CA1138149A - Structural adhesive formulations - Google Patents
Structural adhesive formulationsInfo
- Publication number
- CA1138149A CA1138149A CA000324223A CA324223A CA1138149A CA 1138149 A CA1138149 A CA 1138149A CA 000324223 A CA000324223 A CA 000324223A CA 324223 A CA324223 A CA 324223A CA 1138149 A CA1138149 A CA 1138149A
- Authority
- CA
- Canada
- Prior art keywords
- weight
- percent
- group
- radical
- zero
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000853 adhesive Substances 0.000 title claims abstract description 408
- 230000001070 adhesive effect Effects 0.000 title claims abstract description 408
- 239000000203 mixture Substances 0.000 title claims description 382
- 238000009472 formulation Methods 0.000 title description 4
- 239000000178 monomer Substances 0.000 claims abstract description 135
- 150000001875 compounds Chemical class 0.000 claims abstract description 127
- 229910052698 phosphorus Inorganic materials 0.000 claims abstract description 97
- 239000000463 material Substances 0.000 claims abstract description 94
- 239000011574 phosphorus Substances 0.000 claims abstract description 80
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims abstract description 77
- 229910052751 metal Inorganic materials 0.000 claims abstract description 75
- 239000002184 metal Substances 0.000 claims abstract description 75
- 150000003839 salts Chemical class 0.000 claims abstract description 59
- 229910001463 metal phosphate Inorganic materials 0.000 claims abstract description 34
- 239000006185 dispersion Substances 0.000 claims abstract description 28
- 150000003254 radicals Chemical class 0.000 claims description 167
- -1 unsaturated dicarboxylic acid ester Chemical class 0.000 claims description 132
- 239000006188 syrup Substances 0.000 claims description 112
- 235000020357 syrup Nutrition 0.000 claims description 112
- 239000007800 oxidant agent Substances 0.000 claims description 100
- 235000014786 phosphorus Nutrition 0.000 claims description 79
- 125000004432 carbon atom Chemical group C* 0.000 claims description 78
- 229920000642 polymer Polymers 0.000 claims description 75
- 239000003638 chemical reducing agent Substances 0.000 claims description 61
- 229910052736 halogen Inorganic materials 0.000 claims description 60
- 150000002367 halogens Chemical class 0.000 claims description 60
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 claims description 56
- 239000003981 vehicle Substances 0.000 claims description 53
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 52
- MEFBJEMVZONFCJ-UHFFFAOYSA-N molybdate Chemical compound [O-][Mo]([O-])(=O)=O MEFBJEMVZONFCJ-UHFFFAOYSA-N 0.000 claims description 51
- 229910052739 hydrogen Inorganic materials 0.000 claims description 46
- 239000001257 hydrogen Substances 0.000 claims description 46
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 claims description 45
- 238000006116 polymerization reaction Methods 0.000 claims description 42
- 239000000758 substrate Substances 0.000 claims description 42
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims description 39
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 claims description 38
- 125000003118 aryl group Chemical group 0.000 claims description 38
- 229920006395 saturated elastomer Polymers 0.000 claims description 38
- 239000011230 binding agent Substances 0.000 claims description 37
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 36
- 150000005840 aryl radicals Chemical class 0.000 claims description 34
- 150000008065 acid anhydrides Chemical class 0.000 claims description 33
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 claims description 32
- 150000001991 dicarboxylic acids Chemical class 0.000 claims description 32
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 claims description 31
- 125000000217 alkyl group Chemical group 0.000 claims description 31
- 239000000047 product Substances 0.000 claims description 31
- 125000001424 substituent group Chemical group 0.000 claims description 30
- 238000007792 addition Methods 0.000 claims description 29
- 150000003512 tertiary amines Chemical class 0.000 claims description 29
- 230000036961 partial effect Effects 0.000 claims description 28
- 239000004342 Benzoyl peroxide Substances 0.000 claims description 27
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 claims description 27
- 235000019400 benzoyl peroxide Nutrition 0.000 claims description 27
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 claims description 24
- 230000013011 mating Effects 0.000 claims description 24
- 230000009477 glass transition Effects 0.000 claims description 23
- SEILKFZTLVMHRR-UHFFFAOYSA-N 2-phosphonooxyethyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCOP(O)(O)=O SEILKFZTLVMHRR-UHFFFAOYSA-N 0.000 claims description 22
- 238000012644 addition polymerization Methods 0.000 claims description 22
- 238000000034 method Methods 0.000 claims description 22
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 claims description 21
- 239000003085 diluting agent Substances 0.000 claims description 19
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 19
- 239000011787 zinc oxide Substances 0.000 claims description 19
- LRXTYHSAJDENHV-UHFFFAOYSA-H zinc phosphate Chemical compound [Zn+2].[Zn+2].[Zn+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O LRXTYHSAJDENHV-UHFFFAOYSA-H 0.000 claims description 19
- 229910000165 zinc phosphate Inorganic materials 0.000 claims description 19
- BIOOACNPATUQFW-UHFFFAOYSA-N calcium;dioxido(dioxo)molybdenum Chemical compound [Ca+2].[O-][Mo]([O-])(=O)=O BIOOACNPATUQFW-UHFFFAOYSA-N 0.000 claims description 18
- 150000002148 esters Chemical class 0.000 claims description 18
- 125000000524 functional group Chemical group 0.000 claims description 18
- 229910052760 oxygen Inorganic materials 0.000 claims description 18
- 239000001301 oxygen Substances 0.000 claims description 18
- 229920002554 vinyl polymer Polymers 0.000 claims description 18
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 claims description 17
- 125000004437 phosphorous atom Chemical group 0.000 claims description 17
- 229920001084 poly(chloroprene) Polymers 0.000 claims description 17
- 239000002253 acid Substances 0.000 claims description 16
- RCMWGBKVFBTLCW-UHFFFAOYSA-N barium(2+);dioxido(dioxo)molybdenum Chemical compound [Ba+2].[O-][Mo]([O-])(=O)=O RCMWGBKVFBTLCW-UHFFFAOYSA-N 0.000 claims description 16
- 239000001506 calcium phosphate Substances 0.000 claims description 16
- 229910000389 calcium phosphate Inorganic materials 0.000 claims description 16
- 235000011010 calcium phosphates Nutrition 0.000 claims description 16
- GVALZJMUIHGIMD-UHFFFAOYSA-H magnesium phosphate Chemical compound [Mg+2].[Mg+2].[Mg+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O GVALZJMUIHGIMD-UHFFFAOYSA-H 0.000 claims description 16
- 239000004137 magnesium phosphate Substances 0.000 claims description 16
- 229910000157 magnesium phosphate Inorganic materials 0.000 claims description 16
- 229960002261 magnesium phosphate Drugs 0.000 claims description 16
- 235000010994 magnesium phosphates Nutrition 0.000 claims description 16
- 229910052712 strontium Inorganic materials 0.000 claims description 16
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 claims description 16
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 claims description 16
- XAEWLETZEZXLHR-UHFFFAOYSA-N zinc;dioxido(dioxo)molybdenum Chemical compound [Zn+2].[O-][Mo]([O-])(=O)=O XAEWLETZEZXLHR-UHFFFAOYSA-N 0.000 claims description 16
- 229940123457 Free radical scavenger Drugs 0.000 claims description 15
- 125000005907 alkyl ester group Chemical group 0.000 claims description 15
- 239000002516 radical scavenger Substances 0.000 claims description 15
- 239000003054 catalyst Substances 0.000 claims description 13
- 229920001577 copolymer Polymers 0.000 claims description 13
- 229920006337 unsaturated polyester resin Polymers 0.000 claims description 13
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 claims description 12
- 230000000694 effects Effects 0.000 claims description 12
- 229920002681 hypalon Polymers 0.000 claims description 12
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 claims description 12
- 150000005215 alkyl ethers Chemical class 0.000 claims description 11
- 239000002131 composite material Substances 0.000 claims description 11
- 229920001519 homopolymer Polymers 0.000 claims description 11
- SOGAXMICEFXMKE-UHFFFAOYSA-N Butylmethacrylate Chemical compound CCCCOC(=O)C(C)=C SOGAXMICEFXMKE-UHFFFAOYSA-N 0.000 claims description 10
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 10
- 239000004698 Polyethylene Substances 0.000 claims description 10
- 238000006243 chemical reaction Methods 0.000 claims description 10
- 239000007859 condensation product Substances 0.000 claims description 9
- 229920000573 polyethylene Polymers 0.000 claims description 9
- 230000008569 process Effects 0.000 claims description 9
- 239000004709 Chlorinated polyethylene Substances 0.000 claims description 8
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 8
- 239000007795 chemical reaction product Substances 0.000 claims description 8
- IQPQWNKOIGAROB-UHFFFAOYSA-N isocyanate group Chemical group [N-]=C=O IQPQWNKOIGAROB-UHFFFAOYSA-N 0.000 claims description 8
- 229910052717 sulfur Inorganic materials 0.000 claims description 8
- 239000011593 sulfur Substances 0.000 claims description 8
- 125000001931 aliphatic group Chemical group 0.000 claims description 7
- 125000002947 alkylene group Chemical group 0.000 claims description 7
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 7
- 229920003229 poly(methyl methacrylate) Polymers 0.000 claims description 7
- 229920002857 polybutadiene Polymers 0.000 claims description 7
- 239000004926 polymethyl methacrylate Substances 0.000 claims description 7
- 239000000126 substance Substances 0.000 claims description 7
- 239000005062 Polybutadiene Substances 0.000 claims description 6
- 150000001412 amines Chemical class 0.000 claims description 6
- 239000011145 styrene acrylonitrile resin Substances 0.000 claims description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 5
- GYCMBHHDWRMZGG-UHFFFAOYSA-N Methylacrylonitrile Chemical compound CC(=C)C#N GYCMBHHDWRMZGG-UHFFFAOYSA-N 0.000 claims description 5
- 239000000460 chlorine Substances 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- 230000001590 oxidative effect Effects 0.000 claims description 5
- 229910052723 transition metal Inorganic materials 0.000 claims description 5
- 150000003624 transition metals Chemical class 0.000 claims description 5
- RUMACXVDVNRZJZ-UHFFFAOYSA-N 2-methylpropyl 2-methylprop-2-enoate Chemical compound CC(C)COC(=O)C(C)=C RUMACXVDVNRZJZ-UHFFFAOYSA-N 0.000 claims description 4
- 239000004793 Polystyrene Substances 0.000 claims description 4
- 239000004163 Spermaceti wax Substances 0.000 claims description 4
- 235000013871 bee wax Nutrition 0.000 claims description 4
- 239000012166 beeswax Substances 0.000 claims description 4
- YACLQRRMGMJLJV-UHFFFAOYSA-N chloroprene Chemical compound ClC(=C)C=C YACLQRRMGMJLJV-UHFFFAOYSA-N 0.000 claims description 4
- 238000007334 copolymerization reaction Methods 0.000 claims description 4
- JXTHNDFMNIQAHM-UHFFFAOYSA-N dichloroacetic acid Chemical compound OC(=O)C(Cl)Cl JXTHNDFMNIQAHM-UHFFFAOYSA-N 0.000 claims description 4
- 229960005215 dichloroacetic acid Drugs 0.000 claims description 4
- SUPCQIBBMFXVTL-UHFFFAOYSA-N ethyl 2-methylprop-2-enoate Chemical compound CCOC(=O)C(C)=C SUPCQIBBMFXVTL-UHFFFAOYSA-N 0.000 claims description 4
- LNCPIMCVTKXXOY-UHFFFAOYSA-N hexyl 2-methylprop-2-enoate Chemical compound CCCCCCOC(=O)C(C)=C LNCPIMCVTKXXOY-UHFFFAOYSA-N 0.000 claims description 4
- 239000000155 melt Substances 0.000 claims description 4
- 125000005397 methacrylic acid ester group Chemical group 0.000 claims description 4
- 239000012170 montan wax Substances 0.000 claims description 4
- KCAMXZBMXVIIQN-UHFFFAOYSA-N octan-3-yl 2-methylprop-2-enoate Chemical compound CCCCCC(CC)OC(=O)C(C)=C KCAMXZBMXVIIQN-UHFFFAOYSA-N 0.000 claims description 4
- 239000012188 paraffin wax Substances 0.000 claims description 4
- 229920002223 polystyrene Polymers 0.000 claims description 4
- 235000019385 spermaceti wax Nutrition 0.000 claims description 4
- SJMYWORNLPSJQO-UHFFFAOYSA-N tert-butyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OC(C)(C)C SJMYWORNLPSJQO-UHFFFAOYSA-N 0.000 claims description 4
- 239000001993 wax Substances 0.000 claims description 4
- 125000001188 haloalkyl group Chemical group 0.000 claims description 3
- 230000007704 transition Effects 0.000 claims description 3
- 150000002431 hydrogen Chemical class 0.000 claims 26
- 229940102838 methylmethacrylate Drugs 0.000 claims 21
- 229940063559 methacrylic acid Drugs 0.000 claims 13
- ISIJQEHRDSCQIU-UHFFFAOYSA-N tert-butyl 2,7-diazaspiro[4.5]decane-7-carboxylate Chemical class C1N(C(=O)OC(C)(C)C)CCCC11CNCC1 ISIJQEHRDSCQIU-UHFFFAOYSA-N 0.000 claims 12
- 239000002685 polymerization catalyst Substances 0.000 claims 9
- FUIQBJHUESBZNU-UHFFFAOYSA-N 2-[(dimethylazaniumyl)methyl]phenolate Chemical compound CN(C)CC1=CC=CC=C1O FUIQBJHUESBZNU-UHFFFAOYSA-N 0.000 claims 5
- 239000003999 initiator Substances 0.000 claims 5
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 claims 3
- 239000013536 elastomeric material Substances 0.000 claims 2
- 229920000620 organic polymer Polymers 0.000 claims 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 1
- ZSHHQOWEAFTSBF-UHFFFAOYSA-J calcium magnesium dihydrogen phosphate phosphate Chemical compound P(=O)([O-])([O-])[O-].[Mg+2].P(=O)([O-])(O)O.[Ca+2] ZSHHQOWEAFTSBF-UHFFFAOYSA-J 0.000 claims 1
- 230000002301 combined effect Effects 0.000 claims 1
- SNVLJLYUUXKWOJ-UHFFFAOYSA-N methylidenecarbene Chemical compound C=[C] SNVLJLYUUXKWOJ-UHFFFAOYSA-N 0.000 claims 1
- 230000002411 adverse Effects 0.000 abstract description 5
- 230000007613 environmental effect Effects 0.000 abstract description 5
- 230000002939 deleterious effect Effects 0.000 abstract description 3
- 238000012360 testing method Methods 0.000 description 22
- 229910000831 Steel Inorganic materials 0.000 description 17
- 229920001971 elastomer Polymers 0.000 description 17
- 239000010959 steel Substances 0.000 description 17
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 15
- 239000000806 elastomer Substances 0.000 description 13
- 229910052782 aluminium Inorganic materials 0.000 description 12
- DOIRQSBPFJWKBE-UHFFFAOYSA-N dibutyl phthalate Chemical compound CCCCOC(=O)C1=CC=CC=C1C(=O)OCCCC DOIRQSBPFJWKBE-UHFFFAOYSA-N 0.000 description 12
- 229920005862 polyol Polymers 0.000 description 11
- 150000003077 polyols Chemical class 0.000 description 11
- 238000002360 preparation method Methods 0.000 description 10
- 239000004840 adhesive resin Substances 0.000 description 8
- 229920006223 adhesive resin Polymers 0.000 description 8
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 8
- 150000002739 metals Chemical class 0.000 description 8
- 229920003023 plastic Polymers 0.000 description 8
- 239000004033 plastic Substances 0.000 description 8
- 229920001228 polyisocyanate Polymers 0.000 description 8
- 239000005056 polyisocyanate Substances 0.000 description 8
- 239000012190 activator Substances 0.000 description 7
- 229910052757 nitrogen Inorganic materials 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 6
- VRAIHTAYLFXSJJ-UHFFFAOYSA-N alumane Chemical compound [AlH3].[AlH3] VRAIHTAYLFXSJJ-UHFFFAOYSA-N 0.000 description 6
- 230000007797 corrosion Effects 0.000 description 6
- 238000005260 corrosion Methods 0.000 description 6
- 238000002156 mixing Methods 0.000 description 6
- 229920005989 resin Polymers 0.000 description 6
- 239000011347 resin Substances 0.000 description 6
- 238000003860 storage Methods 0.000 description 6
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 6
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 6
- JFZVSHAMRZPOPA-UHFFFAOYSA-N 1-[n-(2-hydroxypropyl)-4-methylanilino]propan-2-ol Chemical compound CC(O)CN(CC(C)O)C1=CC=C(C)C=C1 JFZVSHAMRZPOPA-UHFFFAOYSA-N 0.000 description 5
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 5
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 5
- 230000000712 assembly Effects 0.000 description 5
- 238000000429 assembly Methods 0.000 description 5
- 229920002587 poly(1,3-butadiene) polymer Polymers 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 4
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 4
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 239000000654 additive Substances 0.000 description 4
- 238000004026 adhesive bonding Methods 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- BHEPBYXIRTUNPN-UHFFFAOYSA-N hydridophosphorus(.) (triplet) Chemical compound [PH] BHEPBYXIRTUNPN-UHFFFAOYSA-N 0.000 description 4
- 239000004615 ingredient Substances 0.000 description 4
- 239000003112 inhibitor Substances 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- 235000011007 phosphoric acid Nutrition 0.000 description 4
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 4
- 239000005060 rubber Substances 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- 239000004135 Bone phosphate Substances 0.000 description 3
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 3
- 229920013646 Hycar Polymers 0.000 description 3
- WOBHKFSMXKNTIM-UHFFFAOYSA-N Hydroxyethyl methacrylate Chemical compound CC(=C)C(=O)OCCO WOBHKFSMXKNTIM-UHFFFAOYSA-N 0.000 description 3
- 229910019142 PO4 Inorganic materials 0.000 description 3
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical compound OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 3
- 229920001944 Plastisol Polymers 0.000 description 3
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 3
- 229910052802 copper Inorganic materials 0.000 description 3
- 239000010949 copper Substances 0.000 description 3
- 125000005442 diisocyanate group Chemical group 0.000 description 3
- 239000001530 fumaric acid Substances 0.000 description 3
- 239000010452 phosphate Substances 0.000 description 3
- 150000003018 phosphorus compounds Chemical class 0.000 description 3
- 239000004999 plastisol Substances 0.000 description 3
- 239000000377 silicon dioxide Substances 0.000 description 3
- 239000007921 spray Substances 0.000 description 3
- DVKJHBMWWAPEIU-UHFFFAOYSA-N toluene 2,4-diisocyanate Chemical compound CC1=CC=C(N=C=O)C=C1N=C=O DVKJHBMWWAPEIU-UHFFFAOYSA-N 0.000 description 3
- OHBQPCCCRFSCAX-UHFFFAOYSA-N 1,4-Dimethoxybenzene Chemical compound COC1=CC=C(OC)C=C1 OHBQPCCCRFSCAX-UHFFFAOYSA-N 0.000 description 2
- AZQWKYJCGOJGHM-UHFFFAOYSA-N 1,4-benzoquinone Chemical compound O=C1C=CC(=O)C=C1 AZQWKYJCGOJGHM-UHFFFAOYSA-N 0.000 description 2
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 2
- XFCMNSHQOZQILR-UHFFFAOYSA-N 2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCOCCOC(=O)C(C)=C XFCMNSHQOZQILR-UHFFFAOYSA-N 0.000 description 2
- FRIBMENBGGCKPD-UHFFFAOYSA-N 3-(2,3-dimethoxyphenyl)prop-2-enal Chemical compound COC1=CC=CC(C=CC=O)=C1OC FRIBMENBGGCKPD-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- 229910000838 Al alloy Inorganic materials 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- 101001053395 Arabidopsis thaliana Acid beta-fructofuranosidase 4, vacuolar Proteins 0.000 description 2
- IRIAEXORFWYRCZ-UHFFFAOYSA-N Butylbenzyl phthalate Chemical compound CCCCOC(=O)C1=CC=CC=C1C(=O)OCC1=CC=CC=C1 IRIAEXORFWYRCZ-UHFFFAOYSA-N 0.000 description 2
- ZTQSAGDEMFDKMZ-UHFFFAOYSA-N Butyraldehyde Chemical compound CCCC=O ZTQSAGDEMFDKMZ-UHFFFAOYSA-N 0.000 description 2
- DWSLZXIVLWVGRD-UHFFFAOYSA-N CC(=C)C(=O)OCCP(O)=O Chemical compound CC(=C)C(=O)OCCP(O)=O DWSLZXIVLWVGRD-UHFFFAOYSA-N 0.000 description 2
- 102100026735 Coagulation factor VIII Human genes 0.000 description 2
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 2
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- 101000911390 Homo sapiens Coagulation factor VIII Proteins 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- 239000004824 Multi-part adhesive Substances 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 2
- 230000003213 activating effect Effects 0.000 description 2
- 230000004913 activation Effects 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- 125000003342 alkenyl group Chemical group 0.000 description 2
- XXROGKLTLUQVRX-UHFFFAOYSA-N allyl alcohol Chemical compound OCC=C XXROGKLTLUQVRX-UHFFFAOYSA-N 0.000 description 2
- 125000000746 allylic group Chemical group 0.000 description 2
- 239000007767 bonding agent Substances 0.000 description 2
- NTXGQCSETZTARF-UHFFFAOYSA-N buta-1,3-diene;prop-2-enenitrile Chemical compound C=CC=C.C=CC#N NTXGQCSETZTARF-UHFFFAOYSA-N 0.000 description 2
- XZKRXPZXQLARHH-UHFFFAOYSA-N buta-1,3-dienylbenzene Chemical compound C=CC=CC1=CC=CC=C1 XZKRXPZXQLARHH-UHFFFAOYSA-N 0.000 description 2
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 2
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- RWGFKTVRMDUZSP-UHFFFAOYSA-N cumene Chemical compound CC(C)C1=CC=CC=C1 RWGFKTVRMDUZSP-UHFFFAOYSA-N 0.000 description 2
- 239000008367 deionised water Substances 0.000 description 2
- 229910021641 deionized water Inorganic materials 0.000 description 2
- 150000001990 dicarboxylic acid derivatives Chemical class 0.000 description 2
- KORSJDCBLAPZEQ-UHFFFAOYSA-N dicyclohexylmethane-4,4'-diisocyanate Chemical compound C1CC(N=C=O)CCC1CC1CCC(N=C=O)CC1 KORSJDCBLAPZEQ-UHFFFAOYSA-N 0.000 description 2
- 229920006332 epoxy adhesive Polymers 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 230000006872 improvement Effects 0.000 description 2
- 239000003701 inert diluent Substances 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 239000012948 isocyanate Substances 0.000 description 2
- YJOMWQQKPKLUBO-UHFFFAOYSA-L lead(2+);phthalate Chemical compound [Pb+2].[O-]C(=O)C1=CC=CC=C1C([O-])=O YJOMWQQKPKLUBO-UHFFFAOYSA-L 0.000 description 2
- UMKARVFXJJITLN-UHFFFAOYSA-N lead;phosphorous acid Chemical compound [Pb].OP(O)O UMKARVFXJJITLN-UHFFFAOYSA-N 0.000 description 2
- 239000000314 lubricant Substances 0.000 description 2
- 150000002689 maleic acids Chemical class 0.000 description 2
- 230000007246 mechanism Effects 0.000 description 2
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 2
- ACVYVLVWPXVTIT-UHFFFAOYSA-N phosphinic acid Chemical class O[PH2]=O ACVYVLVWPXVTIT-UHFFFAOYSA-N 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-L phthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC=C1C([O-])=O XNGIFLGASWRNHJ-UHFFFAOYSA-L 0.000 description 2
- 229920001610 polycaprolactone Polymers 0.000 description 2
- 239000004632 polycaprolactone Substances 0.000 description 2
- 150000007519 polyprotic acids Polymers 0.000 description 2
- 239000011148 porous material Substances 0.000 description 2
- 238000002203 pretreatment Methods 0.000 description 2
- YPFDHNVEDLHUCE-UHFFFAOYSA-N propane-1,3-diol Chemical compound OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 description 2
- 229960004063 propylene glycol Drugs 0.000 description 2
- 238000010926 purge Methods 0.000 description 2
- 238000007761 roller coating Methods 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000008399 tap water Substances 0.000 description 2
- 235000020679 tap water Nutrition 0.000 description 2
- 238000010998 test method Methods 0.000 description 2
- 229940096522 trimethylolpropane triacrylate Drugs 0.000 description 2
- 239000002023 wood Substances 0.000 description 2
- 229920002818 (Hydroxyethyl)methacrylate Polymers 0.000 description 1
- JJWLMSCSLRJSAN-TYYBGVCCSA-L (e)-but-2-enedioate;lead(2+) Chemical compound [Pb+2].[O-]C(=O)\C=C\C([O-])=O JJWLMSCSLRJSAN-TYYBGVCCSA-L 0.000 description 1
- ZCOMURCDMLBWOR-UHFFFAOYSA-N (hydroxy-phenyl-phosphonomethyl)phosphonic acid Chemical compound OP(=O)(O)C(P(O)(O)=O)(O)C1=CC=CC=C1 ZCOMURCDMLBWOR-UHFFFAOYSA-N 0.000 description 1
- UOCLXMDMGBRAIB-UHFFFAOYSA-N 1,1,1-trichloroethane Chemical compound CC(Cl)(Cl)Cl UOCLXMDMGBRAIB-UHFFFAOYSA-N 0.000 description 1
- LFMQNMXVVXHZCC-UHFFFAOYSA-N 1,3-benzothiazol-2-yl n,n-diethylcarbamodithioate Chemical compound C1=CC=C2SC(SC(=S)N(CC)CC)=NC2=C1 LFMQNMXVVXHZCC-UHFFFAOYSA-N 0.000 description 1
- 125000001989 1,3-phenylene group Chemical group [H]C1=C([H])C([*:1])=C([H])C([*:2])=C1[H] 0.000 description 1
- 125000001140 1,4-phenylene group Chemical group [H]C1=C([H])C([*:2])=C([H])C([H])=C1[*:1] 0.000 description 1
- GSJXJZOWHSTWOX-UHFFFAOYSA-N 1-[(4-chlorophenyl)methyl]piperazine Chemical compound C1=CC(Cl)=CC=C1CN1CCNCC1 GSJXJZOWHSTWOX-UHFFFAOYSA-N 0.000 description 1
- IBSQPLPBRSHTTG-UHFFFAOYSA-N 1-chloro-2-methylbenzene Chemical compound CC1=CC=CC=C1Cl IBSQPLPBRSHTTG-UHFFFAOYSA-N 0.000 description 1
- KXESJSGVJFDEAM-UHFFFAOYSA-N 1-hydroxybut-1-en-2-ylphosphonic acid Chemical compound CCC(=CO)P(O)(O)=O KXESJSGVJFDEAM-UHFFFAOYSA-N 0.000 description 1
- YENKRZXDJWBUIY-UHFFFAOYSA-N 1-phosphonooxypropan-2-yl 2-methylprop-2-enoate Chemical compound OP(=O)(O)OCC(C)OC(=O)C(C)=C YENKRZXDJWBUIY-UHFFFAOYSA-N 0.000 description 1
- LIFLRQVHKGGNSG-UHFFFAOYSA-N 2,3-dichlorobuta-1,3-diene Chemical compound ClC(=C)C(Cl)=C LIFLRQVHKGGNSG-UHFFFAOYSA-N 0.000 description 1
- JAHNSTQSQJOJLO-UHFFFAOYSA-N 2-(3-fluorophenyl)-1h-imidazole Chemical compound FC1=CC=CC(C=2NC=CN=2)=C1 JAHNSTQSQJOJLO-UHFFFAOYSA-N 0.000 description 1
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 description 1
- OGWZVZSVQQBXJD-UHFFFAOYSA-N 2-[ethoxy(hydroxy)phosphoryl]oxyethyl 2-methylprop-2-enoate Chemical compound CCOP(O)(=O)OCCOC(=O)C(C)=C OGWZVZSVQQBXJD-UHFFFAOYSA-N 0.000 description 1
- WAJJFPMYKWCDNI-UHFFFAOYSA-N 2-[hydroxy(2-prop-2-enoyloxyethoxy)phosphoryl]oxyethyl prop-2-enoate Chemical compound C=CC(=O)OCCOP(=O)(O)OCCOC(=O)C=C WAJJFPMYKWCDNI-UHFFFAOYSA-N 0.000 description 1
- YWLLQUWZWIKQKV-UHFFFAOYSA-N 2-[hydroxy(methoxy)phosphoryl]oxyethyl prop-2-enoate Chemical compound COP(O)(=O)OCCOC(=O)C=C YWLLQUWZWIKQKV-UHFFFAOYSA-N 0.000 description 1
- NXBXJOWBDCQIHF-UHFFFAOYSA-N 2-[hydroxy-[2-(2-methylprop-2-enoyloxy)ethoxy]phosphoryl]oxyethyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCOP(O)(=O)OCCOC(=O)C(C)=C NXBXJOWBDCQIHF-UHFFFAOYSA-N 0.000 description 1
- SBYMUDUGTIKLCR-UHFFFAOYSA-N 2-chloroethenylbenzene Chemical compound ClC=CC1=CC=CC=C1 SBYMUDUGTIKLCR-UHFFFAOYSA-N 0.000 description 1
- OMIGHNLMNHATMP-UHFFFAOYSA-N 2-hydroxyethyl prop-2-enoate Chemical compound OCCOC(=O)C=C OMIGHNLMNHATMP-UHFFFAOYSA-N 0.000 description 1
- JHWIEAWILPSRMU-UHFFFAOYSA-N 2-methyl-3-pyrimidin-4-ylpropanoic acid Chemical compound OC(=O)C(C)CC1=CC=NC=N1 JHWIEAWILPSRMU-UHFFFAOYSA-N 0.000 description 1
- UDXXYUDJOHIIDZ-UHFFFAOYSA-N 2-phosphonooxyethyl prop-2-enoate Chemical compound OP(O)(=O)OCCOC(=O)C=C UDXXYUDJOHIIDZ-UHFFFAOYSA-N 0.000 description 1
- JWVJCWBVQNCBGA-UHFFFAOYSA-N 3-(dimethylamino)-2-methylphenol Chemical compound CN(C)C1=CC=CC(O)=C1C JWVJCWBVQNCBGA-UHFFFAOYSA-N 0.000 description 1
- PSHNPFJHDJOMGP-UHFFFAOYSA-N 3-(oxiran-2-ylmethoxy)propylphosphonic acid Chemical compound OP(O)(=O)CCCOCC1CO1 PSHNPFJHDJOMGP-UHFFFAOYSA-N 0.000 description 1
- UPMLOUAZCHDJJD-UHFFFAOYSA-N 4,4'-Diphenylmethane Diisocyanate Chemical compound C1=CC(N=C=O)=CC=C1CC1=CC=C(N=C=O)C=C1 UPMLOUAZCHDJJD-UHFFFAOYSA-N 0.000 description 1
- NPDACUSDTOMAMK-UHFFFAOYSA-N 4-Chlorotoluene Chemical compound CC1=CC=C(Cl)C=C1 NPDACUSDTOMAMK-UHFFFAOYSA-N 0.000 description 1
- JLBJTVDPSNHSKJ-UHFFFAOYSA-N 4-Methylstyrene Chemical compound CC1=CC=C(C=C)C=C1 JLBJTVDPSNHSKJ-UHFFFAOYSA-N 0.000 description 1
- YHAUWIDCXVQMPN-UHFFFAOYSA-N 4-methyl-n,n-di(propan-2-yl)aniline Chemical compound CC(C)N(C(C)C)C1=CC=C(C)C=C1 YHAUWIDCXVQMPN-UHFFFAOYSA-N 0.000 description 1
- OHNKSVVCUPOUDJ-UHFFFAOYSA-N 5-nitro-1h-indene Chemical compound [O-][N+](=O)C1=CC=C2CC=CC2=C1 OHNKSVVCUPOUDJ-UHFFFAOYSA-N 0.000 description 1
- JRLTTZUODKEYDH-UHFFFAOYSA-N 8-methylquinoline Chemical group C1=CN=C2C(C)=CC=CC2=C1 JRLTTZUODKEYDH-UHFFFAOYSA-N 0.000 description 1
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 1
- 241001279686 Allium moly Species 0.000 description 1
- 101001053401 Arabidopsis thaliana Acid beta-fructofuranosidase 3, vacuolar Proteins 0.000 description 1
- 229930185605 Bisphenol Natural products 0.000 description 1
- NLZUEZXRPGMBCV-UHFFFAOYSA-N Butylhydroxytoluene Chemical compound CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 NLZUEZXRPGMBCV-UHFFFAOYSA-N 0.000 description 1
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 1
- 101100372806 Caenorhabditis elegans vit-3 gene Proteins 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 1
- 239000004593 Epoxy Substances 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- HDIFHQMREAYYJW-XGXNLDPDSA-N Glyceryl Ricinoleate Chemical class CCCCCC[C@@H](O)C\C=C/CCCCCCCC(=O)OCC(O)CO HDIFHQMREAYYJW-XGXNLDPDSA-N 0.000 description 1
- 239000005057 Hexamethylene diisocyanate Substances 0.000 description 1
- 229920000459 Nitrile rubber Polymers 0.000 description 1
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical group ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 235000004443 Ricinus communis Nutrition 0.000 description 1
- ZJCCRDAZUWHFQH-UHFFFAOYSA-N Trimethylolpropane Chemical compound CCC(CO)(CO)CO ZJCCRDAZUWHFQH-UHFFFAOYSA-N 0.000 description 1
- DAKWPKUUDNSNPN-UHFFFAOYSA-N Trimethylolpropane triacrylate Chemical compound C=CC(=O)OCC(CC)(COC(=O)C=C)COC(=O)C=C DAKWPKUUDNSNPN-UHFFFAOYSA-N 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- 239000003522 acrylic cement Substances 0.000 description 1
- 239000002998 adhesive polymer Substances 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 150000001279 adipic acids Chemical class 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 229910045601 alloy Inorganic materials 0.000 description 1
- 239000000956 alloy Substances 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- SRGBNANKQPZXFZ-UHFFFAOYSA-N aniline;butanal Chemical compound CCCC=O.NC1=CC=CC=C1 SRGBNANKQPZXFZ-UHFFFAOYSA-N 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 239000011324 bead Substances 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- AGIABBZIYOGTGE-UHFFFAOYSA-N bis(prop-2-enyl)phosphinic acid Chemical compound C=CCP(=O)(O)CC=C AGIABBZIYOGTGE-UHFFFAOYSA-N 0.000 description 1
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 1
- 238000005422 blasting Methods 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 230000001680 brushing effect Effects 0.000 description 1
- CQEYYJKEWSMYFG-UHFFFAOYSA-N butyl acrylate Chemical compound CCCCOC(=O)C=C CQEYYJKEWSMYFG-UHFFFAOYSA-N 0.000 description 1
- VNWKTOKETHGBQD-YPZZEJLDSA-N carbane Chemical group [10CH4] VNWKTOKETHGBQD-YPZZEJLDSA-N 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 239000000919 ceramic Substances 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 239000010960 cold rolled steel Substances 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- FCPZWSAJRRKPLK-UHFFFAOYSA-N cyclohex-2-en-1-ylphosphonic acid Chemical compound OP(O)(=O)C1CCCC=C1 FCPZWSAJRRKPLK-UHFFFAOYSA-N 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 230000007812 deficiency Effects 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 239000012933 diacyl peroxide Substances 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 150000002009 diols Chemical class 0.000 description 1
- 238000007590 electrostatic spraying Methods 0.000 description 1
- 239000003822 epoxy resin Substances 0.000 description 1
- 238000005530 etching Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 229920001038 ethylene copolymer Polymers 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 150000002238 fumaric acids Chemical class 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- 125000005456 glyceride group Chemical group 0.000 description 1
- VOZRXNHHFUQHIL-UHFFFAOYSA-N glycidyl methacrylate Chemical compound CC(=C)C(=O)OCC1CO1 VOZRXNHHFUQHIL-UHFFFAOYSA-N 0.000 description 1
- JEGUKCSWCFPDGT-UHFFFAOYSA-N h2o hydrate Chemical compound O.O JEGUKCSWCFPDGT-UHFFFAOYSA-N 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- KETWBQOXTBGBBN-UHFFFAOYSA-N hex-1-enylbenzene Chemical compound CCCCC=CC1=CC=CC=C1 KETWBQOXTBGBBN-UHFFFAOYSA-N 0.000 description 1
- RRAMGCGOFNQTLD-UHFFFAOYSA-N hexamethylene diisocyanate Chemical compound O=C=NCCCCCCN=C=O RRAMGCGOFNQTLD-UHFFFAOYSA-N 0.000 description 1
- 125000004836 hexamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- XXMIOPMDWAUFGU-UHFFFAOYSA-N hexane-1,6-diol Chemical compound OCCCCCCO XXMIOPMDWAUFGU-UHFFFAOYSA-N 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 150000002432 hydroperoxides Chemical class 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 150000002596 lactones Chemical class 0.000 description 1
- 235000021388 linseed oil Nutrition 0.000 description 1
- 239000000944 linseed oil Substances 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 150000002734 metacrylic acid derivatives Chemical class 0.000 description 1
- FQPSGWSUVKBHSU-UHFFFAOYSA-N methacrylamide Chemical compound CC(=C)C(N)=O FQPSGWSUVKBHSU-UHFFFAOYSA-N 0.000 description 1
- LVHBHZANLOWSRM-UHFFFAOYSA-N methylenebutanedioic acid Natural products OC(=O)CC(=C)C(O)=O LVHBHZANLOWSRM-UHFFFAOYSA-N 0.000 description 1
- 150000002763 monocarboxylic acids Chemical class 0.000 description 1
- GYVGXEWAOAAJEU-UHFFFAOYSA-N n,n,4-trimethylaniline Chemical compound CN(C)C1=CC=C(C)C=C1 GYVGXEWAOAAJEU-UHFFFAOYSA-N 0.000 description 1
- GEMHFKXPOCTAIP-UHFFFAOYSA-N n,n-dimethyl-n'-phenylcarbamimidoyl chloride Chemical compound CN(C)C(Cl)=NC1=CC=CC=C1 GEMHFKXPOCTAIP-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- LPXPSTWBTULMJE-UHFFFAOYSA-N n-phenylbutan-1-imine Chemical compound CCCC=NC1=CC=CC=C1 LPXPSTWBTULMJE-UHFFFAOYSA-N 0.000 description 1
- 229910052755 nonmetal Inorganic materials 0.000 description 1
- 150000001451 organic peroxides Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- NWVVVBRKAWDGAB-UHFFFAOYSA-N p-methoxyphenol Chemical compound COC1=CC=C(O)C=C1 NWVVVBRKAWDGAB-UHFFFAOYSA-N 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- WRUUGTRCQOWXEG-UHFFFAOYSA-N pamidronate Chemical compound NCCC(O)(P(O)(O)=O)P(O)(O)=O WRUUGTRCQOWXEG-UHFFFAOYSA-N 0.000 description 1
- 150000002976 peresters Chemical class 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 229920001568 phenolic resin Polymers 0.000 description 1
- 239000005011 phenolic resin Substances 0.000 description 1
- 150000003009 phosphonic acids Chemical class 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- 150000003022 phthalic acids Chemical class 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 239000011120 plywood Substances 0.000 description 1
- 229920001490 poly(butyl methacrylate) polymer Polymers 0.000 description 1
- 229920001483 poly(ethyl methacrylate) polymer Polymers 0.000 description 1
- 229920001200 poly(ethylene-vinyl acetate) Polymers 0.000 description 1
- 229920002492 poly(sulfone) Polymers 0.000 description 1
- 229920002037 poly(vinyl butyral) polymer Polymers 0.000 description 1
- 229920000058 polyacrylate Polymers 0.000 description 1
- 229920001515 polyalkylene glycol Polymers 0.000 description 1
- 229920000515 polycarbonate Polymers 0.000 description 1
- 239000004417 polycarbonate Substances 0.000 description 1
- 229920000647 polyepoxide Polymers 0.000 description 1
- 229920005906 polyester polyol Polymers 0.000 description 1
- 229920001225 polyester resin Polymers 0.000 description 1
- 239000004645 polyester resin Substances 0.000 description 1
- 229920000120 polyethyl acrylate Polymers 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920001470 polyketone Polymers 0.000 description 1
- 230000000379 polymerizing effect Effects 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- SCUZVMOVTVSBLE-UHFFFAOYSA-N prop-2-enenitrile;styrene Chemical compound C=CC#N.C=CC1=CC=CC=C1 SCUZVMOVTVSBLE-UHFFFAOYSA-N 0.000 description 1
- RZKYDQNMAUSEDZ-UHFFFAOYSA-N prop-2-enylphosphonic acid Chemical compound OP(O)(=O)CC=C RZKYDQNMAUSEDZ-UHFFFAOYSA-N 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011253 protective coating Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 230000000979 retarding effect Effects 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- 238000005488 sandblasting Methods 0.000 description 1
- 235000012424 soybean oil Nutrition 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 229920000638 styrene acrylonitrile Polymers 0.000 description 1
- 229920003048 styrene butadiene rubber Polymers 0.000 description 1
- 235000011044 succinic acid Nutrition 0.000 description 1
- 150000003444 succinic acids Chemical class 0.000 description 1
- 150000005846 sugar alcohols Polymers 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 150000003504 terephthalic acids Chemical class 0.000 description 1
- UGNWTBMOAKPKBL-UHFFFAOYSA-N tetrachloro-1,4-benzoquinone Chemical compound ClC1=C(Cl)C(=O)C(Cl)=C(Cl)C1=O UGNWTBMOAKPKBL-UHFFFAOYSA-N 0.000 description 1
- 229950011008 tetrachloroethylene Drugs 0.000 description 1
- 229920001169 thermoplastic Polymers 0.000 description 1
- 239000004416 thermosoftening plastic Substances 0.000 description 1
- KSBAEPSJVUENNK-UHFFFAOYSA-L tin(ii) 2-ethylhexanoate Chemical compound [Sn+2].CCCCC(CC)C([O-])=O.CCCCC(CC)C([O-])=O KSBAEPSJVUENNK-UHFFFAOYSA-L 0.000 description 1
- RUELTTOHQODFPA-UHFFFAOYSA-N toluene 2,6-diisocyanate Chemical compound CC1=C(N=C=O)C=CC=C1N=C=O RUELTTOHQODFPA-UHFFFAOYSA-N 0.000 description 1
- UBOXGVDOUJQMTN-UHFFFAOYSA-N trichloroethylene Natural products ClCC(Cl)Cl UBOXGVDOUJQMTN-UHFFFAOYSA-N 0.000 description 1
- 150000003673 urethanes Chemical class 0.000 description 1
- HGBOYTHUEUWSSQ-UHFFFAOYSA-N valeric aldehyde Natural products CCCCC=O HGBOYTHUEUWSSQ-UHFFFAOYSA-N 0.000 description 1
- 229910052720 vanadium Inorganic materials 0.000 description 1
- 229920006163 vinyl copolymer Polymers 0.000 description 1
- 238000003466 welding Methods 0.000 description 1
- PAPBSGBWRJIAAV-UHFFFAOYSA-N ε-Caprolactone Chemical compound O=C1CCCCCO1 PAPBSGBWRJIAAV-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09J—ADHESIVES; NON-MECHANICAL ASPECTS OF ADHESIVE PROCESSES IN GENERAL; ADHESIVE PROCESSES NOT PROVIDED FOR ELSEWHERE; USE OF MATERIALS AS ADHESIVES
- C09J5/00—Adhesive processes in general; Adhesive processes not provided for elsewhere, e.g. relating to primers
- C09J5/02—Adhesive processes in general; Adhesive processes not provided for elsewhere, e.g. relating to primers involving pretreatment of the surfaces to be joined
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09J—ADHESIVES; NON-MECHANICAL ASPECTS OF ADHESIVE PROCESSES IN GENERAL; ADHESIVE PROCESSES NOT PROVIDED FOR ELSEWHERE; USE OF MATERIALS AS ADHESIVES
- C09J4/00—Adhesives based on organic non-macromolecular compounds having at least one polymerisable carbon-to-carbon unsaturated bond ; adhesives, based on monomers of macromolecular compounds of groups C09J183/00 - C09J183/16
- C09J4/06—Organic non-macromolecular compounds having at least one polymerisable carbon-to-carbon unsaturated bond in combination with a macromolecular compound other than an unsaturated polymer of groups C09J159/00 - C09J187/00
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09J—ADHESIVES; NON-MECHANICAL ASPECTS OF ADHESIVE PROCESSES IN GENERAL; ADHESIVE PROCESSES NOT PROVIDED FOR ELSEWHERE; USE OF MATERIALS AS ADHESIVES
- C09J2400/00—Presence of inorganic and organic materials
- C09J2400/10—Presence of inorganic materials
- C09J2400/16—Metal
- C09J2400/166—Metal in the pretreated surface to be joined
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Adhesives Or Adhesive Processes (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/899,621 US4223115A (en) | 1978-04-24 | 1978-04-24 | Structural adhesive formulations |
| US899,621 | 1978-04-24 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1138149A true CA1138149A (en) | 1982-12-21 |
Family
ID=25411303
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000324223A Expired CA1138149A (en) | 1978-04-24 | 1979-03-27 | Structural adhesive formulations |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US4223115A (enExample) |
| JP (1) | JPS54141826A (enExample) |
| AT (1) | AT376233B (enExample) |
| BE (1) | BE875813A (enExample) |
| CA (1) | CA1138149A (enExample) |
| CH (1) | CH666693A5 (enExample) |
| DE (1) | DE2916537C2 (enExample) |
| DK (1) | DK167679A (enExample) |
| FR (3) | FR2438080A1 (enExample) |
| GB (1) | GB2019415B (enExample) |
| IT (1) | IT1112576B (enExample) |
| NL (1) | NL187817C (enExample) |
| NO (1) | NO154523C (enExample) |
| SE (1) | SE448549B (enExample) |
| ZA (1) | ZA791288B (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5932627A (en) | 1994-05-12 | 1999-08-03 | Dentsply Gmbh | Fluoride releasing dental primer composition and method |
Families Citing this family (89)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA1207944A (en) * | 1980-09-15 | 1986-07-15 | Denis J. Zalucha | Fast curing phosphate modified anaerobic composition |
| US4322509A (en) * | 1980-10-03 | 1982-03-30 | Lord Corporation | Fast curing phosphate modified anaerobic adhesive compositions |
| JPS5915468A (ja) * | 1982-07-16 | 1984-01-26 | Kuraray Co Ltd | 接着剤 |
| US4452944A (en) * | 1982-02-11 | 1984-06-05 | Lord Corporation | Structural adhesive formulations |
| US4467071A (en) * | 1982-09-13 | 1984-08-21 | Lord Corporation | Epoxy modified structural adhesives having improved heat resistance |
| JPS59172567A (ja) * | 1983-03-22 | 1984-09-29 | Okura Ind Co Ltd | 変性二液型接着剤組成物 |
| JPS60120774A (ja) * | 1983-12-05 | 1985-06-28 | Okura Ind Co Ltd | 接着性と保存安定性に優れた二液型アクリル系接着剤 |
| US4703089A (en) * | 1984-04-10 | 1987-10-27 | Damico Dennis J | Structural adhesive formulations |
| CA1231085A (en) * | 1984-05-29 | 1988-01-05 | Denis J. Zalucha | Structural adhesive formulations |
| DE3431369A1 (de) * | 1984-08-25 | 1986-03-06 | Keck Chimie S.A., Ingwiller | Modifizierter polyurethan-klebstoff |
| US5028661A (en) * | 1986-10-14 | 1991-07-02 | Loctite Corporation | Adhesion promoters for thiolene adhesive formulations |
| DE3727112A1 (de) * | 1987-08-14 | 1989-02-23 | Basf Ag | Waessrige beschichtungsstoffe auf basis von sekundaerdispersionen carboxylgruppen enthaltender copolymerisate von acrylsaeure- oder methacrylsaeureestern |
| US4788235A (en) * | 1987-11-23 | 1988-11-29 | Minnesota Mining And Manufacturing Company | Phosphite modified epoxy resin |
| US5096962A (en) * | 1990-11-29 | 1992-03-17 | Lord Corporation | Acrylic adhesive compositions |
| JP2642554B2 (ja) * | 1991-12-27 | 1997-08-20 | 電気化学工業株式会社 | 接着剤組成物 |
| US5385958A (en) * | 1993-03-05 | 1995-01-31 | Dymax Corporation | Activator formulation and composition utilizing same |
| JPH10510578A (ja) * | 1995-03-20 | 1998-10-13 | ダイマックス コーポレーション | 封入配合物、封入方法、及び封入装置 |
| AU2535797A (en) * | 1996-04-15 | 1997-11-07 | Lord Corporation | Free radical polymerizable compositions including para-halogenated aniline derivatives |
| JP3412430B2 (ja) * | 1996-10-28 | 2003-06-03 | 株式会社スリーボンド | ねじ部材などに用いられるプレコート型接着剤組成物及びこれを用いたプレコート螺合部材 |
| ID20459A (id) | 1997-06-24 | 1998-12-24 | Denki Kagaku Kogyo Kk | Komposisi resin yang bisa mengawetkan, komposisi perekat, produk dan susunan yang diawetkan |
| EP1017747B1 (de) * | 1997-09-20 | 2004-11-10 | Röhm GmbH & Co. KG | Thermisch verfilmbare massen mit einem polymerisierbaren bestandteil (reaktiv-plastisole) |
| US6153719A (en) * | 1998-02-04 | 2000-11-28 | Lord Corporation | Thiol-cured epoxy composition |
| US6225408B1 (en) * | 1998-06-12 | 2001-05-01 | Lord Corporation | Adhesive formulations |
| JP2002517595A (ja) * | 1998-06-12 | 2002-06-18 | ロード コーポレーション | 接着剤組成物 |
| US6559257B2 (en) * | 1998-06-12 | 2003-05-06 | Lord Corporation | Adhesive formulations |
| IE980948A1 (en) * | 1998-11-16 | 2000-05-17 | Loctite R & D Ltd | Method of bonding Aluminium Substrates with Anaerobic Sealants to form a Seal |
| US6313257B1 (en) | 1999-03-23 | 2001-11-06 | Lord Corporation | Poly (mercaptopropylaryl) curatives |
| US6762249B1 (en) * | 1999-08-25 | 2004-07-13 | Hitachi Chemical Company, Ltd. | Wiring-connecting material and process for producing circuit board with the same |
| US6632872B1 (en) | 2000-09-19 | 2003-10-14 | 3M Innovative Properties Company | Adhesive compositions including self-assembling molecules, adhesives, articles, and methods |
| KR100518317B1 (ko) * | 2000-12-22 | 2005-10-04 | 주식회사 포스코 | 인산히드록시알킬아크릴레이트를 함유하는 전기강판표면처리용 유무기 복합형 코팅액의 유기재 수지 조성물 |
| EP1239015A1 (en) * | 2001-03-08 | 2002-09-11 | Sika AG, vorm. Kaspar Winkler & Co. | Easy to manufacture meth (acrylic) adhesive compositions |
| US6433091B1 (en) | 2001-05-10 | 2002-08-13 | Henkel Loctite Corporation | Adhesive composition |
| US6596379B2 (en) | 2001-05-24 | 2003-07-22 | Exxonmobil Oil Corporation | Polymers stabilized by water-soluble, cationic, amino-functional polymer, and plastic film coated with same |
| US20050014901A1 (en) * | 2001-07-10 | 2005-01-20 | Ips Corporation | Adhesive compositions for bonding and filling large assemblies |
| US6630555B2 (en) * | 2001-11-06 | 2003-10-07 | Lord Corporation | Internally blocked organoborate initiators and adhesives therefrom |
| US6921454B2 (en) | 2001-11-27 | 2005-07-26 | Henkel Corporation | Elastomer toughened radiation curable adhesives |
| US6730411B1 (en) * | 2002-02-07 | 2004-05-04 | Illinois Tool Works Inc. | Two-part structural adhesive systems and laminates incorporating the same |
| US6893722B2 (en) * | 2002-04-29 | 2005-05-17 | Exxonmobil Oil Corporation | Cationic, amino-functional, adhesion-promoting polymer for curable inks and other plastic film coatings, and plastic film comprising such polymer |
| US7195818B2 (en) * | 2002-05-01 | 2007-03-27 | Exxonmobil Oil Corporation | Sealable multi-layer opaque film |
| US6989416B2 (en) * | 2002-05-07 | 2006-01-24 | Sika Technology Ag | Methacrylate structural adhesive |
| US20040105994A1 (en) * | 2002-12-03 | 2004-06-03 | Pang-Chia Lu | Thermoplastic film structures with a low melting point outer layer |
| US20040229990A1 (en) * | 2003-05-16 | 2004-11-18 | Lord Corporation | Acrylic structural adhesive having improved T-peel strength |
| US20040242817A1 (en) * | 2003-05-29 | 2004-12-02 | Lord Corporation | Internally coordinated organoboranes |
| US7060327B2 (en) * | 2003-11-13 | 2006-06-13 | Henkel Corporation | Corrosion protective methacrylate adhesives for galvanized steel and other metals |
| EP1732707B1 (en) | 2004-03-19 | 2015-04-22 | Commonwealth Scientific and Industrial Research Organisation | Activation method |
| US20050244216A1 (en) * | 2004-04-29 | 2005-11-03 | Michael Magraw | Coupler |
| EP1828335B1 (en) | 2005-01-21 | 2010-03-10 | Commonwealth Scientific And Industrial Research Organisation | Activation method using modifying agent |
| ATE430788T1 (de) * | 2005-05-19 | 2009-05-15 | Lord Corp | Bei raumtemperatur härtbares, schützendes dichtungsmittel |
| EP2363443B1 (en) * | 2005-12-15 | 2020-11-18 | Huntsman Advanced Materials Licensing (Switzerland) GmbH | Multiphase acrylic adhesives |
| US20070155899A1 (en) * | 2005-12-21 | 2007-07-05 | Ips Corporation | Elastic methacrylate compositions |
| US20070155879A1 (en) * | 2005-12-22 | 2007-07-05 | Ips Corporation | Adhesive compositions for bonding metals |
| EP2223982B1 (en) | 2006-07-21 | 2012-01-04 | Hitachi Chemical Co., Ltd. | Circuit connection material, circuit member connecting structure and method of connecting circuit member |
| CA2657991C (en) | 2006-07-28 | 2015-04-07 | Lord Corporation | Dual cure adhesive formulations |
| US20080305345A1 (en) * | 2007-06-06 | 2008-12-11 | Peter William Uhlianuk | Protective coating composition for a metal substrate and a process for coating same |
| US20080305270A1 (en) * | 2007-06-06 | 2008-12-11 | Peter William Uhlianuk | Protective coating composition and a process for applying same |
| FR2928931B1 (fr) | 2008-03-21 | 2011-03-25 | Jacret | Composition pour adhesif structural |
| EP2177553A1 (de) | 2008-10-17 | 2010-04-21 | Sika Technology AG | Radikalisch härtbare Zusammensetzungen mit reduzierter Weichmacheraufnahme |
| US20100113674A1 (en) * | 2008-10-31 | 2010-05-06 | Strand Richard M | Methacrylate adhesive |
| US8362120B2 (en) | 2009-02-02 | 2013-01-29 | Lord Corporation | Structural adhesives containing maleimide terminated polyimides |
| US7932323B1 (en) * | 2009-11-04 | 2011-04-26 | Equistar Chemicals, Lp | Polyolefin-based adhesives having improved oxidative stability |
| GB201005444D0 (en) | 2010-03-31 | 2010-05-19 | 3M Innovative Properties Co | Epoxy adhesive compositions comprising an adhesion promoter |
| DE102011014731A1 (de) * | 2011-03-22 | 2012-09-27 | Stüwa Konrad Stükerjürgen GmbH | Brunnenfiltersegment |
| CA2830584C (en) | 2011-03-29 | 2015-12-22 | Exxonmobil Chemical Patents Inc. | Dynamically vulcanized thermoplastic elastomer laminates |
| DE102011088123A1 (de) | 2011-12-09 | 2013-06-13 | Henkel Ag & Co. Kgaa | Verfahren zum stoffschlüssigen Verbinden von Kunststoff-Rohren |
| US8859098B2 (en) * | 2012-05-18 | 2014-10-14 | Lord Corporation | Acrylic adhesion promoters |
| EP2877544A1 (en) | 2012-07-25 | 2015-06-03 | LORD Corporation | Improved post-vulcanization bonding |
| EP3119822B1 (en) | 2014-03-19 | 2019-09-25 | LORD Corporation | Amine co-accelerator for acrylic adhesives |
| WO2017079426A1 (en) | 2015-11-03 | 2017-05-11 | Lord Corporation | Elastomer adhesive with rapid tack development |
| CN109072032B (zh) | 2017-02-22 | 2021-01-05 | 株式会社Lg化学 | 粘合剂组合物 |
| KR102157352B1 (ko) | 2017-05-02 | 2020-09-17 | 주식회사 엘지화학 | 이액형 접착제 조성물 |
| KR102136705B1 (ko) | 2017-06-02 | 2020-07-22 | 주식회사 엘지화학 | 이액형 접착제 조성물 |
| KR102628558B1 (ko) * | 2017-09-12 | 2024-01-25 | 디디피 스페셜티 일렉트로닉 머티리얼즈 유에스, 엘엘씨 | 접착제 제형 |
| US12325811B2 (en) | 2017-12-18 | 2025-06-10 | Threebond Co., Ltd. | Radical-polymerizable adhesive composition for laminating and bonding steel plates, adhesive laminate, motor, and method for manufacturing adhesive laminate |
| US10954414B2 (en) * | 2017-12-28 | 2021-03-23 | Nitto Denko Corporation | Method for producing glass unit and pressure-sensitive adhesive sheet |
| FR3084370B1 (fr) | 2018-07-24 | 2021-03-05 | Jacret | Composition pour adhesif structural |
| US20210301183A1 (en) | 2020-03-24 | 2021-09-30 | Illinois Tool Works Inc. | Low surface energy accelerated bonding adhesive formulation and process for the use thereof |
| US20230086092A1 (en) * | 2021-09-17 | 2023-03-23 | Z Technologies Corporation | Solvent reducable urethane coating |
| MX2024004930A (es) * | 2021-11-01 | 2024-05-06 | Three Bond Co Ltd | Composicion anaerobicamente curable. |
| KR20250025621A (ko) | 2022-06-17 | 2025-02-24 | 헨켈 아게 운트 코. 카게아아 | 2 성분 (2k) 경화성 접착제 조성물 |
| EP4481913A1 (en) | 2023-06-20 | 2024-12-25 | Henkel AG & Co. KGaA | Electronics assembly having electrochemically debondable components |
| CN117343564B (zh) * | 2023-09-06 | 2025-09-19 | 潍柴动力股份有限公司 | 一种铸渗涂料及其制备方法、带有铸渗层的进气道 |
| WO2025093205A1 (en) | 2023-10-31 | 2025-05-08 | Henkel Ag & Co. Kgaa | Two component (2k) curable and debondable adhesive composition |
| EP4566808A1 (en) | 2023-12-06 | 2025-06-11 | Henkel AG & Co. KGaA | Bonded structure comprising an electrochemically debondable adhesive |
| EP4567085A1 (en) | 2023-12-08 | 2025-06-11 | Henkel AG & Co. KGaA | Electrochemically debondable adhesive film |
| JP7757573B1 (ja) * | 2024-03-18 | 2025-10-21 | セメダイン株式会社 | 鋼板積層体の製法、鋼板積層体及び接着剤組成物 |
| EP4644474A1 (en) | 2024-04-30 | 2025-11-05 | Henkel AG & Co. KGaA | Two component (2k) curable adhesive composition |
| EP4644475A1 (en) | 2024-04-30 | 2025-11-05 | Henkel AG & Co. KGaA | Cured film adhesive |
| EP4644502A1 (en) | 2024-04-30 | 2025-11-05 | Henkel AG & Co. KGaA | Electrochemically debondable adhesive film |
| EP4644500A1 (en) | 2024-04-30 | 2025-11-05 | Henkel AG & Co. KGaA | Two-component (2k) curable adhesive composition |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1123419B (de) * | 1960-09-27 | 1962-02-08 | Degussa | Verfahren zum Verkleben von Metallen |
| US3160618A (en) * | 1961-11-03 | 1964-12-08 | Monsanto Co | Molecular weight regulation in polymerization of vinylidene monomers using acid phosphates as regulators |
| NL124155C (enExample) * | 1965-07-23 | |||
| JPS5310636B1 (enExample) * | 1971-07-01 | 1978-04-14 | ||
| US3845009A (en) * | 1972-02-03 | 1974-10-29 | Johnson & Johnson | Cement compositions employing novel methacrylate monomer |
| US3970505A (en) * | 1973-01-15 | 1976-07-20 | Loctite Corporation | Anaerobic compositions and surface activator therefor |
| US3984500A (en) * | 1974-01-08 | 1976-10-05 | Ford Motor Company | Radiation polymerizable coating composition containing an unsaturated phosphoric ester |
| JPS5713594B2 (enExample) * | 1974-06-05 | 1982-03-18 | ||
| JPS51132234A (en) * | 1975-04-21 | 1976-11-17 | Suriibondo:Kk | An anaerobic adhesive composition |
| US3994764A (en) * | 1975-06-13 | 1976-11-30 | Pratt & Lambert, Inc. | Adhesive compositions |
| US4081308A (en) * | 1977-07-27 | 1978-03-28 | National Starch And Chemical Corporation | Rapid curing two part adhesives |
-
1978
- 1978-04-24 US US05/899,621 patent/US4223115A/en not_active Expired - Lifetime
-
1979
- 1979-03-19 ZA ZA791288A patent/ZA791288B/xx unknown
- 1979-03-27 CA CA000324223A patent/CA1138149A/en not_active Expired
- 1979-04-20 NO NO791332A patent/NO154523C/no unknown
- 1979-04-23 SE SE7903533A patent/SE448549B/sv not_active IP Right Cessation
- 1979-04-23 FR FR7910200A patent/FR2438080A1/fr active Granted
- 1979-04-24 DE DE2916537A patent/DE2916537C2/de not_active Expired
- 1979-04-24 BE BE0/194802A patent/BE875813A/xx not_active IP Right Cessation
- 1979-04-24 NL NLAANVRAGE7903233,A patent/NL187817C/xx not_active IP Right Cessation
- 1979-04-24 AT AT0307379A patent/AT376233B/de not_active IP Right Cessation
- 1979-04-24 GB GB7914182A patent/GB2019415B/en not_active Expired
- 1979-04-24 JP JP5074879A patent/JPS54141826A/ja active Granted
- 1979-04-24 DK DK167679A patent/DK167679A/da not_active IP Right Cessation
- 1979-04-24 CH CH3839/79A patent/CH666693A5/de not_active IP Right Cessation
- 1979-04-24 IT IT22123/79A patent/IT1112576B/it active
-
1980
- 1980-01-09 FR FR8000394A patent/FR2438081A1/fr active Granted
- 1980-01-09 FR FR8000393A patent/FR2438077A1/fr active Granted
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5932627A (en) | 1994-05-12 | 1999-08-03 | Dentsply Gmbh | Fluoride releasing dental primer composition and method |
Also Published As
| Publication number | Publication date |
|---|---|
| NL7903233A (nl) | 1979-10-26 |
| SE7903533L (sv) | 1979-10-25 |
| NO791332L (no) | 1979-10-25 |
| ATA307379A (de) | 1984-03-15 |
| AT376233B (de) | 1984-10-25 |
| FR2438077A1 (fr) | 1980-04-30 |
| JPH039155B2 (enExample) | 1991-02-07 |
| GB2019415B (en) | 1982-10-20 |
| SE448549B (sv) | 1987-03-02 |
| NO154523C (no) | 1986-10-08 |
| FR2438081A1 (fr) | 1980-04-30 |
| BE875813A (fr) | 1979-10-24 |
| IT1112576B (it) | 1986-01-20 |
| FR2438080B1 (enExample) | 1984-11-16 |
| FR2438081B1 (enExample) | 1983-11-04 |
| ZA791288B (en) | 1980-05-28 |
| NL187817C (nl) | 1992-01-16 |
| NO154523B (no) | 1986-06-30 |
| JPS54141826A (en) | 1979-11-05 |
| US4223115A (en) | 1980-09-16 |
| DE2916537A1 (de) | 1979-10-31 |
| DK167679A (da) | 1980-10-25 |
| GB2019415A (en) | 1979-10-31 |
| IT7922123A0 (it) | 1979-04-24 |
| FR2438080A1 (fr) | 1980-04-30 |
| DE2916537C2 (de) | 1986-02-20 |
| CH666693A5 (de) | 1988-08-15 |
| FR2438077B1 (enExample) | 1985-03-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1138149A (en) | Structural adhesive formulations | |
| CA1188840A (en) | Structural adhesive formulations | |
| US4467071A (en) | Epoxy modified structural adhesives having improved heat resistance | |
| CA1329296C (en) | Modified structural adhesives | |
| US4293665A (en) | Structural adhesive formulations | |
| US4574142A (en) | Curable adhesive composition toughened with styrene-butadiene block copolymer rubbers | |
| US6225408B1 (en) | Adhesive formulations | |
| EP0951517B1 (en) | Additives for controlling cure rate of polymerizable composition | |
| US4451615A (en) | Polyisoprene toughened adhesive composition | |
| AU758788B2 (en) | Adhesive formulations | |
| US5096962A (en) | Acrylic adhesive compositions | |
| EP0158462B1 (en) | Ambient temperature curable structure adhesive compositions and a method of adhering one metal surface to another using the same | |
| US6559257B2 (en) | Adhesive formulations | |
| EP0167223A1 (en) | Structural adhesive compositions, three component redox catalyst systems and their use in bonding metal surfaces together | |
| KR820001590B1 (ko) | 건축용 접착제 조성물 | |
| KR820001836B1 (ko) | 건축용 접착제 조성물 | |
| EP1190011A2 (en) | Adhesive formulations |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |