US7012147B2 - Indoline derivative and process for producing the same - Google Patents
Indoline derivative and process for producing the same Download PDFInfo
- Publication number
- US7012147B2 US7012147B2 US10/635,040 US63504003A US7012147B2 US 7012147 B2 US7012147 B2 US 7012147B2 US 63504003 A US63504003 A US 63504003A US 7012147 B2 US7012147 B2 US 7012147B2
- Authority
- US
- United States
- Prior art keywords
- reaction
- group
- acid
- compound
- salt
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related, expires
Links
- 238000000034 method Methods 0.000 title abstract description 97
- 125000003387 indolinyl group Chemical class N1(CCC2=CC=CC=C12)* 0.000 title abstract 2
- 125000000217 alkyl group Chemical group 0.000 claims description 36
- 125000006239 protecting group Chemical group 0.000 claims description 35
- 150000003839 salts Chemical class 0.000 claims description 31
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 23
- 125000003277 amino group Chemical group 0.000 claims description 17
- 150000001408 amides Chemical class 0.000 claims description 10
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 abstract description 47
- 239000000543 intermediate Substances 0.000 abstract description 16
- 230000002401 inhibitory effect Effects 0.000 abstract description 5
- 238000004519 manufacturing process Methods 0.000 abstract description 3
- 230000005764 inhibitory process Effects 0.000 abstract 1
- 150000001875 compounds Chemical class 0.000 description 157
- -1 carboxylic acid compound Chemical class 0.000 description 154
- 238000006243 chemical reaction Methods 0.000 description 146
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 145
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 96
- 239000000203 mixture Substances 0.000 description 90
- 239000002904 solvent Substances 0.000 description 89
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 76
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 66
- 239000000047 product Substances 0.000 description 60
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 54
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 54
- 239000011541 reaction mixture Substances 0.000 description 51
- 239000013078 crystal Substances 0.000 description 50
- 239000000243 solution Substances 0.000 description 49
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical class OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 44
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 43
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 42
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 36
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical class Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 34
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 32
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 30
- 238000001914 filtration Methods 0.000 description 30
- 239000002253 acid Substances 0.000 description 29
- 239000002585 base Substances 0.000 description 29
- 239000007858 starting material Substances 0.000 description 28
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 24
- 239000000741 silica gel Substances 0.000 description 24
- 229910002027 silica gel Inorganic materials 0.000 description 24
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 22
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical class CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 22
- 230000035484 reaction time Effects 0.000 description 22
- 230000002829 reductive effect Effects 0.000 description 22
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 21
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 21
- 238000010511 deprotection reaction Methods 0.000 description 21
- 239000008096 xylene Substances 0.000 description 21
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 20
- 238000001816 cooling Methods 0.000 description 20
- 231100000989 no adverse effect Toxicity 0.000 description 20
- 239000012044 organic layer Substances 0.000 description 19
- 239000000126 substance Substances 0.000 description 19
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 18
- 239000003960 organic solvent Substances 0.000 description 18
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 16
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical class OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 16
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 16
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 16
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 15
- 235000011054 acetic acid Nutrition 0.000 description 15
- 125000003118 aryl group Chemical group 0.000 description 15
- 238000004440 column chromatography Methods 0.000 description 15
- 150000002148 esters Chemical class 0.000 description 15
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 15
- 238000000746 purification Methods 0.000 description 15
- 239000003153 chemical reaction reagent Substances 0.000 description 14
- 238000007796 conventional method Methods 0.000 description 14
- 238000005160 1H NMR spectroscopy Methods 0.000 description 13
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 13
- 150000002476 indolines Chemical class 0.000 description 13
- 239000012046 mixed solvent Substances 0.000 description 13
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 13
- DKPFZGUDAPQIHT-UHFFFAOYSA-N Butyl acetate Natural products CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 description 12
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 12
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 12
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 12
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 12
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 12
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 11
- GQHTUMJGOHRCHB-UHFFFAOYSA-N 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine Chemical compound C1CCCCN2CCCN=C21 GQHTUMJGOHRCHB-UHFFFAOYSA-N 0.000 description 11
- 239000003377 acid catalyst Substances 0.000 description 11
- 125000003545 alkoxy group Chemical group 0.000 description 11
- 239000012043 crude product Substances 0.000 description 11
- 239000000706 filtrate Substances 0.000 description 11
- 238000006722 reduction reaction Methods 0.000 description 11
- 238000003756 stirring Methods 0.000 description 11
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 11
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 10
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 10
- 239000003054 catalyst Substances 0.000 description 10
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 10
- VMKOFRJSULQZRM-UHFFFAOYSA-N 1-bromooctane Chemical compound CCCCCCCCBr VMKOFRJSULQZRM-UHFFFAOYSA-N 0.000 description 9
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 9
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 9
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 9
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 9
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 9
- QQMPCXGCLCNZCT-UHFFFAOYSA-N ethyl 2-[1-acetyl-7-(2,2-dimethylpropanoylamino)-4,6-dimethyl-2,3-dihydroindol-5-yl]acetate Chemical compound CC(C)(C)C(=O)NC1=C(C)C(CC(=O)OCC)=C(C)C2=C1N(C(C)=O)CC2 QQMPCXGCLCNZCT-UHFFFAOYSA-N 0.000 description 9
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 9
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical group [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 9
- 239000002244 precipitate Substances 0.000 description 9
- PAMIQIKDUOTOBW-UHFFFAOYSA-N 1-methylpiperidine Chemical compound CN1CCCCC1 PAMIQIKDUOTOBW-UHFFFAOYSA-N 0.000 description 8
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 8
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 8
- 230000005526 G1 to G0 transition Effects 0.000 description 8
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 8
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 8
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 8
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 8
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 description 8
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 8
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 8
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 8
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 8
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 8
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 8
- 239000003463 adsorbent Substances 0.000 description 8
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 8
- 229920001429 chelating resin Polymers 0.000 description 8
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 8
- GGSUCNLOZRCGPQ-UHFFFAOYSA-N diethylaniline Chemical compound CCN(CC)C1=CC=CC=C1 GGSUCNLOZRCGPQ-UHFFFAOYSA-N 0.000 description 8
- 238000004128 high performance liquid chromatography Methods 0.000 description 8
- 238000004255 ion exchange chromatography Methods 0.000 description 8
- 238000002955 isolation Methods 0.000 description 8
- 239000010410 layer Substances 0.000 description 8
- XELZGAJCZANUQH-UHFFFAOYSA-N methyl 1-acetylthieno[3,2-c]pyrazole-5-carboxylate Chemical compound CC(=O)N1N=CC2=C1C=C(C(=O)OC)S2 XELZGAJCZANUQH-UHFFFAOYSA-N 0.000 description 8
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 8
- 238000003953 normal phase liquid chromatography Methods 0.000 description 8
- 150000002894 organic compounds Chemical class 0.000 description 8
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 8
- 238000001953 recrystallisation Methods 0.000 description 8
- 238000001226 reprecipitation Methods 0.000 description 8
- 238000004366 reverse phase liquid chromatography Methods 0.000 description 8
- 238000001179 sorption measurement Methods 0.000 description 8
- FKHIFSZMMVMEQY-UHFFFAOYSA-N talc Chemical compound [Mg+2].[O-][Si]([O-])=O FKHIFSZMMVMEQY-UHFFFAOYSA-N 0.000 description 8
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical class CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 8
- PAXYOTBBFFQQTI-UHFFFAOYSA-N 2-[7-(2,2-dimethylpropanoylamino)-4,6-dimethyl-1-octyl-2,3-dihydroindol-5-yl]acetic acid;sulfuric acid Chemical compound OS(O)(=O)=O.CC(C)(C)C(=O)NC1=C(C)C(CC(O)=O)=C(C)C2=C1N(CCCCCCCC)CC2 PAXYOTBBFFQQTI-UHFFFAOYSA-N 0.000 description 7
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical class CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 7
- 125000002252 acyl group Chemical group 0.000 description 7
- 229910052783 alkali metal Inorganic materials 0.000 description 7
- 125000005129 aryl carbonyl group Chemical group 0.000 description 7
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 7
- 150000008282 halocarbons Chemical class 0.000 description 7
- 125000005843 halogen group Chemical group 0.000 description 7
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 7
- 150000007522 mineralic acids Chemical class 0.000 description 7
- YKYONYBAUNKHLG-UHFFFAOYSA-N n-Propyl acetate Natural products CCCOC(C)=O YKYONYBAUNKHLG-UHFFFAOYSA-N 0.000 description 7
- 238000006396 nitration reaction Methods 0.000 description 7
- 229910052757 nitrogen Inorganic materials 0.000 description 7
- 150000007524 organic acids Chemical class 0.000 description 7
- 150000007530 organic bases Chemical class 0.000 description 7
- 238000005192 partition Methods 0.000 description 7
- 229940090181 propyl acetate Drugs 0.000 description 7
- 238000000926 separation method Methods 0.000 description 7
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 7
- KBPLFHHGFOOTCA-UHFFFAOYSA-N 1-Octanol Chemical compound CCCCCCCCO KBPLFHHGFOOTCA-UHFFFAOYSA-N 0.000 description 6
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 6
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 6
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 6
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 6
- 0 O=S(=O)(O)O.[2*]C1=C2CCN(C)C2=C(NC(=O)C(C)(C)C)C([3*])=C1CC(=O)O Chemical compound O=S(=O)(O)O.[2*]C1=C2CCN(C)C2=C(NC(=O)C(C)(C)C)C([3*])=C1CC(=O)O 0.000 description 6
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 6
- 125000001931 aliphatic group Chemical group 0.000 description 6
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 6
- 239000007789 gas Substances 0.000 description 6
- PHTQWCKDNZKARW-UHFFFAOYSA-N isoamylol Chemical compound CC(C)CCO PHTQWCKDNZKARW-UHFFFAOYSA-N 0.000 description 6
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 6
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 6
- 150000002825 nitriles Chemical class 0.000 description 6
- 125000001424 substituent group Chemical group 0.000 description 6
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 5
- RGUKYNXWOWSRET-UHFFFAOYSA-N 4-pyrrolidin-1-ylpyridine Chemical compound C1CCCN1C1=CC=NC=C1 RGUKYNXWOWSRET-UHFFFAOYSA-N 0.000 description 5
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical class C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 5
- OIFBSDVPJOWBCH-UHFFFAOYSA-N Diethyl carbonate Chemical compound CCOC(=O)OCC OIFBSDVPJOWBCH-UHFFFAOYSA-N 0.000 description 5
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 5
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 5
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical class O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 5
- 230000002378 acidificating effect Effects 0.000 description 5
- 150000007513 acids Chemical class 0.000 description 5
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 5
- 125000003710 aryl alkyl group Chemical group 0.000 description 5
- WBJINCZRORDGAQ-UHFFFAOYSA-N formic acid ethyl ester Natural products CCOC=O WBJINCZRORDGAQ-UHFFFAOYSA-N 0.000 description 5
- 229910052736 halogen Inorganic materials 0.000 description 5
- 150000002367 halogens Chemical class 0.000 description 5
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 5
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 5
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical class OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 5
- 239000012047 saturated solution Substances 0.000 description 5
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 5
- 238000005406 washing Methods 0.000 description 5
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 4
- OCJBOOLMMGQPQU-UHFFFAOYSA-N 1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C=C1 OCJBOOLMMGQPQU-UHFFFAOYSA-N 0.000 description 4
- HZNVUJQVZSTENZ-UHFFFAOYSA-N 2,3-dichloro-5,6-dicyano-1,4-benzoquinone Chemical compound ClC1=C(Cl)C(=O)C(C#N)=C(C#N)C1=O HZNVUJQVZSTENZ-UHFFFAOYSA-N 0.000 description 4
- HVHZEKKZMFRULH-UHFFFAOYSA-N 2,6-ditert-butyl-4-methylpyridine Chemical compound CC1=CC(C(C)(C)C)=NC(C(C)(C)C)=C1 HVHZEKKZMFRULH-UHFFFAOYSA-N 0.000 description 4
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 4
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 4
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 4
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 4
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 4
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 4
- 150000008041 alkali metal carbonates Chemical class 0.000 description 4
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 4
- 150000001718 carbodiimides Chemical class 0.000 description 4
- 239000007810 chemical reaction solvent Substances 0.000 description 4
- 238000005859 coupling reaction Methods 0.000 description 4
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 4
- 229940117389 dichlorobenzene Drugs 0.000 description 4
- 238000010828 elution Methods 0.000 description 4
- ZMVUOIOPHIQZJM-UHFFFAOYSA-N ethyl 2-(1-acetyl-4,6-dimethyl-2,3-dihydroindol-5-yl)acetate Chemical compound CCOC(=O)CC1=C(C)C=C2N(C(C)=O)CCC2=C1C ZMVUOIOPHIQZJM-UHFFFAOYSA-N 0.000 description 4
- DHXJZYWUUWBZNR-UHFFFAOYSA-N ethyl 2-[7-(2,2-dimethylpropanoylamino)-4,6-dimethyl-2,3-dihydro-1h-indol-5-yl]acetate;hydrochloride Chemical compound Cl.CC(C)(C)C(=O)NC1=C(C)C(CC(=O)OCC)=C(C)C2=C1NCC2 DHXJZYWUUWBZNR-UHFFFAOYSA-N 0.000 description 4
- IIEWJVIFRVWJOD-UHFFFAOYSA-N ethylcyclohexane Chemical compound CCC1CCCCC1 IIEWJVIFRVWJOD-UHFFFAOYSA-N 0.000 description 4
- 150000004820 halides Chemical class 0.000 description 4
- 229910052739 hydrogen Inorganic materials 0.000 description 4
- 239000001257 hydrogen Substances 0.000 description 4
- LRDFRRGEGBBSRN-UHFFFAOYSA-N isobutyronitrile Chemical compound CC(C)C#N LRDFRRGEGBBSRN-UHFFFAOYSA-N 0.000 description 4
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 4
- HJOVHMDZYOCNQW-UHFFFAOYSA-N isophorone Chemical compound CC1=CC(=O)CC(C)(C)C1 HJOVHMDZYOCNQW-UHFFFAOYSA-N 0.000 description 4
- 239000007800 oxidant agent Substances 0.000 description 4
- 229910000073 phosphorus hydride Inorganic materials 0.000 description 4
- 229910000027 potassium carbonate Inorganic materials 0.000 description 4
- 235000011181 potassium carbonates Nutrition 0.000 description 4
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 4
- 235000017557 sodium bicarbonate Nutrition 0.000 description 4
- 229910000029 sodium carbonate Inorganic materials 0.000 description 4
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 4
- 238000000638 solvent extraction Methods 0.000 description 4
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 4
- ITMCEJHCFYSIIV-UHFFFAOYSA-N triflic acid Chemical class OS(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-N 0.000 description 4
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 4
- SGUVLZREKBPKCE-UHFFFAOYSA-N 1,5-diazabicyclo[4.3.0]-non-5-ene Chemical compound C1CCN=C2CCCN21 SGUVLZREKBPKCE-UHFFFAOYSA-N 0.000 description 3
- JVSFQJZRHXAUGT-UHFFFAOYSA-N 2,2-dimethylpropanoyl chloride Chemical compound CC(C)(C)C(Cl)=O JVSFQJZRHXAUGT-UHFFFAOYSA-N 0.000 description 3
- WCYWXUHJBCUOGL-UHFFFAOYSA-N 2-(1-acetyl-4,6-dimethyl-2,3-dihydroindol-5-yl)-2-hydroxyacetic acid Chemical compound C1=C(C)C(C(O)C(O)=O)=C(C)C2=C1N(C(=O)C)CC2 WCYWXUHJBCUOGL-UHFFFAOYSA-N 0.000 description 3
- ZBRCJCFZYPIMKQ-UHFFFAOYSA-N 2-(1-acetyl-4,6-dimethyl-2,3-dihydroindol-5-yl)acetic acid Chemical compound C1=C(C)C(CC(O)=O)=C(C)C2=C1N(C(=O)C)CC2 ZBRCJCFZYPIMKQ-UHFFFAOYSA-N 0.000 description 3
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 3
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 3
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 3
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical class Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 3
- 239000007868 Raney catalyst Substances 0.000 description 3
- 229910000564 Raney nickel Inorganic materials 0.000 description 3
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 3
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 3
- 229910001516 alkali metal iodide Inorganic materials 0.000 description 3
- 125000004448 alkyl carbonyl group Chemical group 0.000 description 3
- 235000011114 ammonium hydroxide Nutrition 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 239000003638 chemical reducing agent Substances 0.000 description 3
- 230000008878 coupling Effects 0.000 description 3
- 238000010168 coupling process Methods 0.000 description 3
- 125000004093 cyano group Chemical group *C#N 0.000 description 3
- HPXRVTGHNJAIIH-UHFFFAOYSA-N cyclohexanol Chemical compound OC1CCCCC1 HPXRVTGHNJAIIH-UHFFFAOYSA-N 0.000 description 3
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 3
- 125000005982 diphenylmethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 3
- 235000019253 formic acid Nutrition 0.000 description 3
- 235000011187 glycerol Nutrition 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 150000002576 ketones Chemical class 0.000 description 3
- XGZVUEUWXADBQD-UHFFFAOYSA-L lithium carbonate Chemical compound [Li+].[Li+].[O-]C([O-])=O XGZVUEUWXADBQD-UHFFFAOYSA-L 0.000 description 3
- 229910052808 lithium carbonate Inorganic materials 0.000 description 3
- JILPJDVXYVTZDQ-UHFFFAOYSA-N lithium methoxide Chemical compound [Li+].[O-]C JILPJDVXYVTZDQ-UHFFFAOYSA-N 0.000 description 3
- AZVCGYPLLBEUNV-UHFFFAOYSA-N lithium;ethanolate Chemical compound [Li+].CC[O-] AZVCGYPLLBEUNV-UHFFFAOYSA-N 0.000 description 3
- 229940098779 methanesulfonic acid Drugs 0.000 description 3
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- 235000006408 oxalic acid Nutrition 0.000 description 3
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 3
- 229910052697 platinum Inorganic materials 0.000 description 3
- 229910003446 platinum oxide Inorganic materials 0.000 description 3
- RPDAUEIUDPHABB-UHFFFAOYSA-N potassium ethoxide Chemical compound [K+].CC[O-] RPDAUEIUDPHABB-UHFFFAOYSA-N 0.000 description 3
- BDAWXSQJJCIFIK-UHFFFAOYSA-N potassium methoxide Chemical compound [K+].[O-]C BDAWXSQJJCIFIK-UHFFFAOYSA-N 0.000 description 3
- 238000007086 side reaction Methods 0.000 description 3
- 125000003808 silyl group Chemical group [H][Si]([H])([H])[*] 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- ISIJQEHRDSCQIU-UHFFFAOYSA-N tert-butyl 2,7-diazaspiro[4.5]decane-7-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCCC11CNCC1 ISIJQEHRDSCQIU-UHFFFAOYSA-N 0.000 description 3
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 3
- MIOPJNTWMNEORI-GMSGAONNSA-N (S)-camphorsulfonic acid Chemical compound C1C[C@@]2(CS(O)(=O)=O)C(=O)C[C@@H]1C2(C)C MIOPJNTWMNEORI-GMSGAONNSA-N 0.000 description 2
- USVVENVKYJZFMW-ONEGZZNKSA-N (e)-carboxyiminocarbamic acid Chemical compound OC(=O)\N=N\C(O)=O USVVENVKYJZFMW-ONEGZZNKSA-N 0.000 description 2
- 125000005918 1,2-dimethylbutyl group Chemical group 0.000 description 2
- LMDZBCPBFSXMTL-UHFFFAOYSA-N 1-ethyl-3-(3-dimethylaminopropyl)carbodiimide Chemical compound CCN=C=NCCCN(C)C LMDZBCPBFSXMTL-UHFFFAOYSA-N 0.000 description 2
- MEKOFIRRDATTAG-UHFFFAOYSA-N 2,2,5,8-tetramethyl-3,4-dihydrochromen-6-ol Chemical compound C1CC(C)(C)OC2=C1C(C)=C(O)C=C2C MEKOFIRRDATTAG-UHFFFAOYSA-N 0.000 description 2
- 125000006176 2-ethylbutyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(C([H])([H])*)C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 2
- 125000004493 2-methylbut-1-yl group Chemical group CC(C*)CC 0.000 description 2
- 125000005916 2-methylpentyl group Chemical group 0.000 description 2
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 2
- QOXOZONBQWIKDA-UHFFFAOYSA-N 3-hydroxypropyl Chemical group [CH2]CCO QOXOZONBQWIKDA-UHFFFAOYSA-N 0.000 description 2
- 125000005917 3-methylpentyl group Chemical group 0.000 description 2
- 125000006201 3-phenylpropyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000006281 4-bromobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Br)C([H])([H])* 0.000 description 2
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 description 2
- 125000004217 4-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C([H])([H])* 0.000 description 2
- 125000006181 4-methyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])C([H])([H])* 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 2
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 2
- KWYHDKDOAIKMQN-UHFFFAOYSA-N N,N,N',N'-tetramethylethylenediamine Chemical compound CN(C)CCN(C)C KWYHDKDOAIKMQN-UHFFFAOYSA-N 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 description 2
- 150000008065 acid anhydrides Chemical class 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- HAXFWIACAGNFHA-UHFFFAOYSA-N aldrithiol Chemical compound C=1C=CC=NC=1SSC1=CC=CC=N1 HAXFWIACAGNFHA-UHFFFAOYSA-N 0.000 description 2
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 2
- 150000008046 alkali metal hydrides Chemical class 0.000 description 2
- 125000005092 alkenyloxycarbonyl group Chemical group 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- 125000005098 aryl alkoxy carbonyl group Chemical group 0.000 description 2
- HKVFISRIUUGTIB-UHFFFAOYSA-O azanium;cerium;nitrate Chemical compound [NH4+].[Ce].[O-][N+]([O-])=O HKVFISRIUUGTIB-UHFFFAOYSA-O 0.000 description 2
- RQPZNWPYLFFXCP-UHFFFAOYSA-L barium dihydroxide Chemical compound [OH-].[OH-].[Ba+2] RQPZNWPYLFFXCP-UHFFFAOYSA-L 0.000 description 2
- 229910001863 barium hydroxide Inorganic materials 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- HTZCNXWZYVXIMZ-UHFFFAOYSA-M benzyl(triethyl)azanium;chloride Chemical compound [Cl-].CC[N+](CC)(CC)CC1=CC=CC=C1 HTZCNXWZYVXIMZ-UHFFFAOYSA-M 0.000 description 2
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 2
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 2
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 2
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- DCFKHNIGBAHNSS-UHFFFAOYSA-N chloro(triethyl)silane Chemical compound CC[Si](Cl)(CC)CC DCFKHNIGBAHNSS-UHFFFAOYSA-N 0.000 description 2
- 238000007872 degassing Methods 0.000 description 2
- RWZVEYCEMWVFLP-UHFFFAOYSA-N ethyl 2-(1-acetyl-4,6-dimethyl-7-nitro-2,3-dihydroindol-5-yl)acetate Chemical compound [O-][N+](=O)C1=C(C)C(CC(=O)OCC)=C(C)C2=C1N(C(C)=O)CC2 RWZVEYCEMWVFLP-UHFFFAOYSA-N 0.000 description 2
- UUYDWMCBMRDEDZ-UHFFFAOYSA-N ethyl 2-(1-acetyl-7-amino-4,6-dimethyl-2,3-dihydroindol-5-yl)acetate Chemical compound NC1=C(C)C(CC(=O)OCC)=C(C)C2=C1N(C(C)=O)CC2 UUYDWMCBMRDEDZ-UHFFFAOYSA-N 0.000 description 2
- JANLGRVMMWYCQL-UHFFFAOYSA-N ethyl 2-[7-(2,2-dimethylpropanoylamino)-4,6-dimethyl-2,3-dihydro-1h-indol-5-yl]acetate Chemical compound CC(C)(C)C(=O)NC1=C(C)C(CC(=O)OCC)=C(C)C2=C1NCC2 JANLGRVMMWYCQL-UHFFFAOYSA-N 0.000 description 2
- HHLFWLYXYJOTON-UHFFFAOYSA-N glyoxylic acid Chemical compound OC(=O)C=O HHLFWLYXYJOTON-UHFFFAOYSA-N 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 2
- 229910000103 lithium hydride Inorganic materials 0.000 description 2
- SIAPCJWMELPYOE-UHFFFAOYSA-N lithium hydride Chemical compound [LiH] SIAPCJWMELPYOE-UHFFFAOYSA-N 0.000 description 2
- HQRPHMAXFVUBJX-UHFFFAOYSA-M lithium;hydrogen carbonate Chemical compound [Li+].OC([O-])=O HQRPHMAXFVUBJX-UHFFFAOYSA-M 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- IOLGVOLPSNSDEM-UHFFFAOYSA-N methyl 2-(1-acetyl-4,6-dimethyl-2,3-dihydroindol-5-yl)acetate Chemical compound COC(=O)CC1=C(C)C=C2N(C(C)=O)CCC2=C1C IOLGVOLPSNSDEM-UHFFFAOYSA-N 0.000 description 2
- OTMAVNBWEHSNGX-UHFFFAOYSA-N methyl 2-(1-acetyl-4,6-dimethyl-7-nitro-2,3-dihydroindol-5-yl)acetate Chemical compound [O-][N+](=O)C1=C(C)C(CC(=O)OC)=C(C)C2=C1N(C(C)=O)CC2 OTMAVNBWEHSNGX-UHFFFAOYSA-N 0.000 description 2
- RGEDQIVIKBDJEG-UHFFFAOYSA-N methyl 2-(1-acetyl-7-amino-4,6-dimethyl-2,3-dihydroindol-5-yl)acetate Chemical compound NC1=C(C)C(CC(=O)OC)=C(C)C2=C1N(C(C)=O)CC2 RGEDQIVIKBDJEG-UHFFFAOYSA-N 0.000 description 2
- GPCRSWMMERRSKS-UHFFFAOYSA-N methyl 2-[1-acetyl-7-(2,2-dimethylpropanoylamino)-4,6-dimethyl-2,3-dihydroindol-5-yl]acetate Chemical compound CC(C)(C)C(=O)NC1=C(C)C(CC(=O)OC)=C(C)C2=C1N(C(C)=O)CC2 GPCRSWMMERRSKS-UHFFFAOYSA-N 0.000 description 2
- IBZWFCLPTHFJBP-UHFFFAOYSA-N methyl 2-[7-(2,2-dimethylpropanoylamino)-4,6-dimethyl-2,3-dihydro-1h-indol-5-yl]acetate Chemical compound CC(C)(C)C(=O)NC1=C(C)C(CC(=O)OC)=C(C)C2=C1NCC2 IBZWFCLPTHFJBP-UHFFFAOYSA-N 0.000 description 2
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 2
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 125000006505 p-cyanobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C#N)C([H])([H])* 0.000 description 2
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 description 2
- NXJCBFBQEVOTOW-UHFFFAOYSA-L palladium(2+);dihydroxide Chemical compound O[Pd]O NXJCBFBQEVOTOW-UHFFFAOYSA-L 0.000 description 2
- 125000003538 pentan-3-yl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 2
- 229960005235 piperonyl butoxide Drugs 0.000 description 2
- 125000004591 piperonyl group Chemical group C(C1=CC=2OCOC2C=C1)* 0.000 description 2
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 2
- 235000015497 potassium bicarbonate Nutrition 0.000 description 2
- 239000011736 potassium bicarbonate Substances 0.000 description 2
- NROKBHXJSPEDAR-UHFFFAOYSA-M potassium fluoride Chemical compound [F-].[K+] NROKBHXJSPEDAR-UHFFFAOYSA-M 0.000 description 2
- 229910000105 potassium hydride Inorganic materials 0.000 description 2
- NTTOTNSKUYCDAV-UHFFFAOYSA-N potassium hydride Chemical compound [KH] NTTOTNSKUYCDAV-UHFFFAOYSA-N 0.000 description 2
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 2
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- PUZPDOWCWNUUKD-UHFFFAOYSA-M sodium fluoride Chemical compound [F-].[Na+] PUZPDOWCWNUUKD-UHFFFAOYSA-M 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Chemical compound [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 description 2
- 239000012453 solvate Substances 0.000 description 2
- 150000003462 sulfoxides Chemical class 0.000 description 2
- NHGXDBSUJJNIRV-UHFFFAOYSA-M tetrabutylammonium chloride Chemical compound [Cl-].CCCC[N+](CCCC)(CCCC)CCCC NHGXDBSUJJNIRV-UHFFFAOYSA-M 0.000 description 2
- FPGGTKZVZWFYPV-UHFFFAOYSA-M tetrabutylammonium fluoride Chemical compound [F-].CCCC[N+](CCCC)(CCCC)CCCC FPGGTKZVZWFYPV-UHFFFAOYSA-M 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- 125000000025 triisopropylsilyl group Chemical group C(C)(C)[Si](C(C)C)(C(C)C)* 0.000 description 2
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- YFTHZRPMJXBUME-UHFFFAOYSA-N tripropylamine Chemical compound CCCN(CCC)CCC YFTHZRPMJXBUME-UHFFFAOYSA-N 0.000 description 2
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- 125000003774 valeryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 1
- ONRNRVLJHFFBJG-UHFFFAOYSA-N 1,2-di(imidazol-1-yl)ethane-1,2-dione Chemical compound C1=CN=CN1C(=O)C(=O)N1C=CN=C1 ONRNRVLJHFFBJG-UHFFFAOYSA-N 0.000 description 1
- BDNKZNFMNDZQMI-UHFFFAOYSA-N 1,3-diisopropylcarbodiimide Chemical compound CC(C)N=C=NC(C)C BDNKZNFMNDZQMI-UHFFFAOYSA-N 0.000 description 1
- BGPJLYIFDLICMR-UHFFFAOYSA-N 1,4,2,3-dioxadithiolan-5-one Chemical compound O=C1OSSO1 BGPJLYIFDLICMR-UHFFFAOYSA-N 0.000 description 1
- QANCFDUNZQXJAE-UHFFFAOYSA-N 1-(4,6-dimethyl-2,3-dihydroindol-1-yl)ethanone Chemical compound C1=C(C)C=C(C)C2=C1N(C(=O)C)CC2 QANCFDUNZQXJAE-UHFFFAOYSA-N 0.000 description 1
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 1
- 125000004973 1-butenyl group Chemical group C(=CCC)* 0.000 description 1
- YVRGKFXJZCTTRB-UHFFFAOYSA-N 1-chloroethyl ethyl carbonate Chemical compound CCOC(=O)OC(C)Cl YVRGKFXJZCTTRB-UHFFFAOYSA-N 0.000 description 1
- CNDHHGUSRIZDSL-UHFFFAOYSA-N 1-chlorooctane Chemical compound CCCCCCCCCl CNDHHGUSRIZDSL-UHFFFAOYSA-N 0.000 description 1
- 125000006074 1-ethyl-2-butenyl group Chemical group 0.000 description 1
- 125000006075 1-ethyl-3-butenyl group Chemical group 0.000 description 1
- 125000006039 1-hexenyl group Chemical group 0.000 description 1
- UWLHSHAHTBJTBA-UHFFFAOYSA-N 1-iodooctane Chemical compound CCCCCCCCI UWLHSHAHTBJTBA-UHFFFAOYSA-N 0.000 description 1
- 125000006025 1-methyl-1-butenyl group Chemical group 0.000 description 1
- 125000006019 1-methyl-1-propenyl group Chemical group 0.000 description 1
- 125000006028 1-methyl-2-butenyl group Chemical group 0.000 description 1
- 125000006048 1-methyl-2-pentenyl group Chemical group 0.000 description 1
- 125000006021 1-methyl-2-propenyl group Chemical group 0.000 description 1
- 125000006030 1-methyl-3-butenyl group Chemical group 0.000 description 1
- 125000006052 1-methyl-3-pentenyl group Chemical group 0.000 description 1
- 125000006055 1-methyl-4-pentenyl group Chemical group 0.000 description 1
- 125000006023 1-pentenyl group Chemical group 0.000 description 1
- 125000006017 1-propenyl group Chemical group 0.000 description 1
- UTQNKKSJPHTPBS-UHFFFAOYSA-N 2,2,2-trichloroethanone Chemical group ClC(Cl)(Cl)[C]=O UTQNKKSJPHTPBS-UHFFFAOYSA-N 0.000 description 1
- 125000004797 2,2,2-trichloroethoxy group Chemical group ClC(CO*)(Cl)Cl 0.000 description 1
- 125000000453 2,2,2-trichloroethyl group Chemical group [H]C([H])(*)C(Cl)(Cl)Cl 0.000 description 1
- 125000004206 2,2,2-trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 1
- YQTCQNIPQMJNTI-UHFFFAOYSA-N 2,2-dimethylpropan-1-one Chemical group CC(C)(C)[C]=O YQTCQNIPQMJNTI-UHFFFAOYSA-N 0.000 description 1
- PGZVFRAEAAXREB-UHFFFAOYSA-N 2,2-dimethylpropanoyl 2,2-dimethylpropanoate Chemical compound CC(C)(C)C(=O)OC(=O)C(C)(C)C PGZVFRAEAAXREB-UHFFFAOYSA-N 0.000 description 1
- QIJIUJYANDSEKG-UHFFFAOYSA-N 2,4,4-trimethylpentan-2-amine Chemical class CC(C)(C)CC(C)(C)N QIJIUJYANDSEKG-UHFFFAOYSA-N 0.000 description 1
- LCPVQAHEFVXVKT-UHFFFAOYSA-N 2-(2,4-difluorophenoxy)pyridin-3-amine Chemical compound NC1=CC=CN=C1OC1=CC=C(F)C=C1F LCPVQAHEFVXVKT-UHFFFAOYSA-N 0.000 description 1
- CBQLVACGEMGVMI-UHFFFAOYSA-N 2-(pyridin-2-yldiselanyl)pyridine Chemical compound C=1C=CC=NC=1[Se][Se]C1=CC=CC=N1 CBQLVACGEMGVMI-UHFFFAOYSA-N 0.000 description 1
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 description 1
- 125000005999 2-bromoethyl group Chemical group 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- 125000000069 2-butynyl group Chemical group [H]C([H])([H])C#CC([H])([H])* 0.000 description 1
- ABFPKTQEQNICFT-UHFFFAOYSA-M 2-chloro-1-methylpyridin-1-ium;iodide Chemical compound [I-].C[N+]1=CC=CC=C1Cl ABFPKTQEQNICFT-UHFFFAOYSA-M 0.000 description 1
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 description 1
- 125000004777 2-fluoroethyl group Chemical group [H]C([H])(F)C([H])([H])* 0.000 description 1
- 125000006040 2-hexenyl group Chemical group 0.000 description 1
- 125000006020 2-methyl-1-propenyl group Chemical group 0.000 description 1
- 125000006049 2-methyl-2-pentenyl group Chemical group 0.000 description 1
- 125000006022 2-methyl-2-propenyl group Chemical group 0.000 description 1
- 125000006031 2-methyl-3-butenyl group Chemical group 0.000 description 1
- 125000006053 2-methyl-3-pentenyl group Chemical group 0.000 description 1
- 125000006056 2-methyl-4-pentenyl group Chemical group 0.000 description 1
- 125000006024 2-pentenyl group Chemical group 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- XQIOBBHIEUGFCI-UHFFFAOYSA-N 3,4-dihydropyrido[1,2-a]pyrimidin-2-one Chemical compound C1=CC=CC2=NC(=O)CCN21 XQIOBBHIEUGFCI-UHFFFAOYSA-N 0.000 description 1
- MWOOKDULMBMMPN-UHFFFAOYSA-N 3-(2-ethyl-1,2-oxazol-2-ium-5-yl)benzenesulfonate Chemical compound O1[N+](CC)=CC=C1C1=CC=CC(S([O-])(=O)=O)=C1 MWOOKDULMBMMPN-UHFFFAOYSA-N 0.000 description 1
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 1
- 125000000474 3-butynyl group Chemical group [H]C#CC([H])([H])C([H])([H])* 0.000 description 1
- 125000006041 3-hexenyl group Chemical group 0.000 description 1
- VBKDUIRAXCKPOA-UHFFFAOYSA-N 3-methyl-1,3-benzothiazole-2-selone Chemical compound C1=CC=C2SC(=[Se])N(C)C2=C1 VBKDUIRAXCKPOA-UHFFFAOYSA-N 0.000 description 1
- 125000000242 4-chlorobenzoyl group Chemical group ClC1=CC=C(C(=O)*)C=C1 0.000 description 1
- 125000006042 4-hexenyl group Chemical group 0.000 description 1
- SXIFAEWFOJETOA-UHFFFAOYSA-N 4-hydroxy-butyl Chemical group [CH2]CCCO SXIFAEWFOJETOA-UHFFFAOYSA-N 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- 125000006043 5-hexenyl group Chemical group 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 101100313763 Arabidopsis thaliana TIM22-2 gene Proteins 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- JISHBXFXSOBZJB-UHFFFAOYSA-N BrBr.CC(=O)N1CCC2=C(C)C(Br)=C(C)C([N+](=O)[O-])=C21.CC(=O)N1CCC2=C(C)C(Br)=C(C)C=C21.CC(=O)N1CCC2=C(C)C=C(C)C=C21.CC(=O)O.CC(=O)O Chemical compound BrBr.CC(=O)N1CCC2=C(C)C(Br)=C(C)C([N+](=O)[O-])=C21.CC(=O)N1CCC2=C(C)C(Br)=C(C)C=C21.CC(=O)N1CCC2=C(C)C=C(C)C=C21.CC(=O)O.CC(=O)O JISHBXFXSOBZJB-UHFFFAOYSA-N 0.000 description 1
- 239000007848 Bronsted acid Substances 0.000 description 1
- MKQZTCCGXCXOBC-UHFFFAOYSA-M CC(=O)N1CCC2=C(C)C=C(C)C(N)=C21.CCOC(=O)CC1=C(C)C(NC)=C2C(=C1C)CCN2C.CNC1=C2C(=C(C)C(CCl)=C1C)CCN2C(C)=O.CNC1=C2C(=C(C)C=C1C)CCN2C(C)=O.N#C[Na].O[Na].[C-]#[N+]CC1=C(C)C(NC)=C2C(=C1C)CCN2C(C)=O.[H]N1CCC2=C(C)C(CC(=O)OCC)=C(C)C(NC)=C21 Chemical compound CC(=O)N1CCC2=C(C)C=C(C)C(N)=C21.CCOC(=O)CC1=C(C)C(NC)=C2C(=C1C)CCN2C.CNC1=C2C(=C(C)C(CCl)=C1C)CCN2C(C)=O.CNC1=C2C(=C(C)C=C1C)CCN2C(C)=O.N#C[Na].O[Na].[C-]#[N+]CC1=C(C)C(NC)=C2C(=C1C)CCN2C(C)=O.[H]N1CCC2=C(C)C(CC(=O)OCC)=C(C)C(NC)=C21 MKQZTCCGXCXOBC-UHFFFAOYSA-M 0.000 description 1
- HAIMHJFMCSWZAG-UHFFFAOYSA-N CC1=C(CC(=O)O)C(C)=C2CCN(C)C2=C1NC(=O)C(C)(C)C.CNC1=C2C(=C(C)C(CC(=O)O)=C1C)CCN2C.O=S(=O)(O)O.O=S(=O)(O)O Chemical compound CC1=C(CC(=O)O)C(C)=C2CCN(C)C2=C1NC(=O)C(C)(C)C.CNC1=C2C(=C(C)C(CC(=O)O)=C1C)CCN2C.O=S(=O)(O)O.O=S(=O)(O)O HAIMHJFMCSWZAG-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- XVZXOLOFWKSDSR-UHFFFAOYSA-N Cc1cc(C)c([C]=O)c(C)c1 Chemical group Cc1cc(C)c([C]=O)c(C)c1 XVZXOLOFWKSDSR-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- NJLHHACGWKAWKL-UHFFFAOYSA-N ClP(Cl)=O Chemical compound ClP(Cl)=O NJLHHACGWKAWKL-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 description 1
- BWLUMTFWVZZZND-UHFFFAOYSA-N Dibenzylamine Chemical class C=1C=CC=CC=1CNCC1=CC=CC=C1 BWLUMTFWVZZZND-UHFFFAOYSA-N 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- BWGNESOTFCXPMA-UHFFFAOYSA-N Dihydrogen disulfide Chemical compound SS BWGNESOTFCXPMA-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical class NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical class F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical class OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 1
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical class OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 1
- KDXKERNSBIXSRK-YFKPBYRVSA-N L-lysine Chemical class NCCCC[C@H](N)C(O)=O KDXKERNSBIXSRK-YFKPBYRVSA-N 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- 102100030817 Liver carboxylesterase 1 Human genes 0.000 description 1
- 101710181187 Liver carboxylesterase 1 Proteins 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- NQTADLQHYWFPDB-UHFFFAOYSA-N N-Hydroxysuccinimide Chemical compound ON1C(=O)CCC1=O NQTADLQHYWFPDB-UHFFFAOYSA-N 0.000 description 1
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical class CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 1
- GOCCREQJUBABAL-UHFFFAOYSA-N O=C(O)C(O)O Chemical compound O=C(O)C(O)O GOCCREQJUBABAL-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 229920000388 Polyphosphate Polymers 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- ZKEVWYZZASPFEQ-UHFFFAOYSA-N [N+](=O)([O-])C1=CC=C(C=C1)S(=O)(=O)C1=[C-]N=NN1 Chemical compound [N+](=O)([O-])C1=CC=C(C=C1)S(=O)(=O)C1=[C-]N=NN1 ZKEVWYZZASPFEQ-UHFFFAOYSA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- DBJUEJCZPKMDPA-UHFFFAOYSA-N acetic acid;zinc Chemical compound [Zn].CC(O)=O DBJUEJCZPKMDPA-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 125000005041 acyloxyalkyl group Chemical group 0.000 description 1
- 229910001515 alkali metal fluoride Inorganic materials 0.000 description 1
- 229910052977 alkali metal sulfide Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 125000004849 alkoxymethyl group Chemical group 0.000 description 1
- 125000000304 alkynyl group Chemical group 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 1
- VOZYXUHNEBULJT-UHFFFAOYSA-N aluminum oxygen(2-) rhodium(3+) Chemical compound [O--].[O--].[O--].[Al+3].[Rh+3] VOZYXUHNEBULJT-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 235000001014 amino acid Nutrition 0.000 description 1
- 125000004103 aminoalkyl group Chemical group 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000002102 aryl alkyloxo group Chemical group 0.000 description 1
- 125000005279 aryl sulfonyloxy group Chemical group 0.000 description 1
- 125000003289 ascorbyl group Chemical class [H]O[C@@]([H])(C([H])([H])O*)[C@@]1([H])OC(=O)C(O*)=C1O* 0.000 description 1
- 150000001509 aspartic acid derivatives Chemical class 0.000 description 1
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Inorganic materials [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 description 1
- UPABQMWFWCMOFV-UHFFFAOYSA-N benethamine Chemical class C=1C=CC=CC=1CNCCC1=CC=CC=C1 UPABQMWFWCMOFV-UHFFFAOYSA-N 0.000 description 1
- JUHORIMYRDESRB-UHFFFAOYSA-N benzathine Chemical class C=1C=CC=CC=1CNCCNCC1=CC=CC=C1 JUHORIMYRDESRB-UHFFFAOYSA-N 0.000 description 1
- 150000008107 benzenesulfonic acids Chemical class 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- PFYXSUNOLOJMDX-UHFFFAOYSA-N bis(2,5-dioxopyrrolidin-1-yl) carbonate Chemical compound O=C1CCC(=O)N1OC(=O)ON1C(=O)CCC1=O PFYXSUNOLOJMDX-UHFFFAOYSA-N 0.000 description 1
- OMAHFYGHUQSIEF-UHFFFAOYSA-N bis(2,5-dioxopyrrolidin-1-yl) oxalate Chemical compound O=C1CCC(=O)N1OC(=O)C(=O)ON1C(=O)CCC1=O OMAHFYGHUQSIEF-UHFFFAOYSA-N 0.000 description 1
- ACBDNFPUXYGKPT-UHFFFAOYSA-N bromomethyl 2,2-dimethylpropanoate Chemical compound CC(C)(C)C(=O)OCBr ACBDNFPUXYGKPT-UHFFFAOYSA-N 0.000 description 1
- 230000005587 bubbling Effects 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 125000002668 chloroacetyl group Chemical group ClCC(=O)* 0.000 description 1
- AOGYCOYQMAVAFD-UHFFFAOYSA-N chlorocarbonic acid Chemical compound OC(Cl)=O AOGYCOYQMAVAFD-UHFFFAOYSA-N 0.000 description 1
- GGRHYQCXXYLUTL-UHFFFAOYSA-N chloromethyl 2,2-dimethylpropanoate Chemical compound CC(C)(C)C(=O)OCCl GGRHYQCXXYLUTL-UHFFFAOYSA-N 0.000 description 1
- SMJYMSAPPGLBAR-UHFFFAOYSA-N chloromethyl acetate Chemical compound CC(=O)OCCl SMJYMSAPPGLBAR-UHFFFAOYSA-N 0.000 description 1
- RTFGZMKXMSDULM-UHFFFAOYSA-N chloromethyl ethyl carbonate Chemical compound CCOC(=O)OCCl RTFGZMKXMSDULM-UHFFFAOYSA-N 0.000 description 1
- JHYNXXBAHWPABC-UHFFFAOYSA-N chloromethyl propan-2-yl carbonate Chemical compound CC(C)OC(=O)OCCl JHYNXXBAHWPABC-UHFFFAOYSA-N 0.000 description 1
- VDANGULDQQJODZ-UHFFFAOYSA-N chloroprocaine Chemical class CCN(CC)CCOC(=O)C1=CC=C(N)C=C1Cl VDANGULDQQJODZ-UHFFFAOYSA-N 0.000 description 1
- WRJWRGBVPUUDLA-UHFFFAOYSA-N chlorosulfonyl isocyanate Chemical compound ClS(=O)(=O)N=C=O WRJWRGBVPUUDLA-UHFFFAOYSA-N 0.000 description 1
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical class OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 1
- 150000001868 cobalt Chemical class 0.000 description 1
- 150000001879 copper Chemical class 0.000 description 1
- 150000003983 crown ethers Chemical class 0.000 description 1
- 239000012024 dehydrating agents Substances 0.000 description 1
- 150000008050 dialkyl sulfates Chemical class 0.000 description 1
- WLXALCKAKGDNAT-UHFFFAOYSA-N diazoethane Chemical compound CC=[N+]=[N-] WLXALCKAKGDNAT-UHFFFAOYSA-N 0.000 description 1
- YSSSPARMOAYJTE-UHFFFAOYSA-N dibenzo-18-crown-6 Chemical compound O1CCOCCOC2=CC=CC=C2OCCOCCOC2=CC=CC=C21 YSSSPARMOAYJTE-UHFFFAOYSA-N 0.000 description 1
- AFZSMODLJJCVPP-UHFFFAOYSA-N dibenzothiazol-2-yl disulfide Chemical compound C1=CC=C2SC(SSC=3SC4=CC=CC=C4N=3)=NC2=C1 AFZSMODLJJCVPP-UHFFFAOYSA-N 0.000 description 1
- 125000004772 dichloromethyl group Chemical group [H]C(Cl)(Cl)* 0.000 description 1
- TXFOLHZMICYNRM-UHFFFAOYSA-N dichlorophosphoryloxybenzene Chemical compound ClP(Cl)(=O)OC1=CC=CC=C1 TXFOLHZMICYNRM-UHFFFAOYSA-N 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical class OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- ZWWWLCMDTZFSOO-UHFFFAOYSA-N diethoxyphosphorylformonitrile Chemical compound CCOP(=O)(C#N)OCC ZWWWLCMDTZFSOO-UHFFFAOYSA-N 0.000 description 1
- FAMRKDQNMBBFBR-BQYQJAHWSA-N diethyl azodicarboxylate Substances CCOC(=O)\N=N\C(=O)OCC FAMRKDQNMBBFBR-BQYQJAHWSA-N 0.000 description 1
- DENRZWYUOJLTMF-UHFFFAOYSA-N diethyl sulfate Chemical compound CCOS(=O)(=O)OCC DENRZWYUOJLTMF-UHFFFAOYSA-N 0.000 description 1
- 229940008406 diethyl sulfate Drugs 0.000 description 1
- 150000005332 diethylamines Chemical class 0.000 description 1
- VLNZUSMTOFYNPS-UHFFFAOYSA-N diethylphosphorylformonitrile Chemical compound CCP(=O)(CC)C#N VLNZUSMTOFYNPS-UHFFFAOYSA-N 0.000 description 1
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 description 1
- 229940043279 diisopropylamine Drugs 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- MKRTXPORKIRPDG-UHFFFAOYSA-N diphenylphosphoryl azide Chemical compound C=1C=CC=CC=1P(=O)(N=[N+]=[N-])C1=CC=CC=C1 MKRTXPORKIRPDG-UHFFFAOYSA-N 0.000 description 1
- GCSAXWHQFYOIFE-UHFFFAOYSA-N dipyridin-2-yl carbonate Chemical compound C=1C=CC=NC=1OC(=O)OC1=CC=CC=N1 GCSAXWHQFYOIFE-UHFFFAOYSA-N 0.000 description 1
- XIMIGUBYDJDCKI-UHFFFAOYSA-N diselenium Chemical compound [Se]=[Se] XIMIGUBYDJDCKI-UHFFFAOYSA-N 0.000 description 1
- 238000005868 electrolysis reaction Methods 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-N ethanesulfonic acid Chemical class CCS(O)(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-N 0.000 description 1
- 125000005949 ethanesulfonyloxy group Chemical group 0.000 description 1
- 239000002031 ethanolic fraction Substances 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- BDHXJIRTSWHBPR-UHFFFAOYSA-N ethyl 1-iodoethyl carbonate Chemical compound CCOC(=O)OC(C)I BDHXJIRTSWHBPR-UHFFFAOYSA-N 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- FAMRKDQNMBBFBR-UHFFFAOYSA-N ethyl n-ethoxycarbonyliminocarbamate Chemical compound CCOC(=O)N=NC(=O)OCC FAMRKDQNMBBFBR-UHFFFAOYSA-N 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 150000002301 glucosamine derivatives Chemical class 0.000 description 1
- 150000002332 glycine derivatives Chemical class 0.000 description 1
- 150000002357 guanidines Chemical class 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical class I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 238000007327 hydrogenolysis reaction Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 229910017053 inorganic salt Inorganic materials 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 150000002505 iron Chemical class 0.000 description 1
- 125000005929 isobutyloxycarbonyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])OC(*)=O 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 125000000400 lauroyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- YNESATAKKCNGOF-UHFFFAOYSA-N lithium bis(trimethylsilyl)amide Chemical compound [Li+].C[Si](C)(C)[N-][Si](C)(C)C YNESATAKKCNGOF-UHFFFAOYSA-N 0.000 description 1
- 229910000032 lithium hydrogen carbonate Inorganic materials 0.000 description 1
- 229910003002 lithium salt Inorganic materials 0.000 description 1
- 159000000002 lithium salts Chemical class 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- 150000002688 maleic acid derivatives Chemical class 0.000 description 1
- 150000004701 malic acid derivatives Chemical class 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- 125000005948 methanesulfonyloxy group Chemical group 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- XMJHPCRAQCTCFT-UHFFFAOYSA-N methyl chloroformate Chemical compound COC(Cl)=O XMJHPCRAQCTCFT-UHFFFAOYSA-N 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- 150000002780 morpholines Chemical class 0.000 description 1
- 125000001419 myristoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- OQJBFFCUFALWQL-UHFFFAOYSA-N n-(piperidine-1-carbonylimino)piperidine-1-carboxamide Chemical compound C1CCCCN1C(=O)N=NC(=O)N1CCCCC1 OQJBFFCUFALWQL-UHFFFAOYSA-N 0.000 description 1
- ZUSSTQCWRDLYJA-UHFFFAOYSA-N n-hydroxy-5-norbornene-2,3-dicarboximide Chemical compound C1=CC2CC1C1C2C(=O)N(O)C1=O ZUSSTQCWRDLYJA-UHFFFAOYSA-N 0.000 description 1
- 150000002815 nickel Chemical class 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 230000000802 nitrating effect Effects 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 230000000269 nucleophilic effect Effects 0.000 description 1
- 125000002801 octanoyl group Chemical group C(CCCCCCC)(=O)* 0.000 description 1
- 125000002524 organometallic group Chemical group 0.000 description 1
- MOOYVEVEDVVKGD-UHFFFAOYSA-N oxaldehydic acid;hydrate Chemical compound O.OC(=O)C=O MOOYVEVEDVVKGD-UHFFFAOYSA-N 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 125000003232 p-nitrobenzoyl group Chemical group [N+](=O)([O-])C1=CC=C(C(=O)*)C=C1 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- UQPUONNXJVWHRM-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 UQPUONNXJVWHRM-UHFFFAOYSA-N 0.000 description 1
- 125000001312 palmitoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000004810 partition chromatography Methods 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- 238000006303 photolysis reaction Methods 0.000 description 1
- 230000015843 photosynthesis, light reaction Effects 0.000 description 1
- 125000005633 phthalidyl group Chemical group 0.000 description 1
- 150000004885 piperazines Chemical class 0.000 description 1
- 239000001205 polyphosphate Substances 0.000 description 1
- 235000011176 polyphosphates Nutrition 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 239000011698 potassium fluoride Substances 0.000 description 1
- 235000003270 potassium fluoride Nutrition 0.000 description 1
- 229940086066 potassium hydrogencarbonate Drugs 0.000 description 1
- USHAGKDGDHPEEY-UHFFFAOYSA-L potassium persulfate Chemical compound [K+].[K+].[O-]S(=O)(=O)OOS([O-])(=O)=O USHAGKDGDHPEEY-UHFFFAOYSA-L 0.000 description 1
- DPLVEEXVKBWGHE-UHFFFAOYSA-N potassium sulfide Chemical compound [S-2].[K+].[K+] DPLVEEXVKBWGHE-UHFFFAOYSA-N 0.000 description 1
- 125000001844 prenyl group Chemical group [H]C([*])([H])C([H])=C(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- MFDFERRIHVXMIY-UHFFFAOYSA-N procaine Chemical class CCN(CC)CCOC(=O)C1=CC=C(N)C=C1 MFDFERRIHVXMIY-UHFFFAOYSA-N 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- SCLOZNXTQXFXCB-UHFFFAOYSA-N propyl 2-(1-acetyl-4,6-dimethyl-2,3-dihydroindol-5-yl)acetate Chemical compound CCCOC(=O)CC1=C(C)C=C2N(C(C)=O)CCC2=C1C SCLOZNXTQXFXCB-UHFFFAOYSA-N 0.000 description 1
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical group CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- 239000011775 sodium fluoride Substances 0.000 description 1
- 235000013024 sodium fluoride Nutrition 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- RMBAVIFYHOYIFM-UHFFFAOYSA-M sodium methanethiolate Chemical compound [Na+].[S-]C RMBAVIFYHOYIFM-UHFFFAOYSA-M 0.000 description 1
- 239000004317 sodium nitrate Substances 0.000 description 1
- 235000010344 sodium nitrate Nutrition 0.000 description 1
- CHQMHPLRPQMAMX-UHFFFAOYSA-L sodium persulfate Substances [Na+].[Na+].[O-]S(=O)(=O)OOS([O-])(=O)=O CHQMHPLRPQMAMX-UHFFFAOYSA-L 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 229910052979 sodium sulfide Inorganic materials 0.000 description 1
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 1
- QJDUDPQVDAASMV-UHFFFAOYSA-M sodium;ethanethiolate Chemical compound [Na+].CC[S-] QJDUDPQVDAASMV-UHFFFAOYSA-M 0.000 description 1
- 238000003797 solvolysis reaction Methods 0.000 description 1
- 125000003696 stearoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical class OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 150000003892 tartrate salts Chemical class 0.000 description 1
- ILMRJRBKQSSXGY-UHFFFAOYSA-N tert-butyl(dimethyl)silicon Chemical group C[Si](C)C(C)(C)C ILMRJRBKQSSXGY-UHFFFAOYSA-N 0.000 description 1
- 125000001981 tert-butyldimethylsilyl group Chemical group [H]C([H])([H])[Si]([H])(C([H])([H])[H])[*]C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- QEMXHQIAXOOASZ-UHFFFAOYSA-N tetramethylammonium Chemical class C[N+](C)(C)C QEMXHQIAXOOASZ-UHFFFAOYSA-N 0.000 description 1
- TUQOTMZNTHZOKS-UHFFFAOYSA-N tributylphosphine Chemical compound CCCCP(CCCC)CCCC TUQOTMZNTHZOKS-UHFFFAOYSA-N 0.000 description 1
- FAQYAMRNWDIXMY-UHFFFAOYSA-N trichloroborane Chemical compound ClB(Cl)Cl FAQYAMRNWDIXMY-UHFFFAOYSA-N 0.000 description 1
- 125000003866 trichloromethyl group Chemical group ClC(Cl)(Cl)* 0.000 description 1
- FEQPHYCEZKWPNE-UHFFFAOYSA-K trichlororhodium;triphenylphosphane Chemical compound Cl[Rh](Cl)Cl.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 FEQPHYCEZKWPNE-UHFFFAOYSA-K 0.000 description 1
- 125000004044 trifluoroacetyl group Chemical group FC(C(=O)*)(F)F 0.000 description 1
- 125000005951 trifluoromethanesulfonyloxy group Chemical group 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical class OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 150000003751 zinc Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/08—Indoles; Hydrogenated indoles with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, directly attached to carbon atoms of the hetero ring
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02P—CLIMATE CHANGE MITIGATION TECHNOLOGIES IN THE PRODUCTION OR PROCESSING OF GOODS
- Y02P20/00—Technologies relating to chemical industry
- Y02P20/50—Improvements relating to the production of bulk chemicals
- Y02P20/55—Design of synthesis routes, e.g. reducing the use of auxiliary or protecting groups
Definitions
- the present invention relates to novel intermediates for the synthesis of indoline derivatives, which exhibit excellent ACAT inhibitory activity, and to processes for the preparation thereof.
- Indoline derivatives of the following general formula (1) [wherein R 2 and R 3 are the same or different and each represents a lower alkyl group; nOc represents an octyl group; preferred compound of formula (1) is a compound of formula (1a), i.e. wherein R 2 and R 3 represent both methyl group] have excellent inhibitory activity against acyl-coenzyme A: cholesterol acyltransferase (hereinafter referred to as ACAT), as disclosed in Japanese Patent Number 2968050 (EP 866,059 and U.S. Pat. No. 6,063,806).
- ACAT cholesterol acyltransferase
- the inventors have for many years made great efforts to study synthetic intermediates of indoline derivatives of formula (1), which exhibit excellent ACAT inhibitory activity, and to study processes for their preparation. They have found novel synthetic intermediates of the indoline derivatives of formula (1) and novel processes for their preparation and have completed the invention.
- the novel preparation process is excellent compared to previous processes, in that:
- productivity such as being able to shorten working time (about 2 ⁇ 3), can be increased
- reaction conditions can be greatly relaxed, such as by lowering the concentration of aqueous sodium hydroxide solution in the last step of preparing the carboxylic acid compound, and
- the present invention provides novel and useful intermediates for the preparation of indoline derivatives of formula (1) and processes for their preparation.
- the novel intermediate of the present invention is a compound of general formula (I) (wherein R 1 represents a protective group for the amino group, R 2 and R 3 are the same or different and each represents a lower alkyl group), a salt or an amide derivative thereof; or a compound of general formula (II) (wherein R 1 represents a protective group for the amino group, R 2 and R 3 are the same or different and each represents a lower alkyl group, R 4 represents a hydrogen atom or a protective group for the carboxyl group), a salt or an amide derivative thereof.
- a novel process for the preparation of the compound of general formula (I) which is a novel synthetic intermediate in the present invention, comprises the reaction of a compound of general formula (IV) (wherein R 1 , R 2 and R 3 have the same meanings as given above) with a compound of general formula (V) or a salt thereof.
- a novel process for the preparation of the compound of general formula (VI′) which is a novel synthetic intermediate in the present invention, (wherein R 1 represents a protective group for the amino group, R 2 and R 3 are the same or different and each represents a lower alkyl group) or a salt thereof, comprises the reduction of the hydroxyl group of a compound of general formula (I) (wherein R 1 , R 2 and R 3 have the same meanings given above) or a salt thereof by phosphorous acid and an alkali metal iodide, preferably in an organic acid.
- a novel process for the preparation of the compound of general formula (II) which is a novel synthetic intermediate in the present invention, (wherein R 1 represents a protective group for the amino group, R 2 and R 3 are the same or different and each represents a lower alkyl group, R 4 represents a hydrogen atom or a protective group for the carboxyl group) or a salt thereof, comprises the nitration of a compound of general formula (VI) (wherein R 1 , R 2 , R 3 and R 4 have the same meanings as given above) or a salt thereof.
- a novel process for the preparation of the compound of general formula (VII) which is a synthetic intermediate in the present invention comprises the reduction of a compound of general formula (II) (wherein R 1 , R 2 , R 3 and R 4 have the same meanings as given above) or a salt thereof.
- a novel process for the preparation of the compound of general formula (VIII) which is a synthetic intermediate in the present invention comprises the pivaloylation of a compound of general formula (VII) (wherein R 1 , R 2 , R 3 and R 4 have the same meanings as given above) or a salt thereof.
- a novel process for the preparation of the compound of general formula (III) which is a synthetic intermediate in the present invention comprises the octylation of a compound of general formula (IX) (wherein R 2 , R 3 and R 4 have the same meanings as given above) or a salt thereof, preferably in a solvent of butyl acetate or xylene and more preferably in the presence of diisopropylethylamine as a base.
- the protective group for the amino group in the definition of R 1 is a usual protective group for amino groups and includes an “aliphatic acyl group”, for example, a C 1 –C 20 alkylcarbonyl group such as formyl, acetyl, propionyl, butyryl, isobutyryl, pentanoyl, pivaloyl, valeryl, isovaleryl, octanoyl, lauroyl, myristoyl, tridecanoyl, palmitoyl or stearoyl; a halogeno lower alkylcarbonyl group such as chloroacetyl, dichloroacetyl, trichloroacetyl or trifluoroacetyl; a lower alkoxy-lower alkylcarbonyl group such as methoxyacetyl or an unsaturated alkylcarbonyl group such as (E)-2-methyl-2-butenoyl; an “aromatic acyl group”, for example
- the “lower alkyl group” in the definition of R 2 and R 3 is a straight or branched chain alkyl group having from 1 to 6 carbon atoms such as methyl, ethyl, n-propyl, isopropyl, n-butyl, isobutyl, s-butyl, tert-butyl, n-pentyl, isopentyl, 2-methylbutyl, neopentyl, 1-ethylpropyl, n-hexyl, isohexyl, 4-methylpentyl, 3-methylpentyl, 2-methylpentyl, 1-methylpentyl, 3,3-dimethylbutyl, 2,2-dimethylbutyl, 1,1-dimethylbutyl, 1,2-dimethylbutyl, 1,3-dimethylbutyl, 2,3-dimethylbutyl or 2-ethylbutyl.
- Preferred as alkyl group is a straight or
- protecting group for the carboxyl group in the definition of R 4 refers to a “protective group in chemical reactions” which can be removed by hydrogenolysis, hydrolysis, electrolysis or photolysis.
- a “protective group in chemical reactions” includes a “lower alkyl group” such as methyl, ethyl, n-propyl, isopropyl, n-butyl, isobutyl, s-butyl, tert-butyl, n-pentyl, isopentyl, 2-methylbutyl, neopentyl, 1-ethylpropyl, n-hexyl, isohexyl, 4-methylpentyl, 3-methylpentyl, 2-methylpentyl, 1-methylpentyl, 3,3-dimethylbutyl, 2,2-dimethylbutyl, 1,1-dimethylbutyl, 1,2-dimethylbutyl, 1,3-dimethylbutyl, 2,3-
- Preferred as protective group for the carboxyl group is a lower alkyl group, more preferred is a straight or branched chain alkyl having from 1 to 4 carbon atoms, still more preferred is a methyl, ethyl or n-propyl group and most preferred as protective group is an ethyl group.
- amide refers to a group which is produced by substitution of a carboxyl group with an amino group wherein said amino group may be optionally substituted with one or two substituents described below.
- Said substituent includes the “lower alkyl group” described above; an “alkyloxy group”, for example, a lower alkoxy group such as methoxy, ethoxy, n-propoxy, isopropoxy, n-butoxy or t-butoxy, a lower alkoxylated lower alkoxy group such as 2-methoxyethoxy or a halogenated lower alkoxy group such as 2,2,2-trichloroethoxy; an “aralkyloxy group”, for example, a lower alkoxy group substituted with one to three aryl groups such as benzyloxy, phenethyloxy, 3-phenylpropoxy, ⁇ -naphthylmethoxy, ⁇ -naphthylmethoxy, diphenylmethoxy, tripheny
- the salt can be obtained by reaction of a compound having a basic group such as an amino group with an acid or by reaction of a compound having an acidic group such as a carboxyl group with a base.
- Preferred salts of a compound having a basic group include an inorganic acid salt, for example, a hydrohalogenic acid salt such as hydrofluoric acid salt, hydrochloric acid salt, hydrobromic acid salt or hydroiodic acid salt, nitric acid salt, perchloric acid salt, sulfuric acid salt, or phosphoric acid salt; an organic acid salt, for example, a lower alkanesulfonic acid salt such as methanesulfonic acid salt, trifluoromethanesulfonic acid salt or ethanesulfonic acid salt, an arylsulfonic acid salt such as benzenesulfonic acid salt or p-toluenesulfonic acid salt, acetic acid salt, malic acid salt, fumaric acid salt, succinic acid salt, citric acid salt, ascorbic acid salt, tartaric acid salt, oxalic acid salt or maleic acid salt; or an amino acid salt such as glycine salt, lysine salt, alg
- Preferred salts of a compound having an acidic group include an alkali metal salt such as sodium salt, potassium salt or lithium salt; an alkaline earth metal salt such as calcium salt or magnesium salt; a metal salt such as aluminum salt, iron salt, zinc salt, copper salt, nickel salt or cobalt salt; an amine salt which includes, for example, an inorganic salt such as ammonium salt or an organic salt such as t-octylamine salt, dibenzylamine salt, morpholine salt, glucosamine salt, phenylglycine alkyl ester salt, ethylenediamine salt, N-methylglucamine salt, guanidine salt, diethylamine salt, triethylamine salt, dicyclohexylamine salt, N,N′-dibenzylethylenediamine salt, chloroprocaine salt, procaine salt, diethanolamine salt, N-benzyl-phenethylamine salt, piperazine salt, tetramethylammonium salt or tris
- the compound of the present invention When the compound of the present invention is allowed to stand in contact with the atmosphere, it may absorb water or water may attach to it to form a hydrate.
- the present invention encompasses such hydrates.
- the compound of the present invention may absorb a solvent to form a solvate.
- the present invention encompasses such solvates.
- each asymmetric carbon is able to have a configuration of R or S.
- the compound can exist as various stereoisomers due to such asymmetric carbons.
- the present invention encompasses both individual stereoisomers and mixtures of two or more of them in any ratio.
- Step 1 is a process for the preparation of a compound of formula (I), which process comprises reacting a compound of formula (IV) (such as the compound of formula (2)) with glyoxylic acid (V) (preferably monohydrate) in the presence of an acid catalyst.
- a compound of formula (IV) such as the compound of formula (2)
- glyoxylic acid (V) preferably monohydrate
- acids include a Br ⁇ nsted acid, for example, an inorganic acid such as hydrochloric acid, hydrobromic acid, sulfuric acid, perchloric acid or phosphoric acid; or an organic acid such as acetic acid, formic acid, oxalic acid, methanesulfonic acid, p-toluenesulfonic acid, camphorsulfonic acid, trifluoroacetic acid or trifluoromethanesulfonic acid.
- Preferred as acid catalyst is an inorganic acid and most preferred is hydrochloric acid or sulfuric acid.
- the solvent used in Step 1 is any usual solvent which has no adverse effect on the reaction.
- An acidic solvent which acts as an acidic catalyst can be used in Step 1 as a solvent.
- Preferred as solvent is acetic acid, which acts as an acid catalyst, or water.
- the reaction temperature of Step 1 is between 0° C. and 110° C. and preferably between 60° C. and 70° C.
- the reaction time of Step 1 depends mainly on the reaction temperature, starting materials, acid catalyst and solvent used in this reaction and usually is in the range of 1 hour to 2 days, preferably from 3 hours to 1 day.
- the desired compound of formula (I) can be isolated from the reaction mixture by conventional procedure.
- the desired compound can be obtained by addition of a suitable amount of water to the reaction mixture to form a precipitate and filtration of the crystals.
- the product thus obtained can, if necessary, be isolated and purified by conventional techniques such as recrystallization, reprecipitation or procedures that are usually used for the isolation and purification of the organic compounds.
- Examples of procedures mentioned above include adsorption column chromatography using a stationary phase such as silica gel, alumina or florisil composed of magnesium-silica gel; partition column chromatography using a synthetic adsorbent such as Sephadex LH-20 (a product of Pharmacia Co., Ltd.), Amberlite XAD-11 (a product of Rohm & Haas Co., Ltd) or Diaion HP-20 (a product of Mitsubishi Chemical Corporation); ion-exchange chromatography; normal and reversed phase liquid chromatography using silica gel or alkylated silica gel (high performance liquid chromatography is preferred); or a suitable combination of these procedures, and the desired compound can be isolated and purified by eluting with appropriate solvent from the column used.
- a stationary phase such as silica gel, alumina or florisil composed of magnesium-silica gel
- partition column chromatography using a synthetic adsorbent such as Sephadex LH-20 (a product of Pharmacia Co., Ltd.), Amberlite XAD
- each of the isomers can be separated at an appropriate stage such as the end of each step mentioned above or the end of a desired step by performing the suitable separation/purification procedure mentioned above or the combination thereof.
- Step 2 is a process for the preparation of a compound of formula (VI), which process comprises a reductive removal reaction for the hydroxyl group of a compound of formula (I) and, if necessary, a protection reaction of the carboxyl group of compound of formula (I).
- the main process of Step 2 can be accomplished in usual manner by conventional reductive reaction of the hydroxyl group.
- a preferred mode of the reaction is:
- Suitable solvents include an alcohol such as methanol, ethanol, n-propanol, isopropanol, n-butanol, isobutanol, t-butanol, isoamylalcohol, diethyleneglycol, glycerin, octanol, cyclohexanol, or methyl cellosolve or an organic acid such as acetic acid.
- Most suitable as solvent is ethanol or acetic acid.
- a compound of formula (VI) having the R 4 group corresponding to said alcohol is obtained (for example, when ethanol is used, a compound of formula (VI) having an ethyl group as the R 4 group is obtained and when methanol is used, a compound of formula (VI) having a methyl group as the R 4 group is obtained).
- the reduction catalyst used in the reaction (1) includes palladium on charcoal, platinum, platinum on charcoal, platinum oxide, palladium hydroxide or Raney nickel and preferably palladium on charcoal.
- the reaction temperature of the reaction (1) is between 30° C. and 90° C. and preferably between 60° C. and 80° C.
- the reaction time of the reaction (1) depends mainly on the reaction temperature, starting materials, reduction catalyst and solvent used in this reaction and usually is in the range of 2 hours to 10 hours, preferably from 3 hours to 6 hours.
- Suitable solvents include an organic acid such as acetic acid, formic acid, oxalic acid, methanesulfonic acid, p-toluenesulfonic acid, camphorsulfonic acid, trifluoroacetic acid or trifluoromethanesulfonic acid and a more suitable solvent is acetic acid.
- the alkali metal iodide used in the reaction preferably is potassium iodide or sodium iodide and more preferably is potassium iodide.
- the reaction temperature of the reaction is between 80° C. and 200° C. and preferably between 90° C. and 180° C.
- the reaction time depends mainly on the reaction temperature, starting materials and solvent used in this reaction and usually is in the range of 1 hour to 10 hours, preferably 1.5 hours to 6 hours.
- Step 2 the protection of the carboxyl group, which is an optional process, can be accomplished by method 1 to method 6.
- Method 1 can be accomplished by reaction of the carboxyl group with a compound of formula R 4 —X in a solvent in the presence of a base at a temperature in the range of ⁇ 20° C. to 120° C. (preferably from 0° C. to 80° C.) for a reaction time in the range of 0.5 hours to 10 hours.
- R 4 has the same meaning as given above, and X represents a leaving group as a nucleophilic residual group, for example, a halogen atom such as chlorine, bromine or iodine; a lower alkanesulfonyloxy group such as methanesulfonyloxy or ethanesulfonyloxy; a halogeno lower alkanesulfonyloxy group such as trifluoromethanesulfonyloxy or pentalluoroethanesulfonyloxy; an arylsulfonyloxy group such as benzensulfonyloxy, p-toluenesulfonyloxy or p-nitrobenzenesulfonyloxy.
- a halogen atom such as chlorine, bromine or iodine
- a lower alkanesulfonyloxy group such as methanesulfonyloxy or ethanesulf
- R 4 —X includes, for example, an aliphatic acyloxymethyl halide such as acetoxymethyl chloride, pivaloyloxymethyl bromide or pivaloyloxymethyl chloride; a lower alkoxycarbonyloxyalkyl halide such as ethoxycarbonyloxymethyl chloride, isopropoxycarbonyloxymethyl chloride, 1-(ethoxycarbonyloxy)ethyl chloride or 1-(ethoxycarbonyloxy)ethyl iodide; phthalidiyl halide or (5-methyl-2-oxo-1,3-dioxolen-4-yl)methyl halide.
- an aliphatic acyloxymethyl halide such as acetoxymethyl chloride, pivaloyloxymethyl bromide or pivaloyloxymethyl chloride
- a lower alkoxycarbonyloxyalkyl halide such as ethoxycarbonyloxymethyl chloride, isopropoxy
- Suitable solvents include an aliphatic hydrocarbon such as hexane or heptane; an aromatic hydrocarbon such as benzene, toluene or xylene; a halogenated hydrocarbon such as methylene chloride, chloroform, carbon tetrachloride, dichloroethane, chlorobenzene or dichlorobenzene; an ether such as diethyl ether, diisopropyl ether, tetrahydrofuran, dioxane, dimethoxyethane or di(ethylene glycol)dimethyl ether; a ketone such as acetone, methyl ethyl ketone, methyl isobutyl ketone, isophorone or cyclohexanone; a nitrile such as acetonitrile or isobutyronit
- Suitable bases include an inorganic base, for example, an alkali metal carbonate such as sodium carbonate, potassium carbonate or lithium carbonate; an alkali metal hydrogencarbonate such as sodium hydrogencarbonate, potassium hydrogencarbonate or lithium hydrogencarbonate; an alkali metal hydride such as lithium hydride, sodium hydride or potassium hydride; an alkali metal hydroxide such as sodium hydroxide, potassium hydroxide, barium hydroxide or lithium hydroxide; an alkali metal fluoride such as sodium fluoride or potassium fluoride; an alkali metal alkoxide such as sodium methoxide, sodium ethoxide, potassium methoxide, potassium ethoxide, potassium tert-butoxide or lithium methoxide; an alkali metal mercaptide such as sodium methylmercaptide or sodium ethylmercaptide; an organic base such as N-methylmorpholine,
- Method 2 can be accomplished by reaction of the compound having the carboxyl group with a compound of formula R 4 —OH [wherein R 4 has the same meanings as given above] using a coupling reagent in a solvent in the presence or absence of a base.
- the coupling reagent used in Method 2 is:
- a carbodiimide such as 1,3-dicyclohexylcarbodiimide, 1,3-diisopropylcarbodiimide or 1-ethyl-3-(3-dimethylaminopropyl) carbodiimide; a combination of the carbodiimide given above and a base as described below; a combination of the carbodiimide given above and an N-hydroxy compound such as N-hydroxysuccinimide, 1-hydroxybenzotriazole or N-hydroxy-5-norbornen-2,3-dicarboximide;
- a carbonate such as N,N′-disuccinimidyl carbonate, di-2-pyridyl carbonate or S,S′-bis(1-phenyl-1H-tetrazol-5-yl)dithiocarbonate;
- a phosphonic chloride such as N,N′-bis(2-oxo-3-oxazolidinyl)phosphinic chloride
- an oxalate such as N,N′-disuccinimidyl oxalate, N,N′-diphthalimide oxalate, N,N′-bis(5-norbornen-2,3-dicarboximidyl)oxalate, 1,1′-bis(benzotriazolyl)oxalate, 1,1′-bis(6-chlorobenzotriazolyl)oxalate or 1,1′-bis(6-trifluoromethylbenzotriazolyl)oxalate;
- an N-lower alkyl-5-arylisoxazolium-3′-sulfonate such as N-ethyl-5-phenylisoxazolium-3′-sulfonate
- a 2-halo-1-lower alkylpyridinium halide such as 2-chloro-1-methylpyridinium iodide
- a phosphate such as phenyl dichlorophosphate or an ester of polyphosphate
- a halosulfonyl isocyanate such as chlorosulfonyl isocyanate
- a halosilane such as trimethylsilyl chloride or triethylsilyl chloride
- N,N,N′,N′-tetra-lower alkyl-haloformamidium chloride such as N,N,N′,N′-tetra-methylchloroformamidium chloride.
- Preferred as coupling reagent is a carbodiimide, a combination of a phosphine and an ester of azodicarboxylic acid or an azodicarboxyamide.
- Suitable solvents include an aliphatic hydrocarbon such as hexane or heptane; an aromatic hydrocarbon such as benzene, toluene or xylene; a halogenated hydrocarbon such as methylene chloride, chloroform, carbon tetrachloride, dichloroethane, chlorobenzene or dichlorobenzene; an ester such as ethyl formate, ethyl acetate, propyl acetate, butyl acetate or diethyl carbonate, an ether such as diethyl ether, diisopropyl ether, tetrahydrofuran, dioxane, dimethoxyethane or di(ethylene glycol)dimethyl ether; a nitrile such as acetonitrile or isobutyronitrile; or
- Suitable bases include an organic base such as N-methylmorpholine, triethylamine, tributylamine, diisopropylethylamine, dicyclohexylamine, N-methylpiperidine, pyridine, 4-pyrrolidinopyridine, picoline, 4-(N,N-dimethylamino)pyridine, 2,6-di(tert-butyl)-4-methylpyridine, quinoline, N,N-dimethylaniline or N,N-diethylaniline.
- organic base such as N-methylmorpholine, triethylamine, tributylamine, diisopropylethylamine, dicyclohexylamine, N-methylpiperidine, pyridine, 4-pyrrolidinopyridine, picoline, 4-(N,N-dimethylamino)pyridine, 2,6-di(tert-butyl)-4-methylpyridine, quinoline, N,N-dimethylaniline or
- a catalytic amount of 4-(N,N-dimethylamino)pyridine or 4-pyrrolidinopyridine can be used in combination with another base.
- a dehydrating agent such as a molecular sieve; a quaternary ammonium salt such as benzyltriethylammonium chloride or tetrabutylammonium chloride; a crown ether such as dibenzo-18-crown-6; or a trapping agent of acid such as 3,4-dihydro-2H-pyrido[1,2-a]pyrimidin-2-one can be used in order to conduct the reaction effectively.
- the reaction temperature is between ⁇ 20° C. and 80° C. and preferably between 0° C. and room temperature.
- the reaction time depends mainly on the reaction temperature, starting materials, reagents and solvent used in this reaction and usually is in the range of 10 minutes to 3 days, preferably 30 minutes to 1 day.
- Method 3 is a process for the preparation of a compound having a lower alkyl group as a protective group of the carboxyl group.
- the process can be accomplished by reaction of a compound having a carboxyl group with an alcohol in a solvent in the presence of an acid catalyst at a temperature in the range of 0° C. to 100° C. (preferably 20° C. to 60° C.) for a reaction time in the range of 10 minutes to 24 hours (preferably 15 minutes to 12 hours).
- Suitable solvents include the same alcohol used as a reagent of this reaction, an aliphatic hydrocarbon such as hexane or heptane; an aromatic hydrocarbon such as benzene, toluene or xylene; a halogenated hydrocarbon such as methylene chloride, chloroform, carbon tetrachloride, dichloroethane, chlorobenzene or dichlorobenzene; an ether such as diethyl ether, diisopropyl ether, tetrahydrofuran, dioxane, dimethoxyethane or di(ethylene glycol)dimethyl ether; a ketone such as acetone, methyl ethyl ketone, methyl isobutyl ketone, isophorone or cyclohexanone; a nitrile such
- Suitable acid catalysts include a Br ⁇ nsted acid, for example, an inorganic acid such as hydrogen chloride, hydrobromic acid, sulfuric acid, perchloric acid or phosphoric acid; or an organic acid such as acetic acid, formic acid, oxalic acid, methanesulfonic acid, para-toluenesulfonic acid, trifluoroacetic acid or trifluoromethanesulfonic acid; a Lewis acid such as boron trichloride, boron trifluoride or boron tribromide; or an acidic ion-exchange resin. More suitable as acid catalyst is an inorganic acid and most suitable is hydrogen chloride.
- the alcohol used in Method 3 as a reagent is methanol, ethanol, propanol or butanol.
- Method 4 The process in Method 4 can be accomplished by:
- a base for example triethylamine
- Suitable solvents include an aromatic hydrocarbon such as benzene, toluene or xylene; a halogenated hydrocarbon such as methylene chloride or chloroform; an ester such as ethyl acetate or propyl acetate; an ether such as diethyl ether, tetrahydrofuran, dioxane or dimethoxyethane; or a nitrile such as acetonitrile.
- aromatic hydrocarbon such as benzene, toluene or xylene
- a halogenated hydrocarbon such as methylene chloride or chloroform
- an ester such as ethyl acetate or propyl acetate
- an ether such as diethyl ether, tetrahydrofuran, dioxane or dimethoxyethane
- a nitrile such as acetonitrile.
- the process in Method 5 can be accomplished by reaction of a compound having a carboxyl group with a diazoalkane such as diazomethane or diazoethane (a solution of diazoalkane in ether) at room temperature (in some cases, if necessary, the reaction may be conducted by heating).
- a diazoalkane such as diazomethane or diazoethane (a solution of diazoalkane in ether)
- Method 6 is a process for the preparation of a compound having a lower alkyl group as a protective group of the carboxyl group.
- the process can be accomplished by reaction of a compound having a carboxyl group with a dialkyl sulfate such as dimethyl sulfate or diethyl sulfate by conventional procedure.
- the desired compound of formula (VI) can be isolated from the reaction mixture by conventional procedure.
- the reaction mixture is neutralized appropriately or precipitates, if present, are removed by filtration, and the neutralized reaction mixture or the filtrate of the reaction mixture is partitioned between an organic solvent such as ethyl acetate that is immiscible with water and water or the like.
- the separated organic layer containing the desired compound is washed with water, dried over anhydrous magnesium sulfate or the like and concentrated to give the desired product.
- the product thus obtained can, if necessary, be isolated and purified by conventional techniques such as recrystallization, reprecipitation or procedures that are usually used for the isolation and purification of the organic compounds.
- procedures mentioned above include adsorption column chromatography using a stationary phase such as silica gel, alumina or florisil composed of magnesium-silica gel; partition column chromatography using a synthetic adsorbent such as Sephadex LH-20 (a product of Pharmacia Co., Ltd.), Amberlite XAD-11 (a product of Rohm & Haas Co., Ltd) or Diaion HP-20 (a product of Mitsubishi Chemical Corporation); ion-exchange chromatography; normal and reversed phase liquid chromatography using silica gel or alkylated silica gel (high performance liquid chromatography is preferred); or a suitable combination of these procedures, and the desired compound can be isolated and purified by eluting with appropriate solvent from the column used.
- each of the isomers can be separated at an appropriate stage such as the end of each step mentioned above or the end of a desired step by performing the suitable separation/purification procedure mentioned above or the combination thereof.
- Step 3 is a process for the preparation of a compound of formula (II), which process comprises a nitration reaction of the 7-position of a compound of formula VI in a solvent.
- nitration reaction is a method using nitric acid, sodium nitrate or fuming nitric acid as nitrating agent and more preferably using fuming nitric acid.
- Suitable as solvent is an acid such as acetic acid, sulfuric acid or a mixture of acetic acid and sulfuric acid and more suitable is a mixture of acetic acid and sulfuric acid.
- the reaction temperature of Step 3 is between ⁇ 20° C. and 30° C. and preferably between ⁇ 10° C. and 20° C.
- the reaction time of Step 3 depends mainly on the reaction temperature, starting materials and solvent used in this reaction and usually is in the range of 0.5 hours to 5 hours, preferably 1 hour to 3 hours.
- the desired compound of formula (II) can be isolated from the reaction mixture by conventional procedure.
- the reaction mixture is neutralized appropriately or precipitates, if present, are removed by filtration, and the neutralized reaction mixture or the filtrate of the reaction mixture is partitioned between an organic solvent such as ethyl acetate that is immiscible with water and water or the like.
- the separated organic layer containing the desired compound is washed with water, dried over anhydrous magnesium sulfate or the like and concentrated to give the desired product.
- the product thus obtained can, if necessary, be isolated and purified by conventional techniques such as recrystallization, reprecipitation or procedures that are usually used for the isolation and purification of the organic compounds.
- the procedures mentioned above include adsorption column chromatography using a stationary phase such as silica gel, alumina or florisil composed of magnesium-silica gel; partition column chromatography using a synthetic adsorbent such as Sephadex LH-20 (a product of Pharmacia Co., Ltd.), Amberlite XAD-11 (a product of Rohm & Haas Co., Ltd) or Diaion HP20 (a product of Mitsubishi Chemical Corporation); ion-exchange chromatography; normal and reversed phase liquid chromatography using silica gel or alkylated silica gel (high performance liquid chromatography is preferred); or a suitable combination of these procedures, and the desired compound can be isolated and purified by eluting with appropriate solvent from the column used.
- each of the isomers can be separated at an appropriate stage such as the end of each step mentioned above or the end of a desired step by performing the suitable separation/purification procedure mentioned above or the combination thereof.
- Step 4 a compound (VII) is prepared by reducing the nitro group of compound (II) in a solvent.
- solvent used in the reaction there is no limitation on the solvent used in the reaction provided that it has no adverse effect on the reaction and dissolves the starting materials at least to some extent.
- preferable solvents include an ester such as ethyl formate, ethyl acetate, propyl acetate, butyl acetate or diethyl carbonate; an alcohol such as methanol, ethanol, n-propanol, isopropanol, n-butanol, isobutanol, t-butanol, isoamyl alcohol, diethylene glycol, glycerol, octanol, cyclohexanol or methyl cellosolve; or a mixture of solvents thereof.
- ethyl acetate, ethanol or mixtures of solvents mentioned above are more preferred.
- reduction catalysts used in the catalytic hydrogenation include palladium on charcoal, platinum, platinum on charcoal, platinum oxide, palladium hydroxide and Raney nickel, and palladium on charcoal is more preferred.
- the catalytic hydrogenation is usually carried out at a pressure of from 1 to 10 atmospheres.
- the reaction temperature is usually between 20° C. and 80° C., and is preferably from 40° C. to 60° C.
- the reaction time depends mainly on the reaction temperature, starting materials and nature of the solvent used in the reaction.
- the reaction time is usually from 0.5 to 10 hours, and is preferably from 1 to 5 hours.
- reaction mixture is neutralized appropriately or precipitates, if present, are removed by filtration, and the neutralized reaction mixture or the filtrate of the reaction mixture is partitioned between an organic solvent such as ethyl acetate that is immiscible with water and water or the like.
- organic solvent such as ethyl acetate that is immiscible with water and water or the like.
- the separated organic layer containing the desired compound is washed with water, dried over anhydrous magnesium sulfate or the like and concentrated to give the desired product.
- the product thus obtained can, if necessary, be isolated and purified by conventional techniques such as recrystallization, reprecipitation or procedures that are usually used for the isolation and purification of the organic compounds.
- Examples of the procedure mentioned above include adsorption column chromatography using a stationary phase such as silica gel, alumina or florisil composed of magnesium-silica gel; partition column chromatography using a synthetic adsorbent such as Sephadex LH-20 (a product of Pharmacia Co., Ltd.), Amberlite XAD-11 (a product of Rohm & Haas Co., Ltd) or Diaion HP-20 (a product of Mitsubishi Chemical Corporation); ion-exchange chromatography; normal and reversed phase liquid chromatography using silica gel or alkylated silica gel (high performance liquid chromatography is preferred); or a suitable combination of these procedures, and the desired compound can be isolated and purified by eluting with appropriate solvent from the column used.
- each of the isomers can be separated at an appropriate stage such as the end of each step mentioned above or the end of a desired step by performing the suitable separation/purification procedure mentioned above or the combination thereof.
- Step 5 a compound (VIII) is prepared by conducting a pivaloylation of the amino group of compound (VII) in the presence of a base in a solvent.
- reagent for pivaloylation used in the reaction provided that it is usually used in pivaloylation reactions.
- preferable reagents used in this reaction include a pivaloyl halide such as pivaloyl chloride and pivalic anhydride. Of these reagents, pivaloyl halide is more preferred, and pivaloyl chloride is most preferred.
- bases include an alkali metal hydroxide such as sodium hydroxide, potassium hydroxide, barium hydroxide or lithium hydroxide; and an organic amine such as N-methylmorpholine, triethylamine, tripropylamine, tributylamine, diisopropylamine, diisopropylethylamine, dicyclohexylamine, N-methylpiperidine, pyridine, 4-pyrrolidinopyridine, picoline, 4-(N,N-dimethylamino)pyridine, 2,6-di-t-butyl-4-methylpyridine, quinoline, N,N-dimethylaniline, N,N-diethylaniline, 1,5-diazabicyclo[4.3.0]non-5-ene (DBN), 1,4-diazabicyclo[2.2.2]octane (DABCO) or 1,
- solvent used in the reaction there is no limitation on the solvent used in the reaction provided that it has no adverse effect on the reaction and dissolves the starting materials at least to some extent.
- preferable solvents include a halogenated hydrocarbon such as dichloromethane, chloroform, carbon tetrachloride, dichloroethane, chlorobenzene or dichlorobenzene; an ester such as ethyl formate, methyl acetate, ethyl acetate, propyl acetate, butyl acetate or diethyl carbonate; a nitrile such as acetonitrile or isobutyronitrile; and an alcohol such as methanol, ethanol, n-propanol, isopropanol, n-butanol, isobutanol, t-butanol, isoamyl alcohol, diethylene glycol, glycerol, octanol, cyclohexanol or methyl cell
- the reaction temperature is usually between ⁇ 10° C. and 20° C., and is preferably between 0° C. and 10° C.
- the reaction time depends mainly on the reaction temperature, starting materials and base or solvent used in the reaction.
- the reaction time is usually from 0.5 to 4 hours, and is preferably from 0.5 to 2 hours.
- reaction mixture is neutralized appropriately or precipitates, if present, are removed by filtration, and the neutralized reaction mixture or the filtrate of the reaction mixture is partitioned between an organic solvent such as ethyl acetate that is immiscible with water and water or the like.
- organic solvent such as ethyl acetate that is immiscible with water and water or the like.
- the separated organic layer containing the desired compound is washed with water, dried over anhydrous magnesium sulfate or the like and concentrated to give the desired product.
- the product thus obtained can, if necessary, be isolated and purified by conventional techniques such as recrystallization, reprecipitation or procedures that are usually used for the isolation and purification of the organic compounds.
- Examples of the procedure mentioned above include adsorption column chromatography using a stationary phase such as silica gel, alumina or florisil composed of magnesium-silica gel; partition column chromatography using a synthetic adsorbent such as Sephadex LH-20 (a product of Pharmacia Co., Ltd.), Amberlite XAD-11 (a product of Rohm & Haas Co., Ltd.) or Diaion HP-20 (a product of Mitsubishi Chemical Corporation); ion-exchange chromatography; normal and reversed phase liquid chromatography using silica gel or alkylated silica gel (high performance liquid chromatography is preferred); or a suitable combination of these procedures, and the desired compound can be isolated and purified by elution with appropriate solvent from the column used.
- each of the isomers can be separated at an appropriate stage such as the end of each step mentioned above or the end of a desired step by performing the suitable separation/purification procedure mentioned above or the combination thereof.
- Step 6 a compound (IX) is prepared by removing the amino-protective group, R 1 , of the compound (VIII) in a solvent.
- the deprotection reaction is usually carried out by treating with a compound that generates a fluorine anion, such as tetrabutylammonium fluoride.
- solvent used in the above-mentioned reaction there is no limitation on the solvent used in the above-mentioned reaction provided that it has no adverse effect on the reaction.
- preferable solvents include an ether such as tetrahydrofuran or dioxane.
- reaction temperature There is no limitation on the reaction temperature and the reaction time is not particularly limited. However, the deprotection reaction is usually carried out at room temperature for a period of from 10 to 18 hours.
- R 1 group is an aliphatic acyl group, an aromatic acyl group or an alkoxycarbonyl group, those can be removed by treating with an acid or a base in the presence of a solvent.
- acid used in the above-mentioned reaction there is no limitation on the acid used in the above-mentioned reaction provided that it is usually used as an acid and has no adverse effect on the reaction.
- preferable acids include an inorganic acid such as hydrochloric acid, sulfuric acid, phosphoric acid, hydrobromic acid, hydrogen chloride or hydrogen bromide. Hydrogen chloride is most preferred.
- preferable bases include an alkali metal alkoxide such as sodium methoxide, sodium ethoxide, potassium methoxide, potassium ethoxide, potassium t-butoxide, lithium methoxide or lithium ethoxide; an alkali metal carbonate such as sodium carbonate, potassium carbonate or lithium carbonate; an alkali metal hydroxide such as sodium hydroxide, potassium hydroxide or lithium hydroxide; or an ammonia solution such as ammonia aqueous solution or concentrated ammonia solution in methanol.
- An alkali metal alkoxide is most preferred.
- solvents include water; an organic solvent including an aromatic hydrocarbon such as benzene, toluene or xylene; an alcohol such as methanol, ethanol or n-propanol; an ether such as tetrahydrofuran or dioxane; an ester such as ethyl formate, methyl acetate, ethyl acetate, propyl acetate, butyl acetate or diethyl carbonate; or a mixed solvent such as mixtures of organic solvents or mixtures of water and one or more organic solvents thereof.
- an organic solvent including an aromatic hydrocarbon such as benzene, toluene or xylene an alcohol such as methanol, ethanol or n-propanol
- an ether such as tetrahydrofuran or dioxane
- an ester such as ethyl formate, methyl acetate, ethyl acetate, propyl acetate, butyl a
- preferable solvent used in the treatment with inorganic acid include mixtures of organic solvents selected from aromatic hydrocarbons, alcohols and esters listed above. Mixtures of organic solvents selected from alcohols and esters are more preferred, and a mixture of ethanol and butyl acetate is most preferred.
- the reaction temperature and the reaction time mainly depend on the starting materials, solvent and acid or base used in the reaction, but are not particularly limited.
- the deprotection reaction is usually carried out at a temperature of from 0° C. to 150° C. for a period of from 1 to 20 hours in order to minimize the occurrence of side reactions.
- the protective group is usually and preferably removed by treating with a reducing agent in a solvent (preferably by a catalytic hydrogenation with catalyst at room temperature) or by treating with an oxidizing agent.
- solvents used in the deprotection reaction by the catalytic hydrogenation there is no limitation on the solvent used in the deprotection reaction by the catalytic hydrogenation provided that it has no adverse effect on the reaction.
- preferable solvents include an alcohol such as methanol, ethanol or isopropanol; an ether such as diethyl ether, tetrahydrofuran or dioxane; an aromatic hydrocarbon such as toluene, benzene or xylene; an aliphatic hydrocarbon such as hexane or cyclohexane; an ester such as ethyl acetate or propyl acetate; an aliphatic acid such as acetic acid; or a mixture of water and one or more organic solvents thereof.
- an alcohol such as methanol, ethanol or isopropanol
- an ether such as diethyl ether, tetrahydrofuran or dioxane
- an aromatic hydrocarbon such as tolu
- catalyst used in the deprotection reaction there is no limitation on the catalyst used in the deprotection reaction provided that it is usually used in catalytic hydrogenation reactions.
- preferable catalysts used in the catalytic hydrogenation include palladium on charcoal, Raney nickel, platinum oxide, platinum black, rhodium-aluminium oxide, triphenylphosphine-rhodium chloride and palladium-barium sulfate.
- the pressure in the catalytic hydrogenation is not particularly limited, but the deprotection by the catalytic hydrogenation is usually carried out at a pressure of from 1 to 10 atmospheres.
- the reaction temperature and the reaction time mainly depend on the starting materials, nature of the catalyst and solvent used in the reaction.
- the deprotection reaction is usually carried out at a temperature of from 0° C. to 100° C. for a period of from 5 minutes to 24 hours.
- Examples of the preferable organic solvent used in this reaction include a ketone such as acetone; a halogenated hydrocarbon such as dichloromethane, chloroform or carbon tetrachloride; a nitrile such as acetonitrile; an ether such as diethyl ether, tetrahydrofuran or dioxane; an amide such as dimethylformamide, dimethylacetamide or hexamethylphosphoric triamide; or a sulfoxide such as dimethyl sulfoxide.
- a ketone such as acetone
- a halogenated hydrocarbon such as dichloromethane, chloroform or carbon tetrachloride
- a nitrile such as acetonitrile
- an ether such as diethyl ether, tetrahydrofuran or dioxane
- an amide such as dimethylformamide, dimethylacetamide or hexamethylphosphoric triamide
- the oxidizing agent used in this reaction is not particularly limited provided that it is usually used for oxidation reactions.
- Examples of the preferable oxidizing agents used in this reaction include potassium persulfate, sodium persulfate, ammonium cerium nitrate (CAN) and 2,3-dichloro-5,6-dicyano-p-benzoquinone (DDQ).
- the reaction temperature and the reaction time mainly depend on the starting materials, the nature of the oxidizing agent or the solvent used in the reaction.
- the deprotection reaction is usually carried out at a temperature of from 0° C. to 150° C. for a period of from 10 minutes to 24 hours.
- the deprotection reaction is usually carried out by treating with a base under the same reaction conditions as that described for the deprotection of the amino group protected with the aliphatic acyl group, the aromatic acyl group or the alkoxycarbonyl group.
- R 1 group is an allyloxycarbonyl group
- the deprotection is commonly carried out using palladium/triphenylphosphine or nickel tetracarbonyl, since this deprotection procedure is simple and the occurrence of side reactions can be prevented.
- reaction mixture is neutralized appropriately or precipitates, if present, are removed by filtration, and the neutralized reaction mixture or the filtrate of the reaction mixture is partitioned between an organic solvent such as ethyl acetate that is immiscible with water and water or the like.
- organic solvent such as ethyl acetate that is immiscible with water and water or the like.
- the separated organic layer containing the desired compound is washed with water, dried over anhydrous magnesium sulfate or the like and concentrated to give the desired product.
- the product thus obtained can, if necessary, be isolated and purified by conventional techniques such as recrystallization, reprecipitation or procedures that are usually used for the isolation and purification of the organic compounds.
- Examples of the procedure mentioned above include adsorption column chromatography using a stationary phase such as silica gel, alumina or florisil composed of magnesium-silica gel; partition chromatography using a synthetic adsorbent such as Sephadex LH-20 (a product of Pharmacia Co., Ltd.), Amberlite XAD-11 (a product of Rohm & Haas Co., Ltd.) or Diaion HP-20 (a product of Mitsubishi Chemical Corporation); ion-exchange chromatography; normal and reversed phase liquid chromatography using silica gel or alkylated silica gel (high performance liquid chromatography is preferred); or a suitable combination of these procedures, and the desired compound can be isolated and purified by elution with appropriate solvent from the column used.
- each of the isomers can be separated at an appropriate stage such as the end of each step mentioned above or the end of a desired step by performing the suitable separation/purification procedure mentioned above or combination thereof.
- Step 7 a compound (III) is prepared by octylation of the amino group of compound (IX) in the presence of a base in a solvent.
- reagent for octylation there is no limitation on the reagent for octylation provided that it is usually used in octylation reactions.
- examples of preferable reagents used in this reaction include an octyl halide such as octyl chloride, octyl bromide or octyl iodide. Octyl bromide is more preferred.
- bases include an alkali metal carbonate such as sodium carbonate, potassium carbonate or lithium carbonate; an alkali metal bicarbonate such as sodium bicarbonate, potassium bicarbonate or lithium bicarbonate; an alkali metal hydride such as lithium hydride, sodium hydride or potassium hydride; a metal alkoxide such as sodium methoxide, sodium ethoxide, potassium methoxide, potassium ethoxide, potassium t-butoxide, lithium methoxide or lithium ethoxide; or an organic base such as N-methylmorpholine, triethylamine, tripropylamine, tributylamine, diisopropylethylamine, dicyclohexylamine, N-methylpiperidine, pyridine, 4-pyrrolidinopyridine, picoline, 4-(N,N-dimethylamino)pyridine, 2,6-
- solvents include an aromatic hydrocarbon such as benzene, toluene or xylene; an ester such as ethyl formate, methyl acetate, ethyl acetate, propyl acetate, butyl acetate or diethyl carbonate; an amide such as formamide, N,N-dimethylformamide, N,N-dimethylacetamide, N-methyl-2-pyrrolidone, N-methylpyrrolidinone, or hexamethylphosphoric triamide; or a sulfoxide such as dimethyl sulfoxide or sulfolane.
- aromatic hydrocarbons or esters are more preferred, further butyl acetate, toluene and xylene are still more preferred, and butyl acetate or xylene is most preferred.
- the reaction temperature is usually from 0° C. to 160° C., and is preferably from 100° C. to 150° C.
- the reaction time depends mainly on the reaction temperature, starting materials, and nature of the base or solvent used in the reaction.
- the reaction time is usually from 2 hours to one day and preferably from 4 hours to 10 hours.
- reaction mixture is neutralized appropriately or precipitates, if present, are removed by filtration, and the neutralized reaction mixture or the filtrate of the reaction mixture is partitioned between an organic solvent such as ethyl acetate that is immiscible with water and water or the like.
- organic solvent such as ethyl acetate that is immiscible with water and water or the like.
- the separated organic layer containing the desired compound is washed with water, dried over anhydrous magnesium sulfate or the like and concentrated to give the desired product.
- the product thus obtained can, if necessary, be isolated and purified by conventional techniques such as recrystallization, reprecipitation or procedures that are usually used for the isolation and purification of the organic compounds.
- Examples of the procedure mentioned above include adsorption column chromatography using a stationary phase such as silica gel, alumina or florisil composed of magnesium-silica gel; partition column chromatography using a synthetic adsorbent such as Sephadex LH-20 (a product of Pharmacia Co., Ltd.), Amberlite XAD-11 (a product of Rohm & Haas Co., Ltd.) or Diaion HP-20 (a product of Mitsubishi Chemical Corporation); ion-exchange chromatography; normal and reversed phase liquid chromatography using silica gel or alkylated silica gel (high performance liquid chromatography is preferred); or a suitable combination of these procedures, and the desired compound can be isolated and purified by elution with appropriate solvent from the column used.
- each of the isomers can be separated at an appropriate stage such as the end of each step mentioned above or the end of a desired step by performing the suitable separation/purification procedure mentioned above or combination thereof.
- Step 8 a compound (1) that is a compound useful as an ACAT inhibitor is prepared by removing the R 4 group of the compound (III) and then converting to a sulfate derivative.
- the deprotection reaction is usually carried out by treating with an acid or a base.
- Examples of preferable acids used in the above-mentioned reaction include hydrochloric acid, sulfuric acid, phosphoric acid or hydrobromic acid.
- preferable bases include an alkali metal carbonate such as sodium carbonate or potassium carbonate; an organic base such as diisopropylethylamine; alkali metal hydroxides such as sodium hydroxide or potassium hydroxide; or concentrated ammonia solution in methanol.
- solvent used in the above-mentioned reaction there is no limitation on the solvent used in the above-mentioned reaction provided that it is usually used in hydrolysis reactions and has no adverse effect on the reaction.
- preferable solvents include water or a mixture of water and one or more organic solvents including an alcohol such as methanol, ethanol or n-propanol or an ether such as tetrahydrofuran or dioxane.
- the reaction temperature and the reaction time depend mainly on starting materials, solvent and reagent used in the reaction, but are not particularly limited.
- the deprotection reaction is usually carried out at a temperature of from 0° C. to 150° C. for a period of from 1 to 10 hours in order to minimize the occurrence of side reactions.
- R 4 group is a diaryl-substituted methyl group such as diphenylmethyl group
- the deprotection reaction is usually carried out by treating with an acid in a solvent.
- Examples of preferable solvents used in the above-mentioned reaction include an aromatic hydrocarbon such as anisole.
- examples of preferable acids used in the above-mentioned reaction include a fluorinated organic acid such as trifluoroacetic acid.
- the reaction temperature and the reaction time depend mainly on starting materials, solvent and acid used in the reaction.
- the reaction is usually carried out at room temperature for a period of from 30 minutes to 10 hours.
- the deprotection reaction is usually carried out by a reduction reaction in a solvent.
- the protective group of the carboxyl group is a halogeno lower alkyl group
- a chemical reduction such as a reduction reaction using zinc-acetic acid is preferable as the deprotection reaction.
- the protective group of the carboxyl group is an aralkyl group
- the deprotection is preferably carried out by conducting either a catalytic hydrogenation using catalysts such as palladium on charcoal or platinum or a chemical reduction using an alkali metal sulfide such as potassium sulfide or sodium sulfide.
- solvent used in the above-mentioned reaction there is no limitation on the solvent used in the above-mentioned reaction provided that it has no adverse effect on the reaction.
- preferable solvent include an alcohol such as methanol or ethanol; an ether such as tetrahydrofuran or dioxane; an aliphatic acid such as acetic acid; or a mixture of water and one or more organic solvents thereof.
- the reaction temperature and the reaction time depend mainly on starting materials, solvent and reducing procedure used in the reaction.
- the deprotection reaction is usually carried out at a temperature of from 0° C. to room temperature for a period of from 5 minutes to 12 hours.
- the protective group is usually removed by treating with an acid in a solvent.
- Br ⁇ nsted acid there is no limitation on the acid used in this reaction provided that it is usually used as a Br ⁇ nsted acid.
- preferable Br ⁇ nsted acids include an inorganic acid such as hydrochloric acid or sulfuric acid; and an organic acid such as acetic acid or p-toluenesulfonic acid.
- solvents used in the above-mentioned reaction there is no limitation on the solvent used in the above-mentioned reaction provided that it has no adverse effect on the reaction.
- preferable solvents include an alcohol such as methanol or ethanol; an ether such as tetrahydrofuran or dioxane; or a mixture of water and one or more organic solvents thereof.
- the reaction temperature and the reaction time depend mainly on starting materials, solvent and nature of the acid used in the reaction.
- the deprotection reaction is usually carried out at a temperature of from 0° C. to 50° C. for a period of from 10 minutes to 18 hours.
- the compound (1) that is the desired product of this reaction is isolated from the reaction mixture using conventional techniques.
- reaction mixture is neutralized appropriately or precipitates, if present, are removed by filtration, and the neutralized reaction mixture or the filtrate of the reaction mixture is partitioned between an organic solvent such as ethyl acetate that is immiscible with water and water or the like.
- organic solvent such as ethyl acetate that is immiscible with water and water or the like.
- the separated organic layer containing the desired compound is washed with water, dried over anhydrous magnesium sulfate or the like and concentrated to give the desired product.
- the product thus obtained can, if necessary, be isolated and purified by conventional techniques such as recrystallization, reprecipitation or procedures that are usually used for the isolation and purification of the organic compounds.
- Examples of the procedure mentioned above include adsorption column chromatography using a stationary phase such as silica gel, alumina or florisil composed of magnesium-silica gel; partition column chromatography using a synthetic adsorbent such as Sephadex LH-20 (a product of Pharmacia Co., Ltd.), Amberlite XAD-11 (a product of Rohm & Haas Co., Ltd.) or Diaion HP-20 (a product of Mitsubishi Chemical Corporation); ion-exchange chromatography; normal and reversed phase liquid chromatography using silica gel or alkylated silica gel (high performance liquid chromatography is preferred); or a suitable combination of these procedures, and the desired compound can be isolated and purified by elution with appropriate solvent from the column used.
- novel intermediates of this invention are useful products for manufacturing the above-mentioned indoline derivatives (1) having excellent ACAT inhibitory activity, and the novel manufacturing methods of this invention are superior to the publicly known conventional methods in respect of several points described below.
- productivity such as being able to shorten working time (about 2 ⁇ 3), can be increased
- reaction conditions can be greatly relaxed, such as by lowering the concentration of aqueous sodium hydroxide solution in the last step of preparing the carboxylic acid compound, and
- Crystals precipitated were separated by filtration, washed with water (800 ml) and dried under reduced pressure (for more than 10 hours at 40° C.). At the end of this time, the dried crystals were taken out from the dryer and ground well and then further dried under reduced pressure (for more than 10 hours at 40° C.) to afford the title compound (59.8 g, yield: 86%) as colourless crystals.
- the title compound was obtained as colourless crystals (yield: 82%) in similar manner to that mentioned in Example 2, using a saturated solution of hydrogen chloride in methanol as the reaction solvent in the place of the saturated solution of hydrogen chloride in ethanol.
- the title compound was obtained as colourless crystals (yield: 93%) in similar manner to that mentioned in Example 2, using a saturated solution of hydrogen chloride in n-propyl alcohol as the reaction solvent in the place of the saturated solution of hydrogen chloride in ethanol.
- Example 8 The title compound was obtained as crystals in 98% yield in a similar manner to that mentioned in Example 9, using 1-acetyl-7-amino-5-methoxycarbonylmethyl-4,6-dimethylindoline obtained in Example 8 as the starting material.
- the separated organic layer was furthermore washed twice with water (28 ml each) and concentrated in vacuo until the volume of xylene was reduced to about 6 ml to give a solution of the title compound in xylene.
- To a mixture of the solution of the title compound in xylene and 90% aqueous ethanol solution (28 ml) was added sodium hydroxide (1.66 g, 5.0 equivalent), and the resulting mixture was stirred for 1 hour at the reaction temperature of 80° C. After cooling to below 30° C., water (15.5 ml) was added, and the resulting mixture was concentrated in vacuo until the volume of the solution was reduced to 18 ml.
- Example 15 To a solution of hydrogen chloride (665 g) in ethanol (2000 ml) was added (1-acetyl-4,6-dimethylindolin-5-yl)acetic acid obtained in Example 15 (150 g), and the resulting mixture was stirred for 30 minutes at 45–50° C., and then an ethanol fraction containing hydrochloric acid (1000 ml) was evaporated off in vacuo.
- reaction mixture was concentrated in vacuo to remove ethyl acetate, and to the residue were added xylene (400 ml), diisopropylethylamine (58 ml) and octyl bromide (46 ml) successively, and the resulting mixture was stirred for 18 hours at 120–130° C. After cooling, the reaction mixture was washed with 3% aqueous sulfuric acid solution twice (150 ml each) and 5% aqueous sodium hydroxide solution (150 ml) successively.
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Indole Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US11/221,003 US20060014965A1 (en) | 2001-02-02 | 2005-09-07 | Indoline derivative and process for producing the same |
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP2001026374 | 2001-02-02 | ||
| JP2001-026374 | 2001-02-02 | ||
| PCT/JP2002/000804 WO2002062758A1 (fr) | 2001-02-02 | 2002-02-01 | Derive d'indoline et son procede de preparation |
Related Parent Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PCT/JP2002/000804 Continuation WO2002062758A1 (fr) | 2001-02-02 | 2002-02-01 | Derive d'indoline et son procede de preparation |
Related Child Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US11/221,003 Division US20060014965A1 (en) | 2001-02-02 | 2005-09-07 | Indoline derivative and process for producing the same |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| US20040058979A1 US20040058979A1 (en) | 2004-03-25 |
| US7012147B2 true US7012147B2 (en) | 2006-03-14 |
Family
ID=18891202
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US10/635,040 Expired - Fee Related US7012147B2 (en) | 2001-02-02 | 2003-07-31 | Indoline derivative and process for producing the same |
| US11/221,003 Abandoned US20060014965A1 (en) | 2001-02-02 | 2005-09-07 | Indoline derivative and process for producing the same |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US11/221,003 Abandoned US20060014965A1 (en) | 2001-02-02 | 2005-09-07 | Indoline derivative and process for producing the same |
Country Status (17)
| Country | Link |
|---|---|
| US (2) | US7012147B2 (cs) |
| EP (1) | EP1364942A4 (cs) |
| KR (1) | KR20030071881A (cs) |
| CN (3) | CN1680318A (cs) |
| AU (1) | AU2002228404B2 (cs) |
| CA (1) | CA2437134A1 (cs) |
| CZ (1) | CZ20032102A3 (cs) |
| HU (1) | HUP0302858A3 (cs) |
| IL (1) | IL157127A0 (cs) |
| MX (1) | MXPA03006932A (cs) |
| NO (1) | NO20033432L (cs) |
| NZ (1) | NZ527271A (cs) |
| PL (1) | PL363528A1 (cs) |
| RU (2) | RU2252213C2 (cs) |
| SK (1) | SK9802003A3 (cs) |
| TW (1) | TW200600497A (cs) |
| WO (1) | WO2002062758A1 (cs) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US7332851B2 (en) * | 2004-09-29 | 2008-02-19 | Ngk Insulators, Ltd. | Piezoelectric/electrostrictive film type device and method of manufacturing the same |
| CN102641321B (zh) * | 2012-05-04 | 2013-12-18 | 乌兰托娅 | 治疗腰椎间盘突出和颈椎骨质增生的中药及其制备方法 |
Citations (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3679701A (en) * | 1970-12-04 | 1972-07-25 | Jackson B Hester Jr | 7-benzoyl indolines |
| WO1997012860A1 (fr) | 1995-10-05 | 1997-04-10 | Kyoto Pharmaceutical Industries, Ltd. | Nouveaux derives heterocycliques et leur utilisation medicinale |
| EP0782986A1 (en) | 1994-09-20 | 1997-07-09 | Kyoto Pharmaceutical Industries, Ltd. | Novel heterocyclic derivatives, process for producing the same, and medicinal use thereof |
| JP2002047269A (ja) * | 2000-08-01 | 2002-02-12 | Kyoto Pharmaceutical Industries Ltd | ヘテロ環化合物の製造方法およびその中間体 |
| US20020055533A1 (en) * | 2000-09-01 | 2002-05-09 | Sankyo Company, Limited | Pharmaceutical composition |
| WO2002072147A1 (fr) * | 2001-03-14 | 2002-09-19 | Sankyo Company, Limited | Compositions medicinales contenant un inhibiteur de transporteur d'acide biliaire |
| WO2003084572A1 (fr) * | 2002-04-05 | 2003-10-16 | Sankyo Company, Limited | Composition médicale comprenant un inhibiteur de l'acat et agent améliorant la résistance à l'insuline |
| WO2004009119A1 (ja) * | 2002-07-18 | 2004-01-29 | Sankyo Company, Limited | 動脈硬化症治療のための医薬組成物 |
| US6765014B1 (en) * | 1999-03-18 | 2004-07-20 | Medical Research Council | 1-Acyl-7-nitroindoline derivatives, their preparation and their use as photocleavable precursors |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US14740A (en) * | 1856-04-22 | sibley | ||
| GB726078A (en) * | 1952-02-08 | 1955-03-16 | Ciba Ltd | Manufacture of indolines |
| DE1169450B (de) * | 1960-08-19 | 1964-05-06 | Hoechst Ag | Verfahren zur Herstellung von Indolinderivaten und deren Salzen |
| US5068234A (en) * | 1990-02-26 | 1991-11-26 | Sterling Drug Inc. | 3-arylcarbonyl-1-(c-attached-n-heteryl)-1h-indoles |
| SG55351A1 (en) * | 1996-07-17 | 1998-12-21 | Asahi Chemical Ind | Photosensitive resin composition for photocast-molding |
| US6083806A (en) * | 1998-07-06 | 2000-07-04 | Motorola, Inc. | Method of forming an alignment mark |
| DE19853558A1 (de) * | 1998-11-20 | 2000-05-31 | Aventis Res & Tech Gmbh & Co | Verfahren zur Herstellung von 2,3-Dihydroindolen (Indolinen), neuartige 2,3-Dihydroindole sowie deren Verwendung |
-
2002
- 2002-01-31 TW TW094130986A patent/TW200600497A/zh unknown
- 2002-02-01 PL PL02363528A patent/PL363528A1/xx not_active Application Discontinuation
- 2002-02-01 NZ NZ527271A patent/NZ527271A/en unknown
- 2002-02-01 EP EP02710441A patent/EP1364942A4/en not_active Withdrawn
- 2002-02-01 WO PCT/JP2002/000804 patent/WO2002062758A1/ja not_active Application Discontinuation
- 2002-02-01 IL IL15712702A patent/IL157127A0/xx unknown
- 2002-02-01 HU HU0302858A patent/HUP0302858A3/hu unknown
- 2002-02-01 RU RU2003124060/04A patent/RU2252213C2/ru not_active IP Right Cessation
- 2002-02-01 CN CNA2005100649713A patent/CN1680318A/zh active Pending
- 2002-02-01 RU RU2005101336/04A patent/RU2283304C1/ru not_active IP Right Cessation
- 2002-02-01 CA CA002437134A patent/CA2437134A1/en not_active Abandoned
- 2002-02-01 CN CN028078837A patent/CN1216863C/zh not_active Expired - Fee Related
- 2002-02-01 KR KR10-2003-7010212A patent/KR20030071881A/ko not_active Withdrawn
- 2002-02-01 SK SK980-2003A patent/SK9802003A3/sk not_active Application Discontinuation
- 2002-02-01 CN CNA2005100649732A patent/CN1680317A/zh active Pending
- 2002-02-01 CZ CZ20032102A patent/CZ20032102A3/cs unknown
- 2002-02-01 MX MXPA03006932A patent/MXPA03006932A/es unknown
- 2002-02-01 AU AU2002228404A patent/AU2002228404B2/en not_active Ceased
-
2003
- 2003-07-31 US US10/635,040 patent/US7012147B2/en not_active Expired - Fee Related
- 2003-08-01 NO NO20033432A patent/NO20033432L/no not_active Application Discontinuation
-
2005
- 2005-09-07 US US11/221,003 patent/US20060014965A1/en not_active Abandoned
Patent Citations (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3679701A (en) * | 1970-12-04 | 1972-07-25 | Jackson B Hester Jr | 7-benzoyl indolines |
| EP0782986A1 (en) | 1994-09-20 | 1997-07-09 | Kyoto Pharmaceutical Industries, Ltd. | Novel heterocyclic derivatives, process for producing the same, and medicinal use thereof |
| US5990150A (en) | 1994-09-20 | 1999-11-23 | Sankyo Company, Ltd. | Heterocyclic derivatives, method of production thereof and pharmaceutical use thereof |
| WO1997012860A1 (fr) | 1995-10-05 | 1997-04-10 | Kyoto Pharmaceutical Industries, Ltd. | Nouveaux derives heterocycliques et leur utilisation medicinale |
| EP0866059A1 (en) | 1995-10-05 | 1998-09-23 | Kyoto Pharmaceutical Industries, Ltd. | Novel heterocyclic derivatives and medicinal use thereof |
| US6063806A (en) | 1995-10-05 | 2000-05-16 | Kyoto Pharmaceutical Industries, Ltd. | Indolyl or indolinyl derivatives and medicinal use thereof as ACAT or lipid peroxidation inhibitors |
| US6765014B1 (en) * | 1999-03-18 | 2004-07-20 | Medical Research Council | 1-Acyl-7-nitroindoline derivatives, their preparation and their use as photocleavable precursors |
| JP2002047269A (ja) * | 2000-08-01 | 2002-02-12 | Kyoto Pharmaceutical Industries Ltd | ヘテロ環化合物の製造方法およびその中間体 |
| US20020055533A1 (en) * | 2000-09-01 | 2002-05-09 | Sankyo Company, Limited | Pharmaceutical composition |
| WO2002072147A1 (fr) * | 2001-03-14 | 2002-09-19 | Sankyo Company, Limited | Compositions medicinales contenant un inhibiteur de transporteur d'acide biliaire |
| WO2003084572A1 (fr) * | 2002-04-05 | 2003-10-16 | Sankyo Company, Limited | Composition médicale comprenant un inhibiteur de l'acat et agent améliorant la résistance à l'insuline |
| WO2004009119A1 (ja) * | 2002-07-18 | 2004-01-29 | Sankyo Company, Limited | 動脈硬化症治療のための医薬組成物 |
Non-Patent Citations (1)
| Title |
|---|
| Kamiya, S., et al., "Bioavailable Acyl-CoA: Cholesterol Acyltransferase Inhibitor with Anti-peroxidative Activity," Chem. Pharm. Bull., vol. 48(6), pp. 817-827 (Jun. 2000), at p. 818, col. 2, lines 16-25 and "Chart 2" (nitration of indolines). * |
Also Published As
| Publication number | Publication date |
|---|---|
| IL157127A0 (en) | 2004-02-08 |
| HUP0302858A3 (en) | 2006-02-28 |
| WO2002062758A1 (fr) | 2002-08-15 |
| RU2005101336A (ru) | 2006-06-27 |
| AU2002228404B2 (en) | 2005-01-06 |
| MXPA03006932A (es) | 2003-11-18 |
| RU2003124060A (ru) | 2005-02-27 |
| EP1364942A1 (en) | 2003-11-26 |
| RU2283304C1 (ru) | 2006-09-10 |
| CN1680318A (zh) | 2005-10-12 |
| CA2437134A1 (en) | 2002-08-15 |
| RU2252213C2 (ru) | 2005-05-20 |
| CN1680317A (zh) | 2005-10-12 |
| KR20030071881A (ko) | 2003-09-06 |
| PL363528A1 (en) | 2004-11-29 |
| CN1216863C (zh) | 2005-08-31 |
| US20040058979A1 (en) | 2004-03-25 |
| NZ527271A (en) | 2005-06-24 |
| HUP0302858A2 (hu) | 2003-12-29 |
| CZ20032102A3 (cs) | 2004-01-14 |
| US20060014965A1 (en) | 2006-01-19 |
| CN1501914A (zh) | 2004-06-02 |
| TW200600497A (en) | 2006-01-01 |
| SK9802003A3 (en) | 2004-04-06 |
| NO20033432L (no) | 2003-10-01 |
| NO20033432D0 (no) | 2003-08-01 |
| EP1364942A4 (en) | 2004-07-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69430636T2 (de) | Neue imidazol-derivate und verfahren zu deren herstellung | |
| HUT60282A (en) | Process for producing new beta-amino-alpha-hydroxycarboxylic acid derivatives and pharmaceutical compositions comprising such compounds | |
| US20160264573A1 (en) | Process for producing diazabicyclooctane derivative and intermediate thereof | |
| CA1104126A (en) | Method for producing derivatives of penicillanic acid | |
| EP0061206B1 (en) | 6-aminopenicillanic acid esters and their use for producing new ampicillin esters | |
| US4382089A (en) | Antibacterial amide compounds, compositions thereof and methods of using them | |
| JP3639449B2 (ja) | 3−アミノ−ピロリジン誘導体の製造方法 | |
| US7012147B2 (en) | Indoline derivative and process for producing the same | |
| US20100152452A1 (en) | Stereoselective synthesis of piperidine derivatives | |
| US5693634A (en) | Urea derivatives for use in treating bacterial infections | |
| HK1057207A (en) | Indoline derivative and process for producing the same | |
| JP2002302482A (ja) | インドリン誘導体及びその製造方法 | |
| US4491547A (en) | Fluoromethylthioacetic acid compounds | |
| US5288860A (en) | Process for preparing thiazolino azetidinone and 2-exo-methylenepenam derivative | |
| JPH04139172A (ja) | α―スルフィニル置換アセトアミド誘導体 | |
| RU2760719C2 (ru) | Способ синтеза замещенных соединений мочевины | |
| JP2771257B2 (ja) | イミダゾール誘導体の製法 | |
| US4889929A (en) | Preparation of 1'-ethoxycarbonyl-oxyethyl esters of penicillins | |
| JP4469040B2 (ja) | ヒダントサイジン中間体 | |
| JP3224584B2 (ja) | 2,3−ジヒドロインドール−3,3−ジカルボン酸及び2,3−ジヒドロインドール−3−カルボン酸誘導体 | |
| JPS643865B2 (cs) | ||
| JPH0733709A (ja) | シュウ酸モノエステル化合物の製法 | |
| HU215112B (hu) | Eljárás gyulladáscsökkentő 1-heteroaril-3-acil-2-oxindol-származékok előállítására | |
| HU185493B (en) | Process for producing new azabicyclo-bracket-3.2.0-bracket closedheptene derivatives | |
| JP2002275155A (ja) | 環状アミン誘導体の製造方法 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| AS | Assignment |
Owner name: SANKYO COMPANY, LIMITED, JAPAN Free format text: ASSIGNMENT OF ASSIGNORS INTEREST;ASSIGNORS:TOMORI, HIROSHI;MIYAMOTO, HIROSHI;FUKUHARA, HIROSHI;AND OTHERS;REEL/FRAME:014670/0462;SIGNING DATES FROM 20030918 TO 20030930 |
|
| CC | Certificate of correction | ||
| REMI | Maintenance fee reminder mailed | ||
| LAPS | Lapse for failure to pay maintenance fees | ||
| STCH | Information on status: patent discontinuation |
Free format text: PATENT EXPIRED DUE TO NONPAYMENT OF MAINTENANCE FEES UNDER 37 CFR 1.362 |
|
| FP | Lapsed due to failure to pay maintenance fee |
Effective date: 20100314 |