CA1158418A - Process for producing hydrogen peroxide - Google Patents
Process for producing hydrogen peroxideInfo
- Publication number
- CA1158418A CA1158418A CA000381918A CA381918A CA1158418A CA 1158418 A CA1158418 A CA 1158418A CA 000381918 A CA000381918 A CA 000381918A CA 381918 A CA381918 A CA 381918A CA 1158418 A CA1158418 A CA 1158418A
- Authority
- CA
- Canada
- Prior art keywords
- urea
- methyl
- phenyl
- radical
- alkyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims abstract description 46
- 230000008569 process Effects 0.000 title claims abstract description 46
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 title claims abstract description 26
- 150000003672 ureas Chemical class 0.000 claims abstract description 25
- 239000002904 solvent Substances 0.000 claims abstract description 19
- 230000003647 oxidation Effects 0.000 claims abstract description 17
- 238000007254 oxidation reaction Methods 0.000 claims abstract description 17
- PYKYMHQGRFAEBM-UHFFFAOYSA-N anthraquinone Natural products CCC(=O)c1c(O)c2C(=O)C3C(C=CC=C3O)C(=O)c2cc1CC(=O)OC PYKYMHQGRFAEBM-UHFFFAOYSA-N 0.000 claims abstract description 16
- 150000004056 anthraquinones Chemical class 0.000 claims abstract description 16
- 229910052757 nitrogen Inorganic materials 0.000 claims abstract description 16
- 125000003118 aryl group Chemical group 0.000 claims abstract description 12
- 125000004433 nitrogen atom Chemical group N* 0.000 claims abstract description 8
- 239000011877 solvent mixture Substances 0.000 claims abstract description 7
- 125000001424 substituent group Chemical group 0.000 claims abstract description 3
- -1 alkyl radical Chemical class 0.000 claims description 27
- 239000004202 carbamide Substances 0.000 claims description 27
- 125000004432 carbon atom Chemical group C* 0.000 claims description 14
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 13
- 150000003254 radicals Chemical class 0.000 claims description 12
- 125000000217 alkyl group Chemical group 0.000 claims description 11
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 9
- 238000006243 chemical reaction Methods 0.000 claims description 8
- IEEBJIUHVRNCHY-UHFFFAOYSA-N 1,1-dibutyl-3-methyl-3-phenylurea Chemical compound CCCCN(CCCC)C(=O)N(C)C1=CC=CC=C1 IEEBJIUHVRNCHY-UHFFFAOYSA-N 0.000 claims description 7
- LRPCKERCLLMBQT-UHFFFAOYSA-N 1-methyl-1-phenyl-3,3-dipropylurea Chemical compound CCCN(CCC)C(=O)N(C)C1=CC=CC=C1 LRPCKERCLLMBQT-UHFFFAOYSA-N 0.000 claims description 7
- YTZKOQUCBOVLHL-UHFFFAOYSA-N tert-butylbenzene Chemical compound CC(C)(C)C1=CC=CC=C1 YTZKOQUCBOVLHL-UHFFFAOYSA-N 0.000 claims description 6
- 150000004996 alkyl benzenes Chemical class 0.000 claims description 5
- QPUYECUOLPXSFR-UHFFFAOYSA-N 1-methylnaphthalene Chemical compound C1=CC=C2C(C)=CC=CC2=C1 QPUYECUOLPXSFR-UHFFFAOYSA-N 0.000 claims description 4
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 claims description 4
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Natural products CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 4
