CA1052811A - Cyclic amino-acids - Google Patents
Cyclic amino-acidsInfo
- Publication number
- CA1052811A CA1052811A CA242,147A CA242147A CA1052811A CA 1052811 A CA1052811 A CA 1052811A CA 242147 A CA242147 A CA 242147A CA 1052811 A CA1052811 A CA 1052811A
- Authority
- CA
- Canada
- Prior art keywords
- aminomethyl
- whenever prepared
- obvious chemical
- process according
- acetate
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- -1 Cyclic amino-acids Chemical class 0.000 title claims description 10
- 238000000034 method Methods 0.000 claims abstract description 25
- 230000008569 process Effects 0.000 claims abstract description 23
- 150000001875 compounds Chemical class 0.000 claims abstract description 21
- 150000003839 salts Chemical class 0.000 claims abstract description 13
- 239000002253 acid Substances 0.000 claims abstract description 11
- 238000002360 preparation method Methods 0.000 claims abstract description 3
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 9
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 8
- 150000001540 azides Chemical class 0.000 claims description 5
- 229940077388 benzenesulfonate Drugs 0.000 claims description 5
- 238000006969 Curtius rearrangement reaction Methods 0.000 claims description 4
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 claims description 4
- LBLYYCQCTBFVLH-UHFFFAOYSA-M 2-methylbenzenesulfonate Chemical class CC1=CC=CC=C1S([O-])(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-M 0.000 claims description 3
- 238000006644 Lossen rearrangement reaction Methods 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- MXNASYICBPHSLF-UHFFFAOYSA-N 2-[1-(aminomethyl)cycloheptyl]acetic acid Chemical compound OC(=O)CC1(CN)CCCCCC1 MXNASYICBPHSLF-UHFFFAOYSA-N 0.000 claims description 2
- 238000007167 Hofmann rearrangement reaction Methods 0.000 claims description 2
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical class OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 claims description 2
- 239000000126 substance Substances 0.000 claims 10
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical group [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 claims 2
- MKGSCDBHUPQQMX-UHFFFAOYSA-N 2-[1-(aminomethyl)cyclopentyl]acetic acid Chemical compound OC(=O)CC1(CN)CCCC1 MKGSCDBHUPQQMX-UHFFFAOYSA-N 0.000 claims 1
- UGJMXCAKCUNAIE-UHFFFAOYSA-N Gabapentin Chemical compound OC(=O)CC1(CN)CCCCC1 UGJMXCAKCUNAIE-UHFFFAOYSA-N 0.000 claims 1
- HJQOMCVHLXVRAK-UHFFFAOYSA-N butyl 2-[1-(aminomethyl)cycloheptyl]acetate Chemical compound CCCCOC(=O)CC1(CN)CCCCCC1 HJQOMCVHLXVRAK-UHFFFAOYSA-N 0.000 claims 1
- IPNWNGVBVWEYLT-UHFFFAOYSA-N butyl 2-[1-(aminomethyl)cyclohexyl]acetate Chemical compound CCCCOC(=O)CC1(CN)CCCCC1 IPNWNGVBVWEYLT-UHFFFAOYSA-N 0.000 claims 1
- QUPDWYMUPZLYJZ-UHFFFAOYSA-N ethyl Chemical compound C[CH2] QUPDWYMUPZLYJZ-UHFFFAOYSA-N 0.000 claims 1
- PQCNPWAMVMHDID-UHFFFAOYSA-N ethyl 2-[1-(aminomethyl)cyclohexyl]acetate Chemical compound CCOC(=O)CC1(CN)CCCCC1 PQCNPWAMVMHDID-UHFFFAOYSA-N 0.000 claims 1
- BPUUTTKHBSNDRT-UHFFFAOYSA-N methyl 2-[1-(aminomethyl)cycloheptyl]acetate Chemical compound COC(=O)CC1(CN)CCCCCC1 BPUUTTKHBSNDRT-UHFFFAOYSA-N 0.000 claims 1
- SYKKFHNKTXXXCK-UHFFFAOYSA-N methyl 2-[1-(aminomethyl)cyclohexyl]acetate Chemical compound COC(=O)CC1(CN)CCCCC1 SYKKFHNKTXXXCK-UHFFFAOYSA-N 0.000 claims 1
- 150000007513 acids Chemical class 0.000 abstract description 3
- 208000010513 Stupor Diseases 0.000 abstract description 2
- 229910052739 hydrogen Inorganic materials 0.000 abstract description 2
- 230000002631 hypothermal effect Effects 0.000 abstract description 2
- 230000003389 potentiating effect Effects 0.000 abstract description 2
- 230000001624 sedative effect Effects 0.000 abstract description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 abstract 1
- 125000004122 cyclic group Chemical group 0.000 abstract 1
- 239000001257 hydrogen Substances 0.000 abstract 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 31
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 30
- 239000000243 solution Substances 0.000 description 29
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 27
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 24
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 20
- 235000013350 formula milk Nutrition 0.000 description 20
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 13
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 11
- 239000011541 reaction mixture Substances 0.000 description 11
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 10
- 229910001868 water Inorganic materials 0.000 description 10
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 150000001413 amino acids Chemical class 0.000 description 9
- 238000002844 melting Methods 0.000 description 9
- 230000008018 melting Effects 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 8
- 238000001704 evaporation Methods 0.000 description 7
- 235000011167 hydrochloric acid Nutrition 0.000 description 7
- 229960000443 hydrochloric acid Drugs 0.000 description 7
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 7
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 7
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 150000008064 anhydrides Chemical class 0.000 description 6
- 238000001816 cooling Methods 0.000 description 6
- 230000008020 evaporation Effects 0.000 description 6
- 239000012948 isocyanate Substances 0.000 description 6
- 150000002513 isocyanates Chemical class 0.000 description 6
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 6
- 229910021529 ammonia Inorganic materials 0.000 description 5
- 239000007864 aqueous solution Substances 0.000 description 5
- 238000002425 crystallisation Methods 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 4
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 4
- 150000002500 ions Chemical class 0.000 description 4
