CA1052782A - Process for the manufacture of bis-azomethine metal complex colorants - Google Patents
Process for the manufacture of bis-azomethine metal complex colorantsInfo
- Publication number
- CA1052782A CA1052782A CA232,451A CA232451A CA1052782A CA 1052782 A CA1052782 A CA 1052782A CA 232451 A CA232451 A CA 232451A CA 1052782 A CA1052782 A CA 1052782A
- Authority
- CA
- Canada
- Prior art keywords
- atoms
- denotes
- compound
- formula
- radical
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims abstract description 19
- 239000003086 colorant Substances 0.000 title claims abstract description 8
- 150000004696 coordination complex Chemical class 0.000 title claims abstract description 8
- 238000004519 manufacturing process Methods 0.000 title claims abstract description 7
- -1 heterocyclic aromatic radical Chemical class 0.000 claims abstract description 30
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 27
- 150000001875 compounds Chemical class 0.000 claims abstract description 17
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 13
- 150000004985 diamines Chemical class 0.000 claims abstract description 8
- PTFCDOFLOPIGGS-UHFFFAOYSA-N Zinc dication Chemical compound [Zn+2] PTFCDOFLOPIGGS-UHFFFAOYSA-N 0.000 claims abstract description 6
- 150000005840 aryl radicals Chemical class 0.000 claims abstract description 6
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract description 3
- 229910021645 metal ion Inorganic materials 0.000 claims abstract description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 claims abstract description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 claims description 17
- PXHVJJICTQNCMI-UHFFFAOYSA-N nickel Substances [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 14
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 10
- 238000006243 chemical reaction Methods 0.000 claims description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 9
- 239000007858 starting material Substances 0.000 claims description 9
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 claims description 8
- 150000003254 radicals Chemical class 0.000 claims description 8
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 7
- 229910052759 nickel Inorganic materials 0.000 claims description 7
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 6
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 claims description 6
- 229910052802 copper Inorganic materials 0.000 claims description 6
- 239000010949 copper Substances 0.000 claims description 6
- AWJUIBRHMBBTKR-UHFFFAOYSA-N isoquinoline Chemical compound C1=NC=CC2=CC=CC=C21 AWJUIBRHMBBTKR-UHFFFAOYSA-N 0.000 claims description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 5
- 229960000956 coumarin Drugs 0.000 claims description 5
- 125000005843 halogen group Chemical group 0.000 claims description 5
- HDHQZCHIXUUSMK-UHFFFAOYSA-N 4-hydroxy-2-quinolone Chemical compound C1=CC=C2C(O)=CC(=O)NC2=C1 HDHQZCHIXUUSMK-UHFFFAOYSA-N 0.000 claims description 4
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 4
- 229960000583 acetic acid Drugs 0.000 claims description 4
- 125000005236 alkanoylamino group Chemical group 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- PYKYMHQGRFAEBM-UHFFFAOYSA-N anthraquinone Natural products CCC(=O)c1c(O)c2C(=O)C3C(C=CC=C3O)C(=O)c2cc1CC(=O)OC PYKYMHQGRFAEBM-UHFFFAOYSA-N 0.000 claims description 4
- 150000004056 anthraquinones Chemical class 0.000 claims description 4
- ZYGHJZDHTFUPRJ-UHFFFAOYSA-N benzo-alpha-pyrone Natural products C1=CC=C2OC(=O)C=CC2=C1 ZYGHJZDHTFUPRJ-UHFFFAOYSA-N 0.000 claims description 4
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 4
- 235000001671 coumarin Nutrition 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 claims description 3
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 claims description 3
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 claims description 3
- 125000000043 benzamido group Chemical group [H]N([*])C(=O)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 3
- 238000009835 boiling Methods 0.000 claims description 3
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 3
- 239000002904 solvent Substances 0.000 claims description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 claims description 2
- 229910002651 NO3 Inorganic materials 0.000 claims description 2
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 claims description 2
- 229910019142 PO4 Inorganic materials 0.000 claims description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 claims description 2
- 125000005115 alkyl carbamoyl group Chemical group 0.000 claims description 2
- 150000001412 amines Chemical class 0.000 claims description 2
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 2
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 2
- 239000012362 glacial acetic acid Substances 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 claims description 2
- 239000010452 phosphate Substances 0.000 claims description 2
- 239000002798 polar solvent Substances 0.000 claims description 2
- 229910021653 sulphate ion Inorganic materials 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 2
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 claims 6
- 239000005749 Copper compound Substances 0.000 claims 1
- PNKUSGQVOMIXLU-UHFFFAOYSA-N Formamidine Chemical compound NC=N PNKUSGQVOMIXLU-UHFFFAOYSA-N 0.000 claims 1
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Natural products OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 claims 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims 1
- 125000004656 alkyl sulfonylamino group Chemical group 0.000 claims 1
- 150000001880 copper compounds Chemical class 0.000 claims 1
- HUQXYRBOXDPXAI-UHFFFAOYSA-N n-phenylnaphthalene-2-carboxamide Chemical compound C=1C=C2C=CC=CC2=CC=1C(=O)NC1=CC=CC=C1 HUQXYRBOXDPXAI-UHFFFAOYSA-N 0.000 claims 1
- 150000002816 nickel compounds Chemical class 0.000 claims 1
- WLZRMCYVCSSEQC-UHFFFAOYSA-N cadmium(2+) Chemical compound [Cd+2] WLZRMCYVCSSEQC-UHFFFAOYSA-N 0.000 abstract 2
- 150000002500 ions Chemical class 0.000 abstract 1
- 229910052723 transition metal Inorganic materials 0.000 abstract 1
- GEYOCULIXLDCMW-UHFFFAOYSA-N 1,2-phenylenediamine Chemical compound NC1=CC=CC=C1N GEYOCULIXLDCMW-UHFFFAOYSA-N 0.000 description 10
- 238000004452 microanalysis Methods 0.000 description 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 7
- 235000019441 ethanol Nutrition 0.000 description 7
- 229910052799 carbon Inorganic materials 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 5
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 4
- VXIXUWQIVKSKSA-UHFFFAOYSA-N 4-hydroxycoumarin Chemical compound C1=CC=CC2=C1OC(=O)C=C2O VXIXUWQIVKSKSA-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 125000003118 aryl group Chemical group 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 239000000460 chlorine Substances 0.000 description 3
- 229920005989 resin Polymers 0.000 description 3
- 239000011347 resin Substances 0.000 description 3
- UPHOPMSGKZNELG-UHFFFAOYSA-N 2-hydroxynaphthalene-1-carboxylic acid Chemical compound C1=CC=C2C(C(=O)O)=C(O)C=CC2=C1 UPHOPMSGKZNELG-UHFFFAOYSA-N 0.000 description 2
- JWAZRIHNYRIHIV-UHFFFAOYSA-N 2-naphthol Chemical compound C1=CC=CC2=CC(O)=CC=C21 JWAZRIHNYRIHIV-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- 235000011054 acetic acid Nutrition 0.000 description 2
- MQRWBMAEBQOWAF-UHFFFAOYSA-N acetic acid;nickel Chemical compound [Ni].CC(O)=O.CC(O)=O MQRWBMAEBQOWAF-UHFFFAOYSA-N 0.000 description 2
- 150000004705 aldimines Chemical class 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 239000004305 biphenyl Substances 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 2
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 239000000025 natural resin Substances 0.000 description 2
- 229940078494 nickel acetate Drugs 0.000 description 2
- 229940078487 nickel acetate tetrahydrate Drugs 0.000 description 2
- 229920002239 polyacrylonitrile Polymers 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- BFVIGZKFVVQUAG-UHFFFAOYSA-N 1h-benzimidazole-2,4-diamine Chemical compound C1=CC(N)=C2NC(N)=NC2=C1 BFVIGZKFVVQUAG-UHFFFAOYSA-N 0.000 description 1
- HEMGYNNCNNODNX-UHFFFAOYSA-N 3,4-diaminobenzoic acid Chemical compound NC1=CC=C(C(O)=O)C=C1N HEMGYNNCNNODNX-UHFFFAOYSA-N 0.000 description 1
- XSZYBMMYQCYIPC-UHFFFAOYSA-N 4,5-dimethyl-1,2-phenylenediamine Chemical compound CC1=CC(N)=C(N)C=C1C XSZYBMMYQCYIPC-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- BXIXXXYDDJVHDL-UHFFFAOYSA-N 4-Chloro-ortho-phenylenediamine Chemical compound NC1=CC=C(Cl)C=C1N BXIXXXYDDJVHDL-UHFFFAOYSA-N 0.000 description 1
- ROJMDQBRKBPHIU-UHFFFAOYSA-N 4-ethylbenzene-1,2-diamine Chemical compound CCC1=CC=C(N)C(N)=C1 ROJMDQBRKBPHIU-UHFFFAOYSA-N 0.000 description 1
- NLWNEYNEOSWQGI-UHFFFAOYSA-N 4-phenyl-2-n-propan-2-ylbenzene-1,2-diamine Chemical compound C1=C(N)C(NC(C)C)=CC(C=2C=CC=CC=2)=C1 NLWNEYNEOSWQGI-UHFFFAOYSA-N 0.000 description 1
- CYMWNBRHNRVFCF-UHFFFAOYSA-N 6,7-diamino-2,3-dihydrophthalazine-1,4-dione Chemical compound O=C1NNC(=O)C2=C1C=C(N)C(N)=C2 CYMWNBRHNRVFCF-UHFFFAOYSA-N 0.000 description 1
- RFWGABANNQMHMZ-UHFFFAOYSA-N 8-acetoxy-7-acetyl-6,7,7a,8-tetrahydro-5H-benzo[g][1,3]dioxolo[4',5':4,5]benzo[1,2,3-de]quinoline Natural products CC=C1C(CC(=O)OCCC=2C=C(O)C(O)=CC=2)C(C(=O)OC)=COC1OC1OC(CO)C(O)C(O)C1O RFWGABANNQMHMZ-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 241000905957 Channa melasoma Species 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000001856 Ethyl cellulose Substances 0.000 description 1
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 229920000877 Melamine resin Polymers 0.000 description 1
- BTMKEDDEMKKSEF-QGZVFWFLSA-N N-[5-[[4-[5-chloro-4-fluoro-2-(2-hydroxypropan-2-yl)anilino]pyrimidin-2-yl]amino]-2-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-4-methoxyphenyl]prop-2-enamide Chemical compound C(C=C)(=O)NC1=C(C=C(C(=C1)NC1=NC=CC(=N1)NC1=C(C=C(C(=C1)Cl)F)C(C)(C)O)OC)N1C[C@@H](CC1)N(C)C BTMKEDDEMKKSEF-QGZVFWFLSA-N 0.000 description 1
- REYJJPSVUYRZGE-UHFFFAOYSA-N Octadecylamine Chemical compound CCCCCCCCCCCCCCCCCCN REYJJPSVUYRZGE-UHFFFAOYSA-N 0.000 description 1
- YNPNZTXNASCQKK-UHFFFAOYSA-N Phenanthrene Natural products C1=CC=C2C3=CC=CC=C3C=CC2=C1 YNPNZTXNASCQKK-UHFFFAOYSA-N 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- 229920001807 Urea-formaldehyde Polymers 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- DGEZNRSVGBDHLK-UHFFFAOYSA-N [1,10]phenanthroline Chemical compound C1=CN=C2C3=NC=CC=C3C=CC2=C1 DGEZNRSVGBDHLK-UHFFFAOYSA-N 0.000 description 1
- 229940022663 acetate Drugs 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 229920000180 alkyd Polymers 0.000 description 1
- 229920003180 amino resin Polymers 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 125000005239 aroylamino group Chemical group 0.000 description 1
- 125000005116 aryl carbamoyl group Chemical group 0.000 description 1
