AU2002351918B2 - Indole-2-carboxamides as factor Xa inhibitors - Google Patents
Indole-2-carboxamides as factor Xa inhibitors Download PDFInfo
- Publication number
- AU2002351918B2 AU2002351918B2 AU2002351918A AU2002351918A AU2002351918B2 AU 2002351918 B2 AU2002351918 B2 AU 2002351918B2 AU 2002351918 A AU2002351918 A AU 2002351918A AU 2002351918 A AU2002351918 A AU 2002351918A AU 2002351918 B2 AU2002351918 B2 AU 2002351918B2
- Authority
- AU
- Australia
- Prior art keywords
- indole
- piperidin
- isopropyl
- isoxazol
- amide
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- VFHUJFBEFDVZPJ-UHFFFAOYSA-N 1h-indole-2-carboxamide Chemical class C1=CC=C2NC(C(=O)N)=CC2=C1 VFHUJFBEFDVZPJ-UHFFFAOYSA-N 0.000 title 1
- 229940123583 Factor Xa inhibitor Drugs 0.000 title 1
- 239000002253 acid Substances 0.000 claims description 341
- 150000001875 compounds Chemical class 0.000 claims description 316
- -1 phenylpyridyl Chemical group 0.000 claims description 281
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 219
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 162
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 claims description 126
- HCUARRIEZVDMPT-UHFFFAOYSA-N Indole-2-carboxylic acid Chemical compound C1=CC=C2NC(C(=O)O)=CC2=C1 HCUARRIEZVDMPT-UHFFFAOYSA-N 0.000 claims description 112
- 125000001072 heteroaryl group Chemical group 0.000 claims description 93
- 239000000203 mixture Substances 0.000 claims description 92
- 238000000034 method Methods 0.000 claims description 89
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 88
- 125000000217 alkyl group Chemical group 0.000 claims description 83
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 77
- 150000002367 halogens Chemical class 0.000 claims description 74
- ZRQQXFMGYSOKDF-UHFFFAOYSA-N 1-propan-2-ylpiperidin-4-amine Chemical compound CC(C)N1CCC(N)CC1 ZRQQXFMGYSOKDF-UHFFFAOYSA-N 0.000 claims description 73
- 229910052736 halogen Inorganic materials 0.000 claims description 73
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Substances CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 72
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 64
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 61
- 125000002950 monocyclic group Chemical group 0.000 claims description 61
- 125000004122 cyclic group Chemical group 0.000 claims description 59
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 claims description 57
- 229910052757 nitrogen Inorganic materials 0.000 claims description 53
- 125000003118 aryl group Chemical group 0.000 claims description 52
- 150000003839 salts Chemical class 0.000 claims description 46
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 claims description 45
- 125000002619 bicyclic group Chemical group 0.000 claims description 45
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 claims description 44
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 35
- 108010074860 Factor Xa Proteins 0.000 claims description 34
- 125000005842 heteroatom Chemical group 0.000 claims description 34
- 230000015572 biosynthetic process Effects 0.000 claims description 33
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 30
- 238000002360 preparation method Methods 0.000 claims description 30
- 229910052717 sulfur Inorganic materials 0.000 claims description 30
- 239000011593 sulfur Substances 0.000 claims description 30
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 29
- 229910052760 oxygen Inorganic materials 0.000 claims description 29
- 239000001301 oxygen Substances 0.000 claims description 29
- 239000000460 chlorine Substances 0.000 claims description 27
- 125000001041 indolyl group Chemical group 0.000 claims description 27
- 150000002148 esters Chemical class 0.000 claims description 26
- 125000004076 pyridyl group Chemical group 0.000 claims description 25
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 claims description 24
- 150000001408 amides Chemical class 0.000 claims description 24
- CTAPFRYPJLPFDF-UHFFFAOYSA-N isoxazole Chemical compound C=1C=NOC=1 CTAPFRYPJLPFDF-UHFFFAOYSA-N 0.000 claims description 22
- 229920006395 saturated elastomer Polymers 0.000 claims description 22
- 125000000623 heterocyclic group Chemical group 0.000 claims description 21
- 150000003536 tetrazoles Chemical class 0.000 claims description 21
- 125000001544 thienyl group Chemical group 0.000 claims description 21
- 230000005764 inhibitory process Effects 0.000 claims description 20
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 claims description 19
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 claims description 19
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 claims description 19
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 19
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 19
- KYQCOXFCLRTKLS-UHFFFAOYSA-N Pyrazine Chemical compound C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 claims description 18
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 claims description 18
- 125000000842 isoxazolyl group Chemical group 0.000 claims description 18
- 125000003226 pyrazolyl group Chemical group 0.000 claims description 18
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 claims description 17
- 125000002883 imidazolyl group Chemical group 0.000 claims description 17
- 125000003373 pyrazinyl group Chemical group 0.000 claims description 17
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 17
- YNPNZTXNASCQKK-UHFFFAOYSA-N Phenanthrene Natural products C1=CC=C2C3=CC=CC=C3C=CC2=C1 YNPNZTXNASCQKK-UHFFFAOYSA-N 0.000 claims description 16
- DGEZNRSVGBDHLK-UHFFFAOYSA-N [1,10]phenanthroline Chemical compound C1=CN=C2C3=NC=CC=C3C=CC2=C1 DGEZNRSVGBDHLK-UHFFFAOYSA-N 0.000 claims description 16
- 125000002098 pyridazinyl group Chemical group 0.000 claims description 16
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 16
- 125000000168 pyrrolyl group Chemical group 0.000 claims description 16
- FYADHXFMURLYQI-UHFFFAOYSA-N 1,2,4-triazine Chemical compound C1=CN=NC=N1 FYADHXFMURLYQI-UHFFFAOYSA-N 0.000 claims description 15
- CIISBYKBBMFLEZ-UHFFFAOYSA-N 1,2-oxazolidine Chemical compound C1CNOC1 CIISBYKBBMFLEZ-UHFFFAOYSA-N 0.000 claims description 15
- JIHQDMXYYFUGFV-UHFFFAOYSA-N 1,3,5-triazine Chemical compound C1=NC=NC=N1 JIHQDMXYYFUGFV-UHFFFAOYSA-N 0.000 claims description 15
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 claims description 15
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 claims description 15
- 125000001397 3-pyrrolyl group Chemical group [H]N1C([H])=C([*])C([H])=C1[H] 0.000 claims description 15
- WEQPBCSPRXFQQS-UHFFFAOYSA-N 4,5-dihydro-1,2-oxazole Chemical compound C1CC=NO1 WEQPBCSPRXFQQS-UHFFFAOYSA-N 0.000 claims description 15
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 claims description 15
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical compound C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims description 15
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical compound C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 claims description 15
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 claims description 15
- 208000007536 Thrombosis Diseases 0.000 claims description 15
- 125000004432 carbon atom Chemical group C* 0.000 claims description 15
- 125000000524 functional group Chemical group 0.000 claims description 15
- ZLTPDFXIESTBQG-UHFFFAOYSA-N isothiazole Chemical compound C=1C=NSC=1 ZLTPDFXIESTBQG-UHFFFAOYSA-N 0.000 claims description 15
- 125000000335 thiazolyl group Chemical group 0.000 claims description 15
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 14
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical compound C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 claims description 14
- RJCRRLMFYIXJAH-UHFFFAOYSA-N 1-[[5-(5-chlorothiophen-2-yl)-1,2-oxazol-3-yl]methyl]indole-2-carboxylic acid Chemical compound OC(=O)C1=CC2=CC=CC=C2N1CC(=NO1)C=C1C1=CC=C(Cl)S1 RJCRRLMFYIXJAH-UHFFFAOYSA-N 0.000 claims description 14
- 125000000389 2-pyrrolyl group Chemical group [H]N1C([*])=C([H])C([H])=C1[H] 0.000 claims description 14
- MSRJJSCOWHWGGX-UHFFFAOYSA-N 2h-1,3-diazepine Chemical compound C1N=CC=CC=N1 MSRJJSCOWHWGGX-UHFFFAOYSA-N 0.000 claims description 14
- 125000003682 3-furyl group Chemical group O1C([H])=C([*])C([H])=C1[H] 0.000 claims description 14
- DPOPAJRDYZGTIR-UHFFFAOYSA-N Tetrazine Chemical compound C1=CN=NN=N1 DPOPAJRDYZGTIR-UHFFFAOYSA-N 0.000 claims description 14
- 229910052794 bromium Inorganic materials 0.000 claims description 14
- 229910052739 hydrogen Inorganic materials 0.000 claims description 14
- 125000002971 oxazolyl group Chemical group 0.000 claims description 14
- IWELDVXSEVIIGI-UHFFFAOYSA-N piperazin-2-one Chemical compound O=C1CNCCN1 IWELDVXSEVIIGI-UHFFFAOYSA-N 0.000 claims description 14
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical compound O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 claims description 14
- BRNULMACUQOKMR-UHFFFAOYSA-N thiomorpholine Chemical compound C1CSCCN1 BRNULMACUQOKMR-UHFFFAOYSA-N 0.000 claims description 14
- 241001024304 Mino Species 0.000 claims description 13
- 230000023555 blood coagulation Effects 0.000 claims description 13
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 13
- 125000002541 furyl group Chemical group 0.000 claims description 13
- 125000003831 tetrazolyl group Chemical group 0.000 claims description 13
- 238000002560 therapeutic procedure Methods 0.000 claims description 13
- POXWDTQUDZUOGP-UHFFFAOYSA-N 1h-1,4-diazepine Chemical compound N1C=CC=NC=C1 POXWDTQUDZUOGP-UHFFFAOYSA-N 0.000 claims description 12
- NSPMIYGKQJPBQR-UHFFFAOYSA-N 4H-1,2,4-triazole Chemical compound C=1N=CNN=1 NSPMIYGKQJPBQR-UHFFFAOYSA-N 0.000 claims description 12
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 12
- XYOVOXDWRFGKEX-UHFFFAOYSA-N azepine Chemical compound N1C=CC=CC=C1 XYOVOXDWRFGKEX-UHFFFAOYSA-N 0.000 claims description 12
- 239000003814 drug Substances 0.000 claims description 12
- 239000000825 pharmaceutical preparation Substances 0.000 claims description 12
- 125000001425 triazolyl group Chemical group 0.000 claims description 12
- LRANPJDWHYRCER-UHFFFAOYSA-N 1,2-diazepine Chemical compound N1C=CC=CC=N1 LRANPJDWHYRCER-UHFFFAOYSA-N 0.000 claims description 11
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims description 11
- 229910052799 carbon Inorganic materials 0.000 claims description 11
- 229910052801 chlorine Inorganic materials 0.000 claims description 11
- 239000001257 hydrogen Substances 0.000 claims description 11
- WSFSSNUMVMOOMR-BJUDXGSMSA-N methanone Chemical compound O=[11CH2] WSFSSNUMVMOOMR-BJUDXGSMSA-N 0.000 claims description 11
- DLFVBJFMPXGRIB-UHFFFAOYSA-N thioacetamide Natural products CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 claims description 11
- 230000002792 vascular Effects 0.000 claims description 11
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 claims description 10
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 claims description 10
- 239000003146 anticoagulant agent Substances 0.000 claims description 10
- 229910052731 fluorine Inorganic materials 0.000 claims description 10
- 125000000904 isoindolyl group Chemical group C=1(NC=C2C=CC=CC12)* 0.000 claims description 10
- 125000001786 isothiazolyl group Chemical group 0.000 claims description 10
- 125000004592 phthalazinyl group Chemical group C1(=NN=CC2=CC=CC=C12)* 0.000 claims description 10
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 claims description 10
- 125000001567 quinoxalinyl group Chemical group N1=C(C=NC2=CC=CC=C12)* 0.000 claims description 10
- VLLMWSRANPNYQX-UHFFFAOYSA-N thiadiazole Chemical compound C1=CSN=N1.C1=CSN=N1 VLLMWSRANPNYQX-UHFFFAOYSA-N 0.000 claims description 10
- 125000001113 thiadiazolyl group Chemical group 0.000 claims description 10
- QWENRTYMTSOGBR-UHFFFAOYSA-N 1H-1,2,3-Triazole Chemical compound C=1C=NNN=1 QWENRTYMTSOGBR-UHFFFAOYSA-N 0.000 claims description 9
- PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Natural products C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 claims description 9
- 208000001435 Thromboembolism Diseases 0.000 claims description 9
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 9
- SJGALSBBFTYSBA-UHFFFAOYSA-N oxaziridine Chemical compound C1NO1 SJGALSBBFTYSBA-UHFFFAOYSA-N 0.000 claims description 9
- 239000002243 precursor Substances 0.000 claims description 9
- 208000037803 restenosis Diseases 0.000 claims description 9
- 125000006565 (C4-C7) cyclic group Chemical group 0.000 claims description 8
- XUKZYTNPGQPSGF-UHFFFAOYSA-N 1-(3-chlorophenyl)indole-2-carboxylic acid Chemical compound OC(=O)C1=CC2=CC=CC=C2N1C1=CC=CC(Cl)=C1 XUKZYTNPGQPSGF-UHFFFAOYSA-N 0.000 claims description 8
- HONIICLYMWZJFZ-UHFFFAOYSA-N azetidine Chemical compound C1CNC1 HONIICLYMWZJFZ-UHFFFAOYSA-N 0.000 claims description 8
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 claims description 8
- AWJUIBRHMBBTKR-UHFFFAOYSA-N isoquinoline Chemical compound C1=NC=CC2=CC=CC=C21 AWJUIBRHMBBTKR-UHFFFAOYSA-N 0.000 claims description 8
- 125000005956 isoquinolyl group Chemical group 0.000 claims description 8
- 125000005494 pyridonyl group Chemical group 0.000 claims description 8
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 claims description 8
- 125000005493 quinolyl group Chemical group 0.000 claims description 8
- 238000001356 surgical procedure Methods 0.000 claims description 8
- IBBLKSWSCDAPIF-UHFFFAOYSA-N thiopyran Chemical compound S1C=CC=C=C1 IBBLKSWSCDAPIF-UHFFFAOYSA-N 0.000 claims description 8
- NBNWLLXCAIOATK-UHFFFAOYSA-N 1-[(3-methoxyphenyl)methyl]indole-2-carboxylic acid Chemical compound COC1=CC=CC(CN2C3=CC=CC=C3C=C2C(O)=O)=C1 NBNWLLXCAIOATK-UHFFFAOYSA-N 0.000 claims description 7
- 230000001154 acute effect Effects 0.000 claims description 7
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 claims description 7
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 claims description 7
- 229910052740 iodine Inorganic materials 0.000 claims description 7
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 claims description 7
- 230000008569 process Effects 0.000 claims description 7
- PBMFSQRYOILNGV-UHFFFAOYSA-N pyridazine Chemical compound C1=CC=NN=C1 PBMFSQRYOILNGV-UHFFFAOYSA-N 0.000 claims description 7
- 125000000719 pyrrolidinyl group Chemical group 0.000 claims description 7
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 7
- UFETTXCVHFVMPU-UHFFFAOYSA-N 1-ethylpiperidin-4-amine Chemical compound CCN1CCC(N)CC1 UFETTXCVHFVMPU-UHFFFAOYSA-N 0.000 claims description 6
- 125000004206 2,2,2-trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 claims description 6
- 208000024172 Cardiovascular disease Diseases 0.000 claims description 6
- 125000004429 atom Chemical group 0.000 claims description 6
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 claims description 6
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 claims description 6
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 claims description 6
- 125000002843 carboxylic acid group Chemical group 0.000 claims description 6
- 125000003016 chromanyl group Chemical group O1C(CCC2=CC=CC=C12)* 0.000 claims description 6
- 125000000259 cinnolinyl group Chemical group N1=NC(=CC2=CC=CC=C12)* 0.000 claims description 6
- 125000004494 ethyl ester group Chemical group 0.000 claims description 6
- 125000003384 isochromanyl group Chemical group C1(OCCC2=CC=CC=C12)* 0.000 claims description 6
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 6
- 125000003386 piperidinyl group Chemical group 0.000 claims description 6
- 210000003462 vein Anatomy 0.000 claims description 6
- KDMMRRCLTYHTRA-UHFFFAOYSA-N 1-[(2-chlorophenyl)methyl]indole-2-carboxylic acid Chemical compound OC(=O)C1=CC2=CC=CC=C2N1CC1=CC=CC=C1Cl KDMMRRCLTYHTRA-UHFFFAOYSA-N 0.000 claims description 5
- 125000004066 1-hydroxyethyl group Chemical group [H]OC([H])([*])C([H])([H])[H] 0.000 claims description 5
- ZHKJHQBOAJQXQR-UHFFFAOYSA-N 1H-azirine Chemical compound N1C=C1 ZHKJHQBOAJQXQR-UHFFFAOYSA-N 0.000 claims description 5
- JECYNCQXXKQDJN-UHFFFAOYSA-N 2-(2-methylhexan-2-yloxymethyl)oxirane Chemical compound CCCCC(C)(C)OCC1CO1 JECYNCQXXKQDJN-UHFFFAOYSA-N 0.000 claims description 5
- MGADZUXDNSDTHW-UHFFFAOYSA-N 2H-pyran Chemical compound C1OC=CC=C1 MGADZUXDNSDTHW-UHFFFAOYSA-N 0.000 claims description 5
- KGWNRZLPXLBMPS-UHFFFAOYSA-N 2h-1,3-oxazine Chemical compound C1OC=CC=N1 KGWNRZLPXLBMPS-UHFFFAOYSA-N 0.000 claims description 5
- NTYABNDBNKVWOO-UHFFFAOYSA-N 2h-1,3-thiazine Chemical compound C1SC=CC=N1 NTYABNDBNKVWOO-UHFFFAOYSA-N 0.000 claims description 5
- YHWMFDLNZGIJSD-UHFFFAOYSA-N 2h-1,4-oxazine Chemical compound C1OC=CN=C1 YHWMFDLNZGIJSD-UHFFFAOYSA-N 0.000 claims description 5
- ZAISDHPZTZIFQF-UHFFFAOYSA-N 2h-1,4-thiazine Chemical compound C1SC=CN=C1 ZAISDHPZTZIFQF-UHFFFAOYSA-N 0.000 claims description 5
- BCHZICNRHXRCHY-UHFFFAOYSA-N 2h-oxazine Chemical compound N1OC=CC=C1 BCHZICNRHXRCHY-UHFFFAOYSA-N 0.000 claims description 5
- AGIJRRREJXSQJR-UHFFFAOYSA-N 2h-thiazine Chemical compound N1SC=CC=C1 AGIJRRREJXSQJR-UHFFFAOYSA-N 0.000 claims description 5
- XKTYXVDYIKIYJP-UHFFFAOYSA-N 3h-dioxole Chemical compound C1OOC=C1 XKTYXVDYIKIYJP-UHFFFAOYSA-N 0.000 claims description 5
- GUUULVAMQJLDSY-UHFFFAOYSA-N 4,5-dihydro-1,2-thiazole Chemical compound C1CC=NS1 GUUULVAMQJLDSY-UHFFFAOYSA-N 0.000 claims description 5
- NOWKCMXCCJGMRR-UHFFFAOYSA-N Aziridine Chemical compound C1CN1 NOWKCMXCCJGMRR-UHFFFAOYSA-N 0.000 claims description 5
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 claims description 5
- 206010040070 Septic Shock Diseases 0.000 claims description 5
- JZFICWYCTCCINF-UHFFFAOYSA-N Thiadiazin Chemical compound S=C1SC(C)NC(C)N1CCN1C(=S)SC(C)NC1C JZFICWYCTCCINF-UHFFFAOYSA-N 0.000 claims description 5
- 238000002399 angioplasty Methods 0.000 claims description 5
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 5
- 230000015271 coagulation Effects 0.000 claims description 5
- 238000005345 coagulation Methods 0.000 claims description 5
- 230000020764 fibrinolysis Effects 0.000 claims description 5
- 238000004519 manufacturing process Methods 0.000 claims description 5
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 claims description 5
- OOFGXDQWDNJDIS-UHFFFAOYSA-N oxathiolane Chemical compound C1COSC1 OOFGXDQWDNJDIS-UHFFFAOYSA-N 0.000 claims description 5
- 125000003538 pentan-3-yl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 claims description 5
- 125000001042 pteridinyl group Chemical group N1=C(N=CC2=NC=CN=C12)* 0.000 claims description 5
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 claims description 5
- 230000036303 septic shock Effects 0.000 claims description 5
- 229930192474 thiophene Natural products 0.000 claims description 5
- 230000002537 thrombolytic effect Effects 0.000 claims description 5
- CZSRXHJVZUBEGW-UHFFFAOYSA-N 1,2-thiazolidine Chemical compound C1CNSC1 CZSRXHJVZUBEGW-UHFFFAOYSA-N 0.000 claims description 4
- 125000005871 1,3-benzodioxolyl group Chemical group 0.000 claims description 4
- ABADUMLIAZCWJD-UHFFFAOYSA-N 1,3-dioxole Chemical compound C1OC=CO1 ABADUMLIAZCWJD-UHFFFAOYSA-N 0.000 claims description 4
- KBXWLAQHWUNMMX-UHFFFAOYSA-N 1-(4-methoxyphenyl)indole-2-carboxylic acid Chemical compound C1=CC(OC)=CC=C1N1C2=CC=CC=C2C=C1C(O)=O KBXWLAQHWUNMMX-UHFFFAOYSA-N 0.000 claims description 4
- FCEHBMOGCRZNNI-UHFFFAOYSA-N 1-benzothiophene Chemical compound C1=CC=C2SC=CC2=C1 FCEHBMOGCRZNNI-UHFFFAOYSA-N 0.000 claims description 4
- ZROILLPDIUNLSE-UHFFFAOYSA-N 1-phenyl-1h-pyrazole-4-carboxylic acid Chemical compound C1=C(C(=O)O)C=NN1C1=CC=CC=C1 ZROILLPDIUNLSE-UHFFFAOYSA-N 0.000 claims description 4
- FUJSJWRORKKPAI-UHFFFAOYSA-N 2-(2,4-dichlorophenoxy)acetyl chloride Chemical compound ClC(=O)COC1=CC=C(Cl)C=C1Cl FUJSJWRORKKPAI-UHFFFAOYSA-N 0.000 claims description 4
- 125000004008 6 membered carbocyclic group Chemical group 0.000 claims description 4
- 206010002388 Angina unstable Diseases 0.000 claims description 4
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 4
- 239000005977 Ethylene Substances 0.000 claims description 4
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims description 4
- 208000007814 Unstable Angina Diseases 0.000 claims description 4
- 230000002159 abnormal effect Effects 0.000 claims description 4
- 201000004332 intermediate coronary syndrome Diseases 0.000 claims description 4
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims description 4
- 208000010125 myocardial infarction Diseases 0.000 claims description 4
- JWVCLYRUEFBMGU-UHFFFAOYSA-N quinazoline Chemical compound N1=CN=CC2=CC=CC=C21 JWVCLYRUEFBMGU-UHFFFAOYSA-N 0.000 claims description 4
- 125000001412 tetrahydropyranyl group Chemical group 0.000 claims description 4
- JGJGATZSBDRWIU-UHFFFAOYSA-N 1-(3-methoxyphenyl)indole-2-carboxylic acid Chemical compound COC1=CC=CC(N2C3=CC=CC=C3C=C2C(O)=O)=C1 JGJGATZSBDRWIU-UHFFFAOYSA-N 0.000 claims description 3
- DSBLCMAHBANTAE-UHFFFAOYSA-N 1-[2-(3-methoxyphenyl)ethyl]indole-2-carboxylic acid Chemical compound COC1=CC=CC(CCN2C3=CC=CC=C3C=C2C(O)=O)=C1 DSBLCMAHBANTAE-UHFFFAOYSA-N 0.000 claims description 3
- OSADXNIFBVARHL-UHFFFAOYSA-N 1-[2-(4-chlorophenyl)ethyl]indole-2-carboxylic acid Chemical compound OC(=O)C1=CC2=CC=CC=C2N1CCC1=CC=C(Cl)C=C1 OSADXNIFBVARHL-UHFFFAOYSA-N 0.000 claims description 3
- ZZAVIQXQBBOHBB-UHFFFAOYSA-N 4-methoxy-1h-indole-2-carboxylic acid Chemical compound COC1=CC=CC2=C1C=C(C(O)=O)N2 ZZAVIQXQBBOHBB-UHFFFAOYSA-N 0.000 claims description 3
- KKJUPNGICOCCDW-UHFFFAOYSA-N 7-N,N-Dimethylamino-1,2,3,4,5-pentathiocyclooctane Chemical compound CN(C)C1CSSSSSC1 KKJUPNGICOCCDW-UHFFFAOYSA-N 0.000 claims description 3
- 206010001052 Acute respiratory distress syndrome Diseases 0.000 claims description 3
- 206010002383 Angina Pectoris Diseases 0.000 claims description 3
- 206010053567 Coagulopathies Diseases 0.000 claims description 3
- 208000005189 Embolism Diseases 0.000 claims description 3
- 208000034486 Multi-organ failure Diseases 0.000 claims description 3
- 208000010378 Pulmonary Embolism Diseases 0.000 claims description 3
- 208000013616 Respiratory Distress Syndrome Diseases 0.000 claims description 3
- 208000006011 Stroke Diseases 0.000 claims description 3
- 208000032109 Transient ischaemic attack Diseases 0.000 claims description 3
- 206010047249 Venous thrombosis Diseases 0.000 claims description 3
- 208000036142 Viral infection Diseases 0.000 claims description 3
- 230000003187 abdominal effect Effects 0.000 claims description 3
- 206010000891 acute myocardial infarction Diseases 0.000 claims description 3
- 208000011341 adult acute respiratory distress syndrome Diseases 0.000 claims description 3
- 201000000028 adult respiratory distress syndrome Diseases 0.000 claims description 3
- 238000007887 coronary angioplasty Methods 0.000 claims description 3
- 208000029078 coronary artery disease Diseases 0.000 claims description 3
- 239000003937 drug carrier Substances 0.000 claims description 3
- 210000003127 knee Anatomy 0.000 claims description 3
- 210000003141 lower extremity Anatomy 0.000 claims description 3
- 208000029744 multiple organ dysfunction syndrome Diseases 0.000 claims description 3
- 230000001575 pathological effect Effects 0.000 claims description 3
- 230000009885 systemic effect Effects 0.000 claims description 3
- 201000010875 transient cerebral ischemia Diseases 0.000 claims description 3
- 230000009385 viral infection Effects 0.000 claims description 3
- 125000006272 (C3-C7) cycloalkyl group Chemical group 0.000 claims description 2
- PHYBBHZCDQLDTJ-UHFFFAOYSA-N 1-(3-methoxybenzoyl)indole-2-carboxylic acid Chemical compound COC1=CC=CC(C(=O)N2C3=CC=CC=C3C=C2C(O)=O)=C1 PHYBBHZCDQLDTJ-UHFFFAOYSA-N 0.000 claims description 2
- GQJKDHLNWBITEP-UHFFFAOYSA-N 1-(4-chlorophenyl)indole-2-carboxylic acid Chemical compound OC(=O)C1=CC2=CC=CC=C2N1C1=CC=C(Cl)C=C1 GQJKDHLNWBITEP-UHFFFAOYSA-N 0.000 claims description 2
- UDFMDSBCVQSAMH-UHFFFAOYSA-N 1-[(4-methoxyphenyl)methyl]indole-2-carboxylic acid Chemical compound C1=CC(OC)=CC=C1CN1C2=CC=CC=C2C=C1C(O)=O UDFMDSBCVQSAMH-UHFFFAOYSA-N 0.000 claims description 2
- QOTVVZPQBGZYFT-UHFFFAOYSA-N 1-[2-(4-chlorophenyl)ethyl]-n-(1-propan-2-ylpiperidin-4-yl)indole-2-carboxamide Chemical compound C1CN(C(C)C)CCC1NC(=O)C1=CC2=CC=CC=C2N1CCC1=CC=C(Cl)C=C1 QOTVVZPQBGZYFT-UHFFFAOYSA-N 0.000 claims description 2
- ROIQWUPGZWRPPT-UHFFFAOYSA-N 1-[[4-(trifluoromethoxy)phenyl]methyl]indole-2-carboxylic acid Chemical compound OC(=O)C1=CC2=CC=CC=C2N1CC1=CC=C(OC(F)(F)F)C=C1 ROIQWUPGZWRPPT-UHFFFAOYSA-N 0.000 claims description 2
- ZFCKJGACJXTSOI-UHFFFAOYSA-N 1-[[5-(5-chlorothiophen-2-yl)-1,2-oxazol-3-yl]methyl]-7-methylindole-2-carboxylic acid Chemical compound C1=2C(C)=CC=CC=2C=C(C(O)=O)N1CC(=NO1)C=C1C1=CC=C(Cl)S1 ZFCKJGACJXTSOI-UHFFFAOYSA-N 0.000 claims description 2
- VPUAYOJTHRDUTK-UHFFFAOYSA-N 1-ethylpyrrole Chemical compound CCN1C=CC=C1 VPUAYOJTHRDUTK-UHFFFAOYSA-N 0.000 claims description 2
- RHDYQUZYHZWTCI-UHFFFAOYSA-N 1-methoxy-4-phenylbenzene Chemical compound C1=CC(OC)=CC=C1C1=CC=CC=C1 RHDYQUZYHZWTCI-UHFFFAOYSA-N 0.000 claims description 2
- JQCSUVJDBHJKNG-UHFFFAOYSA-N 1-methoxy-ethyl Chemical group C[CH]OC JQCSUVJDBHJKNG-UHFFFAOYSA-N 0.000 claims description 2
- AHAPEYABSDOBIP-UHFFFAOYSA-N 4-ethylpiperazin-1-amine Chemical compound CCN1CCN(N)CC1 AHAPEYABSDOBIP-UHFFFAOYSA-N 0.000 claims description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 claims description 2
- WEYVCQFUGFRXOM-UHFFFAOYSA-N perazine Chemical compound C1CN(C)CCN1CCCN1C2=CC=CC=C2SC2=CC=CC=C21 WEYVCQFUGFRXOM-UHFFFAOYSA-N 0.000 claims description 2
- 229960002195 perazine Drugs 0.000 claims description 2
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 claims description 2
- NSKGQURZWSPSBC-VVPCINPTSA-N ribostamycin Chemical compound N[C@@H]1[C@@H](O)[C@H](O)[C@@H](CN)O[C@@H]1O[C@H]1[C@H](O[C@H]2[C@@H]([C@H](O)[C@@H](CO)O2)O)[C@@H](O)[C@H](N)C[C@@H]1N NSKGQURZWSPSBC-VVPCINPTSA-N 0.000 claims 5
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 claims 4
- DHXVGJBLRPWPCS-UHFFFAOYSA-N Tetrahydropyran Chemical compound C1CCOCC1 DHXVGJBLRPWPCS-UHFFFAOYSA-N 0.000 claims 4
- KQKQMDNBLKHSEQ-UHFFFAOYSA-N 1-[(4-chlorophenyl)methyl]indole-2-carboxylic acid Chemical compound OC(=O)C1=CC2=CC=CC=C2N1CC1=CC=C(Cl)C=C1 KQKQMDNBLKHSEQ-UHFFFAOYSA-N 0.000 claims 3
- 125000002993 cycloalkylene group Chemical group 0.000 claims 3
- IYCMYOWBZQNVBV-UHFFFAOYSA-N (1-propan-2-ylpiperidin-4-yl)methanamine Chemical compound CC(C)N1CCC(CN)CC1 IYCMYOWBZQNVBV-UHFFFAOYSA-N 0.000 claims 2
- OGZPXUGZOKKVSQ-UHFFFAOYSA-N 1-[(2,4-dichlorophenyl)methyl]indole-2-carboxylic acid Chemical compound OC(=O)C1=CC2=CC=CC=C2N1CC1=CC=C(Cl)C=C1Cl OGZPXUGZOKKVSQ-UHFFFAOYSA-N 0.000 claims 2
- KMIKWLVMFHIYFK-UHFFFAOYSA-N 6-methoxy-1-[(3-methoxyphenyl)methyl]indole-2-carboxylic acid Chemical compound COC1=CC=CC(CN2C3=CC(OC)=CC=C3C=C2C(O)=O)=C1 KMIKWLVMFHIYFK-UHFFFAOYSA-N 0.000 claims 2
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims 1
- PFJWZQPHCQIIKR-UHFFFAOYSA-N 1-(3,5-dichlorophenyl)-n-(1-propan-2-ylpiperidin-4-yl)indole-2-carboxamide Chemical compound C1CN(C(C)C)CCC1NC(=O)C1=CC2=CC=CC=C2N1C1=CC(Cl)=CC(Cl)=C1 PFJWZQPHCQIIKR-UHFFFAOYSA-N 0.000 claims 1
- PLCKSNLLWTWSJC-UHFFFAOYSA-N 1-(3-methoxyphenyl)sulfonylindole-2-carboxylic acid Chemical compound COC1=CC=CC(S(=O)(=O)N2C3=CC=CC=C3C=C2C(O)=O)=C1 PLCKSNLLWTWSJC-UHFFFAOYSA-N 0.000 claims 1
- XYPXJXNGUNXJSO-UHFFFAOYSA-N 1-[(3,5-dichlorophenyl)methyl]-n-(1-propan-2-ylpiperidin-4-yl)indole-2-carboxamide Chemical compound C1CN(C(C)C)CCC1NC(=O)C1=CC2=CC=CC=C2N1CC1=CC(Cl)=CC(Cl)=C1 XYPXJXNGUNXJSO-UHFFFAOYSA-N 0.000 claims 1
- CVPGDWLGSKSTNB-UHFFFAOYSA-N 1-[(3-chlorophenyl)methyl]indole-2-carboxylic acid Chemical compound OC(=O)C1=CC2=CC=CC=C2N1CC1=CC=CC(Cl)=C1 CVPGDWLGSKSTNB-UHFFFAOYSA-N 0.000 claims 1
- MNPACACYUKHVSF-UHFFFAOYSA-N 1-[(3-methoxyphenyl)methyl]-5-methylindole-2-carboxylic acid Chemical compound COC1=CC=CC(CN2C3=CC=C(C)C=C3C=C2C(O)=O)=C1 MNPACACYUKHVSF-UHFFFAOYSA-N 0.000 claims 1
- HQXOIIFKSWQBTG-UHFFFAOYSA-N 1-[(3-methoxyphenyl)methyl]-5-nitroindole-2-carboxylic acid Chemical compound COC1=CC=CC(CN2C3=CC=C(C=C3C=C2C(O)=O)[N+]([O-])=O)=C1 HQXOIIFKSWQBTG-UHFFFAOYSA-N 0.000 claims 1
- BZVBYLVMDFQPPO-UHFFFAOYSA-N 1-[(3-methoxyphenyl)methyl]-5-phenylmethoxyindole-2-carboxylic acid Chemical compound COC1=CC=CC(CN2C3=CC=C(OCC=4C=CC=CC=4)C=C3C=C2C(O)=O)=C1 BZVBYLVMDFQPPO-UHFFFAOYSA-N 0.000 claims 1
- NVNHLHARFHSBHN-UHFFFAOYSA-N 1-[(3-methoxyphenyl)methyl]-n-[(1-pyridin-4-ylpiperidin-4-yl)methyl]indole-2-carboxamide Chemical compound COC1=CC=CC(CN2C3=CC=CC=C3C=C2C(=O)NCC2CCN(CC2)C=2C=CN=CC=2)=C1 NVNHLHARFHSBHN-UHFFFAOYSA-N 0.000 claims 1
- PQDRFBZXRKOETO-UHFFFAOYSA-N 1-[(6-chloro-1-benzothiophen-2-yl)methyl]-n-(1-propan-2-ylpiperidin-4-yl)indole-2-carboxamide Chemical compound C1CN(C(C)C)CCC1NC(=O)C1=CC2=CC=CC=C2N1CC1=CC2=CC=C(Cl)C=C2S1 PQDRFBZXRKOETO-UHFFFAOYSA-N 0.000 claims 1
- TUJRINRCZRSTKI-UHFFFAOYSA-N 1-[2-(4-chloro-2-fluoroanilino)-2-oxoethyl]-n-(1-propan-2-ylpiperidin-4-yl)indole-2-carboxamide Chemical compound C1CN(C(C)C)CCC1NC(=O)C1=CC2=CC=CC=C2N1CC(=O)NC1=CC=C(Cl)C=C1F TUJRINRCZRSTKI-UHFFFAOYSA-N 0.000 claims 1
- ALRWWJBPMNKBTQ-UHFFFAOYSA-N 1-[2-(4-chloroanilino)-2-oxoethyl]-n-(1-cyclopropylpiperidin-4-yl)indole-2-carboxamide Chemical compound C1=CC(Cl)=CC=C1NC(=O)CN1C2=CC=CC=C2C=C1C(=O)NC1CCN(C2CC2)CC1 ALRWWJBPMNKBTQ-UHFFFAOYSA-N 0.000 claims 1
- ILRJJEMRKWAJMZ-UHFFFAOYSA-N 1-[2-[(5-chloropyridin-2-yl)amino]-2-oxoethyl]-n-(1-propan-2-ylpiperidin-4-yl)indole-2-carboxamide Chemical compound C1CN(C(C)C)CCC1NC(=O)C1=CC2=CC=CC=C2N1CC(=O)NC1=CC=C(Cl)C=N1 ILRJJEMRKWAJMZ-UHFFFAOYSA-N 0.000 claims 1
- YEUPDDNYVSLYJV-UHFFFAOYSA-N 1-[[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methyl]-n-(1-propan-2-ylpiperidin-4-yl)indole-2-carboxamide Chemical compound C1CN(C(C)C)CCC1NC(=O)C1=CC2=CC=CC=C2N1CC1=CSC(C=2C=CC(Cl)=CC=2)=N1 YEUPDDNYVSLYJV-UHFFFAOYSA-N 0.000 claims 1
- DPEUKUWEBKRAKG-UHFFFAOYSA-N 1-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]indole-2-carboxylic acid Chemical compound OC(=O)C1=CC2=CC=CC=C2N1CC(ON=1)=NC=1C1=CC=C(Cl)C=C1 DPEUKUWEBKRAKG-UHFFFAOYSA-N 0.000 claims 1
- DXLGGWHFJIUYJD-UHFFFAOYSA-N 1-[[3-(4-chlorophenyl)-1,2-oxazol-5-yl]methyl]indole-2-carboxylic acid Chemical compound OC(=O)C1=CC2=CC=CC=C2N1CC(ON=1)=CC=1C1=CC=C(Cl)C=C1 DXLGGWHFJIUYJD-UHFFFAOYSA-N 0.000 claims 1
- AXCCESLSZJMAOY-UHFFFAOYSA-N 1-[[5-(5-chlorothiophen-2-yl)-1,2-oxazol-3-yl]methyl]-5,6-dimethoxy-n-(1-propan-2-ylpiperidin-4-yl)indole-2-carboxamide Chemical compound C1=C(C=2SC(Cl)=CC=2)ON=C1CN1C=2C=C(OC)C(OC)=CC=2C=C1C(=O)NC1CCN(C(C)C)CC1 AXCCESLSZJMAOY-UHFFFAOYSA-N 0.000 claims 1
- MMGXOGPDBICRQF-UHFFFAOYSA-N 1-[[5-(5-chlorothiophen-2-yl)-1,2-oxazol-3-yl]methyl]-n-(1-propan-2-ylpiperidin-4-yl)indole-2-carboxamide Chemical compound C1CN(C(C)C)CCC1NC(=O)C1=CC2=CC=CC=C2N1CC1=NOC(C=2SC(Cl)=CC=2)=C1 MMGXOGPDBICRQF-UHFFFAOYSA-N 0.000 claims 1
- FPVIIOSXSGECQO-UHFFFAOYSA-N 1-ethylindole-2-carboxylic acid Chemical compound C1=CC=C2N(CC)C(C(O)=O)=CC2=C1 FPVIIOSXSGECQO-UHFFFAOYSA-N 0.000 claims 1
- FLQSRSQNICPZIH-UHFFFAOYSA-N 1-methylsulfonylpiperidin-4-amine Chemical compound CS(=O)(=O)N1CCC(N)CC1 FLQSRSQNICPZIH-UHFFFAOYSA-N 0.000 claims 1
- KNDUGOWIKQAXHL-UHFFFAOYSA-N 1-propan-2-ylpyrrole Chemical compound CC(C)N1C=CC=C1 KNDUGOWIKQAXHL-UHFFFAOYSA-N 0.000 claims 1
- SYMMPPWYYXRLJX-UHFFFAOYSA-N 1-propan-2-ylpyrrolidin-3-amine Chemical compound CC(C)N1CCC(N)C1 SYMMPPWYYXRLJX-UHFFFAOYSA-N 0.000 claims 1
- SNTWKPAKVQFCCF-UHFFFAOYSA-N 2,3-dihydro-1h-triazole Chemical compound N1NC=CN1 SNTWKPAKVQFCCF-UHFFFAOYSA-N 0.000 claims 1
- RYHLFGOYQFFDAG-UHFFFAOYSA-N 4-methoxy-1-[(3-methoxyphenyl)methyl]indole-2-carboxylic acid Chemical compound COC1=CC=CC(CN2C3=CC=CC(OC)=C3C=C2C(O)=O)=C1 RYHLFGOYQFFDAG-UHFFFAOYSA-N 0.000 claims 1
- BPVHVSBGCPABIQ-UHFFFAOYSA-N 5-chloro-1-[2-[(5-chloropyridin-2-yl)amino]-2-oxoethyl]-n-(1-propan-2-ylpiperidin-4-yl)indole-2-carboxamide Chemical compound C1CN(C(C)C)CCC1NC(=O)C1=CC2=CC(Cl)=CC=C2N1CC(=O)NC1=CC=C(Cl)C=N1 BPVHVSBGCPABIQ-UHFFFAOYSA-N 0.000 claims 1
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 claims 1
- 102100039619 Granulocyte colony-stimulating factor Human genes 0.000 claims 1
- 101000746367 Homo sapiens Granulocyte colony-stimulating factor Proteins 0.000 claims 1
- 241001293945 Pyla Species 0.000 claims 1
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 claims 1
- AXLOCHLTNQDFFS-BESJYZOMSA-N azastene Chemical compound C([C@H]1[C@@H]2CC[C@@]([C@]2(CC[C@@H]1[C@@]1(C)C2)C)(O)C)C=C1C(C)(C)C1=C2C=NO1 AXLOCHLTNQDFFS-BESJYZOMSA-N 0.000 claims 1
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 claims 1
- UZUODNWWWUQRIR-UHFFFAOYSA-L disodium;3-aminonaphthalene-1,5-disulfonate Chemical compound [Na+].[Na+].C1=CC=C(S([O-])(=O)=O)C2=CC(N)=CC(S([O-])(=O)=O)=C21 UZUODNWWWUQRIR-UHFFFAOYSA-L 0.000 claims 1
- PSGAAPLEWMOORI-PEINSRQWSA-N medroxyprogesterone acetate Chemical compound C([C@@]12C)CC(=O)C=C1[C@@H](C)C[C@@H]1[C@@H]2CC[C@]2(C)[C@@](OC(C)=O)(C(C)=O)CC[C@H]21 PSGAAPLEWMOORI-PEINSRQWSA-N 0.000 claims 1
- MYWUZJCMWCOHBA-VIFPVBQESA-N methamphetamine Chemical compound CN[C@@H](C)CC1=CC=CC=C1 MYWUZJCMWCOHBA-VIFPVBQESA-N 0.000 claims 1
- MIJCTFQIMWKOJZ-UHFFFAOYSA-N n-(4-chlorophenyl)-2-[2-[4-(pyridin-4-ylamino)piperidine-1-carbonyl]indol-1-yl]acetamide Chemical compound C1=CC(Cl)=CC=C1NC(=O)CN1C2=CC=CC=C2C=C1C(=O)N1CCC(NC=2C=CN=CC=2)CC1 MIJCTFQIMWKOJZ-UHFFFAOYSA-N 0.000 claims 1
- 150000003852 triazoles Chemical class 0.000 claims 1
- 239000000243 solution Substances 0.000 description 145
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 133
- 230000002829 reductive effect Effects 0.000 description 127
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 123
- 239000000047 product Substances 0.000 description 111
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 105
- 239000002904 solvent Substances 0.000 description 89
- DTQVDTLACAAQTR-UHFFFAOYSA-N trifluoroacetic acid Substances OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 86
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 79
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 72
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 72
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 67
- 238000006243 chemical reaction Methods 0.000 description 62
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 57
- 239000011541 reaction mixture Substances 0.000 description 52
- 239000007787 solid Substances 0.000 description 51
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 42
- 229940093499 ethyl acetate Drugs 0.000 description 38
- 235000019439 ethyl acetate Nutrition 0.000 description 38
- VFRSADQPWYCXDG-LEUCUCNGSA-N ethyl (2s,5s)-5-methylpyrrolidine-2-carboxylate;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.CCOC(=O)[C@@H]1CC[C@H](C)N1 VFRSADQPWYCXDG-LEUCUCNGSA-N 0.000 description 35
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 34
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 31
- 239000000651 prodrug Substances 0.000 description 29
- 229940002612 prodrug Drugs 0.000 description 29
- 238000003786 synthesis reaction Methods 0.000 description 29
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 28
- 239000000741 silica gel Substances 0.000 description 26
- 229910002027 silica gel Inorganic materials 0.000 description 26
- 238000003756 stirring Methods 0.000 description 26
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 25
- 238000010828 elution Methods 0.000 description 24
- 238000004108 freeze drying Methods 0.000 description 24
- 125000001424 substituent group Chemical group 0.000 description 24
- 238000005160 1H NMR spectroscopy Methods 0.000 description 23
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 22
- 239000007858 starting material Substances 0.000 description 22
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 21
- 238000004587 chromatography analysis Methods 0.000 description 20
- 230000000694 effects Effects 0.000 description 20
- 239000012044 organic layer Substances 0.000 description 20
- 238000004007 reversed phase HPLC Methods 0.000 description 20
- 238000001914 filtration Methods 0.000 description 19
- 150000002475 indoles Chemical class 0.000 description 19
- 239000011734 sodium Substances 0.000 description 19
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 18
- 239000012071 phase Substances 0.000 description 18
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 17
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 17
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 17
- 238000000746 purification Methods 0.000 description 17
- 238000002953 preparative HPLC Methods 0.000 description 16
- 230000002441 reversible effect Effects 0.000 description 16
- 125000004093 cyano group Chemical group *C#N 0.000 description 15
- KLDLRDSRCMJKGM-UHFFFAOYSA-N 3-[chloro-(2-oxo-1,3-oxazolidin-3-yl)phosphoryl]-1,3-oxazolidin-2-one Chemical compound C1COC(=O)N1P(=O)(Cl)N1CCOC1=O KLDLRDSRCMJKGM-UHFFFAOYSA-N 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- 238000003556 assay Methods 0.000 description 12
- 239000002244 precipitate Substances 0.000 description 12
- 239000003795 chemical substances by application Substances 0.000 description 11
- 238000011321 prophylaxis Methods 0.000 description 11
- 239000000725 suspension Substances 0.000 description 11
- 239000003153 chemical reaction reagent Substances 0.000 description 10
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 9
- 238000005804 alkylation reaction Methods 0.000 description 9
- 229940054051 antipsychotic indole derivative Drugs 0.000 description 9
- 229910052786 argon Inorganic materials 0.000 description 9
- 239000003112 inhibitor Substances 0.000 description 9
- 229910052763 palladium Inorganic materials 0.000 description 9
- BCIIMDOZSUCSEN-UHFFFAOYSA-N piperidin-4-amine Chemical compound NC1CCNCC1 BCIIMDOZSUCSEN-UHFFFAOYSA-N 0.000 description 9
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 8
- 102000004190 Enzymes Human genes 0.000 description 8
- 108090000790 Enzymes Proteins 0.000 description 8
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 8
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 8
- FPQVGDGSRVMNMR-JCTPKUEWSA-N [[(z)-(1-cyano-2-ethoxy-2-oxoethylidene)amino]oxy-(dimethylamino)methylidene]-dimethylazanium;tetrafluoroborate Chemical compound F[B-](F)(F)F.CCOC(=O)C(\C#N)=N/OC(N(C)C)=[N+](C)C FPQVGDGSRVMNMR-JCTPKUEWSA-N 0.000 description 8
- 235000011054 acetic acid Nutrition 0.000 description 8
- 230000029936 alkylation Effects 0.000 description 8
- 229940088598 enzyme Drugs 0.000 description 8
- 239000003921 oil Substances 0.000 description 8
- 235000019198 oils Nutrition 0.000 description 8
- 125000006239 protecting group Chemical group 0.000 description 8
- YFCIFWOJYYFDQP-PTWZRHHISA-N 4-[3-amino-6-[(1S,3S,4S)-3-fluoro-4-hydroxycyclohexyl]pyrazin-2-yl]-N-[(1S)-1-(3-bromo-5-fluorophenyl)-2-(methylamino)ethyl]-2-fluorobenzamide Chemical compound CNC[C@@H](NC(=O)c1ccc(cc1F)-c1nc(cnc1N)[C@H]1CC[C@H](O)[C@@H](F)C1)c1cc(F)cc(Br)c1 YFCIFWOJYYFDQP-PTWZRHHISA-N 0.000 description 7
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 7
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 7
- 125000002252 acyl group Chemical group 0.000 description 7
- 150000001412 amines Chemical class 0.000 description 7
- 150000001735 carboxylic acids Chemical class 0.000 description 7
- 238000001816 cooling Methods 0.000 description 7
- QQXQAEWRSVZPJM-UHFFFAOYSA-N ethyl 1h-indole-2-carboxylate Chemical class C1=CC=C2NC(C(=O)OCC)=CC2=C1 QQXQAEWRSVZPJM-UHFFFAOYSA-N 0.000 description 7
- 230000002401 inhibitory effect Effects 0.000 description 7
- 125000003367 polycyclic group Chemical group 0.000 description 7
- 230000009467 reduction Effects 0.000 description 7
- 238000006722 reduction reaction Methods 0.000 description 7
- 238000006268 reductive amination reaction Methods 0.000 description 7
- 239000012312 sodium hydride Substances 0.000 description 7
- 229910000104 sodium hydride Inorganic materials 0.000 description 7
- 239000000758 substrate Substances 0.000 description 7
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 6
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical compound ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 6
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 6
- 125000003277 amino group Chemical group 0.000 description 6
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 6
- 239000003480 eluent Substances 0.000 description 6
- 125000004185 ester group Chemical group 0.000 description 6
- 239000006260 foam Substances 0.000 description 6
- 238000010561 standard procedure Methods 0.000 description 6
- CKXZPVPIDOJLLM-UHFFFAOYSA-N tert-butyl n-piperidin-4-ylcarbamate Chemical compound CC(C)(C)OC(=O)NC1CCNCC1 CKXZPVPIDOJLLM-UHFFFAOYSA-N 0.000 description 6
- VOAAEKKFGLPLLU-UHFFFAOYSA-N (4-methoxyphenyl)boronic acid Chemical compound COC1=CC=C(B(O)O)C=C1 VOAAEKKFGLPLLU-UHFFFAOYSA-N 0.000 description 5
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 5
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 5
- 102000020897 Formins Human genes 0.000 description 5
- 108091022623 Formins Proteins 0.000 description 5
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 description 5
- 239000004480 active ingredient Substances 0.000 description 5
- 125000002015 acyclic group Chemical group 0.000 description 5
- 201000010099 disease Diseases 0.000 description 5
- 238000001704 evaporation Methods 0.000 description 5
- 230000008020 evaporation Effects 0.000 description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 5
- FMASTMURQSHELY-UHFFFAOYSA-N n-(4-fluoro-2-methylphenyl)-3-methyl-n-[(2-methyl-1h-indol-4-yl)methyl]pyridine-4-carboxamide Chemical compound C1=CC=C2NC(C)=CC2=C1CN(C=1C(=CC(F)=CC=1)C)C(=O)C1=CC=NC=C1C FMASTMURQSHELY-UHFFFAOYSA-N 0.000 description 5
- 239000012074 organic phase Substances 0.000 description 5
- 229920001223 polyethylene glycol Polymers 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- 239000003826 tablet Substances 0.000 description 5
- 238000011282 treatment Methods 0.000 description 5
- KZPYGQFFRCFCPP-UHFFFAOYSA-N 1,1'-bis(diphenylphosphino)ferrocene Chemical compound [Fe+2].C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1 KZPYGQFFRCFCPP-UHFFFAOYSA-N 0.000 description 4
- OEACEEHJARIXJW-UHFFFAOYSA-N 1-[[5-(5-chlorothiophen-2-yl)-1,2-oxazol-3-yl]methyl]-2-[(1-propan-2-ylpiperidin-4-yl)carbamoyl]indole-5-carboxylic acid Chemical compound C1CN(C(C)C)CCC1NC(=O)C1=CC2=CC(C(O)=O)=CC=C2N1CC1=NOC(C=2SC(Cl)=CC=2)=C1 OEACEEHJARIXJW-UHFFFAOYSA-N 0.000 description 4
- SKZUXKOWTWFPPH-UHFFFAOYSA-N 1-propan-2-ylpiperidin-4-amine;hydrochloride Chemical compound Cl.CC(C)N1CCC(N)CC1 SKZUXKOWTWFPPH-UHFFFAOYSA-N 0.000 description 4
- YSTUPBOIUOUMHG-UHFFFAOYSA-N 2-bromo-n-(4-chlorophenyl)acetamide Chemical compound ClC1=CC=C(NC(=O)CBr)C=C1 YSTUPBOIUOUMHG-UHFFFAOYSA-N 0.000 description 4
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 4
- UBIXPIXAVFHKMM-UHFFFAOYSA-N 3-(bromomethyl)-5-(5-chlorothiophen-2-yl)-1,2-oxazole Chemical compound S1C(Cl)=CC=C1C1=CC(CBr)=NO1 UBIXPIXAVFHKMM-UHFFFAOYSA-N 0.000 description 4
- OLNYNTKNRVFVBI-UHFFFAOYSA-N 7-methyl-1h-indole-2-carboxylic acid Chemical compound CC1=CC=CC2=C1NC(C(O)=O)=C2 OLNYNTKNRVFVBI-UHFFFAOYSA-N 0.000 description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 4
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 4
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 4
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 4
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 4
- LQZMLBORDGWNPD-UHFFFAOYSA-N N-iodosuccinimide Substances IN1C(=O)CCC1=O LQZMLBORDGWNPD-UHFFFAOYSA-N 0.000 description 4
- 241000610375 Sparisoma viride Species 0.000 description 4
- 108090000190 Thrombin Proteins 0.000 description 4
- 108010000499 Thromboplastin Proteins 0.000 description 4
- 102000002262 Thromboplastin Human genes 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 229940127219 anticoagulant drug Drugs 0.000 description 4
- 210000004369 blood Anatomy 0.000 description 4
- 239000008280 blood Substances 0.000 description 4
- 239000003130 blood coagulation factor inhibitor Substances 0.000 description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 4
- 239000000969 carrier Substances 0.000 description 4
- GGRHYQCXXYLUTL-UHFFFAOYSA-N chloromethyl 2,2-dimethylpropanoate Chemical compound CC(C)(C)C(=O)OCCl GGRHYQCXXYLUTL-UHFFFAOYSA-N 0.000 description 4
- 230000007062 hydrolysis Effects 0.000 description 4
- 238000006460 hydrolysis reaction Methods 0.000 description 4
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 4
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 4
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 4
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 4
- 125000004043 oxo group Chemical group O=* 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 239000011780 sodium chloride Substances 0.000 description 4
- 229910052938 sodium sulfate Inorganic materials 0.000 description 4
- 235000011152 sodium sulphate Nutrition 0.000 description 4
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 4
- FQFILJKFZCVHNH-UHFFFAOYSA-N tert-butyl n-[3-[(5-bromo-2-chloropyrimidin-4-yl)amino]propyl]carbamate Chemical compound CC(C)(C)OC(=O)NCCCNC1=NC(Cl)=NC=C1Br FQFILJKFZCVHNH-UHFFFAOYSA-N 0.000 description 4
- 229960004072 thrombin Drugs 0.000 description 4
- SATKWGUTVPCWFY-UHFFFAOYSA-N 1-bromoethyl 2,2-dimethylpropanoate Chemical compound CC(Br)OC(=O)C(C)(C)C SATKWGUTVPCWFY-UHFFFAOYSA-N 0.000 description 3
- BTDZSVPICJLNIN-UHFFFAOYSA-N 1-pyridin-4-ylpiperidin-4-amine Chemical compound C1CC(N)CCN1C1=CC=NC=C1 BTDZSVPICJLNIN-UHFFFAOYSA-N 0.000 description 3
- XYWIPYBIIRTJMM-IBGZPJMESA-N 4-[[(2S)-2-[4-[5-chloro-2-[4-(trifluoromethyl)triazol-1-yl]phenyl]-5-methoxy-2-oxopyridin-1-yl]butanoyl]amino]-2-fluorobenzamide Chemical compound CC[C@H](N1C=C(OC)C(=CC1=O)C1=C(C=CC(Cl)=C1)N1C=C(N=N1)C(F)(F)F)C(=O)NC1=CC(F)=C(C=C1)C(N)=O XYWIPYBIIRTJMM-IBGZPJMESA-N 0.000 description 3
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 3
- HVCNXQOWACZAFN-UHFFFAOYSA-N 4-ethylmorpholine Chemical compound CCN1CCOCC1 HVCNXQOWACZAFN-UHFFFAOYSA-N 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- 208000032843 Hemorrhage Diseases 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- 238000010716 Reissert indole synthesis reaction Methods 0.000 description 3
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 3
- 230000003213 activating effect Effects 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 150000008064 anhydrides Chemical class 0.000 description 3
- 238000006254 arylation reaction Methods 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 208000034158 bleeding Diseases 0.000 description 3
- 230000000740 bleeding effect Effects 0.000 description 3
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 238000006555 catalytic reaction Methods 0.000 description 3
- 238000011097 chromatography purification Methods 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 150000001879 copper Chemical class 0.000 description 3
- 125000006165 cyclic alkyl group Chemical group 0.000 description 3
- VLNZUSMTOFYNPS-UHFFFAOYSA-N diethylphosphorylformonitrile Chemical compound CCP(=O)(CC)C#N VLNZUSMTOFYNPS-UHFFFAOYSA-N 0.000 description 3
- 229940079593 drug Drugs 0.000 description 3
- AZKKPVUCXDZBCR-UHFFFAOYSA-N ethyl 2-[[1-[[5-(5-chlorothiophen-2-yl)-1,2-oxazol-3-yl]methyl]-7-methylindole-2-carbonyl]-(1-propan-2-ylpiperidin-4-yl)amino]acetate Chemical compound C=1C2=CC=CC(C)=C2N(CC2=NOC(=C2)C=2SC(Cl)=CC=2)C=1C(=O)N(CC(=O)OCC)C1CCN(C(C)C)CC1 AZKKPVUCXDZBCR-UHFFFAOYSA-N 0.000 description 3
- PQVSTLUFSYVLTO-UHFFFAOYSA-N ethyl n-ethoxycarbonylcarbamate Chemical compound CCOC(=O)NC(=O)OCC PQVSTLUFSYVLTO-UHFFFAOYSA-N 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 239000007903 gelatin capsule Substances 0.000 description 3
- 125000002795 guanidino group Chemical group C(N)(=N)N* 0.000 description 3
- KMAKOBLIOCQGJP-UHFFFAOYSA-N indole-3-carboxylic acid Chemical compound C1=CC=C2C(C(=O)O)=CNC2=C1 KMAKOBLIOCQGJP-UHFFFAOYSA-N 0.000 description 3
- 150000002476 indolines Chemical class 0.000 description 3
- GLXDVVHUTZTUQK-UHFFFAOYSA-M lithium hydroxide monohydrate Substances [Li+].O.[OH-] GLXDVVHUTZTUQK-UHFFFAOYSA-M 0.000 description 3
- 229940040692 lithium hydroxide monohydrate Drugs 0.000 description 3
- NQPIEWBAWBFGOB-UHFFFAOYSA-N methyl 1h-indole-2-carboxylate Chemical compound C1=CC=C2NC(C(=O)OC)=CC2=C1 NQPIEWBAWBFGOB-UHFFFAOYSA-N 0.000 description 3
- 150000004702 methyl esters Chemical class 0.000 description 3
- 230000000144 pharmacologic effect Effects 0.000 description 3
- IYPZRUYMFDWKSS-UHFFFAOYSA-N piperazin-1-amine Chemical compound NN1CCNCC1 IYPZRUYMFDWKSS-UHFFFAOYSA-N 0.000 description 3
- 125000004193 piperazinyl group Chemical group 0.000 description 3
- 125000004482 piperidin-4-yl group Chemical group N1CCC(CC1)* 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- 230000002265 prevention Effects 0.000 description 3
- 239000000523 sample Substances 0.000 description 3
- 238000007127 saponification reaction Methods 0.000 description 3
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- 239000007790 solid phase Substances 0.000 description 3
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 3
- 229910052723 transition metal Inorganic materials 0.000 description 3
- 150000003624 transition metals Chemical class 0.000 description 3
- ILJYDQMZEQMUBB-UHFFFAOYSA-N (4-pyridin-4-ylphenyl)methanamine Chemical compound C1=CC(CN)=CC=C1C1=CC=NC=C1 ILJYDQMZEQMUBB-UHFFFAOYSA-N 0.000 description 2
- LBUJPTNKIBCYBY-UHFFFAOYSA-N 1,2,3,4-tetrahydroquinoline Chemical compound C1=CC=C2CCCNC2=C1 LBUJPTNKIBCYBY-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- AZQWKYJCGOJGHM-UHFFFAOYSA-N 1,4-benzoquinone Chemical compound O=C1C=CC(=O)C=C1 AZQWKYJCGOJGHM-UHFFFAOYSA-N 0.000 description 2
- FJTSSHUVCCKRBA-UHFFFAOYSA-N 1-(2-chloropyrimidin-4-yl)piperidin-4-amine Chemical compound C1CC(N)CCN1C1=CC=NC(Cl)=N1 FJTSSHUVCCKRBA-UHFFFAOYSA-N 0.000 description 2
- UQUFONQTPPAJAO-UHFFFAOYSA-N 1-(4-methoxyphenyl)-n-(1-propan-2-ylpiperidin-4-yl)indole-2-carboxamide Chemical compound C1=CC(OC)=CC=C1N1C2=CC=CC=C2C=C1C(=O)NC1CCN(C(C)C)CC1 UQUFONQTPPAJAO-UHFFFAOYSA-N 0.000 description 2
- AVAVKXFPPIKFLU-UHFFFAOYSA-N 1-[2-(2,4-dichlorophenyl)ethyl]indole-2-carboxylic acid Chemical compound OC(=O)C1=CC2=CC=CC=C2N1CCC1=CC=C(Cl)C=C1Cl AVAVKXFPPIKFLU-UHFFFAOYSA-N 0.000 description 2
- WSVCZSPRCKBESD-UHFFFAOYSA-N 1-[2-(4-chloroanilino)-2-oxoethyl]-2-[(1-propan-2-ylpiperidin-4-yl)carbamoyl]indole-5-carboxylic acid Chemical compound C1CN(C(C)C)CCC1NC(=O)C1=CC2=CC(C(O)=O)=CC=C2N1CC(=O)NC1=CC=C(Cl)C=C1 WSVCZSPRCKBESD-UHFFFAOYSA-N 0.000 description 2
- RPXARQCXLPPUMJ-UHFFFAOYSA-N 1-[2-(4-chloroanilino)-2-oxoethyl]-n-[(1-pyridin-4-ylpiperidin-4-yl)methyl]indole-2-carboxamide Chemical compound C1=CC(Cl)=CC=C1NC(=O)CN1C2=CC=CC=C2C=C1C(=O)NCC1CCN(C=2C=CN=CC=2)CC1 RPXARQCXLPPUMJ-UHFFFAOYSA-N 0.000 description 2
- AXJHGZQKOZQHQC-UHFFFAOYSA-N 1-[2-(4-chloroanilino)-2-oxoethyl]indole-2-carboxylic acid Chemical compound OC(=O)C1=CC2=CC=CC=C2N1CC(=O)NC1=CC=C(Cl)C=C1 AXJHGZQKOZQHQC-UHFFFAOYSA-N 0.000 description 2
- SYYLBTHATZNOSE-UHFFFAOYSA-N 1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]indole-2-carboxylic acid Chemical compound C1=CC=C2N(CC(=O)OC(C)(C)C)C(C(O)=O)=CC2=C1 SYYLBTHATZNOSE-UHFFFAOYSA-N 0.000 description 2
- ZDEGYYDOWMXDCH-UHFFFAOYSA-N 1-[2-[(5-chloropyridin-2-yl)amino]-2-oxoethyl]-5-methylsulfonyl-n-(1-propan-2-ylpiperidin-4-yl)indole-2-carboxamide Chemical compound C1CN(C(C)C)CCC1NC(=O)C1=CC2=CC(S(C)(=O)=O)=CC=C2N1CC(=O)NC1=CC=C(Cl)C=N1 ZDEGYYDOWMXDCH-UHFFFAOYSA-N 0.000 description 2
- CFBOBFQVPRCOQN-UHFFFAOYSA-N 1-[[5-(5-chlorothiophen-2-yl)-1,2-oxazol-3-yl]methyl]-3,7-diiodo-4-methoxyindole-2-carboxylic acid Chemical compound OC(=O)C1=C(I)C=2C(OC)=CC=C(I)C=2N1CC(=NO1)C=C1C1=CC=C(Cl)S1 CFBOBFQVPRCOQN-UHFFFAOYSA-N 0.000 description 2
- VMMOJOGFBZSURG-UHFFFAOYSA-N 1-[[5-(5-chlorothiophen-2-yl)-1,2-oxazol-3-yl]methyl]-3-cyanoindole-2-carboxylic acid Chemical compound OC(=O)C1=C(C#N)C2=CC=CC=C2N1CC(=NO1)C=C1C1=CC=C(Cl)S1 VMMOJOGFBZSURG-UHFFFAOYSA-N 0.000 description 2
- SVPMYJVMCNPHDZ-UHFFFAOYSA-N 1-[[5-(5-chlorothiophen-2-yl)-1,2-oxazol-3-yl]methyl]-n-[1-(oxan-4-yl)piperidin-4-yl]indole-2-carboxamide Chemical compound S1C(Cl)=CC=C1C1=CC(CN2C3=CC=CC=C3C=C2C(=O)NC2CCN(CC2)C2CCOCC2)=NO1 SVPMYJVMCNPHDZ-UHFFFAOYSA-N 0.000 description 2
- 125000001462 1-pyrrolyl group Chemical group [*]N1C([H])=C([H])C([H])=C1[H] 0.000 description 2