- 239000008096 xylene Substances 0.000 claims description 4
- KWYHDKDOAIKMQN-UHFFFAOYSA-N N,N,N',N'-tetramethylethylenediamine Chemical compound CN(C)CCN(C)C KWYHDKDOAIKMQN-UHFFFAOYSA-N 0.000 claims description 3
- DMCQBGNXRVPLRT-UHFFFAOYSA-N 1-butan-2-yl-1,3-dimethyl-3-phenylurea Chemical compound CCC(C)N(C)C(=O)N(C)C1=CC=CC=C1 DMCQBGNXRVPLRT-UHFFFAOYSA-N 0.000 claims description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 claims description 2
- 150000005840 aryl radicals Chemical class 0.000 claims description 2
- 125000005842 heteroatom Chemical group 0.000 claims description 2
- 239000004215 Carbon black (E152) Substances 0.000 claims 3
- 229930195733 hydrocarbon Natural products 0.000 claims 3
- 150000002430 hydrocarbons Chemical class 0.000 claims 3
- 229960002163 hydrogen peroxide Drugs 0.000 claims 2
- VOPPZIKVDDHMMG-UHFFFAOYSA-N 1,1,3-tributyl-3-phenylurea Chemical compound CCCCN(CCCC)C(=O)N(CCCC)C1=CC=CC=C1 VOPPZIKVDDHMMG-UHFFFAOYSA-N 0.000 claims 1
- TTZPPHVMXXHUBH-UHFFFAOYSA-N 1,1,3-trimethyl-3-phenylurea Chemical compound CN(C)C(=O)N(C)C1=CC=CC=C1 TTZPPHVMXXHUBH-UHFFFAOYSA-N 0.000 claims 1
- SMHSXUILUNIYJZ-UHFFFAOYSA-N 1,1-diethyl-3-methyl-3-phenylurea Chemical compound CCN(CC)C(=O)N(C)C1=CC=CC=C1 SMHSXUILUNIYJZ-UHFFFAOYSA-N 0.000 claims 1
- RZVHIXYEVGDQDX-UHFFFAOYSA-N 9,10-anthraquinone Chemical compound C1=CC=C2C(=O)C3=CC=CC=C3C(=O)C2=C1 RZVHIXYEVGDQDX-UHFFFAOYSA-N 0.000 claims 1
- 235000013877 carbamide Nutrition 0.000 abstract description 43
- 238000004519 manufacturing process Methods 0.000 abstract description 7
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 30
- AZQWKYJCGOJGHM-UHFFFAOYSA-N 1,4-benzoquinone Chemical compound O=C1C=CC(=O)C=C1 AZQWKYJCGOJGHM-UHFFFAOYSA-N 0.000 description 22
- 239000000243 solution Substances 0.000 description 19
- 229960004337 hydroquinone Drugs 0.000 description 15
- 239000000203 mixture Substances 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 150000002978 peroxides Chemical class 0.000 description 5
- JQVDAXLFBXTEQA-UHFFFAOYSA-N dibutylamine Chemical compound CCCCNCCCC JQVDAXLFBXTEQA-UHFFFAOYSA-N 0.000 description 4
- 238000000605 extraction Methods 0.000 description 4
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 4
- 229910052760 oxygen Inorganic materials 0.000 description 4
- PCFMUWBCZZUMRX-UHFFFAOYSA-N 9,10-Dihydroxyanthracene Chemical compound C1=CC=C2C(O)=C(C=CC=C3)C3=C(O)C2=C1 PCFMUWBCZZUMRX-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 230000009471 action Effects 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 238000010525 oxidative degradation reaction Methods 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- KXGCGPZBOPCNDE-UHFFFAOYSA-N 1,1-dibutyl-3,3-diethylurea Chemical compound CCCCN(CCCC)C(=O)N(CC)CC KXGCGPZBOPCNDE-UHFFFAOYSA-N 0.000 description 2
- OTBHDFWQZHPNPU-UHFFFAOYSA-N 1,2,3,4-tetrahydroanthracene-9,10-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1CCCC2 OTBHDFWQZHPNPU-UHFFFAOYSA-N 0.000 description 2
- YEVQZPWSVWZAOB-UHFFFAOYSA-N 2-(bromomethyl)-1-iodo-4-(trifluoromethyl)benzene Chemical class FC(F)(F)C1=CC=C(I)C(CBr)=C1 YEVQZPWSVWZAOB-UHFFFAOYSA-N 0.000 description 2
- SJEBAWHUJDUKQK-UHFFFAOYSA-N 2-ethylanthraquinone Chemical compound C1=CC=C2C(=O)C3=CC(CC)=CC=C3C(=O)C2=C1 SJEBAWHUJDUKQK-UHFFFAOYSA-N 0.000 description 2
- HTSABYAWKQAHBT-UHFFFAOYSA-N 3-methylcyclohexanol Chemical compound CC1CCCC(O)C1 HTSABYAWKQAHBT-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methylaniline Chemical compound CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 230000008859 change Effects 0.000 description 2
- 230000000875 corresponding effect Effects 0.000 description 2
- 230000007423 decrease Effects 0.000 description 2
- 238000005516 engineering process Methods 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 125000000687 hydroquinonyl group Chemical group C1(O)=C(C=C(O)C=C1)* 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- AVQQQNCBBIEMEU-UHFFFAOYSA-N 1,1,3,3-tetramethylurea Chemical compound CN(C)C(=O)N(C)C AVQQQNCBBIEMEU-UHFFFAOYSA-N 0.000 description 1
- YOXCKIZJVVDVET-UHFFFAOYSA-N 1,1-dimethyl-3,3-dipropylurea Chemical compound CCCN(CCC)C(=O)N(C)C YOXCKIZJVVDVET-UHFFFAOYSA-N 0.000 description 1
- JIXBPULJZBURNU-UHFFFAOYSA-N 1-methyl-1-phenyl-3,3-di(propan-2-yl)urea Chemical compound CC(C)N(C(C)C)C(=O)N(C)C1=CC=CC=C1 JIXBPULJZBURNU-UHFFFAOYSA-N 0.000 description 1
- INPHIYULSHLAHR-UHFFFAOYSA-N 1-pentylanthracene-9,10-dione Chemical class O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2CCCCC INPHIYULSHLAHR-UHFFFAOYSA-N 0.000 description 1
- LHXPKFQYXZREQC-UHFFFAOYSA-N 3-phenyl-1,1-dipropylurea Chemical compound CCCN(CCC)C(=O)NC1=CC=CC=C1 LHXPKFQYXZREQC-UHFFFAOYSA-N 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 235000006708 antioxidants Nutrition 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- HQEBLWOYYQPAQH-UHFFFAOYSA-N benzene (1-methylcyclohexyl) acetate Chemical compound C(C)(=O)OC1(CCCCC1)C.C1=CC=CC=C1 HQEBLWOYYQPAQH-UHFFFAOYSA-N 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 239000007857 degradation product Substances 0.000 description 1
- 229940043279 diisopropylamine Drugs 0.000 description 1
- 229910001882 dioxygen Inorganic materials 0.000 description 1
- 239000000374 eutectic mixture Substances 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- TWXDDNPPQUTEOV-FVGYRXGTSA-N methamphetamine hydrochloride Chemical compound Cl.CN[C@@H](C)CC1=CC=CC=C1 TWXDDNPPQUTEOV-FVGYRXGTSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- ZCXOSDRICFIHTA-UHFFFAOYSA-N n-methylaniline;hydrochloride Chemical compound [Cl-].C[NH2+]C1=CC=CC=C1 ZCXOSDRICFIHTA-UHFFFAOYSA-N 0.000 description 1
- 229910000510 noble metal Inorganic materials 0.000 description 1
- FCBBRODPXVPZAH-UHFFFAOYSA-N nonan-5-ol Chemical compound CCCCC(O)CCCC FCBBRODPXVPZAH-UHFFFAOYSA-N 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- UEZVMMHDMIWARA-UHFFFAOYSA-M phosphonate Chemical class [O-]P(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-M 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 125000004151 quinonyl group Chemical group 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 229940086542 triethylamine Drugs 0.000 description 1
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B15/00—Peroxides; Peroxyhydrates; Peroxyacids or salts thereof; Superoxides; Ozonides
- C01B15/01—Hydrogen peroxide
- C01B15/022—Preparation from organic compounds
- C01B15/023—Preparation from organic compounds by the alkyl-anthraquinone process
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CA000435928A CA1204749A (en) | 1980-07-18 | 1983-09-01 | Process for producing hydrogen peroxide |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEP3027253.8-42 | 1980-07-18 | ||
| DE3027253A DE3027253C2 (de) | 1980-07-18 | 1980-07-18 | Verfahren zur Herstellung von Wasserstoffperoxid |
Related Child Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000435928A Division CA1204749A (en) | 1980-07-18 | 1983-09-01 | Process for producing hydrogen peroxide |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1158418A true CA1158418A (en) | 1983-12-13 |
Family
ID=6107520
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000381918A Expired CA1158418A (en) | 1980-07-18 | 1981-07-16 | Process for producing hydrogen peroxide |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US4349526A (cg-RX-API-DMAC7.html) |
| EP (1) | EP0044480B1 (cg-RX-API-DMAC7.html) |
| JP (1) | JPS5756305A (cg-RX-API-DMAC7.html) |
| AR (1) | AR226471A1 (cg-RX-API-DMAC7.html) |
| AT (1) | ATE7011T1 (cg-RX-API-DMAC7.html) |
| BR (1) | BR8104597A (cg-RX-API-DMAC7.html) |
| CA (1) | CA1158418A (cg-RX-API-DMAC7.html) |
| DD (1) | DD202856A5 (cg-RX-API-DMAC7.html) |
| DE (2) | DE3027253C2 (cg-RX-API-DMAC7.html) |
| ES (1) | ES8301451A1 (cg-RX-API-DMAC7.html) |
| IN (1) | IN154788B (cg-RX-API-DMAC7.html) |
| PL (1) | PL127149B1 (cg-RX-API-DMAC7.html) |
| TR (1) | TR20967A (cg-RX-API-DMAC7.html) |
| ZA (1) | ZA814807B (cg-RX-API-DMAC7.html) |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4473579A (en) * | 1982-01-26 | 1984-09-25 | American Cyanamid Company | Antiatherosclerotic tetrasubstituted ureas and thioureas |
| US4394369A (en) * | 1982-05-24 | 1983-07-19 | Fmc Corporation | Hydrogen peroxide process |
| US4782071A (en) * | 1986-11-03 | 1988-11-01 | Warner-Lambert Company | Tetrasubstituted urea cholinergic agents |
| SE459919C (sv) * | 1987-03-27 | 1991-03-25 | Eka Nobel Ab | Foerfarande foer framstaellning av vaeteperoxid genom reduktion och oxidation av en antrakinon |
| FR2614015B1 (fr) * | 1987-04-16 | 1989-07-13 | Atochem | Procede de production cyclique de peroxyde d'hydrogene |
| US5374339A (en) * | 1993-10-14 | 1994-12-20 | Guillet; James E. | Production of hydrogen peroxide |
| US5624543A (en) * | 1995-08-01 | 1997-04-29 | Peroxco Incorporated | Aqueous phase production of hydrogen peroxide and catalysts for use therein |
| US6802972B1 (en) | 1999-01-29 | 2004-10-12 | Mykrolis Corporation | Microporous hollow fiber membranes from perfluorinated thermoplastic polymers |
| DE60140939D1 (de) * | 2000-06-19 | 2010-02-11 | Akzo Nobel Nv | Nd darin verwendete zusammensetzung |
| CN102173391B (zh) * | 2011-01-15 | 2013-06-12 | 王继华 | Pa触媒在三组份溶剂组成的工作液下生产H2O2的方法 |
| SE540100C2 (en) * | 2016-12-29 | 2018-03-27 | Eb Nuberg Ab | Aromatic solvent for hydrogen peroxide production |
| EP3543208A1 (en) | 2018-03-19 | 2019-09-25 | Solvay Sa | Process for manufacturing an aqueous hydrogen peroxide solution |
Family Cites Families (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA565053A (en) * | 1958-10-21 | Kabisch Gerhard | Process for preparation of hydrogen peroxide | |
| DE888840C (de) * | 1949-11-05 | 1953-09-03 | Du Pont | Verfahren zur Herstellung von Wasserstoffperoxyd |
| US2655534A (en) * | 1951-10-25 | 1953-10-13 | Du Pont | Preparation of n-aromatic-n'-aliphatic hydrocarbon ureas |
| DE953790C (de) | 1953-07-01 | 1956-12-06 | Laporte Chemical | Verfahren zur Herstellung von Wasserstoffperoxyd |
| BE531024A (cg-RX-API-DMAC7.html) | 1953-08-11 | 1900-01-01 | ||
| DE963150C (de) | 1954-10-21 | 1957-05-02 | Laporte Chemical | Verfahren zur Herstellung von Wasserstoffperoxyd |
| US2975033A (en) * | 1956-11-24 | 1961-03-14 | Fmc Corp | Process for preparation of hydrogen peroxide |
| GB864884A (en) | 1956-11-24 | 1961-04-12 | Fmc Corp | Process for the preparation of hydrogen peroxide |
| DE1261838B (de) | 1963-09-03 | 1968-02-29 | Degussa | Verfahren zur Herstellung von Wasserstoffperoxyd |
| DE1914739U (de) | 1965-03-06 | 1965-04-29 | Ewald Ridder | Schneidvorrichtung fuer bratwurst od. dgl. |
| NL170124C (nl) * | 1970-04-18 | 1982-10-01 | Degussa | Werkwijze ter bereiding van waterstofperoxyde volgens het antrachinonprocede; werkwijze voor het bereiden van een viervoudig gesubstitueerd ureum. |
| DE2065155C3 (de) * | 1970-04-18 | 1975-03-27 | Deutsche Gold- Und Silber-Scheideanstalt Vormals Roessler, 6000 Frankfurt | N.N-Diäthyl-N'.N'-di-n-butylharnstoff und seine Verwendung |
| DE2104432C3 (de) | 1971-01-30 | 1973-11-22 | Deutsche Gold- Und Silber-Scheideanstalt Vormals Roessler, 6000 Frankfurt | Verfahren zur Herstellung von Wasser stoflfperoxid nach dem Anthrachinonver fahren |
| NL171693C (nl) * | 1971-05-21 | 1983-05-02 | Degussa | Werkwijze voor het overbrengen van waterstofperoxyde uit een waterige oplossing in een dampvormig of vloeibaar mengsel met organische verbindingen. |
| US4046868A (en) * | 1973-09-26 | 1977-09-06 | E. I. Du Pont De Nemours And Company | Production of hydrogen peroxide |
| DE2532819C3 (de) * | 1975-07-23 | 1978-10-05 | Deutsche Gold- Und Silber-Scheideanstalt Vormals Roessler, 6000 Frankfurt | Verfahren zur Herstellung von Wasserstoffperoxid |
-
1980
- 1980-07-18 DE DE3027253A patent/DE3027253C2/de not_active Expired
-
1981
- 1981-06-25 IN IN684/CAL/81A patent/IN154788B/en unknown
- 1981-07-02 TR TR20967A patent/TR20967A/xx unknown
- 1981-07-09 ES ES503800A patent/ES8301451A1/es not_active Expired
- 1981-07-10 AT AT81105386T patent/ATE7011T1/de not_active IP Right Cessation
- 1981-07-10 EP EP81105386A patent/EP0044480B1/de not_active Expired
- 1981-07-10 DE DE8181105386T patent/DE3163071D1/de not_active Expired
- 1981-07-14 ZA ZA814807A patent/ZA814807B/xx unknown
- 1981-07-14 US US06/283,194 patent/US4349526A/en not_active Expired - Fee Related
- 1981-07-15 AR AR286105A patent/AR226471A1/es active
- 1981-07-15 DD DD81231803A patent/DD202856A5/de unknown
- 1981-07-16 CA CA000381918A patent/CA1158418A/en not_active Expired
- 1981-07-17 JP JP56110955A patent/JPS5756305A/ja active Pending
- 1981-07-17 PL PL1981232262A patent/PL127149B1/pl unknown
- 1981-07-17 BR BR8104597A patent/BR8104597A/pt unknown
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5756305A (en) | 1982-04-03 |
| DE3027253C2 (de) | 1982-11-04 |
| EP0044480B1 (de) | 1984-04-11 |
| DD202856A5 (de) | 1983-10-05 |
| PL232262A1 (cg-RX-API-DMAC7.html) | 1982-03-15 |
| ATE7011T1 (de) | 1984-04-15 |
| AR226471A1 (es) | 1982-07-15 |
| PL127149B1 (en) | 1983-09-30 |
| BR8104597A (pt) | 1982-04-06 |
| TR20967A (tr) | 1983-03-07 |
| EP0044480A1 (de) | 1982-01-27 |
| ES503800A0 (es) | 1982-12-01 |
| DE3027253A1 (de) | 1982-02-11 |
| US4349526A (en) | 1982-09-14 |
| ES8301451A1 (es) | 1982-12-01 |
| DE3163071D1 (en) | 1984-05-17 |
| IN154788B (cg-RX-API-DMAC7.html) | 1984-12-15 |
| ZA814807B (en) | 1982-07-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1158418A (en) | Process for producing hydrogen peroxide | |
| KR100430939B1 (ko) | 과산화수소 제조방법과 과산화수소 제조용 조성물 | |
| CA2675114A1 (en) | Process for producing isocyanates | |
| CA2328106C (en) | Process for the preparation of hydrogen peroxide and reaction carrier for carrying out the process | |
| US2739042A (en) | Process for the production of hydrogen peroxide | |
| US3328128A (en) | Process for the manufacture of hydrogen peroxide | |
| US3767778A (en) | Process for the production of hydrogen peroxide | |
| CA1204749A (en) | Process for producing hydrogen peroxide | |
| US3780168A (en) | Process for the regeneration of aluminum oxide | |
| CA1176431A (en) | Hydrogen peroxide process | |
| US5334363A (en) | Process for recovering sulfur and hydrogen from hydrogen sulfide | |
| US2495229A (en) | Production of tetrahydroanthraquinones | |
| US4046868A (en) | Production of hydrogen peroxide | |
| CA1311601C (fr) | Procede de production cyclique de peroxyde d'hydrogene | |
| KR100498786B1 (ko) | 과산화수소 제조방법과 이를 위한 조성물 | |
| US3098714A (en) | Process for the manufacture of hydrogen peroxide | |
| CA1089631A (en) | Process for producing hydrogen peroxide | |
| US3789114A (en) | Process for the production of hydrogen peroxide by the anthraquinone process | |
| FI82671C (fi) | Foerfarande foer framstaellning av vaeteperoxid och loesningsmedelssystem foer anvaendning i detta foerfarande. | |
| US2890105A (en) | Solvent medium for the anthraquinone process for the production of hydrogen peroxide | |
| US2948739A (en) | Conversion of tetrahydroanthraquinone compound to antraquinone compound | |
| CN113195451A (zh) | 特定α,β-不饱和羧酸酯的改进制备方法 | |
| RU2099280C1 (ru) | Способ получения элементарной серы из сероводорода и циклический способ получения перекиси водорода | |
| US3761581A (en) | Process for the production of hydrogen peroxide | |
| US3348916A (en) | Hydrogen peroxide |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |