AU583848B2 - Derivatives of methylene-bisphosphonic acid - Google Patents
Derivatives of methylene-bisphosphonic acidInfo
- Publication number
- AU583848B2 AU583848B2 AU46736/85A AU4673685A AU583848B2 AU 583848 B2 AU583848 B2 AU 583848B2 AU 46736/85 A AU46736/85 A AU 46736/85A AU 4673685 A AU4673685 A AU 4673685A AU 583848 B2 AU583848 B2 AU 583848B2
- Authority
- AU
- Australia
- Prior art keywords
- ppm
- methyl
- nmr
- bisphosphonate
- alkyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- MBKDYNNUVRNNRF-UHFFFAOYSA-N medronic acid Chemical class OP(O)(=O)CP(O)(O)=O MBKDYNNUVRNNRF-UHFFFAOYSA-N 0.000 title description 2
- 150000001875 compounds Chemical class 0.000 claims description 90
- -1 C1-C4-alkoχycarbonyl Chemical group 0.000 claims description 60
- 239000000203 mixture Substances 0.000 claims description 54
- 238000000034 method Methods 0.000 claims description 32
- 150000002148 esters Chemical class 0.000 claims description 23
- 239000002253 acid Substances 0.000 claims description 21
- 150000003839 salts Chemical class 0.000 claims description 19
- 125000004432 carbon atom Chemical group C* 0.000 claims description 12
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 9
- 230000037396 body weight Effects 0.000 claims description 9
- 239000011575 calcium Substances 0.000 claims description 9
- 229910052791 calcium Inorganic materials 0.000 claims description 9
- 229910052736 halogen Inorganic materials 0.000 claims description 9
- 150000002367 halogens Chemical class 0.000 claims description 9
- 229910052739 hydrogen Inorganic materials 0.000 claims description 9
- 239000001257 hydrogen Substances 0.000 claims description 9
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 8
- PJRBPPUAKJRQAP-UHFFFAOYSA-N [phenoxy(phosphono)methyl]phosphonic acid Chemical compound OP(O)(=O)C(P(O)(O)=O)OC1=CC=CC=C1 PJRBPPUAKJRQAP-UHFFFAOYSA-N 0.000 claims description 7
- HKYGSMOFSFOEIP-UHFFFAOYSA-N dichloro(dichloromethoxy)methane Chemical compound ClC(Cl)OC(Cl)Cl HKYGSMOFSFOEIP-UHFFFAOYSA-N 0.000 claims description 7
- 239000007788 liquid Substances 0.000 claims description 7
- 230000000694 effects Effects 0.000 claims description 6
- 150000002431 hydrogen Chemical class 0.000 claims description 6
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 4
- 230000002159 abnormal effect Effects 0.000 claims description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 4
- 238000006243 chemical reaction Methods 0.000 claims description 4
- 231100000252 nontoxic Toxicity 0.000 claims description 4
- 230000003000 nontoxic effect Effects 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- 229920006395 saturated elastomer Polymers 0.000 claims description 4
- PUZPDOWCWNUUKD-UHFFFAOYSA-M sodium fluoride Chemical compound [F-].[Na+] PUZPDOWCWNUUKD-UHFFFAOYSA-M 0.000 claims description 4
- 239000007787 solid Substances 0.000 claims description 4
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 208000037147 Hypercalcaemia Diseases 0.000 claims description 3
- 206010020707 Hyperparathyroidism primary Diseases 0.000 claims description 3
- 206010028980 Neoplasm Diseases 0.000 claims description 3
- 208000010191 Osteitis Deformans Diseases 0.000 claims description 3
- 208000001132 Osteoporosis Diseases 0.000 claims description 3
- 208000027868 Paget disease Diseases 0.000 claims description 3
- 201000000981 Primary Hyperparathyroidism Diseases 0.000 claims description 3
- 239000003937 drug carrier Substances 0.000 claims description 3
- 230000000148 hypercalcaemia Effects 0.000 claims description 3
- 208000030915 hypercalcemia disease Diseases 0.000 claims description 3
- 230000036210 malignancy Effects 0.000 claims description 3
- 208000027202 mammary Paget disease Diseases 0.000 claims description 3
- 206010039073 rheumatoid arthritis Diseases 0.000 claims description 3
- 125000005846 1-(alkanoyloxy)ethyl group Chemical group 0.000 claims description 2
- 125000005847 1-methyl-1-(alkanoyloxy)-ethyl group Chemical group 0.000 claims description 2
- 125000004206 2,2,2-trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 claims description 2
- 102000055006 Calcitonin Human genes 0.000 claims description 2
- 108060001064 Calcitonin Proteins 0.000 claims description 2
- 239000004215 Carbon black (E152) Substances 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- WMJAUGLLRRMITG-UHFFFAOYSA-N [phosphono(2,2,2-trifluoroethoxy)methyl]phosphonic acid Chemical compound OP(O)(=O)C(P(O)(O)=O)OCC(F)(F)F WMJAUGLLRRMITG-UHFFFAOYSA-N 0.000 claims description 2
- MMWXIYGKDHXWCE-UHFFFAOYSA-N [phosphono(propoxy)methyl]phosphonic acid Chemical compound CCCOC(P(O)(O)=O)P(O)(O)=O MMWXIYGKDHXWCE-UHFFFAOYSA-N 0.000 claims description 2
- 125000001539 acetonyl group Chemical group [H]C([H])([H])C(=O)C([H])([H])* 0.000 claims description 2
- 125000002723 alicyclic group Chemical group 0.000 claims description 2
- 125000001931 aliphatic group Chemical group 0.000 claims description 2
- 229910052783 alkali metal Inorganic materials 0.000 claims description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 2
- 150000003973 alkyl amines Chemical class 0.000 claims description 2
- 229910021529 ammonia Inorganic materials 0.000 claims description 2
- 230000002917 arthritic effect Effects 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 150000003939 benzylamines Chemical class 0.000 claims description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 2
- BBBFJLBPOGFECG-VJVYQDLKSA-N calcitonin Chemical compound N([C@H](C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CC=1C=CC(O)=CC=1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H]([C@@H](C)O)C(=O)NCC(=O)N[C@@H](CO)C(=O)NCC(=O)N[C@@H]([C@@H](C)O)C(=O)N1[C@@H](CCC1)C(N)=O)C(C)C)C(=O)[C@@H]1CSSC[C@H](N)C(=O)N[C@@H](CO)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H]([C@@H](C)O)C(=O)N1 BBBFJLBPOGFECG-VJVYQDLKSA-N 0.000 claims description 2
- 229960004015 calcitonin Drugs 0.000 claims description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 2
- 239000000460 chlorine Substances 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims description 2
- 208000035475 disorder Diseases 0.000 claims description 2
- 239000000262 estrogen Substances 0.000 claims description 2
- 229940011871 estrogen Drugs 0.000 claims description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 2
- 125000005643 gamma-butyrolacton-4-yl group Chemical group 0.000 claims description 2
- 229930195733 hydrocarbon Natural products 0.000 claims description 2
- 238000001727 in vivo Methods 0.000 claims description 2
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 claims description 2
- CFCUWKMKBJTWLW-BKHRDMLASA-N mithramycin Chemical compound O([C@@H]1C[C@@H](O[C@H](C)[C@H]1O)OC=1C=C2C=C3C[C@H]([C@@H](C(=O)C3=C(O)C2=C(O)C=1C)O[C@@H]1O[C@H](C)[C@@H](O)[C@H](O[C@@H]2O[C@H](C)[C@H](O)[C@H](O[C@@H]3O[C@H](C)[C@@H](O)[C@@](C)(O)C3)C2)C1)[C@H](OC)C(=O)[C@@H](O)[C@@H](C)O)[C@H]1C[C@@H](O)[C@H](O)[C@@H](C)O1 CFCUWKMKBJTWLW-BKHRDMLASA-N 0.000 claims description 2
- 229940021182 non-steroidal anti-inflammatory drug Drugs 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 2
- 229960003171 plicamycin Drugs 0.000 claims description 2
- 208000001685 postmenopausal osteoporosis Diseases 0.000 claims description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 2
- MFDFERRIHVXMIY-UHFFFAOYSA-N procaine Chemical compound CCN(CC)CCOC(=O)C1=CC=C(N)C=C1 MFDFERRIHVXMIY-UHFFFAOYSA-N 0.000 claims description 2
- 229960004919 procaine Drugs 0.000 claims description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 2
- 239000011775 sodium fluoride Substances 0.000 claims description 2
- 235000013024 sodium fluoride Nutrition 0.000 claims description 2
- 229960000414 sodium fluoride Drugs 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 125000003944 tolyl group Chemical group 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 2
- 239000011653 vitamin D2 Substances 0.000 claims description 2
- MECHNRXZTMCUDQ-RKHKHRCZSA-N vitamin D2 Chemical compound C1(/[C@@H]2CC[C@@H]([C@]2(CCC1)C)[C@H](C)/C=C/[C@H](C)C(C)C)=C\C=C1\C[C@@H](O)CCC1=C MECHNRXZTMCUDQ-RKHKHRCZSA-N 0.000 claims description 2
- 239000011647 vitamin D3 Substances 0.000 claims description 2
- QYSXJUFSXHHAJI-YRZJJWOYSA-N vitamin D3 Chemical compound C1(/[C@@H]2CC[C@@H]([C@]2(CCC1)C)[C@H](C)CCCC(C)C)=C\C=C1\C[C@@H](O)CCC1=C QYSXJUFSXHHAJI-YRZJJWOYSA-N 0.000 claims description 2
- 125000005848 1-(alkoxycarbonyloxy)ethyl group Chemical group 0.000 claims 1
- 125000005042 acyloxymethyl group Chemical group 0.000 claims 1
- 125000005205 alkoxycarbonyloxyalkyl group Chemical group 0.000 claims 1
- 125000005206 alkoxycarbonyloxymethyl group Chemical group 0.000 claims 1
- 239000012752 auxiliary agent Substances 0.000 claims 1
- 125000004985 dialkyl amino alkyl group Chemical group 0.000 claims 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 claims 1
- 238000011321 prophylaxis Methods 0.000 claims 1
- 230000009291 secondary effect Effects 0.000 claims 1
- 239000007858 starting material Substances 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 25
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 23
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 22
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 22
- 229940122361 Bisphosphonate Drugs 0.000 description 18
- 239000000243 solution Substances 0.000 description 18
- 239000003921 oil Substances 0.000 description 17
- 238000009472 formulation Methods 0.000 description 16
- 239000004480 active ingredient Substances 0.000 description 14
- OKKJLVBELUTLKV-MZCSYVLQSA-N Deuterated methanol Chemical compound [2H]OC([2H])([2H])[2H] OKKJLVBELUTLKV-MZCSYVLQSA-N 0.000 description 12
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- MXHTZQSKTCCMFG-UHFFFAOYSA-N n,n-dibenzyl-1-phenylmethanamine Chemical class C=1C=CC=CC=1CN(CC=1C=CC=CC=1)CC1=CC=CC=C1 MXHTZQSKTCCMFG-UHFFFAOYSA-N 0.000 description 9
- 238000003756 stirring Methods 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 8
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 8
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 8
- 238000001704 evaporation Methods 0.000 description 8
- 230000008020 evaporation Effects 0.000 description 8
- 238000001914 filtration Methods 0.000 description 8
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 7
- 239000012074 organic phase Substances 0.000 description 7
- 239000000725 suspension Substances 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- 208000006386 Bone Resorption Diseases 0.000 description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 6
- 230000024279 bone resorption Effects 0.000 description 6
- 238000004587 chromatography analysis Methods 0.000 description 6
- 239000013078 crystal Substances 0.000 description 6
- 230000008021 deposition Effects 0.000 description 6
- 239000004615 ingredient Substances 0.000 description 6
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 6
- 238000002360 preparation method Methods 0.000 description 6
- 239000000741 silica gel Substances 0.000 description 6
- 229910002027 silica gel Inorganic materials 0.000 description 6
- FCUKQLCAKJXJCH-UHFFFAOYSA-N 1-[bis(diethoxyphosphoryl)methoxy]butane Chemical compound CCCCOC(P(=O)(OCC)OCC)P(=O)(OCC)OCC FCUKQLCAKJXJCH-UHFFFAOYSA-N 0.000 description 5
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 239000012043 crude product Substances 0.000 description 5
- KFHYLQJKAJWAQI-UHFFFAOYSA-L disodium;[phenoxy(phosphonato)methyl]phosphonic acid Chemical compound [Na+].[Na+].OP(O)(=O)C(P([O-])([O-])=O)OC1=CC=CC=C1 KFHYLQJKAJWAQI-UHFFFAOYSA-L 0.000 description 5
- 230000001575 pathological effect Effects 0.000 description 5
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 5
- 239000012312 sodium hydride Substances 0.000 description 5
- 229910000104 sodium hydride Inorganic materials 0.000 description 5
- XQMDCFILHWVIPX-UHFFFAOYSA-N bis(diethoxyphosphoryl)methoxybenzene Chemical compound CCOP(=O)(OCC)C(P(=O)(OCC)OCC)OC1=CC=CC=C1 XQMDCFILHWVIPX-UHFFFAOYSA-N 0.000 description 4
- VQPFDLRNOCQMSN-UHFFFAOYSA-N bromosilane Chemical compound Br[SiH3] VQPFDLRNOCQMSN-UHFFFAOYSA-N 0.000 description 4
- 125000004772 dichloromethyl group Chemical group [H]C(Cl)(Cl)* 0.000 description 4
- 238000004821 distillation Methods 0.000 description 4
- 229910052500 inorganic mineral Inorganic materials 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- 235000010755 mineral Nutrition 0.000 description 4
- 239000011707 mineral Substances 0.000 description 4
- 239000008194 pharmaceutical composition Substances 0.000 description 4
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 239000011780 sodium chloride Substances 0.000 description 4
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 4
- IMSWEHIZVIKMQK-UHFFFAOYSA-N 1-(dichloromethoxy)-2-methoxyethane Chemical compound COCCOC(Cl)Cl IMSWEHIZVIKMQK-UHFFFAOYSA-N 0.000 description 3
- DYDUDJUGLBQOCC-UHFFFAOYSA-N 1-[bis(diethoxyphosphoryl)methoxy]-2-methoxyethane Chemical compound CCOP(=O)(OCC)C(P(=O)(OCC)OCC)OCCOC DYDUDJUGLBQOCC-UHFFFAOYSA-N 0.000 description 3
- MPPPKRYCTPRNTB-UHFFFAOYSA-N 1-bromobutane Chemical group CCCCBr MPPPKRYCTPRNTB-UHFFFAOYSA-N 0.000 description 3
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 3
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical class [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 241000700159 Rattus Species 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- GLTACTBDSPIBLT-UHFFFAOYSA-N [butoxy(phosphono)methyl]phosphonic acid Chemical compound CCCCOC(P(O)(O)=O)P(O)(O)=O GLTACTBDSPIBLT-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 238000003776 cleavage reaction Methods 0.000 description 3
- JFCMAIACBGBZRX-UHFFFAOYSA-N dichloromethoxybenzene Chemical compound ClC(Cl)OC1=CC=CC=C1 JFCMAIACBGBZRX-UHFFFAOYSA-N 0.000 description 3
- LXCYSACZTOKNNS-UHFFFAOYSA-N diethoxy(oxo)phosphanium Chemical compound CCO[P+](=O)OCC LXCYSACZTOKNNS-UHFFFAOYSA-N 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- HWJHWSBFPPPIPD-UHFFFAOYSA-N ethoxyethane;propan-2-one Chemical compound CC(C)=O.CCOCC HWJHWSBFPPPIPD-UHFFFAOYSA-N 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 235000019253 formic acid Nutrition 0.000 description 3
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 3
- 238000004452 microanalysis Methods 0.000 description 3
- 230000007017 scission Effects 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000003826 tablet Substances 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical group SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 3
- 239000000606 toothpaste Substances 0.000 description 3
- 238000011200 topical administration Methods 0.000 description 3
- BDZBKCUKTQZUTL-UHFFFAOYSA-N triethyl phosphite Chemical compound CCOP(OCC)OCC BDZBKCUKTQZUTL-UHFFFAOYSA-N 0.000 description 3
- 239000008215 water for injection Substances 0.000 description 3
- CVLVBAUTUFWUGL-UHFFFAOYSA-N 1,1-bis(diethoxyphosphoryl)propoxybenzene Chemical compound CCOP(=O)(OCC)C(CC)(P(=O)(OCC)OCC)OC1=CC=CC=C1 CVLVBAUTUFWUGL-UHFFFAOYSA-N 0.000 description 2
- GVVHBNABFJZWIC-UHFFFAOYSA-N 1-(dichloromethoxy)butane Chemical compound CCCCOC(Cl)Cl GVVHBNABFJZWIC-UHFFFAOYSA-N 0.000 description 2
- QZAVTQKIDYCUQJ-UHFFFAOYSA-N 1-[2-[bis(diethoxyphosphoryl)methoxy]ethoxy]-4-chlorobenzene Chemical compound CCOP(=O)(OCC)C(P(=O)(OCC)OCC)OCCOC1=CC=C(Cl)C=C1 QZAVTQKIDYCUQJ-UHFFFAOYSA-N 0.000 description 2
- RYDOYDPIRREUCV-UHFFFAOYSA-N 1-[bis(diethoxyphosphoryl)methoxy]-3-chlorobenzene Chemical compound CCOP(=O)(OCC)C(P(=O)(OCC)OCC)OC1=CC=CC(Cl)=C1 RYDOYDPIRREUCV-UHFFFAOYSA-N 0.000 description 2
- VVBLVQZYSBPTBC-UHFFFAOYSA-N 1-[bis(diethoxyphosphoryl)methoxy]-4-chlorobenzene Chemical compound CCOP(=O)(OCC)C(P(=O)(OCC)OCC)OC1=CC=C(Cl)C=C1 VVBLVQZYSBPTBC-UHFFFAOYSA-N 0.000 description 2
- JDQOWKOONITIQA-UHFFFAOYSA-N 1-[bis(diethoxyphosphoryl)methoxy]-4-methoxybenzene Chemical compound CCOP(=O)(OCC)C(P(=O)(OCC)OCC)OC1=CC=C(OC)C=C1 JDQOWKOONITIQA-UHFFFAOYSA-N 0.000 description 2
- XKKDUXVIJQHYDV-UHFFFAOYSA-N 1-[bis(diethoxyphosphoryl)methoxy]-4-nitrobenzene Chemical compound CCOP(=O)(OCC)C(P(=O)(OCC)OCC)OC1=CC=C([N+]([O-])=O)C=C1 XKKDUXVIJQHYDV-UHFFFAOYSA-N 0.000 description 2
- WQDUJDBWRNMJOA-UHFFFAOYSA-N 1-[bis(diethoxyphosphoryl)methoxy]-4-tert-butylbenzene Chemical compound CCOP(=O)(OCC)C(P(=O)(OCC)OCC)OC1=CC=C(C(C)(C)C)C=C1 WQDUJDBWRNMJOA-UHFFFAOYSA-N 0.000 description 2
- YFEAVHNYLSFUEK-UHFFFAOYSA-N 1-chloro-4-[2-(dichloromethoxy)ethoxy]benzene Chemical compound ClC(Cl)OCCOC1=CC=C(Cl)C=C1 YFEAVHNYLSFUEK-UHFFFAOYSA-N 0.000 description 2
- BUKGNXNYMSFHPD-UHFFFAOYSA-N 3-(1,3-dioxoisoindol-2-yl)propyl formate Chemical compound C1=CC=C2C(=O)N(CCCOC=O)C(=O)C2=C1 BUKGNXNYMSFHPD-UHFFFAOYSA-N 0.000 description 2
- YSIKHBWUBSFBRZ-UHFFFAOYSA-M 3-methoxypropanoate Chemical compound COCCC([O-])=O YSIKHBWUBSFBRZ-UHFFFAOYSA-M 0.000 description 2
- RLCBPXBEUBBNAX-UHFFFAOYSA-N 4-[bis(diethoxyphosphoryl)methoxy]aniline Chemical compound CCOP(=O)(OCC)C(P(=O)(OCC)OCC)OC1=CC=C(N)C=C1 RLCBPXBEUBBNAX-UHFFFAOYSA-N 0.000 description 2
- 201000001320 Atherosclerosis Diseases 0.000 description 2
- UYWQUFXKFGHYNT-UHFFFAOYSA-N Benzylformate Chemical compound O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 2
- 229920002261 Corn starch Polymers 0.000 description 2
- 208000006558 Dental Calculus Diseases 0.000 description 2
- 229920002153 Hydroxypropyl cellulose Polymers 0.000 description 2
- 241000124008 Mammalia Species 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- HEMHJVSKTPXQMS-DYCDLGHISA-M Sodium hydroxide-d Chemical compound [Na+].[2H][O-] HEMHJVSKTPXQMS-DYCDLGHISA-M 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- 206010044029 Tooth deposit Diseases 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 210000000988 bone and bone Anatomy 0.000 description 2
- 230000018678 bone mineralization Effects 0.000 description 2
- IYYIVELXUANFED-UHFFFAOYSA-N bromo(trimethyl)silane Chemical compound C[Si](C)(C)Br IYYIVELXUANFED-UHFFFAOYSA-N 0.000 description 2
- 239000008120 corn starch Substances 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 238000004090 dissolution Methods 0.000 description 2
- 239000003480 eluent Substances 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 239000001863 hydroxypropyl cellulose Substances 0.000 description 2
- 235000010977 hydroxypropyl cellulose Nutrition 0.000 description 2
- CGIGDMFJXJATDK-UHFFFAOYSA-N indomethacin Chemical compound CC1=C(CC(O)=O)C2=CC(OC)=CC=C2N1C(=O)C1=CC=C(Cl)C=C1 CGIGDMFJXJATDK-UHFFFAOYSA-N 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- PELJISAVHGXLAL-UHFFFAOYSA-N iodomethyl 2,2-dimethylpropanoate Chemical compound CC(C)(C)C(=O)OCI PELJISAVHGXLAL-UHFFFAOYSA-N 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- 239000006072 paste Substances 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 239000001632 sodium acetate Substances 0.000 description 2
- 235000017281 sodium acetate Nutrition 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 230000001225 therapeutic effect Effects 0.000 description 2
- 210000001519 tissue Anatomy 0.000 description 2
- 210000002700 urine Anatomy 0.000 description 2
- 239000011592 zinc chloride Substances 0.000 description 2
- 235000005074 zinc chloride Nutrition 0.000 description 2
- UVTROEKJTGNAEY-UHFFFAOYSA-N (1-butoxy-1-phosphonononyl)phosphonic acid Chemical compound CCCCCCCCC(P(O)(O)=O)(P(O)(O)=O)OCCCC UVTROEKJTGNAEY-UHFFFAOYSA-N 0.000 description 1
- DYYVQFDDUZIQPB-UHFFFAOYSA-N (1-butoxy-1-phosphonopentyl)phosphonic acid Chemical compound CCCCOC(P(O)(O)=O)(P(O)(O)=O)CCCC DYYVQFDDUZIQPB-UHFFFAOYSA-N 0.000 description 1
- JTEDEBWDJVUBKU-UHFFFAOYSA-N (1-butoxy-1-phosphonopropyl)phosphonic acid Chemical compound CCCCOC(CC)(P(O)(O)=O)P(O)(O)=O JTEDEBWDJVUBKU-UHFFFAOYSA-N 0.000 description 1
- KKACTKFGAKMDMM-UHFFFAOYSA-N (1-butoxy-4-phenyl-1-phosphonobutyl)phosphonic acid (1-butoxy-2-phenyl-1-phosphonoethyl)phosphonic acid Chemical compound C(CCC)OC(CCCC1=CC=CC=C1)(P(O)(O)=O)P(O)(O)=O.C(CCC)OC(CC1=CC=CC=C1)(P(O)(O)=O)P(O)(O)=O KKACTKFGAKMDMM-UHFFFAOYSA-N 0.000 description 1
- SNSCBJMUQDJDMD-UHFFFAOYSA-N (1-phenoxy-1-phosphonopentyl)phosphonic acid Chemical compound CCCCC(P(O)(O)=O)(P(O)(O)=O)OC1=CC=CC=C1 SNSCBJMUQDJDMD-UHFFFAOYSA-N 0.000 description 1
- KQNRHVOAXFTLET-UHFFFAOYSA-N (1-phenoxy-1-phosphonopropyl)phosphonic acid Chemical compound CCC(P(O)(O)=O)(P(O)(O)=O)OC1=CC=CC=C1 KQNRHVOAXFTLET-UHFFFAOYSA-N 0.000 description 1
- JAXBDZOGESNBEO-UHFFFAOYSA-N (1-phenoxy-2-phenyl-1-phosphonoethyl)phosphonic acid Chemical compound C=1C=CC=CC=1OC(P(O)(O)=O)(P(O)(=O)O)CC1=CC=CC=C1 JAXBDZOGESNBEO-UHFFFAOYSA-N 0.000 description 1
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- GCPPOYQHZNLRKC-UHFFFAOYSA-N (4-bromophenyl) formate Chemical compound BrC1=CC=C(OC=O)C=C1 GCPPOYQHZNLRKC-UHFFFAOYSA-N 0.000 description 1
- IGCZXNLHMSJZCI-UHFFFAOYSA-N (4-chlorophenyl) formate Chemical compound ClC1=CC=C(OC=O)C=C1 IGCZXNLHMSJZCI-UHFFFAOYSA-N 0.000 description 1
- YPEZLTLIHKMIHU-UHFFFAOYSA-N (4-fluorophenyl) formate Chemical compound FC1=CC=C(OC=O)C=C1 YPEZLTLIHKMIHU-UHFFFAOYSA-N 0.000 description 1
- YTECWTFSOKGVFM-UHFFFAOYSA-N (4-methoxyphenyl) formate Chemical compound COC1=CC=C(OC=O)C=C1 YTECWTFSOKGVFM-UHFFFAOYSA-N 0.000 description 1
- NEIANUMOAXBNRT-UHFFFAOYSA-N (4-methylphenyl) formate Chemical compound CC1=CC=C(OC=O)C=C1 NEIANUMOAXBNRT-UHFFFAOYSA-N 0.000 description 1
- IEXRKQFZXJSHOB-UHFFFAOYSA-N (4-nitrophenyl) formate Chemical compound [O-][N+](=O)C1=CC=C(OC=O)C=C1 IEXRKQFZXJSHOB-UHFFFAOYSA-N 0.000 description 1
- XYISWGCHKYECBN-UHFFFAOYSA-N (4-tert-butylphenyl) formate Chemical compound CC(C)(C)C1=CC=C(OC=O)C=C1 XYISWGCHKYECBN-UHFFFAOYSA-N 0.000 description 1
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 description 1
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 description 1
- 125000004209 (C1-C8) alkyl group Chemical group 0.000 description 1
- HRTZWHNRYKMKAF-UHFFFAOYSA-N 1,1-bis(diethoxyphosphoryl)ethoxybenzene Chemical compound CCOP(=O)(OCC)C(C)(P(=O)(OCC)OCC)OC1=CC=CC=C1 HRTZWHNRYKMKAF-UHFFFAOYSA-N 0.000 description 1
- IYJTXPUEFUABOY-UHFFFAOYSA-N 1,1-bis(diethoxyphosphoryl)pentoxybenzene Chemical compound CCCCC(P(=O)(OCC)OCC)(P(=O)(OCC)OCC)OC1=CC=CC=C1 IYJTXPUEFUABOY-UHFFFAOYSA-N 0.000 description 1
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 1
- OKTBGXFHGIPLGH-UHFFFAOYSA-N 1-(dichloromethoxy)-2-ethoxyethane Chemical group CCOCCOC(Cl)Cl OKTBGXFHGIPLGH-UHFFFAOYSA-N 0.000 description 1
- YUWNOJMMCCQGKA-UHFFFAOYSA-N 1-(dichloromethoxy)-4-methoxybenzene Chemical compound COC1=CC=C(OC(Cl)Cl)C=C1 YUWNOJMMCCQGKA-UHFFFAOYSA-N 0.000 description 1
- LKUUWSJBFHEXCS-UHFFFAOYSA-N 1-(dichloromethoxy)-4-methylbenzene Chemical compound CC1=CC=C(OC(Cl)Cl)C=C1 LKUUWSJBFHEXCS-UHFFFAOYSA-N 0.000 description 1
- QACOIPDGSJDBES-UHFFFAOYSA-N 1-(dichloromethoxy)-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(OC(Cl)Cl)C=C1 QACOIPDGSJDBES-UHFFFAOYSA-N 0.000 description 1
- PZRRKWSJYSNQMP-UHFFFAOYSA-N 1-(dichloromethoxy)naphthalene Chemical compound C1=CC=C2C(OC(Cl)Cl)=CC=CC2=C1 PZRRKWSJYSNQMP-UHFFFAOYSA-N 0.000 description 1
- NZJUCAMALNLSGF-UHFFFAOYSA-N 1-[1,1-bis(diethoxyphosphoryl)propoxy]butane Chemical compound CCCCOC(CC)(P(=O)(OCC)OCC)P(=O)(OCC)OCC NZJUCAMALNLSGF-UHFFFAOYSA-N 0.000 description 1
- FQTCWOOXTXZALQ-UHFFFAOYSA-N 1-[bis(diethoxyphosphoryl)methoxy]-2,4-dichlorobenzene Chemical compound CCOP(=O)(OCC)C(P(=O)(OCC)OCC)OC1=CC=C(Cl)C=C1Cl FQTCWOOXTXZALQ-UHFFFAOYSA-N 0.000 description 1
- GWJJIPVUDLMZSD-UHFFFAOYSA-N 1-[bis(diethoxyphosphoryl)methoxy]-2-methylpropane Chemical compound CCOP(=O)(OCC)C(OCC(C)C)P(=O)(OCC)OCC GWJJIPVUDLMZSD-UHFFFAOYSA-N 0.000 description 1
- YAPZWTBRJITGQJ-UHFFFAOYSA-N 1-[bis(diethoxyphosphoryl)methoxy]-3-(trifluoromethyl)benzene Chemical compound CCOP(=O)(OCC)C(P(=O)(OCC)OCC)OC1=CC=CC(C(F)(F)F)=C1 YAPZWTBRJITGQJ-UHFFFAOYSA-N 0.000 description 1
- CHKCAFBNRDWWEA-UHFFFAOYSA-N 1-[bis(diethoxyphosphoryl)methoxy]-4-bromobenzene Chemical compound CCOP(=O)(OCC)C(P(=O)(OCC)OCC)OC1=CC=C(Br)C=C1 CHKCAFBNRDWWEA-UHFFFAOYSA-N 0.000 description 1
- NPYOJAPGRHHHMG-UHFFFAOYSA-N 1-[bis(diethoxyphosphoryl)methoxy]-4-fluorobenzene Chemical compound CCOP(=O)(OCC)C(P(=O)(OCC)OCC)OC1=CC=C(F)C=C1 NPYOJAPGRHHHMG-UHFFFAOYSA-N 0.000 description 1
- DYRLKSAICBYQOG-UHFFFAOYSA-N 1-[bis(diethoxyphosphoryl)methoxy]propane Chemical compound CCCOC(P(=O)(OCC)OCC)P(=O)(OCC)OCC DYRLKSAICBYQOG-UHFFFAOYSA-N 0.000 description 1
- YCPZIQMIHFLXIO-UHFFFAOYSA-N 1-bromo-4-(dichloromethoxy)benzene Chemical compound ClC(Cl)OC1=CC=C(Br)C=C1 YCPZIQMIHFLXIO-UHFFFAOYSA-N 0.000 description 1
- VMKOFRJSULQZRM-UHFFFAOYSA-N 1-bromooctane Chemical group CCCCCCCCBr VMKOFRJSULQZRM-UHFFFAOYSA-N 0.000 description 1
- HOURVJSMYSJDLI-UHFFFAOYSA-N 1-butoxy-1,1-bis(diethoxyphosphoryl)nonane Chemical compound CCCCCCCCC(P(=O)(OCC)OCC)(P(=O)(OCC)OCC)OCCCC HOURVJSMYSJDLI-UHFFFAOYSA-N 0.000 description 1
- XQNSRIYGQSEARD-UHFFFAOYSA-N 1-butoxy-1,1-bis(diethoxyphosphoryl)pentane Chemical compound CCCCOC(CCCC)(P(=O)(OCC)OCC)P(=O)(OCC)OCC XQNSRIYGQSEARD-UHFFFAOYSA-N 0.000 description 1
- KDONFUBUUOPHPJ-UHFFFAOYSA-N 1-chloro-3-(dichloromethoxy)propane Chemical group ClCCCOC(Cl)Cl KDONFUBUUOPHPJ-UHFFFAOYSA-N 0.000 description 1
- FRAMETSKMUTEFA-UHFFFAOYSA-N 1-chloro-4-(dichloromethoxy)benzene Chemical compound ClC(Cl)OC1=CC=C(Cl)C=C1 FRAMETSKMUTEFA-UHFFFAOYSA-N 0.000 description 1
- ZGLHBRQAEXKACO-XJRQOBMKSA-N 1alpha,25-dihydroxyvitamin D2 Chemical compound C1(/[C@@H]2CC[C@@H]([C@]2(CCC1)C)[C@@H](\C=C\[C@H](C)C(C)(C)O)C)=C\C=C1\C[C@@H](O)C[C@H](O)C1=C ZGLHBRQAEXKACO-XJRQOBMKSA-N 0.000 description 1
- JTTBTXYZOFDQBL-UHFFFAOYSA-N 2,4-dichloro-1-(dichloromethoxy)benzene Chemical compound ClC(Cl)OC1=CC=C(Cl)C=C1Cl JTTBTXYZOFDQBL-UHFFFAOYSA-N 0.000 description 1
- FUJSJWRORKKPAI-UHFFFAOYSA-N 2-(2,4-dichlorophenoxy)acetyl chloride Chemical compound ClC(=O)COC1=CC=C(Cl)C=C1Cl FUJSJWRORKKPAI-UHFFFAOYSA-N 0.000 description 1
- PYWJNWZWVXWDHY-UHFFFAOYSA-N 2-(4-chlorophenoxy)ethyl formate Chemical compound ClC1=CC=C(OCCOC=O)C=C1 PYWJNWZWVXWDHY-UHFFFAOYSA-N 0.000 description 1
- WYRZXDVGXFLKKU-UHFFFAOYSA-N 2-(dichloromethoxy)-1,1,1-trifluoroethane Chemical group FC(F)(F)COC(Cl)Cl WYRZXDVGXFLKKU-UHFFFAOYSA-N 0.000 description 1
- DXKNOVFPMYRGCA-UHFFFAOYSA-N 2-(dichloromethoxy)naphthalene Chemical compound C1=CC=CC2=CC(OC(Cl)Cl)=CC=C21 DXKNOVFPMYRGCA-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- QKPWUPIRKMQWOK-UHFFFAOYSA-N 2-[3-[bis(diethoxyphosphoryl)methoxy]propyl]isoindole-1,3-dione Chemical compound C1=CC=C2C(=O)N(CCCOC(P(=O)(OCC)OCC)P(=O)(OCC)OCC)C(=O)C2=C1 QKPWUPIRKMQWOK-UHFFFAOYSA-N 0.000 description 1
- SZIFAVKTNFCBPC-UHFFFAOYSA-N 2-chloroethanol Chemical compound OCCCl SZIFAVKTNFCBPC-UHFFFAOYSA-N 0.000 description 1
- SQVNITZYWXMWOG-UHFFFAOYSA-N 2-cyclohexyl-1-(2-methylquinolin-4-yl)-3-(1,3-thiazol-2-yl)guanidine Chemical compound C=12C=CC=CC2=NC(C)=CC=1NC(=NC1CCCCC1)NC1=NC=CS1 SQVNITZYWXMWOG-UHFFFAOYSA-N 0.000 description 1
- XMZQWZJMTBCUFT-UHFFFAOYSA-N 3-bromopropylbenzene Chemical group BrCCCC1=CC=CC=C1 XMZQWZJMTBCUFT-UHFFFAOYSA-N 0.000 description 1
- WXNZTHHGJRFXKQ-UHFFFAOYSA-N 4-chlorophenol Chemical compound OC1=CC=C(Cl)C=C1 WXNZTHHGJRFXKQ-UHFFFAOYSA-N 0.000 description 1
- IXLRHDYGZZWNMY-UHFFFAOYSA-N 4-chlorophenol;2-(4-chlorophenoxy)ethyl formate Chemical compound OC1=CC=C(Cl)C=C1.ClC1=CC=C(OCCOC=O)C=C1 IXLRHDYGZZWNMY-UHFFFAOYSA-N 0.000 description 1
- BSYNRYMUTXBXSQ-FOQJRBATSA-N 59096-14-9 Chemical compound CC(=O)OC1=CC=CC=C1[14C](O)=O BSYNRYMUTXBXSQ-FOQJRBATSA-N 0.000 description 1
- KLSJWNVTNUYHDU-UHFFFAOYSA-N Amitrole Chemical compound NC1=NC=NN1 KLSJWNVTNUYHDU-UHFFFAOYSA-N 0.000 description 1
- 241000972773 Aulopiformes Species 0.000 description 1
- 208000031638 Body Weight Diseases 0.000 description 1
- HGIWKTDEINKEOF-UHFFFAOYSA-N C(CCC)OC(CCCC1=CC=CC=C1)(P(OCC)(OCC)=O)P(OCC)(OCC)=O.C(CCC)OC(CC1=CC=CC=C1)(P(OCC)(OCC)=O)P(OCC)(OCC)=O Chemical compound C(CCC)OC(CCCC1=CC=CC=C1)(P(OCC)(OCC)=O)P(OCC)(OCC)=O.C(CCC)OC(CC1=CC=CC=C1)(P(OCC)(OCC)=O)P(OCC)(OCC)=O HGIWKTDEINKEOF-UHFFFAOYSA-N 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- BWLUMTFWVZZZND-UHFFFAOYSA-N Dibenzylamine Chemical compound C=1C=CC=CC=1CNCC1=CC=CC=C1 BWLUMTFWVZZZND-UHFFFAOYSA-N 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical compound C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- 241000792859 Enema Species 0.000 description 1
- DBVJJBKOTRCVKF-UHFFFAOYSA-N Etidronic acid Chemical compound OP(=O)(O)C(O)(C)P(O)(O)=O DBVJJBKOTRCVKF-UHFFFAOYSA-N 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- PMMYEEVYMWASQN-DMTCNVIQSA-N Hydroxyproline Chemical compound O[C@H]1CN[C@H](C(O)=O)C1 PMMYEEVYMWASQN-DMTCNVIQSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- BSMILTTURCQDGJ-UHFFFAOYSA-N N-(3-Hydroxypropyl)phthalimide Chemical compound C1=CC=C2C(=O)N(CCCO)C(=O)C2=C1 BSMILTTURCQDGJ-UHFFFAOYSA-N 0.000 description 1
- HTLZVHNRZJPSMI-UHFFFAOYSA-N N-ethylpiperidine Chemical compound CCN1CCCCC1 HTLZVHNRZJPSMI-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 239000005708 Sodium hypochlorite Substances 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- NGSQEDKKXXIJLB-UHFFFAOYSA-N [(2,4-dichlorophenoxy)-phosphonomethyl]phosphonic acid Chemical compound OP(O)(=O)C(P(O)(O)=O)OC1=CC=C(Cl)C=C1Cl NGSQEDKKXXIJLB-UHFFFAOYSA-N 0.000 description 1
- HVTGDNPIWKUWLM-UHFFFAOYSA-N [(3-chlorophenoxy)-phosphonomethyl]phosphonic acid Chemical compound OP(O)(=O)C(P(O)(O)=O)OC1=CC=CC(Cl)=C1 HVTGDNPIWKUWLM-UHFFFAOYSA-N 0.000 description 1
- AXNJFIBGQBUQLI-UHFFFAOYSA-N [(4-aminophenoxy)-phosphonomethyl]phosphonic acid Chemical compound NC1=CC=C(OC(P(O)(O)=O)P(O)(O)=O)C=C1 AXNJFIBGQBUQLI-UHFFFAOYSA-N 0.000 description 1
- FTFZDHLHMFIXFK-UHFFFAOYSA-N [(4-bromophenoxy)-phosphonomethyl]phosphonic acid Chemical compound OP(O)(=O)C(P(O)(O)=O)OC1=CC=C(Br)C=C1 FTFZDHLHMFIXFK-UHFFFAOYSA-N 0.000 description 1
- KXWNAQRKVMDGHF-UHFFFAOYSA-N [(4-fluorophenoxy)-phosphonomethyl]phosphonic acid Chemical compound OP(O)(=O)C(P(O)(O)=O)OC1=CC=C(F)C=C1 KXWNAQRKVMDGHF-UHFFFAOYSA-N 0.000 description 1
- FCBNUTOTWPYDNT-UHFFFAOYSA-N [(4-hydroxyphenoxy)-phosphonomethyl]phosphonic acid Chemical compound OC1=CC=C(OC(P(O)(O)=O)P(O)(O)=O)C=C1 FCBNUTOTWPYDNT-UHFFFAOYSA-N 0.000 description 1
- NTMUSKRBEUZWFD-UHFFFAOYSA-N [(4-methoxyphenoxy)-phosphonomethyl]phosphonic acid Chemical compound COC1=CC=C(OC(P(O)(O)=O)P(O)(O)=O)C=C1 NTMUSKRBEUZWFD-UHFFFAOYSA-N 0.000 description 1
- IBLXXGAVUJIENV-UHFFFAOYSA-N [(4-nitrophenoxy)-phosphonomethyl]phosphonic acid Chemical compound OP(O)(=O)C(P(O)(O)=O)OC1=CC=C([N+]([O-])=O)C=C1 IBLXXGAVUJIENV-UHFFFAOYSA-N 0.000 description 1
- LCKKYZRGUVSJFI-UHFFFAOYSA-N [2,2-bis(diethoxyphosphoryl)-2-phenoxyethyl]benzene Chemical compound C=1C=CC=CC=1OC(P(=O)(OCC)OCC)(P(=O)(OCC)OCC)CC1=CC=CC=C1 LCKKYZRGUVSJFI-UHFFFAOYSA-N 0.000 description 1
- YLMHDYYACPLTCV-UHFFFAOYSA-N [2-ethoxyethoxy(phosphono)methyl]phosphonic acid Chemical compound CCOCCOC(P(O)(O)=O)P(O)(O)=O YLMHDYYACPLTCV-UHFFFAOYSA-N 0.000 description 1
- LSUCSSFLQFXCBI-UHFFFAOYSA-N [2-hydroxyethoxy(phosphono)methyl]phosphonic acid Chemical compound OCCOC(P(O)(O)=O)P(O)(O)=O LSUCSSFLQFXCBI-UHFFFAOYSA-N 0.000 description 1
- IQIDYIKOKGYQLZ-UHFFFAOYSA-N [2-methoxyethoxy(phosphono)methyl]phosphonic acid Chemical compound COCCOC(P(O)(O)=O)P(O)(O)=O IQIDYIKOKGYQLZ-UHFFFAOYSA-N 0.000 description 1
- DVTNCWCZPGNOMV-UHFFFAOYSA-N [2-methylpropoxy(phosphono)methyl]phosphonic acid Chemical compound CC(C)COC(P(O)(O)=O)P(O)(O)=O DVTNCWCZPGNOMV-UHFFFAOYSA-N 0.000 description 1
- SAXQBHRTKUWTHZ-UHFFFAOYSA-N [3-(trifluoromethyl)phenyl] formate Chemical compound FC(F)(F)C1=CC=CC(OC=O)=C1 SAXQBHRTKUWTHZ-UHFFFAOYSA-N 0.000 description 1
- CKESWSLKMRTAIW-UHFFFAOYSA-N [3-aminopropoxy(phosphono)methyl]phosphonic acid Chemical compound NCCCOC(P(O)(O)=O)P(O)(O)=O CKESWSLKMRTAIW-UHFFFAOYSA-N 0.000 description 1
- AQFKIVUJICJVJT-UHFFFAOYSA-N [3-chloropropoxy(phosphono)methyl]phosphonic acid Chemical compound OP(O)(=O)C(P(O)(O)=O)OCCCCl AQFKIVUJICJVJT-UHFFFAOYSA-N 0.000 description 1
- IIWKJUKNXUANDQ-UHFFFAOYSA-L [Na+].[Na+].CC(C)(C)C1=CC=C(OC(P(O)(O)=O)P([O-])([O-])=O)C=C1 Chemical compound [Na+].[Na+].CC(C)(C)C1=CC=C(OC(P(O)(O)=O)P([O-])([O-])=O)C=C1 IIWKJUKNXUANDQ-UHFFFAOYSA-L 0.000 description 1
- WJBDNGPOTYMDFP-UHFFFAOYSA-L [Na+].[Na+].OP(O)(=O)C(P([O-])([O-])=O)OC1=CC=C(Cl)C=C1 Chemical compound [Na+].[Na+].OP(O)(=O)C(P([O-])([O-])=O)OC1=CC=C(Cl)C=C1 WJBDNGPOTYMDFP-UHFFFAOYSA-L 0.000 description 1
- SZKZMDGQCOCKDB-UHFFFAOYSA-L [Na+].[Na+].OP(O)(=O)C(P([O-])([O-])=O)OCCOC1=CC=C(Cl)C=C1 Chemical compound [Na+].[Na+].OP(O)(=O)C(P([O-])([O-])=O)OCCOC1=CC=C(Cl)C=C1 SZKZMDGQCOCKDB-UHFFFAOYSA-L 0.000 description 1
- ARZCWTQOGKAHFX-UHFFFAOYSA-L [Na+].[Na+].OP(O)(=O)C(P([O-])([O-])=O)OCCOC1=CC=CC=C1 Chemical compound [Na+].[Na+].OP(O)(=O)C(P([O-])([O-])=O)OCCOC1=CC=CC=C1 ARZCWTQOGKAHFX-UHFFFAOYSA-L 0.000 description 1
- YLPWSCSWXQCISU-UHFFFAOYSA-L [Na+].[Na+].OP(O)(=O)C(P([O-])([O-])=O)OCCSC1=CC=CC=C1 Chemical compound [Na+].[Na+].OP(O)(=O)C(P([O-])([O-])=O)OCCSC1=CC=CC=C1 YLPWSCSWXQCISU-UHFFFAOYSA-L 0.000 description 1
- PPMHDYDRRGTAPJ-UHFFFAOYSA-N [phosphono-[3-(trifluoromethyl)phenoxy]methyl]phosphonic acid Chemical compound OP(O)(=O)C(P(O)(O)=O)OC1=CC=CC(C(F)(F)F)=C1 PPMHDYDRRGTAPJ-UHFFFAOYSA-N 0.000 description 1
- 239000011149 active material Substances 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- OFHCOWSQAMBJIW-AVJTYSNKSA-N alfacalcidol Chemical compound C1(/[C@@H]2CC[C@@H]([C@]2(CCC1)C)[C@H](C)CCCC(C)C)=C\C=C1\C[C@@H](O)C[C@H](O)C1=C OFHCOWSQAMBJIW-AVJTYSNKSA-N 0.000 description 1
- 125000005194 alkoxycarbonyloxy group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 235000006708 antioxidants Nutrition 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- UPABQMWFWCMOFV-UHFFFAOYSA-N benethamine Chemical compound C=1C=CC=CC=1CNCCC1=CC=CC=C1 UPABQMWFWCMOFV-UHFFFAOYSA-N 0.000 description 1
- JUHORIMYRDESRB-UHFFFAOYSA-N benzathine Chemical compound C=1C=CC=CC=1CNCCNCC1=CC=CC=C1 JUHORIMYRDESRB-UHFFFAOYSA-N 0.000 description 1
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical group BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical group ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 239000004621 biodegradable polymer Substances 0.000 description 1
- 229920002988 biodegradable polymer Polymers 0.000 description 1
- 150000004663 bisphosphonates Chemical class 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 230000010256 bone deposition Effects 0.000 description 1
- 230000008416 bone turnover Effects 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 239000007853 buffer solution Substances 0.000 description 1
- 239000011612 calcitriol Substances 0.000 description 1
- GMRQFYUYWCNGIN-NKMMMXOESA-N calcitriol Chemical compound C1(/[C@@H]2CC[C@@H]([C@]2(CCC1)C)[C@@H](CCCC(C)(C)O)C)=C\C=C1\C[C@@H](O)C[C@H](O)C1=C GMRQFYUYWCNGIN-NKMMMXOESA-N 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 201000011510 cancer Diseases 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 1
- ACSIXWWBWUQEHA-UHFFFAOYSA-N clodronic acid Chemical compound OP(O)(=O)C(Cl)(Cl)P(O)(O)=O ACSIXWWBWUQEHA-UHFFFAOYSA-N 0.000 description 1
- 229960002286 clodronic acid Drugs 0.000 description 1
- 229940110456 cocoa butter Drugs 0.000 description 1
- 235000019868 cocoa butter Nutrition 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 239000010779 crude oil Substances 0.000 description 1
- QTNXFBZGWIIJNN-UHFFFAOYSA-N cyclohexyl formate;dichloromethoxycyclohexane Chemical compound O=COC1CCCCC1.ClC(Cl)OC1CCCCC1 QTNXFBZGWIIJNN-UHFFFAOYSA-N 0.000 description 1
- 230000002939 deleterious effect Effects 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- JWVSYGMUGPYQLF-UHFFFAOYSA-N dichloromethoxymethylbenzene Chemical compound ClC(Cl)OCC1=CC=CC=C1 JWVSYGMUGPYQLF-UHFFFAOYSA-N 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- PMMYEEVYMWASQN-UHFFFAOYSA-N dl-hydroxyproline Natural products OC1C[NH2+]C(C([O-])=O)C1 PMMYEEVYMWASQN-UHFFFAOYSA-N 0.000 description 1
- HKXBNHCUPKIYDM-CGMHZMFXSA-N doxercalciferol Chemical compound C1(/[C@@H]2CC[C@@H]([C@]2(CCC1)C)[C@H](C)/C=C/[C@H](C)C(C)C)=C\C=C1\C[C@@H](O)C[C@H](O)C1=C HKXBNHCUPKIYDM-CGMHZMFXSA-N 0.000 description 1
- 230000009977 dual effect Effects 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 239000007920 enema Substances 0.000 description 1
- 229940095399 enema Drugs 0.000 description 1
- 229960003750 ethyl chloride Drugs 0.000 description 1
- 229940009626 etidronate Drugs 0.000 description 1
- 230000029142 excretion Effects 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 150000004675 formic acid derivatives Chemical class 0.000 description 1
- 238000005194 fractionation Methods 0.000 description 1
- 230000026030 halogenation Effects 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- 239000008233 hard water Substances 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 1
- 229960002591 hydroxyproline Drugs 0.000 description 1
- 230000000121 hypercalcemic effect Effects 0.000 description 1
- 229960000905 indomethacin Drugs 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical group IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- NZDJTVSTIFYISQ-UHFFFAOYSA-N iodomethyl acetate Chemical group CC(=O)OCI NZDJTVSTIFYISQ-UHFFFAOYSA-N 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 239000000865 liniment Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000006210 lotion Substances 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- 239000012528 membrane Substances 0.000 description 1
- 230000002503 metabolic effect Effects 0.000 description 1
- LXCFILQKKLGQFO-UHFFFAOYSA-N methylparaben Chemical compound COC(=O)C1=CC=C(O)C=C1 LXCFILQKKLGQFO-UHFFFAOYSA-N 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- HVAAHUDGWQAAOJ-UHFFFAOYSA-N n-benzylethanamine Chemical compound CCNCC1=CC=CC=C1 HVAAHUDGWQAAOJ-UHFFFAOYSA-N 0.000 description 1
- JVZGDJJGLDKFRF-UHFFFAOYSA-N naphthalen-1-yl formate Chemical compound C1=CC=C2C(OC=O)=CC=CC2=C1 JVZGDJJGLDKFRF-UHFFFAOYSA-N 0.000 description 1
- ZSFLPNDWUWXOGM-UHFFFAOYSA-N naphthalen-2-yl formate Chemical compound C1=CC=CC2=CC(OC=O)=CC=C21 ZSFLPNDWUWXOGM-UHFFFAOYSA-N 0.000 description 1
- 229940090008 naprosyn Drugs 0.000 description 1
- CMWTZPSULFXXJA-VIFPVBQESA-N naproxen Chemical compound C1=C([C@H](C)C(O)=O)C=CC2=CC(OC)=CC=C21 CMWTZPSULFXXJA-VIFPVBQESA-N 0.000 description 1
- 230000030991 negative regulation of bone resorption Effects 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 239000007764 o/w emulsion Substances 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 201000008482 osteoarthritis Diseases 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000008024 pharmaceutical diluent Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 229920001467 poly(styrenesulfonates) Polymers 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 235000019515 salmon Nutrition 0.000 description 1
- 238000007493 shaping process Methods 0.000 description 1
- KZJPVUDYAMEDRM-UHFFFAOYSA-M silver;2,2,2-trifluoroacetate Chemical compound [Ag+].[O-]C(=O)C(F)(F)F KZJPVUDYAMEDRM-UHFFFAOYSA-M 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 description 1
- VYPDUQYOLCLEGS-UHFFFAOYSA-M sodium;2-ethylhexanoate Chemical compound [Na+].CCCCC(CC)C([O-])=O VYPDUQYOLCLEGS-UHFFFAOYSA-M 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000008174 sterile solution Substances 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 230000009885 systemic effect Effects 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- 150000004685 tetrahydrates Chemical class 0.000 description 1
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 1
- FXJYEWSZMRTNSO-UHFFFAOYSA-J tetrasilver;dioxido-oxo-[phenoxy(phosphonato)methyl]-$l^{5}-phosphane Chemical compound [Ag+].[Ag+].[Ag+].[Ag+].[O-]P([O-])(=O)C(P([O-])([O-])=O)OC1=CC=CC=C1 FXJYEWSZMRTNSO-UHFFFAOYSA-J 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 229950006828 timegadine Drugs 0.000 description 1
- 229940034610 toothpaste Drugs 0.000 description 1
- FGMPLJWBKKVCDB-UHFFFAOYSA-N trans-L-hydroxy-proline Natural products ON1CCCC1C(O)=O FGMPLJWBKKVCDB-UHFFFAOYSA-N 0.000 description 1
- 230000002485 urinary effect Effects 0.000 description 1
- 239000007762 w/o emulsion Substances 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/28—Phosphorus compounds with one or more P—C bonds
- C07F9/38—Phosphonic acids [RP(=O)(OH)2]; Thiophosphonic acids ; [RP(=X1)(X2H)2(X1, X2 are each independently O, S or Se)]
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/28—Phosphorus compounds with one or more P—C bonds
- C07F9/38—Phosphonic acids [RP(=O)(OH)2]; Thiophosphonic acids ; [RP(=X1)(X2H)2(X1, X2 are each independently O, S or Se)]
- C07F9/3804—Phosphonic acids [RP(=O)(OH)2]; Thiophosphonic acids ; [RP(=X1)(X2H)2(X1, X2 are each independently O, S or Se)] not used, see subgroups
- C07F9/3839—Polyphosphonic acids
- C07F9/386—Polyphosphonic acids containing hydroxy substituents in the hydrocarbon radicals
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
- A61P3/02—Nutrients, e.g. vitamins, minerals
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
- A61P3/12—Drugs for disorders of the metabolism for electrolyte homeostasis
- A61P3/14—Drugs for disorders of the metabolism for electrolyte homeostasis for calcium homeostasis
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
Landscapes
- Health & Medical Sciences (AREA)
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- General Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Medicinal Chemistry (AREA)
- Veterinary Medicine (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- General Chemical & Material Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Animal Behavior & Ethology (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Public Health (AREA)
- Engineering & Computer Science (AREA)
- Diabetes (AREA)
- Hematology (AREA)
- Obesity (AREA)
- Biochemistry (AREA)
- Molecular Biology (AREA)
- Nutrition Science (AREA)
- Endocrinology (AREA)
- Rheumatology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Medicines Containing Antibodies Or Antigens For Use As Internal Diagnostic Agents (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB848419489A GB8419489D0 (en) | 1984-07-31 | 1984-07-31 | Chemical compounds |
| GB8419489 | 1984-07-31 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| AU4673685A AU4673685A (en) | 1986-02-25 |
| AU583848B2 true AU583848B2 (en) | 1989-05-11 |
Family
ID=10564711
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AU46736/85A Ceased AU583848B2 (en) | 1984-07-31 | 1985-07-25 | Derivatives of methylene-bisphosphonic acid |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US4732998A (esLanguage) |
| EP (1) | EP0191044B1 (esLanguage) |
| JP (1) | JPH068303B2 (esLanguage) |
| KR (1) | KR860700254A (esLanguage) |
| AU (1) | AU583848B2 (esLanguage) |
| DE (1) | DE3575929D1 (esLanguage) |
| DK (1) | DK167808B1 (esLanguage) |
| ES (1) | ES8707964A1 (esLanguage) |
| FI (1) | FI861357A7 (esLanguage) |
| GB (1) | GB8419489D0 (esLanguage) |
| GR (1) | GR851865B (esLanguage) |
| IE (1) | IE58614B1 (esLanguage) |
| PT (1) | PT80886B (esLanguage) |
| WO (1) | WO1986000902A1 (esLanguage) |
| ZA (1) | ZA855264B (esLanguage) |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3805663A1 (de) * | 1988-02-24 | 1989-09-07 | Henkel Kgaa | Oxaalkanpolyphosphonsaeuren, ihre verwendung als thresholder sowie diese verbindungen enthaltende, komplexierend wirkende zusammensetzungen |
| DE3822650A1 (de) * | 1988-07-05 | 1990-02-01 | Boehringer Mannheim Gmbh | Neue diphosphonsaeurederivate, verfahren zu deren herstellung und diese verbindungen enthaltende arzneimittel |
| US5266722A (en) * | 1988-11-09 | 1993-11-30 | W. R. Grace & Co.-Conn. | Polyether bis-phosphonic acid compounds |
| PH26923A (en) * | 1989-03-08 | 1992-12-03 | Ciba Geigy | N-substituted amino alkanediphosphonic acids |
| FI83421C (fi) * | 1989-06-21 | 1991-07-10 | Huhtamaeki Oy | Foerfarande foer framstaellning av farmakologiskt anvaendbara metylenbisfosfonsyraderivat. |
| US5227506A (en) * | 1989-09-06 | 1993-07-13 | Merck & Co., Inc. | Acyloxymethyl esters of bisphosphonic acids as bone resorption inhibitors |
| EP0416689B1 (en) * | 1989-09-06 | 1995-11-29 | Merck & Co. Inc. | Acyloxymethyl esters of bisphosphonic acids as bone resorption inhibitors |
| GB9024345D0 (en) * | 1990-11-08 | 1990-12-19 | Merck Sharp & Dohme | Therapeutic agents |
| JP3141053B2 (ja) * | 1991-12-26 | 2001-03-05 | アベンティス ファーマ株式会社 | ビスホスホン酸誘導体 |
| US5200554A (en) * | 1992-01-21 | 1993-04-06 | Nasman Jan Anders H | Bisphosphonic acid derivatives and their use |
| EP0603401B1 (en) * | 1992-07-10 | 2001-04-11 | Toray Industries, Inc. | Methanediphosphonate derivative, production thereof, and pharmaceutical use thereof |
| FR2703590B1 (fr) * | 1993-04-05 | 1995-06-30 | Sanofi Elf | Utilisation de derives d'acide bisphosphonique pour la preparation de medicaments destines a favoriser la reparation osseuse . |
| US20010007863A1 (en) * | 1998-06-18 | 2001-07-12 | Merck & Co., Inc. | Wet granulation formulation for bisphosphonic acids |
| US6315566B1 (en) | 1999-05-18 | 2001-11-13 | 3M Innovative Properties Company | Dental materials |
| US6143919A (en) * | 1999-05-18 | 2000-11-07 | 3M Innovative Properties Company | Polymerizable acidic compounds and methods of preparation |
| AU2002337862A1 (en) * | 2001-10-18 | 2003-04-28 | Ilex Products, Inc. | Methods of treating skin with diphosphonate derivatives |
| DE102004032781A1 (de) * | 2004-01-23 | 2005-08-11 | Mcs Micro Carrier Systems Gmbh | Bisphosphonsäurederivate |
| JP2006028024A (ja) * | 2004-07-12 | 2006-02-02 | Toray Ind Inc | リン含有有機化合物の製造方法。 |
| EP2289900A1 (en) * | 2009-08-26 | 2011-03-02 | Humboldt Universität zu Berlin | Bisphosphonates as inhibitors of acid sphingomyelinase |
| JP6226974B2 (ja) * | 2012-07-05 | 2017-11-08 | ユニバーシティー オブ アイオワ リサーチ ファウンデーション | 治療用ビスホスホネート |
| EP3420037B1 (fr) * | 2016-02-22 | 2022-09-07 | Surfactis Technologies | Compositions a base de composes bisphosphoniques dissous dans un solvant fluore ainsi que leur utilisation pour recouvrir la surface d'une piece |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3400131A (en) * | 1964-03-05 | 1968-09-03 | Hoffmann La Roche | 1, 3-di (4-pyridyl)-2-propanol derivatives |
| GB1160640A (en) * | 1966-12-29 | 1969-08-06 | Procter & Gamble | Stannous Phosphonates and their use in Oral Compositions for Caries Prophyaxis |
| GB2118042A (en) * | 1982-04-15 | 1983-10-26 | Gentili Ist Spa | Pharmaceutical compositions containing biphosphonic acids |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA777769A (en) * | 1963-03-18 | 1968-02-06 | H. Roy Clarence | Substituted methylene diphosphonic acid compounds and detergent compositions |
| GB1115044A (en) * | 1964-08-06 | 1968-05-22 | Albright & Wilson Mfg Ltd | Derivatives of hydroxy diphosphonic acids |
| US3400151A (en) * | 1967-12-28 | 1968-09-03 | Procter & Gamble | Bicyclic dimer of ethane-1-hydroxy-1, 1-diphosphonic acid and salts thereof |
| US4014959A (en) | 1975-04-24 | 1977-03-29 | Monsanto Company | Phosphonoether carboxylates |
| SU772152A1 (ru) * | 1977-07-20 | 1983-02-15 | Центральный научно-исследовательский институт оловянной промышленности | 1-Алкоксиалкилиден-1,1-дифосфоновые кислоты или их калиевые,натриевые или аммониевые соли в качестве собирателей дл флотации касситерита и способ их получени |
-
1984
- 1984-07-31 GB GB848419489A patent/GB8419489D0/en active Pending
-
1985
- 1985-07-08 IE IE171785A patent/IE58614B1/en not_active IP Right Cessation
- 1985-07-12 ZA ZA855264A patent/ZA855264B/xx unknown
- 1985-07-25 DE DE8585903807T patent/DE3575929D1/de not_active Expired - Lifetime
- 1985-07-25 US US06/852,248 patent/US4732998A/en not_active Expired - Fee Related
- 1985-07-25 AU AU46736/85A patent/AU583848B2/en not_active Ceased
- 1985-07-25 EP EP85903807A patent/EP0191044B1/en not_active Expired - Lifetime
- 1985-07-25 WO PCT/DK1985/000071 patent/WO1986000902A1/en not_active Ceased
- 1985-07-25 JP JP60503564A patent/JPH068303B2/ja not_active Expired - Lifetime
- 1985-07-25 KR KR1019860700180A patent/KR860700254A/ko not_active Withdrawn
- 1985-07-29 GR GR851865A patent/GR851865B/el unknown
- 1985-07-30 PT PT80886A patent/PT80886B/pt not_active IP Right Cessation
- 1985-07-31 ES ES545783A patent/ES8707964A1/es not_active Expired
-
1986
- 1986-03-27 FI FI861357A patent/FI861357A7/fi not_active Application Discontinuation
- 1986-04-01 DK DK147386A patent/DK167808B1/da not_active IP Right Cessation
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3400131A (en) * | 1964-03-05 | 1968-09-03 | Hoffmann La Roche | 1, 3-di (4-pyridyl)-2-propanol derivatives |
| GB1160640A (en) * | 1966-12-29 | 1969-08-06 | Procter & Gamble | Stannous Phosphonates and their use in Oral Compositions for Caries Prophyaxis |
| GB2118042A (en) * | 1982-04-15 | 1983-10-26 | Gentili Ist Spa | Pharmaceutical compositions containing biphosphonic acids |
Also Published As
| Publication number | Publication date |
|---|---|
| ZA855264B (en) | 1986-03-26 |
| FI861357A0 (fi) | 1986-03-27 |
| GB8419489D0 (en) | 1984-09-05 |
| GR851865B (esLanguage) | 1985-12-02 |
| DK167808B1 (da) | 1993-12-20 |
| IE58614B1 (en) | 1993-10-20 |
| IE851717L (en) | 1986-01-31 |
| DK147386D0 (da) | 1986-04-01 |
| EP0191044B1 (en) | 1990-02-07 |
| KR860700254A (ko) | 1986-08-01 |
| DK147386A (da) | 1986-04-01 |
| ES8707964A1 (es) | 1987-09-01 |
| AU4673685A (en) | 1986-02-25 |
| DE3575929D1 (de) | 1990-03-15 |
| PT80886A (en) | 1985-08-01 |
| US4732998A (en) | 1988-03-22 |
| ES545783A0 (es) | 1987-09-01 |
| JPS61503034A (ja) | 1986-12-25 |
| PT80886B (pt) | 1987-11-30 |
| FI861357A7 (fi) | 1986-03-27 |
| EP0191044A1 (en) | 1986-08-20 |
| WO1986000902A1 (en) | 1986-02-13 |
| JPH068303B2 (ja) | 1994-02-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU583848B2 (en) | Derivatives of methylene-bisphosphonic acid | |
| KR910000726B1 (ko) | 메틸렌-디포스폰산 유도체의 제조방법 | |
| US4942157A (en) | 1-hydroxy-3-(N-methyl-N-propylamino)propane-1,1-diphosphonic acid, pharmaceutical compositions and methods of use | |
| EP0248854B1 (en) | Novel bisphosphonic derivatives, a method for their production and a pharmaceutical composition | |
| JP2701952B2 (ja) | N‐複素環プロピリデン‐1,1‐ビスホスホン酸、その製法および薬剤組成物 | |
| EP0570380B1 (en) | Novel methylenebisphosphonic acid derivatives | |
| EP0563107A1 (en) | Novel methylenebisphosphonic acid derivatives | |
| AU665342B2 (en) | Novel methylenebisphosphonic acid derivatives | |
| HUT56376A (en) | Process for producing methylenediphosphonic acid derivatives and inflammation inhibitiors comprising same as active ingredient | |
| RU2124519C1 (ru) | Производные гуанидиналкил-1,1-бис-фосфоновой кислоты, способ их получения, лекарственное средство и способ его получения | |
| EP0016310B1 (en) | Monophosphonate compounds, process for their preparation and pharmaceutical compositions containing them | |
| RU2074860C1 (ru) | Производные метиленбисфосфоновой кислоты | |
| KR100246809B1 (ko) | 비고리형 아미딘기 함유 디포스폰산유도체, 이들의 제조방법 및 이들을 포함하는 의약조성물 | |
| Mansfield | The synthesis of novel agents which inhibit tumour-stimulated bone resorption |