- XYHKNCXZYYTLRG-UHFFFAOYSA-N 1h-imidazole-2-carbaldehyde Chemical compound O=CC1=NC=CN1 XYHKNCXZYYTLRG-UHFFFAOYSA-N 0.000 description 2
- PAQZWJGSJMLPMG-UHFFFAOYSA-N 2,4,6-tripropyl-1,3,5,2$l^{5},4$l^{5},6$l^{5}-trioxatriphosphinane 2,4,6-trioxide Chemical compound CCCP1(=O)OP(=O)(CCC)OP(=O)(CCC)O1 PAQZWJGSJMLPMG-UHFFFAOYSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- XYYIHBSYADINEC-UHFFFAOYSA-N 2-bromo-n-(5-chloropyridin-2-yl)acetamide Chemical compound ClC1=CC=C(NC(=O)CBr)N=C1 XYYIHBSYADINEC-UHFFFAOYSA-N 0.000 description 2
- LSTRKXWIZZZYAS-UHFFFAOYSA-N 2-bromoacetyl bromide Chemical compound BrCC(Br)=O LSTRKXWIZZZYAS-UHFFFAOYSA-N 0.000 description 2
- OGYYPBLWGAEIRF-UHFFFAOYSA-N 2-o-ethyl 5-o-propan-2-yl 1-[[5-(5-chlorothiophen-2-yl)-1,2-oxazol-3-yl]methyl]indole-2,5-dicarboxylate Chemical compound CCOC(=O)C1=CC2=CC(C(=O)OC(C)C)=CC=C2N1CC(=NO1)C=C1C1=CC=C(Cl)S1 OGYYPBLWGAEIRF-UHFFFAOYSA-N 0.000 description 2
- LOSAFYCEFSLEDZ-UHFFFAOYSA-N 2-o-tert-butyl 4-o-methyl 1-[[5-(5-chlorothiophen-2-yl)-1,2-oxazol-3-yl]methyl]indole-2,4-dicarboxylate Chemical compound CC(C)(C)OC(=O)C1=CC=2C(C(=O)OC)=CC=CC=2N1CC(=NO1)C=C1C1=CC=C(Cl)S1 LOSAFYCEFSLEDZ-UHFFFAOYSA-N 0.000 description 2
- RTWABQYDTAIXPR-UHFFFAOYSA-N 2-o-tert-butyl 4-o-methyl 1h-indole-2,4-dicarboxylate Chemical compound COC(=O)C1=CC=CC2=C1C=C(C(=O)OC(C)(C)C)N2 RTWABQYDTAIXPR-UHFFFAOYSA-N 0.000 description 2
- RNQMFHCNUFEVSQ-UHFFFAOYSA-N 2-o-tert-butyl 5-o-methyl 1-[[5-(5-chlorothiophen-2-yl)-1,2-oxazol-3-yl]methyl]indole-2,5-dicarboxylate Chemical compound CC(C)(C)OC(=O)C1=CC2=CC(C(=O)OC)=CC=C2N1CC(=NO1)C=C1C1=CC=C(Cl)S1 RNQMFHCNUFEVSQ-UHFFFAOYSA-N 0.000 description 2
- 125000004485 2-pyrrolidinyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])([H])C1([H])* 0.000 description 2
- GOLXRNDWAUTYKT-UHFFFAOYSA-N 3-(1H-indol-3-yl)propanoic acid Chemical compound C1=CC=C2C(CCC(=O)O)=CNC2=C1 GOLXRNDWAUTYKT-UHFFFAOYSA-N 0.000 description 2
- NCXGWFIXUJHVLI-UHFFFAOYSA-N 3-methyl-2-indolic acid Chemical compound C1=CC=C2C(C)=C(C(O)=O)NC2=C1 NCXGWFIXUJHVLI-UHFFFAOYSA-N 0.000 description 2
- 125000004575 3-pyrrolidinyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- SXFVRIRMDXONCT-UHFFFAOYSA-N 4-bromo-1h-indole-2-carboxylic acid Chemical compound C1=CC=C2NC(C(=O)O)=CC2=C1Br SXFVRIRMDXONCT-UHFFFAOYSA-N 0.000 description 2
- XGAFCCUNHIMIRV-UHFFFAOYSA-N 4-chloropyridine;hydron;chloride Chemical compound Cl.ClC1=CC=NC=C1 XGAFCCUNHIMIRV-UHFFFAOYSA-N 0.000 description 2
- 229960000549 4-dimethylaminophenol Drugs 0.000 description 2
- HPTPAOBHDQIIAO-UHFFFAOYSA-N 5-propan-2-yloxycarbonyl-1h-indole-2-carboxylic acid Chemical compound CC(C)OC(=O)C1=CC=C2NC(C(O)=O)=CC2=C1 HPTPAOBHDQIIAO-UHFFFAOYSA-N 0.000 description 2
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 2
- XNBGANWAZJWOHS-UHFFFAOYSA-N 6-methoxy-1h-indole-2-carboxylic acid Chemical compound COC1=CC=C2C=C(C(O)=O)NC2=C1 XNBGANWAZJWOHS-UHFFFAOYSA-N 0.000 description 2
- WFWYWVZGUUCHBL-UHFFFAOYSA-N 7-(aminomethyl)quinazolin-4-amine Chemical compound NC1=NC=NC2=CC(CN)=CC=C21 WFWYWVZGUUCHBL-UHFFFAOYSA-N 0.000 description 2
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- 101100243951 Caenorhabditis elegans pie-1 gene Proteins 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- 238000006783 Fischer indole synthesis reaction Methods 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 2
- 238000005684 Liebig rearrangement reaction Methods 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- 238000007126 N-alkylation reaction Methods 0.000 description 2
- 150000001204 N-oxides Chemical class 0.000 description 2
- 238000005481 NMR spectroscopy Methods 0.000 description 2
- 238000006789 Nenitzescu synthesis reaction Methods 0.000 description 2
- 101100030361 Neurospora crassa (strain ATCC 24698 / 74-OR23-1A / CBS 708.71 / DSM 1257 / FGSC 987) pph-3 gene Proteins 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- 108091005804 Peptidases Proteins 0.000 description 2
- 102000035195 Peptidases Human genes 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 239000004365 Protease Substances 0.000 description 2
- LCTONWCANYUPML-UHFFFAOYSA-N Pyruvic acid Chemical compound CC(=O)C(O)=O LCTONWCANYUPML-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 2
- 238000006619 Stille reaction Methods 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 2
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 2
- 159000000021 acetate salts Chemical class 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 239000000443 aerosol Substances 0.000 description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 2
- 238000013459 approach Methods 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 239000012267 brine Substances 0.000 description 2
- 239000000872 buffer Substances 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 2
- 150000001733 carboxylic acid esters Chemical class 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 2
- 230000008878 coupling Effects 0.000 description 2
- 238000010168 coupling process Methods 0.000 description 2
- 238000005859 coupling reaction Methods 0.000 description 2
- 238000006880 cross-coupling reaction Methods 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 230000003247 decreasing effect Effects 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- 125000001033 ether group Chemical group 0.000 description 2
- BLWZGFPNCAEYMO-UHFFFAOYSA-N ethyl 1-[2-(4-chloroanilino)-2-oxoethyl]indole-2-carboxylate Chemical compound CCOC(=O)C1=CC2=CC=CC=C2N1CC(=O)NC1=CC=C(Cl)C=C1 BLWZGFPNCAEYMO-UHFFFAOYSA-N 0.000 description 2
- XKCPMRYMLRYCMI-UHFFFAOYSA-N ethyl 1-[2-(4-chlorophenyl)ethyl]indole-2-carboxylate Chemical compound CCOC(=O)C1=CC2=CC=CC=C2N1CCC1=CC=C(Cl)C=C1 XKCPMRYMLRYCMI-UHFFFAOYSA-N 0.000 description 2
- STSSZKZJODOVDK-UHFFFAOYSA-N ethyl 2-[(1-propan-2-ylpiperidin-4-yl)amino]acetate Chemical compound CCOC(=O)CNC1CCN(C(C)C)CC1 STSSZKZJODOVDK-UHFFFAOYSA-N 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 150000002430 hydrocarbons Chemical group 0.000 description 2
- ORTFAQDWJHRMNX-UHFFFAOYSA-N hydroxidooxidocarbon(.) Chemical group O[C]=O ORTFAQDWJHRMNX-UHFFFAOYSA-N 0.000 description 2
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 2
- 125000002962 imidazol-1-yl group Chemical group [*]N1C([H])=NC([H])=C1[H] 0.000 description 2
- 125000003037 imidazol-2-yl group Chemical group [H]N1C([*])=NC([H])=C1[H] 0.000 description 2
- 125000002140 imidazol-4-yl group Chemical group [H]N1C([H])=NC([*])=C1[H] 0.000 description 2
- 239000007943 implant Substances 0.000 description 2
- 238000000338 in vitro Methods 0.000 description 2
- SEOVTRFCIGRIMH-UHFFFAOYSA-N indole-3-acetic acid Chemical compound C1=CC=C2C(CC(=O)O)=CNC2=C1 SEOVTRFCIGRIMH-UHFFFAOYSA-N 0.000 description 2
- JYGFTBXVXVMTGB-UHFFFAOYSA-N indolin-2-one Chemical compound C1=CC=C2NC(=O)CC2=C1 JYGFTBXVXVMTGB-UHFFFAOYSA-N 0.000 description 2
- 230000028709 inflammatory response Effects 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 230000026045 iodination Effects 0.000 description 2
- 238000006192 iodination reaction Methods 0.000 description 2
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 239000004310 lactic acid Substances 0.000 description 2
- 235000014655 lactic acid Nutrition 0.000 description 2
- 239000010410 layer Substances 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- 230000001404 mediated effect Effects 0.000 description 2
- TWXDDNPPQUTEOV-FVGYRXGTSA-N methamphetamine hydrochloride Chemical compound Cl.CN[C@@H](C)CC1=CC=CC=C1 TWXDDNPPQUTEOV-FVGYRXGTSA-N 0.000 description 2
- CGVAQVAXTQEDNM-UHFFFAOYSA-N methyl 1-(4-methoxyphenyl)indole-2-carboxylate Chemical compound COC(=O)C1=CC2=CC=CC=C2N1C1=CC=C(OC)C=C1 CGVAQVAXTQEDNM-UHFFFAOYSA-N 0.000 description 2
- UJYLZXNTRAEJBB-UHFFFAOYSA-N methyl 1-[[5-(5-chlorothiophen-2-yl)-1,2-oxazol-3-yl]methyl]indole-2-carboxylate Chemical compound COC(=O)C1=CC2=CC=CC=C2N1CC(=NO1)C=C1C1=CC=C(Cl)S1 UJYLZXNTRAEJBB-UHFFFAOYSA-N 0.000 description 2
- FKSGZMZXLNNNHE-UHFFFAOYSA-N methyl 3,7-diiodo-4-methoxy-1h-indole-2-carboxylate Chemical compound C1=CC(OC)=C2C(I)=C(C(=O)OC)NC2=C1I FKSGZMZXLNNNHE-UHFFFAOYSA-N 0.000 description 2
- HRGIGMGNLJTQEQ-UHFFFAOYSA-N methyl 3-cyano-1h-indole-2-carboxylate Chemical compound C1=CC=C2C(C#N)=C(C(=O)OC)NC2=C1 HRGIGMGNLJTQEQ-UHFFFAOYSA-N 0.000 description 2
- GLCZQTLCVLVFGV-UHFFFAOYSA-N methyl 4-methoxy-1h-indole-2-carboxylate Chemical compound C1=CC=C2NC(C(=O)OC)=CC2=C1OC GLCZQTLCVLVFGV-UHFFFAOYSA-N 0.000 description 2
- 239000003094 microcapsule Substances 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- DBNQIOANXZVWIP-UHFFFAOYSA-N n,n-dimethyl-1,1-bis[(2-methylpropan-2-yl)oxy]methanamine Chemical compound CC(C)(C)OC(N(C)C)OC(C)(C)C DBNQIOANXZVWIP-UHFFFAOYSA-N 0.000 description 2
- ABRZLNLFABKMCJ-UHFFFAOYSA-N n-(1-pyridin-4-ylpiperidin-4-yl)pyridin-4-amine Chemical compound C1CN(C=2C=CN=CC=2)CCC1NC1=CC=NC=C1 ABRZLNLFABKMCJ-UHFFFAOYSA-N 0.000 description 2
- GINABUAPACIWCA-UHFFFAOYSA-N n-propan-2-ylpiperidin-4-amine Chemical compound CC(C)NC1CCNCC1 GINABUAPACIWCA-UHFFFAOYSA-N 0.000 description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- 125000000160 oxazolidinyl group Chemical group 0.000 description 2
- FDPIMTJIUBPUKL-UHFFFAOYSA-N pentan-3-one Chemical compound CCC(=O)CC FDPIMTJIUBPUKL-UHFFFAOYSA-N 0.000 description 2
- 239000006187 pill Substances 0.000 description 2
- 125000004574 piperidin-2-yl group Chemical group N1C(CCCC1)* 0.000 description 2
- 125000004483 piperidin-3-yl group Chemical group N1CC(CCC1)* 0.000 description 2
- 229920005862 polyol Polymers 0.000 description 2
- 150000003077 polyols Chemical class 0.000 description 2
- OJQRSXICVBYQNF-UHFFFAOYSA-N propan-2-yl 1-[[5-(5-chlorothiophen-2-yl)-1,2-oxazol-3-yl]methyl]-2-[(1-propan-2-ylpiperidin-4-yl)carbamoyl]indole-5-carboxylate Chemical compound C1CN(C(C)C)CCC1NC(=O)C1=CC2=CC(C(=O)OC(C)C)=CC=C2N1CC(=NO1)C=C1C1=CC=C(Cl)S1 OJQRSXICVBYQNF-UHFFFAOYSA-N 0.000 description 2
- 108010014806 prothrombinase complex Proteins 0.000 description 2
- 125000000246 pyrimidin-2-yl group Chemical group [H]C1=NC(*)=NC([H])=C1[H] 0.000 description 2
- 125000004528 pyrimidin-5-yl group Chemical group N1=CN=CC(=C1)* 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 238000012552 review Methods 0.000 description 2
- 238000007363 ring formation reaction Methods 0.000 description 2
- XIIOFHFUYBLOLW-UHFFFAOYSA-N selpercatinib Chemical compound OC(COC=1C=C(C=2N(C=1)N=CC=2C#N)C=1C=NC(=CC=1)N1CC2N(C(C1)C2)CC=1C=NC(=CC=1)OC)(C)C XIIOFHFUYBLOLW-UHFFFAOYSA-N 0.000 description 2
- 239000003001 serine protease inhibitor Substances 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 2
- 125000000547 substituted alkyl group Chemical group 0.000 description 2
- 125000003107 substituted aryl group Chemical group 0.000 description 2
- 150000003457 sulfones Chemical class 0.000 description 2
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 2
- 238000005694 sulfonylation reaction Methods 0.000 description 2
- 150000003462 sulfoxides Chemical class 0.000 description 2
- 125000004434 sulfur atom Chemical group 0.000 description 2
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 2
- 239000000829 suppository Substances 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- GVPSIFSYYZXVQC-UHFFFAOYSA-N tert-butyl 4-(propan-2-ylamino)piperidine-1-carboxylate Chemical compound CC(C)NC1CCN(C(=O)OC(C)(C)C)CC1 GVPSIFSYYZXVQC-UHFFFAOYSA-N 0.000 description 2
- ORDWBNAADSSUPV-UHFFFAOYSA-N tert-butyl 4-bromo-1h-indole-2-carboxylate Chemical compound C1=CC=C2NC(C(=O)OC(C)(C)C)=CC2=C1Br ORDWBNAADSSUPV-UHFFFAOYSA-N 0.000 description 2
- VEXKSFQGMHFQIT-UHFFFAOYSA-N tert-butyl n-(1-pyrimidin-4-ylpiperidin-4-yl)carbamate Chemical compound C1CC(NC(=O)OC(C)(C)C)CCN1C1=CC=NC=N1 VEXKSFQGMHFQIT-UHFFFAOYSA-N 0.000 description 2
- DJNCXSGGAMADNN-UHFFFAOYSA-N tert-butyl n-[(4-bromophenyl)methyl]carbamate Chemical compound CC(C)(C)OC(=O)NCC1=CC=C(Br)C=C1 DJNCXSGGAMADNN-UHFFFAOYSA-N 0.000 description 2
- RHTXPYGVJVHLQA-UHFFFAOYSA-N tert-butyl n-[(4-pyridin-4-ylphenyl)methyl]carbamate Chemical compound C1=CC(CNC(=O)OC(C)(C)C)=CC=C1C1=CC=NC=C1 RHTXPYGVJVHLQA-UHFFFAOYSA-N 0.000 description 2
- IDPAGRMFQKXGMZ-UHFFFAOYSA-N tert-butyl n-[1-(2-chloropyrimidin-4-yl)piperidin-4-yl]carbamate Chemical compound C1CC(NC(=O)OC(C)(C)C)CCN1C1=CC=NC(Cl)=N1 IDPAGRMFQKXGMZ-UHFFFAOYSA-N 0.000 description 2
- KOYAXJZHZNSNFY-UHFFFAOYSA-N tert-butyl n-pyridin-4-yl-n-(1-pyridin-4-ylpiperidin-4-yl)carbamate Chemical compound C=1C=NC=CC=1N(C(=O)OC(C)(C)C)C(CC1)CCN1C1=CC=NC=C1 KOYAXJZHZNSNFY-UHFFFAOYSA-N 0.000 description 2
- 125000001973 tert-pentyl group Chemical group [H]C([H])([H])C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 125000005958 tetrahydrothienyl group Chemical group 0.000 description 2
- 230000001225 therapeutic effect Effects 0.000 description 2
- 125000004571 thiomorpholin-4-yl group Chemical group N1(CCSCC1)* 0.000 description 2
- 125000004568 thiomorpholinyl group Chemical group 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- 125000004417 unsaturated alkyl group Chemical group 0.000 description 2
- 239000003039 volatile agent Substances 0.000 description 2
- BZMMRNKDONDVIB-UHFFFAOYSA-N (1-ethoxycyclopropyl)oxy-trimethylsilane Chemical compound CCOC1(O[Si](C)(C)C)CC1 BZMMRNKDONDVIB-UHFFFAOYSA-N 0.000 description 1
- JVTMDVFGRFFOOB-UHFFFAOYSA-N (1-pyridin-4-ylpiperidin-4-yl)methanamine Chemical compound C1CC(CN)CCN1C1=CC=NC=C1 JVTMDVFGRFFOOB-UHFFFAOYSA-N 0.000 description 1
- TYIKXPOMOYDGCS-UHFFFAOYSA-N (2,3-dichlorophenyl)boronic acid Chemical compound OB(O)C1=CC=CC(Cl)=C1Cl TYIKXPOMOYDGCS-UHFFFAOYSA-N 0.000 description 1
- DOMQFIFVDIAOOT-ROUUACIJSA-N (2S,3R)-N-[4-(2,6-dimethoxyphenyl)-5-(5-methylpyridin-3-yl)-1,2,4-triazol-3-yl]-3-(5-methylpyrimidin-2-yl)butane-2-sulfonamide Chemical compound COC1=C(C(=CC=C1)OC)N1C(=NN=C1C=1C=NC=C(C=1)C)NS(=O)(=O)[C@@H](C)[C@H](C)C1=NC=C(C=N1)C DOMQFIFVDIAOOT-ROUUACIJSA-N 0.000 description 1
- SDEAGACSNFSZCU-UHFFFAOYSA-N (3-chlorophenyl)boronic acid Chemical compound OB(O)C1=CC=CC(Cl)=C1 SDEAGACSNFSZCU-UHFFFAOYSA-N 0.000 description 1
- NLLGFYPSWCMUIV-UHFFFAOYSA-N (3-methoxyphenyl)boronic acid Chemical compound COC1=CC=CC(B(O)O)=C1 NLLGFYPSWCMUIV-UHFFFAOYSA-N 0.000 description 1
- XRNVSPDQTPVECU-UHFFFAOYSA-N (4-bromophenyl)methanamine Chemical compound NCC1=CC=C(Br)C=C1 XRNVSPDQTPVECU-UHFFFAOYSA-N 0.000 description 1
- CAYQIZIAYYNFCS-UHFFFAOYSA-N (4-chlorophenyl)boronic acid Chemical compound OB(O)C1=CC=C(Cl)C=C1 CAYQIZIAYYNFCS-UHFFFAOYSA-N 0.000 description 1
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- UKVYVZLTGQVOPX-IHWYPQMZSA-N (z)-3-aminobut-2-enoic acid Chemical compound C\C(N)=C\C(O)=O UKVYVZLTGQVOPX-IHWYPQMZSA-N 0.000 description 1
- FTSVTCPUMUXYJS-UHFFFAOYSA-N 1,2,3,4-tetrahydroisoquinoline Chemical compound C1=C=C[C]2CNCCC2=C1 FTSVTCPUMUXYJS-UHFFFAOYSA-N 0.000 description 1
- 125000004605 1,2,3,4-tetrahydroisoquinolinyl group Chemical group C1(NCCC2=CC=CC=C12)* 0.000 description 1
- 125000004607 1,2,3,4-tetrahydroquinolinyl group Chemical group N1(CCCC2=CC=CC=C12)* 0.000 description 1
- 125000004502 1,2,3-oxadiazolyl group Chemical group 0.000 description 1
- 125000004511 1,2,3-thiadiazolyl group Chemical group 0.000 description 1
- 125000004504 1,2,4-oxadiazolyl group Chemical group 0.000 description 1
- 125000004514 1,2,4-thiadiazolyl group Chemical group 0.000 description 1
- 125000004506 1,2,5-oxadiazolyl group Chemical group 0.000 description 1
- 125000004517 1,2,5-thiadiazolyl group Chemical group 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- CFGDUGSIBUXRMR-UHFFFAOYSA-N 1,2-dihydropyrrol-2-ide Chemical compound C=1C=[C-]NC=1 CFGDUGSIBUXRMR-UHFFFAOYSA-N 0.000 description 1
- 125000001781 1,3,4-oxadiazolyl group Chemical group 0.000 description 1
- 125000004520 1,3,4-thiadiazolyl group Chemical group 0.000 description 1
- XMFAAIVNNSITSV-UHFFFAOYSA-N 1,3-dihydropyrrol-3-ide Chemical compound C1=CNC=[C-]1 XMFAAIVNNSITSV-UHFFFAOYSA-N 0.000 description 1
- BDNKZNFMNDZQMI-UHFFFAOYSA-N 1,3-diisopropylcarbodiimide Chemical compound CC(C)N=C=NC(C)C BDNKZNFMNDZQMI-UHFFFAOYSA-N 0.000 description 1
- VAYTZRYEBVHVLE-UHFFFAOYSA-N 1,3-dioxol-2-one Chemical compound O=C1OC=CO1 VAYTZRYEBVHVLE-UHFFFAOYSA-N 0.000 description 1
- WNXJIVFYUVYPPR-UHFFFAOYSA-N 1,3-dioxolane Chemical compound C1COCO1 WNXJIVFYUVYPPR-UHFFFAOYSA-N 0.000 description 1
- OGYGFUAIIOPWQD-UHFFFAOYSA-N 1,3-thiazolidine Chemical compound C1CSCN1 OGYGFUAIIOPWQD-UHFFFAOYSA-N 0.000 description 1
- YNGDWRXWKFWCJY-UHFFFAOYSA-N 1,4-Dihydropyridine Chemical compound C1C=CNC=C1 YNGDWRXWKFWCJY-UHFFFAOYSA-N 0.000 description 1
- APWRZPQBPCAXFP-UHFFFAOYSA-N 1-(1-oxo-2H-isoquinolin-5-yl)-5-(trifluoromethyl)-N-[2-(trifluoromethyl)pyridin-4-yl]pyrazole-4-carboxamide Chemical compound O=C1NC=CC2=C(C=CC=C12)N1N=CC(=C1C(F)(F)F)C(=O)NC1=CC(=NC=C1)C(F)(F)F APWRZPQBPCAXFP-UHFFFAOYSA-N 0.000 description 1
- ZXVWFOMYPHVUGO-UHFFFAOYSA-N 1-(2-methylpropyl)piperidin-4-amine Chemical compound CC(C)CN1CCC(N)CC1 ZXVWFOMYPHVUGO-UHFFFAOYSA-N 0.000 description 1
- JBIHYTKCJCVSPD-UHFFFAOYSA-N 1-(3-chlorophenyl)-n-[(4-pyridin-4-ylphenyl)methyl]indole-2-carboxamide Chemical compound ClC1=CC=CC(N2C3=CC=CC=C3C=C2C(=O)NCC=2C=CC(=CC=2)C=2C=CN=CC=2)=C1 JBIHYTKCJCVSPD-UHFFFAOYSA-N 0.000 description 1
- PTTZBUIZEFYPJB-UHFFFAOYSA-N 1-(4-chlorophenyl)-n-[(4-pyridin-4-ylphenyl)methyl]indole-2-carboxamide Chemical compound C1=CC(Cl)=CC=C1N1C2=CC=CC=C2C=C1C(=O)NCC1=CC=C(C=2C=CN=CC=2)C=C1 PTTZBUIZEFYPJB-UHFFFAOYSA-N 0.000 description 1
- VOWAPKVWYNSFTG-UHFFFAOYSA-N 1-(4-methoxyphenyl)-n-[(4-pyridin-4-ylphenyl)methyl]indole-2-carboxamide Chemical compound C1=CC(OC)=CC=C1N1C2=CC=CC=C2C=C1C(=O)NCC1=CC=C(C=2C=CN=CC=2)C=C1 VOWAPKVWYNSFTG-UHFFFAOYSA-N 0.000 description 1
- PURSZYWBIQIANP-UHFFFAOYSA-N 1-(bromomethyl)-2-chlorobenzene Chemical compound ClC1=CC=CC=C1CBr PURSZYWBIQIANP-UHFFFAOYSA-N 0.000 description 1
- ZKSOJQDNSNJIQW-UHFFFAOYSA-N 1-(bromomethyl)-3-methoxybenzene Chemical compound COC1=CC=CC(CBr)=C1 ZKSOJQDNSNJIQW-UHFFFAOYSA-N 0.000 description 1
- JDNPUJCKXLOHOW-UHFFFAOYSA-N 1-(bromomethyl)-4-(trifluoromethoxy)benzene Chemical compound FC(F)(F)OC1=CC=C(CBr)C=C1 JDNPUJCKXLOHOW-UHFFFAOYSA-N 0.000 description 1
- DNUTZBZXLPWRJG-UHFFFAOYSA-N 1-Piperidine carboxylic acid Chemical compound OC(=O)N1CCCCC1 DNUTZBZXLPWRJG-UHFFFAOYSA-N 0.000 description 1
- FWQFUPSGNFFGTA-UHFFFAOYSA-N 1-[(3-methoxyphenyl)methyl]-n-(4-pyridin-4-ylphenyl)indole-2-carboxamide Chemical compound COC1=CC=CC(CN2C3=CC=CC=C3C=C2C(=O)NC=2C=CC(=CC=2)C=2C=CN=CC=2)=C1 FWQFUPSGNFFGTA-UHFFFAOYSA-N 0.000 description 1
- IJCDPCDHKGAYNO-UHFFFAOYSA-N 1-[(6-chloro-1-benzothiophen-2-yl)methyl]indole-2-carboxylic acid Chemical compound C1=C(Cl)C=C2SC(CN3C4=CC=CC=C4C=C3C(=O)O)=CC2=C1 IJCDPCDHKGAYNO-UHFFFAOYSA-N 0.000 description 1
- DLMIMIWKEZCOGZ-UHFFFAOYSA-N 1-[2-(2,4-dichlorophenyl)ethyl]-n-(1-propan-2-ylpiperidin-4-yl)indole-2-carboxamide Chemical compound C1CN(C(C)C)CCC1NC(=O)C1=CC2=CC=CC=C2N1CCC1=CC=C(Cl)C=C1Cl DLMIMIWKEZCOGZ-UHFFFAOYSA-N 0.000 description 1
- ZPOINDDIXRSATR-UHFFFAOYSA-N 1-[2-(4-chlorophenyl)ethyl]-4-methoxyindole-2-carboxylic acid Chemical compound OC(=O)C1=CC=2C(OC)=CC=CC=2N1CCC1=CC=C(Cl)C=C1 ZPOINDDIXRSATR-UHFFFAOYSA-N 0.000 description 1
- NUKHHRRCGOCYHP-UHFFFAOYSA-N 1-[2-[(5-chloropyridin-2-yl)amino]-2-oxoethyl]-5-methylsulfonylindole-2-carboxylic acid Chemical compound OC(=O)C1=CC2=CC(S(=O)(=O)C)=CC=C2N1CC(=O)NC1=CC=C(Cl)C=N1 NUKHHRRCGOCYHP-UHFFFAOYSA-N 0.000 description 1
- YNGBTQWWOMFMNU-UHFFFAOYSA-N 1-[[5-(5-chlorothiophen-2-yl)-1,2-oxazol-3-yl]methyl]-3-cyano-n-(1-propan-2-ylpiperidin-4-yl)indole-2-carboxamide Chemical compound C1CN(C(C)C)CCC1NC(=O)C1=C(C#N)C2=CC=CC=C2N1CC1=NOC(C=2SC(Cl)=CC=2)=C1 YNGBTQWWOMFMNU-UHFFFAOYSA-N 0.000 description 1
- MLPHCDSYKWYISI-UHFFFAOYSA-N 1-[[5-(5-chlorothiophen-2-yl)-1,2-oxazol-3-yl]methyl]-4-methoxycarbonylindole-2-carboxylic acid Chemical compound OC(=O)C1=CC=2C(C(=O)OC)=CC=CC=2N1CC(=NO1)C=C1C1=CC=C(Cl)S1 MLPHCDSYKWYISI-UHFFFAOYSA-N 0.000 description 1
- LSCQITXXLIDIKD-UHFFFAOYSA-N 1-[[5-(5-chlorothiophen-2-yl)-1,2-oxazol-3-yl]methyl]-5-(hydroxymethyl)-n-(1-propan-2-ylpiperidin-4-yl)indole-2-carboxamide Chemical compound C1CN(C(C)C)CCC1NC(=O)C1=CC2=CC(CO)=CC=C2N1CC1=NOC(C=2SC(Cl)=CC=2)=C1 LSCQITXXLIDIKD-UHFFFAOYSA-N 0.000 description 1
- NOQUMOVTWWSJOA-UHFFFAOYSA-N 1-[[5-(5-chlorothiophen-2-yl)-1,2-oxazol-3-yl]methyl]-5-methoxycarbonylindole-2-carboxylic acid Chemical compound OC(=O)C1=CC2=CC(C(=O)OC)=CC=C2N1CC(=NO1)C=C1C1=CC=C(Cl)S1 NOQUMOVTWWSJOA-UHFFFAOYSA-N 0.000 description 1
- RXJSZFDMGBRIOJ-UHFFFAOYSA-N 1-[[5-(5-chlorothiophen-2-yl)-1,2-oxazol-3-yl]methyl]-5-propan-2-yloxycarbonylindole-2-carboxylic acid Chemical compound OC(=O)C1=CC2=CC(C(=O)OC(C)C)=CC=C2N1CC(=NO1)C=C1C1=CC=C(Cl)S1 RXJSZFDMGBRIOJ-UHFFFAOYSA-N 0.000 description 1
- XDHLEMSKBSBEDC-UHFFFAOYSA-N 1-[[5-(5-chlorothiophen-2-yl)-1,2-oxazol-3-yl]methyl]-n-(1-cyclopropylpiperidin-4-yl)indole-2-carboxamide Chemical compound S1C(Cl)=CC=C1C1=CC(CN2C3=CC=CC=C3C=C2C(=O)NC2CCN(CC2)C2CC2)=NO1 XDHLEMSKBSBEDC-UHFFFAOYSA-N 0.000 description 1
- ZIJGLYMYEJVXBJ-UHFFFAOYSA-N 1-[[5-(5-chlorothiophen-2-yl)-1,2-oxazol-3-yl]methyl]-n-(1-ethylpiperidin-4-yl)-7-methylindole-2-carboxamide Chemical compound C1CN(CC)CCC1NC(=O)C1=CC2=CC=CC(C)=C2N1CC1=NOC(C=2SC(Cl)=CC=2)=C1 ZIJGLYMYEJVXBJ-UHFFFAOYSA-N 0.000 description 1
- ZBYUTHMPEVJBEL-UHFFFAOYSA-N 1-[[5-(5-chlorothiophen-2-yl)-1,2-oxazol-3-yl]methyl]-n-(1-ethylpiperidin-4-yl)indole-2-carboxamide Chemical compound C1CN(CC)CCC1NC(=O)C1=CC2=CC=CC=C2N1CC1=NOC(C=2SC(Cl)=CC=2)=C1 ZBYUTHMPEVJBEL-UHFFFAOYSA-N 0.000 description 1
- WKYZTNUDHMDOAY-UHFFFAOYSA-N 1-[[5-(5-chlorothiophen-2-yl)-1,2-oxazol-3-yl]methyl]-n-(1-propylpiperidin-4-yl)indole-2-carboxamide Chemical compound C1CN(CCC)CCC1NC(=O)C1=CC2=CC=CC=C2N1CC1=NOC(C=2SC(Cl)=CC=2)=C1 WKYZTNUDHMDOAY-UHFFFAOYSA-N 0.000 description 1
- NNWDHTFSPUCMQQ-UHFFFAOYSA-N 1-[[5-(5-chlorothiophen-2-yl)-1,2-oxazol-3-yl]methyl]-n-(1-pyrimidin-4-ylpiperidin-4-yl)indole-2-carboxamide Chemical compound S1C(Cl)=CC=C1C1=CC(CN2C3=CC=CC=C3C=C2C(=O)NC2CCN(CC2)C=2N=CN=CC=2)=NO1 NNWDHTFSPUCMQQ-UHFFFAOYSA-N 0.000 description 1
- CNGMHTSQLMODBT-UHFFFAOYSA-N 1-[[5-(5-chlorothiophen-2-yl)-1,2-oxazol-3-yl]methyl]-n-(4-ethylpiperazin-1-yl)indole-2-carboxamide Chemical compound C1CN(CC)CCN1NC(=O)C1=CC2=CC=CC=C2N1CC1=NOC(C=2SC(Cl)=CC=2)=C1 CNGMHTSQLMODBT-UHFFFAOYSA-N 0.000 description 1
- YXKCQZAYGJLSQA-UHFFFAOYSA-N 1-[[5-(5-chlorothiophen-2-yl)-1,2-oxazol-3-yl]methyl]-n-(4-propan-2-ylpiperazin-1-yl)indole-2-carboxamide Chemical compound C1CN(C(C)C)CCN1NC(=O)C1=CC2=CC=CC=C2N1CC1=NOC(C=2SC(Cl)=CC=2)=C1 YXKCQZAYGJLSQA-UHFFFAOYSA-N 0.000 description 1
- UGHLODFEQUSRJG-UHFFFAOYSA-N 1-[[5-(5-chlorothiophen-2-yl)-1,2-oxazol-3-yl]methyl]-n-[1-(cyanomethyl)piperidin-4-yl]indole-2-carboxamide Chemical compound S1C(Cl)=CC=C1C1=CC(CN2C3=CC=CC=C3C=C2C(=O)NC2CCN(CC#N)CC2)=NO1 UGHLODFEQUSRJG-UHFFFAOYSA-N 0.000 description 1
- VTVNGWNXLGINQY-UHFFFAOYSA-N 1-[[5-(5-chlorothiophen-2-yl)-1,2-oxazol-3-yl]methyl]-n-piperidin-4-ylindole-2-carboxamide Chemical compound S1C(Cl)=CC=C1C1=CC(CN2C3=CC=CC=C3C=C2C(=O)NC2CCNCC2)=NO1 VTVNGWNXLGINQY-UHFFFAOYSA-N 0.000 description 1
- JTZXTKCLAADICV-UHFFFAOYSA-N 1-[[5-(5-chlorothiophen-2-yl)-1,2-oxazol-3-yl]methyl]-n-pyridin-4-yl-n-(1-pyridin-4-ylpiperidin-4-yl)indole-2-carboxamide Chemical compound S1C(Cl)=CC=C1C1=CC(CN2C3=CC=CC=C3C=C2C(=O)N(C2CCN(CC2)C=2C=CN=CC=2)C=2C=CN=CC=2)=NO1 JTZXTKCLAADICV-UHFFFAOYSA-N 0.000 description 1
- ONZWFHWHTYZZLM-UHFFFAOYSA-N 1-chloroethyl cyclohexyl carbonate Chemical compound CC(Cl)OC(=O)OC1CCCCC1 ONZWFHWHTYZZLM-UHFFFAOYSA-N 0.000 description 1
- YVRGKFXJZCTTRB-UHFFFAOYSA-N 1-chloroethyl ethyl carbonate Chemical compound CCOC(=O)OC(C)Cl YVRGKFXJZCTTRB-UHFFFAOYSA-N 0.000 description 1
- XQRNOQYMHPJDCY-UHFFFAOYSA-N 1-cyclopropylpiperidin-4-amine Chemical compound C1CC(N)CCN1C1CC1 XQRNOQYMHPJDCY-UHFFFAOYSA-N 0.000 description 1
- GOLVGZOPWLLUSF-UHFFFAOYSA-N 1-ethylpyrrolidin-3-amine Chemical compound CCN1CCC(N)C1 GOLVGZOPWLLUSF-UHFFFAOYSA-N 0.000 description 1
- PRIGFEJKMMRJSF-UHFFFAOYSA-M 1-fluoro-2,4,6-trimethylpyridin-1-ium;trifluoromethanesulfonate Chemical compound [O-]S(=O)(=O)C(F)(F)F.CC1=CC(C)=[N+](F)C(C)=C1 PRIGFEJKMMRJSF-UHFFFAOYSA-M 0.000 description 1
- JFZMMCYRTJBQQI-UHFFFAOYSA-M 1-fluoropyridin-1-ium;trifluoromethanesulfonate Chemical compound F[N+]1=CC=CC=C1.[O-]S(=O)(=O)C(F)(F)F JFZMMCYRTJBQQI-UHFFFAOYSA-M 0.000 description 1
- UQPQAWFLYZMNRO-UHFFFAOYSA-N 1-methoxyindole-2-carboxylic acid Chemical compound C1=CC=C2N(OC)C(C(O)=O)=CC2=C1 UQPQAWFLYZMNRO-UHFFFAOYSA-N 0.000 description 1
- MAHAMBLNIDMREX-UHFFFAOYSA-N 1-methylindole-2-carboxylic acid Chemical compound C1=CC=C2N(C)C(C(O)=O)=CC2=C1 MAHAMBLNIDMREX-UHFFFAOYSA-N 0.000 description 1
- BWAHBHHABJDRBX-UHFFFAOYSA-N 1-phenylmethoxyindole-2-carboxylic acid Chemical compound OC(=O)C1=CC2=CC=CC=C2N1OCC1=CC=CC=C1 BWAHBHHABJDRBX-UHFFFAOYSA-N 0.000 description 1
- KXIXHISTUVHOCY-UHFFFAOYSA-N 1-propan-2-ylpiperidine Chemical compound CC(C)N1CCCCC1 KXIXHISTUVHOCY-UHFFFAOYSA-N 0.000 description 1
- 125000006017 1-propenyl group Chemical group 0.000 description 1
- 125000000530 1-propynyl group Chemical group [H]C([H])([H])C#C* 0.000 description 1
- ZUEKSECYPXHXAQ-UHFFFAOYSA-N 1-pyrimidin-4-ylpiperidin-4-amine Chemical compound C1CC(N)CCN1C1=CC=NC=N1 ZUEKSECYPXHXAQ-UHFFFAOYSA-N 0.000 description 1
- MXQDWYDUBAAGAF-UHFFFAOYSA-N 1-pyrimidin-4-ylpiperidin-4-amine;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.C1CC(N)CCN1C1=CC=NC=N1 MXQDWYDUBAAGAF-UHFFFAOYSA-N 0.000 description 1
- MBNROFBGTNXXMX-UHFFFAOYSA-N 1h-indole-2,3-dicarboxylic acid Chemical compound C1=CC=C2C(C(O)=O)=C(C(=O)O)NC2=C1 MBNROFBGTNXXMX-UHFFFAOYSA-N 0.000 description 1
- FFQDXZMOBIDDBQ-UHFFFAOYSA-N 2,2-dimethylpropanoyloxymethyl 1-[[5-(5-chlorothiophen-2-yl)-1,2-oxazol-3-yl]methyl]-2-[(1-propan-2-ylpiperidin-4-yl)carbamoyl]indole-4-carboxylate Chemical compound C1CN(C(C)C)CCC1NC(=O)C1=CC2=C(C(=O)OCOC(=O)C(C)(C)C)C=CC=C2N1CC1=NOC(C=2SC(Cl)=CC=2)=C1 FFQDXZMOBIDDBQ-UHFFFAOYSA-N 0.000 description 1
- BTTNYQZNBZNDOR-UHFFFAOYSA-N 2,4-dichloropyrimidine Chemical compound ClC1=CC=NC(Cl)=N1 BTTNYQZNBZNDOR-UHFFFAOYSA-N 0.000 description 1
- JIJGKPVJAALUQQ-UHFFFAOYSA-N 2-(2,4-dichlorophenyl)ethanol Chemical compound OCCC1=CC=C(Cl)C=C1Cl JIJGKPVJAALUQQ-UHFFFAOYSA-N 0.000 description 1
- UPPGEJSCUZMCMW-UHFFFAOYSA-N 2-(3-methoxyphenyl)ethanol Chemical compound COC1=CC=CC(CCO)=C1 UPPGEJSCUZMCMW-UHFFFAOYSA-N 0.000 description 1
- HZFRKZWBVUJYDA-UHFFFAOYSA-N 2-(4-chlorophenyl)ethanol Chemical compound OCCC1=CC=C(Cl)C=C1 HZFRKZWBVUJYDA-UHFFFAOYSA-N 0.000 description 1
- OIWKPVLNEDEDPC-UHFFFAOYSA-N 2-(4-chlorophenyl)ethyl 4-methylbenzenesulfonate Chemical compound C1=CC(C)=CC=C1S(=O)(=O)OCCC1=CC=C(Cl)C=C1 OIWKPVLNEDEDPC-UHFFFAOYSA-N 0.000 description 1
- IMSODMZESSGVBE-UHFFFAOYSA-N 2-Oxazoline Chemical compound C1CN=CO1 IMSODMZESSGVBE-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- KHMNCHDUSFCTGK-UHFFFAOYSA-N 2-aminophenylacetic acid Chemical class NC1=CC=CC=C1CC(O)=O KHMNCHDUSFCTGK-UHFFFAOYSA-N 0.000 description 1
- REXUYBKPWIPONM-UHFFFAOYSA-N 2-bromoacetonitrile Chemical compound BrCC#N REXUYBKPWIPONM-UHFFFAOYSA-N 0.000 description 1
- LDLCZOVUSADOIV-UHFFFAOYSA-N 2-bromoethanol Chemical compound OCCBr LDLCZOVUSADOIV-UHFFFAOYSA-N 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- 125000000069 2-butynyl group Chemical group [H]C([H])([H])C#CC([H])([H])* 0.000 description 1
- HOZLOOPIXHWKCI-UHFFFAOYSA-N 2-chloro-n-methylacetamide Chemical compound CNC(=O)CCl HOZLOOPIXHWKCI-UHFFFAOYSA-N 0.000 description 1
- 125000006029 2-methyl-2-butenyl group Chemical group 0.000 description 1
- 125000005916 2-methylpentyl group Chemical group 0.000 description 1
- CGCWRLDEYHZQCW-UHFFFAOYSA-N 2-nitrophenylpyruvic acid Chemical class OC(=O)C(=O)CC1=CC=CC=C1[N+]([O-])=O CGCWRLDEYHZQCW-UHFFFAOYSA-N 0.000 description 1
- PLAZTCDQAHEYBI-UHFFFAOYSA-N 2-nitrotoluene Chemical class CC1=CC=CC=C1[N+]([O-])=O PLAZTCDQAHEYBI-UHFFFAOYSA-N 0.000 description 1
- XEKVFCUROCMJCH-UHFFFAOYSA-N 2-o-ethyl 5-o-propan-2-yl 1h-indole-2,5-dicarboxylate Chemical compound CC(C)OC(=O)C1=CC=C2NC(C(=O)OCC)=CC2=C1 XEKVFCUROCMJCH-UHFFFAOYSA-N 0.000 description 1
- GFQMPBCEANQRRF-UHFFFAOYSA-N 2-o-tert-butyl 5-o-methyl 1h-indole-2,5-dicarboxylate Chemical compound COC(=O)C1=CC=C2NC(C(=O)OC(C)(C)C)=CC2=C1 GFQMPBCEANQRRF-UHFFFAOYSA-N 0.000 description 1
- VSWICNJIUPRZIK-UHFFFAOYSA-N 2-piperideine Chemical compound C1CNC=CC1 VSWICNJIUPRZIK-UHFFFAOYSA-N 0.000 description 1
- RSEBUVRVKCANEP-UHFFFAOYSA-N 2-pyrroline Chemical compound C1CC=CN1 RSEBUVRVKCANEP-UHFFFAOYSA-N 0.000 description 1
- YZBIEKKAKFEWIL-UHFFFAOYSA-N 3-(2-carboxyethyl)-6-chloro-1h-indole-2-carboxylic acid Chemical compound ClC1=CC=C2C(CCC(=O)O)=C(C(O)=O)NC2=C1 YZBIEKKAKFEWIL-UHFFFAOYSA-N 0.000 description 1
- KQSJKIFUOUFTQO-UHFFFAOYSA-N 3-(2-ethoxy-2-oxoethyl)-1h-indole-2-carboxylic acid Chemical compound C1=CC=C2C(CC(=O)OCC)=C(C(O)=O)NC2=C1 KQSJKIFUOUFTQO-UHFFFAOYSA-N 0.000 description 1
- ORRDZVRYRNYLMB-UHFFFAOYSA-N 3-(bromomethyl)benzamide Chemical compound NC(=O)C1=CC=CC(CBr)=C1 ORRDZVRYRNYLMB-UHFFFAOYSA-N 0.000 description 1
- YGYGASJNJTYNOL-CQSZACIVSA-N 3-[(4r)-2,2-dimethyl-1,1-dioxothian-4-yl]-5-(4-fluorophenyl)-1h-indole-7-carboxamide Chemical compound C1CS(=O)(=O)C(C)(C)C[C@@H]1C1=CNC2=C(C(N)=O)C=C(C=3C=CC(F)=CC=3)C=C12 YGYGASJNJTYNOL-CQSZACIVSA-N 0.000 description 1
- SRVXSISGYBMIHR-UHFFFAOYSA-N 3-[3-[3-(2-amino-2-oxoethyl)phenyl]-5-chlorophenyl]-3-(5-methyl-1,3-thiazol-2-yl)propanoic acid Chemical compound S1C(C)=CN=C1C(CC(O)=O)C1=CC(Cl)=CC(C=2C=C(CC(N)=O)C=CC=2)=C1 SRVXSISGYBMIHR-UHFFFAOYSA-N 0.000 description 1
- TZEVLCOAJTZLBW-UHFFFAOYSA-N 3-[[2-[4-(propan-2-ylamino)piperidine-1-carbonyl]indol-1-yl]methyl]benzamide Chemical compound C1CC(NC(C)C)CCN1C(=O)C1=CC2=CC=CC=C2N1CC1=CC=CC(C(N)=O)=C1 TZEVLCOAJTZLBW-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- KOTZNHLNBDTYMS-UHFFFAOYSA-N 3-bromo-1h-indole-2-carboxylic acid Chemical compound C1=CC=C2C(Br)=C(C(=O)O)NC2=C1 KOTZNHLNBDTYMS-UHFFFAOYSA-N 0.000 description 1
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 1
- JHJKSEKUZNJKGO-UHFFFAOYSA-N 3-methoxybenzenesulfonyl chloride Chemical compound COC1=CC=CC(S(Cl)(=O)=O)=C1 JHJKSEKUZNJKGO-UHFFFAOYSA-N 0.000 description 1
- RUQIUASLAXJZIE-UHFFFAOYSA-N 3-methoxybenzoyl chloride Chemical compound COC1=CC=CC(C(Cl)=O)=C1 RUQIUASLAXJZIE-UHFFFAOYSA-N 0.000 description 1
- 125000005917 3-methylpentyl group Chemical group 0.000 description 1
- DHXISZKSSIWRLH-UHFFFAOYSA-N 4,6-dichloro-1h-indole-2-carboxylic acid Chemical compound C1=C(Cl)C=C2NC(C(=O)O)=CC2=C1Cl DHXISZKSSIWRLH-UHFFFAOYSA-N 0.000 description 1
- GDCKIKSQIWWVNR-UHFFFAOYSA-N 4,6-dimethoxy-1h-indole-2-carboxylic acid Chemical compound COC1=CC(OC)=C2C=C(C(O)=O)NC2=C1 GDCKIKSQIWWVNR-UHFFFAOYSA-N 0.000 description 1
- LMYQVAQDBJJBEM-UHFFFAOYSA-N 4,7-dichloro-1h-indole-2-carboxylic acid Chemical compound C1=CC(Cl)=C2NC(C(=O)O)=CC2=C1Cl LMYQVAQDBJJBEM-UHFFFAOYSA-N 0.000 description 1
- FJWNGDWJFIQNEG-UHFFFAOYSA-N 4,7-dimethoxy-1h-indole-2-carboxylic acid Chemical compound COC1=CC=C(OC)C2=C1C=C(C(O)=O)N2 FJWNGDWJFIQNEG-UHFFFAOYSA-N 0.000 description 1
- UEJQTBKTWJQBRN-UHFFFAOYSA-N 4-(chloromethyl)-2-(4-chlorophenyl)-1,3-thiazole Chemical compound ClCC1=CSC(C=2C=CC(Cl)=CC=2)=N1 UEJQTBKTWJQBRN-UHFFFAOYSA-N 0.000 description 1
- HYNHPPYCTSYSFS-UHFFFAOYSA-N 4-(chloromethyl)-3-(4-chlorophenyl)-1,2-oxazole Chemical compound ClCC=1C(=NOC1)C1=CC=C(C=C1)Cl HYNHPPYCTSYSFS-UHFFFAOYSA-N 0.000 description 1
- MOVKDRSEEJWXRI-UHFFFAOYSA-N 4-(trifluoromethyl)-1h-indole-2-carboxylic acid Chemical compound C1=CC=C2NC(C(=O)O)=CC2=C1C(F)(F)F MOVKDRSEEJWXRI-UHFFFAOYSA-N 0.000 description 1
- VJPPLCNBDLZIFG-ZDUSSCGKSA-N 4-[(3S)-3-(but-2-ynoylamino)piperidin-1-yl]-5-fluoro-2,3-dimethyl-1H-indole-7-carboxamide Chemical compound C(C#CC)(=O)N[C@@H]1CN(CCC1)C1=C2C(=C(NC2=C(C=C1F)C(=O)N)C)C VJPPLCNBDLZIFG-ZDUSSCGKSA-N 0.000 description 1
- NQNQKLBWDARKDG-UHFFFAOYSA-N 4-amino-1-piperidinecarboxylic acid Chemical compound NC1CCN(C(O)=O)CC1 NQNQKLBWDARKDG-UHFFFAOYSA-N 0.000 description 1
- GAMYYCRTACQSBR-UHFFFAOYSA-N 4-azabenzimidazole Chemical compound C1=CC=C2NC=NC2=N1 GAMYYCRTACQSBR-UHFFFAOYSA-N 0.000 description 1
- WUCPCORZZJWVHG-UHFFFAOYSA-N 4-bromo-2-propylthiophene Chemical compound CCCC1=CC(Br)=CS1 WUCPCORZZJWVHG-UHFFFAOYSA-N 0.000 description 1
- VXZHQADIRFFCMJ-UHFFFAOYSA-N 4-chloro-1h-indole-2-carboxylic acid Chemical compound C1=CC=C2NC(C(=O)O)=CC2=C1Cl VXZHQADIRFFCMJ-UHFFFAOYSA-N 0.000 description 1
- CSFDTBRRIBJILD-UHFFFAOYSA-N 4-chloro-2-fluoroaniline Chemical compound NC1=CC=C(Cl)C=C1F CSFDTBRRIBJILD-UHFFFAOYSA-N 0.000 description 1
- QSNSCYSYFYORTR-UHFFFAOYSA-N 4-chloroaniline Chemical compound NC1=CC=C(Cl)C=C1 QSNSCYSYFYORTR-UHFFFAOYSA-N 0.000 description 1
- PVMNPAUTCMBOMO-UHFFFAOYSA-N 4-chloropyridine Chemical compound ClC1=CC=NC=C1 PVMNPAUTCMBOMO-UHFFFAOYSA-N 0.000 description 1
- VLVCDUSVTXIWGW-UHFFFAOYSA-N 4-iodoaniline Chemical compound NC1=CC=C(I)C=C1 VLVCDUSVTXIWGW-UHFFFAOYSA-N 0.000 description 1
- 125000006306 4-iodophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1I 0.000 description 1
- AEOMOQMOFDQVQH-UHFFFAOYSA-N 4-methoxy-1-[(3-methoxyphenyl)methyl]-n-(1-propan-2-ylpiperidin-4-yl)indole-2-carboxamide Chemical compound COC1=CC=CC(CN2C3=CC=CC(OC)=C3C=C2C(=O)NC2CCN(CC2)C(C)C)=C1 AEOMOQMOFDQVQH-UHFFFAOYSA-N 0.000 description 1
- PJROITSVDOANGD-UHFFFAOYSA-N 4-methoxycarbonyl-1h-indole-2-carboxylic acid Chemical compound COC(=O)C1=CC=CC2=C1C=C(C(O)=O)N2 PJROITSVDOANGD-UHFFFAOYSA-N 0.000 description 1
- QMSCXKCJGFIXDF-UHFFFAOYSA-N 4-methyl-1h-indole-2-carboxylic acid Chemical compound CC1=CC=CC2=C1C=C(C(O)=O)N2 QMSCXKCJGFIXDF-UHFFFAOYSA-N 0.000 description 1
- RJWLLQWLBMJCFD-UHFFFAOYSA-N 4-methylpiperazin-1-amine Chemical compound CN1CCN(N)CC1 RJWLLQWLBMJCFD-UHFFFAOYSA-N 0.000 description 1
- 125000004195 4-methylpiperazin-1-yl group Chemical group [H]C([H])([H])N1C([H])([H])C([H])([H])N(*)C([H])([H])C1([H])[H] 0.000 description 1
- UNKDCRUEJJZIIB-UHFFFAOYSA-N 4-piperidin-4-yloxypyridine Chemical compound C1CNCCC1OC1=CC=NC=C1 UNKDCRUEJJZIIB-UHFFFAOYSA-N 0.000 description 1
- WHLOJVAAKSVMKB-UHFFFAOYSA-N 4-propan-2-ylpiperazin-1-amine Chemical compound CC(C)N1CCN(N)CC1 WHLOJVAAKSVMKB-UHFFFAOYSA-N 0.000 description 1
- STWODXDTKGTVCJ-UHFFFAOYSA-N 4-pyrrolidin-1-ylpiperidine Chemical compound C1CCCN1C1CCNCC1 STWODXDTKGTVCJ-UHFFFAOYSA-N 0.000 description 1
- WRDWWAVNELMWAM-UHFFFAOYSA-N 4-tert-butylaniline Chemical compound CC(C)(C)C1=CC=C(N)C=C1 WRDWWAVNELMWAM-UHFFFAOYSA-N 0.000 description 1
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 1
- UZHQHNDRVITJPL-UHFFFAOYSA-N 5,6-dimethoxy-1h-indole-2-carboxylic acid Chemical compound C1=C(OC)C(OC)=CC2=C1NC(C(O)=O)=C2 UZHQHNDRVITJPL-UHFFFAOYSA-N 0.000 description 1
- QILAXMNESNFYJG-UHFFFAOYSA-N 5,7-dichloro-1h-indole-2-carboxylic acid Chemical compound ClC1=CC(Cl)=C2NC(C(=O)O)=CC2=C1 QILAXMNESNFYJG-UHFFFAOYSA-N 0.000 description 1
- BJVYSQGEJHKTBW-UHFFFAOYSA-N 5-(chloromethyl)-3-(4-chlorophenyl)-1,2,4-oxadiazole Chemical compound O1C(CCl)=NC(C=2C=CC(Cl)=CC=2)=N1 BJVYSQGEJHKTBW-UHFFFAOYSA-N 0.000 description 1
- YUMRTSLYUVLHQK-UHFFFAOYSA-N 5-bromo-3-methyl-1h-indole-2-carboxylic acid Chemical compound C1=C(Br)C=C2C(C)=C(C(O)=O)NC2=C1 YUMRTSLYUVLHQK-UHFFFAOYSA-N 0.000 description 1
- VHJNNWZGANFTEB-UHFFFAOYSA-N 5-chloro-1-[(3-methoxyphenyl)methyl]-n-(1-propan-2-ylpiperidin-4-yl)indole-2-carboxamide Chemical compound COC1=CC=CC(CN2C3=CC=C(Cl)C=C3C=C2C(=O)NC2CCN(CC2)C(C)C)=C1 VHJNNWZGANFTEB-UHFFFAOYSA-N 0.000 description 1
- FUQOTYRCMBZFOL-UHFFFAOYSA-N 5-chloro-1H-indole-2-carboxylic acid Chemical compound ClC1=CC=C2NC(C(=O)O)=CC2=C1 FUQOTYRCMBZFOL-UHFFFAOYSA-N 0.000 description 1
- MAXBVGJEFDMHNV-UHFFFAOYSA-N 5-chloropyridin-2-amine Chemical compound NC1=CC=C(Cl)C=N1 MAXBVGJEFDMHNV-UHFFFAOYSA-N 0.000 description 1
- WTXBRZCVLDTWLP-UHFFFAOYSA-N 5-fluoro-1H-indole-2-carboxylic acid Chemical compound FC1=CC=C2NC(C(=O)O)=CC2=C1 WTXBRZCVLDTWLP-UHFFFAOYSA-N 0.000 description 1
- 125000006043 5-hexenyl group Chemical group 0.000 description 1
- KDLHRCGYOILAFD-UHFFFAOYSA-N 5-methoxycarbonyl-1h-indole-2-carboxylic acid Chemical compound COC(=O)C1=CC=C2NC(C(O)=O)=CC2=C1 KDLHRCGYOILAFD-UHFFFAOYSA-N 0.000 description 1
- YEBJVSLNUMZXRJ-UHFFFAOYSA-N 5-methoxyindole-2-carboxylic acid Chemical compound COC1=CC=C2NC(C(O)=O)=CC2=C1 YEBJVSLNUMZXRJ-UHFFFAOYSA-N 0.000 description 1
- OMDMAZNVKWBUDD-UHFFFAOYSA-N 5-methylsulfonyl-1h-indole-2-carboxylic acid Chemical compound CS(=O)(=O)C1=CC=C2NC(C(O)=O)=CC2=C1 OMDMAZNVKWBUDD-UHFFFAOYSA-N 0.000 description 1
- LHFOJSCXLFKDIR-UHFFFAOYSA-N 5-nitro-1h-indole-2-carboxylic acid Chemical compound [O-][N+](=O)C1=CC=C2NC(C(=O)O)=CC2=C1 LHFOJSCXLFKDIR-UHFFFAOYSA-N 0.000 description 1
- MVCLSAMNMAWXFQ-UHFFFAOYSA-N 5-phenylmethoxy-1h-indole-2-carboxylic acid Chemical compound C=1C=C2NC(C(=O)O)=CC2=CC=1OCC1=CC=CC=C1 MVCLSAMNMAWXFQ-UHFFFAOYSA-N 0.000 description 1
- OFKCWDHRSIVZST-UHFFFAOYSA-N 7-(2,2-dimethylpropanoylamino)-1h-indole-2-carboxylic acid Chemical compound CC(C)(C)C(=O)NC1=CC=CC2=C1NC(C(O)=O)=C2 OFKCWDHRSIVZST-UHFFFAOYSA-N 0.000 description 1
- BIUCOFQROHIAEO-UHFFFAOYSA-N 7-nitroindole-2-carboxylic acid Chemical compound C1=CC([N+]([O-])=O)=C2NC(C(=O)O)=CC2=C1 BIUCOFQROHIAEO-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- ZRPZPNYZFSJUPA-UHFFFAOYSA-N ARS-1620 Chemical compound Oc1cccc(F)c1-c1c(Cl)cc2c(ncnc2c1F)N1CCN(CC1)C(=O)C=C ZRPZPNYZFSJUPA-UHFFFAOYSA-N 0.000 description 1
- 206010003162 Arterial injury Diseases 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- 108010017384 Blood Proteins Proteins 0.000 description 1
- 102000004506 Blood Proteins Human genes 0.000 description 1
- IGMQROMDZADDOH-UHFFFAOYSA-N C1=C(SC(=C1)Cl)C2=NOC=C2CBr Chemical compound C1=C(SC(=C1)Cl)C2=NOC=C2CBr IGMQROMDZADDOH-UHFFFAOYSA-N 0.000 description 1
- 125000004648 C2-C8 alkenyl group Chemical group 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-N Carbamic acid Chemical group NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 241001432959 Chernes Species 0.000 description 1
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 1
- 208000017667 Chronic Disease Diseases 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- 108010088842 Fibrinolysin Proteins 0.000 description 1
- 238000006641 Fischer synthesis reaction Methods 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 239000007821 HATU Substances 0.000 description 1
- HTTJABKRGRZYRN-UHFFFAOYSA-N Heparin Chemical compound OC1C(NC(=O)C)C(O)OC(COS(O)(=O)=O)C1OC1C(OS(O)(=O)=O)C(O)C(OC2C(C(OS(O)(=O)=O)C(OC3C(C(O)C(O)C(O3)C(O)=O)OS(O)(=O)=O)C(CO)O2)NS(O)(=O)=O)C(C(O)=O)O1 HTTJABKRGRZYRN-UHFFFAOYSA-N 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- 101000796022 Homo sapiens Thioredoxin-interacting protein Proteins 0.000 description 1
- 235000010650 Hyssopus officinalis Nutrition 0.000 description 1
- 240000001812 Hyssopus officinalis Species 0.000 description 1
- WRYCSMQKUKOKBP-UHFFFAOYSA-N Imidazolidine Chemical compound C1CNCN1 WRYCSMQKUKOKBP-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 238000006861 Madelung synthesis reaction Methods 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 1
- MRLVFVTVXSKAMX-UHFFFAOYSA-N Methyl 4-amino-3-iodobenzoate Chemical compound COC(=O)C1=CC=C(N)C(I)=C1 MRLVFVTVXSKAMX-UHFFFAOYSA-N 0.000 description 1
- FEYNFHSRETUBEM-UHFFFAOYSA-N N-[3-(1,1-difluoroethyl)phenyl]-1-(4-methoxyphenyl)-3-methyl-5-oxo-4H-pyrazole-4-carboxamide Chemical compound COc1ccc(cc1)N1N=C(C)C(C(=O)Nc2cccc(c2)C(C)(F)F)C1=O FEYNFHSRETUBEM-UHFFFAOYSA-N 0.000 description 1
- 230000006181 N-acylation Effects 0.000 description 1
- 239000007832 Na2SO4 Substances 0.000 description 1
- 206010028980 Neoplasm Diseases 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- WYNCHZVNFNFDNH-UHFFFAOYSA-N Oxazolidine Chemical compound C1COCN1 WYNCHZVNFNFDNH-UHFFFAOYSA-N 0.000 description 1
- 241000282520 Papio Species 0.000 description 1
- 229920002594 Polyethylene Glycol 8000 Polymers 0.000 description 1
- 206010040047 Sepsis Diseases 0.000 description 1
- 108010022999 Serine Proteases Proteins 0.000 description 1
- 102000012479 Serine Proteases Human genes 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 102100031344 Thioredoxin-interacting protein Human genes 0.000 description 1
- 229940122388 Thrombin inhibitor Drugs 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- 108090000631 Trypsin Proteins 0.000 description 1
- 102000004142 Trypsin Human genes 0.000 description 1
- 208000027418 Wounds and injury Diseases 0.000 description 1
- GAZVSNAEUUUDEK-JDSLSITLSA-N [(1r,3r,4s)-4,7,7-trimethyl-3-bicyclo[2.2.1]heptanyl] 2-hydroxybenzoate Chemical compound O([C@H]1[C@@]2(C)CC[C@H](C1)C2(C)C)C(=O)C1=CC=CC=C1O GAZVSNAEUUUDEK-JDSLSITLSA-N 0.000 description 1
- BBAWTPDTGRXPDG-UHFFFAOYSA-N [1,3]thiazolo[4,5-b]pyridine Chemical compound C1=CC=C2SC=NC2=N1 BBAWTPDTGRXPDG-UHFFFAOYSA-N 0.000 description 1
- 238000002835 absorbance Methods 0.000 description 1
- IKHGUXGNUITLKF-XPULMUKRSA-N acetaldehyde Chemical compound [14CH]([14CH3])=O IKHGUXGNUITLKF-XPULMUKRSA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- PBCJIPOGFJYBJE-UHFFFAOYSA-N acetonitrile;hydrate Chemical compound O.CC#N PBCJIPOGFJYBJE-UHFFFAOYSA-N 0.000 description 1
- 238000007171 acid catalysis Methods 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 238000012382 advanced drug delivery Methods 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 150000001345 alkine derivatives Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 125000000304 alkynyl group Chemical group 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 238000010640 amide synthesis reaction Methods 0.000 description 1
- 238000005576 amination reaction Methods 0.000 description 1
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 238000005349 anion exchange Methods 0.000 description 1
- 230000002785 anti-thrombosis Effects 0.000 description 1
- 229940127090 anticoagulant agent Drugs 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 150000001499 aryl bromides Chemical class 0.000 description 1
- 150000001501 aryl fluorides Chemical class 0.000 description 1
- ZSIQJIWKELUFRJ-UHFFFAOYSA-N azepane Chemical compound C1CCCNCC1 ZSIQJIWKELUFRJ-UHFFFAOYSA-N 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 125000004931 azocinyl group Chemical group N1=C(C=CC=CC=C1)* 0.000 description 1
- 230000001580 bacterial effect Effects 0.000 description 1
- JPYQFYIEOUVJDU-UHFFFAOYSA-N beclamide Chemical compound ClCCC(=O)NCC1=CC=CC=C1 JPYQFYIEOUVJDU-UHFFFAOYSA-N 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 125000004604 benzisothiazolyl group Chemical group S1N=C(C2=C1C=CC=C2)* 0.000 description 1
- 125000004603 benzisoxazolyl group Chemical group O1N=C(C2=C1C=CC=C2)* 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- IOJUPLGTWVMSFF-UHFFFAOYSA-N benzothiazole Chemical group C1=CC=C2SC=NC2=C1 IOJUPLGTWVMSFF-UHFFFAOYSA-N 0.000 description 1
- 125000005512 benztetrazolyl group Chemical group 0.000 description 1
- YVBGFNPXYFYEIX-UHFFFAOYSA-N benzyl 1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]indole-2-carboxylate Chemical compound C=1C2=CC=CC=C2N(CC(=O)OC(C)(C)C)C=1C(=O)OCC1=CC=CC=C1 YVBGFNPXYFYEIX-UHFFFAOYSA-N 0.000 description 1
- GBVAGZMJJSANDQ-UHFFFAOYSA-N benzyl 1h-indole-2-carboxylate Chemical compound C=1C2=CC=CC=C2NC=1C(=O)OCC1=CC=CC=C1 GBVAGZMJJSANDQ-UHFFFAOYSA-N 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- 229960004217 benzyl alcohol Drugs 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 210000000601 blood cell Anatomy 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- ZADPBFCGQRWHPN-UHFFFAOYSA-N boronic acid Chemical compound OBO ZADPBFCGQRWHPN-UHFFFAOYSA-N 0.000 description 1
- 230000031709 bromination Effects 0.000 description 1
- 238000005893 bromination reaction Methods 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 201000011510 cancer Diseases 0.000 description 1
- 125000000609 carbazolyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3NC12)* 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 125000004623 carbolinyl group Chemical group 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 229910002091 carbon monoxide Inorganic materials 0.000 description 1
- 150000004651 carbonic acid esters Chemical class 0.000 description 1
- 150000001728 carbonyl compounds Chemical class 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 238000005341 cation exchange Methods 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- DGLFSNZWRYADFC-UHFFFAOYSA-N chembl2334586 Chemical compound C1CCC2=CN=C(N)N=C2C2=C1NC1=CC=C(C#CC(C)(O)C)C=C12 DGLFSNZWRYADFC-UHFFFAOYSA-N 0.000 description 1
- 238000007385 chemical modification Methods 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- VXIVSQZSERGHQP-UHFFFAOYSA-N chloroacetamide Chemical compound NC(=O)CCl VXIVSQZSERGHQP-UHFFFAOYSA-N 0.000 description 1
- BULLHNJGPPOUOX-UHFFFAOYSA-N chloroacetone Chemical compound CC(=O)CCl BULLHNJGPPOUOX-UHFFFAOYSA-N 0.000 description 1
- 125000004230 chromenyl group Chemical group O1C(C=CC2=CC=CC=C12)* 0.000 description 1
- 239000003593 chromogenic compound Substances 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- OPQARKPSCNTWTJ-UHFFFAOYSA-L copper(ii) acetate Chemical compound [Cu+2].CC([O-])=O.CC([O-])=O OPQARKPSCNTWTJ-UHFFFAOYSA-L 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 229940099112 cornstarch Drugs 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 238000006114 decarboxylation reaction Methods 0.000 description 1
- 238000013461 design Methods 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 239000012954 diazonium Substances 0.000 description 1
- 150000001989 diazonium salts Chemical class 0.000 description 1
- UQBKNQILGHFDMC-UHFFFAOYSA-N dichloro(phenyl)methanamine Chemical compound NC(Cl)(Cl)C1=CC=CC=C1 UQBKNQILGHFDMC-UHFFFAOYSA-N 0.000 description 1
- 229960004132 diethyl ether Drugs 0.000 description 1
- BGRWYRAHAFMIBJ-UHFFFAOYSA-N diisopropylcarbodiimide Natural products CC(C)NC(=O)NC(C)C BGRWYRAHAFMIBJ-UHFFFAOYSA-N 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- XHFGWHUWQXTGAT-UHFFFAOYSA-N dimethylamine hydrochloride Natural products CNC(C)C XHFGWHUWQXTGAT-UHFFFAOYSA-N 0.000 description 1
- IQDGSYLLQPDQDV-UHFFFAOYSA-N dimethylazanium;chloride Chemical compound Cl.CNC IQDGSYLLQPDQDV-UHFFFAOYSA-N 0.000 description 1
- UXGNZZKBCMGWAZ-UHFFFAOYSA-N dimethylformamide dmf Chemical compound CN(C)C=O.CN(C)C=O UXGNZZKBCMGWAZ-UHFFFAOYSA-N 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- 208000035475 disorder Diseases 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000007876 drug discovery Methods 0.000 description 1
- 239000012039 electrophile Substances 0.000 description 1
- 238000007345 electrophilic aromatic substitution reaction Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 238000006266 etherification reaction Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 229940052303 ethers for general anesthesia Drugs 0.000 description 1
- NPHNRHIEJQTMNC-UHFFFAOYSA-N ethyl 1-[2-(2,4-dichlorophenyl)ethyl]indole-2-carboxylate Chemical compound CCOC(=O)C1=CC2=CC=CC=C2N1CCC1=CC=C(Cl)C=C1Cl NPHNRHIEJQTMNC-UHFFFAOYSA-N 0.000 description 1
- FBXQMKZUDBFFPB-UHFFFAOYSA-N ethyl 1-[[5-(5-chlorothiophen-2-yl)-1,2-oxazol-3-yl]methyl]-2-[(1-propan-2-ylpiperidin-4-yl)carbamoyl]indole-5-carboxylate Chemical compound C1CN(C(C)C)CCC1NC(=O)C1=CC2=CC(C(=O)OCC)=CC=C2N1CC(=NO1)C=C1C1=CC=C(Cl)S1 FBXQMKZUDBFFPB-UHFFFAOYSA-N 0.000 description 1
- BSEGLNNFMGYNDX-UHFFFAOYSA-N ethyl 3-chloro-1h-indole-2-carboxylate Chemical compound C1=CC=C2C(Cl)=C(C(=O)OCC)NC2=C1 BSEGLNNFMGYNDX-UHFFFAOYSA-N 0.000 description 1
- PQJJJMRNHATNKG-UHFFFAOYSA-N ethyl bromoacetate Chemical compound CCOC(=O)CBr PQJJJMRNHATNKG-UHFFFAOYSA-N 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 239000003925 fat Substances 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000003682 fluorination reaction Methods 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 239000012634 fragment Substances 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 125000003838 furazanyl group Chemical group 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 125000003630 glycyl group Chemical group [H]N([H])C([H])([H])C(*)=O 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229960002897 heparin Drugs 0.000 description 1
- 229920000669 heparin Polymers 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000004128 high performance liquid chromatography Methods 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- KRGRHIQRVYJCIG-UHFFFAOYSA-N hydron;1-propan-2-ylpiperidin-4-amine;dichloride Chemical compound Cl.Cl.CC(C)N1CCC(N)CC1 KRGRHIQRVYJCIG-UHFFFAOYSA-N 0.000 description 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 1
- 125000000336 imidazol-5-yl group Chemical group [H]N1C([H])=NC([H])=C1[*] 0.000 description 1
- JBFYUZGYRGXSFL-UHFFFAOYSA-N imidazolide Chemical compound C1=C[N-]C=N1 JBFYUZGYRGXSFL-UHFFFAOYSA-N 0.000 description 1
- 125000002632 imidazolidinyl group Chemical group 0.000 description 1
- MTNDZQHUAFNZQY-UHFFFAOYSA-N imidazoline Chemical compound C1CN=CN1 MTNDZQHUAFNZQY-UHFFFAOYSA-N 0.000 description 1
- 125000002636 imidazolinyl group Chemical group 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 125000000593 indol-1-yl group Chemical group [H]C1=C([H])C([H])=C2N([*])C([H])=C([H])C2=C1[H] 0.000 description 1
- 125000002249 indol-2-yl group Chemical group [H]C1=C([H])C([H])=C2N([H])C([*])=C([H])C2=C1[H] 0.000 description 1
- 125000000814 indol-3-yl group Chemical group [H]C1=C([H])C([H])=C2N([H])C([H])=C([*])C2=C1[H] 0.000 description 1
- 125000004531 indol-5-yl group Chemical group [H]N1C([H])=C([H])C2=C([H])C(*)=C([H])C([H])=C12 0.000 description 1
- 239000003617 indole-3-acetic acid Substances 0.000 description 1
- LPAGFVYQRIESJQ-UHFFFAOYSA-N indoline Chemical class C1=CC=C2NCCC2=C1 LPAGFVYQRIESJQ-UHFFFAOYSA-N 0.000 description 1
- 125000003387 indolinyl group Chemical group N1(CCC2=CC=CC=C12)* 0.000 description 1
- 125000003406 indolizinyl group Chemical group C=1(C=CN2C=CC=CC12)* 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 239000003978 infusion fluid Substances 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 208000014674 injury Diseases 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 229960004903 invert sugar Drugs 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- MGFYSGNNHQQTJW-UHFFFAOYSA-N iodonium Chemical compound [IH2+] MGFYSGNNHQQTJW-UHFFFAOYSA-N 0.000 description 1
- 235000013847 iso-butane Nutrition 0.000 description 1
- 125000001977 isobenzofuranyl group Chemical group C=1(OC=C2C=CC=CC12)* 0.000 description 1
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 1
- 125000005438 isoindazolyl group Chemical group 0.000 description 1
- GWVMLCQWXVFZCN-UHFFFAOYSA-N isoindoline Chemical compound C1=CC=C2CNCC2=C1 GWVMLCQWXVFZCN-UHFFFAOYSA-N 0.000 description 1
- 125000004594 isoindolinyl group Chemical group C1(NCC2=CC=CC=C12)* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004551 isoquinolin-3-yl group Chemical group C1=NC(=CC2=CC=CC=C12)* 0.000 description 1
- 125000004552 isoquinolin-4-yl group Chemical group C1=NC=C(C2=CC=CC=C12)* 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 238000003367 kinetic assay Methods 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 230000000670 limiting effect Effects 0.000 description 1
- 238000012417 linear regression Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000006138 lithiation reaction Methods 0.000 description 1
- 210000004185 liver Anatomy 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 125000005905 mesyloxy group Chemical group 0.000 description 1
- 239000002207 metabolite Substances 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- XXEVPROBSOHXIT-UHFFFAOYSA-N methyl 1-[[5-(5-chlorothiophen-2-yl)-1,2-oxazol-3-yl]methyl]-2-[(1-propan-2-ylpiperidin-4-yl)carbamoyl]indole-4-carboxylate Chemical compound C1CN(C(C)C)CCC1NC(=O)C1=CC=2C(C(=O)OC)=CC=CC=2N1CC(=NO1)C=C1C1=CC=C(Cl)S1 XXEVPROBSOHXIT-UHFFFAOYSA-N 0.000 description 1
- QJGHUFGKFYHBBN-UHFFFAOYSA-N methyl 1-[[5-(5-chlorothiophen-2-yl)-1,2-oxazol-3-yl]methyl]-2-[(1-propan-2-ylpiperidin-4-yl)carbamoyl]indole-5-carboxylate Chemical compound C1CN(C(C)C)CCC1NC(=O)C1=CC2=CC(C(=O)OC)=CC=C2N1CC(=NO1)C=C1C1=CC=C(Cl)S1 QJGHUFGKFYHBBN-UHFFFAOYSA-N 0.000 description 1
- TUKXPFPRMUZOJC-UHFFFAOYSA-N methyl 1-chloroindole-2-carboxylate Chemical compound C1=CC=C2N(Cl)C(C(=O)OC)=CC2=C1 TUKXPFPRMUZOJC-UHFFFAOYSA-N 0.000 description 1
- CGVCRYXJUKSGET-UHFFFAOYSA-N methyl 1-fluoroindole-2-carboxylate Chemical compound COC(=O)C=1N(C2=CC=CC=C2C=1)F CGVCRYXJUKSGET-UHFFFAOYSA-N 0.000 description 1
- ACBWWWIGOQIBMS-UHFFFAOYSA-N methyl 2-hydroxy-3-phenylmethoxypropanoate Chemical compound COC(=O)C(O)COCC1=CC=CC=C1 ACBWWWIGOQIBMS-UHFFFAOYSA-N 0.000 description 1
- AXJGVTDNUULIKN-UHFFFAOYSA-N methyl 4,4,5,5,6,6,7,7-octafluoro-3-oxoheptanoate Chemical compound COC(=O)CC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)F AXJGVTDNUULIKN-UHFFFAOYSA-N 0.000 description 1
- ZMDWACYWJDIIJP-UHFFFAOYSA-N methyl 5,7-difluoro-1h-indole-2-carboxylate Chemical compound FC1=CC(F)=C2NC(C(=O)OC)=CC2=C1 ZMDWACYWJDIIJP-UHFFFAOYSA-N 0.000 description 1
- NVOKZHQKGPZQFP-UHFFFAOYSA-N methyl 5-methylsulfonyl-1h-indole-2-carboxylate Chemical compound CS(=O)(=O)C1=CC=C2NC(C(=O)OC)=CC2=C1 NVOKZHQKGPZQFP-UHFFFAOYSA-N 0.000 description 1
- XMJHPCRAQCTCFT-UHFFFAOYSA-N methyl chloroformate Chemical compound COC(Cl)=O XMJHPCRAQCTCFT-UHFFFAOYSA-N 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- AWXXNBQGZBENFO-UHFFFAOYSA-N morpholine Chemical compound C1COCCN1.C1COCCN1 AWXXNBQGZBENFO-UHFFFAOYSA-N 0.000 description 1
- 125000002757 morpholinyl group Chemical group 0.000 description 1
- WPQSESLBDJWWHA-UHFFFAOYSA-N n,n-dichloro-1-phenylmethanamine Chemical compound ClN(Cl)CC1=CC=CC=C1 WPQSESLBDJWWHA-UHFFFAOYSA-N 0.000 description 1
- GIPCBGDQVGKMPO-UHFFFAOYSA-N n-(1-isopropylpiperidin-4-yl)-1-(3-methoxybenzyl)-1h-indole-2-carboxamide Chemical compound COC1=CC=CC(CN2C3=CC=CC=C3C=C2C(=O)NC2CCN(CC2)C(C)C)=C1 GIPCBGDQVGKMPO-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- NNKPHNTWNILINE-UHFFFAOYSA-N n-cyclopropyl-3-fluoro-4-methyl-5-[3-[[1-[2-[2-(methylamino)ethoxy]phenyl]cyclopropyl]amino]-2-oxopyrazin-1-yl]benzamide Chemical compound CNCCOC1=CC=CC=C1C1(NC=2C(N(C=3C(=C(F)C=C(C=3)C(=O)NC3CC3)C)C=CN=2)=O)CC1 NNKPHNTWNILINE-UHFFFAOYSA-N 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004593 naphthyridinyl group Chemical group N1=C(C=CC2=CC=CN=C12)* 0.000 description 1
- 239000007922 nasal spray Substances 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 125000004930 octahydroisoquinolinyl group Chemical group C1(NCCC2CCCC=C12)* 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 238000006053 organic reaction Methods 0.000 description 1
- 230000003204 osmotic effect Effects 0.000 description 1
- 125000001715 oxadiazolyl group Chemical group 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 150000003901 oxalic acid esters Chemical class 0.000 description 1
- JMJRYTGVHCAYCT-UHFFFAOYSA-N oxan-4-one Chemical compound O=C1CCOCC1 JMJRYTGVHCAYCT-UHFFFAOYSA-N 0.000 description 1
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 238000010647 peptide synthesis reaction Methods 0.000 description 1
- 239000008194 pharmaceutical composition Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 125000004934 phenanthridinyl group Chemical group C1(=CC=CC2=NC=C3C=CC=CC3=C12)* 0.000 description 1
- 125000004625 phenanthrolinyl group Chemical group N1=C(C=CC2=CC=C3C=CC=NC3=C12)* 0.000 description 1
- 125000001791 phenazinyl group Chemical group C1(=CC=CC2=NC3=CC=CC=C3N=C12)* 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 125000001484 phenothiazinyl group Chemical group C1(=CC=CC=2SC3=CC=CC=C3NC12)* 0.000 description 1
- 125000005954 phenoxathiinyl group Chemical group 0.000 description 1
- 125000001644 phenoxazinyl group Chemical group C1(=CC=CC=2OC3=CC=CC=C3NC12)* 0.000 description 1
- 150000007925 phenylethylamine derivatives Chemical class 0.000 description 1
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- 230000004962 physiological condition Effects 0.000 description 1
- VHBNPKSIIFEKSA-UHFFFAOYSA-N piperidin-4-ylmethylcarbamic acid Chemical compound OC(=O)NCC1CCNCC1 VHBNPKSIIFEKSA-UHFFFAOYSA-N 0.000 description 1
- IUGYQRQAERSCNH-UHFFFAOYSA-N pivalic acid Chemical compound CC(C)(C)C(O)=O IUGYQRQAERSCNH-UHFFFAOYSA-N 0.000 description 1
- 229940012957 plasmin Drugs 0.000 description 1
- LZMJNVRJMFMYQS-UHFFFAOYSA-N poseltinib Chemical compound C1CN(C)CCN1C(C=C1)=CC=C1NC1=NC(OC=2C=C(NC(=O)C=C)C=CC=2)=C(OC=C2)C2=N1 LZMJNVRJMFMYQS-UHFFFAOYSA-N 0.000 description 1
- GKKCIDNWFBPDBW-UHFFFAOYSA-M potassium cyanate Chemical compound [K]OC#N GKKCIDNWFBPDBW-UHFFFAOYSA-M 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 125000001844 prenyl group Chemical group [H]C([*])([H])C([H])=C(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- WGBYSDNHCSYUDW-UHFFFAOYSA-N propan-2-yl 1-[2-(4-chloroanilino)-2-oxoethyl]-2-[(1-propan-2-ylpiperidin-4-yl)carbamoyl]indole-5-carboxylate Chemical compound C1CN(C(C)C)CCC1NC(=O)C1=CC2=CC(C(=O)OC(C)C)=CC=C2N1CC(=O)NC1=CC=C(Cl)C=C1 WGBYSDNHCSYUDW-UHFFFAOYSA-N 0.000 description 1
- JBKYTFLQXMYJPY-UHFFFAOYSA-N propan-2-yl 2-[(1-propan-2-ylpiperidin-4-yl)carbamoyl]-1h-indole-5-carboxylate Chemical compound C=1C2=CC(C(=O)OC(C)C)=CC=C2NC=1C(=O)NC1CCN(C(C)C)CC1 JBKYTFLQXMYJPY-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 125000004309 pyranyl group Chemical group O1C(C=CC=C1)* 0.000 description 1
- IWRRRCZSVINKHU-UHFFFAOYSA-N pyrazol-3-ylidenemethanone Chemical class O=C=C1C=CN=N1 IWRRRCZSVINKHU-UHFFFAOYSA-N 0.000 description 1
- 125000002755 pyrazolinyl group Chemical group 0.000 description 1
- QLULGIRFKAWHOJ-UHFFFAOYSA-N pyridin-4-ylboronic acid Chemical compound OB(O)C1=CC=NC=C1 QLULGIRFKAWHOJ-UHFFFAOYSA-N 0.000 description 1
- ZVJHJDDKYZXRJI-UHFFFAOYSA-N pyrroline Natural products C1CC=NC1 ZVJHJDDKYZXRJI-UHFFFAOYSA-N 0.000 description 1
- 125000001422 pyrrolinyl group Chemical group 0.000 description 1
- 150000004728 pyruvic acid derivatives Chemical class 0.000 description 1
- 125000004159 quinolin-2-yl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C([H])C(*)=NC2=C1[H] 0.000 description 1
- 125000004548 quinolin-3-yl group Chemical group N1=CC(=CC2=CC=CC=C12)* 0.000 description 1
- 125000004549 quinolin-4-yl group Chemical group N1=CC=C(C2=CC=CC=C12)* 0.000 description 1
- 125000004550 quinolin-6-yl group Chemical group N1=CC=CC2=CC(=CC=C12)* 0.000 description 1
- 125000004621 quinuclidinyl group Chemical group N12C(CC(CC1)CC2)* 0.000 description 1
- 238000006476 reductive cyclization reaction Methods 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 125000003548 sec-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 208000013223 septicemia Diseases 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000012321 sodium triacetoxyborohydride Substances 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 239000012453 solvate Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- KXCAEQNNTZANTK-UHFFFAOYSA-N stannane Chemical compound [SnH4] KXCAEQNNTZANTK-UHFFFAOYSA-N 0.000 description 1
- 229910000080 stannane Inorganic materials 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 230000000707 stereoselective effect Effects 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 230000006103 sulfonylation Effects 0.000 description 1
- 239000013589 supplement Substances 0.000 description 1
- 238000006557 surface reaction Methods 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- BLGKZXNIJZYYRI-UHFFFAOYSA-N tert-butyl 2-[2-[(1-propan-2-ylpiperidin-4-yl)carbamoyl]indol-1-yl]acetate Chemical compound C1CN(C(C)C)CCC1NC(=O)C1=CC2=CC=CC=C2N1CC(=O)OC(C)(C)C BLGKZXNIJZYYRI-UHFFFAOYSA-N 0.000 description 1
- BNWCETAHAJSBFG-UHFFFAOYSA-N tert-butyl 2-bromoacetate Chemical compound CC(C)(C)OC(=O)CBr BNWCETAHAJSBFG-UHFFFAOYSA-N 0.000 description 1
- KMTMTLIQHPCYTL-UHFFFAOYSA-N tert-butyl 4-(pyridin-4-ylamino)piperidine-1-carboxylate Chemical compound C1CN(C(=O)OC(C)(C)C)CCC1NC1=CC=NC=C1 KMTMTLIQHPCYTL-UHFFFAOYSA-N 0.000 description 1
- QMZFIRHRGPLKEV-UHFFFAOYSA-N tert-butyl 4-aminopiperazine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCN(N)CC1 QMZFIRHRGPLKEV-UHFFFAOYSA-N 0.000 description 1
- LZRDHSFPLUWYAX-UHFFFAOYSA-N tert-butyl 4-aminopiperidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC(N)CC1 LZRDHSFPLUWYAX-UHFFFAOYSA-N 0.000 description 1
- QHPWESLNMUXZMX-UHFFFAOYSA-N tert-butyl n-(1-cyclopropylpiperidin-4-yl)carbamate Chemical compound C1CC(NC(=O)OC(C)(C)C)CCN1C1CC1 QHPWESLNMUXZMX-UHFFFAOYSA-N 0.000 description 1
- JUOXFFYHDMNFHE-UHFFFAOYSA-N tert-butyl n-(1-ethylpiperidin-4-yl)carbamate Chemical compound CCN1CCC(NC(=O)OC(C)(C)C)CC1 JUOXFFYHDMNFHE-UHFFFAOYSA-N 0.000 description 1
- SYXBLASQKPONBN-UHFFFAOYSA-N tert-butyl n-(1-propan-2-ylpiperidin-4-yl)carbamate Chemical compound CC(C)N1CCC(NC(=O)OC(C)(C)C)CC1 SYXBLASQKPONBN-UHFFFAOYSA-N 0.000 description 1
- AUFRDMQSECOCAZ-UHFFFAOYSA-N tert-butyl n-(1-pyridin-4-ylpiperidin-4-yl)carbamate Chemical compound C1CC(NC(=O)OC(C)(C)C)CCN1C1=CC=NC=C1 AUFRDMQSECOCAZ-UHFFFAOYSA-N 0.000 description 1
- VHYXAWLOJGIJPC-UHFFFAOYSA-N tert-butyl n-(piperidin-4-ylmethyl)carbamate Chemical compound CC(C)(C)OC(=O)NCC1CCNCC1 VHYXAWLOJGIJPC-UHFFFAOYSA-N 0.000 description 1
- CWXPZXBSDSIRCS-UHFFFAOYSA-N tert-butyl piperazine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCNCC1 CWXPZXBSDSIRCS-UHFFFAOYSA-N 0.000 description 1
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- UGNWTBMOAKPKBL-UHFFFAOYSA-N tetrachloro-1,4-benzoquinone Chemical compound ClC1=C(Cl)C(=O)C(Cl)=C(Cl)C1=O UGNWTBMOAKPKBL-UHFFFAOYSA-N 0.000 description 1
- YJBKVPRVZAQTPY-UHFFFAOYSA-J tetrachlorostannane;dihydrate Chemical compound O.O.Cl[Sn](Cl)(Cl)Cl YJBKVPRVZAQTPY-UHFFFAOYSA-J 0.000 description 1
- CBXCPBUEXACCNR-UHFFFAOYSA-N tetraethylammonium Chemical compound CC[N+](CC)(CC)CC CBXCPBUEXACCNR-UHFFFAOYSA-N 0.000 description 1
- UWYZHKAOTLEWKK-UHFFFAOYSA-N tetrahydro-isoquinoline Natural products C1=CC=C2CNCCC2=C1 UWYZHKAOTLEWKK-UHFFFAOYSA-N 0.000 description 1
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 1
- RAOIDOHSFRTOEL-UHFFFAOYSA-N tetrahydrothiophene Chemical compound C1CCSC1 RAOIDOHSFRTOEL-UHFFFAOYSA-N 0.000 description 1
- 125000003698 tetramethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- QEMXHQIAXOOASZ-UHFFFAOYSA-N tetramethylammonium Chemical compound C[N+](C)(C)C QEMXHQIAXOOASZ-UHFFFAOYSA-N 0.000 description 1
- WROMPOXWARCANT-UHFFFAOYSA-N tfa trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.OC(=O)C(F)(F)F WROMPOXWARCANT-UHFFFAOYSA-N 0.000 description 1
- CBDKQYKMCICBOF-UHFFFAOYSA-N thiazoline Chemical compound C1CN=CS1 CBDKQYKMCICBOF-UHFFFAOYSA-N 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 150000007970 thio esters Chemical class 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- VRGVVJHPLVPFRR-UHFFFAOYSA-N thiomorpholine Chemical compound C1CSCCN1.C1CSCCN1 VRGVVJHPLVPFRR-UHFFFAOYSA-N 0.000 description 1
- 239000003868 thrombin inhibitor Substances 0.000 description 1
- 230000001732 thrombotic effect Effects 0.000 description 1
- 125000005424 tosyloxy group Chemical group S(=O)(=O)(C1=CC=C(C)C=C1)O* 0.000 description 1
- 238000005809 transesterification reaction Methods 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- 238000000844 transformation Methods 0.000 description 1
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 1
- ITMCEJHCFYSIIV-UHFFFAOYSA-M triflate Chemical compound [O-]S(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-M 0.000 description 1
- 125000002827 triflate group Chemical group FC(S(=O)(=O)O*)(F)F 0.000 description 1
- NNPPMTNAJDCUHE-UHFFFAOYSA-N trimethylmethane Natural products CC(C)C NNPPMTNAJDCUHE-UHFFFAOYSA-N 0.000 description 1
- 239000012588 trypsin Substances 0.000 description 1
- 229960001322 trypsin Drugs 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- 125000001834 xanthenyl group Chemical group C1=CC=CC=2OC3=CC=CC=C3C(C12)* 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing three or more hetero rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P29/00—Non-central analgesic, antipyretic or antiinflammatory agents, e.g. antirheumatic agents; Non-steroidal antiinflammatory drugs [NSAID]
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P7/00—Drugs for disorders of the blood or the extracellular fluid
- A61P7/02—Antithrombotic agents; Anticoagulants; Platelet aggregation inhibitors
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/08—Vasodilators for multiple indications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/10—Drugs for disorders of the cardiovascular system for treating ischaemic or atherosclerotic diseases, e.g. antianginal drugs, coronary vasodilators, drugs for myocardial infarction, retinopathy, cerebrovascula insufficiency, renal arteriosclerosis
-
- C—CHEMISTRY; METALLURGY
- C04—CEMENTS; CONCRETE; ARTIFICIAL STONE; CERAMICS; REFRACTORIES
- C04B—LIME, MAGNESIA; SLAG; CEMENTS; COMPOSITIONS THEREOF, e.g. MORTARS, CONCRETE OR LIKE BUILDING MATERIALS; ARTIFICIAL STONE; CERAMICS; REFRACTORIES; TREATMENT OF NATURAL STONE
- C04B35/00—Shaped ceramic products characterised by their composition; Ceramics compositions; Processing powders of inorganic compounds preparatory to the manufacturing of ceramic products
- C04B35/622—Forming processes; Processing powders of inorganic compounds preparatory to the manufacturing of ceramic products
- C04B35/626—Preparing or treating the powders individually or as batches ; preparing or treating macroscopic reinforcing agents for ceramic products, e.g. fibres; mechanical aspects section B
- C04B35/63—Preparing or treating the powders individually or as batches ; preparing or treating macroscopic reinforcing agents for ceramic products, e.g. fibres; mechanical aspects section B using additives specially adapted for forming the products, e.g.. binder binders
- C04B35/632—Organic additives
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/10—Indoles; Hydrogenated indoles with substituted hydrocarbon radicals attached to carbon atoms of the hetero ring
- C07D209/18—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D209/22—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals with an aralkyl radical attached to the ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/06—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/14—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing three or more hetero rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- General Health & Medical Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Ceramic Engineering (AREA)
- Manufacturing & Machinery (AREA)
- Heart & Thoracic Surgery (AREA)
- Cardiology (AREA)
- Inorganic Chemistry (AREA)
- Materials Engineering (AREA)
- Structural Engineering (AREA)
- Hematology (AREA)
- Pain & Pain Management (AREA)
- Rheumatology (AREA)
- Diabetes (AREA)
- Vascular Medicine (AREA)
- Urology & Nephrology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Indole Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| EP01127809A EP1314733A1 (en) | 2001-11-22 | 2001-11-22 | Indole-2-carboxamides as factor Xa inhibitors |
| EP01127809.0 | 2001-11-22 | ||
| PCT/EP2002/012500 WO2003044014A1 (en) | 2001-11-22 | 2002-11-08 | Indole-2-carboxamides as factor xa inhibitors |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| AU2002351918A1 AU2002351918A1 (en) | 2003-06-10 |
| AU2002351918B2 true AU2002351918B2 (en) | 2008-04-03 |
Family
ID=8179313
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AU2002351918A Ceased AU2002351918B2 (en) | 2001-11-22 | 2002-11-08 | Indole-2-carboxamides as factor Xa inhibitors |
Country Status (30)
| Country | Link |
|---|---|
| US (3) | US6906084B2 (https=) |
| EP (2) | EP1314733A1 (https=) |
| JP (1) | JP4664592B2 (https=) |
| KR (2) | KR101033798B1 (https=) |
| CN (1) | CN1283638C (https=) |
| AR (1) | AR037656A1 (https=) |
| AU (1) | AU2002351918B2 (https=) |
| BR (1) | BR0214396A (https=) |
| CA (1) | CA2467374C (https=) |
| CO (1) | CO5580764A2 (https=) |
| EC (1) | ECSP045115A (https=) |
| HR (1) | HRP20040453A2 (https=) |
| HU (1) | HUP0402063A3 (https=) |
| IL (2) | IL162105A0 (https=) |
| MA (1) | MA27350A1 (https=) |
| ME (1) | MEP43008A (https=) |
| MX (1) | MXPA04004797A (https=) |
| MY (1) | MY131516A (https=) |
| NO (1) | NO327466B1 (https=) |
| NZ (1) | NZ533044A (https=) |
| OA (1) | OA12727A (https=) |
| PE (1) | PE20030593A1 (https=) |
| PL (1) | PL210986B1 (https=) |
| RS (1) | RS40404A (https=) |
| RU (1) | RU2299881C2 (https=) |
| TN (1) | TNSN04091A1 (https=) |
| TW (1) | TWI291950B (https=) |
| UA (1) | UA78731C2 (https=) |
| WO (1) | WO2003044014A1 (https=) |
| ZA (1) | ZA200402945B (https=) |
Families Citing this family (79)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| RU2004117907A (ru) * | 2001-11-14 | 2006-01-10 | Шеринг Корпорейшн (US) | Лиганды каннабиноидных рецепторов |
| US7358268B2 (en) * | 2002-12-04 | 2008-04-15 | Sanofi-Aventis Deutschland Gmbh | Imidazole derivatives as factor Xa inhibitors |
| US7429581B2 (en) * | 2002-12-23 | 2008-09-30 | Sanofi-Aventis Deutschland Gmbh | Pyrazole-derivatives as factor Xa inhibitors |
| ATE450533T1 (de) | 2003-02-14 | 2009-12-15 | Glaxo Group Ltd | Carboxamidderivate |
| US7539725B2 (en) * | 2003-04-03 | 2009-05-26 | Zix Corporation | Auditor system |
| EP1479680A1 (en) * | 2003-05-19 | 2004-11-24 | Aventis Pharma Deutschland GmbH | Azaindole derivatives as Factor Xa inhibitors |
| EP1479675A1 (en) * | 2003-05-19 | 2004-11-24 | Aventis Pharma Deutschland GmbH | Indazole-derivatives as factor Xa inhibitors |
| US7741341B2 (en) | 2003-05-19 | 2010-06-22 | Sanofi-Aventis Deutschland Gmbh | Benzimidazole-derivatives as factor Xa inhibitors |
| US7317027B2 (en) * | 2003-05-19 | 2008-01-08 | Sanofi-Aventis Deutschland Gmbh | Azaindole-derivatives as factor Xa inhibitors |
| EP1479677A1 (en) * | 2003-05-19 | 2004-11-24 | Aventis Pharma Deutschland GmbH | New indole derivatives as factor xa inhibitors |
| US7223780B2 (en) * | 2003-05-19 | 2007-05-29 | Sanofi-Aventis Deutschland Gmbh | Triazole-derivatives as blood clotting enzyme factor Xa inhibitors |
| WO2004108671A1 (en) * | 2003-06-06 | 2004-12-16 | Suven Life Sciences Limited | Substituted indoles with serotonin receptor affinity, process for their preparation and pharmaceutical compositions containing them |
| TWI372050B (en) | 2003-07-03 | 2012-09-11 | Astex Therapeutics Ltd | (morpholin-4-ylmethyl-1h-benzimidazol-2-yl)-1h-pyrazoles |
| EP1568698A1 (en) * | 2004-02-27 | 2005-08-31 | Aventis Pharma Deutschland GmbH | Pyrrole-derivatives as factor Xa inhibitors |
| EP1571154A1 (en) * | 2004-03-03 | 2005-09-07 | Aventis Pharma Deutschland GmbH | Beta-aminoacid-derivatives as factor Xa inhibitors |
| MXPA06014535A (es) | 2004-06-18 | 2007-06-05 | Biolipox Ab | Indoles utiles en el tratamiento de la inflamacion. |
| US7781478B2 (en) | 2004-07-14 | 2010-08-24 | Ptc Therapeutics, Inc. | Methods for treating hepatitis C |
| US7868037B2 (en) | 2004-07-14 | 2011-01-11 | Ptc Therapeutics, Inc. | Methods for treating hepatitis C |
| US7772271B2 (en) | 2004-07-14 | 2010-08-10 | Ptc Therapeutics, Inc. | Methods for treating hepatitis C |
| EP1771169A1 (en) | 2004-07-14 | 2007-04-11 | PTC Therapeutics, Inc. | Methods for treating hepatitis c |
| JP2008507518A (ja) | 2004-07-22 | 2008-03-13 | ピーティーシー セラピューティクス，インコーポレーテッド | Ｃ型肝炎を治療するためのチエノピリジン |
| FR2874015B1 (fr) * | 2004-08-05 | 2006-09-15 | Sanofi Synthelabo | Derives de n-(1h-indolyl)-1h-indole-2-carboxamides, leur preparation et leur application en therapeutique |
| US7446210B2 (en) | 2004-10-26 | 2008-11-04 | Janssen Pharmaceutica N.V. | Factor Xa compounds |
| DE602005009252D1 (de) * | 2004-12-08 | 2008-10-02 | Bristol Myers Squibb Co | Heterocyclische verbindungen als inhibitoren von faktor viia |
| EP1833819A1 (en) | 2004-12-30 | 2007-09-19 | Astex Therapeutics Limited | Pyrazole compounds that modulate the activity of cdk, gsk and aurora kinases |
| FR2880625B1 (fr) * | 2005-01-07 | 2007-03-09 | Sanofi Aventis Sa | Derives de n-(heteroaryl)-1h-indole-2-carboxamides, leur preparation et leur application en therapeutique |
| BRPI0519774A2 (pt) | 2005-01-19 | 2009-02-10 | Biolipox Ab | composto ou um sal farmaceuticamente aceitÁvel do mesmo, formulaÇço farmacÊutica, uso de um composto ou um sal farmaceuticamente aceitÁvel do mesmo, mÉtodo de tratamento de uma doenÇa em que inibiÇço da atividade de um membro da famÍlia mapeg É desejada e/ou necessÁria, produto combinado, e, processo para a preparaÇço de um composto |
| EP2308839B1 (en) | 2005-04-20 | 2017-03-01 | Takeda Pharmaceutical Company Limited | Fused heterocyclic compounds |
| FR2888847B1 (fr) | 2005-07-22 | 2007-08-31 | Sanofi Aventis Sa | Derives de n-(heteriaryl)-1-heteorarylalkyl-1h-indole-2- carboxamides, leur preparation et application en therapeutique |
| GB2431927B (en) | 2005-11-04 | 2010-03-17 | Amira Pharmaceuticals Inc | 5-Lipoxygenase-activating protein (FLAP) inhibitors |
| US7977359B2 (en) | 2005-11-04 | 2011-07-12 | Amira Pharmaceuticals, Inc. | 5-lipdxygenase-activating protein (FLAP) inhibitors |
| US8399666B2 (en) | 2005-11-04 | 2013-03-19 | Panmira Pharmaceuticals, Llc | 5-lipoxygenase-activating protein (FLAP) inhibitors |
| EP1968579A1 (en) | 2005-12-30 | 2008-09-17 | Astex Therapeutics Limited | Pharmaceutical compounds |
| BRPI0706411A2 (pt) * | 2006-01-24 | 2011-03-29 | Lilly Co Eli | composto, composição farmacêutica, método de preparação de um indol ou um sal farmaceuticamente aceitável do mesmo, e, uso de um composto |
| US7943622B2 (en) | 2006-06-06 | 2011-05-17 | Cornerstone Therapeutics, Inc. | Piperazines, pharmaceutical compositions and methods of use thereof |
| EP2049119A2 (en) | 2006-06-29 | 2009-04-22 | Astex Therapeutics Limited | Pharmaceutical combinations of 1-cyclopropyl-3-[3-(5-morphoolin-4-ylmethyl-1h-benzoimidazol-2-yl)-1h-1-pyrazol-4-yl]-urea |
| KR101511074B1 (ko) | 2007-04-16 | 2015-04-13 | 애브비 인코포레이티드 | 7-치환된 인돌 Ｍｃｌ-1 억제제 |
| WO2009023623A1 (en) * | 2007-08-10 | 2009-02-19 | H, Lundbeck A/S | Heteroaryl amide analogues |
| TW200920369A (en) | 2007-10-26 | 2009-05-16 | Amira Pharmaceuticals Inc | 5-lipoxygenase activating protein (flap) inhibitor |
| KR20100097195A (ko) * | 2007-12-07 | 2010-09-02 | 애보트 게엠베하 운트 콤파니 카게 | ５－할로겐－치환된 옥스인돌 유도체 및 바소프레신－의존성 질병을 치료하기 위한 이의 용도 |
| MY157425A (en) * | 2007-12-27 | 2016-06-15 | Abbvie Deutschland | Substituted oxindole derivatives and the use thereof for the treatment of vasopressin-dependent illnesses |
| MX2010008700A (es) | 2008-02-22 | 2010-08-30 | Hoffmann La Roche | Moduladores de beta-amiloide. |
| JP5791500B2 (ja) | 2008-05-23 | 2015-10-07 | パンミラ ファーマシューティカルズ，エルエルシー． | ５−リポキシゲナーゼ活性化タンパク質阻害剤 |
| GB0813144D0 (en) | 2008-07-17 | 2008-08-27 | Glaxo Group Ltd | Novel compounds |
| GB0813142D0 (en) | 2008-07-17 | 2008-08-27 | Glaxo Group Ltd | Novel compounds |
| US8546431B2 (en) | 2008-10-01 | 2013-10-01 | Panmira Pharmaceuticals, Llc | 5-lipoxygenase-activating protein (FLAP) inhibitors |
| CN104945420A (zh) | 2009-06-29 | 2015-09-30 | 因塞特公司 | 作为pi3k抑制剂的嘧啶酮类 |
| WO2011075643A1 (en) | 2009-12-18 | 2011-06-23 | Incyte Corporation | Substituted heteroaryl fused derivatives as pi3k inhibitors |
| US8486967B2 (en) | 2010-02-17 | 2013-07-16 | Hoffmann-La Roche Inc. | Heteroaryl substituted piperidines |
| AR081823A1 (es) | 2010-04-14 | 2012-10-24 | Incyte Corp | DERIVADOS FUSIONADOS COMO INHIBIDORES DE PI3Kd |
| US9062055B2 (en) | 2010-06-21 | 2015-06-23 | Incyte Corporation | Fused pyrrole derivatives as PI3K inhibitors |
| EP2655374B1 (en) | 2010-12-20 | 2019-10-23 | Incyte Holdings Corporation | N-(1-(substituted-phenyl)ethyl)-9h-purin-6-amines as pi3k inhibitors |
| US9108984B2 (en) | 2011-03-14 | 2015-08-18 | Incyte Corporation | Substituted diamino-pyrimidine and diamino-pyridine derivatives as PI3K inhibitors |
| WO2012135009A1 (en) | 2011-03-25 | 2012-10-04 | Incyte Corporation | Pyrimidine-4,6-diamine derivatives as pi3k inhibitors |
| FR2974576B1 (fr) * | 2011-04-29 | 2013-07-19 | Sanofi Aventis | Derives de n-[(1h-pyrazol-1-yl)aryl]-1h-indole ou 1h- indazole-3-carboxamide, leur preparation et leurs applications en therapeutique |
| KR102507287B1 (ko) | 2011-09-02 | 2023-03-07 | 인사이트 홀딩스 코포레이션 | Ｐｉ３ｋ 억제제로서 헤테로시클릴아민 |
| CN104822267B (zh) * | 2012-02-29 | 2018-01-23 | 巴鲁克·S·布伦博格研究所 | 乙型肝炎病毒共价闭合环状dna形成的抑制剂及其使用方法 |
| AR090548A1 (es) | 2012-04-02 | 2014-11-19 | Incyte Corp | Azaheterociclobencilaminas biciclicas como inhibidores de pi3k |
| SG11201506687RA (en) | 2013-03-15 | 2015-09-29 | Plexxikon Inc | Heterocyclic compounds and uses thereof |
| US20140303121A1 (en) | 2013-03-15 | 2014-10-09 | Plexxikon Inc. | Heterocyclic compounds and uses thereof |
| US9840489B2 (en) * | 2013-12-20 | 2017-12-12 | Institute Of Pharmacology And Toxicology Academy Of Military Medical Sciences P.L.A. China | Piperidine carboxamide compound, preparation method, and usage thereof |
| US9938272B2 (en) | 2014-05-22 | 2018-04-10 | North China Pharmaceutical Company., Ltd. | Hydrazine compound as blood coagulation factor Xa inhibitor |
| WO2015191677A1 (en) | 2014-06-11 | 2015-12-17 | Incyte Corporation | Bicyclic heteroarylaminoalkyl phenyl derivatives as pi3k inhibitors |
| WO2016040505A1 (en) * | 2014-09-10 | 2016-03-17 | Epizyme, Inc. | Smyd inhibitors |
| DK3240785T3 (da) | 2014-12-29 | 2021-09-27 | Us Health | Småmolekylede hæmmere af laktasedehydrogenase og fremgangsmåder til brug deraf |
| SI3831833T1 (sl) | 2015-02-27 | 2023-03-31 | Incyte Holdings Corporation | Postopki za pripravo inhibitorja PI3K |
| US9732097B2 (en) | 2015-05-11 | 2017-08-15 | Incyte Corporation | Process for the synthesis of a phosphoinositide 3-kinase inhibitor |
| US9988401B2 (en) | 2015-05-11 | 2018-06-05 | Incyte Corporation | Crystalline forms of a PI3K inhibitor |
| WO2016210294A1 (en) * | 2015-06-25 | 2016-12-29 | Promega Corporation | Thienopyrrole compounds and uses thereof as inhibitors of oplophorus-derived luciferases |
| KR101725451B1 (ko) * | 2016-05-25 | 2017-04-13 | 한국화학연구원 | N-(피페리딘-4-일)-1h-인돌-2-카복스아마이드 유도체, 이의 제조방법 및 이를 유효성분으로 포함하는 유로텐신-ⅱ 수용체 활성 관련 질환의 예방 또는 치료용 약학적 조성물 |
| SG11201901690UA (en) * | 2016-10-18 | 2019-03-28 | Chevron Oronite Tech Bv | Marine diesel lubricant oil compositions |
| WO2018125992A1 (en) | 2016-12-28 | 2018-07-05 | Promega Corporation | Functionalized nanoluc inhibitors |
| CN110770224B (zh) * | 2017-03-10 | 2022-11-18 | 罗格斯新泽西州立大学 | 作为外排泵抑制剂的吲哚衍生物 |
| JP7675519B2 (ja) | 2017-10-13 | 2025-05-13 | オプナ バイオ ソシエテ アノニム | キナーゼを調節するための化合物の固体形態 |
| CA3101323A1 (en) | 2018-06-01 | 2019-12-05 | Incyte Corporation | Dosing regimen for the treatment of pi3k related disorders |
| WO2022136486A1 (en) * | 2020-12-22 | 2022-06-30 | Luxembourg Institute Of Health (Lih) | Conolidine analogues as selective ackr3 modulators for the treatment of cancer and cardiovascular diseases |
| CN116332818B (zh) * | 2021-12-22 | 2023-12-15 | 王喆明 | 四氢吡咯衍生物及其应用 |
| CN116554144B (zh) * | 2022-01-27 | 2025-12-19 | 司马健 | 一种sj系列芳基苯胺类化合物及其制备方法与医药用途 |
| TW202345806A (zh) | 2022-03-31 | 2023-12-01 | 美商艾伯維有限公司 | 噻唑并〔５，４－ｂ〕吡啶ｍａｌｔ－１抑制劑 |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0186367A2 (en) * | 1984-12-10 | 1986-07-02 | Warner-Lambert Company | Acidic indole compounds and their use as antiallergy agents |
| WO1993025524A1 (en) * | 1992-06-05 | 1993-12-23 | Shell Internationale Research Maatschappij B.V. | Fungicidal indole derivatives |
| JPH0987282A (ja) * | 1995-09-21 | 1997-03-31 | Kyowa Hakko Kogyo Co Ltd | チアゾール誘導体 |
Family Cites Families (29)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3317524A (en) * | 1965-02-04 | 1967-05-02 | American Home Prod | Substituted 1, 2, 3, 4-tetrahydro-pyrazino[1, 2-a]indoles |
| FR2260332A1 (en) * | 1974-02-12 | 1975-09-05 | Delalande Sa | 1-Phenyl-2-aminocarbonyl-indoles - with respiratory analeptic, antiinflammatory analgesic, vasodilator, diuretic and anti-ulcer activity |
| IE68593B1 (en) * | 1989-12-06 | 1996-06-26 | Sanofi Sa | Heterocyclic substituted acylaminothiazoles their preparation and pharmaceutical compositions containing them |
| US5506134A (en) | 1990-10-22 | 1996-04-09 | Corvas International, Inc. | Hypridoma and monoclonal antibody which inhibits blood coagulation tissue factor/factor VIIa complex |
| US5833982A (en) | 1991-02-28 | 1998-11-10 | Zymogenetics, Inc. | Modified factor VII |
| US5788965A (en) | 1991-02-28 | 1998-08-04 | Novo Nordisk A/S | Modified factor VII |
| FR2703995B1 (fr) * | 1993-04-16 | 1995-07-21 | Sanofi Elf | 5-acylamino 1,2,4-thiadiazoles, leur preparation et compositions pharmaceutiques en contenant. |
| US5518231A (en) | 1993-04-19 | 1996-05-21 | Xerox Corporation | Self adjusting sheet gripping apparatus |
| SI9520044B (sl) | 1994-04-26 | 2004-08-31 | Aventis Pharmaceuticals Inc. | Inhibitorji Xa faktorja |
| CA2224062C (en) * | 1995-06-06 | 2001-09-04 | Pfizer Limited | Substituted n-(indole-2-carbonyl)-glycinamides and derivatives as glycogen phosphorylase inhibitors |
| EP0782989A4 (en) * | 1995-07-18 | 1999-04-21 | Kyowa Hakko Kogyo Kk | INDOL DERIVATIVES |
| AU2898297A (en) * | 1996-05-24 | 1998-01-05 | Novartis Ag | Use of substance p antagonists for treating social phobia |
| FR2763337B1 (fr) * | 1997-05-13 | 1999-08-20 | Sanofi Sa | Nouveaux derives du triazole, un procede pour leur preparation et compositions pharmaceutiques les contenant |
| GB9716657D0 (en) * | 1997-08-07 | 1997-10-15 | Zeneca Ltd | Chemical compounds |
| HU227568B1 (en) * | 1997-12-24 | 2011-08-29 | Sanofi Aventis Deutschland | Indole derivatives, as inhibitors os factor xa |
| TR200002182T2 (tr) | 1998-01-27 | 2000-12-21 | Aventis Pharmaceuticals Products Inc. | İkame edilmiş aksozaherosayklil faktör xa inhibitörleri |
| EP0987274A1 (en) | 1998-09-15 | 2000-03-22 | Hoechst Marion Roussel Deutschland GmbH | Factor VIIa Inhibitors |
| JP4241970B2 (ja) * | 1998-10-30 | 2009-03-18 | 中外製薬株式会社 | アミド結合を有するインドール誘導体、及びモノ又はジアザインドール誘導体 |
| JP2001002642A (ja) * | 1999-06-21 | 2001-01-09 | Nippon Nohyaku Co Ltd | 複素環ジカルボン酸ジアミド誘導体及び除草剤並びにその使用方法 |
| SK1182002A3 (en) | 1999-07-28 | 2002-11-06 | Aventis Pharm Prod Inc | Substituted oxoazaheterocyclyl compounds |
| US6486211B1 (en) * | 1999-10-22 | 2002-11-26 | Smithkline Beecham Corporation | Indole compounds |
| AU2001250783A1 (en) | 2000-02-29 | 2001-09-12 | Cor Therapeutics, Inc. | Benzamides and related inhibitors of factor xa |
| US6436965B1 (en) * | 2000-03-02 | 2002-08-20 | Merck Frosst Canada & Co. | PDE IV inhibiting amides, compositions and methods of treatment |
| AU2001268711A1 (en) | 2000-06-23 | 2002-01-08 | Bristol-Myers Squibb Pharma Company | Heteroaryl-phenyl substituted factor xa inhibitors |
| DE10147672A1 (de) * | 2001-09-27 | 2003-04-10 | Bayer Ag | Substituierte 2,5-Diamidoindole und ihre Verwendung |
| RU2004117907A (ru) * | 2001-11-14 | 2006-01-10 | Шеринг Корпорейшн (US) | Лиганды каннабиноидных рецепторов |
| EP1479677A1 (en) * | 2003-05-19 | 2004-11-24 | Aventis Pharma Deutschland GmbH | New indole derivatives as factor xa inhibitors |
| FR2888847B1 (fr) * | 2005-07-22 | 2007-08-31 | Sanofi Aventis Sa | Derives de n-(heteriaryl)-1-heteorarylalkyl-1h-indole-2- carboxamides, leur preparation et application en therapeutique |
| FR2911604B1 (fr) * | 2007-01-19 | 2009-04-17 | Sanofi Aventis Sa | Derives de n-(heteroaryl-1h-indole-2-carboxamides, leur preparation et leur application en therapeutique |
-
2001
- 2001-11-22 EP EP01127809A patent/EP1314733A1/en not_active Withdrawn
-
2002
- 2002-08-11 UA UA20040604882A patent/UA78731C2/uk unknown
- 2002-11-08 RS YUP-404/04A patent/RS40404A/sr unknown
- 2002-11-08 EP EP02787604.4A patent/EP1451185B1/en not_active Expired - Lifetime
- 2002-11-08 AU AU2002351918A patent/AU2002351918B2/en not_active Ceased
- 2002-11-08 PL PL368949A patent/PL210986B1/pl unknown
- 2002-11-08 OA OA1200400142A patent/OA12727A/en unknown
- 2002-11-08 JP JP2003545651A patent/JP4664592B2/ja not_active Expired - Fee Related
- 2002-11-08 CA CA2467374A patent/CA2467374C/en not_active Expired - Fee Related
- 2002-11-08 WO PCT/EP2002/012500 patent/WO2003044014A1/en not_active Ceased
- 2002-11-08 MX MXPA04004797A patent/MXPA04004797A/es active IP Right Grant
- 2002-11-08 BR BR0214396-8A patent/BR0214396A/pt active Search and Examination
- 2002-11-08 NZ NZ533044A patent/NZ533044A/en not_active IP Right Cessation
- 2002-11-08 ME MEP-430/08A patent/MEP43008A/xx unknown
- 2002-11-08 CN CNB028232488A patent/CN1283638C/zh not_active Expired - Fee Related
- 2002-11-08 IL IL16210502A patent/IL162105A0/xx unknown
- 2002-11-08 RU RU2004118710/04A patent/RU2299881C2/ru not_active IP Right Cessation
- 2002-11-08 KR KR1020107003845A patent/KR101033798B1/ko not_active Expired - Fee Related
- 2002-11-08 HR HR20040453A patent/HRP20040453A2/xx not_active Application Discontinuation
- 2002-11-08 HU HU0402063A patent/HUP0402063A3/hu unknown
- 2002-11-08 KR KR1020047007838A patent/KR100954508B1/ko not_active Expired - Fee Related
- 2002-11-19 PE PE2002001105A patent/PE20030593A1/es not_active Application Discontinuation
- 2002-11-20 TW TW091133782A patent/TWI291950B/zh not_active IP Right Cessation
- 2002-11-20 AR ARP020104452A patent/AR037656A1/es active IP Right Grant
- 2002-11-21 US US10/301,397 patent/US6906084B2/en not_active Expired - Lifetime
- 2002-11-22 MY MYPI20024375A patent/MY131516A/en unknown
-
2004
- 2004-04-19 ZA ZA2004/02945A patent/ZA200402945B/en unknown
- 2004-04-22 MA MA27647A patent/MA27350A1/fr unknown
- 2004-05-20 CO CO04046947A patent/CO5580764A2/es active IP Right Grant
- 2004-05-20 IL IL162105A patent/IL162105A/en not_active IP Right Cessation
- 2004-05-20 EC EC2004005115A patent/ECSP045115A/es unknown
- 2004-05-21 TN TNP2004000091A patent/TNSN04091A1/en unknown
- 2004-06-21 NO NO20042592A patent/NO327466B1/no not_active IP Right Cessation
- 2004-08-26 US US10/926,909 patent/US20050043302A1/en not_active Abandoned
-
2008
- 2008-05-12 US US12/119,013 patent/US20090069565A1/en not_active Abandoned
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0186367A2 (en) * | 1984-12-10 | 1986-07-02 | Warner-Lambert Company | Acidic indole compounds and their use as antiallergy agents |
| WO1993025524A1 (en) * | 1992-06-05 | 1993-12-23 | Shell Internationale Research Maatschappij B.V. | Fungicidal indole derivatives |
| JPH0987282A (ja) * | 1995-09-21 | 1997-03-31 | Kyowa Hakko Kogyo Co Ltd | チアゾール誘導体 |
Non-Patent Citations (2)
| Title |
|---|
| P. C. Unangst et al., J. Med. Chem., vol. 32, no. 6, 1989, pages 1360-1366. * |
| Patent Abstracts of Japan, 1997, no. 7 (31st July 1997) & JP 09087282 A. * |
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU2002351918B2 (en) | Indole-2-carboxamides as factor Xa inhibitors | |
| AU2004238495B2 (en) | New indole derivatives as factor Xa inhibitors | |
| US7910606B2 (en) | Pyrazole-derivatives as factor Xa inhibitors | |
| US20080280946A1 (en) | Azaindole-Derivatives As Factor Xa Inhibitors | |
| MXPA05006200A (es) | Derivados de pirazol como inhibidores del factor xa. | |
| EP1479675A1 (en) | Indazole-derivatives as factor Xa inhibitors | |
| AU2003285336A1 (en) | IMIDAZOLE-DERIVATIVES AS FACTOR Xa INHIBITORS | |
| AU2004238500B2 (en) | Azaindole-derivatives as factor Xa inhibitors | |
| EP1479676A1 (en) | Benzimidazole-derivatives as factor xa inhibitors |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PC1 | Assignment before grant (sect. 113) |
Owner name: SANOFI-AVENTIS DEUTSCHLAND GMBH Free format text: FORMER APPLICANT(S): AVENTIS PHARMA DEUTSCHLAND GMBH |
|
| FGA | Letters patent sealed or granted (standard patent) | ||
| MK14 | Patent ceased section 143(a) (annual fees not paid) or expired |