AT218425B - - Google Patents
Info
- Publication number
- AT218425B AT218425B AT448960A AT448960A AT218425B AT 218425 B AT218425 B AT 218425B AT 448960 A AT448960 A AT 448960A AT 448960 A AT448960 A AT 448960A AT 218425 B AT218425 B AT 218425B
- Authority
- AT
- Austria
- Prior art keywords
- guide strips
- belt
- conveyor
- piece goods
- arrangement
- Prior art date
Links
- 230000002441 reversible effect Effects 0.000 claims description 2
- 239000000463 material Substances 0.000 description 2
- 210000000056 organ Anatomy 0.000 description 2
- 229910000831 Steel Inorganic materials 0.000 description 1
- WYTGDNHDOZPMIW-RCBQFDQVSA-N alstonine Natural products C1=CC2=C3C=CC=CC3=NC2=C2N1C[C@H]1[C@H](C)OC=C(C(=O)OC)[C@H]1C2 WYTGDNHDOZPMIW-RCBQFDQVSA-N 0.000 description 1
- 239000013590 bulk material Substances 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 238000004806 packaging method and process Methods 0.000 description 1
- 238000007789 sealing Methods 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
Landscapes
- Structure Of Belt Conveyors (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE218425T | 1959-06-18 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| AT218425B true AT218425B (oth) | 1961-11-27 |
Family
ID=29592810
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT448960A AT218425B (oth) | 1959-06-18 | 1960-06-13 |
Country Status (1)
| Country | Link |
|---|---|
| AT (1) | AT218425B (oth) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1224197B (de) * | 1964-11-24 | 1966-09-01 | Mannesmann Meer Ag | Endloses Foerderband mit schwenkbaren Seitenwaenden |
| DE1266215B (de) * | 1965-10-19 | 1968-04-11 | Herbert Schauer | Foerdervorrichtung fuer landwirtschaftliche Produkte |
-
1960
- 1960-06-13 AT AT448960A patent/AT218425B/de active
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1224197B (de) * | 1964-11-24 | 1966-09-01 | Mannesmann Meer Ag | Endloses Foerderband mit schwenkbaren Seitenwaenden |
| DE1266215B (de) * | 1965-10-19 | 1968-04-11 | Herbert Schauer | Foerdervorrichtung fuer landwirtschaftliche Produkte |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2460005A1 (de) | Bueromaschine mit einer aufgabevorrichtung fuer flache gegenstaende | |
| DE4115114A1 (de) | Foerdereinrichtung mit beweglichen trennstegen | |
| DE2314794A1 (de) | Vorrichtung fuer den vertikalen transport von koerpern | |
| DE2734399A1 (de) | Foerdervorrichtung | |
| EP0059984B1 (de) | Ausschleusvorrichtung für eine Förderbahn | |
| DE2045028B2 (de) | Plattenbandförderer | |
| DE1289776B (de) | Foerderer, insbesondere fuer Behaelter | |
| DE2109948A1 (de) | Wanderrost | |
| DE2153078A1 (de) | Senkrechtfoerderer | |
| DE69520317T2 (de) | Kipper für Rollengepäck | |
| DE2614109A1 (de) | Handhabungs-vorrichtung zum transport von schuettguetern | |
| AT218425B (oth) | ||
| CH402731A (de) | Fördereinrichtung | |
| DE2006210A1 (de) | Transportvorrichtung | |
| DE2759636C2 (de) | Schleppkette für ein Schleppkettenfördersystem | |
| DE1913475A1 (de) | Gurtfoerderer | |
| DE676611C (de) | Mitnehmerfoerderer | |
| CH324107A (de) | Fördereinrichtung für Behälter, mit einer endlosen Kette | |
| DE445925C (de) | Elevator als Stapelgeraet zum Stapeln von Brettern | |
| DE393217C (de) | Endloses Foerderband zum Foerdern von Rollkoerpern | |
| DE627543C (de) | Zusammengesetzte Foerderanlage | |
| DE3221243A1 (de) | Vorrichtung zum stapeln flacher gegenstaende | |
| DE3442978A1 (de) | Stueckgutfoerderer | |
| DE1912896A1 (de) | Etagenfoerderer | |
| DE968407C (de) | Foerdervorrichtung aus zwei endlosen, nebeneinander angeordneten Baendern |