- MYONAGGJKCJOBT-UHFFFAOYSA-N benzimidazol-2-one Chemical compound C1=CC=CC2=NC(=O)N=C21 MYONAGGJKCJOBT-UHFFFAOYSA-N 0.000 description 1
- 229950011260 betanaphthol Drugs 0.000 description 1
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000005018 casein Substances 0.000 description 1
- BECPQYXYKAMYBN-UHFFFAOYSA-N casein, tech. Chemical compound NCCCCC(C(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(CC(C)C)N=C(O)C(CCC(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(C(C)O)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(COP(O)(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(N)CC1=CC=CC=C1 BECPQYXYKAMYBN-UHFFFAOYSA-N 0.000 description 1
- 235000021240 caseins Nutrition 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 229920001727 cellulose butyrate Polymers 0.000 description 1
- 229920003086 cellulose ether Polymers 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 229960004756 ethanol Drugs 0.000 description 1
- 229920001249 ethyl cellulose Polymers 0.000 description 1
- 235000019325 ethyl cellulose Nutrition 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 239000000976 ink Substances 0.000 description 1
- 239000004922 lacquer Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 238000001465 metallisation Methods 0.000 description 1
- NTNWKDHZTDQSST-UHFFFAOYSA-N naphthalene-1,2-diamine Chemical compound C1=CC=CC2=C(N)C(N)=CC=C21 NTNWKDHZTDQSST-UHFFFAOYSA-N 0.000 description 1
- XTBLDMQMUSHDEN-UHFFFAOYSA-N naphthalene-2,3-diamine Chemical compound C1=CC=C2C=C(N)C(N)=CC2=C1 XTBLDMQMUSHDEN-UHFFFAOYSA-N 0.000 description 1
- OINIXPNQKAZCRL-UHFFFAOYSA-L nickel(2+);diacetate;tetrahydrate Chemical compound O.O.O.O.[Ni+2].CC([O-])=O.CC([O-])=O OINIXPNQKAZCRL-UHFFFAOYSA-L 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- IOQPZZOEVPZRBK-UHFFFAOYSA-N octan-1-amine Chemical compound CCCCCCCCN IOQPZZOEVPZRBK-UHFFFAOYSA-N 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid Chemical compound CCCCCCCC\C=C/CCCCCCCC(O)=O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- 238000005580 one pot reaction Methods 0.000 description 1
- 239000011368 organic material Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 229920001568 phenolic resin Polymers 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 230000000485 pigmenting effect Effects 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004584 polyacrylic acid Substances 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 239000004417 polycarbonate Substances 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- ODGAOXROABLFNM-UHFFFAOYSA-N polynoxylin Chemical compound O=C.NC(N)=O ODGAOXROABLFNM-UHFFFAOYSA-N 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 150000003097 polyterpenes Chemical class 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- KIDHWZJUCRJVML-UHFFFAOYSA-N putrescine Chemical compound NCCCCN KIDHWZJUCRJVML-UHFFFAOYSA-N 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 229920002050 silicone resin Polymers 0.000 description 1
- 238000009987 spinning Methods 0.000 description 1
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 150000004685 tetrahydrates Chemical class 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B55/00—Azomethine dyes
- C09B55/005—Disazomethine dyes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1058574A CH596276A5 (forum.php) | 1974-07-31 | 1974-07-31 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1052782A true CA1052782A (en) | 1979-04-17 |
Family
ID=4364753
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA232,451A Expired CA1052782A (en) | 1974-07-31 | 1975-07-29 | Process for the manufacture of bis-azomethine metal complex colorants |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US4008225A (forum.php) |
| JP (1) | JPS5139726A (forum.php) |
| BE (1) | BE831902A (forum.php) |
| BR (1) | BR7504896A (forum.php) |
| CA (1) | CA1052782A (forum.php) |
| CH (1) | CH596276A5 (forum.php) |
| CS (1) | CS185238B2 (forum.php) |
| DE (1) | DE2533676C2 (forum.php) |
| DK (1) | DK288875A (forum.php) |
| ES (1) | ES439833A1 (forum.php) |
| FR (1) | FR2280693A1 (forum.php) |
| NL (1) | NL7509090A (forum.php) |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4157265A (en) * | 1976-03-12 | 1979-06-05 | Hoechst Aktiengesellschaft | Water-insoluble disazomethine mixed metal-complex compounds, process for preparing them and their use as colorants |
| JPS57126747A (en) * | 1981-01-30 | 1982-08-06 | Banzai:Kk | Moving truck of car |
| DE3230433A1 (de) * | 1981-08-26 | 1983-03-10 | Sandoz-Patent-GmbH, 7850 Lörrach | Die verwendung von metallkomplexfarbstoffen zum faerben von kunststoffmassen |
| CH655508B (forum.php) * | 1981-08-26 | 1986-04-30 | ||
| DE3413603A1 (de) * | 1984-04-11 | 1985-10-24 | Sandoz-Patent-GmbH, 7850 Lörrach | Metallkomplexfarbstoffe und ihre verwendung zum faerben von kunststoffmassen |
| US4866112A (en) * | 1988-07-29 | 1989-09-12 | Ciba-Geigy Corporation | Thermoplastics containing a nickel complex pigment |
| EP0475906A1 (de) * | 1990-09-14 | 1992-03-18 | Ciba-Geigy Ag | Technische Kunststoffe enthaltend ein Bisazomethin-Metallkomplexpigment |
| JP3366697B2 (ja) * | 1993-08-27 | 2003-01-14 | オリヱント化学工業株式会社 | 長波長紫外線吸収剤およびその製造方法 |
| DE19714122A1 (de) * | 1997-04-05 | 1998-10-08 | Clariant Gmbh | Bleichaktive Metall-Komplexe |
| US7041856B2 (en) * | 2001-10-23 | 2006-05-09 | Sumitomo Chemical Company, Limited | Coupling catalyst and process using the same |
| US20040010056A1 (en) * | 2002-06-28 | 2004-01-15 | Konica Corporation | Colored particle dispersion, ink jet ink, dye, and ink jet recording method |
| US7361415B2 (en) * | 2004-04-16 | 2008-04-22 | The University Of Hong Kong | System and method for producing light with organic light-emitting devices |
| US20050244672A1 (en) * | 2004-04-30 | 2005-11-03 | Chi-Ming Che | Organic light-emitting devices |
| GB0607096D0 (en) * | 2006-04-07 | 2006-05-17 | Imp Innovations Ltd | Compound |
| JP5294397B2 (ja) * | 2008-09-04 | 2013-09-18 | 国立大学法人 東京大学 | 金属錯体化合物 |
| JP6046338B2 (ja) | 2011-10-27 | 2016-12-14 | 株式会社Ihi | ラジカル抑制剤 |
| CN103508950B (zh) * | 2012-06-25 | 2016-04-20 | 南开大学 | 含亚胺结构的4-羟基-2-喹啉酮类化合物及其制备和应用 |
| CN103436047B (zh) * | 2013-08-05 | 2015-09-02 | 宁波龙欣精细化工有限公司 | 一种含苯并咪唑酮环的新型双偶氮甲川镍络合溶剂染料及其制备方法和应用 |
| CN117924961B (zh) * | 2024-01-16 | 2025-08-08 | 德州学院 | 一种c.i.颜料橙68的制备方法 |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2418747A (en) * | 1944-05-20 | 1947-04-08 | Gen Aniline & Film Corp | Nondiffusing phenolic color couplers |
| DE1279257B (de) * | 1963-12-04 | 1968-10-03 | Basf Ag | Verfahren zur Herstellung von Pigmentfarbstoffen |
| FR1453234A (fr) * | 1964-02-18 | 1966-06-03 | Pechiney Progil Sa | Nouveaux composés fongicides à usage agricole |
| FR1550094A (forum.php) * | 1967-05-26 | 1968-12-20 | ||
| DE2007844A1 (de) * | 1970-02-20 | 1971-08-26 | Badische Anilin & Soda Fabrik AG, 6700 Ludwigshafen | Azomethin Metallkomplexfarbstoffe |
| DE2122163A1 (en) * | 1971-05-05 | 1972-11-16 | Badische Anilin- & Soda-Fabrik Ag, 6700 Ludwigshafen | Bright yellow bisazomethine pigments - for plastics printing inks, paints, textiles |
| BE793578A (fr) * | 1971-12-31 | 1973-06-29 | Sandoz Sa | Nouveaux complexes metalliferes utilisables comme pigments et leur preparation |
| BE795836A (fr) * | 1972-02-24 | 1973-08-23 | Ciba Geigy | Pigment bis-azomethinique et sa preparation |
| CH568368A5 (forum.php) * | 1972-06-19 | 1975-10-31 | Ciba Geigy Ag | |
| DE2232086A1 (de) * | 1972-06-30 | 1974-01-03 | Hoechst Ag | Wasserunloesliche disazomethinfarbstoffe, verfahren zu ihrer herstellung und ihre verwendung |
-
1974
- 1974-07-31 CH CH1058574A patent/CH596276A5/xx not_active IP Right Cessation
-
1975
- 1975-06-25 DK DK288875A patent/DK288875A/da unknown
- 1975-07-28 DE DE2533676A patent/DE2533676C2/de not_active Expired
- 1975-07-28 US US05/599,444 patent/US4008225A/en not_active Expired - Lifetime
- 1975-07-29 CA CA232,451A patent/CA1052782A/en not_active Expired
- 1975-07-30 BE BE158751A patent/BE831902A/xx unknown
- 1975-07-30 ES ES439833A patent/ES439833A1/es not_active Expired
- 1975-07-30 FR FR7523753A patent/FR2280693A1/fr active Granted
- 1975-07-30 NL NL7509090A patent/NL7509090A/xx not_active Application Discontinuation
- 1975-07-31 CS CS7500005371A patent/CS185238B2/cs unknown
- 1975-07-31 BR BR7504896*A patent/BR7504896A/pt unknown
- 1975-07-31 JP JP50094137A patent/JPS5139726A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| DK288875A (da) | 1976-02-01 |
| FR2280693A1 (fr) | 1976-02-27 |
| BE831902A (fr) | 1976-01-30 |
| FR2280693B1 (forum.php) | 1977-12-09 |
| DE2533676C2 (de) | 1986-01-02 |
| DE2533676A1 (de) | 1976-02-19 |
| CS185238B2 (en) | 1978-09-15 |
| BR7504896A (pt) | 1976-08-03 |
| NL7509090A (nl) | 1976-02-03 |
| AU8357075A (en) | 1977-02-03 |
| CH596276A5 (forum.php) | 1978-03-15 |
| JPS5139726A (en) | 1976-04-02 |
| ES439833A1 (es) | 1977-06-16 |
| US4008225A (en) | 1977-02-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1052782A (en) | Process for the manufacture of bis-azomethine metal complex colorants | |
| CA1054617A (en) | Metal complexes of azomethines and process for their manufacture | |
| US4838943A (en) | Compounds useful as pigments containing one or more 2,2,6,6-tetraalkylpiperidine groups | |
| US3875200A (en) | New bis-2-azomethine pigments, process for their manufacture and their use | |
| US4065481A (en) | 1:1-Azomethine-metal-complex dyestuffs | |
| US3988323A (en) | Metal complexes of bishydrazides | |
| US3963708A (en) | Bis-azomethine metal complex colorants from hydroxycoumarin derivatives or hydroxychromone derivatives | |
| CA1061348A (en) | Iminoisoindolinone metal complex | |
| US4097450A (en) | Perinone compounds as colorants for polyolefins | |
| US4077953A (en) | Tri-dentate metal complex azo pigments | |
| US3892750A (en) | New azomethine pigments and processes for their manufacture | |
| US3939194A (en) | Bis-2-azomethine pigments, process for their manufacture and their use | |
| US3987023A (en) | Azo pigment metal complexes | |
| CA1089869A (en) | Metal-containing disazomethine compounds, process for preparing them and their use as colorants | |
| US4113759A (en) | Metal-containing disazomethine compounds, process for preparing them and their use as colorants | |
| US3749727A (en) | Benzoxanthene dyestuffs and process for their manufacture | |
| CA1082832A (en) | Perinone compounds, process for preparing them and their use as dyes | |
| US3971739A (en) | Tri or tetradentate metal azo pigment complexes | |
| US3509123A (en) | Monoazo pigments | |
| US4847365A (en) | Metal complexes of substituted 4-(2-carboxy-phenylazo-5-pyrazolones | |
| US4088651A (en) | Acylamino quinophthalone compounds | |
| US4144258A (en) | 1:1-Heterocyclic azo methine-metal complex dyestuffs | |
| US3878188A (en) | Process for the manufacture of coloured polycyclic metal complexes | |
| US4096157A (en) | Azamethine metal complex compounds | |
| US3882099A (en) | Phenyl-azo-(polycyclic)heterocyclic metal complexes |