YU46208B - Postupak za dobijanje derivata penema - Google Patents
Postupak za dobijanje derivata penemaInfo
- Publication number
- YU46208B YU46208B YU100087A YU100087A YU46208B YU 46208 B YU46208 B YU 46208B YU 100087 A YU100087 A YU 100087A YU 100087 A YU100087 A YU 100087A YU 46208 B YU46208 B YU 46208B
- Authority
- YU
- Yugoslavia
- Prior art keywords
- compound
- formula
- solvent
- procedure
- obtaining
- Prior art date
Links
- 150000002961 penems Chemical class 0.000 title 1
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 abstract 6
- 150000001875 compounds Chemical class 0.000 abstract 4
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 abstract 3
- 239000002904 solvent Substances 0.000 abstract 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 abstract 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 abstract 2
- 125000001246 bromo group Chemical group Br* 0.000 abstract 2
- 125000001309 chloro group Chemical group Cl* 0.000 abstract 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 abstract 2
- 229910000102 alkali metal hydride Inorganic materials 0.000 abstract 1
- -1 alkali metal hydride t-butoxide Chemical class 0.000 abstract 1
- XGIUDIMNNMKGDE-UHFFFAOYSA-N bis(trimethylsilyl)azanide Chemical compound C[Si](C)(C)[N-][Si](C)(C)C XGIUDIMNNMKGDE-UHFFFAOYSA-N 0.000 abstract 1
- 239000012442 inert solvent Substances 0.000 abstract 1
- 235000009518 sodium iodide Nutrition 0.000 abstract 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D513/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for in groups C07D463/00, C07D477/00 or C07D499/00 - C07D507/00
- C07D513/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for in groups C07D463/00, C07D477/00 or C07D499/00 - C07D507/00 in which the condensed system contains two hetero rings
- C07D513/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D499/88—Compounds with a double bond between positions 2 and 3 and a carbon atom having three bonds to hetero atoms with at the most one bond to halogen, e.g. an ester or nitrile radical, directly attached in position 2
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Electroluminescent Light Sources (AREA)
- Diaphragms For Electromechanical Transducers (AREA)
- Steroid Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/869,760 US4782145A (en) | 1986-06-02 | 1986-06-02 | Process for penem derivatives |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| YU100087A YU100087A (en) | 1988-12-31 |
| YU46208B true YU46208B (sh) | 1993-05-28 |
Family
ID=25354215
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| YU100087A YU46208B (sh) | 1986-06-02 | 1987-06-01 | Postupak za dobijanje derivata penema |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US4782145A (OSRAM) |
| EP (1) | EP0249358B1 (OSRAM) |
| JP (1) | JPS62294685A (OSRAM) |
| KR (1) | KR890004560B1 (OSRAM) |
| AT (1) | ATE56452T1 (OSRAM) |
| AU (1) | AU574610B2 (OSRAM) |
| CA (1) | CA1279312C (OSRAM) |
| DE (1) | DE3764875D1 (OSRAM) |
| DK (1) | DK174280B1 (OSRAM) |
| ES (1) | ES2018022B3 (OSRAM) |
| FI (1) | FI87649C (OSRAM) |
| GR (1) | GR3000862T3 (OSRAM) |
| HU (1) | HU196601B (OSRAM) |
| IE (1) | IE59871B1 (OSRAM) |
| IL (1) | IL82695A0 (OSRAM) |
| NZ (1) | NZ220498A (OSRAM) |
| PT (1) | PT84983B (OSRAM) |
| YU (1) | YU46208B (OSRAM) |
| ZA (1) | ZA873876B (OSRAM) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4992543A (en) * | 1988-10-19 | 1991-02-12 | Pfizer Inc. | Penem derivatives |
| US4895940A (en) * | 1988-10-19 | 1990-01-23 | Pfizer Inc. | Process for the preparation of penems |
| US5191075A (en) * | 1988-10-19 | 1993-03-02 | Pfizer Inc | Process for the preparation of penems |
| JP2569455B2 (ja) * | 1992-03-06 | 1997-01-08 | 田辺製薬株式会社 | β−ラクタム誘導体の製法 |
| US5399679A (en) * | 1992-06-16 | 1995-03-21 | Farmitalia Carlo Erba S.R.L. | (1'R,3S,4R)4-acylthio azetidinones |
| MX9604505A (es) * | 1994-04-01 | 1997-11-29 | Microcide Pharmaceuticals Inc | Antibioticos de cefalosporina. |
| US5698547A (en) * | 1994-04-01 | 1997-12-16 | Microcide Pharmaceuticals, Inc. | Cephalosporin antibiotics |
| US5688786A (en) * | 1994-04-01 | 1997-11-18 | Microcide Pharmaceuticals, Inc. | β-lactam antibiotics |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3175042D1 (en) * | 1980-11-06 | 1986-09-04 | Hoechst Uk Ltd | 7-oxo-4-thia-1-aza(3,2,0)heptane and 7-oxo-4-thia-1-aza(3,2,0)hept-2-ene derivatives |
| ATE28648T1 (de) * | 1982-03-26 | 1987-08-15 | Hoechst Uk Ltd | 7-oxo-4-thia-1-azabicyclo(3,2,0)heptan-derivate |
| EP0110280B1 (en) * | 1982-11-29 | 1994-10-12 | Schering Corporation | Process for the production of penem compounds |
| US4530793A (en) * | 1982-11-29 | 1985-07-23 | Schering Corporation | Processes for the production of penems |
| CA1221358A (en) * | 1982-12-08 | 1987-05-05 | Erba Farmitalia | 2-thiacephems and (5r) penems derivatives |
| US4695626A (en) * | 1986-07-29 | 1987-09-22 | Pfizer Inc. | 1-aza-4,5-dithiabicyclo [4.2.0] oct-2-en-8-one-2 carboxylate esters |
-
1986
- 1986-06-02 US US06/869,760 patent/US4782145A/en not_active Expired - Lifetime
-
1987
- 1987-05-19 FI FI872195A patent/FI87649C/fi not_active IP Right Cessation
- 1987-05-27 DE DE8787304669T patent/DE3764875D1/de not_active Expired - Lifetime
- 1987-05-27 EP EP87304669A patent/EP0249358B1/en not_active Expired - Lifetime
- 1987-05-27 AT AT87304669T patent/ATE56452T1/de not_active IP Right Cessation
- 1987-05-27 ES ES87304669T patent/ES2018022B3/es not_active Expired - Lifetime
- 1987-05-29 CA CA000538429A patent/CA1279312C/en not_active Expired - Lifetime
- 1987-05-29 IL IL82695A patent/IL82695A0/xx not_active IP Right Cessation
- 1987-05-29 IE IE143087A patent/IE59871B1/en not_active IP Right Cessation
- 1987-05-29 ZA ZA873876A patent/ZA873876B/xx unknown
- 1987-05-29 NZ NZ220498A patent/NZ220498A/xx unknown
- 1987-06-01 KR KR1019870005506A patent/KR890004560B1/ko not_active Expired
- 1987-06-01 DK DK198702798A patent/DK174280B1/da not_active IP Right Cessation
- 1987-06-01 HU HU872511A patent/HU196601B/hu not_active IP Right Cessation
- 1987-06-01 AU AU73695/87A patent/AU574610B2/en not_active Ceased
- 1987-06-01 JP JP62135002A patent/JPS62294685A/ja active Granted
- 1987-06-01 PT PT84983A patent/PT84983B/pt not_active IP Right Cessation
- 1987-06-01 YU YU100087A patent/YU46208B/sh unknown
-
1990
- 1990-09-24 GR GR90400693T patent/GR3000862T3/el unknown
Also Published As
| Publication number | Publication date |
|---|---|
| HU196601B (en) | 1988-12-28 |
| GR3000862T3 (en) | 1991-11-15 |
| DK174280B1 (da) | 2002-11-04 |
| JPS62294685A (ja) | 1987-12-22 |
| ATE56452T1 (de) | 1990-09-15 |
| NZ220498A (en) | 1989-08-29 |
| EP0249358B1 (en) | 1990-09-12 |
| DK279887D0 (da) | 1987-06-01 |
| FI87649B (fi) | 1992-10-30 |
| DE3764875D1 (de) | 1990-10-18 |
| ES2018022B3 (es) | 1991-03-16 |
| KR880000442A (ko) | 1988-03-25 |
| US4782145A (en) | 1988-11-01 |
| PT84983B (pt) | 1990-02-08 |
| IL82695A0 (en) | 1987-11-30 |
| IE871430L (en) | 1987-12-02 |
| YU100087A (en) | 1988-12-31 |
| DK279887A (da) | 1987-12-03 |
| ZA873876B (en) | 1987-11-30 |
| AU574610B2 (en) | 1988-07-07 |
| FI872195A7 (fi) | 1987-12-03 |
| HUT45066A (en) | 1988-05-30 |
| EP0249358A1 (en) | 1987-12-16 |
| KR890004560B1 (ko) | 1989-11-15 |
| AU7369587A (en) | 1987-12-10 |
| JPH0544950B2 (OSRAM) | 1993-07-07 |
| CA1279312C (en) | 1991-01-22 |
| FI87649C (fi) | 1993-02-10 |
| FI872195A0 (fi) | 1987-05-19 |
| IE59871B1 (en) | 1994-04-20 |
| PT84983A (en) | 1987-07-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| YU77594A (sh) | Postupak za dobijanje antagonista leukotriena | |
| YU46112B (sh) | Postupak za dobijanje 1-terc. alkil-supstituisanih naftiridin- i hinolin-karboksilnih derivata | |
| YU46208B (sh) | Postupak za dobijanje derivata penema | |
| PT75329A (en) | Process for the preparation of imidazoline derivatives | |
| SE8404555D0 (sv) | Mellanprodukter for framstellning av 2-substituerade trans-5-aryl-2,3,4,4a,9b-hexahydro-1h-pyrido(4,3-b)indoler | |
| ATE19876T1 (de) | 1-cyclopropyl-6-fluor-1,4-dihydro-4-oxo-7-(4de821229 | |
| DK448684A (da) | Alkyldiaminderivater og deres anvendelse som laegemidler | |
| ES478485A1 (es) | Procedimiento para la preparacion de 1-oxo-1h-pirimido (6-1-b) benzotiazoles. | |
| AU519287B2 (en) | Imidazo(1,2-alpha) imidazole derivatives | |
| FI830007L (fi) | Foerfarande foer framstaellning av 2-halogenpyridin-derivat | |
| SE8703494D0 (sv) | Mellanprodukter anvendbara vid framstellning av 2-tiofen-ettiksyraderivat | |
| JPS5470277A (en) | Hydroxyindole derivatives | |
| DE3275465D1 (en) | Thiolactime ethers of delta-1-pyrrolidine, and their preparation | |
| YU121290A (sh) | Novi postupak za pravljenje fenil-guanadin derivata | |
| YU46086B (sh) | Postupak za dobivanje derivata 2-guanidinotiazola | |
| JPS56113795A (en) | 2'-deoxy-3',5'-di-o-acetyl-5-fluorouridine derivative, its preparation and antitumor agent containing the same | |
| NZ192475A (en) | Indanyloxamic derivatives and pharmaceutical compositions | |
| GB2005680A (en) | Purification of pseudomonic acid | |
| CA1246075A (en) | AMINOALKOXYBENZOPYRANONES USED AS ANTIPSYCHOTIC AGENTS | |
| JPS5432473A (en) | Antibiotics pseudomonic acid derivative and its preparation | |
| GB704416A (en) | Improvements in or relating to thiaxanthones and the preparation thereof | |
| GB731966A (en) | New phenthiazine derivatives and process for their preparation | |
| YU123791A (sh) | Novi derivati 1-difenilmetil-piperazin i postupak za njihovo dobijanje | |
| YU164991A (sh) | Hidroksialkilhinolin etar kiseline kao antagonisti leukotriena | |
| GB890201A (en) | Antibacterial agents |