- 238000001953 recrystallisation Methods 0.000 description 4
- 159000000000 sodium salts Chemical class 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- NEAQRZUHTPSBBM-UHFFFAOYSA-N 2-hydroxy-3,3-dimethyl-7-nitro-4h-isoquinolin-1-one Chemical class C1=C([N+]([O-])=O)C=C2C(=O)N(O)C(C)(C)CC2=C1 NEAQRZUHTPSBBM-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 3
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- 159000000007 calcium salts Chemical class 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 230000008707 rearrangement Effects 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 101500028027 Mus musculus Cathelin-related antimicrobial peptide Proteins 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 150000003863 ammonium salts Chemical class 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 230000032050 esterification Effects 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 231100000053 low toxicity Toxicity 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 230000001681 protective effect Effects 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 2
- LNAZSHAWQACDHT-XIYTZBAFSA-N (2r,3r,4s,5r,6s)-4,5-dimethoxy-2-(methoxymethyl)-3-[(2s,3r,4s,5r,6r)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6r)-4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane Chemical compound CO[C@@H]1[C@@H](OC)[C@H](OC)[C@@H](COC)O[C@H]1O[C@H]1[C@H](OC)[C@@H](OC)[C@H](O[C@H]2[C@@H]([C@@H](OC)[C@H](OC)O[C@@H]2COC)OC)O[C@@H]1COC LNAZSHAWQACDHT-XIYTZBAFSA-N 0.000 description 1
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 1
- DQNWKASPZFJVMJ-UHFFFAOYSA-N 2-cycloheptylacetic acid Chemical compound OC(=O)CC1CCCCCC1 DQNWKASPZFJVMJ-UHFFFAOYSA-N 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 208000018152 Cerebral disease Diseases 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- 239000001828 Gelatine Substances 0.000 description 1
- 241000206672 Gelidium Species 0.000 description 1
- 208000006083 Hypokinesia Diseases 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- CWRVKFFCRWGWCS-UHFFFAOYSA-N Pentrazole Chemical compound C1CCCCC2=NN=NN21 CWRVKFFCRWGWCS-UHFFFAOYSA-N 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 235000010419 agar Nutrition 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- IVRMZWNICZWHMI-UHFFFAOYSA-N azide group Chemical group [N-]=[N+]=[N-] IVRMZWNICZWHMI-UHFFFAOYSA-N 0.000 description 1
- IYMAUEAFOBSGCY-UHFFFAOYSA-N benzene;sulfurochloridic acid Chemical compound OS(Cl)(=O)=O.C1=CC=CC=C1 IYMAUEAFOBSGCY-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 230000033228 biological regulation Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 125000002843 carboxylic acid group Chemical group 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 230000002490 cerebral effect Effects 0.000 description 1
- 239000007979 citrate buffer Substances 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 208000002173 dizziness Diseases 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 229960001484 edetic acid Drugs 0.000 description 1
- 206010015037 epilepsy Diseases 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 229920006158 high molecular weight polymer Polymers 0.000 description 1
- BRWIZMBXBAOCCF-UHFFFAOYSA-N hydrazinecarbothioamide Chemical compound NNC(N)=S BRWIZMBXBAOCCF-UHFFFAOYSA-N 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 230000003483 hypokinetic effect Effects 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 229910052738 indium Inorganic materials 0.000 description 1
- 208000014674 injury Diseases 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 230000000873 masking effect Effects 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 229960005152 pentetrazol Drugs 0.000 description 1
- 239000008194 pharmaceutical composition Substances 0.000 description 1
- 239000008024 pharmaceutical diluent Substances 0.000 description 1
- 230000003285 pharmacodynamic effect Effects 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- SSOLNOMRVKKSON-UHFFFAOYSA-N proguanil Chemical compound CC(C)\N=C(/N)N=C(N)NC1=CC=C(Cl)C=C1 SSOLNOMRVKKSON-UHFFFAOYSA-N 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 125000005624 silicic acid group Chemical class 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 238000005245 sintering Methods 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- CRWJEUDFKNYSBX-UHFFFAOYSA-N sodium;hypobromite Chemical compound [Na+].Br[O-] CRWJEUDFKNYSBX-UHFFFAOYSA-N 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 239000001384 succinic acid Substances 0.000 description 1
- 239000001117 sulphuric acid Substances 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 238000005979 thermal decomposition reaction Methods 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 230000008733 trauma Effects 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- 150000003673 urethanes Chemical class 0.000 description 1
- 235000019871 vegetable fat Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D205/00—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom
- C07D205/02—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings
- C07D205/06—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D205/08—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with one oxygen atom directly attached in position 2, e.g. beta-lactams
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/08—Antiepileptics; Anticonvulsants
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/20—Hypnotics; Sedatives
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- General Health & Medical Sciences (AREA)
- Neurology (AREA)
- Neurosurgery (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Veterinary Medicine (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Biomedical Technology (AREA)
- Public Health (AREA)
- Anesthesiology (AREA)
- Pain & Pain Management (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2460891A DE2460891C2 (de) | 1974-12-21 | 1974-12-21 | 1-Aminomethyl-1-cycloalkanessigsäuren und deren Ester, Verfahren zu deren Herstellung und diese Verbindungen enthaltende Arzneimittel |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1052811A true CA1052811A (en) | 1979-04-17 |
Family
ID=5934284
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA242,147A Expired CA1052811A (en) | 1974-12-21 | 1975-12-19 | Cyclic amino-acids |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US4024175A (enExample) |
| JP (1) | JPS5324064B2 (enExample) |
| AT (1) | AT340892B (enExample) |
| BE (1) | BE836835A (enExample) |
| CA (1) | CA1052811A (enExample) |
| CH (3) | CH612665A5 (enExample) |
| DE (1) | DE2460891C2 (enExample) |
| DK (1) | DK147706C (enExample) |
| ES (1) | ES443723A1 (enExample) |
| FI (1) | FI62282C (enExample) |
| FR (1) | FR2294697A1 (enExample) |
| GB (1) | GB1465229A (enExample) |
| IE (1) | IE42382B1 (enExample) |
| LU (1) | LU74058A1 (enExample) |
| NL (1) | NL181006C (enExample) |
| SE (1) | SE423385B (enExample) |
Families Citing this family (221)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2611690A1 (de) * | 1976-03-19 | 1977-09-22 | Goedecke Ag | Cyclische sulfonyloxyimide |
| JPS5776189U (enExample) * | 1980-10-28 | 1982-05-11 | ||
| JPS6152583U (enExample) * | 1984-09-11 | 1986-04-09 | ||
| JPS61139881U (enExample) * | 1985-02-21 | 1986-08-29 | ||
| US4876279A (en) * | 1986-05-05 | 1989-10-24 | Merck & Co., Inc. | Antihypercholesterolemic compounds |
| US4894476A (en) * | 1988-05-02 | 1990-01-16 | Warner-Lambert Company | Gabapentin monohydrate and a process for producing the same |
| US4960931A (en) * | 1988-05-02 | 1990-10-02 | Warner-Lambert Company | Gabapentin mohohydrate and a process for producing the same |
| YU162789A (en) * | 1988-09-01 | 1990-12-31 | Lonza Ag | 2-aza-4-(alcoxycarbonyl) spiro/4,5/decan-3-ones |
| DE3928184A1 (de) * | 1989-08-25 | 1991-02-28 | Goedecke Ag | Verfahren zur herstellung von cyclischen aminosaeurederivaten sowie zwischenprodukte |
| AU633612B2 (en) * | 1989-08-25 | 1993-02-04 | Warner-Lambert Company | Improved process for cyclic amino acid anticonvulsant compounds |
| US5132451A (en) * | 1989-08-25 | 1992-07-21 | Warner-Lambert Company | Process for cyclic amino acid anticonvulsant compounds |
| DE3928182A1 (de) * | 1989-08-25 | 1991-02-28 | Goedecke Ag | Verfahren zur herstellung von gabapentin |
| US5319135A (en) * | 1989-08-25 | 1994-06-07 | Warner-Lambert Company | Process for cyclic amino acid anticonvulsant compounds |
| DE3928183A1 (de) * | 1989-08-25 | 1991-02-28 | Goedecke Ag | Lactamfreie cyclische aminosaeuren |
| FI905584A7 (fi) * | 1989-11-16 | 1991-05-17 | Lonza Ag | Menetelmä 1-(aminometyyli)sykloheksaanietikkahapon valmistamiseksi |
| US5260467A (en) * | 1989-11-16 | 1993-11-09 | Pfizer Inc. | Glutaric acid derivatives and preparation thereof |
| GB8925933D0 (en) * | 1989-11-16 | 1990-01-04 | Pfizer Ltd | Glutaric acid derivatives and preparation thereof |
| US5136091A (en) * | 1989-11-16 | 1992-08-04 | Lonza Ltd. | Process for the production of 1-(aminomethyl) cyclohexane acetic acid |
| US5149870A (en) * | 1989-11-16 | 1992-09-22 | Lonza Ltd. | Process for the production of 1-(aminomethyl)cyclohexane acetic acid |
| US5157138A (en) * | 1989-11-16 | 1992-10-20 | Pfizer, Inc. | Glutaric acid derivatives and preparation thereof |
| US5084479A (en) * | 1990-01-02 | 1992-01-28 | Warner-Lambert Company | Novel methods for treating neurodegenerative diseases |
| US5025035A (en) * | 1990-10-12 | 1991-06-18 | Warner-Lambert Company | Method of treating depression |
| US5792796A (en) * | 1994-07-27 | 1998-08-11 | Warner-Lambert Company | Methods for treating anxiety and panic |
| US5510381A (en) * | 1995-05-15 | 1996-04-23 | Warner-Lambert Company | Method of treatment of mania and bipolar disorder |
| IL125562A (en) * | 1996-02-07 | 2001-08-08 | Warner Lambert Co | Cyclic amino acids and pharmaceutical compositions comprising them |
| EE9800309A (et) * | 1996-03-14 | 1999-02-15 | Warner-Lambert Company | Uued asendatud tsüklilised aminohapped kui farmatseutilised toimeained |
| ES2169848T3 (es) * | 1996-03-14 | 2002-07-16 | Warner Lambert Co | Nuevos aminoacidos ciclicos coronados como agentes farmaceuticos. |
| DE69722426T3 (de) | 1996-07-24 | 2015-05-07 | Warner-Lambert Company LLC (n.Ges. des Staates Delaware) | Isobutylgaba und dessen derivate zur schmerzbehandlung |
| AU733896B2 (en) * | 1996-10-23 | 2001-05-31 | Warner-Lambert Company | Substituted gamma aminobutyric acids as pharmaceutical agents |
| US6255526B1 (en) | 1996-12-24 | 2001-07-03 | Teva Pharmaceutical Industries Ltd. | Preparation of gabapentin |
| IL119890A (en) * | 1996-12-24 | 2002-03-10 | Teva Pharma | Gabapentin form iii and preparation of gabapentin form ii |
| HRP980342A2 (en) * | 1997-06-25 | 1999-02-28 | Warner Lambert Co | Anti-inflammatory method |
| US6329429B1 (en) | 1997-06-25 | 2001-12-11 | Warner-Lambert Company | Use of GABA analogs such as Gabapentin in the manufacture of a medicament for treating inflammatory diseases |
| WO1999008667A2 (en) | 1997-08-19 | 1999-02-25 | Warner-Lambert Company | Methods for treating physiological conditions associated with the use, or sequelae of use, of cocaine or other psychomotor stimulants |
| PL339142A1 (en) * | 1997-09-08 | 2000-12-04 | Warner Lambert Co | Analgesic compositions containing anticonvulsants and method of using them |
| US6294690B1 (en) | 1997-10-07 | 2001-09-25 | Warner-Lambert Company | Process for preparing a cyclic amino acid anticonvulsant compound |
| KR100589066B1 (ko) * | 1997-10-27 | 2006-06-13 | 워너-램버트 캄파니 엘엘씨 | 약제로서 유용한 시클릭 아미노산 및 그의 유도체 |
| US6984659B2 (en) * | 1997-11-18 | 2006-01-10 | Klinikum Der Albert-Ludwigs Universitaet | 2-pyrrolidinone derivatives substituted at position 4 for reducing the extracellular glutamate level |
| BR9814287A (pt) | 1997-12-16 | 2000-10-03 | Warner Lambert Co | "4(3)-aminometil-(tio)piran 4(3) substituìdo ou derivados da piperidina (= análogos da gabapentina), sua preparação e seu uso no tratamento de desordens neurológicas" |
| BR9813656A (pt) | 1997-12-16 | 2000-10-10 | Warner Lambert Co | Aminas como agentes farmacêuticos |
| PT1047678E (pt) * | 1997-12-16 | 2004-12-31 | Warner Lambert Co | Derivados do 1-aminometil-cicloalcano substituido em 1 (=analogos da gabapentina) sua preparacao e sua utilizacao no tratamento de disturbios neurologicos |
| CA2309354A1 (en) * | 1998-01-23 | 1999-07-29 | Leslie Magnus-Miller | Gabapentin and its derivatives for the treatment of muscular and skeletal pain |
| EP0974351A3 (en) * | 1998-04-24 | 2000-12-13 | Jouveinal | Medicament for preventing and treating gastrointestinal damage |
| PL204921B1 (pl) | 1998-05-15 | 2010-02-26 | Warner Lambert Co | Stabilizowana kompozycja farmaceutyczna zawierająca 4-amino-3-podstawioną pochodną kwasu butanowego i α-aminokwas oraz sposób jej wytwarzania |
| CU23051A3 (es) * | 1998-05-15 | 2005-06-24 | Warner Lambert Co | Composiciones solidas que contienen derivados de acido gamma-aminobutirico y procesos para prepararlas. |
| ES2137137B1 (es) * | 1998-05-25 | 2000-08-16 | Medichem Sa | Nuevo polimorfo de gabapentina no hidratada, su procedimiento de obtencion y su utilizacion para la obtencion de gabapentina de calidad farmaceutica. |
| KR20010043831A (ko) | 1998-05-26 | 2001-05-25 | 로즈 암스트롱, 크리스틴 에이. 트러트웨인 | 칼슘 채널의 알파2델타 서브유닛에 대한 친화력이 있는구조적으로 한정된 아미노산 화합물 |
| ITMI981535A1 (it) * | 1998-07-03 | 2000-01-03 | Zambon Spa | Processo per la preparazione di gabapentina |
| US20030045500A1 (en) * | 1998-07-09 | 2003-03-06 | Leslie Magnus | Pharmaceutical composition containing GABA analogs and an antiviral agent to treat shingles |
| FR2781793B1 (fr) | 1998-08-03 | 2001-07-20 | Prographarm Lab | Procede de fabrication de granules de gabapentine enrobes |
| HU225502B1 (en) * | 1998-12-29 | 2007-01-29 | Richter Gedeon Vegyeszet | Process for producing 1-(amino-metyl)-cyclohexene-acetic-acid and intermediates |
| IT1311984B1 (it) | 1999-03-26 | 2002-03-22 | Bioindustria Lab Italiano Medi | Procedimento per la preparzione di gabapentin. |
| AU4334900A (en) * | 1999-04-09 | 2000-11-14 | Euro-Celtique S.A. | Sodium channel blocker compositions and the use thereof |
| US6710190B1 (en) * | 1999-05-28 | 2004-03-23 | Warner-Lambert Company | 3-heteroarylalkyl substituted gaba analogs |
| BR0011039A (pt) * | 1999-05-28 | 2002-02-26 | Warner Lambert Co | Análogos de gaba substituìdos com 3-heteroarilalquila |
| SI1192125T1 (sl) * | 1999-06-10 | 2009-04-30 | Warner Lambert Co | Mono-substituirane 3-propil gama-aminomaslene kisline |
| US20080207755A1 (en) * | 2000-05-31 | 2008-08-28 | Pfizer Inc | Alpha 2 Delta Ligands For Fibromyalgia and Other Disorders |
| US7164034B2 (en) * | 1999-06-10 | 2007-01-16 | Pfizer Inc. | Alpha2delta ligands for fibromyalgia and other disorders |
| US6294198B1 (en) | 1999-08-24 | 2001-09-25 | Purepac Pharmaceutical Co. | Pharmaceutical tablet formulation containing gabapentin with improved physical and chemical characteristics and method of making the same |
| HN2000000224A (es) * | 1999-10-20 | 2001-04-11 | Warner Lambert Co | Aminoacidos biciclicos como agentes farmaceuticos |
| GB2362646A (en) * | 2000-05-26 | 2001-11-28 | Warner Lambert Co | Cyclic amino acid derivatives useful as pharmaceutical agents |
| ATE255891T1 (de) | 2000-06-16 | 2003-12-15 | Teva Pharma | Stabiles gabapentin, das mehr als 20 ppm chlor enthält |
| EP1384473A1 (en) * | 2000-06-16 | 2004-01-28 | Teva Pharmaceutical Industries Ltd. | Stable gabapentin containing more than 20 ppm of chlorine ion |
| YU95302A (sh) * | 2000-06-16 | 2006-05-25 | Teva Pharmaceutical Industries Ltd. | Stabilni gabapentin koji ima ph u kontrolisanom rasponu |
| ATE390133T1 (de) * | 2000-06-26 | 2008-04-15 | Warner Lambert Co | Gabapentinanaloga für schlafstörungen |
| GB2364049A (en) * | 2000-06-28 | 2002-01-16 | Warner Lambert Co | Cyclic ketones and their use in the synthesis of amino acids |
| NZ525143A (en) * | 2000-09-14 | 2005-12-23 | Gruenenthal Chemie | Beta-thio-amino acids |
| EP1343805A4 (en) * | 2000-10-06 | 2005-07-20 | Xenoport Inc | COMPOUNDS DERIVED FROM GALLENIC ACIDS FOR THE PROVISION OF CONTINUING SYSTEMIC CONCENTRATIONS OF MEDICINAL PRODUCTS AFTER ORAL ADMINISTRATION |
| EP1361847A2 (en) * | 2000-10-06 | 2003-11-19 | Xenoport, Inc. | Bile-acid conjugates for providing sustained systemic concentrations of drugs |
| US6620829B2 (en) * | 2000-10-17 | 2003-09-16 | Warner-Lambert Company | Method of treating noninflammatory cartilage damage |
| IT1319234B1 (it) * | 2000-10-23 | 2003-09-26 | Zambon Spa | Processo di preparazione di gabapentina. |
| GB2368579A (en) * | 2000-10-31 | 2002-05-08 | Parke Davis & Co Ltd | Azole pharmaceutical agents |
| HUP0303352A3 (en) * | 2000-11-02 | 2005-04-28 | Teva Pharma | Improved process for production of gabapentin intermediate |
| ES2230378T3 (es) * | 2000-11-30 | 2005-05-01 | Pfizer Products Inc. | Combinacion de agonistas de gaba e inhibidores de sorbitol deshidrogenasa. |
| AP2001002359A0 (en) * | 2000-11-30 | 2001-12-31 | Pfizer Prod Inc | Combination of gaba agonists and aldose reductase inhibitors. |
| IT1319674B1 (it) * | 2000-12-01 | 2003-10-23 | Erregierre Spa | Processo per la preparazione dell'acido1-(aminometil)cicloesanacetico. |
| JP2004524339A (ja) * | 2001-03-16 | 2004-08-12 | ソルケム イタリアーナ エス.ピー.エイ. | 環状アミノ酸の調製方法 |
| ITMI20011132A1 (it) | 2001-05-29 | 2002-11-29 | Procos Spa | Procedimento per la preparazione dell'acido 1-amminometil-1-cicloesanacetico |
| US8048917B2 (en) | 2005-04-06 | 2011-11-01 | Xenoport, Inc. | Prodrugs of GABA analogs, compositions and uses thereof |
| US7186855B2 (en) | 2001-06-11 | 2007-03-06 | Xenoport, Inc. | Prodrugs of GABA analogs, compositions and uses thereof |
| US7232924B2 (en) * | 2001-06-11 | 2007-06-19 | Xenoport, Inc. | Methods for synthesis of acyloxyalkyl derivatives of GABA analogs |
| US6818787B2 (en) * | 2001-06-11 | 2004-11-16 | Xenoport, Inc. | Prodrugs of GABA analogs, compositions and uses thereof |
| CA2449729C (en) * | 2001-06-11 | 2009-11-03 | Xenoport, Inc. | Prodrugs of gaba analogs, compositions and uses thereof |
| US7420002B2 (en) * | 2001-06-11 | 2008-09-02 | Xenoport | Amino acid conjugates providing for sustained systemic concentrations of GABA analogues |
| IL144066A0 (en) * | 2001-06-28 | 2002-04-21 | Bromine Compounds Ltd | Process for the preparation of 1,1-cyclohexane diacetic monoamide |
| ITMI20011772A1 (it) | 2001-08-10 | 2003-02-10 | A M S A Anonima Materie Sint E | Processo per la preparazione della 2,5-bis-(2,2,2-trifluoroetossi)-n-(2-piperidilmetil)-benzamide(flecainide) |
| CA2459470C (en) | 2001-09-03 | 2010-10-12 | Patricia Salvati | Pharmaceutical composition comprising gabapentin or an analogue thereof and an .alpha.-aminoamide and its analgesic use |
| US6800782B2 (en) * | 2001-10-09 | 2004-10-05 | Warner-Lambert Co. | Anhydrous crystalline forms of gabapentin |
| US20070184104A1 (en) * | 2001-10-25 | 2007-08-09 | Depomed, Inc. | Gastric retentive gabapentin dosage forms and methods for using same |
| TWI312285B (en) | 2001-10-25 | 2009-07-21 | Depomed Inc | Methods of treatment using a gastric retained gabapentin dosage |
| US7612112B2 (en) * | 2001-10-25 | 2009-11-03 | Depomed, Inc. | Methods of treatment using a gastric retained gabapentin dosage |
| US20060159743A1 (en) * | 2001-10-25 | 2006-07-20 | Depomed, Inc. | Methods of treating non-nociceptive pain states with gastric retentive gabapentin |
| ITMI20012750A1 (it) | 2001-12-21 | 2003-06-21 | Procos Spa | Processo per la produzione dell'acido 1-(amminometil)-cicloesil-acetico in forma pura |
| US20030119908A1 (en) * | 2001-12-21 | 2003-06-26 | Zambon Group S.P.A. | Stable gabapentin compositions |
| BR0307411A (pt) * | 2002-01-31 | 2004-12-07 | Warner Lambert Co | Ligantes alfa2delta para tratar zumbidos |
| US6682759B2 (en) | 2002-02-01 | 2004-01-27 | Depomed, Inc. | Manufacture of oral dosage forms delivering both immediate-release and sustained-release drugs |
| WO2003077902A1 (en) * | 2002-02-19 | 2003-09-25 | Xenoport, Inc. | Methods for synthesis of prodrugs from 1-acyl-alkyl derivatives and compositions thereof |
| WO2003080588A1 (en) | 2002-03-20 | 2003-10-02 | Xenoport | Cyclic 1-(acyloxy)-alkyl prodrugs of gaba analogs, compositions and uses thereof |
| WO2003089403A1 (en) * | 2002-04-16 | 2003-10-30 | Taro Pharmaceutical Industries Ltd. | Process for preparing gabapentin |
| EP1549323A2 (en) * | 2002-05-07 | 2005-07-06 | A & D Bioscience, Inc. | Conjugates comprising central nervous system active drug |
| US7183259B2 (en) * | 2002-05-17 | 2007-02-27 | Xenoport | Amino acid conjugates providing for sustained systemic concentrations of GABA analogues |
| MXPA04012922A (es) * | 2002-06-27 | 2005-03-31 | Warner Lambert Co | Procedimiento para tratar el trastorno de hiperactividad con deficit de atencion. |
| CA2395931A1 (en) * | 2002-08-07 | 2004-02-07 | Bernard Charles Sherman | Solid compositions comprising gabapentin having improved stability |
| US7053122B2 (en) * | 2002-08-09 | 2006-05-30 | Pfizer Inc | Therapeutic use of aryl amino acid derivatives |
| US7419981B2 (en) * | 2002-08-15 | 2008-09-02 | Pfizer Inc. | Synergistic combinations of an alpha-2-delta ligand and a cGMP phosphodieterse 5 inhibitor |
| US20040092591A1 (en) * | 2002-08-15 | 2004-05-13 | Blakemore David Clive | Therapeutic use of fused bicyclic or tricyclic amino acids |
| US20040092522A1 (en) * | 2002-08-15 | 2004-05-13 | Field Mark John | Synergistic combinations |
| US20040092498A1 (en) * | 2002-08-16 | 2004-05-13 | David Blakemore | Substituted glycine derivatives for use as medicaments |
| ITMI20022071A1 (it) * | 2002-10-01 | 2004-04-02 | Erregierre Spa | Processo di sintesi dell'acido 1-(aminometil)cicloesanacetico cloridato. |
| US7659305B2 (en) * | 2002-10-31 | 2010-02-09 | Pfizer Inc. | Therapeutic proline derivatives |
| DE60230552D1 (de) * | 2002-11-18 | 2009-02-05 | Nicholas Piramal India Ltd | Verbessertes verfahren zur herstellung von gabapentin |
| AU2002356427A1 (en) * | 2002-11-20 | 2004-06-15 | Sivaramakrishnan Hariharan | An improved process for the preparation of gabalactam |
| AU2003297909A1 (en) * | 2002-12-11 | 2004-06-30 | Xenoport, Inc. | Orally administered dosage forms of fused gaba analog prodrugs having reduced toxicity |
| US7060727B2 (en) * | 2002-12-11 | 2006-06-13 | Xenoport, Inc. | Prodrugs of fused GABA analogs, pharmaceutical compositions and uses thereof |
| KR20050085563A (ko) | 2002-12-13 | 2005-08-29 | 워너-램버트 캄파니 엘엘씨 | 하부요로증상을 치료하기 위한 알파-2-델타 리간드 |
| CA2451267A1 (en) * | 2002-12-13 | 2004-06-13 | Warner-Lambert Company Llc | Pharmaceutical uses for alpha2delta ligands |
| BR0316751A (pt) * | 2002-12-13 | 2005-10-25 | Warner Lambert Co | Análogos de gabapentina para fibromialgia e outros distúrbios relacionados |
| PL377662A1 (pl) * | 2002-12-13 | 2006-02-06 | Warner-Lambert Company Llc | Pregabalina i jej pochodne w leczeniu fibromialgii i innych zaburzeń pokrewnych |
| US20040180958A1 (en) * | 2002-12-13 | 2004-09-16 | Taylor Charles Price | Method of treatment |
| WO2004054566A1 (en) | 2002-12-13 | 2004-07-01 | Warner-Lambert Company Llc | Pregabalin derivatives for the treatment of fibromyalgia and other disorders |
| GB0301143D0 (en) * | 2003-01-17 | 2003-02-19 | Amedis Pharm Ltd | Compounds and their use |
| MXPA05007772A (es) * | 2003-01-22 | 2005-09-30 | Warner Lambert Co | Derivados del ciclopropil (-aminoacido. |
| MXPA05009504A (es) * | 2003-03-07 | 2005-10-18 | Warner Lambert Co | Derivados de (-aminoacidos sustituidos con tetrazol y oxadiazolona. |
| DE602004017166D1 (de) * | 2003-03-25 | 2008-11-27 | Kiel Lab Inc | Gabapentintannat in flüssigen und/oder halbfesten dosierformen |
| WO2004093827A2 (en) * | 2003-03-25 | 2004-11-04 | Kiel Laboratories, Inc. | Phenolic acid salts of gabapentin in solid dosage forms and methods of use |
| WO2004093866A1 (en) * | 2003-03-25 | 2004-11-04 | Kiel Laboratories, Inc. | Process for preparing phenolic acid salts of gabapentin |
| KR20050119676A (ko) * | 2003-03-31 | 2005-12-21 | 제노포트 인코포레이티드 | 가바 유사체의 프로드러그를 사용한 열성 홍조의 치료 또는예방 |
| US20040214893A1 (en) * | 2003-04-11 | 2004-10-28 | Matthew Peterson | Gabapentin compositions |
| ITMI20030825A1 (it) * | 2003-04-18 | 2004-10-19 | Farchemia Srl | Procedimento per la preparazione di gabapentin esente da |
| US7439387B2 (en) * | 2003-04-21 | 2008-10-21 | Matrix Laboratories Ltd. | Process for the preparation of Gabapentin form-II |
| JP2006528676A (ja) * | 2003-05-16 | 2006-12-21 | ファイザー・プロダクツ・インク | 非定形型抗精神病薬と、gaba調節薬及び/又は抗痙攣薬の治療上の組合せ |
| WO2004111256A1 (en) * | 2003-06-19 | 2004-12-23 | Pfizer Products Inc. | Biocatalytic preparation of 1-cyanocyclohexaneacetic acid |
| US7169812B2 (en) * | 2003-07-01 | 2007-01-30 | Medtronic, Inc. | Process for producing injectable gabapentin compositions |
| CA2572324A1 (en) * | 2003-07-02 | 2005-01-13 | Warner-Lambert Company Llc | Combination of an allosteric inhibitor of matrix metalloproteinase-13 and a ligand to an alpha-2-delta receptor |
| US20050013863A1 (en) | 2003-07-18 | 2005-01-20 | Depomed, Inc., A Corporation Of The State Of California | Dual drug dosage forms with improved separation of drugs |
| WO2005046566A2 (en) * | 2003-08-04 | 2005-05-26 | Sun Pharmaceutical Industries Limited | Stable gabapentin containing composition |
| US20050043407A1 (en) * | 2003-08-22 | 2005-02-24 | Pfizer Inc | Pharmaceutical composition for the prevention and treatment of addiction in a mammal |
| AU2004272111A1 (en) * | 2003-09-11 | 2005-03-24 | Xenoport, Inc. | Treating and/or preventing urinary incontinence using prodrugs of GABA analogs |
| KR100828218B1 (ko) | 2003-09-12 | 2008-05-07 | 화이자 인코포레이티드 | 알파-2-델타 리간드 및 세로토닌/노르아드레날린 재흡수 억제제를 포함하는 조합물 |
| JP2007505095A (ja) * | 2003-09-12 | 2007-03-08 | ワーナー−ランバート カンパニー リミティド ライアビリティー カンパニー | うつ病及び不安障害の治療のためのアルファ−2−デルタリガンド及びssri及び/又はsnriを含む組み合わせ |
| MXPA06003043A (es) * | 2003-09-17 | 2006-05-31 | Xenoport Inc | Tratamiento o prevencion del sindrome piernas inquietas utilizando prodrogas de analogos gaba. |
| SI1677767T1 (sl) * | 2003-10-14 | 2011-11-30 | Xenoport Inc | Kristalinična oblika analoga gama-aminomaslene kisline |
| ITMI20032165A1 (it) * | 2003-11-11 | 2005-05-12 | Zambon Spa | Processo di preparazione di gabapentina |
| PL1691811T3 (pl) | 2003-12-11 | 2014-12-31 | Sunovion Pharmaceuticals Inc | Skojarzenie leku uspokajającego i modulatora neuroprzekaźnikowego oraz sposoby poprawy jakości snu i leczenia depresji |
| CA2553291A1 (en) * | 2004-01-29 | 2005-09-09 | Pfizer Products Inc. | Combination of .gamma.-aminobutyric acid modulators and 5-ht1b receptor antagonists |
| US20050187295A1 (en) * | 2004-02-19 | 2005-08-25 | Surendra Kalyan | Processes for the preparation of gabapentin |
| EP2172445A1 (en) * | 2004-03-17 | 2010-04-07 | Hikal Limited | Cis (z) 4-t-butylgabapentin and its synthesis |
| ITMI20040579A1 (it) * | 2004-03-25 | 2004-06-25 | Zambon Spa | Processo di preparazione di gabapentina |
| WO2005102366A2 (en) * | 2004-04-19 | 2005-11-03 | Philip Maxwell Satow | Lithium combinations, and uses related thereto |
| MXPA06014389A (es) * | 2004-06-09 | 2007-02-19 | Pfizer | Uso de la reboxetina para el tratamiento del dolor. |
| GB0416228D0 (en) * | 2004-07-20 | 2004-08-25 | Sandoz Ind Products S A | Process for the preparation of gabapentin |
| GB0419849D0 (en) * | 2004-09-07 | 2004-10-13 | Pfizer Ltd | Pharmaceutical combination |
| SI1809271T1 (sl) * | 2004-09-10 | 2010-10-29 | Newron Pharm Spa | Uporaba (R)-(halobenziloksi) benzilamino propanamidov kot selektivnih modulatorjev natrijevih in/ali kalcijevih kanalov |
| MX2007005306A (es) * | 2004-11-04 | 2007-06-11 | Xenoport Inc | Formas de dosis oral de liberacion sostenida de la prodroga gabapentina. |
| EP2258358A3 (en) | 2005-08-26 | 2011-09-07 | Braincells, Inc. | Neurogenesis with acetylcholinesterase inhibitor |
| US7678363B2 (en) | 2005-08-26 | 2010-03-16 | Braincells Inc | Methods of treating psychiatric conditions comprising administration of muscarinic agents in combination with SSRIs |
| BRPI0616263A2 (pt) * | 2005-09-23 | 2011-06-14 | Janssen Pharmaceutica Nv | moduladores canabinàides do tipo tetrahidro-ciclopentil pirazol |
| UA93389C2 (en) * | 2005-09-23 | 2011-02-10 | Янссен Фармацевтика H.B. | Hexahydro cyclooctyl pyrazole cannabinoid modulators |
| ATE534387T1 (de) * | 2005-09-23 | 2011-12-15 | Janssen Pharmaceutica Nv | Hexahydro-cycloheptapyrazol-cannabinoid- modulatoren |
| US8378117B2 (en) * | 2005-09-23 | 2013-02-19 | Janssen Pharmaceutica N.V. | Hexahydro-cycloheptapyrazole cannabinoid modulators |
| US8378096B2 (en) * | 2005-09-23 | 2013-02-19 | Janssen Pharmaceutica N.V. | Hexahydro-cycloheptapyrazole cannabinoid modulators |
| US7825151B2 (en) * | 2005-09-23 | 2010-11-02 | Janssen Pharmaceutica Nv | Hexahydro-cyclooctyl pyrazole cannabinoid modulators |
| AU2006304787A1 (en) | 2005-10-21 | 2007-04-26 | Braincells, Inc. | Modulation of neurogenesis by PDE inhibition |
| EP2314289A1 (en) | 2005-10-31 | 2011-04-27 | Braincells, Inc. | Gaba receptor mediated modulation of neurogenesis |
| US20070117858A1 (en) * | 2005-11-23 | 2007-05-24 | Mingde Xia | Substituted 5-heteroaryl-1-phenyl-pyrazole cannabinoid modulators |
| US20090176882A1 (en) * | 2008-12-09 | 2009-07-09 | Depomed, Inc. | Gastric retentive gabapentin dosage forms and methods for using same |
| EP1979593B1 (en) * | 2006-02-03 | 2017-12-06 | Rolls-Royce Corporation | Gas turbine engine fuel system with fuel metering valve |
| EP1820502A1 (en) | 2006-02-10 | 2007-08-22 | Laboratorios Del Dr. Esteve, S.A. | Active substance combination comprising azolylcarbinol compounds |
| US7795294B2 (en) * | 2006-02-14 | 2010-09-14 | Janssen Pharmaceutica N.V. | Tetrahydro-2H-indazole pyrazole cannabinoid modulators |
| BRPI0708671A2 (pt) * | 2006-03-06 | 2011-06-07 | Pfizer Prod Inc | ligantes alfa-2-delta para sono não restaurador |
| US20100216734A1 (en) | 2006-03-08 | 2010-08-26 | Braincells, Inc. | Modulation of neurogenesis by nootropic agents |
| US20070254911A1 (en) * | 2006-03-27 | 2007-11-01 | Mingde Xia | Tetrahydro-Pyrazolo[3,4-c]Pyridine Cannabinoid Modulators |
| WO2007112402A1 (en) * | 2006-03-27 | 2007-10-04 | Janssen Pharmaceutica N.V. | Tetrahydro-1h-1,2,6-triaza-azulene cannabinoid modulators |
| CA2651862A1 (en) | 2006-05-09 | 2007-11-22 | Braincells, Inc. | 5 ht receptor mediated neurogenesis |
| EP2377531A2 (en) | 2006-05-09 | 2011-10-19 | Braincells, Inc. | Neurogenesis by modulating angiotensin |
| US7442834B2 (en) * | 2006-06-12 | 2008-10-28 | Zhejiang Chiral Medicine Chemicals Co., Ltd. | Process suitable for industrial scale production of gabapentin |
| ES2439242T3 (es) * | 2006-06-30 | 2014-01-22 | Zach System S.P.A. | Procedimiento para preparar gabapentina |
| US7998971B2 (en) | 2006-09-08 | 2011-08-16 | Braincells Inc. | Combinations containing a 4-acylaminopyridine derivative |
| US20100184806A1 (en) | 2006-09-19 | 2010-07-22 | Braincells, Inc. | Modulation of neurogenesis by ppar agents |
| US20080161393A1 (en) * | 2006-12-08 | 2008-07-03 | Barrett Ronald W | Use of prodrugs of GABA analogs for treating disease |
| EA017171B1 (ru) | 2006-12-22 | 2012-10-30 | Рекордати Айерленд Лимитед | КОМБИНИРОВАННАЯ ТЕРАПИЯ ЗАБОЛЕВАНИЙ НИЖНИХ МОЧЕВЫВОДЯЩИХ ПУТЕЙ С ИСПОЛЬЗОВАНИЕМ ЛИГАНДОВ αδ И НЕСТЕРОИДНЫХ ПРОТИВОВОСПАЛИТЕЛЬНЫХ ПРЕПАРАТОВ (НПВП) |
| BRPI0808962A2 (pt) * | 2007-03-15 | 2014-08-26 | Sun Pharma Advanced Res Co Ltd | Agente para drogas |
| TW200908957A (en) * | 2007-06-15 | 2009-03-01 | Xenoport Inc | Use of prodrugs of GABA analogs, antispasticity agents, and prodrugs of GABAB receptor agonists for treating spasticity |
| US7943653B2 (en) * | 2007-08-13 | 2011-05-17 | Janssen Pharmaceutica N.V. | Substituted 5-vinylphenyl-1-phenyl-pyrazole cannabinoid modulators |
| US20090062392A1 (en) * | 2007-08-29 | 2009-03-05 | Protia, Llc | Deuterium-enriched gabapentin |
| WO2009061934A1 (en) * | 2007-11-06 | 2009-05-14 | Xenoport, Inc. | Use of prodrugs of gaba b agonists for treating neuropathic and musculoskeletal pain |
| TWI369202B (en) * | 2008-01-25 | 2012-08-01 | Xenoport Inc | Enantiomerically resolving acyloxyalkyl thiocarbonates used in synthesizing acyloxyalkyl carbamate prodrugs |
| WO2009094563A2 (en) | 2008-01-25 | 2009-07-30 | Xenoport, Inc. | Crystalline form of calcium-salts of (3s)-aminomethyl-b-methyl-hexanoic acids and methods of use |
| WO2009094577A2 (en) | 2008-01-25 | 2009-07-30 | Xenoport, Inc. | Mesophasic forms of (3s)-aminomethyl-5-methyl-hexanoic acid prodrugs and methods of use |
| EP2116539A1 (en) | 2008-04-25 | 2009-11-11 | Laboratorios Del. Dr. Esteve, S.A. | 1-aryl-3-aminoalkoxy-pyrazoles as sigma ligands enhancing analgesic effects of opioids and attenuating the dependency thereof |
| US20100190752A1 (en) | 2008-09-05 | 2010-07-29 | Gruenenthal Gmbh | Pharmaceutical Combination |
| CA2740087C (en) * | 2008-10-08 | 2019-07-23 | Kyphia Pharmaceuticals, Inc. | Gaba conjugates and methods of use thereof |
| US9192681B2 (en) | 2009-02-24 | 2015-11-24 | Nektar Therapeutics | Oligomer-amino acid conjugates |
| WO2010099217A1 (en) | 2009-02-25 | 2010-09-02 | Braincells, Inc. | Modulation of neurogenesis using d-cycloserine combinations |
| US20110130454A1 (en) * | 2009-11-24 | 2011-06-02 | Xenoport, Inc. | Prodrugs of gamma-amino acid, alpha-2-delta ligands, pharmaceutical compositions and uses thereof |
| US20110124705A1 (en) * | 2009-11-24 | 2011-05-26 | Xenoport, Inc. | Prodrugs of alpha-2-delta ligands, pharmaceutical compositions and uses thereof |
| AU2010328186B2 (en) | 2009-12-08 | 2014-12-18 | Case Western Reserve University | Compounds and methods of treating ocular disorders |
| EP2353591A1 (en) | 2010-02-04 | 2011-08-10 | Laboratorios Del. Dr. Esteve, S.A. | Sigma ligands for potentiating the analgesic effect of opioids and opiates in post-operative pain and attenuating the dependency thereof |
| EP2368872A1 (en) | 2010-03-25 | 2011-09-28 | Serichim S.r.l. | Process for the preparation of Gabapentin |
| EP2388005A1 (en) | 2010-05-21 | 2011-11-23 | Laboratorios Del. Dr. Esteve, S.A. | Sigma ligands for the prevention and/or treatment of emesis induced by chemotherapy or radiotherapy |
| EP2575798B1 (en) | 2010-06-01 | 2017-08-09 | Rubicon Research Private Limited | Gastroretentive dosage forms of gaba analogs |
| US8431739B2 (en) | 2010-06-14 | 2013-04-30 | Divi's Laboratories, Ltd. | Process for the preparation of gabapentin |
| ES2536534T3 (es) | 2010-07-30 | 2015-05-26 | Toray Industries, Inc. | Agente terapéutico o agente profiláctico para el dolor neuropático |
| EP2415471A1 (en) | 2010-08-03 | 2012-02-08 | Laboratorios Del. Dr. Esteve, S.A. | Use of sigma ligands in opioid-induced hyperalgesia |
| JP2013216580A (ja) * | 2010-08-06 | 2013-10-24 | Kyorin Pharmaceutical Co Ltd | ビシクロ[2.2.2]オクチルアミン誘導体の製造方法 |
| EP2524694A1 (en) | 2011-05-19 | 2012-11-21 | Laboratorios Del. Dr. Esteve, S.A. | Use of sigma ligands in diabetes type-2 associated pain |
| EP2530072A1 (en) | 2011-06-03 | 2012-12-05 | Lacer, S.A. | New compounds, synthesis and use thereof in the treatment of pain |
| US9066853B2 (en) | 2013-01-15 | 2015-06-30 | Warsaw Orthopedic, Inc. | Clonidine compounds in a biodegradable fiber |
| ITMI20131757A1 (it) | 2013-10-22 | 2015-04-23 | Zach System Spa | Processo di preparazione di gabapentina |
| WO2015064453A1 (ja) | 2013-11-01 | 2015-05-07 | 株式会社糖鎖工学研究所 | チオール基を有するd-体またはl-体アミノ酸誘導体の製造方法 |
| SG11201604478UA (en) | 2013-12-17 | 2016-07-28 | Esteve Labor Dr | Gabapentinoids and sigma receptor ligands combinations |
| MA39147B1 (fr) | 2013-12-17 | 2019-12-31 | Esteve Labor Dr | Combinaisons d'inhibiteurs de la recapture de sérotonine-norépinéphrine (snri) et de ligands des récepteurs sigma |
| WO2015144825A1 (en) | 2014-03-27 | 2015-10-01 | Sanovel Ilac Sanayi Ve Ticaret A.S. | Oral liquid pharmaceutical solution of gabapentin |
| US11213517B2 (en) | 2016-12-16 | 2022-01-04 | Idorsia Pharmaceuticals Ltd | Pharmaceutical combination comprising a T-type calcium channel blocker |
| MX384760B (es) | 2018-07-04 | 2025-03-14 | Federico Amezcua Amezcua | Combinación farmacéutica sinérgica del enantiómero activo s-ketorolaco y gabapentina para el tratamiento del dolor neuropático. |
| US10399926B1 (en) | 2018-08-01 | 2019-09-03 | Divi's Laboratories Ltd. | Process for the preparation of gabapentin |
| ES2754280A1 (es) | 2018-10-11 | 2020-04-16 | Laboratoris Sanifit S L | Pautas posológicas de IP y análogos de IP para el tratamiento de calcificaciones ectópicas |
| EP4049679A4 (en) * | 2019-10-25 | 2023-11-01 | Kyoto University | Preventative or therapeutic agent for tauopathy |
| IL296166A (en) | 2020-03-04 | 2022-11-01 | Pleopharma L L C | Methods and preparations for treating cannabis use disorder and facilitating cannabinoid withdrawal |
| EP4015494A1 (en) | 2020-12-15 | 2022-06-22 | Sanifit Therapeutics S.A. | Processes for the preparation of soluble salts of inositol phosphates |
| GB2625579A (en) | 2022-12-21 | 2024-06-26 | Novumgen Ltd | An orally disintegrating tablet containing gabapentin or pharmaceutically acceptable salts thereof and the process of preparing the same |
-
1974
- 1974-12-21 DE DE2460891A patent/DE2460891C2/de not_active Expired
-
1975
- 1975-12-15 IE IE2736/75A patent/IE42382B1/en unknown
- 1975-12-15 GB GB5119375A patent/GB1465229A/en not_active Expired
- 1975-12-18 CH CH430778A patent/CH612665A5/xx not_active IP Right Cessation
- 1975-12-18 CH CH1645175A patent/CH612664A5/xx not_active IP Right Cessation
- 1975-12-18 BE BE6045299A patent/BE836835A/xx not_active IP Right Cessation
- 1975-12-18 CH CH430878A patent/CH612666A5/xx active Protection Beyond IP Right Term
- 1975-12-18 FR FR7538818A patent/FR2294697A1/fr active Granted
- 1975-12-19 SE SE7514442A patent/SE423385B/xx active Protection Beyond IP Right Term
- 1975-12-19 FI FI753613A patent/FI62282C/fi not_active IP Right Cessation
- 1975-12-19 LU LU74058A patent/LU74058A1/xx unknown
- 1975-12-19 ES ES443723A patent/ES443723A1/es not_active Expired
- 1975-12-19 CA CA242,147A patent/CA1052811A/en not_active Expired
- 1975-12-19 DK DK581475A patent/DK147706C/da not_active IP Right Cessation
- 1975-12-20 NL NLAANVRAGE7514900,A patent/NL181006C/xx not_active IP Right Cessation
- 1975-12-22 JP JP15319475A patent/JPS5324064B2/ja not_active Expired
- 1975-12-22 AT AT975075A patent/AT340892B/de active Protection Beyond IP Right Term
- 1975-12-31 US US05/645,724 patent/US4024175A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| SE423385B (sv) | 1982-05-03 |
| DE2460891A1 (de) | 1976-07-01 |
| NL7514900A (nl) | 1976-06-23 |
| JPS5188940A (enExample) | 1976-08-04 |
| IE42382L (en) | 1976-06-21 |
| SE7514442L (sv) | 1976-06-22 |
| CH612666A5 (enExample) | 1979-08-15 |
| FI753613A7 (enExample) | 1976-06-22 |
| NL181006C (nl) | 1987-06-01 |
| ATA975075A (de) | 1977-05-15 |
| FR2294697B1 (enExample) | 1978-07-28 |
| DK147706B (da) | 1984-11-19 |
| NL181006B (nl) | 1987-01-02 |
| AT340892B (de) | 1978-01-10 |
| DK581475A (da) | 1976-01-22 |
| GB1465229A (en) | 1977-02-23 |
| BE836835A (fr) | 1976-06-18 |
| DE2460891C2 (de) | 1982-09-23 |
| US4024175A (en) | 1977-05-17 |
| FR2294697A1 (fr) | 1976-07-16 |
| LU74058A1 (enExample) | 1976-07-20 |
| CH612665A5 (enExample) | 1979-08-15 |
| ES443723A1 (es) | 1977-04-16 |
| DK147706C (da) | 1985-05-13 |
| IE42382B1 (en) | 1980-07-30 |
| CH612664A5 (enExample) | 1979-08-15 |
| AU8774175A (en) | 1977-06-23 |
| FI62282C (fi) | 1982-12-10 |
| FI62282B (fi) | 1982-08-31 |
| JPS5324064B2 (enExample) | 1978-07-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1052811A (en) | Cyclic amino-acids | |
| US4087544A (en) | Treatment of cranial dysfunctions using novel cyclic amino acids | |
| US4152326A (en) | Cyclic sulphonyloxyimides | |
| BG65657B1 (bg) | Метод за получаване на амплодипин бензенсулфонат | |
| SU747419A3 (ru) | Способ получени производных аминокислот или их солей или оптических изомеров | |
| DE602004002692T2 (de) | Verfahren zur Herstellung von Topiramate | |
| EP0543343A2 (de) | Verfahren zur Herstellung von alpha-Hydroxy-beta-aminocarbonsäuren | |
| US5395945A (en) | Synthesis of 3,3-dinitroazetidine | |
| US3551433A (en) | Preparation of 4-phenyl-4-acyloxypiperidine | |
| EP0739885B1 (en) | Process for producing 3-isoxazolecarboxylic acid | |
| EP0088252B1 (de) | Verfahren zur Herstellung von 1-(4-Chlorbenzoyl)-5-methoxy-2-methyl-3-indolacetoxyessigsäure | |
| US4022830A (en) | Process for preparing polychlorobenzamide derivatives | |
| US3037019A (en) | Pharmacologically active compounds | |
| KR19980703584A (ko) | 살절지동물성 옥사디아진 중간체 | |
| DE60024540T2 (de) | Synthese von alpha-amino-alpha',alpha'-dihaloketonen und verfahren zur herstellung von beta)-aminosäurederivaten durch verwendung derselben | |
| US5220041A (en) | Sulfonate ester | |
| US3951997A (en) | Cyclic sulphoximides | |
| US3951995A (en) | Method for industrial production of N-substituted dipropylacetamides | |
| US3531488A (en) | Disulphonamides | |
| KR0150566B1 (ko) | 광학활성이 있는 3-아미노 헤테로고리아민유도체의 제조방법 | |
| JP3216673B2 (ja) | 3−ヒドロキシイソオキサゾールの製造法 | |
| KR100483317B1 (ko) | α-페닐-α-프로폭시벤젠아세트산 1-메틸-4-피페리디닐에스테르 염산염의 제조방법 | |
| DE2813287A1 (de) | Verfahren zur herstellung von 2-benzoyl- 3,3-dimethyl-7-oxo-alpha-(4-benzyloxyphenyl) -4-thia-2,6-diazabicyclo-eckige klammer auf 3.2.0 eckige klammer zu heptan-6-essigsaeurebenzylester | |
| US2931828A (en) | Carbamate of propinyl, cyclohexanol | |
| RU2051908C1 (ru) | Способ получения n-(5-оксиникотиноил)-l-глутаминовой кислоты |