US2913327A - Certain thiolcarbamates and use as herbicides - Google Patents
Certain thiolcarbamates and use as herbicides Download PDFInfo
- Publication number
- US2913327A US2913327A US559541A US55954156A US2913327A US 2913327 A US2913327 A US 2913327A US 559541 A US559541 A US 559541A US 55954156 A US55954156 A US 55954156A US 2913327 A US2913327 A US 2913327A
- Authority
- US
- United States
- Prior art keywords
- parts
- mole
- sodium
- added
- chloride
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 239000004009 herbicide Substances 0.000 title description 9
- 238000000034 method Methods 0.000 claims description 15
- 150000001875 compounds Chemical class 0.000 claims description 10
- 239000002689 soil Substances 0.000 claims description 9
- 231100000208 phytotoxic Toxicity 0.000 claims description 7
- 230000000885 phytotoxic effect Effects 0.000 claims description 7
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 21
- 229910052708 sodium Inorganic materials 0.000 description 21
- 239000011734 sodium Substances 0.000 description 21
- 239000000203 mixture Substances 0.000 description 16
- 241000196324 Embryophyta Species 0.000 description 13
- 239000006185 dispersion Substances 0.000 description 10
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 9
- 239000008096 xylene Substances 0.000 description 9
- 240000008042 Zea mays Species 0.000 description 8
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 8
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 8
- 235000005822 corn Nutrition 0.000 description 8
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 7
- 238000010992 reflux Methods 0.000 description 7
- DNJIEGIFACGWOD-UHFFFAOYSA-N ethanethiol Chemical compound CCS DNJIEGIFACGWOD-UHFFFAOYSA-N 0.000 description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 6
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- 235000007238 Secale cereale Nutrition 0.000 description 4
- -1 alkyl radical Chemical class 0.000 description 4
- OWRABTHGOKNUDV-UHFFFAOYSA-N n,n-dipropylcarbamoyl chloride Chemical compound CCCN(C(Cl)=O)CCC OWRABTHGOKNUDV-UHFFFAOYSA-N 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 235000007319 Avena orientalis Nutrition 0.000 description 3
- 244000075850 Avena orientalis Species 0.000 description 3
- GUVLYNGULCJVDO-UHFFFAOYSA-N EPTC Chemical compound CCCN(CCC)C(=O)SCC GUVLYNGULCJVDO-UHFFFAOYSA-N 0.000 description 3
- 230000002363 herbicidal effect Effects 0.000 description 3
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- GTSSFGPSIKYACK-UHFFFAOYSA-N C(CC)OC(NC=1SC=CC1)=O Chemical compound C(CC)OC(NC=1SC=CC1)=O GTSSFGPSIKYACK-UHFFFAOYSA-N 0.000 description 2
- 240000004713 Pisum sativum Species 0.000 description 2
- 235000010582 Pisum sativum Nutrition 0.000 description 2
- 244000088415 Raphanus sativus Species 0.000 description 2
- 235000006140 Raphanus sativus var sativus Nutrition 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- OSWBZCCZJXCOGL-UHFFFAOYSA-N n,n-dibutylcarbamoyl chloride Chemical compound CCCCN(C(Cl)=O)CCCC OSWBZCCZJXCOGL-UHFFFAOYSA-N 0.000 description 2
- PFWZXDDTAYMUPE-UHFFFAOYSA-N propan-2-ol;1,2-xylene Chemical group CC(C)O.CC1=CC=CC=C1C PFWZXDDTAYMUPE-UHFFFAOYSA-N 0.000 description 2
- KJRCEJOSASVSRA-UHFFFAOYSA-N propane-2-thiol Chemical compound CC(C)S KJRCEJOSASVSRA-UHFFFAOYSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- WRIDQFICGBMAFQ-UHFFFAOYSA-N (E)-8-Octadecenoic acid Natural products CCCCCCCCCC=CCCCCCCC(O)=O WRIDQFICGBMAFQ-UHFFFAOYSA-N 0.000 description 1
- LQJBNNIYVWPHFW-UHFFFAOYSA-N 20:1omega9c fatty acid Natural products CCCCCCCCCCC=CCCCCCCCC(O)=O LQJBNNIYVWPHFW-UHFFFAOYSA-N 0.000 description 1
- QSBYPNXLFMSGKH-UHFFFAOYSA-N 9-Heptadecensaeure Natural products CCCCCCCC=CCCCCCCCC(O)=O QSBYPNXLFMSGKH-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 240000008067 Cucumis sativus Species 0.000 description 1
- 235000010799 Cucumis sativus var sativus Nutrition 0.000 description 1
- 240000004244 Cucurbita moschata Species 0.000 description 1
- 235000009854 Cucurbita moschata Nutrition 0.000 description 1
- 235000009852 Cucurbita pepo Nutrition 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- 241000520028 Lamium Species 0.000 description 1
- 239000005642 Oleic acid Substances 0.000 description 1
- ZQPPMHVWECSIRJ-UHFFFAOYSA-N Oleic acid Natural products CCCCCCCCC=CCCCCCCCC(O)=O ZQPPMHVWECSIRJ-UHFFFAOYSA-N 0.000 description 1
- 244000046052 Phaseolus vulgaris Species 0.000 description 1
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 1
- 241000209504 Poaceae Species 0.000 description 1
- 241000209056 Secale Species 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000012364 cultivation method Methods 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 244000013123 dwarf bean Species 0.000 description 1
- 235000005489 dwarf bean Nutrition 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- QXJSBBXBKPUZAA-UHFFFAOYSA-N isooleic acid Natural products CCCCCCCC=CCCCCCCCCC(O)=O QXJSBBXBKPUZAA-UHFFFAOYSA-N 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- RSAFAYLZKCYUQW-UHFFFAOYSA-N n,n-di(propan-2-yl)carbamoyl chloride Chemical compound CC(C)N(C(C)C)C(Cl)=O RSAFAYLZKCYUQW-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid Chemical compound CCCCCCCC\C=C/CCCCCCCC(O)=O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 230000001931 phytocidal effect Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- QJDUDPQVDAASMV-UHFFFAOYSA-M sodium;ethanethiolate Chemical group [Na+].CC[S-] QJDUDPQVDAASMV-UHFFFAOYSA-M 0.000 description 1
- WBQTXTBONIWRGK-UHFFFAOYSA-N sodium;propan-2-olate Chemical compound [Na+].CC(C)[O-] WBQTXTBONIWRGK-UHFFFAOYSA-N 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 235000020354 squash Nutrition 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 238000011282 treatment Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01Q—ANTENNAS, i.e. RADIO AERIALS
- H01Q1/00—Details of, or arrangements associated with, antennas
- H01Q1/12—Supports; Mounting means
- H01Q1/1235—Collapsible supports; Means for erecting a rigid antenna
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N47/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid
- A01N47/08—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid the carbon atom having one or more single bonds to nitrogen atoms
- A01N47/10—Carbamic acid derivatives, i.e. containing the group —O—CO—N<; Thio analogues thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/38—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/52—Radicals substituted by nitrogen atoms not forming part of a nitro radical
Definitions
- Ethyl N N-di-n-propylthiolcarbamate Methyl ,N-di-n-propylthiolcarbamate. n-Propyl ,N-di-n-propylthiolcarbamate. Ethyl N,N-pentamethylenethiolcarbamate. n-Propyl N,N-pentamethylenethiolcarbamate. Isobutyl N.N-di-n-propylthiolcarbamate. n-Butyl N,N-di-n-propylthiolcarbamate.
- N,N-di-n-butylthiolcarbamate Ethyl N,N-di-n-butylthiolcarbamate. sec-Butyl N,N-di-n-propylthiolcarbamate. n-Amyl N, -di-n-propylthiolcarbamate. n-Propyl N ,N-di-isopropylthiolcarbamate.
- Example II (R-1607).
- 38 parts (0.50 mole) of l-propanethiol, sodium dispersion equivalent to 9.2 parts (.40 mole) of sodium, and 65.5 parts (0.40 mole) of di-n-propylcarbamyl chloride are employed, there is obtained 70.3 parts (86.5% yield) of n-propyl N,N-din- Example Ill (R1880).
- 9.12 parts (0.12 mole) of l-p-ropanethiol, sodium dispersion equivalent to 2.3 parts (0.10 mole) of sodium, and 19.2 parts (0.10 mole) of di-n-butylcarbamyl chloride are employed, there is obtained 20.4 parts (88.3% yield) of n-propyl N,
- Example IV (R-1854).-When the general procedure of Example I is repeated except that 16.9 parts (0.188 mole) of Z-methyl-l-propanethiol, sodium dispersion equivalent to 3.45 parts (0.15 mole) of sodium and 24.5 parts (0.15 mole) of di-n-propylcarbamyl chloride are employed, there is obtained 25.2 parts (77.3% yield) of isobutyl N,N-di-n-propylthiolcarbamate (B.P. (18 mm.) 143145 0, n 1.4744).
- Example V (RJ857).When the general procedure of Example I is repeated except that 16.9 parts (0.188 mole) of l-butanethiol, sodium dispersion equivalent to 3.45 parts (0.15 mole) sodium and 24.5 parts (0.15 mole) of di-n-propylcarbamyl chloride are employed, there is obtained 24.8 parts (76% yield) of n-butyl N,N-di-n-propyl- 3 thiolcarbamate (B.P. (19 mm.) l51.0-151.5' C., 11 1.4766).
- Example VI (R-I866). The general procedure of Example I was followed except that 25 parts (0.52 mole) of methanethiol is added in small portions at 50-60 C. to the sodium dispersion equivalent to 2.3 parts (0.10 mole) of sodium. It is necessary to make sure that unreacted mercaptan does not build up in the reaction mixture since a violent reaction may take place if too much unreacted mercaptan is present with unreacted dispersion. After all of the sodium dispersion has reacted which is evidenced by the reaction mixture changing from a purplish hue to a white color, it is heated to reflux and 19.2 parts (0.10 mole) of di-n-butylcarbamyl chloride is added. After working up in the usual manner, there is obtained 13.9 parts (68.5% yield) of methyl N,N,-din-butylthiolcarbamate (B.P. (20 mm.) 144-146 C., n 1.4760).
- Example X (R-1905).
- Example VIII When the general procedure of Example VIII is repeated except that 13.0 parts (0.125 mole) of l-pentanethiol, 2.3 parts (0.10 mole) of sodium and 16.4 parts of di-isopropylcarbamyl chloride are employed, there is obtained 15.8 parts (68.3%) of n-amyl N,N,-di-isopropylthiolcarbamate (B.P. (22 mm.) 145- 149 C., a 1.4721).
- Example XI (R-1824).Wl1en the general procedure of Example VIII is repeated except that 14.3 parts (0.188 mole) of 2-propanethiol, 3.45 parts (0.15 mole) of sodium and 22.1 parts (0.15 mole) of N,N-pentarnethyl-
- Pre-emergence herbicides are ordinarily used by placing a narrow band of the herbicide over the center of a seeded crop row at time of planting or before crop emerges. If the herbicide is harmless to the desired crop, seeds or seedlings, but phytotoxic to the weed seeds or seedlings most frequently encountered, the crop grows in an almost weedfree environment.
- the pre-emergence herbicide may be used over the entire field, but it is normally used in a narrow band which straddles the crop row and the balance of the weeds are controlled by various cultivation methods.
- the herbicides of the present invention are selective toward small seeded annual grasses and broad-leafed plants, and so are efiective against the most common weeds but have little effect on such valuable row crops as corn and beans.
- the phytocidal composition may be applied to the soil in any convenient form.
- the method-of combatting weeds comprising ap- 2562911 fP July 1951 plying to the soil a phytotoxic amount of n-propyl N,N- 2642451 welllard et a1 June 1953 di n propylthiolcarbamate Kosmin g' 24! 12.
- the method of combatting weeds comprising applying to the soil a phytotoxic amount of n-propy1'N,N- 10 OTHER REFERENCES di-n-butylthiolcarbamate.
- the method of combatting weeds comprising ap- (1953).
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Agronomy & Crop Science (AREA)
- Pest Control & Pesticides (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (23)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL108235D NL108235C (enExample) | 1956-01-17 | ||
| NL213753D NL213753A (enExample) | 1956-01-17 | ||
| BE582794D BE582794A (enExample) | 1956-01-17 | ||
| NL232065D NL232065A (enExample) | 1956-01-17 | ||
| BE554214D BE554214A (enExample) | 1956-01-17 | ||
| BE559977D BE559977A (enExample) | 1956-01-17 | ||
| BE571955D BE571955A (enExample) | 1956-01-17 | ||
| US559541A US2913327A (en) | 1956-01-17 | 1956-01-17 | Certain thiolcarbamates and use as herbicides |
| FR1171404D FR1171404A (fr) | 1956-01-17 | 1957-01-15 | Perfectionnements apportés aux herbicides et à leurs procédés de fabrication |
| DEST1239A DE1031571B (de) | 1956-01-17 | 1957-01-17 | Pflanzenvertilgungsmittel |
| GB1845/57A GB808753A (en) | 1956-01-17 | 1957-01-17 | Improvements in or relating to thiolcarbamates |
| GB23841/57A GB862548A (en) | 1956-01-17 | 1957-07-26 | Improvements in or relating to phytocidal compositions of matter |
| CH357238D CH357238A (de) | 1956-01-17 | 1957-07-31 | Unkrautvertilgungsmittel |
| DEST12853A DE1081715B (de) | 1956-01-17 | 1957-08-06 | Pflanzenvertilgungsmittel |
| FR72159D FR72159E (fr) | 1956-01-17 | 1957-08-07 | Perfectionnements apportés aux herbicides et à leurs procédé de fabrication |
| GB31728/58A GB868111A (en) | 1956-01-17 | 1958-10-03 | Improvements in or relating to thiolcarbamates |
| DEST14328A DE1082452B (de) | 1956-01-17 | 1958-10-10 | Pflanzenvertilgungsmittel |
| FR777391A FR74319E (fr) | 1956-01-17 | 1958-10-23 | Perfectionnements apportés aux herbicides et à leurs procédés de fabrication |
| CH6652558A CH371921A (de) | 1956-01-17 | 1958-11-24 | Unkrautvertilgungsmittel |
| GB30509/59A GB862250A (en) | 1956-01-17 | 1959-09-07 | Improvements in or relating to thiolcarbamates |
| FR806064A FR77056E (fr) | 1956-01-17 | 1959-09-25 | Perfectionnements apportés aux herbicides et à leurs procédés de fabrication |
| CH8043159A CH368015A (de) | 1956-01-17 | 1959-11-10 | Unkrautvertilgungsmittel |
| MY19622A MY6200002A (en) | 1956-01-17 | 1962-12-31 | Improvements in or relating to thiolcarbamates |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US559541A US2913327A (en) | 1956-01-17 | 1956-01-17 | Certain thiolcarbamates and use as herbicides |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| US2913327A true US2913327A (en) | 1959-11-17 |
Family
ID=24233981
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US559541A Expired - Lifetime US2913327A (en) | 1956-01-17 | 1956-01-17 | Certain thiolcarbamates and use as herbicides |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US2913327A (enExample) |
| BE (4) | BE582794A (enExample) |
| CH (3) | CH357238A (enExample) |
| DE (3) | DE1031571B (enExample) |
| FR (4) | FR1171404A (enExample) |
| GB (4) | GB808753A (enExample) |
| MY (1) | MY6200002A (enExample) |
| NL (3) | NL108235C (enExample) |
Cited By (73)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3037853A (en) * | 1958-04-04 | 1962-06-05 | Du Pont | Herbicidal composition and method employing a mixture of ethyl n, n-dipropylthiolcarbamate and a herbicidal s-triazine |
| US3046189A (en) * | 1957-05-18 | 1962-07-24 | Merck Ag E | Nematocidal agents |
| US3095299A (en) * | 1960-05-11 | 1963-06-25 | Du Pont | Herbicidal composition and method |
| US3101263A (en) * | 1959-04-20 | 1963-08-20 | Stauffer Chemical Co | Herbicidal method |
| US3154402A (en) * | 1962-03-12 | 1964-10-27 | Exxon Research Engineering Co | Wax formulations of thiolcarbamate herbicides |
| US3175897A (en) * | 1962-08-21 | 1965-03-30 | Stauffer Chemical Co | Asymmetric thiolcarbamates as herbicides |
| US3185720A (en) * | 1962-08-21 | 1965-05-25 | Stauffer Chemical Co | Asymmetric thiolcarbamates |
| US3198786A (en) * | 1961-05-01 | 1965-08-03 | Stauffer Chemical Co | Alkyl hexamethylene-thiolcarbamates |
| US3298817A (en) * | 1959-04-16 | 1967-01-17 | Tilles Harry | Method of combating weeds |
| US3305576A (en) * | 1959-07-10 | 1967-02-21 | Monsanto Co | 3-chloropropyl diisopropylthiolcarbamate |
| US3893838A (en) * | 1972-11-16 | 1975-07-08 | Stauffer Chemical Co | Halogenated esters as herbicide antidotes |
| US3923494A (en) * | 1973-05-24 | 1975-12-02 | Stauffer Chemical Co | Gem-bis amide herbicide antidote compositions and methods of use |
| US3976469A (en) * | 1972-11-16 | 1976-08-24 | Stauffer Chemical Company | Halogenated ketones as herbicide antidotes |
| US4021224A (en) * | 1971-12-09 | 1977-05-03 | Stauffer Chemical Company | Herbicide compositions |
| US4036628A (en) * | 1972-11-13 | 1977-07-19 | Stauffer Chemical Company | Phosphorus containing herbicide antidotes |
| US4098599A (en) * | 1975-09-12 | 1978-07-04 | Stauffer Chemical Company | Antidote compositions and method of use with herbicides |
| US4137070A (en) * | 1971-04-16 | 1979-01-30 | Stauffer Chemical Company | Herbicide compositions |
| US4208203A (en) * | 1971-09-17 | 1980-06-17 | Gulf Research & Development Co. | Method of protecting corn from herbicides |
| US4222938A (en) * | 1978-09-29 | 1980-09-16 | Monsanto Company | Preparation of thiolcarbamates |
| US4268456A (en) * | 1979-09-24 | 1981-05-19 | Ppg Industries, Inc. | Process for preparing chlorothiolformates |
| US4273725A (en) * | 1979-07-25 | 1981-06-16 | Ppg Industries, Inc. | Process for preparing chlorothiolformates |
| US4276078A (en) * | 1978-08-04 | 1981-06-30 | Stauffer Chemical Company | Herbicide compositions |
| US4279638A (en) * | 1979-08-13 | 1981-07-21 | Stauffer Chemical Company | 3,5-Disubstituted 1,2,4-oxadiazole herbicidal antidotes |
| US4299616A (en) * | 1980-03-31 | 1981-11-10 | Stauffer Chemical Company | Herbicide compositions of extended soil life |
| US4320070A (en) * | 1979-09-24 | 1982-03-16 | Ppg Industries, Inc. | Process for preparing chlorothiolformates |
| US4321084A (en) * | 1977-09-23 | 1982-03-23 | Stauffer Chemical Company | Certain halogenated phenols as antidotes for thiocarbamate herbicides |
| US4321083A (en) * | 1980-04-21 | 1982-03-23 | Stauffer Chemical Company | N-Acyl-phenyl-thiourea herbicidal antidotes |
| US4338120A (en) * | 1980-04-21 | 1982-07-06 | Stauffer Chemical Company | Halo-substituted thionoacyl ketone herbicidal antidotes |
| FR2509136A1 (fr) * | 1981-07-08 | 1983-01-14 | Eszakmagyar Vegyimuevek | Composition herbicide contenant un melange de deux esters d'acides thiocarbamiques |
| US4378239A (en) * | 1981-04-27 | 1983-03-29 | Stauffer Chemical Company | N-Methylcarbamoyloxy benzaldehyde imine herbicide extenders |
| US4380468A (en) * | 1980-10-14 | 1983-04-19 | Stauffer Chemical Company | Isonitriles as herbicide extenders |
| US4380467A (en) * | 1981-03-12 | 1983-04-19 | Stauffer Chemical Company | Amine oxanilic acid salts as herbicide extenders |
| US4381196A (en) * | 1981-04-20 | 1983-04-26 | Stauffer Chemical Company | O-(Substituted phenyl) N-methylcarbamates as herbicide extenders |
| US4381195A (en) * | 1981-04-20 | 1983-04-26 | Stauffer Chemical Company | N-Methylcarbamoyloxy anilides as herbicide extenders |
| US4381936A (en) * | 1980-03-31 | 1983-05-03 | Stauffer Chemical Company | Herbicide compositions of extended soil life |
| US4386955A (en) * | 1981-04-20 | 1983-06-07 | Stauffer Chemical Company | O-(Substituted phenyl) N-methylcarbamates as herbicide extenders |
| US4396419A (en) * | 1981-03-16 | 1983-08-02 | Stauffer Chemical Company | Chloroacetamido alkoxy ethane herbicide antidotes |
| US4400197A (en) * | 1979-12-26 | 1983-08-23 | Ppg Industries, Inc. | N-(Optionally substituted 1,3-dioxolan- or dioxan-2-ylmethyl)-N-alkyl, alkenyl, or alkynyl-2,2-dichloroacetamides |
| US4420322A (en) * | 1979-04-02 | 1983-12-13 | Stauffer Chemical Company | Herbicidal antidotes |
| US4420323A (en) * | 1982-05-10 | 1983-12-13 | Stauffer Chemical Company | Thiophosphoryl carbamate herbicide antidotes |
| US4422869A (en) * | 1981-04-20 | 1983-12-27 | Stauffer Chemical Company | Halogenated allylthioisopropyl N-methylcarbamates as herbicide extenders |
| US4432909A (en) * | 1981-03-12 | 1984-02-21 | Stauffer Chemical Company | Amine oxanilic acid salts as herbicide extenders |
| US4433999A (en) | 1981-07-20 | 1984-02-28 | Stauffer Chemical Company | Herbicide compositions containing soil life extenders and antidotes |
| US4441916A (en) * | 1981-10-19 | 1984-04-10 | Stauffer Chemical Company | Haloalkyloxime herbicidal antidotes |
| US4478636A (en) * | 1982-06-01 | 1984-10-23 | Stauffer Chemical Company | Herbicidal compositions of extended soil life |
| US4490166A (en) * | 1982-06-01 | 1984-12-25 | Stauffer Chemical Company | Iminophenyl N-methylcarbamates as herbicide extenders |
| US4495365A (en) * | 1980-11-21 | 1985-01-22 | Stauffer Chemical Co. | N-Acylsulfonamide herbicidal antidotes |
| US4517012A (en) * | 1979-07-09 | 1985-05-14 | Stauffer Chemical Company | Herbicide compositions |
| US4540429A (en) * | 1981-03-16 | 1985-09-10 | Stauffer Chemical Company | 4-Phenyl-1,2,3-thiadiazoles as herbicide extenders |
| US4545805A (en) * | 1982-03-24 | 1985-10-08 | Stauffer Chemical Company | Herbicide compositions of extended soil life |
| US4546199A (en) * | 1981-04-20 | 1985-10-08 | Stauffer Chemical Company | Halogenated allylthioisopropyl N-methyl carbamates as herbicide extenders |
| US4559082A (en) * | 1983-08-12 | 1985-12-17 | Stauffer Chemical Co. | Herbicide compositions of extended soil life |
| US4613358A (en) * | 1983-05-20 | 1986-09-23 | Stauffer Chemical Co. | Herbicide compositions of extended soil life |
| US4648894A (en) * | 1983-05-20 | 1987-03-10 | Stauffer Chemical Co. | Herbicide compositions of extended soil life |
| US4650516A (en) * | 1979-03-23 | 1987-03-17 | Stauffer Chemical Co. | α-halo-Ω-haloalkylamides herbicidal antidotes |
| US4652298A (en) * | 1983-05-16 | 1987-03-24 | Stauffer Chemical Co. | Herbicide compositions of extended soil life |
| US4652296A (en) * | 1983-05-16 | 1987-03-24 | Stauffer Chemical Co. | Herbicide compositions of extended soil life |
| US4652302A (en) * | 1983-05-20 | 1987-03-24 | Stauffer Chemical Co. | Herbicide compositions of extended soil life |
| US4652300A (en) * | 1983-05-16 | 1987-03-24 | Stauffer Chemical Co. | Herbicide compositions of extended soil life |
| US4652301A (en) * | 1983-05-16 | 1987-03-24 | Stauffer Chemical Co. | Herbicide compositions of extended soil life |
| US4662930A (en) * | 1983-05-20 | 1987-05-05 | Stauffer Chemical Co. | Herbicide compositions of extended soil life |
| WO1989009208A1 (en) * | 1988-03-30 | 1989-10-05 | Bio-Tox Diagnostics Kommanditbolag | Carbamic acid ester and a preparation thereof for treatment of addiction to alcohol |
| US4915725A (en) * | 1978-09-20 | 1990-04-10 | Ici Americas, Inc. | Herbicide compositions of extended soil life |
| US5011526A (en) * | 1978-09-20 | 1991-04-30 | Ici Americas Inc. | Herbicide compositions of extended soil life |
| US5041599A (en) * | 1990-07-30 | 1991-08-20 | Phillips Petroleum Company | Catalytic synthesis of thionocarbamates from xanthates and amines |
| US5171356A (en) * | 1984-09-19 | 1992-12-15 | Ici Americas Inc. | Herbicide compositions of extended soil life |
| US5527762A (en) * | 1990-12-12 | 1996-06-18 | Zeneca Limited | Antidoting herbicidal 3-isoxazolidinone compounds |
| EP2052606A1 (de) | 2007-10-24 | 2009-04-29 | Bayer CropScience AG | Herbizid-Kombination |
| DE102008037620A1 (de) | 2008-08-14 | 2010-02-18 | Bayer Crop Science Ag | Herbizid-Kombination mit Dimethoxytriazinyl-substituierten Difluormethansulfonylaniliden |
| WO2012049266A1 (en) | 2010-10-15 | 2012-04-19 | Bayer Cropscience Ag | Use of als inhibitor herbicides for control of unwanted vegetation in als inhibitor herbicide tolerant beta vulgaris plants |
| WO2012150333A1 (en) | 2011-05-04 | 2012-11-08 | Bayer Intellectual Property Gmbh | Use of als inhibitor herbicides for control of unwanted vegetation in als inhibitor herbicide tolerant brassica, such as b. napus, plants |
| WO2014090760A1 (en) | 2012-12-13 | 2014-06-19 | Bayer Cropscience Ag | Use of als inhibitor herbicides for control of unwanted vegetation in als inhibitor herbicide tolerant beta vulgaris plants |
| WO2023062184A1 (en) | 2021-10-15 | 2023-04-20 | KWS SAAT SE & Co. KGaA | Als inhibitor herbicide tolerant beta vulgaris mutants |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL213753A (enExample) * | 1956-01-17 | |||
| DE1142464B (de) * | 1959-05-11 | 1963-01-17 | Monsanto Chemicals | Bekaempfung unerwuenschten Pflanzenwuchses, Unkrautvertilgung, Entblaetterung, Bodenentseuchung, Fungi- und Nematodenbekaempfung |
| US3318676A (en) * | 1959-07-10 | 1967-05-09 | Monsanto Co | Controlling vegetation with haloalkyl thiolcarbamates |
| US3839010A (en) * | 1970-05-19 | 1974-10-01 | Exxon Research Engineering Co | Thiocarbamic acid ester pesticides |
| DE2329043A1 (de) * | 1973-06-07 | 1975-01-02 | Basf Ag | Carbothiolate |
| US4056549A (en) | 1976-06-07 | 1977-11-01 | Ppg Industries, Inc. | S-3-Methoxyphenyl N-alkylthiolcarbamates and S-3-methylthiophenyl N-alkylthiolcarbamates |
| ES8104796A1 (es) * | 1979-07-25 | 1981-05-16 | Hoechst Ag | Procedimiento para la preparacion de anilidas de acido tio- glicolico, fungicidas |
| AU549319B2 (en) * | 1980-10-21 | 1986-01-23 | Hodogaya Chemical Co. Ltd. | Nematocide |
Citations (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2060733A (en) * | 1934-09-04 | 1936-11-10 | Du Pont | Process of treating cellulose and derivatives thereof |
| US2160880A (en) * | 1936-11-02 | 1939-06-06 | Standard Oil Co | Lubricant |
| US2562011A (en) * | 1948-12-10 | 1951-07-24 | Goodrich Co B F | Herbicidal compositions and application thereof |
| US2642451A (en) * | 1953-06-16 | Thiolurethanes and processes for | ||
| US2687348A (en) * | 1952-09-17 | 1954-08-24 | Monsanto Chemicals | Herbicidal compositions |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE858352C (de) * | 1948-10-02 | 1952-12-04 | Schering Ag | Verhinderung der Keimung bei Hackfruechten u. dgl. |
| NL213753A (enExample) * | 1956-01-17 |
-
0
- NL NL213753D patent/NL213753A/xx unknown
- BE BE559977D patent/BE559977A/xx unknown
- NL NL232065D patent/NL232065A/xx unknown
- NL NL108235D patent/NL108235C/xx active
- BE BE554214D patent/BE554214A/xx unknown
- BE BE571955D patent/BE571955A/xx unknown
- BE BE582794D patent/BE582794A/xx unknown
-
1956
- 1956-01-17 US US559541A patent/US2913327A/en not_active Expired - Lifetime
-
1957
- 1957-01-15 FR FR1171404D patent/FR1171404A/fr not_active Expired
- 1957-01-17 DE DEST1239A patent/DE1031571B/de active Pending
- 1957-01-17 GB GB1845/57A patent/GB808753A/en not_active Expired
- 1957-07-26 GB GB23841/57A patent/GB862548A/en not_active Expired
- 1957-07-31 CH CH357238D patent/CH357238A/de unknown
- 1957-08-06 DE DEST12853A patent/DE1081715B/de active Pending
- 1957-08-07 FR FR72159D patent/FR72159E/fr not_active Expired
-
1958
- 1958-10-03 GB GB31728/58A patent/GB868111A/en not_active Expired
- 1958-10-10 DE DEST14328A patent/DE1082452B/de active Pending
- 1958-10-23 FR FR777391A patent/FR74319E/fr not_active Expired
- 1958-11-24 CH CH6652558A patent/CH371921A/de unknown
-
1959
- 1959-09-07 GB GB30509/59A patent/GB862250A/en not_active Expired
- 1959-09-25 FR FR806064A patent/FR77056E/fr not_active Expired
- 1959-11-10 CH CH8043159A patent/CH368015A/de unknown
-
1962
- 1962-12-31 MY MY19622A patent/MY6200002A/xx unknown
Patent Citations (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2642451A (en) * | 1953-06-16 | Thiolurethanes and processes for | ||
| US2060733A (en) * | 1934-09-04 | 1936-11-10 | Du Pont | Process of treating cellulose and derivatives thereof |
| US2160880A (en) * | 1936-11-02 | 1939-06-06 | Standard Oil Co | Lubricant |
| US2562011A (en) * | 1948-12-10 | 1951-07-24 | Goodrich Co B F | Herbicidal compositions and application thereof |
| US2687348A (en) * | 1952-09-17 | 1954-08-24 | Monsanto Chemicals | Herbicidal compositions |
Cited By (81)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3046189A (en) * | 1957-05-18 | 1962-07-24 | Merck Ag E | Nematocidal agents |
| US3037853A (en) * | 1958-04-04 | 1962-06-05 | Du Pont | Herbicidal composition and method employing a mixture of ethyl n, n-dipropylthiolcarbamate and a herbicidal s-triazine |
| US3298817A (en) * | 1959-04-16 | 1967-01-17 | Tilles Harry | Method of combating weeds |
| US3101263A (en) * | 1959-04-20 | 1963-08-20 | Stauffer Chemical Co | Herbicidal method |
| US3305576A (en) * | 1959-07-10 | 1967-02-21 | Monsanto Co | 3-chloropropyl diisopropylthiolcarbamate |
| US3095299A (en) * | 1960-05-11 | 1963-06-25 | Du Pont | Herbicidal composition and method |
| US3198786A (en) * | 1961-05-01 | 1965-08-03 | Stauffer Chemical Co | Alkyl hexamethylene-thiolcarbamates |
| US3154402A (en) * | 1962-03-12 | 1964-10-27 | Exxon Research Engineering Co | Wax formulations of thiolcarbamate herbicides |
| US3175897A (en) * | 1962-08-21 | 1965-03-30 | Stauffer Chemical Co | Asymmetric thiolcarbamates as herbicides |
| US3185720A (en) * | 1962-08-21 | 1965-05-25 | Stauffer Chemical Co | Asymmetric thiolcarbamates |
| US4137070A (en) * | 1971-04-16 | 1979-01-30 | Stauffer Chemical Company | Herbicide compositions |
| US4208203A (en) * | 1971-09-17 | 1980-06-17 | Gulf Research & Development Co. | Method of protecting corn from herbicides |
| US4021224A (en) * | 1971-12-09 | 1977-05-03 | Stauffer Chemical Company | Herbicide compositions |
| US4036628A (en) * | 1972-11-13 | 1977-07-19 | Stauffer Chemical Company | Phosphorus containing herbicide antidotes |
| US3893838A (en) * | 1972-11-16 | 1975-07-08 | Stauffer Chemical Co | Halogenated esters as herbicide antidotes |
| US3976469A (en) * | 1972-11-16 | 1976-08-24 | Stauffer Chemical Company | Halogenated ketones as herbicide antidotes |
| US3923494A (en) * | 1973-05-24 | 1975-12-02 | Stauffer Chemical Co | Gem-bis amide herbicide antidote compositions and methods of use |
| US4098599A (en) * | 1975-09-12 | 1978-07-04 | Stauffer Chemical Company | Antidote compositions and method of use with herbicides |
| US4321084A (en) * | 1977-09-23 | 1982-03-23 | Stauffer Chemical Company | Certain halogenated phenols as antidotes for thiocarbamate herbicides |
| US4276078A (en) * | 1978-08-04 | 1981-06-30 | Stauffer Chemical Company | Herbicide compositions |
| US4915725A (en) * | 1978-09-20 | 1990-04-10 | Ici Americas, Inc. | Herbicide compositions of extended soil life |
| US5011526A (en) * | 1978-09-20 | 1991-04-30 | Ici Americas Inc. | Herbicide compositions of extended soil life |
| US4222938A (en) * | 1978-09-29 | 1980-09-16 | Monsanto Company | Preparation of thiolcarbamates |
| US4650516A (en) * | 1979-03-23 | 1987-03-17 | Stauffer Chemical Co. | α-halo-Ω-haloalkylamides herbicidal antidotes |
| US4420322A (en) * | 1979-04-02 | 1983-12-13 | Stauffer Chemical Company | Herbicidal antidotes |
| US4517012A (en) * | 1979-07-09 | 1985-05-14 | Stauffer Chemical Company | Herbicide compositions |
| US4273725A (en) * | 1979-07-25 | 1981-06-16 | Ppg Industries, Inc. | Process for preparing chlorothiolformates |
| US4279638A (en) * | 1979-08-13 | 1981-07-21 | Stauffer Chemical Company | 3,5-Disubstituted 1,2,4-oxadiazole herbicidal antidotes |
| US4268456A (en) * | 1979-09-24 | 1981-05-19 | Ppg Industries, Inc. | Process for preparing chlorothiolformates |
| US4320070A (en) * | 1979-09-24 | 1982-03-16 | Ppg Industries, Inc. | Process for preparing chlorothiolformates |
| US4400197A (en) * | 1979-12-26 | 1983-08-23 | Ppg Industries, Inc. | N-(Optionally substituted 1,3-dioxolan- or dioxan-2-ylmethyl)-N-alkyl, alkenyl, or alkynyl-2,2-dichloroacetamides |
| US4381936A (en) * | 1980-03-31 | 1983-05-03 | Stauffer Chemical Company | Herbicide compositions of extended soil life |
| EP0038945A3 (en) * | 1980-03-31 | 1981-12-16 | Stauffer Chemical Company | Herbicide compositions of extended soil life |
| US4299616A (en) * | 1980-03-31 | 1981-11-10 | Stauffer Chemical Company | Herbicide compositions of extended soil life |
| US4321083A (en) * | 1980-04-21 | 1982-03-23 | Stauffer Chemical Company | N-Acyl-phenyl-thiourea herbicidal antidotes |
| US4338120A (en) * | 1980-04-21 | 1982-07-06 | Stauffer Chemical Company | Halo-substituted thionoacyl ketone herbicidal antidotes |
| US4380468A (en) * | 1980-10-14 | 1983-04-19 | Stauffer Chemical Company | Isonitriles as herbicide extenders |
| US4495365A (en) * | 1980-11-21 | 1985-01-22 | Stauffer Chemical Co. | N-Acylsulfonamide herbicidal antidotes |
| US4380467A (en) * | 1981-03-12 | 1983-04-19 | Stauffer Chemical Company | Amine oxanilic acid salts as herbicide extenders |
| US4432909A (en) * | 1981-03-12 | 1984-02-21 | Stauffer Chemical Company | Amine oxanilic acid salts as herbicide extenders |
| US4540429A (en) * | 1981-03-16 | 1985-09-10 | Stauffer Chemical Company | 4-Phenyl-1,2,3-thiadiazoles as herbicide extenders |
| US4396419A (en) * | 1981-03-16 | 1983-08-02 | Stauffer Chemical Company | Chloroacetamido alkoxy ethane herbicide antidotes |
| US4422869A (en) * | 1981-04-20 | 1983-12-27 | Stauffer Chemical Company | Halogenated allylthioisopropyl N-methylcarbamates as herbicide extenders |
| US4381196A (en) * | 1981-04-20 | 1983-04-26 | Stauffer Chemical Company | O-(Substituted phenyl) N-methylcarbamates as herbicide extenders |
| US4546199A (en) * | 1981-04-20 | 1985-10-08 | Stauffer Chemical Company | Halogenated allylthioisopropyl N-methyl carbamates as herbicide extenders |
| US4381195A (en) * | 1981-04-20 | 1983-04-26 | Stauffer Chemical Company | N-Methylcarbamoyloxy anilides as herbicide extenders |
| US4386955A (en) * | 1981-04-20 | 1983-06-07 | Stauffer Chemical Company | O-(Substituted phenyl) N-methylcarbamates as herbicide extenders |
| US4378239A (en) * | 1981-04-27 | 1983-03-29 | Stauffer Chemical Company | N-Methylcarbamoyloxy benzaldehyde imine herbicide extenders |
| FR2509136A1 (fr) * | 1981-07-08 | 1983-01-14 | Eszakmagyar Vegyimuevek | Composition herbicide contenant un melange de deux esters d'acides thiocarbamiques |
| US4433999A (en) | 1981-07-20 | 1984-02-28 | Stauffer Chemical Company | Herbicide compositions containing soil life extenders and antidotes |
| US4441916A (en) * | 1981-10-19 | 1984-04-10 | Stauffer Chemical Company | Haloalkyloxime herbicidal antidotes |
| US4545805A (en) * | 1982-03-24 | 1985-10-08 | Stauffer Chemical Company | Herbicide compositions of extended soil life |
| US4420323A (en) * | 1982-05-10 | 1983-12-13 | Stauffer Chemical Company | Thiophosphoryl carbamate herbicide antidotes |
| US4490166A (en) * | 1982-06-01 | 1984-12-25 | Stauffer Chemical Company | Iminophenyl N-methylcarbamates as herbicide extenders |
| US4478636A (en) * | 1982-06-01 | 1984-10-23 | Stauffer Chemical Company | Herbicidal compositions of extended soil life |
| US4652300A (en) * | 1983-05-16 | 1987-03-24 | Stauffer Chemical Co. | Herbicide compositions of extended soil life |
| US4652298A (en) * | 1983-05-16 | 1987-03-24 | Stauffer Chemical Co. | Herbicide compositions of extended soil life |
| US4652296A (en) * | 1983-05-16 | 1987-03-24 | Stauffer Chemical Co. | Herbicide compositions of extended soil life |
| US4652301A (en) * | 1983-05-16 | 1987-03-24 | Stauffer Chemical Co. | Herbicide compositions of extended soil life |
| US4613358A (en) * | 1983-05-20 | 1986-09-23 | Stauffer Chemical Co. | Herbicide compositions of extended soil life |
| US4652302A (en) * | 1983-05-20 | 1987-03-24 | Stauffer Chemical Co. | Herbicide compositions of extended soil life |
| US4662930A (en) * | 1983-05-20 | 1987-05-05 | Stauffer Chemical Co. | Herbicide compositions of extended soil life |
| US4648894A (en) * | 1983-05-20 | 1987-03-10 | Stauffer Chemical Co. | Herbicide compositions of extended soil life |
| US4559082A (en) * | 1983-08-12 | 1985-12-17 | Stauffer Chemical Co. | Herbicide compositions of extended soil life |
| US5171356A (en) * | 1984-09-19 | 1992-12-15 | Ici Americas Inc. | Herbicide compositions of extended soil life |
| WO1989009208A1 (en) * | 1988-03-30 | 1989-10-05 | Bio-Tox Diagnostics Kommanditbolag | Carbamic acid ester and a preparation thereof for treatment of addiction to alcohol |
| US5100916A (en) * | 1988-03-30 | 1992-03-31 | Bio-Tox Diagnostics Kommanditbolag | Carbamic acid ester for treatment of addiction to alcohol |
| US5041599A (en) * | 1990-07-30 | 1991-08-20 | Phillips Petroleum Company | Catalytic synthesis of thionocarbamates from xanthates and amines |
| US5527762A (en) * | 1990-12-12 | 1996-06-18 | Zeneca Limited | Antidoting herbicidal 3-isoxazolidinone compounds |
| US5527761A (en) * | 1990-12-12 | 1996-06-18 | Zeneca Limited | Antidoting herbicidal 3-isoxazolidinone compounds |
| EP2052606A1 (de) | 2007-10-24 | 2009-04-29 | Bayer CropScience AG | Herbizid-Kombination |
| US20100099564A1 (en) * | 2008-08-14 | 2010-04-22 | Bayer Cropscience Ag | Herbicide combination comprising dimethoxytriazinyl-substituted difluoromethanesulfonylanilides |
| DE102008037620A1 (de) | 2008-08-14 | 2010-02-18 | Bayer Crop Science Ag | Herbizid-Kombination mit Dimethoxytriazinyl-substituierten Difluormethansulfonylaniliden |
| WO2012049266A1 (en) | 2010-10-15 | 2012-04-19 | Bayer Cropscience Ag | Use of als inhibitor herbicides for control of unwanted vegetation in als inhibitor herbicide tolerant beta vulgaris plants |
| EP3284346A1 (en) | 2010-10-15 | 2018-02-21 | Bayer Intellectual Property GmbH | Use of als inhibitor herbicides for control of unwanted vegetation in als inhibitor herbicide tolerant beta vulgaris plants |
| US10544426B2 (en) | 2010-10-15 | 2020-01-28 | Bayer Intellectual Property Gmbh | Methods of using ALS inhibitor herbicides for control of unwanted vegetation in ALS inhibitor herbicide tolerant beta vulgaris plants |
| US11371057B2 (en) | 2010-10-15 | 2022-06-28 | Bayer Intellectual Property Gmbh | Methods of using ALS inhibitor herbicides for control of unwanted vegetation in ALS inhibitor herbicide tolerant beta vulgaris plants |
| WO2012150333A1 (en) | 2011-05-04 | 2012-11-08 | Bayer Intellectual Property Gmbh | Use of als inhibitor herbicides for control of unwanted vegetation in als inhibitor herbicide tolerant brassica, such as b. napus, plants |
| US9370183B2 (en) | 2011-05-04 | 2016-06-21 | Bayer Intellectual Property Gmbh | Use of ALS inhibitor herbicides for control of unwanted vegetation in ALS inhibitor herbicide tolerant Brassica, such as B. napus, plants |
| WO2014090760A1 (en) | 2012-12-13 | 2014-06-19 | Bayer Cropscience Ag | Use of als inhibitor herbicides for control of unwanted vegetation in als inhibitor herbicide tolerant beta vulgaris plants |
| WO2023062184A1 (en) | 2021-10-15 | 2023-04-20 | KWS SAAT SE & Co. KGaA | Als inhibitor herbicide tolerant beta vulgaris mutants |
Also Published As
| Publication number | Publication date |
|---|---|
| FR1171404A (fr) | 1959-01-26 |
| CH371921A (de) | 1963-09-15 |
| BE582794A (enExample) | |
| CH357238A (de) | 1961-09-30 |
| DE1081715B (de) | 1960-05-12 |
| BE571955A (enExample) | |
| MY6200002A (en) | 1962-12-31 |
| NL232065A (enExample) | |
| GB862548A (en) | 1961-03-15 |
| NL108235C (enExample) | |
| DE1082452B (de) | 1960-05-25 |
| FR72159E (fr) | 1960-03-30 |
| FR74319E (fr) | 1960-11-07 |
| NL213753A (enExample) | |
| GB862250A (en) | 1961-03-08 |
| GB868111A (en) | 1961-05-17 |
| BE559977A (enExample) | |
| GB808753A (en) | 1959-02-11 |
| FR77056E (fr) | 1962-01-12 |
| CH368015A (de) | 1963-03-15 |
| BE554214A (enExample) | |
| DE1031571B (de) | 1958-06-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US2913327A (en) | Certain thiolcarbamates and use as herbicides | |
| US2655445A (en) | 3-(halophenyl)-1-methyl-1-(methyl or ethyl) ureas and herbicidal compositions and methods employing same | |
| US3063823A (en) | Method of killing weeds and influencing plant growth | |
| US3367949A (en) | Sulfanilamides | |
| US3564608A (en) | Selected n-acylsubstituted-n'-hydroxyguanidines | |
| US2913326A (en) | Propyl-n, n-diethylthiolcarbamate and use as herbicide | |
| US2901498A (en) | N-alkyl, n-allyl thiolcarbamate compositions | |
| US2916370A (en) | Chlorinated thiolcarbamates and their use as herbicides | |
| US4331807A (en) | Pyridazine urea plant growth regulators | |
| US4108627A (en) | N-(substituted phenyl) derivatives of saccharin | |
| US2977209A (en) | Method of combatting weeds | |
| US3536473A (en) | Method for regulating plant growth with a halogenated derivative of thiophenecarboxylic acid | |
| US3427146A (en) | Phenoxypyridazines as herbicides | |
| CS214672B2 (en) | Means for regulation of the plant growth and insecticide means and method of making the active substances | |
| US2913328A (en) | Isobutyl-n, n-diethylthiolcarbamate and use as herbicide | |
| US2893855A (en) | N-1-napthylchlorophthalamic herbicides | |
| US3246976A (en) | Method for controlling crab grass and water grass | |
| US3000940A (en) | Perchlorylarylureas | |
| KR830001038B1 (ko) | 1, 3-디티오 복소환 화합물을 함유하는 제초제 조성물 | |
| US2913325A (en) | Amyl-n, n-diethylthiolcarbamate and use as herbicide | |
| US3246974A (en) | Method of controlling water grass | |
| US3518075A (en) | Method of controlling weeds | |
| US2980578A (en) | Method of combating plant-attacking fungus | |
| US3116995A (en) | Method for destroying undesired plant life | |
| US3383195A (en) | m-(3, 3-dimethylureido) phenyl dimethyl-sulfamate as a herbicide |