CA1089489A - Water-soluble, non ionic radioopaque contrast agents (x-ray contrast agents) and process for their production - Google Patents
Water-soluble, non ionic radioopaque contrast agents (x-ray contrast agents) and process for their productionInfo
- Publication number
- CA1089489A CA1089489A CA298,854A CA298854A CA1089489A CA 1089489 A CA1089489 A CA 1089489A CA 298854 A CA298854 A CA 298854A CA 1089489 A CA1089489 A CA 1089489A
- Authority
- CA
- Canada
- Prior art keywords
- amino
- triiodo
- aminocarbonyl
- bis
- methyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 34
- 239000002872 contrast media Substances 0.000 title description 4
- 238000004519 manufacturing process Methods 0.000 title description 2
- 150000001875 compounds Chemical class 0.000 claims abstract description 45
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 5
- 239000001257 hydrogen Substances 0.000 claims abstract description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 4
- 125000004990 dihydroxyalkyl group Chemical group 0.000 claims abstract description 4
- -1 1,3-dihydroxy-2-methyl-2-propyl Chemical group 0.000 claims description 18
- 239000000126 substance Substances 0.000 claims description 15
- 150000008064 anhydrides Chemical class 0.000 claims description 7
- VVODXPFIWOSTQB-UHFFFAOYSA-N 3-amino-2,4,6-triiodobenzoyl chloride Chemical compound NC1=C(I)C=C(I)C(C(Cl)=O)=C1I VVODXPFIWOSTQB-UHFFFAOYSA-N 0.000 claims description 6
- 239000002253 acid Substances 0.000 claims description 5
- NXUWAAUAPCWASM-UHFFFAOYSA-N n-methyl-3-[2-[2-[2-[3-(methylamino)propoxy]ethoxy]ethoxy]ethoxy]propan-1-amine Chemical compound CNCCCOCCOCCOCCOCCCNC NXUWAAUAPCWASM-UHFFFAOYSA-N 0.000 claims description 5
- FVUIAOHMTFHVTE-UHFFFAOYSA-N 3-[2-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]ethoxy]propan-1-amine Chemical compound NCCCOCCOCCOCCOCCCN FVUIAOHMTFHVTE-UHFFFAOYSA-N 0.000 claims description 4
- IFZOPNLVYZYSMQ-UHFFFAOYSA-N 2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethanamine Chemical compound NCCOCCOCCOCCOCCN IFZOPNLVYZYSMQ-UHFFFAOYSA-N 0.000 claims description 3
- 125000001589 carboacyl group Chemical group 0.000 claims description 3
- GXVUZYLYWKWJIM-UHFFFAOYSA-N 2-(2-aminoethoxy)ethanamine Chemical compound NCCOCCN GXVUZYLYWKWJIM-UHFFFAOYSA-N 0.000 claims description 2
- 239000000460 chlorine Substances 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- SVXRQSNCKDZGGW-UHFFFAOYSA-N 3-n-(1,3-dihydroxy-2-methylpropan-2-yl)-1-n-[2-[2-[[3-[(1,3-dihydroxy-2-methylpropan-2-yl)carbamoyl]-5-(2-hydroxypropanoylamino)-2,4,6-triiodobenzoyl]amino]ethoxy]ethyl]-5-(2-hydroxypropanoylamino)-2,4,6-triiodobenzene-1,3-dicarboxamide Chemical compound OCC(C)(CO)NC(=O)C1=C(I)C(NC(=O)C(O)C)=C(I)C(C(=O)NCCOCCNC(=O)C=2C(=C(C(=O)NC(C)(CO)CO)C(I)=C(NC(=O)C(C)O)C=2I)I)=C1I SVXRQSNCKDZGGW-UHFFFAOYSA-N 0.000 claims 2
- XMJIAMIJAGSNSM-UHFFFAOYSA-N 1-(2-aminoethoxy)-2-[2-(2-ethoxyethoxy)ethoxy]ethanamine Chemical compound CCOCCOCCOCC(N)OCCN XMJIAMIJAGSNSM-UHFFFAOYSA-N 0.000 claims 1
- NIQFAJBKEHPUAM-UHFFFAOYSA-N 2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethanamine Chemical compound NCCOCCOCCOCCN NIQFAJBKEHPUAM-UHFFFAOYSA-N 0.000 claims 1
- AEOSOPDTXCTDRD-UHFFFAOYSA-N 3-n-(1,3-dihydroxy-2-methylpropan-2-yl)-1-n-[3-[2-[2-[2-[3-[[3-[(1,3-dihydroxy-2-methylpropan-2-yl)carbamoyl]-5-(2-hydroxypropanoylamino)-2,4,6-triiodobenzoyl]amino]propoxy]ethoxy]ethoxy]ethoxy]propyl]-5-(2-hydroxypropanoylamino)-2,4,6-triiodobenzene-1,3- Chemical compound OCC(C)(CO)NC(=O)C1=C(I)C(NC(=O)C(O)C)=C(I)C(C(=O)NCCCOCCOCCOCCOCCCNC(=O)C=2C(=C(C(=O)NC(C)(CO)CO)C(I)=C(NC(=O)C(C)O)C=2I)I)=C1I AEOSOPDTXCTDRD-UHFFFAOYSA-N 0.000 claims 1
- CAGLPRVLXOQLRR-UHFFFAOYSA-N [1-[3-carbonochloridoyl-5-[(1,3-dihydroxy-2-methylpropan-2-yl)carbamoyl]-2,4,6-triiodoanilino]-1-oxopropan-2-yl] acetate Chemical compound CC(=O)OC(C)C(=O)NC1=C(I)C(C(Cl)=O)=C(I)C(C(=O)NC(C)(CO)CO)=C1I CAGLPRVLXOQLRR-UHFFFAOYSA-N 0.000 claims 1
- PPIFOQZZAAVLDS-UHFFFAOYSA-N [1-[5-amino-5-carbonochloridoyl-3-[(1,3-dihydroxy-2-methylpropan-2-yl)carbamoyl]-2,4,6-triiodocyclohexa-1,3-dien-1-yl]-1-oxopropan-2-yl] acetate Chemical compound CC(=O)OC(C)C(=O)C1=C(I)C(C(=O)NC(C)(CO)CO)=C(I)C(N)(C(Cl)=O)C1I PPIFOQZZAAVLDS-UHFFFAOYSA-N 0.000 claims 1
- SQWLZOYZHFSNJW-UHFFFAOYSA-N [1-[N-carbamoyl-3-carbonochloridoyl-5-(1,3-dihydroxy-2-methylpropan-2-yl)-2,4,6-triiodoanilino]-1-oxopropan-2-yl] acetate Chemical compound OCC(CO)(C)C=1C(=C(C(=C(C(=O)Cl)C=1I)I)N(C(C(C)OC(C)=O)=O)C(=O)N)I SQWLZOYZHFSNJW-UHFFFAOYSA-N 0.000 claims 1
- 230000003301 hydrolyzing effect Effects 0.000 claims 1
- DQWNGAQNIKMWBO-UHFFFAOYSA-N n-methyl-2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]ethanamine Chemical compound CNCCOCCOCCOCCNC DQWNGAQNIKMWBO-UHFFFAOYSA-N 0.000 claims 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 abstract description 20
- 239000000203 mixture Substances 0.000 abstract description 12
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 abstract 1
- 239000000243 solution Substances 0.000 description 24
- 229910052740 iodine Inorganic materials 0.000 description 18
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 16
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- 239000011630 iodine Substances 0.000 description 15
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 11
- 229940113088 dimethylacetamide Drugs 0.000 description 11
- 239000002904 solvent Substances 0.000 description 10
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 10
- 239000011541 reaction mixture Substances 0.000 description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- 239000007864 aqueous solution Substances 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 230000003204 osmotic effect Effects 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- LVTJOONKWUXEFR-FZRMHRINSA-N protoneodioscin Natural products O(C[C@@H](CC[C@]1(O)[C@H](C)[C@@H]2[C@]3(C)[C@H]([C@H]4[C@@H]([C@]5(C)C(=CC4)C[C@@H](O[C@@H]4[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@@H](O)[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@H](CO)O4)CC5)CC3)C[C@@H]2O1)C)[C@H]1[C@H](O)[C@H](O)[C@H](O)[C@@H](CO)O1 LVTJOONKWUXEFR-FZRMHRINSA-N 0.000 description 4
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 239000012153 distilled water Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 238000002347 injection Methods 0.000 description 3
- 239000007924 injection Substances 0.000 description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 210000000278 spinal cord Anatomy 0.000 description 3
- 238000011282 treatment Methods 0.000 description 3
- DSPIZZQMSHIZLS-UHFFFAOYSA-N 1-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]propane Chemical compound CCCOCCOCCOCCOCCC DSPIZZQMSHIZLS-UHFFFAOYSA-N 0.000 description 2
- DTZMSDADRKLCQE-RFMXWLSYSA-N 3-acetamido-5-[acetyl(methyl)amino]-2,4,6-triiodo-n-[(2r,3r,4s,5r)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]benzamide Chemical compound CC(=O)N(C)C1=C(I)C(NC(C)=O)=C(I)C(C(=O)N[C@@H](C=O)[C@@H](O)[C@H](O)[C@H](O)CO)=C1I DTZMSDADRKLCQE-RFMXWLSYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 229940126062 Compound A Drugs 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- DTVWJAGFYXEJAU-UHFFFAOYSA-N [1-[3-(carbamoylamino)-5-carbonochloridoyl-2,4,6-triiodophenyl]-1-oxopropan-2-yl] acetate Chemical compound NC(=O)NC=1C(=C(C(=C(C(=O)Cl)C=1I)I)C(C(C)OC(C)=O)=O)I DTVWJAGFYXEJAU-UHFFFAOYSA-N 0.000 description 2
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 2
- 150000001263 acyl chlorides Chemical class 0.000 description 2
- 239000003957 anion exchange resin Substances 0.000 description 2
- 210000004204 blood vessel Anatomy 0.000 description 2
- 230000036760 body temperature Effects 0.000 description 2
- 210000004556 brain Anatomy 0.000 description 2
- 239000003729 cation exchange resin Substances 0.000 description 2
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 2
- 229910000397 disodium phosphate Inorganic materials 0.000 description 2
- 235000019800 disodium phosphate Nutrition 0.000 description 2
- DCAYPVUWAIABOU-UHFFFAOYSA-N hexadecane Chemical compound CCCCCCCCCCCCCCCC DCAYPVUWAIABOU-UHFFFAOYSA-N 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 231100000053 low toxicity Toxicity 0.000 description 2
- 238000009608 myelography Methods 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 230000002285 radioactive effect Effects 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 238000007127 saponification reaction Methods 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 239000001488 sodium phosphate Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 231100000419 toxicity Toxicity 0.000 description 2
- 230000001988 toxicity Effects 0.000 description 2
- HXOYWCSTHVTLOW-UHFFFAOYSA-N (2,2-dimethyl-1,3-dioxolan-4-yl)methanamine Chemical compound CC1(C)OCC(CN)O1 HXOYWCSTHVTLOW-UHFFFAOYSA-N 0.000 description 1
- HZDNNJABYXNPPV-UHFFFAOYSA-N (2-chloro-2-oxoethyl) acetate Chemical compound CC(=O)OCC(Cl)=O HZDNNJABYXNPPV-UHFFFAOYSA-N 0.000 description 1
- GHPYJLCQYMAXGG-WCCKRBBISA-N (2R)-2-amino-3-(2-boronoethylsulfanyl)propanoic acid hydrochloride Chemical compound Cl.N[C@@H](CSCCB(O)O)C(O)=O GHPYJLCQYMAXGG-WCCKRBBISA-N 0.000 description 1
- KIAMPLQEZAMORJ-UHFFFAOYSA-N 1-ethoxy-2-[2-(2-ethoxyethoxy)ethoxy]ethane Chemical compound CCOCCOCCOCCOCC KIAMPLQEZAMORJ-UHFFFAOYSA-N 0.000 description 1
- RZICEOJUAFHYFO-UHFFFAOYSA-N 1-hydroperoxyhexane Chemical compound CCCCCCOO RZICEOJUAFHYFO-UHFFFAOYSA-N 0.000 description 1
- ADLFBRNPQMLXTQ-UHFFFAOYSA-N 2,2-dimethyl-1,3-dioxan-5-amine Chemical compound CC1(C)OCC(N)CO1 ADLFBRNPQMLXTQ-UHFFFAOYSA-N 0.000 description 1
- UXFQFBNBSPQBJW-UHFFFAOYSA-N 2-amino-2-methylpropane-1,3-diol Chemical compound OCC(N)(C)CO UXFQFBNBSPQBJW-UHFFFAOYSA-N 0.000 description 1
- KJJPLEZQSCZCKE-UHFFFAOYSA-N 2-aminopropane-1,3-diol Chemical compound OCC(N)CO KJJPLEZQSCZCKE-UHFFFAOYSA-N 0.000 description 1
- KQIGMPWTAHJUMN-UHFFFAOYSA-N 3-aminopropane-1,2-diol Chemical compound NCC(O)CO KQIGMPWTAHJUMN-UHFFFAOYSA-N 0.000 description 1
- FVUKYCZRWSQGAS-UHFFFAOYSA-N 3-carbamoylbenzoic acid Chemical compound NC(=O)C1=CC=CC(C(O)=O)=C1 FVUKYCZRWSQGAS-UHFFFAOYSA-N 0.000 description 1
- FBEHFRAORPEGFH-UHFFFAOYSA-N Allyxycarb Chemical compound CNC(=O)OC1=CC(C)=C(N(CC=C)CC=C)C(C)=C1 FBEHFRAORPEGFH-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- YBSPTIRIAOLRDG-UHFFFAOYSA-N CC(C(=O)C1=C(C(=C(C(C1I)(C(=O)Cl)NC(=O)N)I)C(C)(CO)CO)I)OC(=O)C Chemical compound CC(C(=O)C1=C(C(=C(C(C1I)(C(=O)Cl)NC(=O)N)I)C(C)(CO)CO)I)OC(=O)C YBSPTIRIAOLRDG-UHFFFAOYSA-N 0.000 description 1
- ACPGMMBDJWEWRV-UHFFFAOYSA-N CNC(=O)COCCOCCOCC(=O)NC Chemical compound CNC(=O)COCCOCCOCC(=O)NC ACPGMMBDJWEWRV-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- SMQYOVYWPWASGU-UHFFFAOYSA-N Iocarmic acid Chemical compound OC(=O)C1=C(I)C(C(=O)NC)=C(I)C(NC(=O)CCCCC(=O)NC=2C(=C(C(=O)NC)C(I)=C(C(O)=O)C=2I)I)=C1I SMQYOVYWPWASGU-UHFFFAOYSA-N 0.000 description 1
- 241000699666 Mus <mouse, genus> Species 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- 208000031481 Pathologic Constriction Diseases 0.000 description 1
- 241000220317 Rosa Species 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- YVPYQUNUQOZFHG-UHFFFAOYSA-N amidotrizoic acid Chemical compound CC(=O)NC1=C(I)C(NC(C)=O)=C(I)C(C(O)=O)=C1I YVPYQUNUQOZFHG-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 239000000010 aprotic solvent Substances 0.000 description 1
- 239000008365 aqueous carrier Substances 0.000 description 1
- 125000000043 benzamido group Chemical group [H]N([*])C(=O)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- XTEGARKTQYYJKE-UHFFFAOYSA-N chloric acid Chemical compound OCl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-N 0.000 description 1
- 229940005991 chloric acid Drugs 0.000 description 1
- IWBOPFCKHIJFMS-UHFFFAOYSA-N ethylene glycol bis(2-aminoethyl) ether Chemical compound NCCOCCOCCN IWBOPFCKHIJFMS-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- JUINSXZKUKVTMD-UHFFFAOYSA-N hydrogen azide Chemical compound N=[N+]=[N-] JUINSXZKUKVTMD-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 239000007972 injectable composition Substances 0.000 description 1
- 229910001410 inorganic ion Inorganic materials 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- 229960002517 iocarmic acid Drugs 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- 210000002751 lymph Anatomy 0.000 description 1
- 210000001165 lymph node Anatomy 0.000 description 1
- 229960000554 metrizamide Drugs 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000011148 porous material Substances 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000009993 protective function Effects 0.000 description 1
- 238000002601 radiography Methods 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- KVCGISUBCHHTDD-UHFFFAOYSA-M sodium;4-methylbenzenesulfonate Chemical compound [Na+].CC1=CC=C(S([O-])(=O)=O)C=C1 KVCGISUBCHHTDD-UHFFFAOYSA-M 0.000 description 1
- 239000008279 sol Substances 0.000 description 1
- 210000002330 subarachnoid space Anatomy 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 238000012800 visualization Methods 0.000 description 1
- NWONKYPBYAMBJT-UHFFFAOYSA-L zinc sulfate Chemical compound [Zn+2].[O-]S([O-])(=O)=O NWONKYPBYAMBJT-UHFFFAOYSA-L 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
- C07C233/01—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C233/12—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by halogen atoms or by nitro or nitroso groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Medicines Containing Antibodies Or Antigens For Use As Internal Diagnostic Agents (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH380677A CH626873A5 (en:Method) | 1977-03-28 | 1977-03-28 | |
| CH3806/77 | 1977-05-28 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1089489A true CA1089489A (en) | 1980-11-11 |
Family
ID=4263847
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA298,854A Expired CA1089489A (en) | 1977-03-28 | 1978-03-14 | Water-soluble, non ionic radioopaque contrast agents (x-ray contrast agents) and process for their production |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4139605A (en:Method) |
| JP (1) | JPS53119842A (en:Method) |
| AT (1) | AT362870B (en:Method) |
| CA (1) | CA1089489A (en:Method) |
| CH (1) | CH626873A5 (en:Method) |
| DE (1) | DE2805928C3 (en:Method) |
| DK (1) | DK148783C (en:Method) |
| FR (1) | FR2385698B1 (en:Method) |
| GB (1) | GB1569242A (en:Method) |
| NO (1) | NO145338C (en:Method) |
| SE (1) | SE437513B (en:Method) |
Families Citing this family (34)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2628517C2 (de) * | 1976-06-23 | 1985-02-21 | Schering AG, 1000 Berlin und 4709 Bergkamen | Dicarbonsäure-bis(3,5-dicarbamoyl-2,4,6-trijodanilid)-Verbindungen, Verfahren zu ihrer Herstellung und Röntgenkontrastmittel |
| US4279887A (en) * | 1978-11-29 | 1981-07-21 | Medi-Physics, Inc. | Amides useful as brain imaging agents |
| US4311853A (en) * | 1979-02-06 | 1982-01-19 | The Radiochemical Centre Limited | Selenium derivatives of thyroxine and tri-iodothyronine |
| US4256729A (en) | 1979-03-23 | 1981-03-17 | Mallinckrodt, Inc. | N,N'-Bis-(2,3-dihydroxypropyl)-2,4,6-triiodo-5-(2-keto-L-gulonamido)isophthalamide and radiological compositions containing same |
| DK273280A (da) * | 1979-06-28 | 1980-12-29 | Schering Ag | Trijoderede 5-aminoisophthalsyrederivater |
| IT1207226B (it) * | 1979-08-09 | 1989-05-17 | Bracco Ind Chimica Spa | Derivati dell'acido 2,4,6-triiodo-isoftalico, metodo per la loro preparazione e mezzi di contrasto che li contengono. |
| DE3038853A1 (de) * | 1980-10-10 | 1982-05-27 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | Neue n-hydroxy-alkylierte dicarbonsaeure-bis-(3,5-dicarbamoyl-2,4,6-trijodanilide), deren herstellung und diese enthaltende roentgenkonstrastmittel (ii) |
| DE3044814A1 (de) * | 1980-11-25 | 1982-07-08 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | Unsymmetrisch substituierte dicarbonsaeure-bis-(2,4,6-trijod-anilide), deren herstellung und diese enthaltende roentgenkontrastmittel |
| US5191119A (en) * | 1983-10-20 | 1993-03-02 | Cook Imaging Corp. | Process for producing non-ionic radiographic contrast media utilizing N-allylation |
| US4650903A (en) * | 1984-06-21 | 1987-03-17 | The Bf Goodrich Company | Oligomeric amides as synergists for antioxidants and UV stabilizers |
| DE3731542A1 (de) * | 1987-09-17 | 1989-03-30 | Schering Ag | Neue dicarbonsaeure-bis(3,5-dicarbamoyl-2,4,6-triiod-anilide), verfahren zu deren herstellung sowie diese enthaltende roentgenkontrastmittel |
| DE3937118A1 (de) * | 1989-11-03 | 1991-05-08 | Schering Ag | Nichtionische roentgenkontrastmittel mit hohem jodgehalt |
| IT1245853B (it) * | 1990-11-16 | 1994-10-25 | Bracco Spa | 1,3-bis(3-(mono o poliidrossi)acilamino-5-(mono o poliidrossi-alchil) aminocarbonil-2,4,6-triiodo-benzoil-amino)-idrossi- o idrossi-alchil- propani, loro metodo di preparazione e mezzi di contrasto roentgenografici che li contengono |
| DE4109169A1 (de) * | 1991-03-20 | 1992-09-24 | Koehler Chemie Dr Franz | Wasserloesliche nicht ionische roentgenkontrastmittel sowie mittel und verfahren zu ihrer herstellung |
| IT1256162B (it) * | 1992-10-27 | 1995-11-29 | Zambon Spa | Processo per la preparazione di un intermedio della sintesi organica |
| KR100269080B1 (ko) * | 1995-05-23 | 2000-10-16 | 안토니오 칸탈루피 | 디카르복실산디클로라이드의제조방법 |
| DE19731591C2 (de) * | 1997-07-17 | 1999-09-16 | Schering Ag | Pharmazeutische Mittel enthaltend perfluoralkylgruppenhaltige Trijodaromaten und ihre Verwendung in der Tumortherapie und interventionellen Radiologie |
| US20040170561A1 (en) * | 1998-09-08 | 2004-09-02 | Jesse Salb | Functional radiographic imaging methods and agents |
| US6723746B2 (en) * | 1998-09-08 | 2004-04-20 | Veritas Pharmaceuticals, Inc. | Functional radiographic imaging methods and agents |
| US20010038682A1 (en) * | 1998-09-08 | 2001-11-08 | Jesse Salb | Radiographic assessment of tissue response to compounds |
| US6751290B2 (en) | 1998-09-08 | 2004-06-15 | Veritas Pharmaceuticals, Inc. | Radiographic assessment of tissue after exposure to a compound |
| US6226352B1 (en) * | 1998-09-08 | 2001-05-01 | Veritas Pharmaceuticals, Inc. | System and method for radiographic imaging of tissue |
| SE520688C2 (sv) * | 2000-04-11 | 2003-08-12 | Bone Support Ab | Ett injicerbart ersättningsmaterial för benmineral |
| SE517168C2 (sv) * | 2000-07-17 | 2002-04-23 | Bone Support Ab | En komposition för ett injicerbart ersättningsmaterial för benmineral |
| SE522098C2 (sv) * | 2001-12-20 | 2004-01-13 | Bone Support Ab | Ett nytt benmineralsubstitut |
| SE0300620D0 (sv) * | 2003-03-05 | 2003-03-05 | Bone Support Ab | A new bone substitute composition |
| SE0302983D0 (sv) * | 2003-11-11 | 2003-11-11 | Bone Support Ab | Anordning för att förse spongiöst ben med benersättnings- och/eller benförstärkningsmaterial och förfarande i samband därmed |
| SE527528C2 (sv) * | 2004-06-22 | 2006-04-04 | Bone Support Ab | Anordning för framställning av härdbar massa samt användning av anordningen |
| WO2007143698A2 (en) * | 2006-06-06 | 2007-12-13 | Rutgers, The State University Of New Jersey | Iodinated polymers |
| US7955234B1 (en) | 2007-02-28 | 2011-06-07 | Pursley Michael G | Exercise device and method |
| US8202511B2 (en) | 2007-10-12 | 2012-06-19 | Ge Healthcare As | Contrast agents |
| US9180137B2 (en) | 2010-02-09 | 2015-11-10 | Bone Support Ab | Preparation of bone cement compositions |
| WO2012136813A2 (en) | 2011-04-07 | 2012-10-11 | Universitetet I Oslo | Agents for medical radar diagnosis |
| EP2958603B1 (en) | 2013-02-20 | 2018-03-28 | Bone Support AB | Improved setting of hardenable bone substitute |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA855739A (en) * | 1970-11-10 | Felder Ernst | Radioopaque compound and method of preparing the same | |
| US3733397A (en) * | 1966-12-02 | 1973-05-15 | Pharmacia Ab | Method for the x-ray visualization of body cavities and a preparation for carrying out the method |
| US3660469A (en) * | 1969-08-04 | 1972-05-02 | Squibb & Sons Inc | Bis-triiodoisophthalamic acid compounds |
| BE795555A (fr) * | 1972-02-16 | 1973-08-16 | Schering Ag | Amides de triiodo-isophtaloyl-monoamino-acide, leur procede de preparation et leur utilisation |
| US4032567A (en) * | 1972-02-16 | 1977-06-28 | Schering Aktiengesellschaft | Triiodoisophthalic acid monoamino acid amides, process for the preparation thereof, and use thereof as x-ray contrast media |
| GB1488903A (en) * | 1974-05-31 | 1977-10-19 | Guerbet Sa | X-ray contrast media |
| AR207465A1 (es) * | 1974-05-31 | 1976-10-08 | Guerbet Lab Andre | Procedimiento de preparacion de derivados de acido triiodoi2,4,6-(triiodo-2,4,6-benzoil)-amino-alcanoilaminobenzoico de acido triiodo-2,4,6-(triiodo-2,4,6-(triiodo-2,4,6-benzoil)-aminoalcanoilaminobenzoil)-amino-alcanoil-aminobenzoico y de acido triiodo-2,4,6-bis((triiodo-2,4,6-fenil)-carbamoil-metil)-aminoalcanoil-aminobenzoico |
| CH608189A5 (en:Method) * | 1974-12-13 | 1978-12-29 | Savac Ag | |
| GB1491129A (en) * | 1975-06-04 | 1977-11-09 | Guerbet Sa | Iodo-benzene derivatives and an x-ray contrast medium containing them |
| DE2628517C2 (de) * | 1976-06-23 | 1985-02-21 | Schering AG, 1000 Berlin und 4709 Bergkamen | Dicarbonsäure-bis(3,5-dicarbamoyl-2,4,6-trijodanilid)-Verbindungen, Verfahren zu ihrer Herstellung und Röntgenkontrastmittel |
-
1977
- 1977-03-28 CH CH380677A patent/CH626873A5/de not_active IP Right Cessation
-
1978
- 1978-02-13 DE DE2805928A patent/DE2805928C3/de not_active Expired
- 1978-02-17 GB GB6470/78A patent/GB1569242A/en not_active Expired
- 1978-02-23 SE SE7802106A patent/SE437513B/sv not_active IP Right Cessation
- 1978-02-27 US US05/881,567 patent/US4139605A/en not_active Expired - Lifetime
- 1978-03-14 CA CA298,854A patent/CA1089489A/en not_active Expired
- 1978-03-16 DK DK119878A patent/DK148783C/da not_active IP Right Cessation
- 1978-03-17 AT AT0190378A patent/AT362870B/de not_active IP Right Cessation
- 1978-03-20 NO NO780991A patent/NO145338C/no unknown
- 1978-03-24 FR FR7808737A patent/FR2385698B1/fr not_active Expired
- 1978-03-28 JP JP3493678A patent/JPS53119842A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| ATA190378A (de) | 1980-11-15 |
| FR2385698A1 (en:Method) | 1978-10-27 |
| SE437513B (sv) | 1985-03-04 |
| NO145338C (no) | 1982-03-03 |
| NO780991L (no) | 1978-09-29 |
| CH626873A5 (en:Method) | 1981-12-15 |
| JPS5715103B2 (en:Method) | 1982-03-29 |
| DE2805928C3 (de) | 1982-02-25 |
| GB1569242A (en) | 1980-06-11 |
| AT362870B (de) | 1981-06-25 |
| DK148783B (da) | 1985-09-30 |
| SE7802106L (sv) | 1978-09-29 |
| FR2385698B1 (en:Method) | 1981-04-30 |
| DK119878A (da) | 1978-09-29 |
| DE2805928A1 (de) | 1978-10-05 |
| DE2805928B2 (de) | 1981-04-23 |
| US4139605A (en) | 1979-02-13 |
| DK148783C (da) | 1986-06-30 |
| NO145338B (no) | 1981-11-23 |
| JPS53119842A (en) | 1978-10-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1089489A (en) | Water-soluble, non ionic radioopaque contrast agents (x-ray contrast agents) and process for their production | |
| CA1123009A (en) | Derivatives of 2,4,6-triiodo-isophthalic acid, processes for their synthesis and x-ray contrasting materials containing these | |
| CN108047151A (zh) | 一种高收率钆布醇的制备方法 | |
| AU616203B2 (en) | New dicarboxylic acid-bis(3,5-dicarbamoyl-2,4,6- triiodoanilides), process for their production as well as x- ray contrast media containing them | |
| US3818035A (en) | 2{8 (2-ALKYLBENZO{8 b{9 {11 FURAN-3 yl)METHYL{9 -{66 {11 IMIDAZOLINE | |
| JPH0222066B2 (en:Method) | ||
| RU2254330C2 (ru) | Кислотно-аддитивные нитратные соли соединений и фармацевтическая композиция | |
| CN109761924A (zh) | 一种改进的缬沙坦反应混合液的后处理方法 | |
| JPH039900B2 (en:Method) | ||
| DE68915341T2 (de) | Expektoranz, das ein Hydroxy-alkyl-cystein-Derivat enthält. | |
| CN108623451A (zh) | 一种多臂单一分子量聚乙二醇及其活性衍生物及其制备和应用 | |
| US7872137B2 (en) | Process for the preparation of mivacurium chloride | |
| RU2060246C1 (ru) | Трийод-5-аминоизофталдиамиды, способы их получения и радиологическая композиция | |
| SE436027B (sv) | Nya estrar av kvarternera ammoniumsalter med antikolinerg anti-sekretorisk verkan och farmaceutiska kompositioner innehallande dessa salter | |
| CA2095927A1 (en) | X-ray contrast agents, compositions and methods | |
| KR970011452B1 (ko) | 치환된 디카복실산-비스(3,5-디카바모일-2,4,6-트리요오도아닐리드) 및 이를 함유하는 x-선 조영제 | |
| JPS59167564A (ja) | スルホニウム化合物 | |
| FI56679C (fi) | 3-amino-2,4,6-trijodfenyl- eller -bensoylalkansyror som anvaendes som roentgenkontrastmedel och dessa foereningars farmaceutiskt godtagbara salter | |
| JPS6152812B2 (en:Method) | ||
| JPS63500522A (ja) | イオン性コントラスト媒体からの非イオン性ポリオ−ルコントラスト媒体 | |
| DE3017026C2 (de) | Isoprenylamine und ihre Säureadditionssalze sowie sie enthaltende Antivirus-Mittel für Wirbeltiere | |
| CN106565771A (zh) | 一种含有双氨基的磷酰胆碱化合物Lys‑PC及其制备方法 | |
| JPS606958B2 (ja) | 抗生物質の精製法 | |
| CA2100338A1 (en) | Non ionic iodized agents for x-ray contrasting, method for preparing them and galenical compositions containing them | |
| CH637650A5 (fr) | Procede de preparation d'un acide chromone carboxylique. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |