CA1055019A - Metallised dyes, their manufacture and use - Google Patents
Metallised dyes, their manufacture and useInfo
- Publication number
- CA1055019A CA1055019A CA231,396A CA231396A CA1055019A CA 1055019 A CA1055019 A CA 1055019A CA 231396 A CA231396 A CA 231396A CA 1055019 A CA1055019 A CA 1055019A
- Authority
- CA
- Canada
- Prior art keywords
- group
- radical
- copper
- formula
- hydrogen
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000975 dye Substances 0.000 title claims abstract description 21
- 238000004519 manufacturing process Methods 0.000 title 1
- 239000010949 copper Substances 0.000 claims abstract description 59
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims abstract description 40
- -1 sulpho Chemical class 0.000 claims abstract description 37
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims abstract description 23
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 23
- 229910052802 copper Inorganic materials 0.000 claims abstract description 19
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 17
- 239000001257 hydrogen Substances 0.000 claims abstract description 17
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 16
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims abstract description 13
- 239000011651 chromium Substances 0.000 claims abstract description 13
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims abstract description 9
- 229910052804 chromium Inorganic materials 0.000 claims abstract description 9
- 229910052759 nickel Inorganic materials 0.000 claims abstract description 9
- 150000001868 cobalt Chemical class 0.000 claims abstract description 6
- 239000000460 chlorine Substances 0.000 claims description 16
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 15
- 125000003545 alkoxy group Chemical group 0.000 claims description 13
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 12
- 230000008878 coupling Effects 0.000 claims description 11
- 238000010168 coupling process Methods 0.000 claims description 11
- 238000005859 coupling reaction Methods 0.000 claims description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 11
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 10
- 125000003277 amino group Chemical group 0.000 claims description 10
- 125000004432 carbon atom Chemical group C* 0.000 claims description 10
- 229910052801 chlorine Inorganic materials 0.000 claims description 9
- 150000002815 nickel Chemical class 0.000 claims description 9
- DYRDKSSFIWVSNM-UHFFFAOYSA-N acetoacetanilide Chemical compound CC(=O)CC(=O)NC1=CC=CC=C1 DYRDKSSFIWVSNM-UHFFFAOYSA-N 0.000 claims description 8
- 125000004442 acylamino group Chemical group 0.000 claims description 8
- 229910052783 alkali metal Inorganic materials 0.000 claims description 8
- 150000001340 alkali metals Chemical class 0.000 claims description 8
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 6
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 6
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 6
- 229910052757 nitrogen Inorganic materials 0.000 claims description 6
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 6
- KJCVRFUGPWSIIH-UHFFFAOYSA-N 1-naphthol Chemical compound C1=CC=C2C(O)=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-N 0.000 claims description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 5
- 229910003202 NH4 Chemical group 0.000 claims description 5
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 claims description 5
- XBYRMPXUBGMOJC-UHFFFAOYSA-N 1,2-dihydropyrazol-3-one Chemical compound OC=1C=CNN=1 XBYRMPXUBGMOJC-UHFFFAOYSA-N 0.000 claims description 4
- JVVRJMXHNUAPHW-UHFFFAOYSA-N 1h-pyrazol-5-amine Chemical compound NC=1C=CNN=1 JVVRJMXHNUAPHW-UHFFFAOYSA-N 0.000 claims description 4
- TWMYIGNIDPMOSD-UHFFFAOYSA-N 4,6-diaminopyridine-3-carbonitrile Chemical compound NC1=CC(N)=C(C#N)C=N1 TWMYIGNIDPMOSD-UHFFFAOYSA-N 0.000 claims description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 125000004414 alkyl thio group Chemical group 0.000 claims description 4
- 125000004104 aryloxy group Chemical group 0.000 claims description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 4
- 229910052794 bromium Inorganic materials 0.000 claims description 4
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 4
- 229910001431 copper ion Inorganic materials 0.000 claims description 4
- 229910001453 nickel ion Inorganic materials 0.000 claims description 4
- 125000001424 substituent group Chemical group 0.000 claims description 4
- 229910052727 yttrium Inorganic materials 0.000 claims description 4
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- 150000004780 naphthols Chemical class 0.000 claims description 3
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 claims description 3
- WLFXSECCHULRRO-UHFFFAOYSA-N pyridine-2,6-diol Chemical class OC1=CC=CC(O)=N1 WLFXSECCHULRRO-UHFFFAOYSA-N 0.000 claims description 3
- CPEONABTMRSIKA-UHFFFAOYSA-N 1,4$l^{2}-oxazinane Chemical compound C1COCC[N]1 CPEONABTMRSIKA-UHFFFAOYSA-N 0.000 claims description 2
- 125000003282 alkyl amino group Chemical group 0.000 claims description 2
- 125000001769 aryl amino group Chemical group 0.000 claims description 2
- 125000001434 methanylylidene group Chemical group [H]C#[*] 0.000 claims description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N pyridine Substances C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 2
- 125000002947 alkylene group Chemical group 0.000 claims 2
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims 1
- 150000002790 naphthalenes Chemical class 0.000 claims 1
- 125000005184 naphthylamino group Chemical class C1(=CC=CC2=CC=CC=C12)N* 0.000 claims 1
- SMQUZDBALVYZAC-UHFFFAOYSA-N salicylaldehyde Chemical compound OC1=CC=CC=C1C=O SMQUZDBALVYZAC-UHFFFAOYSA-N 0.000 claims 1
- 150000003254 radicals Chemical class 0.000 description 15
- 229940124530 sulfonamide Drugs 0.000 description 12
- 229920002647 polyamide Polymers 0.000 description 10
- 229910006069 SO3H Inorganic materials 0.000 description 9
- 239000004952 Polyamide Substances 0.000 description 8
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 8
- 239000002253 acid Substances 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 5
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 5
- RWZYAGGXGHYGMB-UHFFFAOYSA-N anthranilic acid Chemical compound NC1=CC=CC=C1C(O)=O RWZYAGGXGHYGMB-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 238000004043 dyeing Methods 0.000 description 3
- 229960003742 phenol Drugs 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 239000001632 sodium acetate Substances 0.000 description 3
- 235000017281 sodium acetate Nutrition 0.000 description 3
- CDAWCLOXVUBKRW-UHFFFAOYSA-N 2-aminophenol Chemical compound NC1=CC=CC=C1O CDAWCLOXVUBKRW-UHFFFAOYSA-N 0.000 description 2
- ILEIUTCVWLYZOM-UHFFFAOYSA-N 2-hydroxy-5-methylbenzaldehyde Chemical compound CC1=CC=C(O)C(C=O)=C1 ILEIUTCVWLYZOM-UHFFFAOYSA-N 0.000 description 2
- JWAZRIHNYRIHIV-UHFFFAOYSA-N 2-naphthol Chemical compound C1=CC=CC2=CC(O)=CC=C21 JWAZRIHNYRIHIV-UHFFFAOYSA-N 0.000 description 2
- YCOXTKKNXUZSKD-UHFFFAOYSA-N 3,4-xylenol Chemical compound CC1=CC=C(O)C=C1C YCOXTKKNXUZSKD-UHFFFAOYSA-N 0.000 description 2
- IPPQNXSAJZOTJZ-UHFFFAOYSA-N 3-methylsalicylaldehyde Chemical compound CC1=CC=CC(C=O)=C1O IPPQNXSAJZOTJZ-UHFFFAOYSA-N 0.000 description 2
- 241000252067 Megalops atlanticus Species 0.000 description 2
- 239000004677 Nylon Substances 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 150000001299 aldehydes Chemical class 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 150000003931 anilides Chemical class 0.000 description 2
- 150000004982 aromatic amines Chemical class 0.000 description 2
- 239000000987 azo dye Substances 0.000 description 2
- 229910017052 cobalt Inorganic materials 0.000 description 2
- 239000010941 cobalt Substances 0.000 description 2
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 2
- XTVVROIMIGLXTD-UHFFFAOYSA-N copper(II) nitrate Chemical compound [Cu+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O XTVVROIMIGLXTD-UHFFFAOYSA-N 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 2
- 239000010985 leather Substances 0.000 description 2
- 239000002609 medium Substances 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- 229920001778 nylon Polymers 0.000 description 2
- IWDCLRJOBJJRNH-UHFFFAOYSA-N p-cresol Chemical compound CC1=CC=C(O)C=C1 IWDCLRJOBJJRNH-UHFFFAOYSA-N 0.000 description 2
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 2
- ZRHUHDUEXWHZMA-UHFFFAOYSA-N 1,4-dihydropyrazol-5-one Chemical class O=C1CC=NN1 ZRHUHDUEXWHZMA-UHFFFAOYSA-N 0.000 description 1
- 150000004782 1-naphthols Chemical class 0.000 description 1
- DOPJTDJKZNWLRB-UHFFFAOYSA-N 2-Amino-5-nitrophenol Chemical compound NC1=CC=C([N+]([O-])=O)C=C1O DOPJTDJKZNWLRB-UHFFFAOYSA-N 0.000 description 1
- LWUAMROXVQLJKA-UHFFFAOYSA-N 2-amino-3-chlorobenzoic acid Chemical compound NC1=C(Cl)C=CC=C1C(O)=O LWUAMROXVQLJKA-UHFFFAOYSA-N 0.000 description 1
- WASQBNCGNUTVNI-UHFFFAOYSA-N 2-amino-4,6-dichlorophenol Chemical compound NC1=CC(Cl)=CC(Cl)=C1O WASQBNCGNUTVNI-UHFFFAOYSA-N 0.000 description 1
- ZBQSNAUKYZWVIV-UHFFFAOYSA-N 2-amino-4-methoxyphenol 2-amino-4-methylphenol Chemical compound CC1=CC=C(O)C(N)=C1.COC1=CC=C(O)C(N)=C1 ZBQSNAUKYZWVIV-UHFFFAOYSA-N 0.000 description 1
- QPKNFEVLZVJGBM-UHFFFAOYSA-N 2-aminonaphthalen-1-ol Chemical compound C1=CC=CC2=C(O)C(N)=CC=C21 QPKNFEVLZVJGBM-UHFFFAOYSA-N 0.000 description 1
- FSMCOBJDZVRWIZ-UHFFFAOYSA-N 2-butoxybenzaldehyde Chemical compound CCCCOC1=CC=CC=C1C=O FSMCOBJDZVRWIZ-UHFFFAOYSA-N 0.000 description 1
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 1
- WTHUWXPBPNTSHJ-UHFFFAOYSA-N 2-hydroxy-3,6-dimethylbenzaldehyde Chemical compound CC1=CC=C(C)C(C=O)=C1O WTHUWXPBPNTSHJ-UHFFFAOYSA-N 0.000 description 1
- IHFRMUGEILMHNU-UHFFFAOYSA-N 2-hydroxy-5-nitrobenzaldehyde Chemical compound OC1=CC=C([N+]([O-])=O)C=C1C=O IHFRMUGEILMHNU-UHFFFAOYSA-N 0.000 description 1
- 150000004786 2-naphthols Chemical class 0.000 description 1
- FABVMBDCVAJXMB-UHFFFAOYSA-N 3,5-dichloro-2-hydroxybenzaldehyde Chemical compound OC1=C(Cl)C=C(Cl)C=C1C=O FABVMBDCVAJXMB-UHFFFAOYSA-N 0.000 description 1
- OEUMLWRWURKDRL-UHFFFAOYSA-N 3-chloro-2-hydroxy-5-methylbenzaldehyde Chemical compound CC1=CC(Cl)=C(O)C(C=O)=C1 OEUMLWRWURKDRL-UHFFFAOYSA-N 0.000 description 1
- DOHOPUBZLWVZMZ-UHFFFAOYSA-N 3-chloro-2-hydroxybenzaldehyde Chemical compound OC1=C(Cl)C=CC=C1C=O DOHOPUBZLWVZMZ-UHFFFAOYSA-N 0.000 description 1
- PFPUAFIFTNHJHO-UHFFFAOYSA-N 4,6-diamino-2-anilinopyridine-3-carbonitrile Chemical compound NC1=CC(N)=C(C#N)C(NC=2C=CC=CC=2)=N1 PFPUAFIFTNHJHO-UHFFFAOYSA-N 0.000 description 1
- MQVFKNRZTODPQQ-UHFFFAOYSA-N 4,6-diamino-2-piperidin-1-ylpyridine-3-carbonitrile Chemical compound NC1=CC(N)=C(C#N)C(N2CCCCC2)=N1 MQVFKNRZTODPQQ-UHFFFAOYSA-N 0.000 description 1
- WJASNMAUXFNVNB-UHFFFAOYSA-N 4-chloro-2-hydroxy-5-nitrobenzaldehyde Chemical compound OC1=CC(Cl)=C([N+]([O-])=O)C=C1C=O WJASNMAUXFNVNB-UHFFFAOYSA-N 0.000 description 1
- QNZWAJZEJAOVPN-UHFFFAOYSA-N 4-chloro-2-hydroxybenzaldehyde Chemical compound OC1=CC(Cl)=CC=C1C=O QNZWAJZEJAOVPN-UHFFFAOYSA-N 0.000 description 1
- RGHHSNMVTDWUBI-UHFFFAOYSA-N 4-hydroxybenzaldehyde Chemical compound OC1=CC=C(C=O)C=C1 RGHHSNMVTDWUBI-UHFFFAOYSA-N 0.000 description 1
- QHPQWRBYOIRBIT-UHFFFAOYSA-N 4-tert-butylphenol Chemical compound CC(C)(C)C1=CC=C(O)C=C1 QHPQWRBYOIRBIT-UHFFFAOYSA-N 0.000 description 1
- KEGNUIZNBCHWLZ-UHFFFAOYSA-N 5,8-dichloronaphthalen-1-ol Chemical compound C1=CC(Cl)=C2C(O)=CC=CC2=C1Cl KEGNUIZNBCHWLZ-UHFFFAOYSA-N 0.000 description 1
- ACOIYJJFAXRSHM-UHFFFAOYSA-N 5-aminopyrazol-3-one Chemical class NC1=CC(=O)N=N1 ACOIYJJFAXRSHM-UHFFFAOYSA-N 0.000 description 1
- NSKZAOKQZDLHGO-UHFFFAOYSA-N 5-chloro-2-hydroxy-3-methylbenzaldehyde Chemical compound CC1=CC(Cl)=CC(C=O)=C1O NSKZAOKQZDLHGO-UHFFFAOYSA-N 0.000 description 1
- IPZJPYHEVWLBNH-UHFFFAOYSA-N 5-chloronaphthalen-1-ol Chemical compound C1=CC=C2C(O)=CC=CC2=C1Cl IPZJPYHEVWLBNH-UHFFFAOYSA-N 0.000 description 1
- USQCUKQZXOWUDF-YWZLYKJASA-N 6-chloro-n-[(3s)-1-[(2s)-1-(4-methyl-5-oxo-1,4-diazepan-1-yl)-1-oxopropan-2-yl]-2-oxopyrrolidin-3-yl]naphthalene-2-sulfonamide Chemical compound O=C([C@@H](N1C([C@@H](NS(=O)(=O)C=2C=C3C=CC(Cl)=CC3=CC=2)CC1)=O)C)N1CCN(C)C(=O)CC1 USQCUKQZXOWUDF-YWZLYKJASA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical class C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 1
- 241001237728 Precis Species 0.000 description 1
- JELAXYWVEVGBGC-UHFFFAOYSA-N S(=O)(=O)(O)C1=CC=C(C=C1)S(=O)(=O)N.C1=C(C=CC2=CC=CC=C12)O Chemical compound S(=O)(=O)(O)C1=CC=C(C=C1)S(=O)(=O)N.C1=C(C=CC2=CC=CC=C12)O JELAXYWVEVGBGC-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 125000005236 alkanoylamino group Chemical group 0.000 description 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 1
- 125000004466 alkoxycarbonylamino group Chemical group 0.000 description 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 125000003435 aroyl group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000005161 aryl oxy carbonyl group Chemical group 0.000 description 1
- 125000004391 aryl sulfonyl group Chemical group 0.000 description 1
- 125000000732 arylene group Chemical group 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 125000000043 benzamido group Chemical group [H]N([*])C(=O)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 229950011260 betanaphthol Drugs 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001589 carboacyl group Chemical group 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 125000002668 chloroacetyl group Chemical group ClCC(=O)* 0.000 description 1
- 229940011182 cobalt acetate Drugs 0.000 description 1
- QAHREYKOYSIQPH-UHFFFAOYSA-L cobalt(II) acetate Chemical compound [Co+2].CC([O-])=O.CC([O-])=O QAHREYKOYSIQPH-UHFFFAOYSA-L 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 150000001879 copper Chemical class 0.000 description 1
- 125000001664 diethylamino group Chemical group [H]C([H])([H])C([H])([H])N(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- JHPHOFWHLYJZRN-UHFFFAOYSA-N ethyl n-(2-hydroxy-5-methylphenyl)carbamate Chemical compound CCOC(=O)NC1=CC(C)=CC=C1O JHPHOFWHLYJZRN-UHFFFAOYSA-N 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- FXHSLXPCKVVSLS-UHFFFAOYSA-N methyl n-(2-hydroxy-5-methylphenyl)carbamate Chemical compound COC(=O)NC1=CC(C)=CC=C1O FXHSLXPCKVVSLS-UHFFFAOYSA-N 0.000 description 1
- BFVHBHKMLIBQNN-UHFFFAOYSA-N n-(2-chlorophenyl)-3-oxobutanamide Chemical compound CC(=O)CC(=O)NC1=CC=CC=C1Cl BFVHBHKMLIBQNN-UHFFFAOYSA-N 0.000 description 1
- MHQYNOHBRKPLGX-UHFFFAOYSA-N n-(5-hydroxy-2-methylphenyl)acetamide Chemical compound CC(=O)NC1=CC(O)=CC=C1C MHQYNOHBRKPLGX-UHFFFAOYSA-N 0.000 description 1
- 150000005002 naphthylamines Chemical class 0.000 description 1
- 125000004957 naphthylene group Chemical group 0.000 description 1
- LGQLOGILCSXPEA-UHFFFAOYSA-L nickel sulfate Chemical compound [Ni+2].[O-]S([O-])(=O)=O LGQLOGILCSXPEA-UHFFFAOYSA-L 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- NRZWYNLTFLDQQX-UHFFFAOYSA-N p-tert-Amylphenol Chemical compound CCC(C)(C)C1=CC=C(O)C=C1 NRZWYNLTFLDQQX-UHFFFAOYSA-N 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 125000006678 phenoxycarbonyl group Chemical group 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- PTHOQHHSYVYATB-UHFFFAOYSA-N pyrazol-3-imine Chemical compound N=C1C=CN=N1 PTHOQHHSYVYATB-UHFFFAOYSA-N 0.000 description 1
- UBQKCCHYAOITMY-UHFFFAOYSA-N pyridin-2-ol Chemical class OC1=CC=CC=N1 UBQKCCHYAOITMY-UHFFFAOYSA-N 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-N sulfonic acid Chemical group OS(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-N 0.000 description 1
- 238000011282 treatment Methods 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 210000002268 wool Anatomy 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B45/00—Complex metal compounds of azo dyes
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B55/00—Azomethine dyes
- C09B55/002—Monoazomethine dyes
-
- D—TEXTILES; PAPER
- D06—TREATMENT OF TEXTILES OR THE LIKE; LAUNDERING; FLEXIBLE MATERIALS NOT OTHERWISE PROVIDED FOR
- D06P—DYEING OR PRINTING TEXTILES; DYEING LEATHER, FURS OR SOLID MACROMOLECULAR SUBSTANCES IN ANY FORM
- D06P1/00—General processes of dyeing or printing textiles, or general processes of dyeing leather, furs, or solid macromolecular substances in any form, classified according to the dyes, pigments, or auxiliary substances employed
- D06P1/02—General processes of dyeing or printing textiles, or general processes of dyeing leather, furs, or solid macromolecular substances in any form, classified according to the dyes, pigments, or auxiliary substances employed using azo dyes
- D06P1/10—General processes of dyeing or printing textiles, or general processes of dyeing leather, furs, or solid macromolecular substances in any form, classified according to the dyes, pigments, or auxiliary substances employed using azo dyes containing metal
-
- D—TEXTILES; PAPER
- D06—TREATMENT OF TEXTILES OR THE LIKE; LAUNDERING; FLEXIBLE MATERIALS NOT OTHERWISE PROVIDED FOR
- D06P—DYEING OR PRINTING TEXTILES; DYEING LEATHER, FURS OR SOLID MACROMOLECULAR SUBSTANCES IN ANY FORM
- D06P1/00—General processes of dyeing or printing textiles, or general processes of dyeing leather, furs, or solid macromolecular substances in any form, classified according to the dyes, pigments, or auxiliary substances employed
- D06P1/13—General processes of dyeing or printing textiles, or general processes of dyeing leather, furs, or solid macromolecular substances in any form, classified according to the dyes, pigments, or auxiliary substances employed using azomethine dyes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Textile Engineering (AREA)
- Coloring (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH976474A CH603758A5 (en) | 1974-07-16 | 1974-07-16 | Metallised azo or axomethine dyes |
| CH675075 | 1975-05-27 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1055019A true CA1055019A (en) | 1979-05-22 |
Family
ID=25700111
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA231,396A Expired CA1055019A (en) | 1974-07-16 | 1975-07-14 | Metallised dyes, their manufacture and use |
Country Status (12)
| Country | Link |
|---|---|
| US (3) | US4215042A (enExample) |
| JP (1) | JPS5921904B2 (enExample) |
| AR (1) | AR207988A1 (enExample) |
| CA (1) | CA1055019A (enExample) |
| DD (1) | DD120462A5 (enExample) |
| DE (1) | DE2531443C2 (enExample) |
| ES (1) | ES439414A1 (enExample) |
| FR (1) | FR2278738A1 (enExample) |
| GB (1) | GB1520308A (enExample) |
| IT (1) | IT1040931B (enExample) |
| NL (1) | NL7507204A (enExample) |
| SU (1) | SU893138A3 (enExample) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4507124A (en) * | 1982-07-02 | 1985-03-26 | Ciba-Geigy Corporation | 1:2 Metal complexes of azomethine dyes having arylazo groups |
| CH660016A5 (de) * | 1983-11-09 | 1987-03-13 | Ciba Geigy Ag | Reaktivfarbstoffe und deren herstellung. |
| EP0183651B1 (de) * | 1984-11-30 | 1990-05-23 | Ciba-Geigy Ag | Neue Metallkomplexe, Verfahren zu deren Herstellung und Verwendung |
| US4760134A (en) * | 1985-08-28 | 1988-07-26 | Hoechst Celanese Corporation | Process for the preparation of the copper complex disazo compounds from disazo compounds containing an O'-alkoxyaniline group by coppering dimethylation at a pH at about 3-6 |
| US5821356A (en) | 1996-08-12 | 1998-10-13 | The Perkin Elmer Corporation | Propargylethoxyamino nucleotides |
| GB9921928D0 (en) * | 1999-09-16 | 1999-11-17 | Avecia Ltd | Compound |
| WO2002059216A1 (en) * | 2001-01-26 | 2002-08-01 | Ciba Specialty Chemicals Holding Inc. | Azo dyes, a process for their preparation and their use in the dyeing or printing of hydrophobic fibre materials |
| DE10206564A1 (de) * | 2002-02-18 | 2003-09-04 | Bayer Ag | Inkjet-Farbstoffe |
| GB0413557D0 (en) * | 2004-06-17 | 2004-07-21 | Avecia Ltd | Compounds |
| JP2013091723A (ja) * | 2011-10-26 | 2013-05-16 | Sumitomo Chemical Co Ltd | 化合物 |
Family Cites Families (33)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3040019A (en) * | 1962-06-19 | Metal-complex dyestuffs | ||
| US2317733A (en) * | 1940-06-20 | 1943-04-27 | Geigy Ag J R | Dyestuffs becoming green when chromed and their manufacture |
| US2602080A (en) * | 1947-10-22 | 1952-07-01 | Gen Aniline & Film Corp | Metallized ortho-hydroxy monoazo dyestuffs |
| US2897190A (en) * | 1951-12-21 | 1959-07-28 | Ciba Ltd | Metalliferous azo-dyestuffs |
| DE934905C (de) * | 1951-12-21 | 1955-11-10 | Ciba Geigy | Verfahren zur Herstellung neuer metallhaltiger Azofarbstoffe |
| US2897189A (en) * | 1951-12-21 | 1959-07-28 | Ciba Ltd | Metalliferous azo-dyestuffs |
| CH340284A (de) * | 1955-12-20 | 1959-08-15 | Sandoz Ag | Verfahren zur Herstellung metallisierbarer Monoazofarbstoffe |
| US2970137A (en) * | 1958-09-09 | 1961-01-31 | Verona Pharma Chemical Corp | Metallized mixed azo-dyestuffs |
| DE1275706B (de) * | 1958-12-12 | 1968-08-22 | Sandoz Ag | Verfahren zur Herstellung von Metallkomplexfarbstoffen |
| CH384108A (de) * | 1959-05-28 | 1964-11-15 | Sandoz Ag | Verfahren zur Herstellung metallhaltiger Azofarbstoffe |
| DE1233518B (de) * | 1961-12-14 | 1967-02-02 | Bayer Ag | Verfahren zur Herstellung metallhaltiger Azofarbstoffe |
| CH442574A (de) * | 1962-03-21 | 1967-08-31 | Acna | Verfahren zur Herstellung von neuen metallisierten Farbstoffen |
| CH473871A (de) * | 1965-02-19 | 1969-06-15 | Sandoz Ag | Verfahren zur Herstellung wasserlöslicher, kupferhaltiger Reaktivfarbstoffe |
| CH503781A (de) | 1968-05-15 | 1971-02-28 | Sandoz Ag | Verfahren zur Herstellung von basischen Farbstoffen |
| CH544138A (de) | 1968-07-15 | 1973-11-15 | Ciba Geigy Ag | Verfahren zur Herstellung metallhaltiger Azofarbstoffe |
| CH552035A (de) | 1968-07-15 | 1974-07-31 | Ciba Geigy Ag | Verfahren zur herstellung von azofarbstoffen. |
| CH552661A (de) | 1968-11-12 | 1974-08-15 | Ciba Geigy Ag | Verfahren zur herstellung neuer azofarbstoffe. |
| US3936436A (en) | 1969-12-22 | 1976-02-03 | Imperial Chemical Industries Limited | Water-soluble azo dyestuffs containing triazine and 3-azo-2,6-dihydroxypyrid-6-one radicals |
| US4067864A (en) | 1970-05-15 | 1978-01-10 | Ciba-Geigy Ag | Fiber-reactive 2-hydroxy-pyrid-6-on-(3)-yl azo dyestuffs |
| US3723490A (en) * | 1970-05-20 | 1973-03-27 | Ciba Geigy Ag | Production of azomethine pigments |
| US3700709A (en) * | 1970-05-20 | 1972-10-24 | Ciba Geigy Ag | Azomethine pigments |
| GB1350602A (en) | 1970-07-10 | 1974-04-18 | Ici Ltd | Azo dyestuffs |
| US4017477A (en) | 1970-08-19 | 1977-04-12 | Ciba-Geigy Ag | 3-Halogeno-6-hydroxy-pyridone-(2) azo dyestuffs |
| CH562301A5 (enExample) * | 1971-12-13 | 1975-05-30 | Ciba Geigy Ag | |
| US4058515A (en) * | 1972-05-30 | 1977-11-15 | Toms River Chemical Corporation | Metallized phenyl-azo-naphthol compounds |
| US4092308A (en) | 1972-10-05 | 1978-05-30 | Ciba-Geigy Corporation | 4-Sulphomethyl substituted hydroxypyridone azo dyestuffs |
| DE2307341A1 (de) * | 1973-02-15 | 1974-08-29 | Hoechst Ag | Wasserunloesliche monoazomethinfarbstoffe, verfahren zu ihrer herstellung und ihre verwendung |
| US4066637A (en) | 1974-06-18 | 1978-01-03 | Ciba-Geigy Corporation | Basic diaminopyridine-(3)-azo dyestuffs |
| US4096157A (en) * | 1974-08-28 | 1978-06-20 | Hoechst Aktiengesellschaft | Azamethine metal complex compounds |
| US4116952A (en) | 1975-05-14 | 1978-09-26 | Ciba-Geigy Corporation | Unsymmetrical azo - azo methine 1:2 chromium complex dyes |
| CH636632A5 (de) | 1976-10-08 | 1983-06-15 | Ciba Geigy Ag | Neues verfahren zur herstellung von schwermetallkomplexen. |
| CH627201A5 (enExample) | 1977-03-14 | 1981-12-31 | Sandoz Ag | |
| GB1555423A (en) | 1977-05-27 | 1979-11-07 | Ici Ltd | Reactive dyestuffs containing a halogeno-pyridine residue |
-
1975
- 1975-01-01 AR AR259567A patent/AR207988A1/es active
- 1975-06-17 NL NL7507204A patent/NL7507204A/xx not_active Application Discontinuation
- 1975-06-23 JP JP50075795A patent/JPS5921904B2/ja not_active Expired
- 1975-07-10 FR FR7521712A patent/FR2278738A1/fr active Granted
- 1975-07-14 CA CA231,396A patent/CA1055019A/en not_active Expired
- 1975-07-14 IT IT50505/75A patent/IT1040931B/it active
- 1975-07-14 DE DE2531443A patent/DE2531443C2/de not_active Expired
- 1975-07-15 ES ES439414A patent/ES439414A1/es not_active Expired
- 1975-07-15 SU SU752155211A patent/SU893138A3/ru active
- 1975-07-15 GB GB29634/75A patent/GB1520308A/en not_active Expired
- 1975-07-15 DD DD187307A patent/DD120462A5/xx unknown
-
1978
- 1978-05-09 US US05/904,358 patent/US4215042A/en not_active Expired - Lifetime
-
1980
- 1980-05-05 US US06/146,973 patent/US4318849A/en not_active Expired - Lifetime
-
1981
- 1981-11-09 US US06/319,533 patent/US4436659A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| US4436659A (en) | 1984-03-13 |
| ES439414A1 (es) | 1977-02-01 |
| US4318849A (en) | 1982-03-09 |
| GB1520308A (en) | 1978-08-09 |
| JPS5921904B2 (ja) | 1984-05-23 |
| DE2531443C2 (de) | 1985-02-14 |
| AR207988A1 (es) | 1976-11-22 |
| AU8304675A (en) | 1977-01-20 |
| SU893138A3 (ru) | 1981-12-23 |
| FR2278738A1 (fr) | 1976-02-13 |
| FR2278738B1 (enExample) | 1977-12-16 |
| US4215042A (en) | 1980-07-29 |
| IT1040931B (it) | 1979-12-20 |
| NL7507204A (nl) | 1976-01-20 |
| DD120462A5 (enExample) | 1976-06-12 |
| JPS5117220A (enExample) | 1976-02-12 |
| DE2531443A1 (de) | 1976-01-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1055019A (en) | Metallised dyes, their manufacture and use | |
| US4052374A (en) | Unsymmetrical 1:2-chromium complexes containing an azo compound and an azomethine compound | |
| US2775581A (en) | Oxhxc | |
| US4234479A (en) | Chromium mixed complex dyestuffs of phenyl-azo-pyrazole components | |
| US2778816A (en) | Cobaltiferous and chromiferous azo-dyestuffs | |
| US3041328A (en) | Metallized disazo dyes | |
| US3468871A (en) | Metal-containing monoazo dyestuffs | |
| US2804454A (en) | Complex heavy metal compounds of monoazo dyestuffs | |
| US3516980A (en) | Heterogeneous 1:2 cobalt or chromium complex azo dyestuffs | |
| US2901473A (en) | Oxazoline and dihydro oxazine monoazo dyestuffs and their metal complex compounds | |
| US2839521A (en) | Azo dyestuffs containing heavy metal | |
| US2366633A (en) | Metalized azo dyestuffs | |
| US4489002A (en) | Azo compound and an azomethine compound and having a tertiary N-dative bond | |
| US3933785A (en) | Azo compounds | |
| US2789975A (en) | Azo dyestuffs of the pyrazolone series | |
| US4663441A (en) | Asymmetric 1:2 chrome complex dye of a phenylazosulphonaphtholamine and a naphtholazosulphonaphthol | |
| CA1168654A (en) | Chrome-complex dyes and the production and use thereof | |
| US2529444A (en) | Metalized ortho-hydroxy, ortho amino monoazo dyestuffs | |
| US4212801A (en) | Unsymmetrical 1:2-chromium complexes containing an azo and an azomethine bond | |
| US4315854A (en) | Chromium and cobalt complex amino hydroxy azomethine dyes | |
| US2014484A (en) | Azo dyestuffs | |
| US2780619A (en) | Metallizable disazo dyestuffs | |
| US2177427A (en) | Azo dyestuffs | |
| US2897190A (en) | Metalliferous azo-dyestuffs | |
| US2753334A (en) | Pyrazolone metalliferous azodyestuffs |