopentan-1-ol Chemical compound C1C(O)CCC1OC1=CC=C(C=2C=CC=CC=2)C=C1 NWYNLOMOKHYWMY-UHFFFAOYSA-N 0.000 description 1
- SKMKJBYBPYBDMN-RYUDHWBXSA-N 3-(difluoromethoxy)-5-[2-(3,3-difluoropyrrolidin-1-yl)-6-[(1s,4s)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]pyrimidin-4-yl]pyridin-2-amine Chemical compound C1=C(OC(F)F)C(N)=NC=C1C1=CC(N2[C@H]3C[C@H](OC3)C2)=NC(N2CC(F)(F)CC2)=N1 SKMKJBYBPYBDMN-RYUDHWBXSA-N 0.000 description 1
- UGEJOEBBMPOJMT-UHFFFAOYSA-N 3-(trifluoromethyl)phenol Chemical compound OC1=CC=CC(C(F)(F)F)=C1 UGEJOEBBMPOJMT-UHFFFAOYSA-N 0.000 description 1
- QBWKPGNFQQJGFY-QLFBSQMISA-N 3-[(1r)-1-[(2r,6s)-2,6-dimethylmorpholin-4-yl]ethyl]-n-[6-methyl-3-(1h-pyrazol-4-yl)imidazo[1,2-a]pyrazin-8-yl]-1,2-thiazol-5-amine Chemical compound N1([C@H](C)C2=NSC(NC=3C4=NC=C(N4C=C(C)N=3)C3=CNN=C3)=C2)C[C@H](C)O[C@H](C)C1 QBWKPGNFQQJGFY-QLFBSQMISA-N 0.000 description 1
- MAGHQEACVRMSGI-UHFFFAOYSA-N 3-[2-chloro-4-[3-(4-phenylphenoxy)propoxy]phenyl]-2-methoxypropanoic acid Chemical compound C1=C(Cl)C(CC(OC)C(O)=O)=CC=C1OCCCOC1=CC=C(C=2C=CC=CC=2)C=C1 MAGHQEACVRMSGI-UHFFFAOYSA-N 0.000 description 1
- WNEODWDFDXWOLU-QHCPKHFHSA-N 3-[3-(hydroxymethyl)-4-[1-methyl-5-[[5-[(2s)-2-methyl-4-(oxetan-3-yl)piperazin-1-yl]pyridin-2-yl]amino]-6-oxopyridin-3-yl]pyridin-2-yl]-7,7-dimethyl-1,2,6,8-tetrahydrocyclopenta[3,4]pyrrolo[3,5-b]pyrazin-4-one Chemical compound C([C@@H](N(CC1)C=2C=NC(NC=3C(N(C)C=C(C=3)C=3C(=C(N4C(C5=CC=6CC(C)(C)CC=6N5CC4)=O)N=CC=3)CO)=O)=CC=2)C)N1C1COC1 WNEODWDFDXWOLU-QHCPKHFHSA-N 0.000 description 1
- KPQOAKNIKPOBKO-UHFFFAOYSA-N 3-[3-[2-(3-fluorophenoxy)ethoxy]phenyl]-2-methoxypropanoic acid Chemical compound COC(C(O)=O)CC1=CC=CC(OCCOC=2C=C(F)C=CC=2)=C1 KPQOAKNIKPOBKO-UHFFFAOYSA-N 0.000 description 1
- BHLROMAWBULUAE-UHFFFAOYSA-N 3-[4-[3-[4-(4-fluorobenzoyl)phenoxy]propoxy]-3-methoxyphenyl]-2-methoxypropanoic acid Chemical compound COC1=CC(CC(OC)C(O)=O)=CC=C1OCCCOC1=CC=C(C(=O)C=2C=CC(F)=CC=2)C=C1 BHLROMAWBULUAE-UHFFFAOYSA-N 0.000 description 1
- ISHARVPNLFDQFW-UHFFFAOYSA-N 3-[4-[4-(4-benzoylphenoxy)butanoyl]phenyl]-2-methoxypropanoic acid Chemical compound C1=CC(CC(OC)C(O)=O)=CC=C1C(=O)CCCOC1=CC=C(C(=O)C=2C=CC=CC=2)C=C1 ISHARVPNLFDQFW-UHFFFAOYSA-N 0.000 description 1
- TZZDVPMABRWKIZ-MFTLXVFQSA-N 3-[6-[4-[[1-[4-[(1R,2S)-6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]piperidin-4-yl]methyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione Chemical compound OC=1C=C2CC[C@@H]([C@@H](C2=CC=1)C1=CC=C(C=C1)N1CCC(CC1)CN1CCN(CC1)C=1C=C2CN(C(C2=CC=1)=O)C1C(NC(CC1)=O)=O)C1=CC=CC=C1 TZZDVPMABRWKIZ-MFTLXVFQSA-N 0.000 description 1
- 125000003682 3-furyl group Chemical group O1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- JSHLOPGSDZTEGQ-UHFFFAOYSA-N 3-methoxy-4-phenylmethoxybenzaldehyde Chemical compound COC1=CC(C=O)=CC=C1OCC1=CC=CC=C1 JSHLOPGSDZTEGQ-UHFFFAOYSA-N 0.000 description 1
- BMGSGGYIUOQZBZ-UHFFFAOYSA-N 3-morpholin-4-ylphenol Chemical compound OC1=CC=CC(N2CCOCC2)=C1 BMGSGGYIUOQZBZ-UHFFFAOYSA-N 0.000 description 1
- MCBHAIMUCYXEPF-UHFFFAOYSA-N 3-phenyl-1-benzofuran-6-ol Chemical compound C=1OC2=CC(O)=CC=C2C=1C1=CC=CC=C1 MCBHAIMUCYXEPF-UHFFFAOYSA-N 0.000 description 1
- MVQVNTPHUGQQHK-UHFFFAOYSA-N 3-pyridinemethanol Chemical compound OCC1=CC=CN=C1 MVQVNTPHUGQQHK-UHFFFAOYSA-N 0.000 description 1
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- IYTJRMRETHPZAC-UHFFFAOYSA-N 4,4-dibenzylpiperidine Chemical compound C1CNCCC1(CC=1C=CC=CC=1)CC1=CC=CC=C1 IYTJRMRETHPZAC-UHFFFAOYSA-N 0.000 description 1
- NBJHDLKSWUDGJG-UHFFFAOYSA-N 4-(2-chloroethyl)morpholin-4-ium;chloride Chemical compound Cl.ClCCN1CCOCC1 NBJHDLKSWUDGJG-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- WDRJNKMAZMEYOF-UHFFFAOYSA-N 4-(trifluoromethoxy)phenol Chemical compound OC1=CC=C(OC(F)(F)F)C=C1 WDRJNKMAZMEYOF-UHFFFAOYSA-N 0.000 description 1
- BAYGVMXZJBFEMB-UHFFFAOYSA-N 4-(trifluoromethyl)phenol Chemical compound OC1=CC=C(C(F)(F)F)C=C1 BAYGVMXZJBFEMB-UHFFFAOYSA-N 0.000 description 1
- MSTDXOZUKAQDRL-UHFFFAOYSA-N 4-Chromanone Chemical compound C1=CC=C2C(=O)CCOC2=C1 MSTDXOZUKAQDRL-UHFFFAOYSA-N 0.000 description 1
- FJFSSESWAFPCSU-UHFFFAOYSA-N 4-[4-(trifluoromethyl)phenoxy]phenol Chemical compound C1=CC(O)=CC=C1OC1=CC=C(C(F)(F)F)C=C1 FJFSSESWAFPCSU-UHFFFAOYSA-N 0.000 description 1
- WYFCZWSWFGJODV-MIANJLSGSA-N 4-[[(1s)-2-[(e)-3-[3-chloro-2-fluoro-6-(tetrazol-1-yl)phenyl]prop-2-enoyl]-5-(4-methyl-2-oxopiperazin-1-yl)-3,4-dihydro-1h-isoquinoline-1-carbonyl]amino]benzoic acid Chemical compound O=C1CN(C)CCN1C1=CC=CC2=C1CCN(C(=O)\C=C\C=1C(=CC=C(Cl)C=1F)N1N=NN=C1)[C@@H]2C(=O)NC1=CC=C(C(O)=O)C=C1 WYFCZWSWFGJODV-MIANJLSGSA-N 0.000 description 1
- MPMKMQHJHDHPBE-RUZDIDTESA-N 4-[[(2r)-1-(1-benzothiophene-3-carbonyl)-2-methylazetidine-2-carbonyl]-[(3-chlorophenyl)methyl]amino]butanoic acid Chemical compound O=C([C@@]1(N(CC1)C(=O)C=1C2=CC=CC=C2SC=1)C)N(CCCC(O)=O)CC1=CC=CC(Cl)=C1 MPMKMQHJHDHPBE-RUZDIDTESA-N 0.000 description 1
- XWQVQSXLXAXOPJ-QNGMFEMESA-N 4-[[[6-[5-chloro-2-[[4-[[(2r)-1-methoxypropan-2-yl]amino]cyclohexyl]amino]pyridin-4-yl]pyridin-2-yl]amino]methyl]oxane-4-carbonitrile Chemical compound C1CC(N[C@H](C)COC)CCC1NC1=CC(C=2N=C(NCC3(CCOCC3)C#N)C=CC=2)=C(Cl)C=N1 XWQVQSXLXAXOPJ-QNGMFEMESA-N 0.000 description 1
- GVCLNACSYKYUHP-UHFFFAOYSA-N 4-amino-7-(2-hydroxyethoxymethyl)pyrrolo[2,3-d]pyrimidine-5-carbothioamide Chemical compound C1=NC(N)=C2C(C(=S)N)=CN(COCCO)C2=N1 GVCLNACSYKYUHP-UHFFFAOYSA-N 0.000 description 1
- KVCQTKNUUQOELD-UHFFFAOYSA-N 4-amino-n-[1-(3-chloro-2-fluoroanilino)-6-methylisoquinolin-5-yl]thieno[3,2-d]pyrimidine-7-carboxamide Chemical compound N=1C=CC2=C(NC(=O)C=3C4=NC=NC(N)=C4SC=3)C(C)=CC=C2C=1NC1=CC=CC(Cl)=C1F KVCQTKNUUQOELD-UHFFFAOYSA-N 0.000 description 1
- SNBKPVVDUBFDEJ-UHFFFAOYSA-N 4-cyclopentylphenol Chemical compound C1=CC(O)=CC=C1C1CCCC1 SNBKPVVDUBFDEJ-UHFFFAOYSA-N 0.000 description 1
- DQAZPZIYEOGZAF-UHFFFAOYSA-N 4-ethyl-n-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]piperazine-1-carboxamide Chemical compound C1CN(CC)CCN1C(=O)NC(C(=CC1=NC=N2)OC)=CC1=C2NC1=CC=CC(C#C)=C1 DQAZPZIYEOGZAF-UHFFFAOYSA-N 0.000 description 1
- HLRVUOFDBXRZBI-UHFFFAOYSA-N 4-fluoro-4'-hydroxybenzophenone Chemical compound C1=CC(O)=CC=C1C(=O)C1=CC=C(F)C=C1 HLRVUOFDBXRZBI-UHFFFAOYSA-N 0.000 description 1
- RHMPLDJJXGPMEX-UHFFFAOYSA-N 4-fluorophenol Chemical compound OC1=CC=C(F)C=C1 RHMPLDJJXGPMEX-UHFFFAOYSA-N 0.000 description 1
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- KDDQRKBRJSGMQE-UHFFFAOYSA-N 4-thiazolyl Chemical group [C]1=CSC=N1 KDDQRKBRJSGMQE-UHFFFAOYSA-N 0.000 description 1
- NKOHRVBBQISBSB-UHFFFAOYSA-N 5-[(4-hydroxyphenyl)methyl]-1,3-thiazolidine-2,4-dione Chemical compound C1=CC(O)=CC=C1CC1C(=O)NC(=O)S1 NKOHRVBBQISBSB-UHFFFAOYSA-N 0.000 description 1
- MVDXXGIBARMXSA-PYUWXLGESA-N 5-[[(2r)-2-benzyl-3,4-dihydro-2h-chromen-6-yl]methyl]-1,3-thiazolidine-2,4-dione Chemical compound S1C(=O)NC(=O)C1CC1=CC=C(O[C@@H](CC=2C=CC=CC=2)CC2)C2=C1 MVDXXGIBARMXSA-PYUWXLGESA-N 0.000 description 1
- VKLKXFOZNHEBSW-UHFFFAOYSA-N 5-[[3-[(4-morpholin-4-ylbenzoyl)amino]phenyl]methoxy]pyridine-3-carboxamide Chemical compound O1CCN(CC1)C1=CC=C(C(=O)NC=2C=C(COC=3C=NC=C(C(=O)N)C=3)C=CC=2)C=C1 VKLKXFOZNHEBSW-UHFFFAOYSA-N 0.000 description 1
- IJRKLHTZAIFUTB-UHFFFAOYSA-N 5-nitro-2-(2-phenylethylamino)benzoic acid Chemical compound OC(=O)C1=CC([N+]([O-])=O)=CC=C1NCCC1=CC=CC=C1 IJRKLHTZAIFUTB-UHFFFAOYSA-N 0.000 description 1
- CWDWFSXUQODZGW-UHFFFAOYSA-N 5-thiazolyl Chemical group [C]1=CN=CS1 CWDWFSXUQODZGW-UHFFFAOYSA-N 0.000 description 1
- RSIWALKZYXPAGW-NSHDSACASA-N 6-(3-fluorophenyl)-3-methyl-7-[(1s)-1-(7h-purin-6-ylamino)ethyl]-[1,3]thiazolo[3,2-a]pyrimidin-5-one Chemical compound C=1([C@@H](NC=2C=3N=CNC=3N=CN=2)C)N=C2SC=C(C)N2C(=O)C=1C1=CC=CC(F)=C1 RSIWALKZYXPAGW-NSHDSACASA-N 0.000 description 1
- GDUANFXPOZTYKS-UHFFFAOYSA-N 6-bromo-8-[(2,6-difluoro-4-methoxybenzoyl)amino]-4-oxochromene-2-carboxylic acid Chemical compound FC1=CC(OC)=CC(F)=C1C(=O)NC1=CC(Br)=CC2=C1OC(C(O)=O)=CC2=O GDUANFXPOZTYKS-UHFFFAOYSA-N 0.000 description 1
- ZQWOALDQHOSLNS-UHFFFAOYSA-N 6-but-3-ynoxy-3-(4-fluorophenyl)-1-benzofuran Chemical compound C1=CC(F)=CC=C1C1=COC2=CC(OCCC#C)=CC=C12 ZQWOALDQHOSLNS-UHFFFAOYSA-N 0.000 description 1
- FNSQPQKPPGALFA-UHFFFAOYSA-N 6-hydroxy-3,4-dihydro-2h-naphthalen-1-one Chemical compound O=C1CCCC2=CC(O)=CC=C21 FNSQPQKPPGALFA-UHFFFAOYSA-N 0.000 description 1
- XYHWPQUEOOBIOW-UHFFFAOYSA-N 6-hydroxyflavanone Chemical compound C1C(=O)C2=CC(O)=CC=C2OC1C1=CC=CC=C1 XYHWPQUEOOBIOW-UHFFFAOYSA-N 0.000 description 1
- SWAJPHCXKPCPQZ-AWEZNQCLSA-N 7-Hydroxyflavanone Natural products C1([C@@H]2CC(=O)C3=CC=C(C=C3O2)O)=CC=CC=C1 SWAJPHCXKPCPQZ-AWEZNQCLSA-N 0.000 description 1
- NJIAKNWTIVDSDA-FQEVSTJZSA-N 7-[4-(1-methylsulfonylpiperidin-4-yl)phenyl]-n-[[(2s)-morpholin-2-yl]methyl]pyrido[3,4-b]pyrazin-5-amine Chemical compound C1CN(S(=O)(=O)C)CCC1C1=CC=C(C=2N=C(NC[C@H]3OCCNC3)C3=NC=CN=C3C=2)C=C1 NJIAKNWTIVDSDA-FQEVSTJZSA-N 0.000 description 1
- CYJRNFFLTBEQSQ-UHFFFAOYSA-N 8-(3-methyl-1-benzothiophen-5-yl)-N-(4-methylsulfonylpyridin-3-yl)quinoxalin-6-amine Chemical compound CS(=O)(=O)C1=C(C=NC=C1)NC=1C=C2N=CC=NC2=C(C=1)C=1C=CC2=C(C(=CS2)C)C=1 CYJRNFFLTBEQSQ-UHFFFAOYSA-N 0.000 description 1
- XASOHFCUIQARJT-UHFFFAOYSA-N 8-methoxy-6-[7-(2-morpholin-4-ylethoxy)imidazo[1,2-a]pyridin-3-yl]-2-(2,2,2-trifluoroethyl)-3,4-dihydroisoquinolin-1-one Chemical compound C(N1C(=O)C2=C(OC)C=C(C=3N4C(=NC=3)C=C(C=C4)OCCN3CCOCC3)C=C2CC1)C(F)(F)F XASOHFCUIQARJT-UHFFFAOYSA-N 0.000 description 1
- IRBAWVGZNJIROV-SFHVURJKSA-N 9-(2-cyclopropylethynyl)-2-[[(2s)-1,4-dioxan-2-yl]methoxy]-6,7-dihydropyrimido[6,1-a]isoquinolin-4-one Chemical compound C1=C2C3=CC=C(C#CC4CC4)C=C3CCN2C(=O)N=C1OC[C@@H]1COCCO1 IRBAWVGZNJIROV-SFHVURJKSA-N 0.000 description 1
- 229940077274 Alpha glucosidase inhibitor Drugs 0.000 description 1
- 240000008025 Alternanthera ficoidea Species 0.000 description 1
- 208000024827 Alzheimer disease Diseases 0.000 description 1
- 239000004475 Arginine Substances 0.000 description 1
- IYHHRZBKXXKDDY-UHFFFAOYSA-N BI-605906 Chemical compound N=1C=2SC(C(N)=O)=C(N)C=2C(C(F)(F)CC)=CC=1N1CCC(S(C)(=O)=O)CC1 IYHHRZBKXXKDDY-UHFFFAOYSA-N 0.000 description 1
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 1
- MOZDKDIOPSPTBH-UHFFFAOYSA-N Benzyl parahydroxybenzoate Chemical compound C1=CC(O)=CC=C1C(=O)OCC1=CC=CC=C1 MOZDKDIOPSPTBH-UHFFFAOYSA-N 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- 241000167854 Bourreria succulenta Species 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Natural products CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 1
- JQUCWIWWWKZNCS-LESHARBVSA-N C(C1=CC=CC=C1)(=O)NC=1SC[C@H]2[C@@](N1)(CO[C@H](C2)C)C=2SC=C(N2)NC(=O)C2=NC=C(C=C2)OC(F)F Chemical compound C(C1=CC=CC=C1)(=O)NC=1SC[C@H]2[C@@](N1)(CO[C@H](C2)C)C=2SC=C(N2)NC(=O)C2=NC=C(C=C2)OC(F)F JQUCWIWWWKZNCS-LESHARBVSA-N 0.000 description 1
- ISMDILRWKSYCOD-GNKBHMEESA-N C(C1=CC=CC=C1)[C@@H]1NC(OCCCCCCCCCCCNC([C@@H](NC(C[C@@H]1O)=O)C(C)C)=O)=O Chemical compound C(C1=CC=CC=C1)[C@@H]1NC(OCCCCCCCCCCCNC([C@@H](NC(C[C@@H]1O)=O)C(C)C)=O)=O ISMDILRWKSYCOD-GNKBHMEESA-N 0.000 description 1
- BGGALFIXXQOTPY-NRFANRHFSA-N C1(=C(C2=C(C=C1)N(C(C#N)=C2)C[C@@H](N1CCN(CC1)S(=O)(=O)C)C)C)CN1CCC(CC1)NC1=NC(=NC2=C1C=C(S2)CC(F)(F)F)NC Chemical compound C1(=C(C2=C(C=C1)N(C(C#N)=C2)C[C@@H](N1CCN(CC1)S(=O)(=O)C)C)C)CN1CCC(CC1)NC1=NC(=NC2=C1C=C(S2)CC(F)(F)F)NC BGGALFIXXQOTPY-NRFANRHFSA-N 0.000 description 1
- KCBAMQOKOLXLOX-BSZYMOERSA-N CC1=C(SC=N1)C2=CC=C(C=C2)[C@H](C)NC(=O)[C@@H]3C[C@H](CN3C(=O)[C@H](C(C)(C)C)NC(=O)CCCCCCCCCCNCCCONC(=O)C4=C(C(=C(C=C4)F)F)NC5=C(C=C(C=C5)I)F)O Chemical compound CC1=C(SC=N1)C2=CC=C(C=C2)[C@H](C)NC(=O)[C@@H]3C[C@H](CN3C(=O)[C@H](C(C)(C)C)NC(=O)CCCCCCCCCCNCCCONC(=O)C4=C(C(=C(C=C4)F)F)NC5=C(C=C(C=C5)I)F)O KCBAMQOKOLXLOX-BSZYMOERSA-N 0.000 description 1
- UHNRLQRZRNKOKU-UHFFFAOYSA-N CCN(CC1=NC2=C(N1)C1=CC=C(C=C1N=C2N)C1=NNC=C1)C(C)=O Chemical compound CCN(CC1=NC2=C(N1)C1=CC=C(C=C1N=C2N)C1=NNC=C1)C(C)=O UHNRLQRZRNKOKU-UHFFFAOYSA-N 0.000 description 1
- BQXUPNKLZNSUMC-YUQWMIPFSA-N CCN(CCCCCOCC(=O)N[C@H](C(=O)N1C[C@H](O)C[C@H]1C(=O)N[C@@H](C)c1ccc(cc1)-c1scnc1C)C(C)(C)C)CCOc1ccc(cc1)C(=O)c1c(sc2cc(O)ccc12)-c1ccc(O)cc1 Chemical compound CCN(CCCCCOCC(=O)N[C@H](C(=O)N1C[C@H](O)C[C@H]1C(=O)N[C@@H](C)c1ccc(cc1)-c1scnc1C)C(C)(C)C)CCOc1ccc(cc1)C(=O)c1c(sc2cc(O)ccc12)-c1ccc(O)cc1 BQXUPNKLZNSUMC-YUQWMIPFSA-N 0.000 description 1
- SCJNYBYSTCRPAO-LXBQGUBHSA-N CN(C)C\C=C\C(=O)NC1=CC=C(N=C1)C(=O)N[C@@]1(C)CCC[C@H](C1)NC1=NC(C2=CNC3=CC=CC=C23)=C(Cl)C=N1 Chemical compound CN(C)C\C=C\C(=O)NC1=CC=C(N=C1)C(=O)N[C@@]1(C)CCC[C@H](C1)NC1=NC(C2=CNC3=CC=CC=C23)=C(Cl)C=N1 SCJNYBYSTCRPAO-LXBQGUBHSA-N 0.000 description 1
- PKMUHQIDVVOXHQ-HXUWFJFHSA-N C[C@H](C1=CC(C2=CC=C(CNC3CCCC3)S2)=CC=C1)NC(C1=C(C)C=CC(NC2CNC2)=C1)=O Chemical compound C[C@H](C1=CC(C2=CC=C(CNC3CCCC3)S2)=CC=C1)NC(C1=C(C)C=CC(NC2CNC2)=C1)=O PKMUHQIDVVOXHQ-HXUWFJFHSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 241000700198 Cavia Species 0.000 description 1
- PTHCMJGKKRQCBF-UHFFFAOYSA-N Cellulose, microcrystalline Chemical compound OC1C(O)C(OC)OC(CO)C1OC1C(O)C(O)C(OC)C(CO)O1 PTHCMJGKKRQCBF-UHFFFAOYSA-N 0.000 description 1
- 241001000171 Chira Species 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- RAPBNVDSDCTNRC-UHFFFAOYSA-N Chlorobenzilate Chemical compound C=1C=C(Cl)C=CC=1C(O)(C(=O)OCC)C1=CC=C(Cl)C=C1 RAPBNVDSDCTNRC-UHFFFAOYSA-N 0.000 description 1
- RKWGIWYCVPQPMF-UHFFFAOYSA-N Chloropropamide Chemical compound CCCNC(=O)NS(=O)(=O)C1=CC=C(Cl)C=C1 RKWGIWYCVPQPMF-UHFFFAOYSA-N 0.000 description 1
- 229920001268 Cholestyramine Polymers 0.000 description 1
- 235000001258 Cinchona calisaya Nutrition 0.000 description 1
- KPSRODZRAIWAKH-JTQLQIEISA-N Ciprofibrate Natural products C1=CC(OC(C)(C)C(O)=O)=CC=C1[C@H]1C(Cl)(Cl)C1 KPSRODZRAIWAKH-JTQLQIEISA-N 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- 206010053567 Coagulopathies Diseases 0.000 description 1
- 229920002911 Colestipol Polymers 0.000 description 1
- 229940126657 Compound 17 Drugs 0.000 description 1
- 229940126639 Compound 33 Drugs 0.000 description 1
- 229940127007 Compound 39 Drugs 0.000 description 1
- 229910021589 Copper(I) bromide Inorganic materials 0.000 description 1
- 229910021590 Copper(II) bromide Inorganic materials 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- 208000011231 Crohn disease Diseases 0.000 description 1
- 229920002307 Dextran Polymers 0.000 description 1
- 239000004375 Dextrin Substances 0.000 description 1
- 229920001353 Dextrin Polymers 0.000 description 1
- 235000019739 Dicalciumphosphate Nutrition 0.000 description 1
- 239000004338 Dichlorodifluoromethane Substances 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical compound C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- 101100456896 Drosophila melanogaster metl gene Proteins 0.000 description 1
- 206010014486 Elevated triglycerides Diseases 0.000 description 1
- 241000792859 Enema Species 0.000 description 1
- 241000283086 Equidae Species 0.000 description 1
- KMTRUDSVKNLOMY-UHFFFAOYSA-N Ethylene carbonate Chemical compound O=C1OCCO1 KMTRUDSVKNLOMY-UHFFFAOYSA-N 0.000 description 1
- RRSNDVCODIMOFX-MPKOGUQCSA-N Fc1c(Cl)cccc1[C@H]1[C@@H](NC2(CCCCC2)[C@@]11C(=O)Nc2cc(Cl)ccc12)C(=O)Nc1ccc(cc1)C(=O)NCCCCCc1cccc2C(=O)N(Cc12)C1CCC(=O)NC1=O Chemical compound Fc1c(Cl)cccc1[C@H]1[C@@H](NC2(CCCCC2)[C@@]11C(=O)Nc2cc(Cl)ccc12)C(=O)Nc1ccc(cc1)C(=O)NCCCCCc1cccc2C(=O)N(Cc12)C1CCC(=O)NC1=O RRSNDVCODIMOFX-MPKOGUQCSA-N 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- 206010018429 Glucose tolerance impaired Diseases 0.000 description 1
- 102000004366 Glucosidases Human genes 0.000 description 1
- 108010056771 Glucosidases Proteins 0.000 description 1
- WHUUTDBJXJRKMK-UHFFFAOYSA-N Glutamic acid Natural products OC(=O)C(N)CCC(O)=O WHUUTDBJXJRKMK-UHFFFAOYSA-N 0.000 description 1
- 229920002527 Glycogen Polymers 0.000 description 1
- 239000007821 HATU Substances 0.000 description 1
- 208000022559 Inflammatory bowel disease Diseases 0.000 description 1
- 208000031773 Insulin resistance syndrome Diseases 0.000 description 1
- COLNVLDHVKWLRT-QMMMGPOBSA-N L-phenylalanine Chemical compound OC(=O)[C@@H](N)CC1=CC=CC=C1 COLNVLDHVKWLRT-QMMMGPOBSA-N 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- 102000004895 Lipoproteins Human genes 0.000 description 1
- 108090001030 Lipoproteins Proteins 0.000 description 1
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 1
- 239000004472 Lysine Substances 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- PCZOHLXUXFIOCF-UHFFFAOYSA-N Monacolin X Natural products C12C(OC(=O)C(C)CC)CC(C)C=C2C=CC(C)C1CCC1CC(O)CC(=O)O1 PCZOHLXUXFIOCF-UHFFFAOYSA-N 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- AYCPARAPKDAOEN-LJQANCHMSA-N N-[(1S)-2-(dimethylamino)-1-phenylethyl]-6,6-dimethyl-3-[(2-methyl-4-thieno[3,2-d]pyrimidinyl)amino]-1,4-dihydropyrrolo[3,4-c]pyrazole-5-carboxamide Chemical compound C1([C@H](NC(=O)N2C(C=3NN=C(NC=4C=5SC=CC=5N=C(C)N=4)C=3C2)(C)C)CN(C)C)=CC=CC=C1 AYCPARAPKDAOEN-LJQANCHMSA-N 0.000 description 1
- LVDRREOUMKACNJ-BKMJKUGQSA-N N-[(2R,3S)-2-(4-chlorophenyl)-1-(1,4-dimethyl-2-oxoquinolin-7-yl)-6-oxopiperidin-3-yl]-2-methylpropane-1-sulfonamide Chemical compound CC(C)CS(=O)(=O)N[C@H]1CCC(=O)N([C@@H]1c1ccc(Cl)cc1)c1ccc2c(C)cc(=O)n(C)c2c1 LVDRREOUMKACNJ-BKMJKUGQSA-N 0.000 description 1
- LIMFPAAAIVQRRD-BCGVJQADSA-N N-[2-[(3S,4R)-3-fluoro-4-methoxypiperidin-1-yl]pyrimidin-4-yl]-8-[(2R,3S)-2-methyl-3-(methylsulfonylmethyl)azetidin-1-yl]-5-propan-2-ylisoquinolin-3-amine Chemical compound F[C@H]1CN(CC[C@H]1OC)C1=NC=CC(=N1)NC=1N=CC2=C(C=CC(=C2C=1)C(C)C)N1[C@@H]([C@H](C1)CS(=O)(=O)C)C LIMFPAAAIVQRRD-BCGVJQADSA-N 0.000 description 1
- AVYVHIKSFXVDBG-UHFFFAOYSA-N N-benzyl-N-hydroxy-2,2-dimethylbutanamide Chemical compound C(C1=CC=CC=C1)N(C(C(CC)(C)C)=O)O AVYVHIKSFXVDBG-UHFFFAOYSA-N 0.000 description 1
- POFVJRKJJBFPII-UHFFFAOYSA-N N-cyclopentyl-5-[2-[[5-[(4-ethylpiperazin-1-yl)methyl]pyridin-2-yl]amino]-5-fluoropyrimidin-4-yl]-4-methyl-1,3-thiazol-2-amine Chemical compound C1(CCCC1)NC=1SC(=C(N=1)C)C1=NC(=NC=C1F)NC1=NC=C(C=C1)CN1CCN(CC1)CC POFVJRKJJBFPII-UHFFFAOYSA-N 0.000 description 1
- OPFJDXRVMFKJJO-ZHHKINOHSA-N N-{[3-(2-benzamido-4-methyl-1,3-thiazol-5-yl)-pyrazol-5-yl]carbonyl}-G-dR-G-dD-dD-dD-NH2 Chemical compound S1C(C=2NN=C(C=2)C(=O)NCC(=O)N[C@H](CCCN=C(N)N)C(=O)NCC(=O)N[C@H](CC(O)=O)C(=O)N[C@H](CC(O)=O)C(=O)N[C@H](CC(O)=O)C(N)=O)=C(C)N=C1NC(=O)C1=CC=CC=C1 OPFJDXRVMFKJJO-ZHHKINOHSA-N 0.000 description 1
- QOVYHDHLFPKQQG-NDEPHWFRSA-N N[C@@H](CCC(=O)N1CCC(CC1)NC1=C2C=CC=CC2=NC(NCC2=CN(CCCNCCCNC3CCCCC3)N=N2)=N1)C(O)=O Chemical compound N[C@@H](CCC(=O)N1CCC(CC1)NC1=C2C=CC=CC2=NC(NCC2=CN(CCCNCCCNC3CCCCC3)N=N2)=N1)C(O)=O QOVYHDHLFPKQQG-NDEPHWFRSA-N 0.000 description 1
- 108090000189 Neuropeptides Proteins 0.000 description 1
- 102000003797 Neuropeptides Human genes 0.000 description 1
- 101100281518 Neurospora crassa (strain ATCC 24698 / 74-OR23-1A / CBS 708.71 / DSM 1257 / FGSC 987) fox-2 gene Proteins 0.000 description 1
- 108091028043 Nucleic acid sequence Proteins 0.000 description 1
- CBENFWSGALASAD-UHFFFAOYSA-N Ozone Chemical compound [O-][O+]=O CBENFWSGALASAD-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- 241001494479 Pecora Species 0.000 description 1
- TUZYXOIXSAXUGO-UHFFFAOYSA-N Pravastatin Natural products C1=CC(C)C(CCC(O)CC(O)CC(O)=O)C2C(OC(=O)C(C)CC)CC(O)C=C21 TUZYXOIXSAXUGO-UHFFFAOYSA-N 0.000 description 1
- 201000004681 Psoriasis Diseases 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- 241000283984 Rodentia Species 0.000 description 1
- YASAKCUCGLMORW-UHFFFAOYSA-N Rosiglitazone Chemical compound C=1C=CC=NC=1N(C)CCOC(C=C1)=CC=C1CC1SC(=O)NC1=O YASAKCUCGLMORW-UHFFFAOYSA-N 0.000 description 1
- 229910019891 RuCl3 Inorganic materials 0.000 description 1
- RYMZZMVNJRMUDD-UHFFFAOYSA-N SJ000286063 Natural products C12C(OC(=O)C(C)(C)CC)CC(C)C=C2C=CC(C)C1CCC1CC(O)CC(=O)O1 RYMZZMVNJRMUDD-UHFFFAOYSA-N 0.000 description 1
- 244000000231 Sesamum indicum Species 0.000 description 1
- 229920001800 Shellac Polymers 0.000 description 1
- 229910018557 Si O Inorganic materials 0.000 description 1
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical compound [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 241000282887 Suidae Species 0.000 description 1
- 239000004809 Teflon Substances 0.000 description 1
- 229920006362 Teflon® Polymers 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 208000027418 Wounds and injury Diseases 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- JVVXZOOGOGPDRZ-SLFFLAALSA-N [(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methanamine Chemical compound NC[C@]1(C)CCC[C@]2(C)C3=CC=C(C(C)C)C=C3CC[C@H]21 JVVXZOOGOGPDRZ-SLFFLAALSA-N 0.000 description 1
- LJOOWESTVASNOG-UFJKPHDISA-N [(1s,3r,4ar,7s,8s,8as)-3-hydroxy-8-[2-[(4r)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,4,4a,7,8,8a-octahydronaphthalen-1-yl] (2s)-2-methylbutanoate Chemical compound C([C@H]1[C@@H](C)C=C[C@H]2C[C@@H](O)C[C@@H]([C@H]12)OC(=O)[C@@H](C)CC)CC1C[C@@H](O)CC(=O)O1 LJOOWESTVASNOG-UFJKPHDISA-N 0.000 description 1
- SPXSEZMVRJLHQG-XMMPIXPASA-N [(2R)-1-[[4-[(3-phenylmethoxyphenoxy)methyl]phenyl]methyl]pyrrolidin-2-yl]methanol Chemical compound C(C1=CC=CC=C1)OC=1C=C(OCC2=CC=C(CN3[C@H](CCC3)CO)C=C2)C=CC=1 SPXSEZMVRJLHQG-XMMPIXPASA-N 0.000 description 1
- DRBWRJPFNOBNIO-KOLCDFICSA-N [(2r)-1-[(2r)-2-(pyridine-4-carbonylamino)propanoyl]pyrrolidin-2-yl]boronic acid Chemical compound N([C@H](C)C(=O)N1[C@@H](CCC1)B(O)O)C(=O)C1=CC=NC=C1 DRBWRJPFNOBNIO-KOLCDFICSA-N 0.000 description 1
- LNUFLCYMSVYYNW-ZPJMAFJPSA-N [(2r,3r,4s,5r,6r)-2-[(2r,3r,4s,5r,6r)-6-[(2r,3r,4s,5r,6r)-6-[(2r,3r,4s,5r,6r)-6-[[(3s,5s,8r,9s,10s,13r,14s,17r)-10,13-dimethyl-17-[(2r)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1h-cyclopenta[a]phenanthren-3-yl]oxy]-4,5-disulfo Chemical compound O([C@@H]1[C@@H](COS(O)(=O)=O)O[C@@H]([C@@H]([C@H]1OS(O)(=O)=O)OS(O)(=O)=O)O[C@@H]1[C@@H](COS(O)(=O)=O)O[C@@H]([C@@H]([C@H]1OS(O)(=O)=O)OS(O)(=O)=O)O[C@@H]1[C@@H](COS(O)(=O)=O)O[C@H]([C@@H]([C@H]1OS(O)(=O)=O)OS(O)(=O)=O)O[C@@H]1C[C@@H]2CC[C@H]3[C@@H]4CC[C@@H]([C@]4(CC[C@@H]3[C@@]2(C)CC1)C)[C@H](C)CCCC(C)C)[C@H]1O[C@H](COS(O)(=O)=O)[C@@H](OS(O)(=O)=O)[C@H](OS(O)(=O)=O)[C@H]1OS(O)(=O)=O LNUFLCYMSVYYNW-ZPJMAFJPSA-N 0.000 description 1
- GUCGNPVNTKEXEI-RBUKOAKNSA-N [(2r,3s)-3-(4-phenoxyphenoxy)butan-2-yl] 4-methylbenzenesulfonate Chemical compound O([C@@H](C)[C@@H](C)OS(=O)(=O)C=1C=CC(C)=CC=1)C(C=C1)=CC=C1OC1=CC=CC=C1 GUCGNPVNTKEXEI-RBUKOAKNSA-N 0.000 description 1
- PSLUFJFHTBIXMW-WYEYVKMPSA-N [(3r,4ar,5s,6s,6as,10s,10ar,10bs)-3-ethenyl-10,10b-dihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-6-(2-pyridin-2-ylethylcarbamoyloxy)-5,6,6a,8,9,10-hexahydro-2h-benzo[f]chromen-5-yl] acetate Chemical compound O([C@@H]1[C@@H]([C@]2(O[C@](C)(CC(=O)[C@]2(O)[C@@]2(C)[C@@H](O)CCC(C)(C)[C@@H]21)C=C)C)OC(=O)C)C(=O)NCCC1=CC=CC=N1 PSLUFJFHTBIXMW-WYEYVKMPSA-N 0.000 description 1
- XMUZQOKACOLCSS-UHFFFAOYSA-N [2-(hydroxymethyl)phenyl]methanol Chemical compound OCC1=CC=CC=C1CO XMUZQOKACOLCSS-UHFFFAOYSA-N 0.000 description 1
- YWMLORGQOFONNT-UHFFFAOYSA-N [3-(hydroxymethyl)phenyl]methanol Chemical compound OCC1=CC=CC(CO)=C1 YWMLORGQOFONNT-UHFFFAOYSA-N 0.000 description 1
- PZRPBPMLSSNFOM-UHFFFAOYSA-N [4-(hydroxymethyl)phenyl]boronic acid Chemical compound OCC1=CC=C(B(O)O)C=C1 PZRPBPMLSSNFOM-UHFFFAOYSA-N 0.000 description 1
- PLJGRFOJXHUSSP-UHFFFAOYSA-N [5-(4-fluorophenyl)-2-hydroxyphenyl]-phenylmethanone Chemical compound OC1=CC=C(C=2C=CC(F)=CC=2)C=C1C(=O)C1=CC=CC=C1 PLJGRFOJXHUSSP-UHFFFAOYSA-N 0.000 description 1
- SMNRFWMNPDABKZ-WVALLCKVSA-N [[(2R,3S,4R,5S)-5-(2,6-dioxo-3H-pyridin-3-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [[[(2R,3S,4S,5R,6R)-4-fluoro-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl] hydrogen phosphate Chemical compound OC[C@H]1O[C@H](OP(O)(=O)OP(O)(=O)OP(O)(=O)OP(O)(=O)OC[C@H]2O[C@H]([C@H](O)[C@@H]2O)C2C=CC(=O)NC2=O)[C@H](O)[C@@H](F)[C@@H]1O SMNRFWMNPDABKZ-WVALLCKVSA-N 0.000 description 1
- 230000002159 abnormal effect Effects 0.000 description 1
- 229960002632 acarbose Drugs 0.000 description 1
- XUFXOAAUWZOOIT-UHFFFAOYSA-N acarviostatin I01 Natural products OC1C(O)C(NC2C(C(O)C(O)C(CO)=C2)O)C(C)OC1OC(C(C1O)O)C(CO)OC1OC1C(CO)OC(O)C(O)C1O XUFXOAAUWZOOIT-UHFFFAOYSA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 229960001466 acetohexamide Drugs 0.000 description 1
- VGZSUPCWNCWDAN-UHFFFAOYSA-N acetohexamide Chemical compound C1=CC(C(=O)C)=CC=C1S(=O)(=O)NC(=O)NC1CCCCC1 VGZSUPCWNCWDAN-UHFFFAOYSA-N 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 239000012042 active reagent Substances 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 210000001789 adipocyte Anatomy 0.000 description 1
- 239000000048 adrenergic agonist Substances 0.000 description 1
- 229940126157 adrenergic receptor agonist Drugs 0.000 description 1
- 125000003158 alcohol group Chemical group 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- QBYJBZPUGVGKQQ-SJJAEHHWSA-N aldrin Chemical compound C1[C@H]2C=C[C@@H]1[C@H]1[C@@](C3(Cl)Cl)(Cl)C(Cl)=C(Cl)[C@@]3(Cl)[C@H]12 QBYJBZPUGVGKQQ-SJJAEHHWSA-N 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 125000000746 allylic group Chemical group 0.000 description 1
- 239000003888 alpha glucosidase inhibitor Substances 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- UKFWSNCTAHXBQN-UHFFFAOYSA-N ammonium iodide Chemical compound [NH4+].[I-] UKFWSNCTAHXBQN-UHFFFAOYSA-N 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- HOPRXXXSABQWAV-UHFFFAOYSA-N anhydrous collidine Natural products CC1=CC=NC(C)=C1C HOPRXXXSABQWAV-UHFFFAOYSA-N 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- 229940127226 anticholesterol agent Drugs 0.000 description 1
- 239000003472 antidiabetic agent Substances 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 1
- 150000003934 aromatic aldehydes Chemical class 0.000 description 1
- 150000008378 aryl ethers Chemical class 0.000 description 1
- XRWSZZJLZRKHHD-WVWIJVSJSA-N asunaprevir Chemical compound O=C([C@@H]1C[C@H](CN1C(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C)OC1=NC=C(C2=CC=C(Cl)C=C21)OC)N[C@]1(C(=O)NS(=O)(=O)C2CC2)C[C@H]1C=C XRWSZZJLZRKHHD-WVWIJVSJSA-N 0.000 description 1
- 238000011914 asymmetric synthesis Methods 0.000 description 1
- 230000003143 atherosclerotic effect Effects 0.000 description 1
- OTKPPUXRIADSGD-PPRNARJGSA-N avoparcina Chemical compound O([C@@H]1C2=CC=C(C(=C2)Cl)OC=2C=C3C=C(C=2O[C@H]2C([C@@H](O)[C@H](O)[C@@H](CO)O2)O[C@@H]2O[C@@H](C)[C@H](O)[C@H](N)C2)OC2=CC=C(C=C2)[C@@H](O)[C@H](C(N[C@H](C(=O)N[C@H]3C(=O)N[C@H]2C(=O)N[C@@H]1C(N[C@@H](C1=CC(O)=CC(O)=C1C=1C(O)=CC=C2C=1)C(O)=O)=O)C=1C=CC(O)=CC=1)=O)NC(=O)[C@H](NC)C=1C=CC(O[C@H]2[C@@H]([C@H](O)[C@@H](O)[C@H](C)O2)O)=CC=1)[C@H]1C[C@@H](N)[C@@H](O)[C@H](C)O1 OTKPPUXRIADSGD-PPRNARJGSA-N 0.000 description 1
- 125000002393 azetidinyl group Chemical group 0.000 description 1
- 125000005604 azodicarboxylate group Chemical group 0.000 description 1
- JUHORIMYRDESRB-UHFFFAOYSA-N benzathine Chemical compound C=1C=CC=CC=1CNCCNCC1=CC=CC=C1 JUHORIMYRDESRB-UHFFFAOYSA-N 0.000 description 1
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 1
- 239000012965 benzophenone Substances 0.000 description 1
- 125000003354 benzotriazolyl group Chemical group N1N=NC2=C1C=CC=C2* 0.000 description 1
- 125000001743 benzylic group Chemical group 0.000 description 1
- 229940076810 beta sitosterol Drugs 0.000 description 1
- LGJMUZUPVCAVPU-UHFFFAOYSA-N beta-Sitostanol Natural products C1CC2CC(O)CCC2(C)C2C1C1CCC(C(C)CCC(CC)C(C)C)C1(C)CC2 LGJMUZUPVCAVPU-UHFFFAOYSA-N 0.000 description 1
- NJKOMDUNNDKEAI-UHFFFAOYSA-N beta-sitosterol Natural products CCC(CCC(C)C1CCC2(C)C3CC=C4CC(O)CCC4C3CCC12C)C(C)C NJKOMDUNNDKEAI-UHFFFAOYSA-N 0.000 description 1
- 229960000516 bezafibrate Drugs 0.000 description 1
- IIBYAHWJQTYFKB-UHFFFAOYSA-N bezafibrate Chemical compound C1=CC(OC(C)(C)C(O)=O)=CC=C1CCNC(=O)C1=CC=C(Cl)C=C1 IIBYAHWJQTYFKB-UHFFFAOYSA-N 0.000 description 1
- 150000005347 biaryls Chemical group 0.000 description 1
- MUALRAIOVNYAIW-UHFFFAOYSA-N binap Chemical group C1=CC=CC=C1P(C=1C(=C2C=CC=CC2=CC=1)C=1C2=CC=CC=C2C=CC=1P(C=1C=CC=CC=1)C=1C=CC=CC=1)C1=CC=CC=C1 MUALRAIOVNYAIW-UHFFFAOYSA-N 0.000 description 1
- YNHIGQDRGKUECZ-UHFFFAOYSA-L bis(triphenylphosphine)palladium(ii) dichloride Chemical compound [Cl-].[Cl-].[Pd+2].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 YNHIGQDRGKUECZ-UHFFFAOYSA-L 0.000 description 1
- 208000015294 blood coagulation disease Diseases 0.000 description 1
- 229910052792 caesium Inorganic materials 0.000 description 1
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical compound [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 1
- 235000013877 carbamide Nutrition 0.000 description 1
- 230000023852 carbohydrate metabolic process Effects 0.000 description 1
- 235000021256 carbohydrate metabolism Nutrition 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 229960004424 carbon dioxide Drugs 0.000 description 1
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 1
- MOIPGXQKZSZOQX-UHFFFAOYSA-N carbonyl bromide Chemical compound BrC(Br)=O MOIPGXQKZSZOQX-UHFFFAOYSA-N 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 230000004700 cellular uptake Effects 0.000 description 1
- GPUADMRJQVPIAS-QCVDVZFFSA-M cerivastatin sodium Chemical compound [Na+].COCC1=C(C(C)C)N=C(C(C)C)C(\C=C\[C@@H](O)C[C@@H](O)CC([O-])=O)=C1C1=CC=C(F)C=C1 GPUADMRJQVPIAS-QCVDVZFFSA-M 0.000 description 1
- 150000005829 chemical entities Chemical class 0.000 description 1
- 235000019693 cherries Nutrition 0.000 description 1
- 239000007958 cherry flavor Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- AOGYCOYQMAVAFD-UHFFFAOYSA-N chlorocarbonic acid Chemical class OC(Cl)=O AOGYCOYQMAVAFD-UHFFFAOYSA-N 0.000 description 1
- 229960001761 chlorpropamide Drugs 0.000 description 1
- 230000001906 cholesterol absorption Effects 0.000 description 1
- KMPWYEUPVWOPIM-KODHJQJWSA-N cinchonidine Chemical compound C1=CC=C2C([C@H]([C@H]3[N@]4CC[C@H]([C@H](C4)C=C)C3)O)=CC=NC2=C1 KMPWYEUPVWOPIM-KODHJQJWSA-N 0.000 description 1
- KMPWYEUPVWOPIM-UHFFFAOYSA-N cinchonidine Natural products C1=CC=C2C(C(C3N4CCC(C(C4)C=C)C3)O)=CC=NC2=C1 KMPWYEUPVWOPIM-UHFFFAOYSA-N 0.000 description 1
- LOUPRKONTZGTKE-UHFFFAOYSA-N cinchonine Natural products C1C(C(C2)C=C)CCN2C1C(O)C1=CC=NC2=CC=C(OC)C=C21 LOUPRKONTZGTKE-UHFFFAOYSA-N 0.000 description 1
- 229960002174 ciprofibrate Drugs 0.000 description 1
- KPSRODZRAIWAKH-UHFFFAOYSA-N ciprofibrate Chemical compound C1=CC(OC(C)(C)C(O)=O)=CC=C1C1C(Cl)(Cl)C1 KPSRODZRAIWAKH-UHFFFAOYSA-N 0.000 description 1
- 150000001860 citric acid derivatives Chemical class 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- GMRWGQCZJGVHKL-UHFFFAOYSA-N colestipol Chemical compound ClCC1CO1.NCCNCCNCCNCCN GMRWGQCZJGVHKL-UHFFFAOYSA-N 0.000 description 1
- 229960002604 colestipol Drugs 0.000 description 1
- UTBIMNXEDGNJFE-UHFFFAOYSA-N collidine Natural products CC1=CC=C(C)C(C)=N1 UTBIMNXEDGNJFE-UHFFFAOYSA-N 0.000 description 1
- 239000002299 complementary DNA Substances 0.000 description 1
- 229940125773 compound 10 Drugs 0.000 description 1
- 229940125797 compound 12 Drugs 0.000 description 1
- 229940126543 compound 14 Drugs 0.000 description 1
- 229940125758 compound 15 Drugs 0.000 description 1
- 229940126142 compound 16 Drugs 0.000 description 1
- 229940125782 compound 2 Drugs 0.000 description 1
- 229940125810 compound 20 Drugs 0.000 description 1
- 229940126086 compound 21 Drugs 0.000 description 1
- 229940126208 compound 22 Drugs 0.000 description 1
- 229940125833 compound 23 Drugs 0.000 description 1
- 229940125961 compound 24 Drugs 0.000 description 1
- 229940125846 compound 25 Drugs 0.000 description 1
- 229940125851 compound 27 Drugs 0.000 description 1
- 229940127204 compound 29 Drugs 0.000 description 1
- 229940126214 compound 3 Drugs 0.000 description 1
- 229940125877 compound 31 Drugs 0.000 description 1
- 229940125878 compound 36 Drugs 0.000 description 1
- 229940125807 compound 37 Drugs 0.000 description 1
- 229940127573 compound 38 Drugs 0.000 description 1
- 229940126540 compound 41 Drugs 0.000 description 1
- 229940125936 compound 42 Drugs 0.000 description 1
- 229940125844 compound 46 Drugs 0.000 description 1
- 229940127271 compound 49 Drugs 0.000 description 1
- 229940126545 compound 53 Drugs 0.000 description 1
- 229940127113 compound 57 Drugs 0.000 description 1
- 229940125900 compound 59 Drugs 0.000 description 1
- 229940126179 compound 72 Drugs 0.000 description 1
- 235000008504 concentrate Nutrition 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- NKNDPYCGAZPOFS-UHFFFAOYSA-M copper(i) bromide Chemical compound Br[Cu] NKNDPYCGAZPOFS-UHFFFAOYSA-M 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 239000013058 crude material Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- HPXRVTGHNJAIIH-UHFFFAOYSA-N cyclohexanol Chemical compound OC1CCCCC1 HPXRVTGHNJAIIH-UHFFFAOYSA-N 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 238000005661 deetherification reaction Methods 0.000 description 1
- 239000003405 delayed action preparation Substances 0.000 description 1
- 230000002939 deleterious effect Effects 0.000 description 1
- 229960004597 dexfenfluramine Drugs 0.000 description 1
- 235000019425 dextrin Nutrition 0.000 description 1
- 239000008121 dextrose Substances 0.000 description 1
- 125000004985 dialkyl amino alkyl group Chemical group 0.000 description 1
- MHDVGSVTJDSBDK-UHFFFAOYSA-N dibenzyl ether Chemical compound C=1C=CC=CC=1COCC1=CC=CC=C1 MHDVGSVTJDSBDK-UHFFFAOYSA-N 0.000 description 1
- NEFBYIFKOOEVPA-UHFFFAOYSA-K dicalcium phosphate Chemical compound [Ca+2].[Ca+2].[O-]P([O-])([O-])=O NEFBYIFKOOEVPA-UHFFFAOYSA-K 0.000 description 1
- 229910000390 dicalcium phosphate Inorganic materials 0.000 description 1
- 229940038472 dicalcium phosphate Drugs 0.000 description 1
- 235000019404 dichlorodifluoromethane Nutrition 0.000 description 1
- 229940087091 dichlorotetrafluoroethane Drugs 0.000 description 1
- 235000018823 dietary intake Nutrition 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- 238000000113 differential scanning calorimetry Methods 0.000 description 1
- 230000004069 differentiation Effects 0.000 description 1
- UXGNZZKBCMGWAZ-UHFFFAOYSA-N dimethylformamide dmf Chemical compound CN(C)C=O.CN(C)C=O UXGNZZKBCMGWAZ-UHFFFAOYSA-N 0.000 description 1
- BFXLJWUGRPGMFU-UHFFFAOYSA-N dipropoxyphosphinothioyl n,n-diethylcarbamodithioate;sulfane Chemical compound S.CCCOP(=S)(OCCC)SC(=S)N(CC)CC BFXLJWUGRPGMFU-UHFFFAOYSA-N 0.000 description 1
- 239000002612 dispersion medium Substances 0.000 description 1
- CNXMDTWQWLGCPE-UHFFFAOYSA-N ditert-butyl-(2-phenylphenyl)phosphane Chemical group CC(C)(C)P(C(C)(C)C)C1=CC=CC=C1C1=CC=CC=C1 CNXMDTWQWLGCPE-UHFFFAOYSA-N 0.000 description 1
- CETRZFQIITUQQL-UHFFFAOYSA-N dmso dimethylsulfoxide Chemical compound CS(C)=O.CS(C)=O CETRZFQIITUQQL-UHFFFAOYSA-N 0.000 description 1
- 229940112141 dry powder inhaler Drugs 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 239000012039 electrophile Substances 0.000 description 1
- 238000002330 electrospray ionisation mass spectrometry Methods 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- DFBKLUNHFCTMDC-GKRDHZSOSA-N endrin Chemical compound C([C@@H]1[C@H]2[C@@]3(Cl)C(Cl)=C([C@]([C@H]22)(Cl)C3(Cl)Cl)Cl)[C@@H]2[C@H]2[C@@H]1O2 DFBKLUNHFCTMDC-GKRDHZSOSA-N 0.000 description 1
- 239000007920 enema Substances 0.000 description 1
- 229940079360 enema for constipation Drugs 0.000 description 1
- JPGQOUSTVILISH-UHFFFAOYSA-N enflurane Chemical compound FC(F)OC(F)(F)C(F)Cl JPGQOUSTVILISH-UHFFFAOYSA-N 0.000 description 1
- 229950002375 englitazone Drugs 0.000 description 1
- BJXYHBKEQFQVES-NWDGAFQWSA-N enpatoran Chemical compound N[C@H]1CN(C[C@H](C1)C(F)(F)F)C1=C2C=CC=NC2=C(C=C1)C#N BJXYHBKEQFQVES-NWDGAFQWSA-N 0.000 description 1
- 230000002255 enzymatic effect Effects 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000005677 ethinylene group Chemical group [*:2]C#C[*:1] 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- LRMHFDNWKCSEQU-UHFFFAOYSA-N ethoxyethane;phenol Chemical compound CCOCC.OC1=CC=CC=C1 LRMHFDNWKCSEQU-UHFFFAOYSA-N 0.000 description 1
- IJZDQCHCEUGPKX-QMMMGPOBSA-N ethyl (2s)-2-(3-hydroxy-2-methoxyphenyl)propanoate Chemical compound CCOC(=O)[C@@H](C)C1=CC=CC(O)=C1OC IJZDQCHCEUGPKX-QMMMGPOBSA-N 0.000 description 1
- AHMUTRZLUUGNQA-ZDUSSCGKSA-N ethyl (2s)-3-(4-acetylphenyl)-2-methoxypropanoate Chemical compound CCOC(=O)[C@@H](OC)CC1=CC=C(C(C)=O)C=C1 AHMUTRZLUUGNQA-ZDUSSCGKSA-N 0.000 description 1
- CYWJYPOYJXDJAQ-ZDUSSCGKSA-N ethyl (2s)-3-(4-ethynylphenyl)-2-methoxypropanoate Chemical compound CCOC(=O)[C@@H](OC)CC1=CC=C(C#C)C=C1 CYWJYPOYJXDJAQ-ZDUSSCGKSA-N 0.000 description 1
- KJHUKECBCSRATP-KRWDZBQOSA-N ethyl (2s)-3-[4-(3-bromophenoxy)phenyl]-2-methoxypropanoate Chemical compound C1=CC(C[C@@H](C(=O)OCC)OC)=CC=C1OC1=CC=CC(Br)=C1 KJHUKECBCSRATP-KRWDZBQOSA-N 0.000 description 1
- RJXCZVGPGSTHJO-HNNXBMFYSA-N ethyl (2s)-3-[4-(4-hydroxybutyl)phenyl]-2-methoxypropanoate Chemical compound CCOC(=O)[C@@H](OC)CC1=CC=C(CCCCO)C=C1 RJXCZVGPGSTHJO-HNNXBMFYSA-N 0.000 description 1
- UIJVUWWTMRVHJA-SFHVURJKSA-N ethyl (2s)-3-[4-[4-(hydroxymethyl)phenyl]phenyl]-2-methoxypropanoate Chemical compound C1=CC(C[C@@H](C(=O)OCC)OC)=CC=C1C1=CC=C(CO)C=C1 UIJVUWWTMRVHJA-SFHVURJKSA-N 0.000 description 1
- MGFONKMXEQMPLI-UHFFFAOYSA-N ethyl 2-(3-hydroxyphenyl)-2-methoxypropanoate Chemical compound CCOC(=O)C(C)(OC)C1=CC=CC(O)=C1 MGFONKMXEQMPLI-UHFFFAOYSA-N 0.000 description 1
- NTJRCMPUTOCGHH-UHFFFAOYSA-N ethyl 2-(4-phenylphenoxy)acetate Chemical compound C1=CC(OCC(=O)OCC)=CC=C1C1=CC=CC=C1 NTJRCMPUTOCGHH-UHFFFAOYSA-N 0.000 description 1
- SFTYDROGLAWTKI-UHFFFAOYSA-N ethyl 3-(4-hydroxyphenyl)-2-methoxypropanoate Chemical compound CCOC(=O)C(OC)CC1=CC=C(O)C=C1 SFTYDROGLAWTKI-UHFFFAOYSA-N 0.000 description 1
- KNDYYZDNDTVNIQ-UHFFFAOYSA-N ethyl 3-[4-(4-hydroxybut-1-ynyl)phenyl]-2-methoxypropanoate Chemical compound CCOC(=O)C(OC)CC1=CC=C(C#CCCO)C=C1 KNDYYZDNDTVNIQ-UHFFFAOYSA-N 0.000 description 1
- GWNFQAKCJYEJEW-UHFFFAOYSA-N ethyl 3-[8-[[4-methyl-5-[(3-methyl-4-oxophthalazin-1-yl)methyl]-1,2,4-triazol-3-yl]sulfanyl]octanoylamino]benzoate Chemical compound CCOC(=O)C1=CC(NC(=O)CCCCCCCSC2=NN=C(CC3=NN(C)C(=O)C4=CC=CC=C34)N2C)=CC=C1 GWNFQAKCJYEJEW-UHFFFAOYSA-N 0.000 description 1
- 229960003501 etofibrate Drugs 0.000 description 1
- XXRVYAFBUDSLJX-UHFFFAOYSA-N etofibrate Chemical compound C=1C=CN=CC=1C(=O)OCCOC(=O)C(C)(C)OC1=CC=C(Cl)C=C1 XXRVYAFBUDSLJX-UHFFFAOYSA-N 0.000 description 1
- 239000010685 fatty oil Substances 0.000 description 1
- 229960001582 fenfluramine Drugs 0.000 description 1
- MQOBSOSZFYZQOK-UHFFFAOYSA-N fenofibric acid Chemical class C1=CC(OC(C)(C)C(O)=O)=CC=C1C(=O)C1=CC=C(Cl)C=C1 MQOBSOSZFYZQOK-UHFFFAOYSA-N 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 238000003818 flash chromatography Methods 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- YLQWCDOCJODRMT-UHFFFAOYSA-N fluoren-9-one Chemical compound C1=CC=C2C(=O)C3=CC=CC=C3C2=C1 YLQWCDOCJODRMT-UHFFFAOYSA-N 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 238000011010 flushing procedure Methods 0.000 description 1
- 229960003765 fluvastatin Drugs 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 235000012631 food intake Nutrition 0.000 description 1
- 235000010855 food raising agent Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-L fumarate(2-) Chemical class [O-]C(=O)\C=C\C([O-])=O VZCYOOQTPOCHFL-OWOJBTEDSA-L 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- ZJJXGWJIGJFDTL-UHFFFAOYSA-N glipizide Chemical compound C1=NC(C)=CN=C1C(=O)NCCC1=CC=C(S(=O)(=O)NC(=O)NC2CCCCC2)C=C1 ZJJXGWJIGJFDTL-UHFFFAOYSA-N 0.000 description 1
- 229960001381 glipizide Drugs 0.000 description 1
- 230000009229 glucose formation Effects 0.000 description 1
- 230000004153 glucose metabolism Effects 0.000 description 1
- 230000004190 glucose uptake Effects 0.000 description 1
- 235000013922 glutamic acid Nutrition 0.000 description 1
- 239000004220 glutamic acid Substances 0.000 description 1
- 125000005456 glyceride group Chemical group 0.000 description 1
- 229940096919 glycogen Drugs 0.000 description 1
- 230000036433 growing body Effects 0.000 description 1
- 230000012010 growth Effects 0.000 description 1
- JAXFJECJQZDFJS-XHEPKHHKSA-N gtpl8555 Chemical compound OC(=O)C[C@H](N)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C(C)C)C(=O)N1CCC[C@@H]1C(=O)N[C@H](B1O[C@@]2(C)[C@H]3C[C@H](C3(C)C)C[C@H]2O1)CCC1=CC=C(F)C=C1 JAXFJECJQZDFJS-XHEPKHHKSA-N 0.000 description 1
- 125000006161 haloaliphatic group Chemical group 0.000 description 1
- 231100000304 hepatotoxicity Toxicity 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 238000007327 hydrogenolysis reaction Methods 0.000 description 1
- 230000002209 hydrophobic effect Effects 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 150000001261 hydroxy acids Chemical class 0.000 description 1
- 229940126904 hypoglycaemic agent Drugs 0.000 description 1
- 230000002218 hypoglycaemic effect Effects 0.000 description 1
- 229940121380 ileal bile acid transporter inhibitor Drugs 0.000 description 1
- 125000002962 imidazol-1-yl group Chemical group [*]N1C([H])=NC([H])=C1[H] 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 238000002513 implantation Methods 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 238000011221 initial treatment Methods 0.000 description 1
- 208000014674 injury Diseases 0.000 description 1
- 230000010354 integration Effects 0.000 description 1
- 238000010255 intramuscular injection Methods 0.000 description 1
- 239000007927 intramuscular injection Substances 0.000 description 1
- 238000007912 intraperitoneal administration Methods 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 208000028867 ischemia Diseases 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- ZLVXBBHTMQJRSX-VMGNSXQWSA-N jdtic Chemical compound C1([C@]2(C)CCN(C[C@@H]2C)C[C@H](C(C)C)NC(=O)[C@@H]2NCC3=CC(O)=CC=C3C2)=CC=CC(O)=C1 ZLVXBBHTMQJRSX-VMGNSXQWSA-N 0.000 description 1
- 150000004715 keto acids Chemical class 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- XMGQYMWWDOXHJM-UHFFFAOYSA-N limonene Chemical compound CC(=C)C1CCC(C)=CC1 XMGQYMWWDOXHJM-UHFFFAOYSA-N 0.000 description 1
- 230000004130 lipolysis Effects 0.000 description 1
- 239000011344 liquid material Substances 0.000 description 1
- YNESATAKKCNGOF-UHFFFAOYSA-N lithium bis(trimethylsilyl)amide Chemical compound [Li+].C[Si](C)(C)[N-][Si](C)(C)C YNESATAKKCNGOF-UHFFFAOYSA-N 0.000 description 1
- 210000005229 liver cell Anatomy 0.000 description 1
- 210000005228 liver tissue Anatomy 0.000 description 1
- 230000007056 liver toxicity Effects 0.000 description 1
- RENRQMCACQEWFC-UGKGYDQZSA-N lnp023 Chemical compound C1([C@H]2N(CC=3C=4C=CNC=4C(C)=CC=3OC)CC[C@@H](C2)OCC)=CC=C(C(O)=O)C=C1 RENRQMCACQEWFC-UGKGYDQZSA-N 0.000 description 1
- 150000004668 long chain fatty acids Chemical class 0.000 description 1
- 229960004844 lovastatin Drugs 0.000 description 1
- PCZOHLXUXFIOCF-BXMDZJJMSA-N lovastatin Chemical compound C([C@H]1[C@@H](C)C=CC2=C[C@H](C)C[C@@H]([C@H]12)OC(=O)[C@@H](C)CC)C[C@@H]1C[C@@H](O)CC(=O)O1 PCZOHLXUXFIOCF-BXMDZJJMSA-N 0.000 description 1
- QLJODMDSTUBWDW-UHFFFAOYSA-N lovastatin hydroxy acid Natural products C1=CC(C)C(CCC(O)CC(O)CC(O)=O)C2C(OC(=O)C(C)CC)CC(C)C=C21 QLJODMDSTUBWDW-UHFFFAOYSA-N 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 239000002932 luster Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- 235000014380 magnesium carbonate Nutrition 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 235000009973 maize Nutrition 0.000 description 1
- 150000002688 maleic acid derivatives Chemical class 0.000 description 1
- 238000004949 mass spectrometry Methods 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 150000004667 medium chain fatty acids Chemical class 0.000 description 1
- 229940101209 mercuric oxide Drugs 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 239000002207 metabolite Substances 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-M methanesulfonate group Chemical class CS(=O)(=O)[O-] AFVFQIVMOAPDHO-UHFFFAOYSA-M 0.000 description 1
- HRDXJKGNWSUIBT-UHFFFAOYSA-N methoxybenzene Chemical group [CH2]OC1=CC=CC=C1 HRDXJKGNWSUIBT-UHFFFAOYSA-N 0.000 description 1
- VABBJJOSOCPYIT-UHFFFAOYSA-N methyl 2-methoxypropanoate Chemical compound COC(C)C(=O)OC VABBJJOSOCPYIT-UHFFFAOYSA-N 0.000 description 1
- OPJUTSGIUHUKTA-UHFFFAOYSA-N methyl 3-hydroxy-2-methoxy-3-(3-methoxy-4-phenylmethoxyphenyl)propanoate Chemical compound COC1=CC(C(O)C(OC)C(=O)OC)=CC=C1OCC1=CC=CC=C1 OPJUTSGIUHUKTA-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 235000010270 methyl p-hydroxybenzoate Nutrition 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 244000005700 microbiome Species 0.000 description 1
- 125000006203 morpholinoethyl group Chemical group [H]C([H])(*)C([H])([H])N1C([H])([H])C([H])([H])OC([H])([H])C1([H])[H] 0.000 description 1
- 125000002757 morpholinyl group Chemical group 0.000 description 1
- 210000000663 muscle cell Anatomy 0.000 description 1
- PEECTLLHENGOKU-UHFFFAOYSA-N n,n-dimethylpyridin-4-amine Chemical compound CN(C)C1=CC=NC=C1.CN(C)C1=CC=NC=C1 PEECTLLHENGOKU-UHFFFAOYSA-N 0.000 description 1
- YCJZWBZJSYLMPB-UHFFFAOYSA-N n-(2-chloropyrimidin-4-yl)-2,5-dimethyl-1-phenylimidazole-4-carboxamide Chemical compound CC=1N(C=2C=CC=CC=2)C(C)=NC=1C(=O)NC1=CC=NC(Cl)=N1 YCJZWBZJSYLMPB-UHFFFAOYSA-N 0.000 description 1
- IHCHOVVAJBADAH-UHFFFAOYSA-N n-[2-hydroxy-4-(1h-pyrazol-4-yl)phenyl]-6-methoxy-3,4-dihydro-2h-chromene-3-carboxamide Chemical compound C1C2=CC(OC)=CC=C2OCC1C(=O)NC(C(=C1)O)=CC=C1C=1C=NNC=1 IHCHOVVAJBADAH-UHFFFAOYSA-N 0.000 description 1
- YGBMCLDVRUGXOV-UHFFFAOYSA-N n-[6-[6-chloro-5-[(4-fluorophenyl)sulfonylamino]pyridin-3-yl]-1,3-benzothiazol-2-yl]acetamide Chemical compound C1=C2SC(NC(=O)C)=NC2=CC=C1C(C=1)=CN=C(Cl)C=1NS(=O)(=O)C1=CC=C(F)C=C1 YGBMCLDVRUGXOV-UHFFFAOYSA-N 0.000 description 1
- LPOIGVZLNWEGJG-UHFFFAOYSA-N n-benzyl-5-(4-methylpiperazin-1-yl)-2-nitroaniline Chemical compound C1CN(C)CCN1C1=CC=C([N+]([O-])=O)C(NCC=2C=CC=CC=2)=C1 LPOIGVZLNWEGJG-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- IOMMMLWIABWRKL-WUTDNEBXSA-N nazartinib Chemical compound C1N(C(=O)/C=C/CN(C)C)CCCC[C@H]1N1C2=C(Cl)C=CC=C2N=C1NC(=O)C1=CC=NC(C)=C1 IOMMMLWIABWRKL-WUTDNEBXSA-N 0.000 description 1
- PKWDZWYVIHVNKS-UHFFFAOYSA-N netoglitazone Chemical compound FC1=CC=CC=C1COC1=CC=C(C=C(CC2C(NC(=O)S2)=O)C=C2)C2=C1 PKWDZWYVIHVNKS-UHFFFAOYSA-N 0.000 description 1
- 125000000627 niacin group Chemical group 0.000 description 1
- 229960004738 nicotinyl alcohol Drugs 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 125000006574 non-aromatic ring group Chemical group 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 102000006255 nuclear receptors Human genes 0.000 description 1
- 229960001679 octinoxate Drugs 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- PIDFDZJZLOTZTM-KHVQSSSXSA-N ombitasvir Chemical compound COC(=O)N[C@@H](C(C)C)C(=O)N1CCC[C@H]1C(=O)NC1=CC=C([C@H]2N([C@@H](CC2)C=2C=CC(NC(=O)[C@H]3N(CCC3)C(=O)[C@@H](NC(=O)OC)C(C)C)=CC=2)C=2C=CC(=CC=2)C(C)(C)C)C=C1 PIDFDZJZLOTZTM-KHVQSSSXSA-N 0.000 description 1
- 239000007968 orange flavor Substances 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- AHLBNYSZXLDEJQ-FWEHEUNISA-N orlistat Chemical compound CCCCCCCCCCC[C@H](OC(=O)[C@H](CC(C)C)NC=O)C[C@@H]1OC(=O)[C@H]1CCCCCC AHLBNYSZXLDEJQ-FWEHEUNISA-N 0.000 description 1
- 229960001243 orlistat Drugs 0.000 description 1
- 235000010292 orthophenyl phenol Nutrition 0.000 description 1
- 201000008968 osteosarcoma Diseases 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- UQPUONNXJVWHRM-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 UQPUONNXJVWHRM-UHFFFAOYSA-N 0.000 description 1
- 210000000496 pancreas Anatomy 0.000 description 1
- 239000006072 paste Substances 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 239000001814 pectin Substances 0.000 description 1
- 229920001277 pectin Polymers 0.000 description 1
- 235000010987 pectin Nutrition 0.000 description 1
- RUOPINZRYMFPBF-UHFFFAOYSA-N pentane-1,3-diol Chemical compound CCC(O)CCO RUOPINZRYMFPBF-UHFFFAOYSA-N 0.000 description 1
- 210000002824 peroxisome Anatomy 0.000 description 1
- 239000008177 pharmaceutical agent Substances 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 125000001792 phenanthrenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3C=CC12)* 0.000 description 1
- KHUXNRRPPZOJPT-UHFFFAOYSA-N phenoxy radical Chemical compound O=C1C=C[CH]C=C1 KHUXNRRPPZOJPT-UHFFFAOYSA-N 0.000 description 1
- COLNVLDHVKWLRT-UHFFFAOYSA-N phenylalanine Natural products OC(=O)C(N)CC1=CC=CC=C1 COLNVLDHVKWLRT-UHFFFAOYSA-N 0.000 description 1
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 150000003904 phospholipids Chemical class 0.000 description 1
- XKJCHHZQLQNZHY-UHFFFAOYSA-N phthalimide Chemical compound C1=CC=C2C(=O)NC(=O)C2=C1 XKJCHHZQLQNZHY-UHFFFAOYSA-N 0.000 description 1
- 230000004962 physiological condition Effects 0.000 description 1
- 230000035479 physiological effects, processes and functions Effects 0.000 description 1
- 230000035790 physiological processes and functions Effects 0.000 description 1
- 229960005095 pioglitazone Drugs 0.000 description 1
- 125000003386 piperidinyl group Chemical group 0.000 description 1
- 229960005235 piperonyl butoxide Drugs 0.000 description 1
- 230000036470 plasma concentration Effects 0.000 description 1
- 230000004983 pleiotropic effect Effects 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229920005862 polyol Polymers 0.000 description 1
- 150000003077 polyols Chemical class 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- 238000000634 powder X-ray diffraction Methods 0.000 description 1
- 229960002965 pravastatin Drugs 0.000 description 1
- TUZYXOIXSAXUGO-PZAWKZKUSA-N pravastatin Chemical compound C1=C[C@H](C)[C@H](CC[C@@H](O)C[C@@H](O)CC(O)=O)[C@H]2[C@@H](OC(=O)[C@@H](C)CC)C[C@H](O)C=C21 TUZYXOIXSAXUGO-PZAWKZKUSA-N 0.000 description 1
- 230000002335 preservative effect Effects 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- FYPMFJGVHOHGLL-UHFFFAOYSA-N probucol Chemical compound C=1C(C(C)(C)C)=C(O)C(C(C)(C)C)=CC=1SC(C)(C)SC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 FYPMFJGVHOHGLL-UHFFFAOYSA-N 0.000 description 1
- 229960003912 probucol Drugs 0.000 description 1
- MFDFERRIHVXMIY-UHFFFAOYSA-N procaine Chemical compound CCN(CC)CCOC(=O)C1=CC=C(N)C=C1 MFDFERRIHVXMIY-UHFFFAOYSA-N 0.000 description 1
- 229960004919 procaine Drugs 0.000 description 1
- 230000035755 proliferation Effects 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- TVDSBUOJIPERQY-UHFFFAOYSA-N prop-2-yn-1-ol Chemical compound OCC#C TVDSBUOJIPERQY-UHFFFAOYSA-N 0.000 description 1
- 230000000069 prophylactic effect Effects 0.000 description 1
- 235000010232 propyl p-hydroxybenzoate Nutrition 0.000 description 1
- 150000003180 prostaglandins Chemical class 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 238000010926 purge Methods 0.000 description 1
- 239000008213 purified water Substances 0.000 description 1
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- 229960000948 quinine Drugs 0.000 description 1
- 230000002285 radioactive effect Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 230000004043 responsiveness Effects 0.000 description 1
- 238000010916 retrosynthetic analysis Methods 0.000 description 1
- 206010039073 rheumatoid arthritis Diseases 0.000 description 1
- 238000007142 ring opening reaction Methods 0.000 description 1
- 125000006413 ring segment Chemical group 0.000 description 1
- CVHZOJJKTDOEJC-UHFFFAOYSA-N saccharin Chemical compound C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-N 0.000 description 1
- 229940081974 saccharin Drugs 0.000 description 1
- 235000019204 saccharin Nutrition 0.000 description 1
- 239000000901 saccharin and its Na,K and Ca salt Substances 0.000 description 1
- 239000000523 sample Substances 0.000 description 1
- 238000003345 scintillation counting Methods 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 230000028327 secretion Effects 0.000 description 1
- 230000000276 sedentary effect Effects 0.000 description 1
- 239000012056 semi-solid material Substances 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000003352 sequestering agent Substances 0.000 description 1
- 239000008159 sesame oil Substances 0.000 description 1
- 235000011803 sesame oil Nutrition 0.000 description 1
- 239000004208 shellac Substances 0.000 description 1
- ZLGIYFNHBLSMPS-ATJNOEHPSA-N shellac Chemical compound OCCCCCC(O)C(O)CCCCCCCC(O)=O.C1C23[C@H](C(O)=O)CCC2[C@](C)(CO)[C@@H]1C(C(O)=O)=C[C@@H]3O ZLGIYFNHBLSMPS-ATJNOEHPSA-N 0.000 description 1
- 229940113147 shellac Drugs 0.000 description 1
- 235000013874 shellac Nutrition 0.000 description 1
- 229910000077 silane Inorganic materials 0.000 description 1
- LIVNPJMFVYWSIS-UHFFFAOYSA-N silicon monoxide Inorganic materials [Si-]#[O+] LIVNPJMFVYWSIS-UHFFFAOYSA-N 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 125000003808 silyl group Chemical group [H][Si]([H])([H])[*] 0.000 description 1
- XGVXKJKTISMIOW-ZDUSSCGKSA-N simurosertib Chemical compound N1N=CC(C=2SC=3C(=O)NC(=NC=3C=2)[C@H]2N3CCC(CC3)C2)=C1C XGVXKJKTISMIOW-ZDUSSCGKSA-N 0.000 description 1
- 229960002855 simvastatin Drugs 0.000 description 1
- RYMZZMVNJRMUDD-HGQWONQESA-N simvastatin Chemical compound C([C@H]1[C@@H](C)C=CC2=C[C@H](C)C[C@@H]([C@H]12)OC(=O)C(C)(C)CC)C[C@@H]1C[C@@H](O)CC(=O)O1 RYMZZMVNJRMUDD-HGQWONQESA-N 0.000 description 1
- KZJWDPNRJALLNS-VJSFXXLFSA-N sitosterol Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CC[C@@H](CC)C(C)C)[C@@]1(C)CC2 KZJWDPNRJALLNS-VJSFXXLFSA-N 0.000 description 1
- 229950005143 sitosterol Drugs 0.000 description 1
- 210000002027 skeletal muscle Anatomy 0.000 description 1
- 238000010583 slow cooling Methods 0.000 description 1
- WRIKHQLVHPKCJU-UHFFFAOYSA-N sodium bis(trimethylsilyl)amide Chemical compound C[Si](C)(C)N([Na])[Si](C)(C)C WRIKHQLVHPKCJU-UHFFFAOYSA-N 0.000 description 1
- KSAVQLQVUXSOCR-UHFFFAOYSA-M sodium lauroyl sarcosinate Chemical compound [Na+].CCCCCCCCCCCC(=O)N(C)CC([O-])=O KSAVQLQVUXSOCR-UHFFFAOYSA-M 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 238000003797 solvolysis reaction Methods 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 125000003011 styrenyl group Chemical group [H]\C(*)=C(/[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 125000005156 substituted alkylene group Chemical group 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 150000003900 succinic acid esters Chemical class 0.000 description 1
- YROXIXLRRCOBKF-UHFFFAOYSA-N sulfonylurea Chemical class OC(=N)N=S(=O)=O YROXIXLRRCOBKF-UHFFFAOYSA-N 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000002511 suppository base Substances 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- GFYHSKONPJXCDE-UHFFFAOYSA-N sym-collidine Natural products CC1=CN=C(C)C(C)=C1 GFYHSKONPJXCDE-UHFFFAOYSA-N 0.000 description 1
- 238000002626 targeted therapy Methods 0.000 description 1
- 150000003892 tartrate salts Chemical class 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000001981 tert-butyldimethylsilyl group Chemical group [H]C([H])([H])[Si]([H])(C([H])([H])[H])[*]C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- DZLFLBLQUQXARW-UHFFFAOYSA-N tetrabutylammonium Chemical compound CCCC[N+](CCCC)(CCCC)CCCC DZLFLBLQUQXARW-UHFFFAOYSA-N 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- WHRNULOCNSKMGB-UHFFFAOYSA-N tetrahydrofuran thf Chemical compound C1CCOC1.C1CCOC1 WHRNULOCNSKMGB-UHFFFAOYSA-N 0.000 description 1
- WROMPOXWARCANT-UHFFFAOYSA-N tfa trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.OC(=O)C(F)(F)F WROMPOXWARCANT-UHFFFAOYSA-N 0.000 description 1
- OUDSBRTVNLOZBN-UHFFFAOYSA-N tolazamide Chemical compound C1=CC(C)=CC=C1S(=O)(=O)NC(=O)NN1CCCCCC1 OUDSBRTVNLOZBN-UHFFFAOYSA-N 0.000 description 1
- 229960002277 tolazamide Drugs 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- CYRMSUTZVYGINF-UHFFFAOYSA-N trichlorofluoromethane Chemical compound FC(Cl)(Cl)Cl CYRMSUTZVYGINF-UHFFFAOYSA-N 0.000 description 1
- 229940029284 trichlorofluoromethane Drugs 0.000 description 1
- UFTFJSFQGQCHQW-UHFFFAOYSA-N triformin Chemical compound O=COCC(OC=O)COC=O UFTFJSFQGQCHQW-UHFFFAOYSA-N 0.000 description 1
- CWMFRHBXRUITQE-UHFFFAOYSA-N trimethylsilylacetylene Chemical group C[Si](C)(C)C#C CWMFRHBXRUITQE-UHFFFAOYSA-N 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- 125000003774 valeryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 238000012800 visualization Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
- 230000004584 weight gain Effects 0.000 description 1
- 235000019786 weight gain Nutrition 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/44—Iso-indoles; Hydrogenated iso-indoles
- C07D209/48—Iso-indoles; Hydrogenated iso-indoles with oxygen atoms in positions 1 and 3, e.g. phthalimide
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P1/00—Drugs for disorders of the alimentary tract or the digestive system
- A61P1/14—Prodigestives, e.g. acids, enzymes, appetite stimulants, antidyspeptics, tonics, antiflatulents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P15/00—Drugs for genital or sexual disorders; Contraceptives
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
- A61P3/04—Anorexiants; Antiobesity agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
- A61P3/06—Antihyperlipidemics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
- A61P3/08—Drugs for disorders of the metabolism for glucose homeostasis
- A61P3/10—Drugs for disorders of the metabolism for glucose homeostasis for hyperglycaemia, e.g. antidiabetics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/02—Non-specific cardiovascular stimulants, e.g. drugs for syncope, antihypotensives
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/04—Inotropic agents, i.e. stimulants of cardiac contraction; Drugs for heart failure
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/12—Antihypertensives
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C217/00—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton
- C07C217/02—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C217/04—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated
- C07C217/06—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one etherified hydroxy group and one amino group bound to the carbon skeleton, which is not further substituted
- C07C217/14—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one etherified hydroxy group and one amino group bound to the carbon skeleton, which is not further substituted the oxygen atom of the etherified hydroxy group being further bound to a carbon atom of a six-membered aromatic ring
- C07C217/18—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one etherified hydroxy group and one amino group bound to the carbon skeleton, which is not further substituted the oxygen atom of the etherified hydroxy group being further bound to a carbon atom of a six-membered aromatic ring the six-membered aromatic ring or condensed ring system containing that ring being further substituted
- C07C217/20—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one etherified hydroxy group and one amino group bound to the carbon skeleton, which is not further substituted the oxygen atom of the etherified hydroxy group being further bound to a carbon atom of a six-membered aromatic ring the six-membered aromatic ring or condensed ring system containing that ring being further substituted by halogen atoms, by trihalomethyl, nitro or nitroso groups, or by singly-bound oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C217/00—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton
- C07C217/78—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having amino groups and etherified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton
- C07C217/80—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having amino groups and etherified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton having amino groups and etherified hydroxy groups bound to carbon atoms of non-condensed six-membered aromatic rings
- C07C217/82—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having amino groups and etherified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton having amino groups and etherified hydroxy groups bound to carbon atoms of non-condensed six-membered aromatic rings of the same non-condensed six-membered aromatic ring
- C07C217/84—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having amino groups and etherified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton having amino groups and etherified hydroxy groups bound to carbon atoms of non-condensed six-membered aromatic rings of the same non-condensed six-membered aromatic ring the oxygen atom of at least one of the etherified hydroxy groups being further bound to an acyclic carbon atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C217/00—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton
- C07C217/78—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having amino groups and etherified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton
- C07C217/80—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having amino groups and etherified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton having amino groups and etherified hydroxy groups bound to carbon atoms of non-condensed six-membered aromatic rings
- C07C217/82—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having amino groups and etherified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton having amino groups and etherified hydroxy groups bound to carbon atoms of non-condensed six-membered aromatic rings of the same non-condensed six-membered aromatic ring
- C07C217/92—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having amino groups and etherified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton having amino groups and etherified hydroxy groups bound to carbon atoms of non-condensed six-membered aromatic rings of the same non-condensed six-membered aromatic ring the nitrogen atom of at least one of the amino groups being further bound to a carbon atom of a six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C219/00—Compounds containing amino and esterified hydroxy groups bound to the same carbon skeleton
- C07C219/02—Compounds containing amino and esterified hydroxy groups bound to the same carbon skeleton having esterified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C219/04—Compounds containing amino and esterified hydroxy groups bound to the same carbon skeleton having esterified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated
- C07C219/10—Compounds containing amino and esterified hydroxy groups bound to the same carbon skeleton having esterified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having at least one of the hydroxy groups esterified by a carboxylic acid having the esterifying carboxyl group bound to an acyclic carbon atom of a carbon skeleton containing rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
- C07C233/01—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C233/16—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by singly-bound oxygen atoms
- C07C233/24—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by singly-bound oxygen atoms with the substituted hydrocarbon radical bound to the nitrogen atom of the carboxamide group by a carbon atom of a six-membered aromatic ring
- C07C233/25—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by singly-bound oxygen atoms with the substituted hydrocarbon radical bound to the nitrogen atom of the carboxamide group by a carbon atom of a six-membered aromatic ring having the carbon atom of the carboxamide group bound to a hydrogen atom or to a carbon atom of an acyclic saturated carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
- C07C233/01—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C233/16—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by singly-bound oxygen atoms
- C07C233/24—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by singly-bound oxygen atoms with the substituted hydrocarbon radical bound to the nitrogen atom of the carboxamide group by a carbon atom of a six-membered aromatic ring
- C07C233/29—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by singly-bound oxygen atoms with the substituted hydrocarbon radical bound to the nitrogen atom of the carboxamide group by a carbon atom of a six-membered aromatic ring having the carbon atom of the carboxamide group bound to an acyclic carbon atom of a carbon skeleton containing six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
- C07C233/57—Carboxylic acid amides having carbon atoms of carboxamide groups bound to carbon atoms of rings other than six-membered aromatic rings
- C07C233/60—Carboxylic acid amides having carbon atoms of carboxamide groups bound to carbon atoms of rings other than six-membered aromatic rings having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by singly-bound oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
- C07C233/64—Carboxylic acid amides having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings
- C07C233/67—Carboxylic acid amides having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by singly-bound oxygen atoms
- C07C233/75—Carboxylic acid amides having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by singly-bound oxygen atoms with the substituted hydrocarbon radical bound to the nitrogen atom of the carboxamide group by a carbon atom of a six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C235/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms
- C07C235/42—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton
- C07C235/44—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton with carbon atoms of carboxamide groups and singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring
- C07C235/56—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton with carbon atoms of carboxamide groups and singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C235/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms
- C07C235/42—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton
- C07C235/44—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton with carbon atoms of carboxamide groups and singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring
- C07C235/58—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton with carbon atoms of carboxamide groups and singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring with carbon atoms of carboxamide groups and singly-bound oxygen atoms, bound in ortho-position to carbon atoms of the same non-condensed six-membered aromatic ring
- C07C235/64—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton with carbon atoms of carboxamide groups and singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring with carbon atoms of carboxamide groups and singly-bound oxygen atoms, bound in ortho-position to carbon atoms of the same non-condensed six-membered aromatic ring having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C239/00—Compounds containing nitrogen-to-halogen bonds; Hydroxylamino compounds or ethers or esters thereof
- C07C239/08—Hydroxylamino compounds or their ethers or esters
- C07C239/12—Hydroxylamino compounds or their ethers or esters having nitrogen atoms of hydroxylamino groups further bound to carbon atoms of hydrocarbon radicals substituted by singly-bound oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
- C07C255/49—Carboxylic acid nitriles having cyano groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C255/54—Carboxylic acid nitriles having cyano groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton containing cyano groups and etherified hydroxy groups bound to the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/58—Unsaturated compounds containing ether groups, groups, groups, or groups
- C07C59/64—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings
- C07C59/66—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings the non-carboxylic part of the ether containing six-membered aromatic rings
- C07C59/68—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings the non-carboxylic part of the ether containing six-membered aromatic rings the oxygen atom of the ether group being bound to a non-condensed six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/58—Unsaturated compounds containing ether groups, groups, groups, or groups
- C07C59/72—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings and other rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/76—Unsaturated compounds containing keto groups
- C07C59/90—Unsaturated compounds containing keto groups containing singly bound oxygen-containing groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/08—Indoles; Hydrogenated indoles with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, directly attached to carbon atoms of the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/28—Radicals substituted by singly-bound oxygen or sulphur atoms
- C07D213/30—Oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/12—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D215/14—Radicals substituted by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/02—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with only hydrogen atoms or radicals containing only carbon and hydrogen atoms, directly attached to carbon atoms of the nitrogen-containing ring; Alkylene-bis-isoquinolines
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/56—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D257/00—Heterocyclic compounds containing rings having four nitrogen atoms as the only ring hetero atoms
- C07D257/02—Heterocyclic compounds containing rings having four nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D257/04—Five-membered rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/60—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings condensed with carbocyclic rings or ring systems
- C07D277/62—Benzothiazoles
- C07D277/64—Benzothiazoles with only hydrocarbon or substituted hydrocarbon radicals attached in position 2
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/08—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms
- C07D295/096—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms separated by carbocyclic rings or by carbon chains interrupted by carbocyclic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/10—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by doubly bound oxygen or sulphur atoms
- C07D295/112—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by doubly bound oxygen or sulphur atoms with the ring nitrogen atoms and the doubly bound oxygen or sulfur atoms separated by carbocyclic rings or by carbon chains interrupted by carbocyclic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/16—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms
- C07D295/18—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms by radicals derived from carboxylic acids, or sulfur or nitrogen analogues thereof
- C07D295/182—Radicals derived from carboxylic acids
- C07D295/185—Radicals derived from carboxylic acids from aliphatic carboxylic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/78—Benzo [b] furans; Hydrogenated benzo [b] furans
- C07D307/79—Benzo [b] furans; Hydrogenated benzo [b] furans with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to carbon atoms of the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/78—Benzo [b] furans; Hydrogenated benzo [b] furans
- C07D307/82—Benzo [b] furans; Hydrogenated benzo [b] furans with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to carbon atoms of the hetero ring
- C07D307/83—Oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/91—Dibenzofurans; Hydrogenated dibenzofurans
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/93—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems condensed with a ring other than six-membered
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/04—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring
- C07D311/22—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 4
- C07D311/26—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 4 with aromatic rings attached in position 2 or 3
- C07D311/28—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 4 with aromatic rings attached in position 2 or 3 with aromatic rings attached in position 2 only
- C07D311/30—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 4 with aromatic rings attached in position 2 or 3 with aromatic rings attached in position 2 only not hydrogenated in the hetero ring, e.g. flavones
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/10—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 not condensed with other rings
- C07D317/14—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 not condensed with other rings with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D317/18—Radicals substituted by singly bound oxygen or sulfur atoms
- C07D317/20—Free hydroxyl or mercaptan
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/10—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 not condensed with other rings
- C07D317/14—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 not condensed with other rings with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D317/18—Radicals substituted by singly bound oxygen or sulfur atoms
- C07D317/22—Radicals substituted by singly bound oxygen or sulfur atoms etherified
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/44—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D317/46—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems condensed with one six-membered ring
- C07D317/48—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring
- C07D317/50—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to atoms of the carbocyclic ring
- C07D317/54—Radicals substituted by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/44—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D317/46—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems condensed with one six-membered ring
- C07D317/48—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring
- C07D317/62—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to atoms of the carbocyclic ring
- C07D317/64—Oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/14—Radicals substituted by singly bound hetero atoms other than halogen
- C07D333/16—Radicals substituted by singly bound hetero atoms other than halogen by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/50—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom condensed with carbocyclic rings or ring systems
- C07D333/76—Dibenzothiophenes
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D335/00—Heterocyclic compounds containing six-membered rings having one sulfur atom as the only ring hetero atom
- C07D335/02—Heterocyclic compounds containing six-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/06—Systems containing only non-condensed rings with a five-membered ring
- C07C2601/08—Systems containing only non-condensed rings with a five-membered ring the ring being saturated
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Engineering & Computer Science (AREA)
- General Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Public Health (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Veterinary Medicine (AREA)
- Pharmacology & Pharmacy (AREA)
- Cardiology (AREA)
- Diabetes (AREA)
- Heart & Thoracic Surgery (AREA)
- Obesity (AREA)
- Hematology (AREA)
- Endocrinology (AREA)
- Emergency Medicine (AREA)
- Hospice & Palliative Care (AREA)
- Child & Adolescent Psychology (AREA)
- Reproductive Health (AREA)
- Nutrition Science (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Other In-Based Heterocyclic Compounds (AREA)
- Steroid Compounds (AREA)
- Indole Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Quinoline Compounds (AREA)
- Electrochromic Elements, Electrophoresis, Or Variable Reflection Or Absorption Elements (AREA)
- Furan Compounds (AREA)
- Pyridine Compounds (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
- Heterocyclic Compounds That Contain Two Or More Ring Oxygen Atoms (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US29714401P | 2001-06-07 | 2001-06-07 | |
| US60/297,144 | 2001-06-07 | ||
| PCT/US2002/016950 WO2002100813A2 (en) | 2001-06-07 | 2002-05-30 | Modulators of peroxisome proliferator activated receptors |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA2449256A1 true CA2449256A1 (en) | 2002-12-19 |
Family
ID=23145037
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA002449256A Abandoned CA2449256A1 (en) | 2001-06-07 | 2002-05-30 | Modulators of peroxisome proliferator activated receptors |
Country Status (24)
| Country | Link |
|---|---|
| US (2) | US7192982B2 (https=) |
| EP (1) | EP1392637A2 (https=) |
| JP (1) | JP2005509590A (https=) |
| KR (1) | KR20040012905A (https=) |
| CN (1) | CN1543451A (https=) |
| AR (1) | AR036084A1 (https=) |
| BR (1) | BR0210190A (https=) |
| CA (1) | CA2449256A1 (https=) |
| CO (1) | CO5640097A2 (https=) |
| CZ (1) | CZ20033309A3 (https=) |
| EA (1) | EA200400010A1 (https=) |
| EC (1) | ECSP034877A (https=) |
| EE (1) | EE200400001A (https=) |
| HR (1) | HRP20031001A2 (https=) |
| HU (1) | HUP0400280A3 (https=) |
| IL (1) | IL158873A0 (https=) |
| MX (1) | MXPA03011201A (https=) |
| NO (1) | NO20035439D0 (https=) |
| NZ (1) | NZ529351A (https=) |
| PE (1) | PE20030099A1 (https=) |
| PL (1) | PL368051A1 (https=) |
| SK (1) | SK14912003A3 (https=) |
| WO (1) | WO2002100813A2 (https=) |
| ZA (1) | ZA200308863B (https=) |
Families Citing this family (58)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EA200400011A1 (ru) | 2001-06-07 | 2004-06-24 | Эли Лилли Энд Компани | Модуляторы рецепторов, активируемых пролифераторами пероксисом (prar) |
| MXPA03011201A (es) * | 2001-06-07 | 2004-02-26 | Lilly Co Eli | Moduladores de receptores activados por proliferadores de persoxisomas. |
| MXPA03011558A (es) * | 2001-06-12 | 2004-03-26 | Wellstat Therapeutics Corp | Compuestos para el tratamiento de desordenes metabolicos. |
| ITRM20020016A1 (it) * | 2002-01-15 | 2003-07-15 | Sigma Tau Ind Farmaceuti | Derivati di acidi fenil(alchil)carbossilici e derivati fenilalchileterociclici dionici, loro uso come medicamenti ad attivita' ipoglicemizza |
| PL376736A1 (pl) * | 2002-11-25 | 2006-01-09 | Galderma Research & Development, S.N.C. | Nowe związki diaromatyczne, które aktywują receptor typu PPAR<$Egamma> i ich zastosowanie w kompozycjach kosmetycznych lub farmaceutycznych |
| FR2847580B1 (fr) * | 2002-11-25 | 2006-03-03 | Galderma Res & Dev | NOUVEAUX COMPOSES BI-AROMATIQUES ACTIVATEURS DES RECEPTEURS DE TYPE PPARy ET LEUR UTILISATION DANS DES COMPOSITIONS COSMETIQUES OU PHARMACEUTIQUES |
| US7192970B2 (en) * | 2002-11-26 | 2007-03-20 | Chipscreen Biosciences, Ltd. | Noncyclic 1,3-dicarbonyl compounds as dual PPAR agonists with potent antihyperglycemic and antihyperlipidemic activity |
| CN1751037A (zh) | 2003-02-14 | 2006-03-22 | 伊莱利利公司 | 作为ppar调节剂的磺酰胺衍生物 |
| GB0314075D0 (en) * | 2003-06-18 | 2003-07-23 | Astrazeneca Ab | Therapeutic agents |
| WO2005009104A2 (en) * | 2003-07-16 | 2005-02-03 | Ligand Pharmacueticals Incorporated | Benzoic and phenyl acetic acid derivatives as hnf-4 modulators |
| JP2007502815A (ja) * | 2003-08-20 | 2007-02-15 | イーライ リリー アンド カンパニー | Ppar調節因子 |
| EP1667964B1 (en) | 2003-09-19 | 2009-07-22 | Janssen Pharmaceutica N.V. | 4-((phenoxyalkyl)thio)-phenoxyacetic acids and analogs |
| EP1675814A1 (en) * | 2003-10-14 | 2006-07-05 | Eli Lilly And Company | Phenoxyether derivatives as ppar modulators |
| JP4074616B2 (ja) * | 2003-12-25 | 2008-04-09 | 武田薬品工業株式会社 | 3−(4−ベンジルオキシフェニル)プロパン酸誘導体 |
| AU2004309271A1 (en) | 2003-12-25 | 2005-07-14 | Takeda Pharmaceutical Company Limited | 3-(4-benzyloxyphenyl)propanoic acid derivatives |
| US7262318B2 (en) * | 2004-03-10 | 2007-08-28 | Pfizer, Inc. | Substituted heteroaryl- and phenylsulfamoyl compounds |
| BRPI0510803A (pt) * | 2004-05-12 | 2007-11-06 | Proteotech Inc | composto, composição farmacêutica, artigo de fabricação, métodos de tratar ou prevenir a formação, deposição, acúmulo ou persistência de fibrilas de amilóide e de fibrilas de sinucleìna, e de tratar, prevenir ou melhorar um ou mais sintomas de uma doença amilóide ou uma sinucleinopatia em um mamìfero, e, uso do composto |
| FR2872159B1 (fr) * | 2004-06-28 | 2007-10-05 | Merck Sante Soc Par Actions Si | Nouveaux derives acides carboxyliques phenyliques et leur utilisation dans le traitement du diabete |
| US20050288340A1 (en) * | 2004-06-29 | 2005-12-29 | Pfizer Inc | Substituted heteroaryl- and phenylsulfamoyl compounds |
| TW200608967A (en) | 2004-07-29 | 2006-03-16 | Sankyo Co | Pharmaceutical compositions containing with diabetic agent |
| US7622491B2 (en) * | 2004-08-13 | 2009-11-24 | Metabolex Inc. | Modulators of PPAR and methods of their preparation |
| US7405236B2 (en) * | 2004-08-16 | 2008-07-29 | Hoffman-La Roche Inc. | Indole derivatives comprising an acetylene group |
| CN101014332A (zh) * | 2004-09-13 | 2007-08-08 | 参天制药株式会社 | 角膜结膜病变治疗剂 |
| MY147518A (en) | 2004-09-15 | 2012-12-31 | Janssen Pharmaceutica Nv | 4-((phenoxyalkyl)thio)-phenoxyacetic acids and analogs |
| MY145712A (en) * | 2004-09-15 | 2012-03-30 | Janssen Pharmaceutica Nv | 4-((phenoxyalkyl)thio)-phenoxyacetic acids and analogs |
| US7635779B2 (en) * | 2004-10-15 | 2009-12-22 | Council Of Scientific & Industrial Research | Oxy substituted flavones as antihyperglycemic and antidyslipidemic agents |
| FR2882359A1 (fr) * | 2005-02-24 | 2006-08-25 | Negma Lerads Soc Par Actions S | Derives activateurs de ppar, procede de preparation et application en therapeutique |
| JO3006B1 (ar) * | 2005-09-14 | 2016-09-05 | Janssen Pharmaceutica Nv | املاح ليسين مبتكرة من مشتقات حامض 4-((فينوكسي الكيل)ثيو) فينوكسي الخليك |
| KR20080106455A (ko) * | 2006-03-31 | 2008-12-05 | 웰스태트 테러퓨틱스 코포레이션 | 대사장애의 조합치료 |
| UY30288A1 (es) | 2006-04-18 | 2007-08-31 | Janssen Pharmaceutica Nv | Derivados del ácido benzoazepin-oxi-acético como agonistas de ppar-delta usados para aumentar hdl-c. reducir ldl-c y reducir colesterol |
| JP2010502670A (ja) | 2006-09-07 | 2010-01-28 | ニコメッド ゲゼルシャフト ミット ベシュレンクテル ハフツング | 真性糖尿病のための組合せ治療 |
| CN102114076B (zh) * | 2006-10-25 | 2013-04-10 | 中国科学院上海生命科学研究院 | 肉桂提取物的制备方法、肉桂提取物、其组合物以及用途 |
| ES2465216T3 (es) | 2007-06-04 | 2014-06-05 | Ben Gurion University Of The Negev Research And Development Authority | Compuestos de triarilo y composiciones que comprenden los mismos |
| JP5496913B2 (ja) * | 2008-01-15 | 2014-05-21 | ウェルスタット セラピューティクス コーポレイション | 代謝異常の治療のための化合物 |
| US20090238900A1 (en) * | 2008-03-24 | 2009-09-24 | Himalaya Global Holdings Limited | Novel anti-diabetic herbal composition, method for preparing the same and use thereof |
| JP5436941B2 (ja) * | 2009-06-03 | 2014-03-05 | あすか製薬株式会社 | ラクタム化合物又はその塩及びppar活性化剤 |
| AU2011281134B2 (en) * | 2010-07-23 | 2015-05-14 | Connexios Life Sciences Pvt. Ltd. | Agonists of GPR40 |
| RU2015140066A (ru) | 2013-02-22 | 2017-03-30 | Мерк Шарп И Доум Корп. | Противодиабетические бициклические соединения |
| CR20160207A (es) | 2013-11-05 | 2016-08-10 | Ben Gurion Univ Of The Negev Res And Dev Authority | Compuestos para el tratamiento de la diabetes y las complicaciones que surgen de la misma enfermedad |
| CN105037290A (zh) * | 2015-07-14 | 2015-11-11 | 佛山市赛维斯医药科技有限公司 | 一类含苯并异恶唑和腈基苯类结构化合物及其用途 |
| CN104974103A (zh) * | 2015-07-14 | 2015-10-14 | 佛山市赛维斯医药科技有限公司 | 一类含苯并异恶唑和烷氧苯基类结构的化合物及其用途 |
| CN104961702A (zh) * | 2015-07-14 | 2015-10-07 | 佛山市赛维斯医药科技有限公司 | 苯并异恶唑类11β-HSD1抑制剂、制备方法及其用途 |
| CN104926742A (zh) * | 2015-07-14 | 2015-09-23 | 佛山市赛维斯医药科技有限公司 | 一类含苯并异恶唑和硝基苯基类结构的化合物及其用途 |
| CN104987314A (zh) * | 2015-07-14 | 2015-10-21 | 佛山市赛维斯医药科技有限公司 | 含苯并异恶唑和末端硝基苄基类结构的化合物及其用途 |
| CN104926746A (zh) * | 2015-07-14 | 2015-09-23 | 佛山市赛维斯医药科技有限公司 | 含苯并异恶唑和末端胺基苄基类结构的化合物及其用途 |
| CN105001174A (zh) * | 2015-07-14 | 2015-10-28 | 佛山市赛维斯医药科技有限公司 | 含苯并异恶唑和末端腈基苄基类结构的化合物及其用途 |
| CN104926744A (zh) * | 2015-07-14 | 2015-09-23 | 佛山市赛维斯医药科技有限公司 | 一类含苯并异恶唑和末端苄基类结构的化合物及其用途 |
| CN104945344A (zh) * | 2015-07-14 | 2015-09-30 | 佛山市赛维斯医药科技有限公司 | 一类含苯并异恶唑和末端胺基结构化合物及其用途 |
| CN104926743A (zh) * | 2015-07-14 | 2015-09-23 | 佛山市赛维斯医药科技有限公司 | 含苯并异恶唑和末端苄基类结构的化合物及其用途 |
| CN104961703A (zh) * | 2015-07-14 | 2015-10-07 | 佛山市赛维斯医药科技有限公司 | 一类苯并异恶唑类11β-HSD1抑制剂、制备方法及其用途 |
| CN104926745A (zh) * | 2015-07-14 | 2015-09-23 | 佛山市赛维斯医药科技有限公司 | 含苯并异恶唑和末端卤代苄基类结构的化合物及其用途 |
| MX2020003242A (es) | 2017-09-22 | 2020-09-18 | Jubilant Epipad LLC | Compuestos heterociclicos como inhibidores de pad. |
| AU2018352142B2 (en) | 2017-10-18 | 2022-08-25 | Jubilant Epipad LLC | Imidazo-pyridine compounds as PAD inhibitors |
| KR20200085836A (ko) | 2017-11-06 | 2020-07-15 | 주빌런트 프로델 엘엘씨 | Pd1/pd-l1 활성화 억제제로서의 피리미딘 유도체 |
| BR112020010322A2 (pt) | 2017-11-24 | 2020-11-17 | Jubilant Episcribe Llc | composto da fórmula i; composto da fórmula ia; composto da fórmula ib; processo de preparação de compostos da fórmula i; composição farmacêutica; método para o tratamento e/ou prevenção de várias doenças; uso dos compostos; método para o tratamento de câncer; e método para o tratamento e/ou prevenção de uma afecção mediada por prmt5 ou um distúrbio proliferativo ou câncer |
| SG11202008950PA (en) | 2018-03-13 | 2020-10-29 | Jubilant Prodel LLC | Bicyclic compounds as inhibitors of pd1/pd-l1 interaction/activation |
| SG11202107614PA (en) | 2019-01-18 | 2021-08-30 | Astrazeneca Ab | Pcsk9 inhibitors and methods of use thereof |
| WO2025079680A1 (ja) * | 2023-10-13 | 2025-04-17 | 国立研究開発法人国立精神・神経医療研究センター | 神経保護剤 |
Family Cites Families (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5089514A (en) | 1990-06-14 | 1992-02-18 | Pfizer Inc. | 3-coxazolyl [phenyl, chromanyl or benzofuranyl]-2-hydroxypropionic acid derivatives and analogs as hypoglycemic agents |
| PH30449A (en) * | 1991-11-25 | 1997-05-28 | Lilly Co Eli | Substituted phenyl phenol leukotriene antagonists |
| US5232945A (en) | 1992-07-20 | 1993-08-03 | Pfizer Inc. | 3-aryl-2-hydroxypropionic acid derivatives and analogs as antihypertensives |
| US5387672A (en) * | 1993-03-02 | 1995-02-07 | The University Of Maryland At Baltimore | Hemoglobin intramolecularly cross-linked withlong chain divalent reagents |
| EP0743064A1 (en) * | 1995-05-17 | 1996-11-20 | Eli Lilly And Company | Leukotriene antagonists for use in the treatment or prevention of alzheimer's disease |
| JP3964478B2 (ja) | 1995-06-30 | 2007-08-22 | エーザイ・アール・アンド・ディー・マネジメント株式会社 | ヘテロ環含有カルボン酸誘導体及びそれを含有する医薬 |
| GB9604242D0 (en) * | 1996-02-28 | 1996-05-01 | Glaxo Wellcome Inc | Chemical compounds |
| EP0903343B1 (en) | 1997-09-19 | 2003-05-28 | SSP Co., Ltd. | Alpha-Substituted phenylpropionic acid derivative and medicine containing the same |
| AU749505B2 (en) | 1997-10-27 | 2002-06-27 | Dr. Reddy's Laboratories Limited | Novel tricyclic compounds and their use in medicine; process for their preparation and pharmaceutical compositions containing them |
| ATE451346T1 (de) | 1998-03-10 | 2009-12-15 | Ono Pharmaceutical Co | Carbonsäurederivate und medikamente die diese als aktiven wirkstoff enthalten |
| SE9801992D0 (sv) | 1998-06-04 | 1998-06-04 | Astra Ab | New 3-aryl-2-hydroxypropionic acid derivative I |
| SE9801990D0 (sv) | 1998-06-04 | 1998-06-04 | Astra Ab | New 3-aryl propionic acid derivatives and analogs |
| DE60005973T2 (de) * | 1999-08-27 | 2004-05-13 | Eli Lilly And Co., Indianapolis | Biaryl-oxa(thia)zolderivate und ihre verwendung als ppars modulatoren |
| TWI262185B (en) | 1999-10-01 | 2006-09-21 | Eisai Co Ltd | Carboxylic acid derivatives having anti-hyperglycemia and anti-hyperlipemia action, and pharmaceutical composition containing the derivatives |
| AU2001248279A1 (en) * | 2000-04-17 | 2001-10-30 | Novo-Nordisk A/S | New compounds, their preparation and use |
| EP1313717B1 (en) * | 2000-08-23 | 2007-10-17 | Eli Lilly And Company | Oxazolyl-arylpropionic acid derivatives and their use as ppar agonists |
| KR100659679B1 (ko) | 2000-09-01 | 2006-12-21 | 에자이 가부시키가이샤 | 1-벤질-4-[(5,6-디메톡시-2-플루오로-1-인다논)-2-일]메틸피페리딘 |
| JPWO2002080899A1 (ja) * | 2001-03-30 | 2005-01-06 | エーザイ株式会社 | 消化器疾患治療剤 |
| TWI311133B (en) * | 2001-04-20 | 2009-06-21 | Eisai R&D Man Co Ltd | Carboxylic acid derivativeand the salt thereof |
| MXPA03011201A (es) * | 2001-06-07 | 2004-02-26 | Lilly Co Eli | Moduladores de receptores activados por proliferadores de persoxisomas. |
-
2002
- 2002-05-30 MX MXPA03011201A patent/MXPA03011201A/es unknown
- 2002-05-30 NZ NZ529351A patent/NZ529351A/en unknown
- 2002-05-30 BR BR0210190-4A patent/BR0210190A/pt not_active IP Right Cessation
- 2002-05-30 EA EA200400010A patent/EA200400010A1/ru unknown
- 2002-05-30 SK SK1491-2003A patent/SK14912003A3/sk not_active Application Discontinuation
- 2002-05-30 PL PL02368051A patent/PL368051A1/xx not_active Application Discontinuation
- 2002-05-30 JP JP2003503584A patent/JP2005509590A/ja active Pending
- 2002-05-30 CZ CZ20033309A patent/CZ20033309A3/cs unknown
- 2002-05-30 EE EEP200400001A patent/EE200400001A/xx unknown
- 2002-05-30 IL IL15887302A patent/IL158873A0/xx unknown
- 2002-05-30 HU HU0400280A patent/HUP0400280A3/hu unknown
- 2002-05-30 US US10/479,262 patent/US7192982B2/en not_active Expired - Fee Related
- 2002-05-30 CN CNA028115309A patent/CN1543451A/zh active Pending
- 2002-05-30 WO PCT/US2002/016950 patent/WO2002100813A2/en not_active Ceased
- 2002-05-30 EP EP02739503A patent/EP1392637A2/en not_active Withdrawn
- 2002-05-30 KR KR10-2003-7016050A patent/KR20040012905A/ko not_active Withdrawn
- 2002-05-30 CA CA002449256A patent/CA2449256A1/en not_active Abandoned
- 2002-05-30 HR HR20031001A patent/HRP20031001A2/hr not_active Application Discontinuation
- 2002-06-06 AR ARP020102096A patent/AR036084A1/es not_active Application Discontinuation
- 2002-06-07 PE PE2002000484A patent/PE20030099A1/es not_active Application Discontinuation
-
2003
- 2003-11-13 ZA ZA200308863A patent/ZA200308863B/en unknown
- 2003-12-04 EC EC2003004877A patent/ECSP034877A/es unknown
- 2003-12-05 NO NO20035439A patent/NO20035439D0/no not_active Application Discontinuation
- 2003-12-05 CO CO03107407A patent/CO5640097A2/es not_active Application Discontinuation
-
2006
- 2006-12-11 US US11/637,223 patent/US20070276138A1/en not_active Abandoned
Also Published As
| Publication number | Publication date |
|---|---|
| IL158873A0 (en) | 2004-05-12 |
| HRP20031001A2 (en) | 2004-06-30 |
| CO5640097A2 (es) | 2006-05-31 |
| WO2002100813A2 (en) | 2002-12-19 |
| US7192982B2 (en) | 2007-03-20 |
| NO20035439D0 (no) | 2003-12-05 |
| EP1392637A2 (en) | 2004-03-03 |
| JP2005509590A (ja) | 2005-04-14 |
| AR036084A1 (es) | 2004-08-11 |
| EA200400010A1 (ru) | 2004-06-24 |
| BR0210190A (pt) | 2004-04-06 |
| US20050020684A1 (en) | 2005-01-27 |
| CN1543451A (zh) | 2004-11-03 |
| WO2002100813A3 (en) | 2003-11-27 |
| EE200400001A (et) | 2004-02-16 |
| HUP0400280A3 (en) | 2006-01-30 |
| ECSP034877A (es) | 2004-01-28 |
| PE20030099A1 (es) | 2003-04-08 |
| SK14912003A3 (sk) | 2004-09-08 |
| CZ20033309A3 (cs) | 2004-05-12 |
| NZ529351A (en) | 2006-01-27 |
| PL368051A1 (en) | 2005-03-21 |
| HUP0400280A2 (hu) | 2005-01-28 |
| KR20040012905A (ko) | 2004-02-11 |
| US20070276138A1 (en) | 2007-11-29 |
| MXPA03011201A (es) | 2004-02-26 |
| ZA200308863B (en) | 2005-02-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA2449256A1 (en) | Modulators of peroxisome proliferator activated receptors | |
| JP2005509590A6 (ja) | ペルオキシソーム増殖因子活性化受容体の調節物質 | |
| DE60205481T2 (de) | Furan and thiophen-derivate die menschliche peroxisome proliferator aktivierte rezeptoren aktivieren | |
| ES2288982T3 (es) | Derivados de acido oxazolil-ariloxiacetico y su uso como agonistas ppar. | |
| EP1206457B1 (en) | Biaryl-oxa(thia)zole derivatives and their use as ppars modulators | |
| US6214877B1 (en) | 2,3,5-substituted biphenyls useful in the treatment of insulin resistance and hyperglycemia | |
| CA2547212A1 (en) | Peroxisome proliferator activated receptor modulators | |
| EP0351194B1 (en) | Thiazole derivatives having a 5-lipoxygenase-inhibiting activity | |
| JP2007502815A (ja) | Ppar調節因子 | |
| WO2005037763A1 (en) | Phenoxyether derivatives as ppar modulators | |
| AU2003241579B9 (en) | Amide linker peroxisome proliferator activated receptor modulators | |
| EP1742902B1 (en) | Hexenoic acid derivatives, processes for the preparation thereof, pharmaceutical compositions comprising them, and therapeutic applications thereof | |
| EP1742927B1 (en) | Butanoic acid derivatives, processes for the preparation thereof, pharmaceutical compositions comprising them, and therapeutic applications threreof | |
| AU2002312147A1 (en) | Modulators of peroxisome proliferator activated receptors | |
| MX2008008098A (en) | Phenoxy acetic acids as ppar delta activators |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| FZDE | Discontinued |