CA1057773A - Diphenylethers and their use as insecticides - Google Patents
Diphenylethers and their use as insecticidesInfo
- Publication number
- CA1057773A CA1057773A CA245,116A CA245116A CA1057773A CA 1057773 A CA1057773 A CA 1057773A CA 245116 A CA245116 A CA 245116A CA 1057773 A CA1057773 A CA 1057773A
- Authority
- CA
- Canada
- Prior art keywords
- compound
- spec
- formula
- chlorine
- insects
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000002917 insecticide Substances 0.000 title description 2
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical class C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims abstract description 52
- 239000000460 chlorine Substances 0.000 claims abstract description 26
- 229910052801 chlorine Inorganic materials 0.000 claims abstract description 12
- 239000001257 hydrogen Substances 0.000 claims abstract description 12
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 12
- 239000004305 biphenyl Substances 0.000 claims abstract description 9
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims abstract description 6
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical group FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims abstract description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 6
- 125000001309 chloro group Chemical group Cl* 0.000 claims abstract description 6
- 239000011737 fluorine Chemical group 0.000 claims abstract description 6
- 229910052731 fluorine Inorganic materials 0.000 claims abstract description 6
- 150000002431 hydrogen Chemical class 0.000 claims abstract description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract description 5
- 238000000034 method Methods 0.000 claims description 25
- 241000238631 Hexapoda Species 0.000 claims description 19
- 239000000203 mixture Substances 0.000 claims description 11
- 238000002360 preparation method Methods 0.000 claims description 11
- 239000003085 diluting agent Substances 0.000 claims description 10
- GYNAVKULVOETAD-UHFFFAOYSA-N n-phenoxyaniline Chemical compound C=1C=CC=CC=1NOC1=CC=CC=C1 GYNAVKULVOETAD-UHFFFAOYSA-N 0.000 claims description 6
- 239000004480 active ingredient Substances 0.000 claims description 5
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 claims description 4
- LURYMYITPCOQAU-UHFFFAOYSA-N benzoyl isocyanate Chemical compound O=C=NC(=O)C1=CC=CC=C1 LURYMYITPCOQAU-UHFFFAOYSA-N 0.000 claims description 3
- 230000000749 insecticidal effect Effects 0.000 abstract description 7
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 24
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 15
- 239000002904 solvent Substances 0.000 description 12
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- -1 for example Chemical class 0.000 description 8
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 7
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 7
- 241000607479 Yersinia pestis Species 0.000 description 7
- 238000006243 chemical reaction Methods 0.000 description 7
- 239000003995 emulsifying agent Substances 0.000 description 7
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- 238000009472 formulation Methods 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- 240000007124 Brassica oleracea Species 0.000 description 4
- 239000000969 carrier Substances 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 239000012141 concentrate Substances 0.000 description 4
- 230000006378 damage Effects 0.000 description 4
- 229920000151 polyglycol Polymers 0.000 description 4
- 239000010695 polyglycol Substances 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- ZRJSABISRHPRSB-UHFFFAOYSA-N 2,6-difluorobenzoyl isocyanate Chemical compound FC1=CC=CC(F)=C1C(=O)N=C=O ZRJSABISRHPRSB-UHFFFAOYSA-N 0.000 description 3
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- ASAOLTVUTGZJST-UHFFFAOYSA-N 4-(4-nitrophenoxy)aniline Chemical compound C1=CC(N)=CC=C1OC1=CC=C([N+]([O-])=O)C=C1 ASAOLTVUTGZJST-UHFFFAOYSA-N 0.000 description 3
- 241000254173 Coleoptera Species 0.000 description 3
- 241000196324 Embryophyta Species 0.000 description 3
- 241000500437 Plutella xylostella Species 0.000 description 3
- 125000003118 aryl group Chemical group 0.000 description 3
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 3
- 150000002170 ethers Chemical class 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- SYBYTAAJFKOIEJ-UHFFFAOYSA-N 3-Methylbutan-2-one Chemical compound CC(C)C(C)=O SYBYTAAJFKOIEJ-UHFFFAOYSA-N 0.000 description 2
- 235000011303 Brassica alboglabra Nutrition 0.000 description 2
- 235000011302 Brassica oleracea Nutrition 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- 241000490229 Eucephalus Species 0.000 description 2
- 239000004606 Fillers/Extenders Substances 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 2
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- 241001608568 Phaedon Species 0.000 description 2
- 241001608567 Phaedon cochleariae Species 0.000 description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 2
- 125000002877 alkyl aryl group Chemical group 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 2
- 229940054066 benzamide antipsychotics Drugs 0.000 description 2
- 150000003936 benzamides Chemical class 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 238000010410 dusting Methods 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 238000011156 evaluation Methods 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 229940043265 methyl isobutyl ketone Drugs 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 239000003595 mist Substances 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 230000003071 parasitic effect Effects 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 235000012239 silicon dioxide Nutrition 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- DURPTKYDGMDSBL-UHFFFAOYSA-N 1-butoxybutane Chemical compound CCCCOCCCC DURPTKYDGMDSBL-UHFFFAOYSA-N 0.000 description 1
- JHSPCUHPSIUQRB-UHFFFAOYSA-N 2,6-dichlorobenzamide Chemical compound NC(=O)C1=C(Cl)C=CC=C1Cl JHSPCUHPSIUQRB-UHFFFAOYSA-N 0.000 description 1
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 1
- MQRKHZUATJBAPV-UHFFFAOYSA-N 3,5-dichloro-4-(4-nitrophenoxy)aniline Chemical compound ClC1=CC(N)=CC(Cl)=C1OC1=CC=C([N+]([O-])=O)C=C1 MQRKHZUATJBAPV-UHFFFAOYSA-N 0.000 description 1
- 241001143309 Acanthoscelides obtectus Species 0.000 description 1
- 241000238818 Acheta domesticus Species 0.000 description 1
- 241000256111 Aedes <genus> Species 0.000 description 1
- 241000349731 Afzelia bipindensis Species 0.000 description 1
- 102000009027 Albumins Human genes 0.000 description 1
- 108010088751 Albumins Proteins 0.000 description 1
- 241000411449 Anobium punctatum Species 0.000 description 1
- 241000256186 Anopheles <genus> Species 0.000 description 1
- 241001427556 Anoplura Species 0.000 description 1
- 241001414828 Aonidiella aurantii Species 0.000 description 1
- 241001600407 Aphis <genus> Species 0.000 description 1
- 241001425390 Aphis fabae Species 0.000 description 1
- 241001162025 Archips podana Species 0.000 description 1
- 241000387321 Aspidiotus nerii Species 0.000 description 1
- 241001174347 Atomaria Species 0.000 description 1
- 241000726103 Atta Species 0.000 description 1
- 241001490249 Bactrocera oleae Species 0.000 description 1
- 241000254127 Bemisia tabaci Species 0.000 description 1
- 241001142392 Bibio Species 0.000 description 1
- 241000238662 Blatta orientalis Species 0.000 description 1
- 241000238658 Blattella Species 0.000 description 1
- 235000003899 Brassica oleracea var acephala Nutrition 0.000 description 1
- 235000011301 Brassica oleracea var capitata Nutrition 0.000 description 1
- 235000001169 Brassica oleracea var oleracea Nutrition 0.000 description 1
- 241000982105 Brevicoryne brassicae Species 0.000 description 1
- 241001517925 Bucculatrix Species 0.000 description 1
- 241001491790 Bupalus piniaria Species 0.000 description 1
- 241001350371 Capua Species 0.000 description 1
- 241000255579 Ceratitis capitata Species 0.000 description 1
- 241000426499 Chilo Species 0.000 description 1
- 241001327638 Cimex lectularius Species 0.000 description 1
- 241001427559 Collembola Species 0.000 description 1
- 241000683561 Conoderus Species 0.000 description 1
- 241001212534 Cosmopolites sordidus Species 0.000 description 1
- 241000500845 Costelytra zealandica Species 0.000 description 1
- 241000256054 Culex <genus> Species 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 241001635274 Cydia pomonella Species 0.000 description 1
- 241001124144 Dermaptera Species 0.000 description 1
- 241001641895 Dermestes Species 0.000 description 1
- 241000489975 Diabrotica Species 0.000 description 1
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 1
- 241000511318 Diprion Species 0.000 description 1
- 241000255925 Diptera Species 0.000 description 1
- 241001425477 Dysdercus Species 0.000 description 1
- 241000353522 Earias insulana Species 0.000 description 1
- 241000995023 Empoasca Species 0.000 description 1
- 241000630736 Ephestia Species 0.000 description 1
- 241000462639 Epilachna varivestis Species 0.000 description 1
- 241000917109 Eriosoma Species 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 241001331999 Euproctis Species 0.000 description 1
- 241000239245 Euscelis Species 0.000 description 1
- 241001585293 Euxoa Species 0.000 description 1
- 241000720914 Forficula auricularia Species 0.000 description 1
- 241001043186 Gibbium Species 0.000 description 1
- 241000256257 Heliothis Species 0.000 description 1
- 241000258937 Hemiptera Species 0.000 description 1
- 241001466007 Heteroptera Species 0.000 description 1
- 241000679711 Homona Species 0.000 description 1
- 241001417351 Hoplocampa Species 0.000 description 1
- 241001251909 Hyalopterus pruni Species 0.000 description 1
- 241000832178 Hylotrupes Species 0.000 description 1
- 241000257303 Hymenoptera Species 0.000 description 1
- 241000257176 Hypoderma <fly> Species 0.000 description 1
- 241001470017 Laodelphax striatella Species 0.000 description 1
- 241000255777 Lepidoptera Species 0.000 description 1
- 238000005684 Liebig rearrangement reaction Methods 0.000 description 1
- 241000257162 Lucilia <blowfly> Species 0.000 description 1
- 241000255685 Malacosoma neustria Species 0.000 description 1
- 241000555303 Mamestra brassicae Species 0.000 description 1
- 241001415015 Melanoplus differentialis Species 0.000 description 1
- 241000254099 Melolontha melolontha Species 0.000 description 1
- 241000332345 Myzus cerasi Species 0.000 description 1
- 241000721621 Myzus persicae Species 0.000 description 1
- 241000358422 Nephotettix cincticeps Species 0.000 description 1
- 241001556090 Nilaparvata Species 0.000 description 1
- IGFHQQFPSIBGKE-UHFFFAOYSA-N Nonylphenol Natural products CCCCCCCCCC1=CC=C(O)C=C1 IGFHQQFPSIBGKE-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 241001491877 Operophtera brumata Species 0.000 description 1
- 241000238814 Orthoptera Species 0.000 description 1
- 241000131101 Oryzaephilus surinamensis Species 0.000 description 1
- 241001157806 Oscinella Species 0.000 description 1
- 241000486438 Panolis flammea Species 0.000 description 1
- 241001450657 Parthenolecanium corni Species 0.000 description 1
- 241000721452 Pectinophora Species 0.000 description 1
- 241000517306 Pediculus humanus corporis Species 0.000 description 1
- 241000587784 Pemphis Species 0.000 description 1
- 241001387976 Pera Species 0.000 description 1
- 241000238675 Periplaneta americana Species 0.000 description 1
- 241001401861 Phorodon humuli Species 0.000 description 1
- 241001525654 Phyllocnistis citrella Species 0.000 description 1
- 241001517955 Phyllonorycter blancardella Species 0.000 description 1
- 241000255972 Pieris <butterfly> Species 0.000 description 1
- 241000690748 Piesma Species 0.000 description 1
- 241000500439 Plutella Species 0.000 description 1
- 241000722234 Pseudococcus Species 0.000 description 1
- 241000526145 Psylla Species 0.000 description 1
- 241001105129 Ptinus Species 0.000 description 1
- 241001509970 Reticulitermes <genus> Species 0.000 description 1
- 241000722249 Rhodnius prolixus Species 0.000 description 1
- 241000125162 Rhopalosiphum Species 0.000 description 1
- 241000318997 Rhyzopertha dominica Species 0.000 description 1
- 241000316887 Saissetia oleae Species 0.000 description 1
- 241000254026 Schistocerca Species 0.000 description 1
- 241000788381 Siphona Species 0.000 description 1
- 241000180219 Sitobion avenae Species 0.000 description 1
- 241000256248 Spodoptera Species 0.000 description 1
- 241000254109 Tenebrio molitor Species 0.000 description 1
- 241000511627 Tipula paludosa Species 0.000 description 1
- 241001414833 Triatoma Species 0.000 description 1
- 241000254086 Tribolium <beetle> Species 0.000 description 1
- 241000255993 Trichoplusia ni Species 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical class ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- 241001274788 Viteus vitifoliae Species 0.000 description 1
- 241001466337 Yponomeuta Species 0.000 description 1
- 241001414985 Zygentoma Species 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 244000000054 animal parasite Species 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 229960000892 attapulgite Drugs 0.000 description 1
- 150000008047 benzoylureas Chemical class 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 238000002512 chemotherapy Methods 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 150000008422 chlorobenzenes Chemical class 0.000 description 1
- 239000008199 coating composition Substances 0.000 description 1
- 230000001066 destructive effect Effects 0.000 description 1
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 244000078703 ectoparasite Species 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 229940052308 general anesthetics halogenated hydrocarbons Drugs 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- IQPQWNKOIGAROB-UHFFFAOYSA-N isocyanate group Chemical group [N-]=C=O IQPQWNKOIGAROB-UHFFFAOYSA-N 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- 235000013372 meat Nutrition 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 229910052901 montmorillonite Inorganic materials 0.000 description 1
- 210000003205 muscle Anatomy 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- SNQQPOLDUKLAAF-UHFFFAOYSA-N nonylphenol Chemical compound CCCCCCCCCC1=CC=CC=C1O SNQQPOLDUKLAAF-UHFFFAOYSA-N 0.000 description 1
- 229910052625 palygorskite Inorganic materials 0.000 description 1
- 239000006072 paste Substances 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C279/00—Derivatives of guanidine, i.e. compounds containing the group, the singly-bound nitrogen atoms not being part of nitro or nitroso groups
- C07C279/20—Derivatives of guanidine, i.e. compounds containing the group, the singly-bound nitrogen atoms not being part of nitro or nitroso groups containing any of the groups, X being a hetero atom, Y being any atom, e.g. acylguanidines
- C07C279/22—Y being a hydrogen or a carbon atom, e.g. benzoylguanidines
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2504983A DE2504983C2 (de) | 1975-02-06 | 1975-02-06 | Benzoylureido-nitro-diphenyläther, Verfahren zu ihrer Herstellung und ihre Verwendung als Insektizide |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1057773A true CA1057773A (en) | 1979-07-03 |
Family
ID=5938254
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA245,116A Expired CA1057773A (en) | 1975-02-06 | 1976-02-05 | Diphenylethers and their use as insecticides |
Country Status (34)
Families Citing this family (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5245071A (en) * | 1970-05-15 | 1993-09-14 | Duphar International Research B.V. | Organic compounds derived from urea or thiourea |
| US5342958A (en) * | 1970-05-15 | 1994-08-30 | Solvay Duphar International Research B.V. | Organic compounds derived from urea or thiourea |
| NL160809C (nl) * | 1970-05-15 | 1979-12-17 | Duphar Int Res | Werkwijze ter bereiding van benzoylureumverbindingen, alsmede werkwijze ter bereiding van insekticide prepara- ten op basis van benzoylureumverbindingen. |
| DE2531279C2 (de) * | 1975-07-12 | 1983-07-14 | Bayer Ag, 5090 Leverkusen | N-(3-Trifluormethyl-4-halogen-phenyl)- N'-benzoyl-harnstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung als Insektizide |
| DE2601780B2 (de) * | 1976-01-20 | 1979-07-26 | Bayer Ag, 5090 Leverkusen | N-Phenyl-N'-benzoylharnstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung als Insektizide |
| USRE32418E (en) * | 1977-05-13 | 1987-05-12 | The Dow Chemical Company | Substituted(((phenyl)amino)carbonyl)-benzamides |
| US4170657A (en) * | 1977-05-13 | 1979-10-09 | The Dow Chemical Company | Substituted(((phenyl)amino)carbonyl)-benzamides |
| DE2860137D1 (en) * | 1977-07-28 | 1980-12-11 | Ciba Geigy Ag | N-phenyl-n'-benzoyl ureas, process for their preparation, substances containing them, and their use as pesticides |
| ZA793186B (en) * | 1978-07-06 | 1981-02-25 | Duphar Int Res | New urea and thiourea compounds, method of preparing the new compounds, as well as insecticidal compositions on the basis of these compounds |
| GR73690B (online.php) * | 1979-01-15 | 1984-04-02 | Celamerck Gmbh & Co Kg | |
| US4399152A (en) * | 1980-04-03 | 1983-08-16 | Duphar International B.V. | Substituted benzoyl ureas as insecticides |
| DE3026825A1 (de) * | 1980-07-16 | 1982-02-18 | Basf Ag, 6700 Ludwigshafen | Substituierte n-benzoyl-n'-phenoxyphenylharnstoffe, ihre herstellung, ihre verwendung zur bekaempfung von bekaempfung von insekten und mittel dafuer |
| US4426385A (en) | 1980-10-16 | 1984-01-17 | Union Carbide Corporation | Insecticidal bicyclooxyphenyl ureas |
| US4880838A (en) * | 1982-06-30 | 1989-11-14 | Rhone-Poulenc | Pesticidal 1-(4-Phenoxyphenyl)-5-Benzoyl urea compounds and process for preparation |
| US4868215A (en) * | 1982-07-26 | 1989-09-19 | The Dow Chemical Company | Substituted N-aroyl N'-phenyl urea compounds |
| US4602109A (en) * | 1982-12-30 | 1986-07-22 | Union Carbide Corporation | Novel pesticidal phenoxyphenyl and phenoxypyridyl benzoyl ureas and process for preparation |
| US4540578A (en) * | 1982-12-30 | 1985-09-10 | Union Carbide Corporation | Pesticidal phenoxypyridyl benzoyl ureas |
| US4659724A (en) * | 1982-12-30 | 1987-04-21 | Union Carbide Corporation | Certain 1-[4-(5-cyano-2-pyridyloxy)phenyl-benzoyl ureas having pesticidal properties |
| US4873264A (en) * | 1983-05-20 | 1989-10-10 | Rhone-Poulenc Nederlands B.V. | Novel pesticidal 1-(alkyl-phenoxy-aryl)-3-benzoyl ureas and process for preparation |
| CA1339745C (en) * | 1984-04-10 | 1998-03-17 | Martin Anderson | Pesticidal benzoylurea compounds |
| US4623658A (en) * | 1984-04-10 | 1986-11-18 | Shell Oil Company | Pesticidal benzoylurea compounds |
| US5135953A (en) * | 1984-12-28 | 1992-08-04 | Ciba-Geigy | Use of acyl urea compounds for controlling endoparasites and ectoparasites of warm-blooded animals |
| US4734404A (en) * | 1986-06-06 | 1988-03-29 | Rhone-Poulenc Nederland B.V. | Pesticidal benzoylureidoaryl phosphate compounds |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE920245C (de) * | 1950-04-29 | 1954-11-18 | Variapat Ag | Verfahren zur Herstellung von aromatischen, farblosen, wasserloeslichen Trifluormethyl- und Sulfosaeuregruppen enthaltenden unsymmetrischen Harnstoffen bzw. Thioharnstoffen |
| US2722544A (en) * | 1950-12-26 | 1955-11-01 | Variapat Ag | Trifluoromethyl halogenated diphenylcarbamide sulfonic acids and their preparation |
| NL254547A (online.php) * | 1959-08-05 | |||
| NL254871A (online.php) * | 1959-08-14 | |||
| US3261865A (en) * | 1962-09-04 | 1966-07-19 | Monsanto Co | N-(chlorobenzoyl)ureas |
| US3284433A (en) * | 1963-07-17 | 1966-11-08 | Merck & Co Inc | 4-phenoxy-carbanilides |
| US3450747A (en) * | 1965-05-07 | 1969-06-17 | Monsanto Co | Preparation of aroyl isocyanates and aryl isocyanatoformates |
| NL160809C (nl) * | 1970-05-15 | 1979-12-17 | Duphar Int Res | Werkwijze ter bereiding van benzoylureumverbindingen, alsmede werkwijze ter bereiding van insekticide prepara- ten op basis van benzoylureumverbindingen. |
| US3798276A (en) * | 1972-03-14 | 1974-03-19 | H Bayer | Herbicidal 4-trifluoromethyl-4'-nitrodiphenyl ethers |
| DE2438747C2 (de) * | 1974-08-13 | 1982-10-14 | Bayer Ag, 5090 Leverkusen | Benzoylureido-diphenyläther, Verfahren zu ihrer Herstellung und ihre Verwendung als Insektizide |
| GB1460419A (en) * | 1975-02-06 | 1977-01-06 | Bayer Ag | Benzoylureido-diphenyl ethers and their use as insecticides |
-
1975
- 1975-02-06 DE DE2504983A patent/DE2504983C2/de not_active Expired
- 1975-10-21 GB GB4310775A patent/GB1460418A/en not_active Expired
-
1976
- 1976-01-22 NO NO76760197A patent/NO149105C/no unknown
- 1976-01-23 US US05/651,986 patent/US4041177A/en not_active Expired - Lifetime
- 1976-01-31 EG EG7647A patent/EG12218A/xx active
- 1976-02-02 CS CS76644A patent/CS188269B2/cs unknown
- 1976-02-02 CH CH122576A patent/CH616655A5/de not_active IP Right Cessation
- 1976-02-02 BG BG032253A patent/BG25504A3/xx unknown
- 1976-02-03 IL IL7648963A patent/IL48963A/xx unknown
- 1976-02-03 PH PH18041A patent/PH12718A/en unknown
- 1976-02-03 LU LU74305A patent/LU74305A1/xx unknown
- 1976-02-03 PT PT64771A patent/PT64771B/pt unknown
- 1976-02-04 RO RO7684688A patent/RO72997A/ro unknown
- 1976-02-04 TR TR18901A patent/TR18901A/xx unknown
- 1976-02-04 DD DD191100A patent/DD124947A5/xx unknown
- 1976-02-04 FI FI760265A patent/FI62826C/fi not_active IP Right Cessation
- 1976-02-05 CA CA245,116A patent/CA1057773A/en not_active Expired
- 1976-02-05 DK DK47376A patent/DK145261C/da not_active IP Right Cessation
- 1976-02-05 BE BE164106A patent/BE838287A/xx not_active IP Right Cessation
- 1976-02-05 BR BR7600735A patent/BR7600735A/pt unknown
- 1976-02-05 OA OA55732A patent/OA05238A/xx unknown
- 1976-02-05 PL PL1976187039A patent/PL100325B1/zh unknown
- 1976-02-05 IE IE232/76A patent/IE42472B1/en unknown
- 1976-02-05 ES ES444934A patent/ES444934A1/es not_active Expired
- 1976-02-05 SE SE7601258A patent/SE421411B/xx unknown
- 1976-02-05 ZA ZA667A patent/ZA76667B/xx unknown
- 1976-02-06 NL NL7601245A patent/NL7601245A/xx not_active Application Discontinuation
- 1976-02-06 AT AT84376A patent/AT346646B/de not_active IP Right Cessation
- 1976-02-06 AR AR262176A patent/AR209345A1/es active
- 1976-02-06 JP JP51011500A patent/JPS5842184B2/ja not_active Expired
- 1976-02-06 FR FR7603317A patent/FR2300077A1/fr active Granted
- 1976-02-16 HU HU76BA3367A patent/HU176913B/hu unknown
-
1977
- 1977-06-29 KE KE2751A patent/KE2751A/xx unknown
- 1977-12-31 MY MY1977299A patent/MY7700299A/xx unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1124747A (en) | Substituted n-phenyl-n'-benzoyl-ureas and their use as insecticides | |
| US4277499A (en) | Combating insects with N-(substituted-phenyl)-N-(2-chloro-6-fluoro-benzoyl)-ureas | |
| US4041177A (en) | 4-Nitro-4'-[N-(N'-benzoyl)-ureido]-diphenyl ethers | |
| US4276310A (en) | Combating pests with N-(4-substituted-phenyl)-N'-(2-substituted-benzoyl)-thioureas | |
| US4234600A (en) | Combating arthropods with N-benzoyl-N'-tert.-alkoxycarbonylphenyl-(thio) ureas | |
| US4103022A (en) | Combating arthropods with 3-(2,2,4,4-tetrafluoro-benz-1,3-dioxin-6-yl)-1-(substituted benzoyl)-ureas | |
| US4536587A (en) | Combating pests with substituted benzoyl-(thio)ureas | |
| CA1120044A (en) | Phenylcarbamoyl-pyrazolines and their use as insecticides | |
| CA1082735A (en) | Combating arthropods with 4-cyano- n-(n'-substituted- benzoyl)-ureido -diphenyl ethers | |
| US4611003A (en) | N-substituted benzoyl-N'-3,4-tetrafluoroethylenedioxy-urea pesticides | |
| US4774260A (en) | Novel benzoylurea pesticides | |
| EP0123861B1 (de) | Harnstoffderivate | |
| GB1580876A (en) | Substituted (thio) ureas and their use as insecticides | |
| DE2504982C2 (de) | 4-Trifluormethyl-4'-benzoylureido-diphenyläther, Verfahren zu ihrer Herstellung und ihre Verwendung zur Bekämpfung von Insekten | |
| US4123449A (en) | 4-Nitro-4-isocyanato- or amino-diphenyl ethers | |
| US4782090A (en) | Benzoyl(thio)urea pesticides | |
| EP0318796B1 (de) | Substituierte Benzoyl(thio)harnstoffe | |
| US4757086A (en) | N-benzoyl-N'-(2,2,-difluoro-3-methyl-benzo-1,4-dioxanyl)-ureas | |
| AT373579B (de) | Verfahren zur herstellung von neuen substituierten n-phenyl-n'-(2-chlor-6-fluorbenzoyl)-harnstoffe | |
| KR810000472B1 (ko) | 벤조일 우레아 유도체의 제조방법 | |
| KR810001875B1 (ko) | 치환된 벤조일우레이도 디페닐 에스테르의 제조 방법 | |
| KR820002081B1 (ko) | 신규 치환된 n-페닐-n'-벤조일-우레아류의 제조방법 | |
| GB1591280A (en) | Phenylcarbamoyl-pyrazolines and their use as insecticides | |
| DE3640175A1 (de) | Benzoyl(thio)harnstoffe |