CA1122218A - 1,2-dihydroquinolin-2-one derivatives - Google Patents
1,2-dihydroquinolin-2-one derivativesInfo
- Publication number
- CA1122218A CA1122218A CA000329712A CA329712A CA1122218A CA 1122218 A CA1122218 A CA 1122218A CA 000329712 A CA000329712 A CA 000329712A CA 329712 A CA329712 A CA 329712A CA 1122218 A CA1122218 A CA 1122218A
- Authority
- CA
- Canada
- Prior art keywords
- oxo
- dihydroquinoline
- piperazin
- methyl
- propoxy
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- LISFMEBWQUVKPJ-UHFFFAOYSA-N quinolin-2-ol Chemical class C1=CC=C2NC(=O)C=CC2=C1 LISFMEBWQUVKPJ-UHFFFAOYSA-N 0.000 title claims abstract description 20
- 150000003839 salts Chemical class 0.000 claims abstract description 16
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 14
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 11
- 239000002253 acid Substances 0.000 claims abstract description 10
- HZVOZRGWRWCICA-UHFFFAOYSA-N methanediyl Chemical compound [CH2] HZVOZRGWRWCICA-UHFFFAOYSA-N 0.000 claims abstract description 9
- 150000007522 mineralic acids Chemical class 0.000 claims abstract description 6
- 231100000252 nontoxic Toxicity 0.000 claims abstract description 6
- 230000003000 nontoxic effect Effects 0.000 claims abstract description 6
- 150000007524 organic acids Chemical class 0.000 claims abstract description 6
- 125000005843 halogen group Chemical group 0.000 claims abstract description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 5
- 239000001257 hydrogen Substances 0.000 claims abstract description 5
- 238000000034 method Methods 0.000 claims description 55
- 239000000126 substance Substances 0.000 claims description 22
- 150000001875 compounds Chemical class 0.000 claims description 15
- GQMHYGCWUDYARM-UHFFFAOYSA-N 1-[(4-chlorophenyl)methyl]-4-(3-chloropropyl)piperazine Chemical compound C1CN(CCCCl)CCN1CC1=CC=C(Cl)C=C1 GQMHYGCWUDYARM-UHFFFAOYSA-N 0.000 claims description 13
- MYEVEFULPUKTSZ-UHFFFAOYSA-N 7-hydroxy-4-methyl-1H-quinolin-2-one Chemical compound OC1=CC=C2C(C)=CC(=O)NC2=C1 MYEVEFULPUKTSZ-UHFFFAOYSA-N 0.000 claims description 10
- 238000006243 chemical reaction Methods 0.000 claims description 10
- 150000004885 piperazines Chemical class 0.000 claims description 9
- MLWJMEZPVTZSKE-UHFFFAOYSA-N 6-hydroxy-4-methyl-1h-quinolin-2-one Chemical compound C1=C(O)C=C2C(C)=CC(=O)NC2=C1 MLWJMEZPVTZSKE-UHFFFAOYSA-N 0.000 claims description 8
- 229910052801 chlorine Inorganic materials 0.000 claims description 7
- 239000000460 chlorine Substances 0.000 claims description 7
- 239000002904 solvent Substances 0.000 claims description 7
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 claims description 4
- 229960001760 dimethyl sulfoxide Drugs 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 3
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 3
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 claims description 3
- 229910052731 fluorine Inorganic materials 0.000 claims description 3
- 239000011737 fluorine Substances 0.000 claims description 3
- 125000005905 mesyloxy group Chemical group 0.000 claims description 3
- NDQKGEFMUGSRNS-UHFFFAOYSA-N 1-(3-chlorophenyl)-4-(3-chloropropyl)piperazine Chemical compound C1CN(CCCCl)CCN1C1=CC=CC(Cl)=C1 NDQKGEFMUGSRNS-UHFFFAOYSA-N 0.000 claims description 2
- CFGYCZCDJBNISG-UHFFFAOYSA-N 1-(3-chloropropyl)-4-[(2-methoxyphenyl)methyl]piperazine Chemical compound COC1=CC=CC=C1CN1CCN(CCCCl)CC1 CFGYCZCDJBNISG-UHFFFAOYSA-N 0.000 claims description 2
- KULRQQDUKMJDJH-UHFFFAOYSA-N 1-(3-chloropropyl)-4-[(2-propoxyphenyl)methyl]piperazine Chemical compound CCCOC1=CC=CC=C1CN1CCN(CCCCl)CC1 KULRQQDUKMJDJH-UHFFFAOYSA-N 0.000 claims description 2
- LGDYIRVVBRQQIU-UHFFFAOYSA-N 1-(3-chloropropyl)-4-[(3-methoxyphenyl)methyl]piperazine Chemical compound COC1=CC=CC(CN2CCN(CCCCl)CC2)=C1 LGDYIRVVBRQQIU-UHFFFAOYSA-N 0.000 claims description 2
- OIMXWBXBBASKAL-UHFFFAOYSA-N 1-(3-chloropropyl)-4-[(4-fluorophenyl)methyl]piperazine Chemical compound C1=CC(F)=CC=C1CN1CCN(CCCCl)CC1 OIMXWBXBBASKAL-UHFFFAOYSA-N 0.000 claims description 2
- DFBLBPFSFUPYJN-UHFFFAOYSA-N 1-(3-chloropropyl)-4-[(4-methoxyphenyl)methyl]piperazine Chemical compound C1=CC(OC)=CC=C1CN1CCN(CCCCl)CC1 DFBLBPFSFUPYJN-UHFFFAOYSA-N 0.000 claims description 2
- FNPMXZQPFBMFEB-UHFFFAOYSA-N 1-(3-chloropropyl)-4-[(4-methylphenyl)methyl]piperazine Chemical compound C1=CC(C)=CC=C1CN1CCN(CCCCl)CC1 FNPMXZQPFBMFEB-UHFFFAOYSA-N 0.000 claims description 2
- GSJXJZOWHSTWOX-UHFFFAOYSA-N 1-[(4-chlorophenyl)methyl]piperazine Chemical compound C1=CC(Cl)=CC=C1CN1CCNCC1 GSJXJZOWHSTWOX-UHFFFAOYSA-N 0.000 claims description 2
- XOSNEZPIANDZMR-UHFFFAOYSA-N 1-benzyl-4-(3-chloropropyl)piperazine Chemical compound C1CN(CCCCl)CCN1CC1=CC=CC=C1 XOSNEZPIANDZMR-UHFFFAOYSA-N 0.000 claims description 2
- TZMLKTJSHYZWOY-UHFFFAOYSA-N 3-butyl-7-hydroxy-4-methyl-1h-quinolin-2-one Chemical compound C1=C(O)C=C2NC(=O)C(CCCC)=C(C)C2=C1 TZMLKTJSHYZWOY-UHFFFAOYSA-N 0.000 claims description 2
- TUSXLRWSPGPMHW-UHFFFAOYSA-N 6-hydroxy-1,4-dimethylquinolin-2-one Chemical compound C1=C(O)C=C2C(C)=CC(=O)N(C)C2=C1 TUSXLRWSPGPMHW-UHFFFAOYSA-N 0.000 claims description 2
- HAAQRKWTDMETIA-UHFFFAOYSA-N 7-[3-(4-benzylpiperazin-1-yl)propoxy]-4-methyl-1h-quinolin-2-one Chemical compound C=1C=C2C(C)=CC(=O)NC2=CC=1OCCCN(CC1)CCN1CC1=CC=CC=C1 HAAQRKWTDMETIA-UHFFFAOYSA-N 0.000 claims description 2
- RXBXOOULDWYQMY-UHFFFAOYSA-N 7-hydroxy-3,4-dimethyl-1h-quinolin-2-one Chemical compound OC1=CC=C2C(C)=C(C)C(=O)NC2=C1 RXBXOOULDWYQMY-UHFFFAOYSA-N 0.000 claims description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 2
- 239000003513 alkali Substances 0.000 claims description 2
- 239000011591 potassium Substances 0.000 claims description 2
- 229910052700 potassium Inorganic materials 0.000 claims description 2
- AQLYZDRHNHZHIS-UHFFFAOYSA-N quinoline-2,6-diol Chemical compound N1C(=O)C=CC2=CC(O)=CC=C21 AQLYZDRHNHZHIS-UHFFFAOYSA-N 0.000 claims description 2
- 150000003512 tertiary amines Chemical class 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims 4
- HIEZPWBQOHPHHO-UHFFFAOYSA-N 3-butyl-7-[3-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]propoxy]-4-methyl-1h-quinolin-2-one Chemical compound C1=C2NC(=O)C(CCCC)=C(C)C2=CC=C1OCCCN(CC1)CCN1CC1=CC=C(Cl)C=C1 HIEZPWBQOHPHHO-UHFFFAOYSA-N 0.000 claims 3
- RIXNISPGHIFOBF-UHFFFAOYSA-N 4-methyl-6-[3-[4-[(2-propoxyphenyl)methyl]piperazin-1-yl]propoxy]-1h-quinolin-2-one Chemical compound CCCOC1=CC=CC=C1CN1CCN(CCCOC=2C=C3C(C)=CC(=O)NC3=CC=2)CC1 RIXNISPGHIFOBF-UHFFFAOYSA-N 0.000 claims 2
- DIVQYUXYCIMKJA-UHFFFAOYSA-N 4-methyl-6-[3-[4-[(4-methylphenyl)methyl]piperazin-1-yl]propoxy]-1h-quinolin-2-one Chemical compound C1=CC(C)=CC=C1CN1CCN(CCCOC=2C=C3C(C)=CC(=O)NC3=CC=2)CC1 DIVQYUXYCIMKJA-UHFFFAOYSA-N 0.000 claims 2
- MKHVEEJFCLICLI-UHFFFAOYSA-N 6-[3-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]propoxy]-1,4-dimethylquinolin-2-one Chemical compound C1=C2C(C)=CC(=O)N(C)C2=CC=C1OCCCN(CC1)CCN1CC1=CC=C(Cl)C=C1 MKHVEEJFCLICLI-UHFFFAOYSA-N 0.000 claims 2
- ZPDRWQZDLBFSSQ-UHFFFAOYSA-N 6-[3-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]propoxy]-1h-quinolin-2-one Chemical compound C1=CC(Cl)=CC=C1CN1CCN(CCCOC=2C=C3C=CC(=O)NC3=CC=2)CC1 ZPDRWQZDLBFSSQ-UHFFFAOYSA-N 0.000 claims 2
- QAJIPUFOYYZWON-UHFFFAOYSA-N 6-[3-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]propoxy]-4-methyl-1h-quinolin-2-one Chemical compound C1=C2C(C)=CC(=O)NC2=CC=C1OCCCN(CC1)CCN1CC1=CC=C(Cl)C=C1 QAJIPUFOYYZWON-UHFFFAOYSA-N 0.000 claims 2
- JCQXOHGXAODGGU-UHFFFAOYSA-N 6-[3-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]propoxy]-4-methyl-1h-quinolin-2-one Chemical compound C1=C2C(C)=CC(=O)NC2=CC=C1OCCCN(CC1)CCN1CC1=CC=C(F)C=C1 JCQXOHGXAODGGU-UHFFFAOYSA-N 0.000 claims 2
- USMYLSISQGWEIK-UHFFFAOYSA-N 6-[3-[4-[(4-tert-butylphenyl)methyl]piperazin-1-yl]propoxy]-4-methyl-1h-quinolin-2-one Chemical compound C1=C2C(C)=CC(=O)NC2=CC=C1OCCCN(CC1)CCN1CC1=CC=C(C(C)(C)C)C=C1 USMYLSISQGWEIK-UHFFFAOYSA-N 0.000 claims 2
- VZHFISFBRKTVHA-UHFFFAOYSA-N 7-[3-(4-benzhydrylpiperazin-1-yl)propoxy]-4-methyl-1h-quinolin-2-one Chemical compound C=1C=C2C(C)=CC(=O)NC2=CC=1OCCCN(CC1)CCN1C(C=1C=CC=CC=1)C1=CC=CC=C1 VZHFISFBRKTVHA-UHFFFAOYSA-N 0.000 claims 2
- MJWXLMMRJXKNNG-UHFFFAOYSA-N 7-[3-[4-(3-chlorophenyl)piperazin-1-yl]propoxy]-4-methyl-1h-quinolin-2-one Chemical compound C=1C=C2C(C)=CC(=O)NC2=CC=1OCCCN(CC1)CCN1C1=CC=CC(Cl)=C1 MJWXLMMRJXKNNG-UHFFFAOYSA-N 0.000 claims 2
- LCCTZXMYVQICSZ-UHFFFAOYSA-N 7-[3-[4-[(2-methoxyphenyl)methyl]piperazin-1-yl]propoxy]-4-methyl-1h-quinolin-2-one Chemical compound COC1=CC=CC=C1CN1CCN(CCCOC=2C=C3NC(=O)C=C(C)C3=CC=2)CC1 LCCTZXMYVQICSZ-UHFFFAOYSA-N 0.000 claims 2
- UUIBZEVSXTXQFL-UHFFFAOYSA-N 7-[3-[4-[(3-methoxyphenyl)methyl]piperazin-1-yl]propoxy]-4-methyl-1h-quinolin-2-one Chemical compound COC1=CC=CC(CN2CCN(CCCOC=3C=C4NC(=O)C=C(C)C4=CC=3)CC2)=C1 UUIBZEVSXTXQFL-UHFFFAOYSA-N 0.000 claims 2
- QYAHLRCILCKBTO-UHFFFAOYSA-N 7-[3-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]propoxy]-1,4-dimethylquinolin-2-one Chemical compound C=1C=C2C(C)=CC(=O)N(C)C2=CC=1OCCCN(CC1)CCN1CC1=CC=C(Cl)C=C1 QYAHLRCILCKBTO-UHFFFAOYSA-N 0.000 claims 2
- RKXISSGMJCPKRG-UHFFFAOYSA-N 7-[3-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]propoxy]-4-methyl-1h-quinolin-2-one Chemical compound C=1C=C2C(C)=CC(=O)NC2=CC=1OCCCN(CC1)CCN1CC1=CC=C(Cl)C=C1 RKXISSGMJCPKRG-UHFFFAOYSA-N 0.000 claims 2
- SIAJZNTXEPLBER-UHFFFAOYSA-N 7-[3-[4-[(4-methoxyphenyl)methyl]piperazin-1-yl]propoxy]-4-methyl-1h-quinolin-2-one Chemical compound C1=CC(OC)=CC=C1CN1CCN(CCCOC=2C=C3NC(=O)C=C(C)C3=CC=2)CC1 SIAJZNTXEPLBER-UHFFFAOYSA-N 0.000 claims 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims 2
- 229910052794 bromium Inorganic materials 0.000 claims 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims 2
- 125000005424 tosyloxy group Chemical group S(=O)(=O)(C1=CC=C(C)C=C1)O* 0.000 claims 2
- RYIHZKCTNCEMFQ-UHFFFAOYSA-N 1-[(4-tert-butylphenyl)methyl]-4-(3-chloropropyl)piperazine Chemical compound C1=CC(C(C)(C)C)=CC=C1CN1CCN(CCCCl)CC1 RYIHZKCTNCEMFQ-UHFFFAOYSA-N 0.000 claims 1
- NCXYITBAJJDJMN-UHFFFAOYSA-N 3-butyl-7-(3-chloropropoxy)-4-methyl-1h-quinolin-2-one Chemical compound C1=C(OCCCCl)C=C2NC(=O)C(CCCC)=C(C)C2=C1 NCXYITBAJJDJMN-UHFFFAOYSA-N 0.000 claims 1
- BOBQMVGDGXUMEL-UHFFFAOYSA-N 7-[3-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]propoxy]-3,4-dimethyl-1h-quinolin-2-one Chemical compound C=1C=C2C(C)=C(C)C(=O)NC2=CC=1OCCCN(CC1)CCN1CC1=CC=C(Cl)C=C1 BOBQMVGDGXUMEL-UHFFFAOYSA-N 0.000 claims 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 1
- -1 phenyl-substituted methylene Chemical group 0.000 abstract description 12
- 241000700159 Rattus Species 0.000 abstract description 6
- 206010002198 Anaphylactic reaction Diseases 0.000 abstract description 5
- 208000003455 anaphylaxis Diseases 0.000 abstract description 5
- 235000005985 organic acids Nutrition 0.000 abstract description 4
- 230000000144 pharmacologic effect Effects 0.000 abstract description 4
- 230000036783 anaphylactic response Effects 0.000 abstract description 3
- 230000003266 anti-allergic effect Effects 0.000 abstract description 3
- 238000001727 in vivo Methods 0.000 abstract 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 15
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 15
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 11
- 239000000155 melt Substances 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 239000002585 base Substances 0.000 description 8
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 7
- 239000000243 solution Substances 0.000 description 7
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- 241001465754 Metazoa Species 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- 210000002966 serum Anatomy 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 4
- 238000002347 injection Methods 0.000 description 4
- 239000007924 injection Substances 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000000427 antigen Substances 0.000 description 3
- 102000036639 antigens Human genes 0.000 description 3
- 108091007433 antigens Proteins 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 230000005764 inhibitory process Effects 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 239000008194 pharmaceutical composition Substances 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- IRFSXVIRXMYULF-UHFFFAOYSA-N 1,2-dihydroquinoline Chemical compound C1=CC=C2C=CCNC2=C1 IRFSXVIRXMYULF-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- 108010058846 Ovalbumin Proteins 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 239000011149 active material Substances 0.000 description 2
- 230000000172 allergic effect Effects 0.000 description 2
- 208000010668 atopic eczema Diseases 0.000 description 2
- 239000000872 buffer Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 239000012895 dilution Substances 0.000 description 2
- 229920006158 high molecular weight polymer Polymers 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 238000010534 nucleophilic substitution reaction Methods 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 238000012797 qualification Methods 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 2
- LNAZSHAWQACDHT-XIYTZBAFSA-N (2r,3r,4s,5r,6s)-4,5-dimethoxy-2-(methoxymethyl)-3-[(2s,3r,4s,5r,6r)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6r)-4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane Chemical compound CO[C@@H]1[C@@H](OC)[C@H](OC)[C@@H](COC)O[C@H]1O[C@H]1[C@H](OC)[C@@H](OC)[C@H](O[C@H]2[C@@H]([C@@H](OC)[C@H](OC)O[C@@H]2COC)OC)O[C@@H]1COC LNAZSHAWQACDHT-XIYTZBAFSA-N 0.000 description 1
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- NFNIRGPPIRJASP-UHFFFAOYSA-N 1-hydroxyquinolin-2-one Chemical compound C1=CC=C2C=CC(=O)N(O)C2=C1 NFNIRGPPIRJASP-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- ALFBCHRNOAVKOR-UHFFFAOYSA-N 7-hydroxy-1,4-dimethylquinolin-2-one Chemical compound OC1=CC=C2C(C)=CC(=O)N(C)C2=C1 ALFBCHRNOAVKOR-UHFFFAOYSA-N 0.000 description 1
- 208000035285 Allergic Seasonal Rhinitis Diseases 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- BTBUEUYNUDRHOZ-UHFFFAOYSA-N Borate Chemical compound [O-]B([O-])[O-] BTBUEUYNUDRHOZ-UHFFFAOYSA-N 0.000 description 1
- 241000588832 Bordetella pertussis Species 0.000 description 1
- COXVTLYNGOIATD-HVMBLDELSA-N CC1=C(C=CC(=C1)C1=CC(C)=C(C=C1)\N=N\C1=C(O)C2=C(N)C(=CC(=C2C=C1)S(O)(=O)=O)S(O)(=O)=O)\N=N\C1=CC=C2C(=CC(=C(N)C2=C1O)S(O)(=O)=O)S(O)(=O)=O Chemical compound CC1=C(C=CC(=C1)C1=CC(C)=C(C=C1)\N=N\C1=C(O)C2=C(N)C(=CC(=C2C=C1)S(O)(=O)=O)S(O)(=O)=O)\N=N\C1=CC=C2C(=CC(=C(N)C2=C1O)S(O)(=O)=O)S(O)(=O)=O COXVTLYNGOIATD-HVMBLDELSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- 206010030113 Oedema Diseases 0.000 description 1
- 201000005702 Pertussis Diseases 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 206010042674 Swelling Diseases 0.000 description 1
- 208000024780 Urticaria Diseases 0.000 description 1
- 230000003187 abdominal effect Effects 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- 230000001154 acute effect Effects 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 201000009961 allergic asthma Diseases 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 210000000702 aorta abdominal Anatomy 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 208000006673 asthma Diseases 0.000 description 1
- RFRXIWQYSOIBDI-UHFFFAOYSA-N benzarone Chemical compound CCC=1OC2=CC=CC=C2C=1C(=O)C1=CC=C(O)C=C1 RFRXIWQYSOIBDI-UHFFFAOYSA-N 0.000 description 1
- 230000033228 biological regulation Effects 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 238000000160 carbon, hydrogen and nitrogen elemental analysis Methods 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 230000001684 chronic effect Effects 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 230000001609 comparable effect Effects 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 229960001484 edetic acid Drugs 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 229960003699 evans blue Drugs 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- 210000003630 histaminocyte Anatomy 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- RFKMCNOHBTXSMU-UHFFFAOYSA-N methoxyflurane Chemical compound COC(F)(F)C(Cl)Cl RFKMCNOHBTXSMU-UHFFFAOYSA-N 0.000 description 1
- 229960002455 methoxyflurane Drugs 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 235000019198 oils Nutrition 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 239000004006 olive oil Substances 0.000 description 1
- 235000008390 olive oil Nutrition 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 229940066827 pertussis vaccine Drugs 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000001384 succinic acid Substances 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 230000008961 swelling Effects 0.000 description 1
- 208000011580 syndromic disease Diseases 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 238000002076 thermal analysis method Methods 0.000 description 1
- 238000011200 topical administration Methods 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
- C07D215/22—Oxygen atoms attached in position 2 or 4
- C07D215/227—Oxygen atoms attached in position 2 or 4 only one oxygen atom which is attached in position 2
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
- A61P37/08—Antiallergic agents
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
- C07D215/24—Oxygen atoms attached in position 8
- C07D215/26—Alcohols; Ethers thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Pulmonology (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Immunology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Quinoline Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19782827566 DE2827566A1 (de) | 1978-06-23 | 1978-06-23 | 1,2-dihydro-chinolin-2-on-derivate und verfahren zu ihrer herstellung |
| DEP2827566.3 | 1978-06-23 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1122218A true CA1122218A (en) | 1982-04-20 |
Family
ID=6042551
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000329712A Expired CA1122218A (en) | 1978-06-23 | 1979-06-13 | 1,2-dihydroquinolin-2-one derivatives |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US4234585A (OSRAM) |
| EP (1) | EP0006506B1 (OSRAM) |
| JP (1) | JPS552693A (OSRAM) |
| AT (1) | ATE224T1 (OSRAM) |
| CA (1) | CA1122218A (OSRAM) |
| CS (2) | CS207799B2 (OSRAM) |
| DE (2) | DE2827566A1 (OSRAM) |
| ES (1) | ES481729A1 (OSRAM) |
| HU (1) | HU177959B (OSRAM) |
| IL (1) | IL57577A (OSRAM) |
| PL (1) | PL115260B1 (OSRAM) |
| SU (1) | SU831077A3 (OSRAM) |
Families Citing this family (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS54130587A (en) * | 1978-03-30 | 1979-10-09 | Otsuka Pharmaceut Co Ltd | Carbostyryl derivative |
| JPS55162774A (en) * | 1979-06-06 | 1980-12-18 | Otsuka Pharmaceut Co Ltd | Carbostyril derivative |
| DE3034237A1 (de) * | 1979-09-18 | 1981-04-16 | Otsuka Pharmaceutical Co. Ltd., Tokyo | Carbostyrilderivate, verfahren zu ihrer herstellung und diese verbindungen enthaltende, antihistaminisch wirkende mittel |
| PH17194A (en) * | 1980-03-06 | 1984-06-19 | Otsuka Pharma Co Ltd | Novel carbostyril derivatives,and pharmaceutical composition containing the same |
| DE3033112A1 (de) * | 1980-09-03 | 1982-04-01 | Hochtemperatur-Reaktorbau GmbH, 5000 Köln | Atomkernreaktor |
| JPS57130210A (en) * | 1981-02-06 | 1982-08-12 | Kinseishiya Kk | Power switch noise remover for audio appliance |
| US4442111A (en) * | 1981-07-25 | 1984-04-10 | Dr. Karl Thomae Gesellschaft Mit Beschrankter Haftung | Antithrombotic sulfimino and sulfoximino indolinones-2 |
| DE3225169A1 (de) * | 1982-07-06 | 1984-01-12 | Basf Ag, 6700 Ludwigshafen | Chinolinderivate, verfahren zu ihrer herstellung, diese enthaltende mikrobizide und ihre verwendung zur bekaempfung von pilzen |
| DE3434271A1 (de) * | 1984-09-19 | 1986-03-20 | Beiersdorf Ag, 2000 Hamburg | Substituierte 3,4-dihydro-chinolin-2(1h)-one verfahren zu ihrer herstellung und ihre verwendung sowie diese verbindungen enthaltende zubereitungen |
| CN85108214A (zh) * | 1984-11-22 | 1986-08-20 | 赫彻斯特股份公司 | 新的取代的苯基哌嗪衍生物及其药物的制造方法 |
| GB8502267D0 (en) * | 1985-01-30 | 1985-02-27 | Pfizer Ltd | Quinolone inotropic agents |
| JPS63119467A (ja) * | 1987-10-21 | 1988-05-24 | Otsuka Pharmaceut Co Ltd | カルボスチリル誘導体 |
| US5006528A (en) * | 1988-10-31 | 1991-04-09 | Otsuka Pharmaceutical Co., Ltd. | Carbostyril derivatives |
| JP2608788B2 (ja) * | 1988-10-31 | 1997-05-14 | 大塚製薬 株式会社 | 精神分裂病治療剤 |
| US5457099A (en) * | 1992-07-02 | 1995-10-10 | Sawai Pharmaceutical Co., Ltd. | Carbostyril derivatives and antiallergic agent |
| DE4410822A1 (de) * | 1994-03-24 | 1995-09-28 | Schering Ag | Neue Piperidin-Derivate |
| CA2180190A1 (en) * | 1995-07-10 | 1997-01-11 | Kazumi Ogata | Benzylpiperazine derivatives |
| GB0203778D0 (en) * | 2002-02-18 | 2002-04-03 | Glaxo Group Ltd | Compounds |
| CN100497325C (zh) * | 2004-04-21 | 2009-06-10 | 齐鲁制药有限公司 | 哌嗪衍生物及其在制备喹啉酮衍生物中的用途 |
| TWI320783B (en) | 2005-04-14 | 2010-02-21 | Otsuka Pharma Co Ltd | Heterocyclic compound |
| CN101538252B (zh) * | 2008-03-20 | 2011-04-20 | 成都康弘药业集团股份有限公司 | 阿立哌唑的制备方法及其中间体 |
| CA2796755C (en) * | 2010-08-24 | 2015-10-27 | Otsuka Pharmaceutical Co., Ltd. | Suspension and cake composition containing carbostyryl derivative and silicone oil and/or silicone oil derivative |
| CA2872883A1 (en) * | 2012-05-09 | 2013-11-14 | Sunovion Pharmaceuticals Inc. | Heteroaryl compounds and methods of use thereof |
| CN109180577B (zh) * | 2018-10-15 | 2021-11-16 | 迪嘉药业集团有限公司 | 一种阿立哌唑的制备方法 |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH523899A (de) * | 1968-07-05 | 1972-06-15 | Cassella Farbwerke Mainkur Ag | Verfahren zur Herstellung von Derivaten des 2-Oxo-1,2-dihydro-chinolins |
| JPS48103590A (OSRAM) * | 1972-04-13 | 1973-12-25 | ||
| DE2337461A1 (de) * | 1973-07-24 | 1975-02-06 | Boehringer Mannheim Gmbh | Neue indolderivate und verfahren zu deren herstellung |
| GB1501149A (en) * | 1975-07-11 | 1978-02-15 | Nisshin Flour Milling Co | Isocarbostyril derivatives |
| JPS54130587A (en) * | 1978-03-30 | 1979-10-09 | Otsuka Pharmaceut Co Ltd | Carbostyryl derivative |
| JPS55124766A (en) * | 1979-03-20 | 1980-09-26 | Otsuka Pharmaceut Co Ltd | Antihistaminic |
-
1978
- 1978-06-23 DE DE19782827566 patent/DE2827566A1/de not_active Withdrawn
-
1979
- 1979-06-04 US US06/045,472 patent/US4234585A/en not_active Expired - Lifetime
- 1979-06-08 AT AT79101827T patent/ATE224T1/de not_active IP Right Cessation
- 1979-06-08 EP EP79101827A patent/EP0006506B1/de not_active Expired
- 1979-06-08 DE DE7979101827T patent/DE2960820D1/de not_active Expired
- 1979-06-13 CA CA000329712A patent/CA1122218A/en not_active Expired
- 1979-06-17 IL IL57577A patent/IL57577A/xx unknown
- 1979-06-18 PL PL1979216409A patent/PL115260B1/pl unknown
- 1979-06-20 ES ES481729A patent/ES481729A1/es not_active Expired
- 1979-06-21 CS CS798953A patent/CS207799B2/cs unknown
- 1979-06-21 CS CS794286A patent/CS207798B2/cs unknown
- 1979-06-22 HU HU79BO1793A patent/HU177959B/hu not_active IP Right Cessation
- 1979-06-22 SU SU792782353A patent/SU831077A3/ru active
- 1979-06-22 JP JP7823079A patent/JPS552693A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| PL216409A1 (OSRAM) | 1980-03-24 |
| CS207799B2 (en) | 1981-08-31 |
| EP0006506A1 (de) | 1980-01-09 |
| JPS552693A (en) | 1980-01-10 |
| IL57577A0 (en) | 1979-10-31 |
| ES481729A1 (es) | 1980-03-01 |
| HU177959B (en) | 1982-02-28 |
| JPS6331465B2 (OSRAM) | 1988-06-23 |
| EP0006506B1 (de) | 1981-09-16 |
| PL115260B1 (en) | 1981-03-31 |
| SU831077A3 (ru) | 1981-05-15 |
| ATE224T1 (de) | 1981-10-15 |
| CS207798B2 (en) | 1981-08-31 |
| DE2960820D1 (en) | 1981-12-03 |
| US4234585A (en) | 1980-11-18 |
| DE2827566A1 (de) | 1980-01-10 |
| IL57577A (en) | 1982-03-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1122218A (en) | 1,2-dihydroquinolin-2-one derivatives | |
| US5006528A (en) | Carbostyril derivatives | |
| Burckhalter et al. | Aminoalkylphenols as Antimalarials. II. 1 (Heterocyclic-amino)-α-amino-o-cresols. The Synthesis of Camoquin2 | |
| US4455422A (en) | Carbostyril derivatives and pharmaceutical composition containing the same | |
| US4824840A (en) | Carbostyril derivatives and pharmaceutical preparations containing same | |
| FI94413C (fi) | Menetelmä valmistaa terapeuttisesti aktiivisia 2-(1-piperatsinyyli)-4-fenyylisykloalkanopyridiinijohdannaisia | |
| CA1141385A (en) | Aryl ether piperidino derivatives | |
| EP0093521B1 (en) | Quinoline derivatives | |
| US4232024A (en) | 1-Oxo-1H-pyrimido[6,1-b]benzthiazole derivatives | |
| CA1208643A (en) | 1,5-diphenyl-pyrazolin-3-one compounds, process and intermediates for preparation thereof and pharmaceutical compositions containing them | |
| US3173918A (en) | Bis(x-quwolyl-piperazinyjl) compounds | |
| NO843292L (no) | Fremgangsmaate for fremstilling av nye kinolon-derivater | |
| US3644368A (en) | Novel quinolines | |
| US4010270A (en) | 4-Oxo-4H-pyrano[3,2-c]quinoline-2-carboxylic acids and salts thereof | |
| CA1095914A (en) | 4-hydroxy-2-quinolinone-3-carboxylic acid compounds | |
| US4263299A (en) | Heterocyclic coumarin derivatives | |
| US5981530A (en) | Piperazine derivative | |
| US2505462A (en) | Alkamine sulfides of quinoline and method of producing the same | |
| JPH07165720A (ja) | カルボスチリル誘導体及び該誘導体を含有する精神分裂病治療剤 | |
| KRUEGER et al. | STUDIES IN THE PHENANTHRENE SERIES. XXV. DIBENZO-[f, h] QUINOLINE AND 7-METHOXYDIBENZO-[f, h] QUINOLINE1 | |
| KR850001796B1 (ko) | 카르보스티릴 유도체의 제조방법 | |
| JPS6110574A (ja) | 6−フルオロ−1,4−ジヒドロ−4−オキソ−7−置換ピペラジニルキノリン−3−カルボン酸誘導体 | |
| JPS6160831B2 (OSRAM) | ||
| DK156432B (da) | 3-n-pyrrolo-5-sulfamoylbenzoesyre-derivater til anvendelse som mellemprodukter ved fremstilling af 3-n-pyrrolidino-5-sulfamoylbenzoesyre-derivater |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |