UA62002C2 - A method for cyclizing hydrolysis of an aminonitrile compound into a lactam - Google Patents
A method for cyclizing hydrolysis of an aminonitrile compound into a lactam Download PDFInfo
- Publication number
- UA62002C2 UA62002C2 UA2001021193A UA2001021193A UA62002C2 UA 62002 C2 UA62002 C2 UA 62002C2 UA 2001021193 A UA2001021193 A UA 2001021193A UA 2001021193 A UA2001021193 A UA 2001021193A UA 62002 C2 UA62002 C2 UA 62002C2
- Authority
- UA
- Ukraine
- Prior art keywords
- catalyst
- pore volume
- fact
- pores
- diameter
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 49
- 150000003951 lactams Chemical class 0.000 title claims abstract description 30
- -1 aminonitrile compound Chemical class 0.000 title claims abstract description 11
- 230000007062 hydrolysis Effects 0.000 title abstract description 5
- 238000006460 hydrolysis reaction Methods 0.000 title abstract description 5
- 239000003054 catalyst Substances 0.000 claims abstract description 64
- 150000001875 compounds Chemical class 0.000 claims abstract description 30
- 239000011148 porous material Substances 0.000 claims description 53
- 230000003301 hydrolyzing effect Effects 0.000 claims description 18
- 238000007363 ring formation reaction Methods 0.000 claims description 18
- 125000005219 aminonitrile group Chemical group 0.000 claims description 15
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical group O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 claims description 14
- 150000001450 anions Chemical class 0.000 claims description 12
- 238000006243 chemical reaction Methods 0.000 claims description 12
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 11
- 239000011324 bead Substances 0.000 claims description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 11
- 229910052809 inorganic oxide Inorganic materials 0.000 claims description 10
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 claims description 8
- 229910052710 silicon Inorganic materials 0.000 claims description 8
- 239000010703 silicon Substances 0.000 claims description 8
- 239000000203 mixture Substances 0.000 claims description 7
- 229910052720 vanadium Inorganic materials 0.000 claims description 7
- GPPXJZIENCGNKB-UHFFFAOYSA-N vanadium Chemical compound [V]#[V] GPPXJZIENCGNKB-UHFFFAOYSA-N 0.000 claims description 7
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 claims description 6
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 6
- 229910052750 molybdenum Inorganic materials 0.000 claims description 6
- 239000011733 molybdenum Substances 0.000 claims description 6
- 229910052757 nitrogen Inorganic materials 0.000 claims description 6
- 229910052698 phosphorus Inorganic materials 0.000 claims description 6
- 239000011574 phosphorus Substances 0.000 claims description 6
- 229910052761 rare earth metal Inorganic materials 0.000 claims description 6
- 150000002910 rare earth metals Chemical class 0.000 claims description 6
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 claims description 6
- 229910052721 tungsten Inorganic materials 0.000 claims description 6
- 239000010937 tungsten Substances 0.000 claims description 6
- 239000012808 vapor phase Substances 0.000 claims description 6
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 claims description 5
- 229910052758 niobium Inorganic materials 0.000 claims description 5
- 239000010955 niobium Substances 0.000 claims description 5
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 claims description 5
- 239000002245 particle Substances 0.000 claims description 5
- 229910052715 tantalum Inorganic materials 0.000 claims description 5
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 claims description 5
- 229910052726 zirconium Inorganic materials 0.000 claims description 5
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 4
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 4
- 229910052785 arsenic Inorganic materials 0.000 claims description 4
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 claims description 4
- 239000010936 titanium Substances 0.000 claims description 4
- 229910052719 titanium Inorganic materials 0.000 claims description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 3
- 125000001931 aliphatic group Chemical group 0.000 claims description 3
- 229910052782 aluminium Inorganic materials 0.000 claims description 3
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 3
- 239000007787 solid Substances 0.000 claims description 3
- 238000001179 sorption measurement Methods 0.000 claims description 3
- 239000011593 sulfur Substances 0.000 claims description 3
- 229910052717 sulfur Inorganic materials 0.000 claims description 3
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 claims description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 2
- 150000001342 alkaline earth metals Chemical class 0.000 claims description 2
- 229910052796 boron Inorganic materials 0.000 claims description 2
- 229910052799 carbon Inorganic materials 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 239000011737 fluorine Substances 0.000 claims description 2
- 229910052731 fluorine Inorganic materials 0.000 claims description 2
- 229910052732 germanium Inorganic materials 0.000 claims description 2
- GNPVGFCGXDBREM-UHFFFAOYSA-N germanium atom Chemical compound [Ge] GNPVGFCGXDBREM-UHFFFAOYSA-N 0.000 claims description 2
- 239000008187 granular material Substances 0.000 claims description 2
- 229910052735 hafnium Inorganic materials 0.000 claims description 2
- VBJZVLUMGGDVMO-UHFFFAOYSA-N hafnium atom Chemical compound [Hf] VBJZVLUMGGDVMO-UHFFFAOYSA-N 0.000 claims description 2
- 238000001556 precipitation Methods 0.000 claims description 2
- 239000011949 solid catalyst Substances 0.000 claims description 2
- 241000264877 Hippospongia communis Species 0.000 claims 1
- 229910052706 scandium Inorganic materials 0.000 claims 1
- SIXSYDAISGFNSX-UHFFFAOYSA-N scandium atom Chemical compound [Sc] SIXSYDAISGFNSX-UHFFFAOYSA-N 0.000 claims 1
- 238000012876 topography Methods 0.000 claims 1
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 abstract description 41
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 abstract description 7
- FHKPTEOFUHYQFY-UHFFFAOYSA-N 2-aminohexanenitrile Chemical compound CCCCC(N)C#N FHKPTEOFUHYQFY-UHFFFAOYSA-N 0.000 abstract description 6
- 238000005470 impregnation Methods 0.000 abstract description 6
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 abstract 1
- 229910052760 oxygen Inorganic materials 0.000 abstract 1
- 239000001301 oxygen Substances 0.000 abstract 1
- 230000015572 biosynthetic process Effects 0.000 description 12
- 239000000243 solution Substances 0.000 description 11
- 238000004519 manufacturing process Methods 0.000 description 10
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 6
- 238000001354 calcination Methods 0.000 description 6
- 239000003792 electrolyte Substances 0.000 description 5
- 239000002609 medium Substances 0.000 description 5
- 238000000746 purification Methods 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- AMIMRNSIRUDHCM-UHFFFAOYSA-N Isopropylaldehyde Chemical compound CC(C)C=O AMIMRNSIRUDHCM-UHFFFAOYSA-N 0.000 description 4
- 238000006555 catalytic reaction Methods 0.000 description 4
- 238000001035 drying Methods 0.000 description 4
- 239000011521 glass Substances 0.000 description 4
- 238000002156 mixing Methods 0.000 description 4
- 229920000642 polymer Polymers 0.000 description 4
- 238000007086 side reaction Methods 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 229920002292 Nylon 6 Polymers 0.000 description 3
- 239000004952 Polyamide Substances 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- 238000010521 absorption reaction Methods 0.000 description 3
- 238000004458 analytical method Methods 0.000 description 3
- 229910052786 argon Inorganic materials 0.000 description 3
- 230000003197 catalytic effect Effects 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- 238000005516 engineering process Methods 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 150000002466 imines Chemical class 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 229920002647 polyamide Polymers 0.000 description 3
- 239000012286 potassium permanganate Substances 0.000 description 3
- 239000002243 precursor Substances 0.000 description 3
- 238000011084 recovery Methods 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- 238000005345 coagulation Methods 0.000 description 2
- 230000015271 coagulation Effects 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 238000001125 extrusion Methods 0.000 description 2
- 239000000835 fiber Substances 0.000 description 2
- 238000004817 gas chromatography Methods 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000000178 monomer Substances 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 230000001590 oxidative effect Effects 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 229910052814 silicon oxide Inorganic materials 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 239000004753 textile Substances 0.000 description 2
- 238000004448 titration Methods 0.000 description 2
- DEVSOMFAQLZNKR-RJRFIUFISA-N (z)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-n'-pyrazin-2-ylprop-2-enehydrazide Chemical compound FC(F)(F)C1=CC(C(F)(F)F)=CC(C2=NN(\C=C/C(=O)NNC=3N=CC=NC=3)C=N2)=C1 DEVSOMFAQLZNKR-RJRFIUFISA-N 0.000 description 1
- GRIQUVSERHHWAY-UHFFFAOYSA-N 2-(methylamino)pentanenitrile Chemical compound CCCC(NC)C#N GRIQUVSERHHWAY-UHFFFAOYSA-N 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- MXRIRQGCELJRSN-UHFFFAOYSA-N O.O.O.[Al] Chemical compound O.O.O.[Al] MXRIRQGCELJRSN-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 101100299498 Xenopus laevis pteg gene Proteins 0.000 description 1
- 230000004931 aggregating effect Effects 0.000 description 1
- 238000004220 aggregation Methods 0.000 description 1
- 230000002776 aggregation Effects 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 239000012300 argon atmosphere Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 229910001680 bayerite Inorganic materials 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 229910052797 bismuth Inorganic materials 0.000 description 1
- JCXGWMGPZLAOME-UHFFFAOYSA-N bismuth atom Chemical compound [Bi] JCXGWMGPZLAOME-UHFFFAOYSA-N 0.000 description 1
- 238000004364 calculation method Methods 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 150000001924 cycloalkanes Chemical class 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000005265 energy consumption Methods 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000004088 foaming agent Substances 0.000 description 1
- 229910001679 gibbsite Inorganic materials 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229910052734 helium Inorganic materials 0.000 description 1
- 239000001307 helium Substances 0.000 description 1
- SWQJXJOGLNCZEY-UHFFFAOYSA-N helium atom Chemical compound [He] SWQJXJOGLNCZEY-UHFFFAOYSA-N 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 229910001682 nordstrandite Inorganic materials 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000012086 standard solution Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D201/00—Preparation, separation, purification or stabilisation of unsubstituted lactams
- C07D201/02—Preparation of lactams
- C07D201/08—Preparation of lactams from carboxylic acids or derivatives thereof, e.g. hydroxy carboxylic acids, lactones or nitriles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Catalysts (AREA)
- Other In-Based Heterocyclic Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Hydrogenated Pyridines (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR9809529A FR2781480B1 (fr) | 1998-07-22 | 1998-07-22 | Procede d'hydrolyse cyclisante d'un compose aminonitrile en lactame |
| PCT/FR1999/001730 WO2000005203A1 (fr) | 1998-07-22 | 1999-07-15 | Procede d'hydrolyse cyclisante d'un compose aminonitrile en lactame |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| UA62002C2 true UA62002C2 (en) | 2003-12-15 |
Family
ID=9529009
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| UA2001021193A UA62002C2 (en) | 1998-07-22 | 1999-07-15 | A method for cyclizing hydrolysis of an aminonitrile compound into a lactam |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US6479658B1 (zh) |
| EP (1) | EP1098875B1 (zh) |
| JP (1) | JP4017345B2 (zh) |
| KR (1) | KR100438474B1 (zh) |
| CN (1) | CN1176073C (zh) |
| AT (1) | ATE258917T1 (zh) |
| BR (1) | BR9912338A (zh) |
| CA (1) | CA2337326A1 (zh) |
| DE (1) | DE69914606T2 (zh) |
| ES (1) | ES2211114T3 (zh) |
| FR (1) | FR2781480B1 (zh) |
| ID (1) | ID28697A (zh) |
| PL (1) | PL345597A1 (zh) |
| RU (1) | RU2199528C2 (zh) |
| SK (1) | SK1092001A3 (zh) |
| UA (1) | UA62002C2 (zh) |
| WO (1) | WO2000005203A1 (zh) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2822465A1 (fr) * | 2001-03-21 | 2002-09-27 | Rhodia Polyamide Intermediates | Procede d'hydrolyse cyclisante d'un compose aminonitrile en lactame |
| DE10223827A1 (de) * | 2002-05-28 | 2003-12-11 | Basf Ag | Verfahren zur Reduzierung des Gehalts an einem ungesättigten Amin in einer Mischung enthaltend ein Aminonitril, ein Diamin, ein Dinitril oder deren Gemische |
| US6858728B2 (en) * | 2003-06-17 | 2005-02-22 | Invista North America S.A.R.L. | Method for making caprolactam from impure ACN in which THA is not removed until after caprolactam is produced |
| FR2944791B1 (fr) | 2009-04-27 | 2012-02-10 | Rhodia Operations | Procede de preparation de lactames. |
| CN108911973B (zh) * | 2018-06-04 | 2021-04-13 | 湖南海利常德农药化工有限公司 | 一种利用水杨腈生产废水制备水杨酸的方法 |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2357484A (en) * | 1941-09-12 | 1944-09-05 | Du Pont | Process for producing compounds containing an n-substituted amide group |
| US4625023A (en) * | 1985-09-03 | 1986-11-25 | Allied Corporation | Selective conversion of aliphatic and aromatic aminonitriles and/or dinitriles into lactams |
| US4628085A (en) * | 1985-09-03 | 1986-12-09 | Allied Corporation | Use of silica catalyst for selective production of lactams |
| FR2729949A1 (fr) * | 1995-01-27 | 1996-08-02 | Rhone Poulenc Chimie | Procede de preparation de lactame |
| FR2735471B1 (fr) * | 1995-06-16 | 1997-08-22 | Rhone Poulenc Chimie | Procede de preparation de lactames |
| DE19632006A1 (de) * | 1996-08-08 | 1998-02-12 | Bayer Ag | Verfahren zur Herstellung von Lactamen |
-
1998
- 1998-07-22 FR FR9809529A patent/FR2781480B1/fr not_active Expired - Fee Related
-
1999
- 1999-07-15 RU RU2001104899/04A patent/RU2199528C2/ru not_active IP Right Cessation
- 1999-07-15 WO PCT/FR1999/001730 patent/WO2000005203A1/fr active IP Right Grant
- 1999-07-15 US US09/744,210 patent/US6479658B1/en not_active Expired - Lifetime
- 1999-07-15 CA CA002337326A patent/CA2337326A1/fr not_active Abandoned
- 1999-07-15 AT AT99931348T patent/ATE258917T1/de not_active IP Right Cessation
- 1999-07-15 ID IDW20010426A patent/ID28697A/id unknown
- 1999-07-15 JP JP2000561160A patent/JP4017345B2/ja not_active Expired - Fee Related
- 1999-07-15 SK SK109-2001A patent/SK1092001A3/sk unknown
- 1999-07-15 DE DE69914606T patent/DE69914606T2/de not_active Expired - Lifetime
- 1999-07-15 UA UA2001021193A patent/UA62002C2/uk unknown
- 1999-07-15 EP EP99931348A patent/EP1098875B1/fr not_active Expired - Lifetime
- 1999-07-15 ES ES99931348T patent/ES2211114T3/es not_active Expired - Lifetime
- 1999-07-15 CN CNB998109606A patent/CN1176073C/zh not_active Expired - Fee Related
- 1999-07-15 PL PL99345597A patent/PL345597A1/xx not_active Application Discontinuation
- 1999-07-15 BR BR9912338-0A patent/BR9912338A/pt not_active Application Discontinuation
- 1999-07-15 KR KR10-2001-7001035A patent/KR100438474B1/ko not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| SK1092001A3 (en) | 2001-09-11 |
| KR100438474B1 (ko) | 2004-07-03 |
| CN1176073C (zh) | 2004-11-17 |
| BR9912338A (pt) | 2002-01-29 |
| EP1098875A1 (fr) | 2001-05-16 |
| ATE258917T1 (de) | 2004-02-15 |
| WO2000005203A1 (fr) | 2000-02-03 |
| JP2002521361A (ja) | 2002-07-16 |
| ID28697A (id) | 2001-06-28 |
| CA2337326A1 (fr) | 2000-02-03 |
| EP1098875B1 (fr) | 2004-02-04 |
| PL345597A1 (en) | 2001-12-17 |
| DE69914606T2 (de) | 2005-01-05 |
| DE69914606D1 (de) | 2004-03-11 |
| ES2211114T3 (es) | 2004-07-01 |
| RU2199528C2 (ru) | 2003-02-27 |
| KR20010088784A (ko) | 2001-09-28 |
| JP4017345B2 (ja) | 2007-12-05 |
| CN1318048A (zh) | 2001-10-17 |
| US6479658B1 (en) | 2002-11-12 |
| FR2781480B1 (fr) | 2001-06-01 |
| FR2781480A1 (fr) | 2000-01-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP3053114B2 (ja) | ラクタムの製法 | |
| JPH09505570A (ja) | カプロラクタムの製造方法 | |
| US4628085A (en) | Use of silica catalyst for selective production of lactams | |
| KR0159098B1 (ko) | 카프로락탐의 연속 정제방법 | |
| UA62002C2 (en) | A method for cyclizing hydrolysis of an aminonitrile compound into a lactam | |
| JP2898604B2 (ja) | ラクタムの製造方法 | |
| BG63303B1 (bg) | Метод за получаване на капролактам | |
| Lambert et al. | The catalytic oxidation of cyclohexanone to caprolactone using hexagonal mesoporous silica supported SbF 3 | |
| KR930010993B1 (ko) | 히드라진 수화물 수용액의 정제방법 | |
| US6677448B1 (en) | Method for reactivating a catalyst for cyclizing hydrolysis of an aminonitrile into a lactam and use of the regenerated catalyst for making lactams | |
| MXPA01000749A (en) | Method for cyclizing hydrolysis of an aminonitrile compound into lactam | |
| RU2136588C1 (ru) | Способ получения гидроксиламмониевых солей | |
| KR100203200B1 (ko) | 다공성 구형 알루미나 담체의 제조 방법 | |
| CZ2001256A3 (cs) | Způsob cyklizační hydrolýzy aminonitrilové sloučeniny na laktam | |
| US3886196A (en) | Magnesium-aluminum-silicate-phosphate catalysts for ammonialytic cleavage of lactams to form omega-aminonitriles | |
| JPH03127745A (ja) | プロピレンの製造方法 | |
| MXPA97008676A (en) | Caprolact preparation | |
| KR960010901B1 (ko) | 구형 알루미나 촉매지지체의 제조방법 | |
| CA1142697A (en) | Removal of residual catalyst from polyolefin polymers | |
| MXPA01000745A (en) | Method for reactivating a catalyst for cyclizing hydrolysis of an aminonitrile into a lactam and use of the regenerated catalyst for making lactams | |
| JP3218124B2 (ja) | トリオキサンの製造法 | |
| KR20030093264A (ko) | 락탐을 수득하기 위한 아미노니트릴 화합물의 가수분해적고리화 방법 |