WO2004035526A1 - 芳香族ニトリル化合物の製造方法 - Google Patents
芳香族ニトリル化合物の製造方法 Download PDFInfo
- Publication number
- WO2004035526A1 WO2004035526A1 PCT/JP2003/013373 JP0313373W WO2004035526A1 WO 2004035526 A1 WO2004035526 A1 WO 2004035526A1 JP 0313373 W JP0313373 W JP 0313373W WO 2004035526 A1 WO2004035526 A1 WO 2004035526A1
- Authority
- WO
- WIPO (PCT)
- Prior art keywords
- group
- branched
- aromatic
- ring
- compound
- Prior art date
Links
- -1 aromatic nitrile compound Chemical class 0.000 title claims abstract description 166
- 238000000034 method Methods 0.000 title abstract description 36
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims abstract description 45
- 239000000203 mixture Substances 0.000 claims abstract description 25
- 239000003377 acid catalyst Substances 0.000 claims abstract description 22
- 229910021529 ammonia Inorganic materials 0.000 claims abstract description 17
- 150000003863 ammonium salts Chemical class 0.000 claims abstract description 17
- 125000003277 amino group Chemical group 0.000 claims description 51
- 238000004519 manufacturing process Methods 0.000 claims description 44
- 150000001875 compounds Chemical class 0.000 claims description 39
- 125000002915 carbonyl group Chemical class [*:2]C([*:1])=O 0.000 claims description 38
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 31
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims description 30
- 229910052751 metal Chemical class 0.000 claims description 29
- 239000002184 metal Chemical class 0.000 claims description 29
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 29
- 125000005843 halogen group Chemical group 0.000 claims description 27
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 26
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 26
- 239000002994 raw material Substances 0.000 claims description 25
- 150000003839 salts Chemical class 0.000 claims description 25
- 125000001424 substituent group Chemical group 0.000 claims description 19
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 claims description 17
- 125000005842 heteroatom Chemical group 0.000 claims description 15
- 229910052757 nitrogen Inorganic materials 0.000 claims description 15
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 14
- 125000001153 fluoro group Chemical group F* 0.000 claims description 12
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 12
- 125000006615 aromatic heterocyclic group Chemical group 0.000 claims description 11
- 125000000217 alkyl group Chemical group 0.000 claims description 10
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 8
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical group C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims description 7
- 125000003545 alkoxy group Chemical group 0.000 claims description 6
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 6
- 229910052717 sulfur Inorganic materials 0.000 claims description 6
- 125000004434 sulfur atom Chemical group 0.000 claims description 6
- 125000004849 alkoxymethyl group Chemical group 0.000 claims description 5
- 125000004429 atom Chemical group 0.000 claims description 5
- 125000003282 alkyl amino group Chemical group 0.000 claims description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 3
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical group C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 claims description 3
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical group C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 claims description 3
- 125000006575 electron-withdrawing group Chemical group 0.000 claims description 3
- 125000001188 haloalkyl group Chemical group 0.000 claims description 3
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 claims description 3
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 2
- 150000001491 aromatic compounds Chemical class 0.000 claims description 2
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 2
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 2
- 125000006618 5- to 10-membered aromatic heterocyclic group Chemical group 0.000 claims 1
- 229910000435 bromine oxide Inorganic materials 0.000 abstract description 20
- FMSOWMGJJIHFTQ-UHFFFAOYSA-N oxidobromine(.) Chemical compound Br[O] FMSOWMGJJIHFTQ-UHFFFAOYSA-N 0.000 abstract description 20
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 78
- 238000006243 chemical reaction Methods 0.000 description 54
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Natural products CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 50
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 description 43
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 description 39
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 39
- 239000000243 solution Substances 0.000 description 32
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 31
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 24
- 238000004817 gas chromatography Methods 0.000 description 22
- SXDBWCPKPHAZSM-UHFFFAOYSA-N bromic acid Chemical compound OBr(=O)=O SXDBWCPKPHAZSM-UHFFFAOYSA-N 0.000 description 21
- 239000007789 gas Substances 0.000 description 21
- 125000000171 (C1-C6) haloalkyl group Chemical group 0.000 description 20
- 125000003178 carboxy group Chemical class [H]OC(*)=O 0.000 description 20
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 18
- 235000011114 ammonium hydroxide Nutrition 0.000 description 18
- 150000001793 charged compounds Chemical class 0.000 description 18
- WVDDGKGOMKODPV-UHFFFAOYSA-N hydroxymethyl benzene Natural products OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 18
- XUXNAKZDHHEHPC-UHFFFAOYSA-M sodium bromate Chemical compound [Na+].[O-]Br(=O)=O XUXNAKZDHHEHPC-UHFFFAOYSA-M 0.000 description 18
- 239000007858 starting material Substances 0.000 description 18
- 125000006577 C1-C6 hydroxyalkyl group Chemical group 0.000 description 17
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 17
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 17
- SXDBWCPKPHAZSM-UHFFFAOYSA-M bromate Inorganic materials [O-]Br(=O)=O SXDBWCPKPHAZSM-UHFFFAOYSA-M 0.000 description 16
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 description 16
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 15
- 235000019439 ethyl acetate Nutrition 0.000 description 14
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 14
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 14
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 14
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 14
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 description 13
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 13
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 13
- 238000002290 gas chromatography-mass spectrometry Methods 0.000 description 13
- 125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 description 13
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 13
- 125000003506 n-propoxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 13
- 238000010992 reflux Methods 0.000 description 13
- 239000002904 solvent Substances 0.000 description 13
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- 238000004587 chromatography analysis Methods 0.000 description 12
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 12
- 125000001309 chloro group Chemical group Cl* 0.000 description 11
- HYBBIBNJHNGZAN-UHFFFAOYSA-N furfural Chemical compound O=CC1=CC=CO1 HYBBIBNJHNGZAN-UHFFFAOYSA-N 0.000 description 11
- 125000001072 heteroaryl group Chemical group 0.000 description 11
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 10
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 238000004255 ion exchange chromatography Methods 0.000 description 9
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 9
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 9
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 9
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 9
- 238000002360 preparation method Methods 0.000 description 9
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 9
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 8
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 8
- 235000019445 benzyl alcohol Nutrition 0.000 description 8
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- 239000002253 acid Substances 0.000 description 7
- 125000001246 bromo group Chemical group Br* 0.000 description 7
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 7
- 125000004672 ethylcarbonyl group Chemical group [H]C([H])([H])C([H])([H])C(*)=O 0.000 description 7
- 125000004674 methylcarbonyl group Chemical group CC(=O)* 0.000 description 7
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 7
- 238000012360 testing method Methods 0.000 description 7
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 6
- JGJLWPGRMCADHB-UHFFFAOYSA-N hypobromite Chemical compound Br[O-] JGJLWPGRMCADHB-UHFFFAOYSA-N 0.000 description 6
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 6
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 5
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 5
- 150000003934 aromatic aldehydes Chemical class 0.000 description 5
- 239000002585 base Substances 0.000 description 5
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 5
- 229940073608 benzyl chloride Drugs 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 5
- 239000003054 catalyst Substances 0.000 description 5
- 235000019260 propionic acid Nutrition 0.000 description 5
- 125000004076 pyridyl group Chemical group 0.000 description 5
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 5
- 125000004916 (C1-C6) alkylcarbonyl group Chemical group 0.000 description 4
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 4
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 description 4
- 125000003806 alkyl carbonyl amino group Chemical group 0.000 description 4
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- DKSMCEUSSQTGBK-UHFFFAOYSA-M bromite Chemical compound [O-]Br=O DKSMCEUSSQTGBK-UHFFFAOYSA-M 0.000 description 4
- 239000006227 byproduct Substances 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- 125000002541 furyl group Chemical group 0.000 description 4
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 4
- 239000003921 oil Substances 0.000 description 4
- 230000009257 reactivity Effects 0.000 description 4
- 238000003786 synthesis reaction Methods 0.000 description 4
- YXDXXGXWFJCXEB-UHFFFAOYSA-N 2-furonitrile Chemical compound N#CC1=CC=CO1 YXDXXGXWFJCXEB-UHFFFAOYSA-N 0.000 description 3
- MVQVNTPHUGQQHK-UHFFFAOYSA-N 3-pyridinemethanol Chemical compound OCC1=CC=CN=C1 MVQVNTPHUGQQHK-UHFFFAOYSA-N 0.000 description 3
- GJNGXPDXRVXSEH-UHFFFAOYSA-N 4-chlorobenzonitrile Chemical compound ClC1=CC=C(C#N)C=C1 GJNGXPDXRVXSEH-UHFFFAOYSA-N 0.000 description 3
- VCZNNAKNUVJVGX-UHFFFAOYSA-N 4-methylbenzonitrile Chemical compound CC1=CC=C(C#N)C=C1 VCZNNAKNUVJVGX-UHFFFAOYSA-N 0.000 description 3
- BXRFQSNOROATLV-UHFFFAOYSA-N 4-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=C(C=O)C=C1 BXRFQSNOROATLV-UHFFFAOYSA-N 0.000 description 3
- NKJIFDNZPGLLSH-UHFFFAOYSA-N 4-nitrobenzonitrile Chemical compound [O-][N+](=O)C1=CC=C(C#N)C=C1 NKJIFDNZPGLLSH-UHFFFAOYSA-N 0.000 description 3
- WPYMKLBDIGXBTP-UHFFFAOYSA-N Benzoic acid Natural products OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 3
- BHXFKXOIODIUJO-UHFFFAOYSA-N benzene-1,4-dicarbonitrile Chemical compound N#CC1=CC=C(C#N)C=C1 BHXFKXOIODIUJO-UHFFFAOYSA-N 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 238000004891 communication Methods 0.000 description 3
- 230000000052 comparative effect Effects 0.000 description 3
- 230000003301 hydrolyzing effect Effects 0.000 description 3
- 125000002560 nitrile group Chemical group 0.000 description 3
- 239000007800 oxidant agent Substances 0.000 description 3
- FXLOVSHXALFLKQ-UHFFFAOYSA-N p-tolualdehyde Chemical compound CC1=CC=C(C=O)C=C1 FXLOVSHXALFLKQ-UHFFFAOYSA-N 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- WVDDGKGOMKODPV-ZQBYOMGUSA-N phenyl(114C)methanol Chemical compound O[14CH2]C1=CC=CC=C1 WVDDGKGOMKODPV-ZQBYOMGUSA-N 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 239000011347 resin Substances 0.000 description 3
- 229920005989 resin Polymers 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- MBIZXFATKUQOOA-UHFFFAOYSA-N 1,3,4-thiadiazole Chemical compound C1=NN=CS1 MBIZXFATKUQOOA-UHFFFAOYSA-N 0.000 description 2
- JIHQDMXYYFUGFV-UHFFFAOYSA-N 1,3,5-triazine Chemical compound C1=NC=NC=N1 JIHQDMXYYFUGFV-UHFFFAOYSA-N 0.000 description 2
- ZGTFNNUASMWGTM-UHFFFAOYSA-N 1,3-thiazole-2-carbaldehyde Chemical compound O=CC1=NC=CS1 ZGTFNNUASMWGTM-UHFFFAOYSA-N 0.000 description 2
- ZIRGWUZHKJDYKT-UHFFFAOYSA-N 1,3-thiazole-2-carbonitrile Chemical compound N#CC1=NC=CS1 ZIRGWUZHKJDYKT-UHFFFAOYSA-N 0.000 description 2
- FCEHBMOGCRZNNI-UHFFFAOYSA-N 1-benzothiophene Chemical compound C1=CC=C2SC=CC2=C1 FCEHBMOGCRZNNI-UHFFFAOYSA-N 0.000 description 2
- UIEABCXJWANXFS-UHFFFAOYSA-N 1h-pyrazol-5-ylmethanol Chemical compound OCC=1C=CNN=1 UIEABCXJWANXFS-UHFFFAOYSA-N 0.000 description 2
- ICFGFAUMBISMLR-UHFFFAOYSA-N 1h-pyrazole-5-carbaldehyde Chemical compound O=CC=1C=CNN=1 ICFGFAUMBISMLR-UHFFFAOYSA-N 0.000 description 2
- XVHIUKSUZLPFCP-UHFFFAOYSA-N 2-(hydroxymethyl)benzaldehyde Chemical compound OCC1=CC=CC=C1C=O XVHIUKSUZLPFCP-UHFFFAOYSA-N 0.000 description 2
- ZHERWZMAGGWSIX-UHFFFAOYSA-N 2-(methoxymethyl)aniline Chemical compound COCC1=CC=CC=C1N ZHERWZMAGGWSIX-UHFFFAOYSA-N 0.000 description 2
- PKZJLOCLABXVMC-UHFFFAOYSA-N 2-Methoxybenzaldehyde Chemical compound COC1=CC=CC=C1C=O PKZJLOCLABXVMC-UHFFFAOYSA-N 0.000 description 2
- GDHXJNRAJRCGMX-UHFFFAOYSA-N 2-fluorobenzonitrile Chemical compound FC1=CC=CC=C1C#N GDHXJNRAJRCGMX-UHFFFAOYSA-N 0.000 description 2
- CSDSSGBPEUDDEE-UHFFFAOYSA-N 2-formylpyridine Chemical compound O=CC1=CC=CC=N1 CSDSSGBPEUDDEE-UHFFFAOYSA-N 0.000 description 2
- BZSXEZOLBIJVQK-UHFFFAOYSA-N 2-methylsulfonylbenzoic acid Chemical compound CS(=O)(=O)C1=CC=CC=C1C(O)=O BZSXEZOLBIJVQK-UHFFFAOYSA-N 0.000 description 2
- CDNQOMJEQKBLBN-UHFFFAOYSA-N 3-(hydroxymethyl)benzaldehyde Chemical compound OCC1=CC=CC(C=O)=C1 CDNQOMJEQKBLBN-UHFFFAOYSA-N 0.000 description 2
- UOKBFIOAEPCADP-UHFFFAOYSA-N 3-(hydroxymethyl)benzoic acid Chemical compound OCC1=CC=CC(C(O)=O)=C1 UOKBFIOAEPCADP-UHFFFAOYSA-N 0.000 description 2
- BQWQTLKHBHLJAQ-UHFFFAOYSA-N 3-(methoxymethyl)benzaldehyde Chemical compound COCC1=CC=CC(C=O)=C1 BQWQTLKHBHLJAQ-UHFFFAOYSA-N 0.000 description 2
- CUZYAGBQYFQQCE-UHFFFAOYSA-N 3-(methoxymethyl)furan Chemical compound COCC=1C=COC=1 CUZYAGBQYFQQCE-UHFFFAOYSA-N 0.000 description 2
- RCTIHQZIVLNKDZ-UHFFFAOYSA-N 3-(methoxymethyl)thiophene Chemical compound COCC=1C=CSC=1 RCTIHQZIVLNKDZ-UHFFFAOYSA-N 0.000 description 2
- BOWIFWCBNWWZOG-UHFFFAOYSA-N 3-Thiophenemethanol Chemical compound OCC=1C=CSC=1 BOWIFWCBNWWZOG-UHFFFAOYSA-N 0.000 description 2
- AZVSIHIBYRHSLB-UHFFFAOYSA-N 3-furaldehyde Chemical compound O=CC=1C=COC=1 AZVSIHIBYRHSLB-UHFFFAOYSA-N 0.000 description 2
- WMPDAIZRQDCGFH-UHFFFAOYSA-N 3-methoxybenzaldehyde Chemical compound COC1=CC=CC(C=O)=C1 WMPDAIZRQDCGFH-UHFFFAOYSA-N 0.000 description 2
- GZPHSAQLYPIAIN-UHFFFAOYSA-N 3-pyridinecarbonitrile Chemical compound N#CC1=CC=CN=C1 GZPHSAQLYPIAIN-UHFFFAOYSA-N 0.000 description 2
- WWYFPDXEIFBNKE-UHFFFAOYSA-N 4-(hydroxymethyl)benzoic acid Chemical compound OCC1=CC=C(C(O)=O)C=C1 WWYFPDXEIFBNKE-UHFFFAOYSA-N 0.000 description 2
- LHKUVIRLOYVRHW-UHFFFAOYSA-N 4-(methoxymethyl)benzaldehyde Chemical compound COCC1=CC=C(C=O)C=C1 LHKUVIRLOYVRHW-UHFFFAOYSA-N 0.000 description 2
- AVPYQKSLYISFPO-UHFFFAOYSA-N 4-chlorobenzaldehyde Chemical compound ClC1=CC=C(C=O)C=C1 AVPYQKSLYISFPO-UHFFFAOYSA-N 0.000 description 2
- XRHGYUZYPHTUJZ-UHFFFAOYSA-N 4-chlorobenzoic acid Chemical compound OC(=O)C1=CC=C(Cl)C=C1 XRHGYUZYPHTUJZ-UHFFFAOYSA-N 0.000 description 2
- RGHHSNMVTDWUBI-UHFFFAOYSA-N 4-hydroxybenzaldehyde Chemical compound OC1=CC=C(C=O)C=C1 RGHHSNMVTDWUBI-UHFFFAOYSA-N 0.000 description 2
- FJKROLUGYXJWQN-UHFFFAOYSA-N 4-hydroxybenzoic acid Chemical compound OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 2
- NSPMIYGKQJPBQR-UHFFFAOYSA-N 4H-1,2,4-triazole Chemical compound C=1N=CNN=1 NSPMIYGKQJPBQR-UHFFFAOYSA-N 0.000 description 2
- YWXPPKJKSSLZOD-UHFFFAOYSA-N 5-(methoxymethyl)-1h-1,2,4-triazole Chemical compound COCC=1N=CNN=1 YWXPPKJKSSLZOD-UHFFFAOYSA-N 0.000 description 2
- IKUAHKWSYIFRPJ-UHFFFAOYSA-N 5-(methoxymethyl)-1h-imidazole Chemical compound COCC1=CNC=N1 IKUAHKWSYIFRPJ-UHFFFAOYSA-N 0.000 description 2
- RBQRZWYCXAXPIN-UHFFFAOYSA-N 5-methylthiophene-2-carbonitrile Chemical compound CC1=CC=C(C#N)S1 RBQRZWYCXAXPIN-UHFFFAOYSA-N 0.000 description 2
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 2
- 239000005695 Ammonium acetate Substances 0.000 description 2
- 239000005711 Benzoic acid Substances 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 2
- UWIULCYKVGIOPW-UHFFFAOYSA-N Glycolone Natural products CCOC1=C(CC=CC)C(=O)N(C)c2c(O)cccc12 UWIULCYKVGIOPW-UHFFFAOYSA-N 0.000 description 2
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical class ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 2
- 238000000023 Kugelrohr distillation Methods 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- XMUZQOKACOLCSS-UHFFFAOYSA-N [2-(hydroxymethyl)phenyl]methanol Chemical compound OCC1=CC=CC=C1CO XMUZQOKACOLCSS-UHFFFAOYSA-N 0.000 description 2
- YWMLORGQOFONNT-UHFFFAOYSA-N [3-(hydroxymethyl)phenyl]methanol Chemical compound OCC1=CC=CC(CO)=C1 YWMLORGQOFONNT-UHFFFAOYSA-N 0.000 description 2
- 238000006136 alcoholysis reaction Methods 0.000 description 2
- 150000001299 aldehydes Chemical class 0.000 description 2
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 2
- 150000004703 alkoxides Chemical class 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 235000019257 ammonium acetate Nutrition 0.000 description 2
- 229940043376 ammonium acetate Drugs 0.000 description 2
- SWLVFNYSXGMGBS-UHFFFAOYSA-N ammonium bromide Chemical compound [NH4+].[Br-] SWLVFNYSXGMGBS-UHFFFAOYSA-N 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- XJMWHXZUIGHOBA-UHFFFAOYSA-N azane;propanoic acid Chemical compound N.CCC(O)=O XJMWHXZUIGHOBA-UHFFFAOYSA-N 0.000 description 2
- 235000010233 benzoic acid Nutrition 0.000 description 2
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000012230 colorless oil Substances 0.000 description 2
- 230000018044 dehydration Effects 0.000 description 2
- 238000006297 dehydration reaction Methods 0.000 description 2
- 125000005448 ethoxyethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 2
- QEWYKACRFQMRMB-UHFFFAOYSA-N fluoroacetic acid Chemical compound OC(=O)CF QEWYKACRFQMRMB-UHFFFAOYSA-N 0.000 description 2
- STJIISDMSMJQQK-UHFFFAOYSA-N furan-3-ylmethanol Chemical compound OCC=1C=COC=1 STJIISDMSMJQQK-UHFFFAOYSA-N 0.000 description 2
- 150000002391 heterocyclic compounds Chemical group 0.000 description 2
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- PVWXHEMUPZXLKS-UHFFFAOYSA-N methoxymethoxymethylbenzene Chemical compound COCOCC1=CC=CC=C1 PVWXHEMUPZXLKS-UHFFFAOYSA-N 0.000 description 2
- 150000002825 nitriles Chemical class 0.000 description 2
- BTFQKIATRPGRBS-UHFFFAOYSA-N o-tolualdehyde Chemical compound CC1=CC=CC=C1C=O BTFQKIATRPGRBS-UHFFFAOYSA-N 0.000 description 2
- ZWLPBLYKEWSWPD-UHFFFAOYSA-N o-toluic acid Chemical compound CC1=CC=CC=C1C(O)=O ZWLPBLYKEWSWPD-UHFFFAOYSA-N 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- RUOJZAUFBMNUDX-UHFFFAOYSA-N propylene carbonate Chemical compound CC1COC(=O)O1 RUOJZAUFBMNUDX-UHFFFAOYSA-N 0.000 description 2
- QJZUKDFHGGYHMC-UHFFFAOYSA-N pyridine-3-carbaldehyde Chemical compound O=CC1=CC=CN=C1 QJZUKDFHGGYHMC-UHFFFAOYSA-N 0.000 description 2
- SMUQFGGVLNAIOZ-UHFFFAOYSA-N quinaldine Chemical compound C1=CC=CC2=NC(C)=CC=C21 SMUQFGGVLNAIOZ-UHFFFAOYSA-N 0.000 description 2
- KXYNLLGPBDUAHW-UHFFFAOYSA-N quinolin-4-ylmethanol Chemical compound C1=CC=C2C(CO)=CC=NC2=C1 KXYNLLGPBDUAHW-UHFFFAOYSA-N 0.000 description 2
- MGCGJBXTNWUHQE-UHFFFAOYSA-N quinoline-4-carbaldehyde Chemical compound C1=CC=C2C(C=O)=CC=NC2=C1 MGCGJBXTNWUHQE-UHFFFAOYSA-N 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 238000010898 silica gel chromatography Methods 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- NYCVSSWORUBFET-UHFFFAOYSA-M sodium;bromite Chemical compound [Na+].[O-]Br=O NYCVSSWORUBFET-UHFFFAOYSA-M 0.000 description 2
- 239000011973 solid acid Substances 0.000 description 2
- 229910052723 transition metal Inorganic materials 0.000 description 2
- 150000003624 transition metals Chemical class 0.000 description 2
- XPNGNIFUDRPBFJ-UHFFFAOYSA-N (2-methylphenyl)methanol Chemical compound CC1=CC=CC=C1CO XPNGNIFUDRPBFJ-UHFFFAOYSA-N 0.000 description 1
- VKTQADPEPIVMHK-UHFFFAOYSA-N (2-phenylphenyl)methanol Chemical group OCC1=CC=CC=C1C1=CC=CC=C1 VKTQADPEPIVMHK-UHFFFAOYSA-N 0.000 description 1
- HOXDYOFMLGYVGR-UHFFFAOYSA-N (benzylamino)methanol Chemical compound OCNCC1=CC=CC=C1 HOXDYOFMLGYVGR-UHFFFAOYSA-N 0.000 description 1
- AVQQQNCBBIEMEU-UHFFFAOYSA-N 1,1,3,3-tetramethylurea Chemical compound CN(C)C(=O)N(C)C AVQQQNCBBIEMEU-UHFFFAOYSA-N 0.000 description 1
- WCLKSQYCWXZMGX-UHFFFAOYSA-N 1,2,3,4-tetrabromo-5,6-dimethoxybenzene Chemical compound COC1=C(Br)C(Br)=C(Br)C(Br)=C1OC WCLKSQYCWXZMGX-UHFFFAOYSA-N 0.000 description 1
- UGUHFDPGDQDVGX-UHFFFAOYSA-N 1,2,3-thiadiazole Chemical compound C1=CSN=N1 UGUHFDPGDQDVGX-UHFFFAOYSA-N 0.000 description 1
- VRBDBKZGTNNODI-UHFFFAOYSA-N 1,2,4-thiadiazol-3-ylmethanol Chemical compound OCC=1N=CSN=1 VRBDBKZGTNNODI-UHFFFAOYSA-N 0.000 description 1
- CCWICYPDYRZQFG-UHFFFAOYSA-N 1,2,4-thiadiazol-5-ylmethanol Chemical compound OCC1=NC=NS1 CCWICYPDYRZQFG-UHFFFAOYSA-N 0.000 description 1
- AKJKHYJOLIRYKP-UHFFFAOYSA-N 1,2,4-thiadiazole-5-carbaldehyde Chemical compound O=CC1=NC=NS1 AKJKHYJOLIRYKP-UHFFFAOYSA-N 0.000 description 1
- GBCAGXLDCTZCCT-UHFFFAOYSA-N 1,2-oxazol-3-ylmethanol Chemical compound OCC=1C=CON=1 GBCAGXLDCTZCCT-UHFFFAOYSA-N 0.000 description 1
- YUXAURUEOIQGKA-UHFFFAOYSA-N 1,2-oxazol-4-ylmethanol Chemical compound OCC=1C=NOC=1 YUXAURUEOIQGKA-UHFFFAOYSA-N 0.000 description 1
- QOOSRUMHBCVQFK-UHFFFAOYSA-N 1,2-oxazol-5-ylmethanol Chemical compound OCC1=CC=NO1 QOOSRUMHBCVQFK-UHFFFAOYSA-N 0.000 description 1
- WNVZOHNNPDZYFN-UHFFFAOYSA-N 1,2-oxazole-3-carbaldehyde Chemical compound O=CC=1C=CON=1 WNVZOHNNPDZYFN-UHFFFAOYSA-N 0.000 description 1
- BLOZNQVFQCOHRW-UHFFFAOYSA-N 1,2-oxazole-4-carbaldehyde Chemical compound O=CC=1C=NOC=1 BLOZNQVFQCOHRW-UHFFFAOYSA-N 0.000 description 1
- OVRPVAZRSIBVJO-UHFFFAOYSA-N 1,2-thiazol-4-ylmethanol Chemical compound OCC=1C=NSC=1 OVRPVAZRSIBVJO-UHFFFAOYSA-N 0.000 description 1
- VDJLMGHKRZLAFP-UHFFFAOYSA-N 1,2-thiazol-5-ylmethanol Chemical compound OCC1=CC=NS1 VDJLMGHKRZLAFP-UHFFFAOYSA-N 0.000 description 1
- UTYMNDRFIGGIDB-UHFFFAOYSA-N 1,2-thiazole-3-carbaldehyde Chemical compound O=CC=1C=CSN=1 UTYMNDRFIGGIDB-UHFFFAOYSA-N 0.000 description 1
- UNRYEXYOMXENNP-UHFFFAOYSA-N 1,2-thiazole-4-carbaldehyde Chemical compound O=CC=1C=NSC=1 UNRYEXYOMXENNP-UHFFFAOYSA-N 0.000 description 1
- IEHJKGRLVGZCMX-UHFFFAOYSA-N 1,3-oxazol-2-ylmethanol Chemical compound OCC1=NC=CO1 IEHJKGRLVGZCMX-UHFFFAOYSA-N 0.000 description 1
- BKHIXCNJVHVHAG-UHFFFAOYSA-N 1,3-oxazol-4-ylmethanol Chemical compound OCC1=COC=N1 BKHIXCNJVHVHAG-UHFFFAOYSA-N 0.000 description 1
- CRPXMLXYMBLZEP-UHFFFAOYSA-N 1,3-oxazol-5-ylmethanol Chemical compound OCC1=CN=CO1 CRPXMLXYMBLZEP-UHFFFAOYSA-N 0.000 description 1
- TYHOSUCCUICRLM-UHFFFAOYSA-N 1,3-oxazole-2-carbaldehyde Chemical compound O=CC1=NC=CO1 TYHOSUCCUICRLM-UHFFFAOYSA-N 0.000 description 1
- JBWIIXBEPINWPB-UHFFFAOYSA-N 1,3-oxazole-4-carbaldehyde Chemical compound O=CC1=COC=N1 JBWIIXBEPINWPB-UHFFFAOYSA-N 0.000 description 1
- WKBQQWDVVHGWDB-UHFFFAOYSA-N 1,3-thiazol-5-ylmethanol Chemical compound OCC1=CN=CS1 WKBQQWDVVHGWDB-UHFFFAOYSA-N 0.000 description 1
- WRFKSVINLIQRKF-UHFFFAOYSA-N 1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC=N1 WRFKSVINLIQRKF-UHFFFAOYSA-N 0.000 description 1
- ZXRLWHGLEJGMNO-UHFFFAOYSA-N 1,3-thiazole-5-carbaldehyde Chemical compound O=CC1=CN=CS1 ZXRLWHGLEJGMNO-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- DAJPMKAQEUGECW-UHFFFAOYSA-N 1,4-bis(methoxymethyl)benzene Chemical compound COCC1=CC=C(COC)C=C1 DAJPMKAQEUGECW-UHFFFAOYSA-N 0.000 description 1
- BCCNTWSBUIVXFE-UHFFFAOYSA-N 1-(dimethoxymethyl)-2-phenylbenzene Chemical group COC(OC)C1=CC=CC=C1C1=CC=CC=C1 BCCNTWSBUIVXFE-UHFFFAOYSA-N 0.000 description 1
- XHXKNCQHSRTGPK-UHFFFAOYSA-N 1-(fluoromethyl)-2-(methoxymethyl)benzene Chemical compound COCC1=CC=CC=C1CF XHXKNCQHSRTGPK-UHFFFAOYSA-N 0.000 description 1
- MRCLQLUYAPOHMA-UHFFFAOYSA-N 1-(fluoromethyl)-4-(methoxymethyl)benzene Chemical compound COCC1=CC=C(CF)C=C1 MRCLQLUYAPOHMA-UHFFFAOYSA-N 0.000 description 1
- HNASEWFYPPRNKM-UHFFFAOYSA-N 1-(methoxymethyl)-4-methylbenzene Chemical compound COCC1=CC=C(C)C=C1 HNASEWFYPPRNKM-UHFFFAOYSA-N 0.000 description 1
- KAYWCNMTNWESKH-UHFFFAOYSA-N 1-(methoxymethyl)-4-phenylbenzene Chemical group C1=CC(COC)=CC=C1C1=CC=CC=C1 KAYWCNMTNWESKH-UHFFFAOYSA-N 0.000 description 1
- JUULFFKCNJHMAQ-UHFFFAOYSA-N 1-[3-(methoxymethoxy)phenyl]ethanone Chemical compound COCOC1=CC=CC(C(C)=O)=C1 JUULFFKCNJHMAQ-UHFFFAOYSA-N 0.000 description 1
- NXSVNPSWARVMAY-UHFFFAOYSA-N 1-benzothiophene-2-carbaldehyde Chemical compound C1=CC=C2SC(C=O)=CC2=C1 NXSVNPSWARVMAY-UHFFFAOYSA-N 0.000 description 1
- WDJLPQCBTBZTRH-UHFFFAOYSA-N 1-benzothiophene-3-carbaldehyde Chemical compound C1=CC=C2C(C=O)=CSC2=C1 WDJLPQCBTBZTRH-UHFFFAOYSA-N 0.000 description 1
- WTCQKBKVLYOTFC-UHFFFAOYSA-N 1-benzothiophene-4-carbaldehyde Chemical compound O=CC1=CC=CC2=C1C=CS2 WTCQKBKVLYOTFC-UHFFFAOYSA-N 0.000 description 1
- QHHRWAPVYHRAJA-UHFFFAOYSA-N 1-benzothiophene-5-carbaldehyde Chemical compound O=CC1=CC=C2SC=CC2=C1 QHHRWAPVYHRAJA-UHFFFAOYSA-N 0.000 description 1
- WSSVAOKEXMFMIO-UHFFFAOYSA-N 1-benzothiophene-7-carbaldehyde Chemical compound O=CC1=CC=CC2=C1SC=C2 WSSVAOKEXMFMIO-UHFFFAOYSA-N 0.000 description 1
- REXQTRHCVRPOMB-UHFFFAOYSA-N 1-chloro-4-[(4-chlorophenyl)methoxymethyl]benzene Chemical compound C1=CC(Cl)=CC=C1COCC1=CC=C(Cl)C=C1 REXQTRHCVRPOMB-UHFFFAOYSA-N 0.000 description 1
- KPRPNESWNQSZDE-UHFFFAOYSA-N 1-nitro-4-[2-[2-(4-nitrophenyl)ethoxy]ethyl]benzene Chemical compound C1=CC([N+](=O)[O-])=CC=C1CCOCCC1=CC=C([N+]([O-])=O)C=C1 KPRPNESWNQSZDE-UHFFFAOYSA-N 0.000 description 1
- UDDMDSNULOKCLP-UHFFFAOYSA-N 1h-1,2,4-triazol-5-ylmethanol Chemical compound OCC1=NN=CN1 UDDMDSNULOKCLP-UHFFFAOYSA-N 0.000 description 1
- VKFMHRMTBYXHKO-UHFFFAOYSA-N 1h-imidazol-1-ium-5-olate Chemical class OC1=CNC=N1 VKFMHRMTBYXHKO-UHFFFAOYSA-N 0.000 description 1
- ZOMATQMEHRJKLO-UHFFFAOYSA-N 1h-imidazol-2-ylmethanol Chemical compound OCC1=NC=CN1 ZOMATQMEHRJKLO-UHFFFAOYSA-N 0.000 description 1
- XYHKNCXZYYTLRG-UHFFFAOYSA-N 1h-imidazole-2-carbaldehyde Chemical compound O=CC1=NC=CN1 XYHKNCXZYYTLRG-UHFFFAOYSA-N 0.000 description 1
- ZQEXIXXJFSQPNA-UHFFFAOYSA-N 1h-imidazole-5-carbaldehyde Chemical compound O=CC1=CNC=N1 ZQEXIXXJFSQPNA-UHFFFAOYSA-N 0.000 description 1
- XEEANGGQJOWRTG-UHFFFAOYSA-N 1h-indol-2-ylmethanol Chemical compound C1=CC=C2NC(CO)=CC2=C1 XEEANGGQJOWRTG-UHFFFAOYSA-N 0.000 description 1
- BVSGXWCTWBZFEV-UHFFFAOYSA-N 1h-indol-4-ylmethanol Chemical compound OCC1=CC=CC2=C1C=CN2 BVSGXWCTWBZFEV-UHFFFAOYSA-N 0.000 description 1
- LRGBDJBDJXZTTD-UHFFFAOYSA-N 1h-pyrazole-4-carbaldehyde Chemical compound O=CC=1C=NNC=1 LRGBDJBDJXZTTD-UHFFFAOYSA-N 0.000 description 1
- CHNYVNOFAWYUEG-UHFFFAOYSA-N 1h-pyrrole-3-carbaldehyde Chemical compound O=CC=1C=CNC=1 CHNYVNOFAWYUEG-UHFFFAOYSA-N 0.000 description 1
- RJCFWJNYLJRLRC-UHFFFAOYSA-N 2-(2-methyl-1,3-thiazol-4-yl)acetic acid Chemical compound CC1=NC(CC(O)=O)=CS1 RJCFWJNYLJRLRC-UHFFFAOYSA-N 0.000 description 1
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 description 1
- GANSPRKOWQQXPE-UHFFFAOYSA-N 2-(Methoxymethyl)furan Chemical compound COCC1=CC=CO1 GANSPRKOWQQXPE-UHFFFAOYSA-N 0.000 description 1
- ZKUTZTOFMRABQH-UHFFFAOYSA-N 2-(aminomethyl)benzaldehyde Chemical compound NCC1=CC=CC=C1C=O ZKUTZTOFMRABQH-UHFFFAOYSA-N 0.000 description 1
- ICHYJYHEPOAXNU-UHFFFAOYSA-N 2-(fluoromethyl)benzaldehyde Chemical compound FCC1=CC=CC=C1C=O ICHYJYHEPOAXNU-UHFFFAOYSA-N 0.000 description 1
- NWRXEGKWQXAEHC-UHFFFAOYSA-N 2-(hydroxymethyl)benzonitrile Chemical compound OCC1=CC=CC=C1C#N NWRXEGKWQXAEHC-UHFFFAOYSA-N 0.000 description 1
- PWPUFEWBHCVGED-UHFFFAOYSA-N 2-(methoxymethoxy)phenol Chemical compound COCOC1=CC=CC=C1O PWPUFEWBHCVGED-UHFFFAOYSA-N 0.000 description 1
- QKPYNROLRFWVMB-UHFFFAOYSA-N 2-(methoxymethyl)-1,3-oxazole Chemical compound COCC1=NC=CO1 QKPYNROLRFWVMB-UHFFFAOYSA-N 0.000 description 1
- MXPUSPLPHOOHFT-UHFFFAOYSA-N 2-(methoxymethyl)-1-benzothiophene Chemical compound C1=CC=C2SC(COC)=CC2=C1 MXPUSPLPHOOHFT-UHFFFAOYSA-N 0.000 description 1
- WBQTVZALNOJHNB-UHFFFAOYSA-N 2-(methoxymethyl)-1h-imidazole Chemical compound COCC1=NC=CN1 WBQTVZALNOJHNB-UHFFFAOYSA-N 0.000 description 1
- DHWCROPORHAZJK-UHFFFAOYSA-N 2-(methoxymethyl)-1h-isoquinoline Chemical compound C1=CC=C2C=CN(COC)CC2=C1 DHWCROPORHAZJK-UHFFFAOYSA-N 0.000 description 1
- GPWBSZYCZARIHN-UHFFFAOYSA-N 2-(methoxymethyl)benzaldehyde Chemical compound COCC1=CC=CC=C1C=O GPWBSZYCZARIHN-UHFFFAOYSA-N 0.000 description 1
- SZBJAHPVWKIPIU-UHFFFAOYSA-N 2-(methoxymethyl)benzoic acid Chemical compound COCC1=CC=CC=C1C(O)=O SZBJAHPVWKIPIU-UHFFFAOYSA-N 0.000 description 1
- JMUPRKJXQQILFI-UHFFFAOYSA-N 2-(methoxymethyl)benzonitrile Chemical compound COCC1=CC=CC=C1C#N JMUPRKJXQQILFI-UHFFFAOYSA-N 0.000 description 1
- QDTSINVSGKAPBV-UHFFFAOYSA-N 2-(methoxymethyl)pyridine Chemical compound COCC1=CC=CC=N1 QDTSINVSGKAPBV-UHFFFAOYSA-N 0.000 description 1
- CJCGBPVQHQMDIG-UHFFFAOYSA-N 2-(methoxymethyl)quinoline Chemical compound C1=CC=CC2=NC(COC)=CC=C21 CJCGBPVQHQMDIG-UHFFFAOYSA-N 0.000 description 1
- BMZQEYGEQALEIO-UHFFFAOYSA-N 2-(methoxymethyl)thiophene Chemical compound COCC1=CC=CS1 BMZQEYGEQALEIO-UHFFFAOYSA-N 0.000 description 1
- LIZGLUQDMOJDMM-UHFFFAOYSA-N 2-(methylamino)benzaldehyde Chemical compound CNC1=CC=CC=C1C=O LIZGLUQDMOJDMM-UHFFFAOYSA-N 0.000 description 1
- QDAWXRKTSATEOP-UHFFFAOYSA-N 2-acetylbenzoic acid Chemical compound CC(=O)C1=CC=CC=C1C(O)=O QDAWXRKTSATEOP-UHFFFAOYSA-N 0.000 description 1
- ZWDVQMVZZYIAHO-UHFFFAOYSA-N 2-fluorobenzaldehyde Chemical compound FC1=CC=CC=C1C=O ZWDVQMVZZYIAHO-UHFFFAOYSA-N 0.000 description 1
- DYNFCHNNOHNJFG-UHFFFAOYSA-N 2-formylbenzoic acid Chemical compound OC(=O)C1=CC=CC=C1C=O DYNFCHNNOHNJFG-UHFFFAOYSA-N 0.000 description 1
- QVTPWONEVZJCCS-UHFFFAOYSA-N 2-formylbenzonitrile Chemical compound O=CC1=CC=CC=C1C#N QVTPWONEVZJCCS-UHFFFAOYSA-N 0.000 description 1
- XQFJDFIHJKPUEL-UHFFFAOYSA-N 2-methoxy-n,n-dimethylaniline Chemical compound COC1=CC=CC=C1N(C)C XQFJDFIHJKPUEL-UHFFFAOYSA-N 0.000 description 1
- LXBGSDVWAMZHDD-UHFFFAOYSA-N 2-methyl-1h-imidazole Chemical compound CC1=NC=CN1 LXBGSDVWAMZHDD-UHFFFAOYSA-N 0.000 description 1
- XQQBUAPQHNYYRS-UHFFFAOYSA-N 2-methylthiophene Chemical compound CC1=CC=CS1 XQQBUAPQHNYYRS-UHFFFAOYSA-N 0.000 description 1
- CMWKITSNTDAEDT-UHFFFAOYSA-N 2-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=CC=C1C=O CMWKITSNTDAEDT-UHFFFAOYSA-N 0.000 description 1
- CHMNRJCRDOWYLX-UHFFFAOYSA-N 2h-tetrazol-5-ylmethanol Chemical compound OCC1=NN=NN1 CHMNRJCRDOWYLX-UHFFFAOYSA-N 0.000 description 1
- GUCBUVXBLCUMPZ-UHFFFAOYSA-N 3-(aminomethyl)benzaldehyde Chemical compound NCC1=CC=CC(C=O)=C1 GUCBUVXBLCUMPZ-UHFFFAOYSA-N 0.000 description 1
- VLUXDTNIKMUDNZ-UHFFFAOYSA-N 3-(fluoromethyl)benzaldehyde Chemical compound FCC1=CC=CC(C=O)=C1 VLUXDTNIKMUDNZ-UHFFFAOYSA-N 0.000 description 1
- VTXUKOKMVNMHJX-UHFFFAOYSA-N 3-(methoxymethoxy)phenol Chemical compound COCOC1=CC=CC(O)=C1 VTXUKOKMVNMHJX-UHFFFAOYSA-N 0.000 description 1
- MBJXKGJLQCOYGJ-UHFFFAOYSA-N 3-(methoxymethyl)-1,2,4-thiadiazole Chemical compound COCC=1N=CSN=1 MBJXKGJLQCOYGJ-UHFFFAOYSA-N 0.000 description 1
- LALOXWWHWXJFAM-UHFFFAOYSA-N 3-(methoxymethyl)-1,2-oxazole Chemical compound COCC=1C=CON=1 LALOXWWHWXJFAM-UHFFFAOYSA-N 0.000 description 1
- SZMCDBYIMBWMQE-UHFFFAOYSA-N 3-(methoxymethyl)-1,2-thiazole Chemical compound COCC=1C=CSN=1 SZMCDBYIMBWMQE-UHFFFAOYSA-N 0.000 description 1
- RJWLFBCRNXZXTJ-UHFFFAOYSA-N 3-(methoxymethyl)-1h-indole Chemical compound C1=CC=C2C(COC)=CNC2=C1 RJWLFBCRNXZXTJ-UHFFFAOYSA-N 0.000 description 1
- RVZIRNWJPQXUDG-UHFFFAOYSA-N 3-(methoxymethyl)-n-methylaniline Chemical compound CNC1=CC=CC(COC)=C1 RVZIRNWJPQXUDG-UHFFFAOYSA-N 0.000 description 1
- IRMGVBTVFRYBGN-UHFFFAOYSA-N 3-(methoxymethyl)aniline Chemical compound COCC1=CC=CC(N)=C1 IRMGVBTVFRYBGN-UHFFFAOYSA-N 0.000 description 1
- ZPBMOTGPFVLBMN-UHFFFAOYSA-N 3-(methoxymethyl)benzoic acid Chemical compound COCC1=CC=CC(C(O)=O)=C1 ZPBMOTGPFVLBMN-UHFFFAOYSA-N 0.000 description 1
- AQAAPEKGAKDCPI-UHFFFAOYSA-N 3-(methoxymethyl)isoquinoline Chemical compound C1=CC=C2C=NC(COC)=CC2=C1 AQAAPEKGAKDCPI-UHFFFAOYSA-N 0.000 description 1
- KFHBDDCHWCZICL-UHFFFAOYSA-N 3-(methoxymethyl)pyridazine Chemical compound COCC1=CC=CN=N1 KFHBDDCHWCZICL-UHFFFAOYSA-N 0.000 description 1
- HJJVHNKOXFYNTJ-UHFFFAOYSA-N 3-(methoxymethyl)pyridine Chemical compound COCC1=CC=CN=C1 HJJVHNKOXFYNTJ-UHFFFAOYSA-N 0.000 description 1
- BTWOKFFFRGJQFJ-UHFFFAOYSA-N 3-(methoxymethyl)quinoline Chemical compound C1=CC=CC2=CC(COC)=CN=C21 BTWOKFFFRGJQFJ-UHFFFAOYSA-N 0.000 description 1
- NNZUWTNLXGNSHE-UHFFFAOYSA-N 3-(methylamino)benzaldehyde Chemical compound CNC1=CC=CC(C=O)=C1 NNZUWTNLXGNSHE-UHFFFAOYSA-N 0.000 description 1
- HMNKTRSOROOSPP-UHFFFAOYSA-N 3-Ethylphenol Chemical compound CCC1=CC=CC(O)=C1 HMNKTRSOROOSPP-UHFFFAOYSA-N 0.000 description 1
- UHDNUPHSDMOGCR-UHFFFAOYSA-N 3-Formylbenzoic acid Chemical compound OC(=O)C1=CC=CC(C=O)=C1 UHDNUPHSDMOGCR-UHFFFAOYSA-N 0.000 description 1
- QVNFUJVNBRCKNJ-UHFFFAOYSA-N 3-acetylbenzaldehyde Chemical compound CC(=O)C1=CC=CC(C=O)=C1 QVNFUJVNBRCKNJ-UHFFFAOYSA-N 0.000 description 1
- CHZPJUSFUDUEMZ-UHFFFAOYSA-N 3-acetylbenzoic acid Chemical compound CC(=O)C1=CC=CC(C(O)=O)=C1 CHZPJUSFUDUEMZ-UHFFFAOYSA-N 0.000 description 1
- SIXYIEWSUKAOEN-UHFFFAOYSA-N 3-aminobenzaldehyde Chemical compound NC1=CC=CC(C=O)=C1 SIXYIEWSUKAOEN-UHFFFAOYSA-N 0.000 description 1
- HGZJJKZPPMFIBU-UHFFFAOYSA-N 3-formylbenzonitrile Chemical compound O=CC1=CC=CC(C#N)=C1 HGZJJKZPPMFIBU-UHFFFAOYSA-N 0.000 description 1
- IAVREABSGIHHMO-UHFFFAOYSA-N 3-hydroxybenzaldehyde Chemical compound OC1=CC=CC(C=O)=C1 IAVREABSGIHHMO-UHFFFAOYSA-N 0.000 description 1
- OKVJCVWFVRATSG-UHFFFAOYSA-N 3-hydroxybenzyl alcohol Chemical compound OCC1=CC=CC(O)=C1 OKVJCVWFVRATSG-UHFFFAOYSA-N 0.000 description 1
- KFKSIUOALVIACE-UHFFFAOYSA-N 3-phenylbenzaldehyde Chemical group O=CC1=CC=CC(C=2C=CC=CC=2)=C1 KFKSIUOALVIACE-UHFFFAOYSA-N 0.000 description 1
- ZXVONLUNISGICL-UHFFFAOYSA-N 4,6-dinitro-o-cresol Chemical group CC1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1O ZXVONLUNISGICL-UHFFFAOYSA-N 0.000 description 1
- WTOVNDAVEOVZAL-UHFFFAOYSA-N 4-(aminomethyl)benzaldehyde Chemical compound NCC1=CC=C(C=O)C=C1 WTOVNDAVEOVZAL-UHFFFAOYSA-N 0.000 description 1
- DHKHIAVEQXTIAI-UHFFFAOYSA-N 4-(fluoromethyl)benzaldehyde Chemical compound FCC1=CC=C(C=O)C=C1 DHKHIAVEQXTIAI-UHFFFAOYSA-N 0.000 description 1
- ZFHUHPNDGVGXMS-UHFFFAOYSA-N 4-(hydroxymethyl)benzaldehyde Chemical compound OCC1=CC=C(C=O)C=C1 ZFHUHPNDGVGXMS-UHFFFAOYSA-N 0.000 description 1
- RXBWSPDZPJIEHL-UHFFFAOYSA-N 4-(methoxymethyl)-1,2-oxazole Chemical compound COCC=1C=NOC=1 RXBWSPDZPJIEHL-UHFFFAOYSA-N 0.000 description 1
- FQJLLSQHHQHNAG-UHFFFAOYSA-N 4-(methoxymethyl)-1,2-thiazole Chemical compound COCC=1C=NSC=1 FQJLLSQHHQHNAG-UHFFFAOYSA-N 0.000 description 1
- HAJABPSXWQKNIX-UHFFFAOYSA-N 4-(methoxymethyl)-1,3-oxazole Chemical compound COCC1=COC=N1 HAJABPSXWQKNIX-UHFFFAOYSA-N 0.000 description 1
- JPONOTGMJUOKCE-UHFFFAOYSA-N 4-(methoxymethyl)-1h-indole Chemical compound COCC1=CC=CC2=C1C=CN2 JPONOTGMJUOKCE-UHFFFAOYSA-N 0.000 description 1
- JOJNHKAQBKZPJA-UHFFFAOYSA-N 4-(methoxymethyl)-n-methylaniline Chemical compound CNC1=CC=C(COC)C=C1 JOJNHKAQBKZPJA-UHFFFAOYSA-N 0.000 description 1
- URSADVDNUKPSIK-UHFFFAOYSA-N 4-(methoxymethyl)aniline Chemical compound COCC1=CC=C(N)C=C1 URSADVDNUKPSIK-UHFFFAOYSA-N 0.000 description 1
- OORFINRYBCDBEN-UHFFFAOYSA-N 4-(methoxymethyl)benzoic acid Chemical compound COCC1=CC=C(C(O)=O)C=C1 OORFINRYBCDBEN-UHFFFAOYSA-N 0.000 description 1
- AKDZZWWQBYBGAC-UHFFFAOYSA-N 4-(methoxymethyl)isoquinoline Chemical compound C1=CC=C2C(COC)=CN=CC2=C1 AKDZZWWQBYBGAC-UHFFFAOYSA-N 0.000 description 1
- MBGSSZLPFNHEHX-UHFFFAOYSA-N 4-(methoxymethyl)pyridine Chemical compound COCC1=CC=NC=C1 MBGSSZLPFNHEHX-UHFFFAOYSA-N 0.000 description 1
- VOEGOMSUWZOVGK-UHFFFAOYSA-N 4-(methoxymethyl)thiadiazole Chemical compound COCC1=CSN=N1 VOEGOMSUWZOVGK-UHFFFAOYSA-N 0.000 description 1
- SKLUWKYNZNXSLX-UHFFFAOYSA-N 4-Acetamidobenzaldehyde Chemical compound CC(=O)NC1=CC=C(C=O)C=C1 SKLUWKYNZNXSLX-UHFFFAOYSA-N 0.000 description 1
- UTMBQYSAHLIYSV-UHFFFAOYSA-N 4-[2-[2-(4-cyanophenyl)ethoxy]ethyl]benzonitrile Chemical compound C1=CC(C#N)=CC=C1CCOCCC1=CC=C(C#N)C=C1 UTMBQYSAHLIYSV-UHFFFAOYSA-N 0.000 description 1
- XWNSFEAWWGGSKJ-UHFFFAOYSA-N 4-acetyl-4-methylheptanedinitrile Chemical compound N#CCCC(C)(C(=O)C)CCC#N XWNSFEAWWGGSKJ-UHFFFAOYSA-N 0.000 description 1
- KTFKRVMXIVSARW-UHFFFAOYSA-N 4-acetylbenzaldehyde Chemical compound CC(=O)C1=CC=C(C=O)C=C1 KTFKRVMXIVSARW-UHFFFAOYSA-N 0.000 description 1
- QBHDSQZASIBAAI-UHFFFAOYSA-N 4-acetylbenzoic acid Chemical compound CC(=O)C1=CC=C(C(O)=O)C=C1 QBHDSQZASIBAAI-UHFFFAOYSA-N 0.000 description 1
- WZWIQYMTQZCSKI-UHFFFAOYSA-N 4-cyanobenzaldehyde Chemical compound O=CC1=CC=C(C#N)C=C1 WZWIQYMTQZCSKI-UHFFFAOYSA-N 0.000 description 1
- 229940090248 4-hydroxybenzoic acid Drugs 0.000 description 1
- ISDBWOPVZKNQDW-UHFFFAOYSA-N 4-phenylbenzaldehyde Chemical group C1=CC(C=O)=CC=C1C1=CC=CC=C1 ISDBWOPVZKNQDW-UHFFFAOYSA-N 0.000 description 1
- DDMDTMZQGJLMDW-UHFFFAOYSA-N 4-phenylcyclohexa-1,5-diene-1,4-dicarbaldehyde Chemical group C1=CC(C=O)=CCC1(C=O)C1=CC=CC=C1 DDMDTMZQGJLMDW-UHFFFAOYSA-N 0.000 description 1
- WTZXCHZCKBKRIK-UHFFFAOYSA-N 5-(methoxymethyl)-1,2,4-thiadiazole Chemical compound COCC1=NC=NS1 WTZXCHZCKBKRIK-UHFFFAOYSA-N 0.000 description 1
- LOZGFOHKYMETIB-UHFFFAOYSA-N 5-(methoxymethyl)-1,2-oxazole Chemical compound COCC1=CC=NO1 LOZGFOHKYMETIB-UHFFFAOYSA-N 0.000 description 1
- ZZZOBRKIOJLYMC-UHFFFAOYSA-N 5-(methoxymethyl)-1,2-thiazole Chemical compound COCC1=CC=NS1 ZZZOBRKIOJLYMC-UHFFFAOYSA-N 0.000 description 1
- AZVKOLOECHOHNN-UHFFFAOYSA-N 5-(methoxymethyl)-1,3-oxazole Chemical compound COCC1=CN=CO1 AZVKOLOECHOHNN-UHFFFAOYSA-N 0.000 description 1
- BTFRKRYIPLNIEG-UHFFFAOYSA-N 5-(methoxymethyl)-1h-pyrazole Chemical compound COCC=1C=CNN=1 BTFRKRYIPLNIEG-UHFFFAOYSA-N 0.000 description 1
- SPCMJEOPCMQWAM-UHFFFAOYSA-N 5-(methoxymethyl)thiadiazole Chemical compound COCC1=CN=NS1 SPCMJEOPCMQWAM-UHFFFAOYSA-N 0.000 description 1
- VAUMDUIUEPIGHM-UHFFFAOYSA-N 5-Methyl-2-thiophenecarboxaldehyde Chemical compound CC1=CC=C(C=O)S1 VAUMDUIUEPIGHM-UHFFFAOYSA-N 0.000 description 1
- ZFVRPAOFSPXEIM-UHFFFAOYSA-N 5-methoxyquinoline Chemical class C1=CC=C2C(OC)=CC=CC2=N1 ZFVRPAOFSPXEIM-UHFFFAOYSA-N 0.000 description 1
- LSBHSDZNFDNMSD-UHFFFAOYSA-N 6-(methoxymethyl)-1h-indole Chemical compound COCC1=CC=C2C=CNC2=C1 LSBHSDZNFDNMSD-UHFFFAOYSA-N 0.000 description 1
- QBJZJEIVXALWET-UHFFFAOYSA-N 6-(methoxymethyl)isoquinoline Chemical compound C1=NC=CC2=CC(COC)=CC=C21 QBJZJEIVXALWET-UHFFFAOYSA-N 0.000 description 1
- MQANXDXASOJDTG-UHFFFAOYSA-N 6-(methoxymethyl)quinoline Chemical compound N1=CC=CC2=CC(COC)=CC=C21 MQANXDXASOJDTG-UHFFFAOYSA-N 0.000 description 1
- HDSYXFXBMOPJQL-UHFFFAOYSA-N 7-(methoxymethyl)-1h-indole Chemical compound COCC1=CC=CC2=C1NC=C2 HDSYXFXBMOPJQL-UHFFFAOYSA-N 0.000 description 1
- LPAVTSLARLTWSI-UHFFFAOYSA-N 7-(methoxymethyl)isoquinoline Chemical compound C1=CN=CC2=CC(COC)=CC=C21 LPAVTSLARLTWSI-UHFFFAOYSA-N 0.000 description 1
- JRZIVJZZMRDYMO-UHFFFAOYSA-N 7-(methoxymethyl)quinoline Chemical compound C1=CC=NC2=CC(COC)=CC=C21 JRZIVJZZMRDYMO-UHFFFAOYSA-N 0.000 description 1
- ICLNPCISPPLFSS-UHFFFAOYSA-N 8-(methoxymethyl)isoquinoline Chemical compound C1=NC=C2C(COC)=CC=CC2=C1 ICLNPCISPPLFSS-UHFFFAOYSA-N 0.000 description 1
- VZQPUNFOFLLTDI-UHFFFAOYSA-N 8-(methoxymethyl)quinoline Chemical compound C1=CN=C2C(COC)=CC=CC2=C1 VZQPUNFOFLLTDI-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 239000004251 Ammonium lactate Substances 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- DKPFZGUDAPQIHT-UHFFFAOYSA-N Butyl acetate Natural products CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 description 1
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 1
- HZRTVZJJHSHDHC-UHFFFAOYSA-N C[S+]1C(C=O)=CC=C1 Chemical compound C[S+]1C(C=O)=CC=C1 HZRTVZJJHSHDHC-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 239000004154 Calcium bromate Substances 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- QENGPZGAWFQWCZ-UHFFFAOYSA-N Methylthiophene Natural products CC=1C=CSC=1 QENGPZGAWFQWCZ-UHFFFAOYSA-N 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- OCESEWRBGDARNI-UHFFFAOYSA-N OC(=O)c1ccccc1.OC(=O)c1ccc(Cl)cc1 Chemical compound OC(=O)c1ccccc1.OC(=O)c1ccc(Cl)cc1 OCESEWRBGDARNI-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 239000004153 Potassium bromate Substances 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- 235000002597 Solanum melongena Nutrition 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- WMOUKOAUAFESMR-UHFFFAOYSA-N [4-(aminomethyl)phenyl]methanol Chemical compound NCC1=CC=C(CO)C=C1 WMOUKOAUAFESMR-UHFFFAOYSA-N 0.000 description 1
- BWVAOONFBYYRHY-UHFFFAOYSA-N [4-(hydroxymethyl)phenyl]methanol Chemical compound OCC1=CC=C(CO)C=C1 BWVAOONFBYYRHY-UHFFFAOYSA-N 0.000 description 1
- DGPBXQNDKIZRIJ-UHFFFAOYSA-N [4-(methylamino)phenyl]methanol Chemical compound CNC1=CC=C(CO)C=C1 DGPBXQNDKIZRIJ-UHFFFAOYSA-N 0.000 description 1
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 102000011759 adducin Human genes 0.000 description 1
- 108010076723 adducin Proteins 0.000 description 1
- 239000003905 agrochemical Substances 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000004448 alkyl carbonyl group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 229940059265 ammonium lactate Drugs 0.000 description 1
- 235000019286 ammonium lactate Nutrition 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- 150000003931 anilides Chemical class 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- XZAVPVVTKGFNQK-UHFFFAOYSA-N azane;ethanesulfonic acid Chemical compound [NH4+].CCS([O-])(=O)=O XZAVPVVTKGFNQK-UHFFFAOYSA-N 0.000 description 1
- QHYIGPGWXQQZSA-UHFFFAOYSA-N azane;methanesulfonic acid Chemical compound [NH4+].CS([O-])(=O)=O QHYIGPGWXQQZSA-UHFFFAOYSA-N 0.000 description 1
- RXQNHIDQIJXKTK-UHFFFAOYSA-N azane;pentanoic acid Chemical compound [NH4+].CCCCC([O-])=O RXQNHIDQIJXKTK-UHFFFAOYSA-N 0.000 description 1
- RZOBLYBZQXQGFY-HSHFZTNMSA-N azanium;(2r)-2-hydroxypropanoate Chemical compound [NH4+].C[C@@H](O)C([O-])=O RZOBLYBZQXQGFY-HSHFZTNMSA-N 0.000 description 1
- WWLOCCUNZXBJFR-UHFFFAOYSA-N azanium;benzenesulfonate Chemical compound [NH4+].[O-]S(=O)(=O)C1=CC=CC=C1 WWLOCCUNZXBJFR-UHFFFAOYSA-N 0.000 description 1
- YNTQKXBRXYIAHM-UHFFFAOYSA-N azanium;butanoate Chemical compound [NH4+].CCCC([O-])=O YNTQKXBRXYIAHM-UHFFFAOYSA-N 0.000 description 1
- JTSVYBPWSSQBEB-UHFFFAOYSA-N azanium;hexanoate Chemical compound [NH4+].CCCCCC([O-])=O JTSVYBPWSSQBEB-UHFFFAOYSA-N 0.000 description 1
- 150000003935 benzaldehydes Chemical class 0.000 description 1
- IZALUMVGBVKPJD-UHFFFAOYSA-N benzene-1,3-dicarbaldehyde Chemical compound O=CC1=CC=CC(C=O)=C1 IZALUMVGBVKPJD-UHFFFAOYSA-N 0.000 description 1
- 150000008107 benzenesulfonic acids Chemical class 0.000 description 1
- 125000005605 benzo group Chemical group 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- MAYUYFCAPVDYBQ-UHFFFAOYSA-N butoxymethylbenzene Chemical compound CCCCOCC1=CC=CC=C1 MAYUYFCAPVDYBQ-UHFFFAOYSA-N 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 235000019397 calcium bromate Nutrition 0.000 description 1
- AIXAANGOTKPUOY-UHFFFAOYSA-N carbachol Chemical group [Cl-].C[N+](C)(C)CCOC(N)=O AIXAANGOTKPUOY-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- GYMBTLRVABDEHT-UHFFFAOYSA-N chlorobenzene;dichloromethane Chemical compound ClCCl.ClC1=CC=CC=C1 GYMBTLRVABDEHT-UHFFFAOYSA-N 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- DMSZORWOGDLWGN-UHFFFAOYSA-N ctk1a3526 Chemical compound NP(N)(N)=O DMSZORWOGDLWGN-UHFFFAOYSA-N 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 239000012024 dehydrating agents Substances 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- MHDVGSVTJDSBDK-UHFFFAOYSA-N dibenzyl ether Chemical class C=1C=CC=CC=1COCC1=CC=CC=C1 MHDVGSVTJDSBDK-UHFFFAOYSA-N 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000001177 diphosphate Substances 0.000 description 1
- XPPKVPWEQAFLFU-UHFFFAOYSA-J diphosphate(4-) Chemical compound [O-]P([O-])(=O)OP([O-])([O-])=O XPPKVPWEQAFLFU-UHFFFAOYSA-J 0.000 description 1
- 235000011180 diphosphates Nutrition 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 239000004210 ether based solvent Substances 0.000 description 1
- 125000005745 ethoxymethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])* 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- XPFVYQJUAUNWIW-UHFFFAOYSA-N furfuryl alcohol Chemical compound OCC1=CC=CO1 XPFVYQJUAUNWIW-UHFFFAOYSA-N 0.000 description 1
- 238000010574 gas phase reaction Methods 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 239000002920 hazardous waste Substances 0.000 description 1
- 230000020169 heat generation Effects 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical group I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Substances C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 1
- QDYTUZCWBJRHKK-UHFFFAOYSA-N imidazole-4-methanol Chemical compound OCC1=CNC=N1 QDYTUZCWBJRHKK-UHFFFAOYSA-N 0.000 description 1
- IVYPNXXAYMYVSP-UHFFFAOYSA-N indole-3-methanol Chemical compound C1=CC=C2C(CO)=CNC2=C1 IVYPNXXAYMYVSP-UHFFFAOYSA-N 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 229910052920 inorganic sulfate Inorganic materials 0.000 description 1
- 125000002346 iodo group Chemical group I* 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- HQABEHZXAJHCLV-UHFFFAOYSA-N isoquinolin-1-ylmethanol Chemical compound C1=CC=C2C(CO)=NC=CC2=C1 HQABEHZXAJHCLV-UHFFFAOYSA-N 0.000 description 1
- CMGQQHGOFWZGJH-UHFFFAOYSA-N isoquinolin-3-ylmethanol Chemical compound C1=CC=C2C=NC(CO)=CC2=C1 CMGQQHGOFWZGJH-UHFFFAOYSA-N 0.000 description 1
- QWTIYWBQFLATTN-UHFFFAOYSA-N isoquinolin-4-ylmethanol Chemical compound C1=CC=C2C(CO)=CN=CC2=C1 QWTIYWBQFLATTN-UHFFFAOYSA-N 0.000 description 1
- HSPKIXPRSRGOQK-UHFFFAOYSA-N isoquinolin-5-ylmethanol Chemical compound N1=CC=C2C(CO)=CC=CC2=C1 HSPKIXPRSRGOQK-UHFFFAOYSA-N 0.000 description 1
- XIRLIZNMBKEUDD-UHFFFAOYSA-N isoquinolin-6-ylmethanol Chemical compound C1=NC=CC2=CC(CO)=CC=C21 XIRLIZNMBKEUDD-UHFFFAOYSA-N 0.000 description 1
- VLONTUPZTAEOIH-UHFFFAOYSA-N isoquinolin-7-ylmethanol Chemical compound C1=CN=CC2=CC(CO)=CC=C21 VLONTUPZTAEOIH-UHFFFAOYSA-N 0.000 description 1
- UDNDYRZGZAWJHB-UHFFFAOYSA-N isoquinolin-8-ylmethanol Chemical compound C1=NC=C2C(CO)=CC=CC2=C1 UDNDYRZGZAWJHB-UHFFFAOYSA-N 0.000 description 1
- HORFVOWTVOJVAN-UHFFFAOYSA-N isoquinoline-1-carbaldehyde Chemical compound C1=CC=C2C(C=O)=NC=CC2=C1 HORFVOWTVOJVAN-UHFFFAOYSA-N 0.000 description 1
- 150000003854 isothiazoles Chemical class 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000004811 liquid chromatography Methods 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- OVWYEQOVUDKZNU-UHFFFAOYSA-N m-tolualdehyde Chemical compound CC1=CC=CC(C=O)=C1 OVWYEQOVUDKZNU-UHFFFAOYSA-N 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 125000001434 methanylylidene group Chemical group [H]C#[*] 0.000 description 1
- DDAHODSRFCRULG-UHFFFAOYSA-N methoxymethoxybenzene Chemical compound COCOC1=CC=CC=C1 DDAHODSRFCRULG-UHFFFAOYSA-N 0.000 description 1
- CPWIWKDXZSJHHG-UHFFFAOYSA-N methyl 2-(hydroxymethyl)benzoate Chemical compound COC(=O)C1=CC=CC=C1CO CPWIWKDXZSJHHG-UHFFFAOYSA-N 0.000 description 1
- XLSZMDLNRCVEIJ-UHFFFAOYSA-N methylimidazole Natural products CC1=CNC=N1 XLSZMDLNRCVEIJ-UHFFFAOYSA-N 0.000 description 1
- PQIOSYKVBBWRRI-UHFFFAOYSA-N methylphosphonyl difluoride Chemical group CP(F)(F)=O PQIOSYKVBBWRRI-UHFFFAOYSA-N 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 239000012046 mixed solvent Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- KBKWZUVMKBNTFP-UHFFFAOYSA-N n-(3-formylphenyl)acetamide Chemical compound CC(=O)NC1=CC=CC(C=O)=C1 KBKWZUVMKBNTFP-UHFFFAOYSA-N 0.000 description 1
- XRPGKJBCQNWNTR-UHFFFAOYSA-N n-(methoxymethyl)-1-phenylmethanamine Chemical compound COCNCC1=CC=CC=C1 XRPGKJBCQNWNTR-UHFFFAOYSA-N 0.000 description 1
- RQJHQXMAFMCVHL-UHFFFAOYSA-N n-[2-(hydroxymethyl)phenyl]acetamide Chemical compound CC(=O)NC1=CC=CC=C1CO RQJHQXMAFMCVHL-UHFFFAOYSA-N 0.000 description 1
- VRQSVLQWEPWRSR-UHFFFAOYSA-N n-[2-(methoxymethyl)phenyl]acetamide Chemical compound COCC1=CC=CC=C1NC(C)=O VRQSVLQWEPWRSR-UHFFFAOYSA-N 0.000 description 1
- WIXYDGUCWPQDPW-UHFFFAOYSA-N n-[3-(hydroxymethyl)phenyl]acetamide Chemical compound CC(=O)NC1=CC=CC(CO)=C1 WIXYDGUCWPQDPW-UHFFFAOYSA-N 0.000 description 1
- XEYORFKUJZEQCH-UHFFFAOYSA-N n-[4-(hydroxymethyl)phenyl]acetamide Chemical compound CC(=O)NC1=CC=C(CO)C=C1 XEYORFKUJZEQCH-UHFFFAOYSA-N 0.000 description 1
- NCCHARWOCKOHIH-UHFFFAOYSA-N n-methylbenzamide Chemical compound CNC(=O)C1=CC=CC=C1 NCCHARWOCKOHIH-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 1
- 229940054441 o-phthalaldehyde Drugs 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 238000006146 oximation reaction Methods 0.000 description 1
- VATYWCRQDJIRAI-UHFFFAOYSA-N p-aminobenzaldehyde Chemical compound NC1=CC=C(C=O)C=C1 VATYWCRQDJIRAI-UHFFFAOYSA-N 0.000 description 1
- ZRSNZINYAWTAHE-UHFFFAOYSA-N p-methoxybenzaldehyde Chemical compound COC1=CC=C(C=O)C=C1 ZRSNZINYAWTAHE-UHFFFAOYSA-N 0.000 description 1
- JRKICGRDRMAZLK-UHFFFAOYSA-N peroxydisulfuric acid Chemical compound OS(=O)(=O)OOS(O)(=O)=O JRKICGRDRMAZLK-UHFFFAOYSA-N 0.000 description 1
- ZWLUXSQADUDCSB-UHFFFAOYSA-N phthalaldehyde Chemical compound O=CC1=CC=CC=C1C=O ZWLUXSQADUDCSB-UHFFFAOYSA-N 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 235000019396 potassium bromate Nutrition 0.000 description 1
- 229940094037 potassium bromate Drugs 0.000 description 1
- LDPWMLSYNVOMKZ-UHFFFAOYSA-M potassium bromite Chemical compound [K+].[O-]Br=O LDPWMLSYNVOMKZ-UHFFFAOYSA-M 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- LFCWHDGQCWJKCG-UHFFFAOYSA-N pyrazin-2-ylmethanol Chemical compound OCC1=CN=CC=N1 LFCWHDGQCWJKCG-UHFFFAOYSA-N 0.000 description 1
- DXBWJLDFSICTIH-UHFFFAOYSA-N pyrazine-2-carbaldehyde Chemical compound O=CC1=CN=CC=N1 DXBWJLDFSICTIH-UHFFFAOYSA-N 0.000 description 1
- 150000003216 pyrazines Chemical class 0.000 description 1
- STIKETVNLGXQCS-UHFFFAOYSA-N pyridazin-3-ylmethanol Chemical compound OCC1=CC=CN=N1 STIKETVNLGXQCS-UHFFFAOYSA-N 0.000 description 1
- GXWAGVFGTPTYAO-UHFFFAOYSA-N pyridazin-4-ylmethanol Chemical compound OCC1=CC=NN=C1 GXWAGVFGTPTYAO-UHFFFAOYSA-N 0.000 description 1
- YRUFRSUZZACWCW-UHFFFAOYSA-N pyridazine-3-carbaldehyde Chemical compound O=CC1=CC=CN=N1 YRUFRSUZZACWCW-UHFFFAOYSA-N 0.000 description 1
- BZORCBQGFKOHMY-UHFFFAOYSA-N pyridazine-4-carbaldehyde Chemical compound O=CC1=CC=NN=C1 BZORCBQGFKOHMY-UHFFFAOYSA-N 0.000 description 1
- 150000004892 pyridazines Chemical class 0.000 description 1
- SHNUBALDGXWUJI-UHFFFAOYSA-N pyridin-2-ylmethanol Chemical compound OCC1=CC=CC=N1 SHNUBALDGXWUJI-UHFFFAOYSA-N 0.000 description 1
- PTMBWNZJOQBTBK-UHFFFAOYSA-N pyridin-4-ylmethanol Chemical compound OCC1=CC=NC=C1 PTMBWNZJOQBTBK-UHFFFAOYSA-N 0.000 description 1
- BGUWFUQJCDRPTL-UHFFFAOYSA-N pyridine-4-carbaldehyde Chemical compound O=CC1=CC=NC=C1 BGUWFUQJCDRPTL-UHFFFAOYSA-N 0.000 description 1
- 150000003230 pyrimidines Chemical class 0.000 description 1
- ZSKGQVFRTSEPJT-UHFFFAOYSA-N pyrrole-2-carboxaldehyde Chemical compound O=CC1=CC=CN1 ZSKGQVFRTSEPJT-UHFFFAOYSA-N 0.000 description 1
- 150000003233 pyrroles Chemical class 0.000 description 1
- HREHOXSRYOZKNT-UHFFFAOYSA-N quinolin-2-ylmethanol Chemical compound C1=CC=CC2=NC(CO)=CC=C21 HREHOXSRYOZKNT-UHFFFAOYSA-N 0.000 description 1
- FLGKQMOTLCGOQH-UHFFFAOYSA-N quinolin-3-ylmethanol Chemical compound C1=CC=CC2=CC(CO)=CN=C21 FLGKQMOTLCGOQH-UHFFFAOYSA-N 0.000 description 1
- ZKPMQVSVRVORAH-UHFFFAOYSA-N quinolin-5-ylmethanol Chemical compound C1=CC=C2C(CO)=CC=CC2=N1 ZKPMQVSVRVORAH-UHFFFAOYSA-N 0.000 description 1
- RDBBFCMDRBOXIG-UHFFFAOYSA-N quinolin-7-ylmethanol Chemical compound C1=CC=NC2=CC(CO)=CC=C21 RDBBFCMDRBOXIG-UHFFFAOYSA-N 0.000 description 1
- BGLZVNYGUGILJU-UHFFFAOYSA-N quinolin-8-ylmethanol Chemical compound C1=CN=C2C(CO)=CC=CC2=C1 BGLZVNYGUGILJU-UHFFFAOYSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- SMQUZDBALVYZAC-UHFFFAOYSA-N salicylaldehyde Chemical compound OC1=CC=CC=C1C=O SMQUZDBALVYZAC-UHFFFAOYSA-N 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 125000003808 silyl group Chemical class [H][Si]([H])([H])[*] 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- KUCOHFSKRZZVRO-UHFFFAOYSA-N terephthalaldehyde Chemical compound O=CC1=CC=C(C=O)C=C1 KUCOHFSKRZZVRO-UHFFFAOYSA-N 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 150000003536 tetrazoles Chemical class 0.000 description 1
- CHHDHVBATKGUSP-UHFFFAOYSA-N thiadiazol-4-ylmethanol Chemical compound OCC1=CSN=N1 CHHDHVBATKGUSP-UHFFFAOYSA-N 0.000 description 1
- PNHGMSJMBREBKO-UHFFFAOYSA-N thiadiazol-5-ylmethanol Chemical compound OCC1=CN=NS1 PNHGMSJMBREBKO-UHFFFAOYSA-N 0.000 description 1
- JNEBZFFTOLBIKJ-UHFFFAOYSA-N thiadiazole-4-carbaldehyde Chemical compound O=CC1=CSN=N1 JNEBZFFTOLBIKJ-UHFFFAOYSA-N 0.000 description 1
- 150000003557 thiazoles Chemical class 0.000 description 1
- ZPHGMBGIFODUMF-UHFFFAOYSA-N thiophen-2-ylmethanol Chemical compound OCC1=CC=CS1 ZPHGMBGIFODUMF-UHFFFAOYSA-N 0.000 description 1
- 229930192474 thiophene Natural products 0.000 description 1
- 150000003613 toluenes Chemical class 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 150000003918 triazines Chemical class 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/84—Nitriles
- C07D213/85—Nitriles in position 3
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C253/00—Preparation of carboxylic acid nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
- C07C255/49—Carboxylic acid nitriles having cyano groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C255/50—Carboxylic acid nitriles having cyano groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton to carbon atoms of non-condensed six-membered aromatic rings
- C07C255/51—Carboxylic acid nitriles having cyano groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton to carbon atoms of non-condensed six-membered aromatic rings containing at least two cyano groups bound to the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/48—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
- C07D215/50—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen attached in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/52—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings condensed with carbocyclic rings or ring systems
- C07D263/54—Benzoxazoles; Hydrogenated benzoxazoles
- C07D263/58—Benzoxazoles; Hydrogenated benzoxazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 2
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/32—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D277/56—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/56—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D307/68—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/26—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D333/38—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
Definitions
- the present invention provides an acidic hydroxymethyl compound, an aromatic alkoxymethyl compound or an aromatic aldehyde compound, or a mixture thereof in the presence of ammonia or the like as a nitrogen source.
- the present invention relates to a method for producing a corresponding aromatic nitrile conjugate.
- the aromatic nitrile compound can be easily produced under mild conditions without the need for a special reaction device or a reactant by solving the above-mentioned disadvantages of the conventional technology.
- the development of a method that can do this was desired.
- the present inventor produces a corresponding aromatic nitrile compound from one or a mixture of an aromatic hydroxymethyl compound, an aromatic alkoxymethyl compound and an aromatic aldehyde compound.
- the above problem could be solved by reacting with bromic acid in the presence of an acid catalyst using ammonia or the like as a nitrogen source. Based on this, the present invention has been completed. Disclosure of the invention
- the present invention has solved the above-mentioned problems by providing the following [1] to [17].
- X represents a hydroxymethyl group, an alkoxymethyl group or a formyl group, n represents an integer of 1 to 9, and when n is 2 or more, X may be the same or different.
- R represents a hydrogen atom, an alkyl group, a hydroxyl group, an alkoxy group, a hydroxyalkyl group, an alkoxyalkyl group, a haloalkyl group, a carboxyl group or a metal salt thereof, an alkoxycarbonyl group, a halogen atom, a nitro group, an amino group, an alkylamino group , A dialkylamino group, an alkylcarbonylamino group, a cyano group, a formyl group, an alkylcarbonyl group or an optionally substituted group, and q represents an integer of 1 to 9; Here, (q ⁇ n) is 0 or a positive integer.
- R may be the same or different, and R may form a ring by bonding two.
- M represents a hydrogen atom or a metal atom, and m represents an integer of 1 to 3.
- ring A is a para-aromatic hetero ring having at least one hetero atom
- the method of the present invention comprises the step of reacting any one of aromatic hydroxymethyl conjugates, aromatic alkoxymethyl compounds and aromatic aldehyde compounds represented by the general formula (1) or a mixture thereof (hereinafter simply referred to as “general formula”).
- the raw material compound represented by the formula (1) or the “raw material compound” may be referred to as) and the brominated anilide represented by the general formula (2) with an acid catalyst, ammonia, and ammonia.
- X is a hydroxymethyl group; a methoxymethyl group, an ethoxymethyl group, or the like, having 1 to 6 carbon atoms (hereinafter, when the carbon number is 1 to 6, for example, This is abbreviated as "C1-C6".) Represents a linear or branched C1-C6 alkoxymethyl group; a formyl group.
- R in the general formula (1) is a hydrogen atom; for example, methyl group, ethyl group, n-propyl group, isopropyl group, n-butyl group, sec-butyl group, t-butyl group, n-pentyl
- a straight-chain or branched C 1 -C 6 alkyl group such as an n-hexynole group; a hydroxyl group; a straight-chain or branched group such as a methoxy group, an ethoxy group, an n-propoxy group, an isopropoxy group, etc.
- a branched C 1 -C 6 alkoxy group (the C 1 -C 6 alkoxy group is, for example, a hydroxy group; for example, a linear or branched C 1 -C 1 group such as a methoxy group, an ethoxy group, an n-propoxy group, an isopropoxy group, etc.
- a straight-chain or branched C 1 -C 6 hydroxyalkyl group such as a hydroxymethyl group or a hydroxyethyl group; a straight-chain such as a methoxymethyl group, a methoxethyl group or an ethoxyxyl group; Or a branched (C 1 -C 6 alkoxy) — (C 1 -C 6 alkyl) group; for example, a linear or branched C 1 -C 6 haloalkyl group such as a fluoromethyl group, a difluoromethyl group, and a trifluoromethyl group; A group or a metal salt thereof; for example, a straight-chain or branched (C 1 -C 6 alkoxy) carbonyl group such as a methoxycarbonyl group and an ethoxycarbonyl group; a halogen atom such as bromo, chloro, fluoro, and phodo; Group; amino group; for example, straight chain
- a mono- or di- (C 1 -C 6 alkyl) amino group for example, a linear or branched C 1 -C 6 alkylcarbonylamino group such as an acetylamino group, a propio-amino group, a butyrylamino group; a cyano group; a formyl group; For example, it may have a substituent such as a straight-chain or branched (C1-C6 alkyl) carbonyl group such as a methylcarbonyl group or an ethylcarbonyl group.
- a straight-chain or branched C 1 -C 6 hydroxyalkyl group such as a hydroxymethyl group or a hydroxyethyl group; a straight-chain or branched (C 1) group such as a methoxymethyl group, a methoxyethyl group, an ethoxyshethyl group, etc.
- C 1 -C 6 alkoxy a (C 1 -C 6 alkyl) group; for example, a linear or branched C 1 -C 6 haloalkyl group such as a fluoromethyl group, a difluoromethyl group, and a trifluoromethyl group; a carboxyl group or a metal thereof Salt; for example, methoxycarbonyl group, ethoxycarbonyl group, etc., straight-chain or branched (C 1 -C 6 anorecoxy) canolepodinole group; for example, bromo, chloro, phenolic, etc.
- a straight-chain or branched mono- or di- (C 1 -C 6 alkyl) amino group such as an acetylamino group, a acetylamino group; a straight-chain or branched mono- or di- (C 1 -C 6 alkyl) amino group such as an acetylamino group, a propio-lamino group, a butyrylamino group;
- a heteroaryl group such as a pyridyl group, a phenyl group, a phenyl group, a furyl group, etc.
- the heteroaryl group is, for example, a methyl group, an ethyl group, an n-propyl group, an isopropyl group, an n-butyl group, a sec-butyl group, a t-butyl group
- Straight-chain or branched C 1 C 6 alkyl group such as butyl group, n-pentyl group, n-xyl group; hydroxyl group; for example, straight-chain such as methoxy group, ethoxy group, n-propoxy group, isopropoxy group;
- a chain or branched C 1 C 6 alkoxy group for example, a hydroxymethyl group, a hydroxyethyl group, etc .
- a linear or branched C 1 C 6 hydroxyalkyl group for example, a
- a straight-chain or branched (C1C6 alkoxy) mono (C1C6 alkyl) group for example, a straight-chain such as a fluoromethyl group, a difluoromethyl group, and a trifluoromethyl group;
- a halogen atom such as a promoter, a black mouth, a phenolic mouth, and an aldehyde; a nitro group; an amino group; for example, a straight-chain or branched mono- or di- (C 1) group such as a methylamino group, a dimethylamino group, an ethylamino group, and a acet
- n represents an integer of 1 to 9
- q represents an integer of 1 to 9
- (q-n) is 0 or a positive integer.
- n 2 or more
- the Xs may be the same or different.
- (q ⁇ n) 2 or more
- the Rs may be the same or different. Is also good.
- n is preferably 1 to 3 from the viewpoint of availability of raw materials and reactivity.
- all R are hydrogen atoms or that at least one of R is an electron-withdrawing group or an alkyl group, and all R are hydrogen atoms
- Particularly preferred is one in which at least one of the force and R is any of a chloro group, a nitro group, a fluoro group, and a methyl group.
- ring A represents an aromatic hetero ring or a phenyl ring having at least one hetero atom.
- the ring A is an aromatic heterocyclic ring having at least one heteroatom.
- a heterocyclic aromatic hydroxymethyl compound, a heterocyclic aromatic alkoxymethyl compound or a heterocyclic aromatic aldehyde compound may be an aromatic ring.
- a monocyclic compound or a condensed ring compound may be used as long as it is a heterocyclic compound having a property.
- the ring A is a heterocyclic compound selected from the group consisting of a nitrogen atom, an oxygen atom and a sulfur atom. Having an atom, more preferably a nitrogen atom, an oxygen atom, a sulfur atom
- a heterocyclic aromatic compound having 1 to 3 identical or different hetero atoms selected from the above heteroatom group and having 2 to 9 carbon atoms in particular, the above heteroatom
- a heterocyclic aromatic compound having 1 to 2 identical or different heteroatoms selected from the group of atoms and having 2 to 9 carbon atoms such as a furan ring, a thiophene ring, a pyridine ring, a quinoline ring, or a thiazole ring Is preferred.
- heterocyclic aromatic compounds include, for example, methyl group, ethyl group, n-propyl group, isopropyl group, n-butyl group, sec-butyl group, t-butyl group, n-pentyl group, n- Straight-chain or branched C1-C6 alkyl group such as xyl group; hydroxyl group; straight-chain or branched C1-C6 group such as methoxy group, ethoxy group, n-propoxy group, isopropoxy group and the like.
- a 6-alkoxy group (the C 1 -C 6 alkoxy group is, for example, a hydroxyl group; for example, a linear or branched C 1 -C 6 alkoxy group such as a methoxy group, an ethoxy group, an n-propoxy group, an isopropoxy group;
- a straight-chain or branched C1-C6 hydroxyanolealkyl group such as a hydroxymethyl group or a hydroxyethyl group
- a straight-chain or branched C1-C6 hydroxyanolealkyl group such as a methoxymethyl group, a methoxyxyl group, an ethoxyxyl group, etc.
- a branched (C 1 -C 6 alkoxy) mono (C 1 -C 6 alkyl) group for example, a linear or branched C 1 -C 6 haloalkyl group such as a fluoromethyl group, a difluoromethyl group, and a trifluoromethyl group; Group or a metal salt thereof; for example, a straight-chain or branched (C 1 -C 6 alkoxy) carbonyl group such as a methoxycarbonyl group and an ethoxycarbonyl group; and a halogen atom such as bromo, chloro, fluoro, and chloride.
- Alkyl It may have a substituent such as a carbonyl group.
- a straight-chain or branched C 1 -C 6 hydroxyalkyl group such as a hydroxymethyl group, a hydroxyethyl group, etc .
- a straight-chain or branched (C) group such as a methoxymethyl group, a methoxyxyl group, an ethoxyxyl group, etc.
- 1-C6 alkoxy) a (C1-C6 alkyl) group for example, a linear or branched C1-C6 haloalkyl group such as a fluoromethyl group, a difluoromethyl group, a trifluoromethyl group; a carboxyl group or Metal salts; linear or branched (C 1 -C 6 anorecoxy), such as methoxycarbonyl, ethoxycarbonyl, etc.
- a halogen atom for example, a straight-chain or branched mono group such as a methylamino group, a dimethylamino group, an ethylamino group, a acetylamino group, and the like.
- a di (C 1 -C 6 alkyl) amino group for example, a linear or branched (C 1 -C 6 alkyl) carbonylamino group such as an acetylamino group, a propionylamino group, a butyrylamino group; a cyano group; a formyl group A straight-chain or branched (C 1 -C 6 alkyl) carbonyl group such as a methylcarbinole group or an ethenylcarbonyl group; a phenyl group (the phenyl group is, for example, a methyl group, an ethyl group, an n-propyl group); A linear or branched C1-C6 alkyl group such as a group, isopropyl group, n-butyl group, sec-butyl group, t-butyl group, n-pentyl group, n-hexyl group; hydroxyl group; A straight
- An amino group for example, a linear or branched C 1 -C 6 alkyl-propionylamino group such as an acetylamino group, a propionylamino group, and a butyrylamino group; a cyano group; a formyl group; It may have a substituent such as a linear or branched (C 1 -C 6 alkyl) carbonyl group. ), A heteroaryl group such as a pyridyl group, a phenyl group, a phenyl group, a fenyl group, etc.
- the heteroaryl group is, for example, a methyl group, an ethyl group, an n-propyl group, an isopropyl group, an n-butyl group, a sec-butyl group, a Straight-chain or branched C 1 -C 6 alkyl group such as butyl group, n-pentyl group, n-hexyl group; hydroxyl group; for example, methoxy group, ethoxy group, n-propoxy group, isopropoxy group, etc.
- a straight-chain or branched C 1 -C 6 alkoxy group for example, a straight-chain or branched C 1 -C 6 hydroxyalkyl group such as a hydroxymethyl group or a hydroxyethyl group; for example, a methoxymethyl group, a methoxethyl group;
- Straight-chain or branched (C 1-C6 alkoxy) a (C1-C6 alkyl) group for example, a linear or branched C1-C6 haloalkyl group such as a fluoromethyl group, a difluoromethyl group, a trifluoromethyl group; a carboxyl group or a carboxyl group thereof
- Metal salts for example, straight-chain or branched (C 1 -C 6 alkoxy) carbonyl groups such as methoxycarbonyl and ethoxycarbonyl groups; and halogen atoms such as promo, chloro, fluoro, and odo.
- heterocyclic aromatic hydroxymethyl compound, heterocyclic aromatic alkoxymethyl compound or heterocyclic aromatic aldehyde compound is a known compound, or, for example, a raw material obtained from the corresponding heterocyclic aromatic chloromethyl compound.
- Method of hydrolyzing in water as water ⁇
- the corresponding heterocyclic aromatic hydroxymethyl The compound, heterocyclic aromatic alkoxymethyl compound or heterocyclic aromatic aldehyde compound can be used as a raw material in the method of the present invention as a mixture, not as a single product.
- benzyl alcohol compound, benzyl ether compound or benzaldehyde compound in which ring A is a phenyl ring examples include, for example, benzyl alcohol, o-hydroxymethyltoluene, m-hydroxyl Methyltoluene, p-Hydroxymethynorolenolen, o-Hydroxymethinolephenore, m-Hydroxymethylphenolate, p-Hydroxymethylenophenol, o-Methoxypen Dinoleanorecole, m-methoxypentinolenolecole, p-methyoxybenzylalcohol, o-xylylene glycol, m-xylyleneglycol, —xylyleneglyconele, o-fluoromethinolebenzyla Noreco Nore, m-Funoleolomethinole, Penzinoleanorecol
- An alkoxy group for example, a linear or branched C1-C6 hydroxyalkyl group such as a hydroxymethinole group or a hydroxyethynole group; a linear or branched C1-C6 hydroxyalkyl group; A branched (C 1 -C 6 alkoxy) mono (C 1 -C 6 alkyl) group; for example, a linear or branched C such as a fluoromethyl group, a difluoromethyl group, a trifluoromethyl group, etc.
- a halogen atom such as promoter, black mouth, fluoro, and odo
- a nitro group an amino group; for example, a linear or branched mono- or di- (C 1 -C 1) group such as a methylamino group, a dimethylamino group, an ethylamino group, and a acetylamino group; 6 alkyl) amino group; for example, acetylamino group, propionylamino group, butyrylamino group, etc., linear or branched C1-C6 alkylcarbonylamino group; cyano group; formyl group; for example, methylcarbonyl group
- a heteroaryl group such as a pyridyl group, a phenyl group, a phenyl group, a furyl group, etc. (for example, a methyl group, an ethyl group, an n-propyl group, an isopropyl group, an n-butyl group, a sec-butyl group, a straight-chain or branched C 1 -C 6 alkyl group, such as t-pentynole group, n-pentyl group, n-hexyl group; hydroxyl group; for example, methoxy group, ethoxy group, n-propoxy group, and isopropoxy group
- a straight-chain or branched C1-C6 alkoxy group for example, a straight-chain or branched C1-C6 hydroxyalkyl group such as a hydroxymethyl group, a hydroxyethyl group; and the like, for example, a methoxymethinole
- group downy emissions benzyl alcohol compound may have the like; main butoxy methyl benzene, o- main Toki caulking Chino les toluene, m - main Toki caulking Chino les toluene, p- main Tokishimechinore Tonolen, o-Methoxymethoxyphenol, m-Methoxymethoxyphenol, ⁇ -Methoxymethylphenol, o-Methoxymethoxymethylbenzene, M-methoxymethoxymethylbenzene, p-Methoxymethoxybenzene O-xylylene glycol mono-resin methine resin, m-xylylene glycol resin methyl ether, p-xylylene glycol dimethyl ether, o-methoxymethyl-fluoromethylbenzene, m-methyl Toxmethyl-fluoromethylbenzene, p-Methoxymethyl-fluoromethylbenzene, o-Methoxymethylbenzen
- Canoleponinole group for example, halogen atom such as bromo, chloro, fluoro, and nitro; nitro group; amino group; for example, linear or branched such as methylamino group, dimethylamino group, ethylamino group, ethylamino group, and the like.
- a mono- or di- (C 1 -C 6 alkyl) amino group for example, a linear or branched C 1 -C 6 alkylcarbonylamino group such as an acetylamino group, a propionylamino group, a butyrylamino group; a cyano group; a formyl group Having a substituent such as a linear or branched (C 1 -C 6 alkyl) group such as a methylcarbonyl group or an ethylcarbonyl group; Linear or branched hydroxy-C 1 -C 6 alkyl group; linear or branched (C 1 -C 6 alkoxy) 1 (C 1 -C 6 alkyl) group; linear or branched C 1 -C 6 haloalkyl group; carboxyl Straight-chain or branched (C1-C6 alkoxy) carbonyl group; halogen atom; nitro group; amino group; straight-chain or branched mono-
- a pyridyl group, a phenyl group, a heteroaryl group such as a furyl group (the heteroaryl group is, for example, a methyl group, an ethyl group, an n-propyl group, an isopropyl group, an n-butyl group, a sec-butyl group, a t-butyl group).
- Straight-chain or branched C 1 -C 6 alkyl group such as n-pentyl group, n-hexyl group; hydroxyl group; for example, methoxy group, ethoxy group, n-propoxy group, isopropoxy group, etc.
- a straight-chain or branched C 1 to C 6 alkoxy group for example, a straight-chain or branched C 1 to C 6 hydroxyalkyl group such as a hydroxymethyl group or a hydroxyethyl group; for example, a methoxymethyl group; a methoxethyl group; Linear or branched (C 1 -C 6 alkoxy) mono (C 1 -C 6 alkyl) group; for example, fluoromethyl group, difluo Linear or branched C 1 -C 6 haloalkyl group, such as methoxymethyl group, trifluoromethyl group, or the like; linear or branched, such as methoxycarbonyl group or ethoxycarbonyl group; C 1 -C 6 alkoxy) difluoro group; for example, a halogen atom such as promo, chloro, fluoro, chloride, etc .; dinitro group; amino group; for example, methylamino group, dimethylamin
- Benzyl ether compounds which may have a group such as: benzaldehyde, o-methylbenzaldehyde, m_methylbenzaldehyde, p-methylbenzaldehyde, o-formylphenol, m-formylphenol, p-formylphenol, o— Methoxybenzaldehyde, m-methoxybenzaldehyde, p-methoxybenzaldehyde, o-aminomethylbenzaldehyde, m-aminomethylbenzaldehyde, p-aminomethylbenzaldehyde, o-fluoromethyl-benzaldehyde, m-fluoromethyl-benzaldehyde, p —Fluoromethyl-benzaldehyde, o —Formylbenzoic acid, m-Formylbenzoic acid, ⁇ -For
- a heteroaryl group such as a pyridyl group, a phenyl group, a furyl group, etc.
- the heteroaryl group is, for example, Linear or branched C 1 ⁇ such as tinole, ethyl, n-propyl, isopropyl, n-butyl, sec-butyl, t-butyl, n-pentyl, n-hexyl, etc.
- C 6 alkyl group hydroxyl group; straight-chain or branched C 1 -C 6 alkoxy group such as methoxy group, ethoxy group, n-propoxy group, isopropoxy group;
- a straight-chain or branched C1-C6 hydroxyalkyl group such as a tyl group; for example, a straight-chain or branched (C1-C6 alkoxy) group such as a methoxymethyl group, a methoxyshetyl group, an ethoxyshetyl group; -C 6 alkyl) group; for example, a linear or branched C 1 -C 6 haloalkyl group such as a fluoromethyl group, a difluoromethyl group, and a trifluoromethyl group; a carboxyl group or a metal salt thereof; Straight-chain or branched (C 1 -C 6 alkoxy) carbonyl group such as carbonyl group and ethoxycarbonyl group
- Benzaldehyde compounds which may have a group such as: o-xylylene glycolone monomethinoleate, m-xylylene glycolonelemo methinoleone te ⁇ ⁇ p-xylylene glycolone monomethyone , O-methoxymethylbenzaldehyde, m-methoxymethylbenzaldehyde, p —Methoxymethylbenzaldehyde, o-hydroxymethylbenzaldehyde, m-hydroxymethylbenzaldehyde, p-hydroxymethylbenzaldehyde, o-methoxymethylbenzaldehyde, m-methoxymethylbenzaldehyde, p-methoxymethylbenzaldehyde, etc.
- Examples thereof include a benzyl alcohol compound, a benzyl ether compound and a benzaldehyde compound.
- the benzyl alcohol compound, benzyl ether compound or benzyl aldehyde compound is a known compound, or is, for example, a method of hydrolyzing the corresponding benzyl chloride compound as a raw material in water, or a corresponding benzyl chloride compound.
- a suitable organic solvent with a metal alkoxide such as sodium alkoxide or by hydrolyzing in water using the corresponding benzyl chloride compound as a raw material, or by alcoholysis. It is a compound that can
- a mixture of a corresponding toluene derivative which is generally obtained as a mixture of a benzyl chloride compound and a benzyl chloride compound by chlorination of the corresponding toluene
- It is then prepared as a mixture of the corresponding benzyl alcohol compound, benzyl ether compound or benzaldehyde compound (that is, a raw material compound composed of a plurality of compounds) by hydrolysis or alcoholysis.
- It can be used as a raw material in the method of the present invention as a mixture without purifying it into individual benzyl alcohol compound, benzyl ether compound or benzaldehyde compound alone.
- the bromine oxide represented by the general formula (2) will be described.
- M in the general formula (2) represents a hydrogen atom; an alkali metal such as sodium, potassium, and lithium; and a metal atom such as an alkaline earth metal such as magnesium and calcium, and m represents an integer of 1 to 3. Is shown.
- the compound represented by the general formula (1) which can be used for the reaction with any one of the aromatic hydroxymethyl aldehyde compound, the aromatic alkoxymethyl compound and the aromatic aldehyde compound represented by the general formula (1) or a mixture thereof:
- the bromide oxide represented by 2) include, for example, bromic acid, wherein m in the general formula (2) is 3, sodium bromate, sodium bromate, calcium bromate, and the like.
- hypobromite; m in the general formula (2) is 1; hypobromite; hypobromite, etc., and hydrates thereof can also be used. is there. From the viewpoints of availability, simplicity of handling, reactivity, and the like, use of bromate, bromate, or bromate is preferred, and use of bromate is particularly preferred.
- bromine oxides represented by the general formula (2) are known compounds. Regarding the molar ratio of the bromic acid represented by the general formula (2) in the reaction, the reaction proceeds at any molar ratio with respect to the starting compound represented by the general formula (1).
- the starting material represented by the general formula (1) is either an aromatic hydroxymethyl compound or an aromatic alkoxymethyl compound
- 1 mole of the starting compound is expressed by the general formula (2)
- m in the general formula (2) is 3
- the bromine oxide represented is usually 0.66 to 1.0 mol, preferably 0.7 to 0.8 mol.
- m in the general formula (2) is 2
- the range of usually 1.0 to 1.5 mol, preferably 1.1 to 1.2 mol is defined as m in the general formula (2).
- the range is usually 2.0 to 3.0 mol, preferably 2.2 to 2.4 mol.
- the bromine oxide represented by the general formula (2) with respect to 1 mol of the raw material compound when m in the general formula (2) is 3, The range is usually 0.33 to 0.5 mol, preferably 0.35 to 0.4 mol.
- m in the general formula (2) when m in the general formula (2) is 2, usually 0.5 to 0.75 mol
- the range of 0.55 to 0.6 mol is usually 1.0 to 1.5 mol, preferably 1.1 to 1.2 mol. Can be exemplified.
- the starting compound represented by the general formula (1) has a plurality of groups X (hydroxymethyl group, alkoxymethyl group or formyl group) (that is, starting compound 1K, n in the general formula (1) Is 2 to 9, or a compound having a phenyl group or a heteroaryl group substituted by a group X as R, or a compound in which both of these are simultaneously satisfied. If it is desired to convert all the groups X to nitrile groups, it is necessary to use a bromine oxide having a molar ratio obtained by multiplying the molar ratio of the bromine oxide by the total number of the substituents.
- the raw material compound has a plurality of groups —X as described above, by controlling the molar ratio of the bromine oxide represented by the general formula (2), a plurality of groups X can be obtained. Can be converted to a nitrile group.
- This reaction is carried out by adding ammonia or an ammonium salt as a nitrogen source.
- the shape of the ammonia to be added may be any, but from the viewpoint of availability, ammonia water and ammonia gas are preferred. Particularly preferred is ammonia water.
- ammonium salt examples include, for example, ammonium acetate, ammonium propionate, ammonium butanoate, ammonium pentanoate, ammonium hexanoate, ammonium lactate, and the like.
- a branched or branched C 1 -C 6 alkoxy group a linear or branched hydroxy C 1 -C 6 alkyl group; a linear or branched (C 1 -C 6 alkoxy) 1 (C 1 -C 6 alkyl) group; Straight-chain or branched (C1-C6 alkoxy) carbonyl group; halogen atom; nitro group; amino group; straight-chain or branched mono- or di- (C1-C6 alkyl) amino group; (C 1 -C 6 alkyl) carbonylamino group; cyano group; formyl group; linear or branched (C 1 -C 6 alkyl) carbonyl group; phenyl group [the phenyl
- Carboxylic acid ammonium salts which may have an aromatic carboxylic acid ammonium salt, etc., which may have a group such as ammonium chloride, ammonium bromide, etc .; ammonium halide acid salts represented by ammonium chloride, ammonium bromide, etc .; ammonium sulfate, phosphoric acid Mineral acid ammonium salts such as ammonium and ammonium nitrate: methanesulfonic acid ammonium C1 to C6 alkylsulfonic acid ammonium salts such as ammonium salt, ethanesulfonic acid ammonium salt, etc .; C such as paratonolenesulfonic acid ammonium salt, benzenesnolephonic acid ammonium salt, 2,4-dichloroammonium benzenesulfonic acid salt, etc.
- ammonium benzenesulfonate which may be substituted with a 1-C6 alkyl group or a halogen atom.
- it is a carboxylic acid ammonium salt, and more preferably, a linear or branched C1-C6 aliphatic carboxylic acid ammonium salt which may have a substituent, among which ammonium acetate and ammonium propionate. Particularly preferred.
- the amount of the ammonia or ammonium salt used may be at least the equivalent of the raw material compound, but is usually 1 to 1 mol per mole of the raw material compound represented by the general formula (1).
- It may be in the range of 0 to 5.0 equivalents, preferably 1.0 to 3.0 equivalents.
- the starting compound represented by the general formula (1) has a plurality of groups X (hydroxymethyl group, alkoxymethyl group or formyl group) (that is, the starting compound is represented by the general formula (1) Is a compound in which n is 2 to 9, or a compound in which the group -X has a substituted phenyl group or heteroaryl group as R, or a compound in which both are simultaneously satisfied.
- groups X hydroxymethyl group, alkoxymethyl group or formyl group
- the starting compound represented by the general formula (1) Is a compound in which n is 2 to 9, or a compound in which the group -X has a substituted phenyl group or heteroaryl group as R, or a compound in which both are simultaneously satisfied.
- the equivalent of ammonia or ammonium salt obtained by multiplying the above-mentioned equivalent of ammonia or ammonium salt by the total number of the substituents. preferable.
- amines primary amines, secondary amines, or tertiary amines
- ammonia or ammonium salts can result in the formation of amide compounds as by-products in addition to the target product, and facilitate the target reaction.
- the target is obtained without progress Undesirable results may not be obtained.
- This reaction is performed using an acid catalyst.
- the acid catalyst that can be used in this reaction include organic sulfonic acids such as acetic acid, propionic acid, trifluoroacetic acid, fluoroacetic acid, lactic acid, and amino acids such as canoleponic acid; organic acids typified by; hydrochloric, sulfuric, inorganic acids such as phosphoric acid; Shioi ⁇ aluminum, boron trifluoride chromatography tetrahydrofuran complex (BF 3 one TH F complexes), Lewis acids such as polyphosphoric acid and the like; a solid acid And the like, but preferably using a carboxylic acid such as acetic acid or propionic acid.
- organic sulfonic acids such as acetic acid, propionic acid, trifluoroacetic acid, fluoroacetic acid, lactic acid, and amino acids such as canoleponic acid
- organic acids typified by; hydrochloric, sulfuric, inorganic acids such as
- the amount of the acid catalyst used in this reaction may be any as long as the reaction sufficiently proceeds, but is preferably 0.01 to 100 mol per 1 mol of the starting compound represented by the general formula (1).
- the range is preferably from 0.05 to 30 mol, more preferably from 0.1 to 30 mol, and particularly preferably from 0.2 to 10 mol. If is neutral, the above molar ratios are sufficient.
- the acid catalyst is paired with the raw material compound in the reaction system. It is considered that the amount of the acid catalyst capable of exerting the intended function is reduced in the reaction system by forming ions or the like. Therefore, the amount of the acid catalyst used is limited to the amount of the heterocatalyst represented by the general formula (1).
- the amount of the acid catalyst capable of exerting the intended function can be reduced by a technique such as using an extra amount of an acid catalyst corresponding to the number of basic sites in the ring aromatic compound molecule. Adjust to be in the example range of Is preferred.
- the amount of the acid catalyst to be used is not limited to the above range, and a large excess can be used in combination with the solvent described below.
- Solvents that can be used in this reaction are not particularly limited as long as they do not inhibit the reaction. Examples thereof include carboxylic acids such as acetic acid and propionic acid; water; aromatic hydrocarbons such as toluene, xylene, and chlorobenzene; dichloromethane; Halogenated aliphatic hydrocarbons such as methyl form; acetic esters such as methyl acetate, ethyl acetate, and butyl acetate; dimethylformamide, dimethylacetamide, N-methylpyrrolidone, tetramethylurea, and hexamethyl Aprotic polar solvents such as phosphoric triamide (HMPA) and propylene carbonate; ether solvents such as getyl ether, tetrahydrofuran and dioxane; aliphatic hydrocarbons such as pentane and n-hexane Is mentioned.
- carboxylic acids such as acetic acid and propionic acid
- water aromatic hydrocarbon
- carboxylic acid such as acetic acid or propionic acid or water is used from the viewpoint of solubility and reactivity of the oxidizing agent (bromine oxide).
- carboxylic acid is used as a solvent, this also serves as an acid catalyst.
- the solvent can be used alone or as a mixed solvent at an arbitrary mixing ratio.
- the amount of the solvent is not particularly limited as long as the reaction system can be sufficiently stirred.
- the amount of the solvent is preferably from 0.05 to 101, relative to 1 mol of the starting compound represented by the general formula (1). More preferably, it should be in the range of 0.5 to 21. It is not desirable that the polarity of the solvent be too low, because the solubility of the oxidizing agent (bromine oxide) decreases and the reaction may not proceed easily.
- the starting compound represented by the general formula (1), the catalyst, and the general formula (2) The required reaction materials such as bromine oxide, ammonia or ammonium salt, and a solvent represented by the formula may be charged all at once and reacted.
- the required reaction materials such as bromine oxide, ammonia or ammonium salt, and a solvent represented by the formula may be charged all at once and reacted.
- a method in which the bromine oxide represented by the formula (2) is dividedly charged in a solid state a method in which a bromine oxide represented by the general formula (2) is slurried using a solvent such as water, and then gradually added.
- a method of dropping an aqueous solution is preferable.
- the reaction temperature of this reaction is from 50 ° C to the reflux temperature of the solvent used, preferably from 70 ° C to the reflux temperature of the solvent used, particularly preferably from 70 ° C to 100 ° C. No.
- reaction time of this reaction is not particularly limited, it is preferably 1 hour to 30 hours from the viewpoint of suppressing by-products.
- the aromatic nitrile represented by the general formula (3) can be selectively obtained under mild conditions without using a special reactor or an excessive oxidizing agent (bromine oxide) or a nitrogen source. A compound is formed.
- the obtained aromatic nitrile compound represented by the general formula (3) is a compound useful as an intermediate material for pharmaceuticals and agricultural chemicals.
- the aqueous phase was further extracted with 50 ml of ethyl acetate.
- the ethyl acetate phases were combined, washed with saturated saline and dried over anhydrous sodium sulfate, and then ethyl acetate was distilled off under reduced pressure.
- the molecular ion peak [M +] 104 was confirmed by gas mass chromatography.
- GC-MS Gas ion chromatography
- Example 9 was carried out in the same manner as in Example 9 except that 0.27 g (2 mmo 1) of sodium bromite was used instead of sodium bromate.
- the components in the reaction solution at this time were 79.0% of benzoetrile and 17.3% of benzaldehyde in terms of area ratio by gas chromatography.
- Example 9 was carried out in the same manner as in Example 9, except that 2 ml of propionic acid (26.8 mmo 1) was used instead of acetic acid.
- the components in the reaction solution at this time were 92.1% benzonitrile and 6.4% benzaldehyde in terms of area ratio by gas chromatography.
- the molecular ion peak of benzonitrile [M + ] 103 was confirmed.
- Example 1 II Production of Benzonitrile
- Example 19 Production of benzonitrile using a mixture as a starting compound
- a mixture as a starting compound
- 0.22 g (2 mmo 1) of benzyl alcohol and 0.2 ml of benzaldehyde were added.
- 21 g (2 mmo 1), sodium bromate 0.30 g (2 mmo 1), acetic acid 2 m 1 (34.8 mmo l), 25% aqueous ammonia 0.4 g (5.9 mm o 1) and add 90 .
- the mixture was stirred at C for 3 hours.
- Example 8 was repeated except that propylene carbonate 2m1, sodium bromate 0.2g (1.35mmol), and 25% aqueous ammonia 0.31g (4.6mmo1) were used instead of acetic acid 2ml. Performed similarly. At this time, 98.7% of the starting material benzaldehyde remained in the components of the reaction solution by gas chromatography area ratio, and the production of the target benzonitrile hardly proceeded.
- Example 8 was carried out in the same manner as in Example 8, except that 0.14 g (1.35 mmo 1) of sodium chlorate and 0.31 g (4.6 mmo 1) of 25% aqueous ammonia were used instead of sodium bromate. At this time, the components in the reaction solution were found to have 100% of the starting benzaldehyde remaining in the area ratio of gas chromatography, Zonitrile was not formed.
- any one of an aromatic hydroxymethyl compound, an aromatic alkoxymethyl aldehyde compound or an aromatic aldehyde compound represented by the general formula (1) or a mixture thereof is used as a raw material. It can be used arbitrarily and can be used for highly selective and convenient operation of the target aromatic nitrile compound under mild conditions without using a special reactor or expensive catalyst or transition metal. It is easy to process waste, is environmentally friendly, and has a high industrial value because no hazardous waste derived from catalysts or transition metals is produced.
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyridine Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Plural Heterocyclic Compounds (AREA)
Description
Claims
Priority Applications (5)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
AT03754195T ATE455753T1 (de) | 2002-10-21 | 2003-10-20 | Verfahren zur herstellung einer aromatischen nitrilverbindung |
US10/531,171 US7262316B2 (en) | 2002-10-21 | 2003-10-20 | Process for producing aromatic nitrile compound |
AU2003273055A AU2003273055A1 (en) | 2002-10-21 | 2003-10-20 | Process for producing aromatic nitrile compound |
EP03754195A EP1555257B1 (en) | 2002-10-21 | 2003-10-20 | Process for producing aromatic nitrile compound |
DE60331095T DE60331095D1 (de) | 2002-10-21 | 2003-10-20 | Verfahren zur herstellung einer aromatischen nitrilverbindung |
Applications Claiming Priority (4)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
JP2002-305742 | 2002-10-21 | ||
JP2002305742A JP4228133B2 (ja) | 2002-10-21 | 2002-10-21 | 芳香族ニトリルの製造方法 |
JP2003-276507 | 2003-07-18 | ||
JP2003276507A JP4706995B2 (ja) | 2003-07-18 | 2003-07-18 | ヘテロ環芳香族ニトリルの製造方法 |
Publications (1)
Publication Number | Publication Date |
---|---|
WO2004035526A1 true WO2004035526A1 (ja) | 2004-04-29 |
Family
ID=32109492
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
PCT/JP2003/013373 WO2004035526A1 (ja) | 2002-10-21 | 2003-10-20 | 芳香族ニトリル化合物の製造方法 |
Country Status (9)
Country | Link |
---|---|
US (1) | US7262316B2 (ja) |
EP (1) | EP1555257B1 (ja) |
KR (1) | KR101031141B1 (ja) |
CN (1) | CN100339360C (ja) |
AT (1) | ATE455753T1 (ja) |
AU (1) | AU2003273055A1 (ja) |
DE (1) | DE60331095D1 (ja) |
TW (1) | TW200413289A (ja) |
WO (1) | WO2004035526A1 (ja) |
Families Citing this family (5)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
WO2005062854A2 (en) | 2003-12-19 | 2005-07-14 | University Of Cincinnati | Polyamides for nucleic acid delivery |
US8501478B2 (en) * | 2006-06-15 | 2013-08-06 | University Of Cincinnati | Trehalose click polymers for delivery of biologically active molecules |
CN105294646A (zh) * | 2015-09-17 | 2016-02-03 | 浙江工业大学 | 一种由醇氧化制备腈的方法 |
CN108707113A (zh) * | 2018-06-28 | 2018-10-26 | 长沙麓兴生物科技有限公司 | 一种n-烷基-氰基吡唑的合成方法 |
CN110423207B (zh) * | 2019-09-02 | 2022-08-12 | 三门峡环宇生化科技有限公司 | 一种邻氯苯腈的合成方法 |
Citations (2)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
JPS55153759A (en) * | 1979-05-17 | 1980-11-29 | Ube Ind Ltd | Preparation of dicyanodihydroxybenzene derivative |
JPS562951A (en) * | 1979-06-20 | 1981-01-13 | Ube Ind Ltd | Preparation of 2-cyanophenol derivative |
Family Cites Families (5)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US4929634A (en) * | 1987-10-23 | 1990-05-29 | American Cyanamid Company | Method of and bait compositions for controlling mollusks |
EP0731086B1 (de) * | 1995-03-09 | 1999-04-28 | Ciba SC Holding AG | Verfahren zur Herstellung aromatischer Nitrile |
JP2000239247A (ja) | 1999-02-22 | 2000-09-05 | Mitsubishi Gas Chem Co Inc | 芳香族アルデヒドからの芳香族ニトリルの製造方法 |
US6310222B1 (en) * | 1999-11-01 | 2001-10-30 | Sumika Fine Chemicals Co., Ltd. | Production method of 5-phthalancarbonitrile compound, intermediate therefor and production method of the intermediate |
DE602004019737D1 (de) * | 2003-09-29 | 2009-04-16 | Mitsubishi Gas Chemical Co | Methode zur Herstellung von alkyl- und/oder cycloalkyl-substituierten zyklischen Nitrilen |
-
2003
- 2003-10-20 KR KR1020057006788A patent/KR101031141B1/ko not_active IP Right Cessation
- 2003-10-20 US US10/531,171 patent/US7262316B2/en not_active Expired - Fee Related
- 2003-10-20 DE DE60331095T patent/DE60331095D1/de not_active Expired - Lifetime
- 2003-10-20 CN CNB2003801039691A patent/CN100339360C/zh not_active Expired - Fee Related
- 2003-10-20 AU AU2003273055A patent/AU2003273055A1/en not_active Abandoned
- 2003-10-20 WO PCT/JP2003/013373 patent/WO2004035526A1/ja active Application Filing
- 2003-10-20 AT AT03754195T patent/ATE455753T1/de not_active IP Right Cessation
- 2003-10-20 EP EP03754195A patent/EP1555257B1/en not_active Expired - Lifetime
- 2003-10-21 TW TW092129105A patent/TW200413289A/zh not_active IP Right Cessation
Patent Citations (2)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
JPS55153759A (en) * | 1979-05-17 | 1980-11-29 | Ube Ind Ltd | Preparation of dicyanodihydroxybenzene derivative |
JPS562951A (en) * | 1979-06-20 | 1981-01-13 | Ube Ind Ltd | Preparation of 2-cyanophenol derivative |
Non-Patent Citations (5)
Title |
---|
LAI, G. ET AL., SYNLETT, 2001, pages 230 - 231 |
MCALLISTER, G.D. ET AL., SYNLETT, 2002, pages 1291 - 1292 |
MISONO, A. ET AL., BULLETIN OF THE CHEMICAL SOCIETY OF JAPAN, vol. 39, 1966, pages 854 |
See also references of EP1555257A4 |
TALUKDAR, S. ET AL., TETRAHEDRON LETTERS, vol. 42, 2001, pages 1103 - 1105 |
Also Published As
Publication number | Publication date |
---|---|
KR20050053784A (ko) | 2005-06-08 |
TWI324588B (ja) | 2010-05-11 |
AU2003273055A1 (en) | 2004-05-04 |
US7262316B2 (en) | 2007-08-28 |
DE60331095D1 (de) | 2010-03-11 |
EP1555257B1 (en) | 2010-01-20 |
EP1555257A1 (en) | 2005-07-20 |
ATE455753T1 (de) | 2010-02-15 |
CN1714074A (zh) | 2005-12-28 |
US20060069282A1 (en) | 2006-03-30 |
EP1555257A4 (en) | 2007-07-04 |
KR101031141B1 (ko) | 2011-04-27 |
CN100339360C (zh) | 2007-09-26 |
TW200413289A (en) | 2004-08-01 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
So et al. | Palladium-catalyzed cross-coupling reactions of aryl mesylates | |
Khazaei et al. | Trityl chloride as an efficient organic catalyst for the synthesis of 1-amidoalkyl-2-naphtols in neutral media at room temperature | |
KR102522231B1 (ko) | 2-피리딜에틸카복사미드 유도체의 제조 방법 | |
EP3222606B1 (en) | Carboxylic acid preparation method | |
Milen et al. | Study on the propylphosphonic anhydride (T3P®) mediated Ugi-type three-component reaction. Efficient synthesis of an α-amino amide library | |
WO2004035526A1 (ja) | 芳香族ニトリル化合物の製造方法 | |
Khazaei et al. | Efficient preparation of some new 1-carbamato-alkyl-2-naphthols using N-halo reagents in neutral media | |
KR20100014364A (ko) | 2-치환된-5-(1-알킬티오)알킬피리딘의 제조 방법 | |
JP2008542408A (ja) | 置換されたアゾールを調製するための方法 | |
JP5570524B2 (ja) | 5−ホルミル−ピリジン−2,3−ジカルボン酸エステルの製造方法 | |
CN110981790B (zh) | 一种1,4-二氢吡啶类衍生物及其合成方法 | |
Xie et al. | The synthesis of 5-substituted 1 H-tetrazoles in molten tetrabutylammonium bromide | |
CN111018807B (zh) | 一种合成1,2,4-噻二唑衍生物的方法 | |
JP4706995B2 (ja) | ヘテロ環芳香族ニトリルの製造方法 | |
KR20200082424A (ko) | 로잘탄 대사체 exp-3174의 제조방법 | |
JP4228145B2 (ja) | 芳香族ニトリル誘導体の製造方法 | |
HU192070B (en) | Process for transforming carboxy group into trichloro-methyl group | |
JP2660330B2 (ja) | チオフェン誘導体及びその製造方法 | |
CN111592486B (zh) | 一种芳基乙烯与n,n-二甲基甲酰胺通过环化反应构建3,5-二取代吡啶的方法 | |
JP2001081074A (ja) | アリールピリジン誘導体の製造法 | |
Zhu et al. | Protecting-group-free synthesis of carboxylic group substituted alkynes by Sonogashira coupling in water | |
EP1044956A1 (en) | A process for the preparation of 2-(4-methylphenyl) benzoic acid derivatives | |
JP4693261B2 (ja) | 5−置換オキサゾール化合物の製造方法 | |
JP2009126785A (ja) | 2−ヨード−3,4−ジメトキシベンゾニトリルの製造方法 | |
WO2002014284A1 (fr) | Procedes de preparation de composes de pyrazole |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
AK | Designated states |
Kind code of ref document: A1 Designated state(s): AE AG AL AM AT AU AZ BA BB BG BR BY BZ CA CH CN CO CR CU CZ DE DK DM DZ EC EE EG ES FI GB GD GE GH GM HR HU ID IL IN IS KE KG KP KR KZ LC LK LR LS LT LU LV MA MD MG MK MN MW MX MZ NI NO NZ OM PG PH PL PT RO RU SC SD SE SG SK SL SY TJ TM TN TR TT TZ UA UG US UZ VC VN YU ZA ZM ZW |
|
AL | Designated countries for regional patents |
Kind code of ref document: A1 Designated state(s): GH GM KE LS MW MZ SD SL SZ TZ UG ZM ZW AM AZ BY KG KZ MD RU TJ TM AT BE BG CH CY CZ DE DK EE ES FI FR GB GR HU IE IT LU MC NL PT RO SE SI SK TR BF BJ CF CG CI CM GA GN GQ GW ML MR NE SN TD TG |
|
121 | Ep: the epo has been informed by wipo that ep was designated in this application | ||
ENP | Entry into the national phase |
Ref document number: 2006069282 Country of ref document: US Kind code of ref document: A1 |
|
WWE | Wipo information: entry into national phase |
Ref document number: 10531171 Country of ref document: US |
|
WWE | Wipo information: entry into national phase |
Ref document number: 2003754195 Country of ref document: EP |
|
WWE | Wipo information: entry into national phase |
Ref document number: 662/CHENP/2005 Country of ref document: IN |
|
WWE | Wipo information: entry into national phase |
Ref document number: 1020057006788 Country of ref document: KR |
|
WWE | Wipo information: entry into national phase |
Ref document number: 20038A39691 Country of ref document: CN |
|
WWP | Wipo information: published in national office |
Ref document number: 1020057006788 Country of ref document: KR |
|
WWP | Wipo information: published in national office |
Ref document number: 2003754195 Country of ref document: EP |
|
WWP | Wipo information: published in national office |
Ref document number: 10531171 Country of ref document: US |