TWI532483B - 喹啉衍生物及含此衍生物之melk抑制劑 - Google Patents
喹啉衍生物及含此衍生物之melk抑制劑Info
- Publication number
- TWI532483B TWI532483B TW100126942A TW100126942A TWI532483B TW I532483 B TWI532483 B TW I532483B TW 100126942 A TW100126942 A TW 100126942A TW 100126942 A TW100126942 A TW 100126942A TW I532483 B TWI532483 B TW I532483B
- Authority
- TW
- Taiwan
- Prior art keywords
- group
- mmol
- amino
- alkyl
- substituent
- Prior art date
Links
- 125000002943 quinolinyl group Chemical class N1=C(C=CC2=CC=CC=C12)* 0.000 title description 6
- 229940124787 MELK inhibitor Drugs 0.000 title description 2
- 229940027991 antiseptic and disinfectant quinoline derivative Drugs 0.000 title 1
- -1 ureido, ureido benzyl group Chemical group 0.000 claims description 317
- 125000001424 substituent group Chemical group 0.000 claims description 247
- 125000004548 quinolin-3-yl group Chemical group N1=CC(=CC2=CC=CC=C12)* 0.000 claims description 117
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 89
- 125000003277 amino group Chemical group 0.000 claims description 88
- 125000001931 aliphatic group Chemical group 0.000 claims description 85
- 125000000623 heterocyclic group Chemical group 0.000 claims description 85
- 150000001875 compounds Chemical class 0.000 claims description 81
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 73
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 71
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 69
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 69
- 150000003839 salts Chemical class 0.000 claims description 67
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 57
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 claims description 50
- 125000006615 aromatic heterocyclic group Chemical group 0.000 claims description 46
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 41
- 150000001412 amines Chemical class 0.000 claims description 36
- 125000003161 (C1-C6) alkylene group Chemical group 0.000 claims description 33
- 229910052757 nitrogen Inorganic materials 0.000 claims description 30
- 125000004890 (C1-C6) alkylamino group Chemical group 0.000 claims description 27
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 26
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 23
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 claims description 21
- 125000000217 alkyl group Chemical group 0.000 claims description 21
- 102100024299 Maternal embryonic leucine zipper kinase Human genes 0.000 claims description 17
- 101710154611 Maternal embryonic leucine zipper kinase Proteins 0.000 claims description 17
- 125000005843 halogen group Chemical group 0.000 claims description 15
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 claims description 14
- UFUASNAHBMBJIX-UHFFFAOYSA-N propan-1-one Chemical compound CC[C]=O UFUASNAHBMBJIX-UHFFFAOYSA-N 0.000 claims description 13
- 125000006376 (C3-C10) cycloalkyl group Chemical group 0.000 claims description 12
- 125000006577 C1-C6 hydroxyalkyl group Chemical group 0.000 claims description 12
- 125000003118 aryl group Chemical group 0.000 claims description 12
- 239000004480 active ingredient Substances 0.000 claims description 11
- 206010028980 Neoplasm Diseases 0.000 claims description 10
- 239000008194 pharmaceutical composition Substances 0.000 claims description 10
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 10
- 125000004739 (C1-C6) alkylsulfonyl group Chemical group 0.000 claims description 9
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 claims description 9
- 125000004845 (C1-C6) alkylsulfonylamino group Chemical group 0.000 claims description 8
- 206010006187 Breast cancer Diseases 0.000 claims description 8
- 208000026310 Breast neoplasm Diseases 0.000 claims description 8
- 201000011510 cancer Diseases 0.000 claims description 8
- 201000010099 disease Diseases 0.000 claims description 8
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims description 8
- 125000003386 piperidinyl group Chemical group 0.000 claims description 6
- 206010005003 Bladder cancer Diseases 0.000 claims description 5
- 208000007097 Urinary Bladder Neoplasms Diseases 0.000 claims description 5
- 201000005112 urinary bladder cancer Diseases 0.000 claims description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 4
- 206010058467 Lung neoplasm malignant Diseases 0.000 claims description 4
- 201000005202 lung cancer Diseases 0.000 claims description 4
- 208000020816 lung neoplasm Diseases 0.000 claims description 4
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 claims description 4
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 claims description 3
- 230000002018 overexpression Effects 0.000 claims description 3
- 208000002495 Uterine Neoplasms Diseases 0.000 claims description 2
- 201000011199 bladder lymphoma Diseases 0.000 claims description 2
- 125000004550 quinolin-6-yl group Chemical group N1=CC=CC2=CC(=CC=C12)* 0.000 claims description 2
- 206010046766 uterine cancer Diseases 0.000 claims description 2
- CKJNUZNMWOVDFN-UHFFFAOYSA-N methanone Chemical compound O=[CH-] CKJNUZNMWOVDFN-UHFFFAOYSA-N 0.000 claims 4
- UYIMHVQEXCPIKN-RUCARUNLSA-N C1C[C@@H](CN(C)C)CC[C@@H]1NC1=C(C(C)=O)C=NC2=CC=C(C=3C=C(Cl)C(O)=C(F)C=3)C=C12 Chemical compound C1C[C@@H](CN(C)C)CC[C@@H]1NC1=C(C(C)=O)C=NC2=CC=C(C=3C=C(Cl)C(O)=C(F)C=3)C=C12 UYIMHVQEXCPIKN-RUCARUNLSA-N 0.000 claims 1
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 claims 1
- 239000003814 drug Substances 0.000 claims 1
- 238000002330 electrospray ionisation mass spectrometry Methods 0.000 description 405
- 239000007787 solid Substances 0.000 description 396
- 239000000047 product Substances 0.000 description 389
- 238000000034 method Methods 0.000 description 343
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 283
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 270
- 238000005481 NMR spectroscopy Methods 0.000 description 212
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 189
- 238000004128 high performance liquid chromatography Methods 0.000 description 174
- 239000000243 solution Substances 0.000 description 167
- 238000006243 chemical reaction Methods 0.000 description 159
- FQFILJKFZCVHNH-UHFFFAOYSA-N tert-butyl n-[3-[(5-bromo-2-chloropyrimidin-4-yl)amino]propyl]carbamate Chemical compound CC(C)(C)OC(=O)NCCCNC1=NC(Cl)=NC=C1Br FQFILJKFZCVHNH-UHFFFAOYSA-N 0.000 description 133
- 235000019439 ethyl acetate Nutrition 0.000 description 121
- 239000011541 reaction mixture Substances 0.000 description 113
- 239000000460 chlorine Substances 0.000 description 109
- 239000000203 mixture Substances 0.000 description 94
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 93
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 87
- SKMHXQZCLNKWIE-UHFFFAOYSA-N (6-bromo-4-chloroquinolin-3-yl)-cyclopropylmethanone Chemical compound C1=NC2=CC=C(Br)C=C2C(Cl)=C1C(=O)C1CC1 SKMHXQZCLNKWIE-UHFFFAOYSA-N 0.000 description 70
- OKKJLVBELUTLKV-VMNATFBRSA-N methanol-d1 Chemical compound [2H]OC OKKJLVBELUTLKV-VMNATFBRSA-N 0.000 description 60
- 239000012044 organic layer Substances 0.000 description 59
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 58
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 57
- 239000000725 suspension Substances 0.000 description 55
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 54
- WSFSSNUMVMOOMR-BJUDXGSMSA-N methanone Chemical compound O=[11CH2] WSFSSNUMVMOOMR-BJUDXGSMSA-N 0.000 description 53
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 50
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 48
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 47
- 239000002253 acid Substances 0.000 description 46
- 229910052736 halogen Inorganic materials 0.000 description 44
- 150000002367 halogens Chemical class 0.000 description 44
- IAVSUBSFIDLDNW-UHFFFAOYSA-N 2,6-dichloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol Chemical compound O1C(C)(C)C(C)(C)OB1C1=CC(Cl)=C(O)C(Cl)=C1 IAVSUBSFIDLDNW-UHFFFAOYSA-N 0.000 description 43
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 42
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 42
- 150000001335 aliphatic alkanes Chemical class 0.000 description 36
- 229960003742 phenol Drugs 0.000 description 34
- 229920006395 saturated elastomer Polymers 0.000 description 34
- KFZMGEQAYNKOFK-UHFFFAOYSA-N isopropyl alcohol Natural products CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 32
- KDLHZDBZIXYQEI-UHFFFAOYSA-N palladium Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 30
- TZSUMDMNMCGUEP-UHFFFAOYSA-N 1-(6-bromo-4-chloroquinolin-3-yl)ethanone Chemical compound C1=CC(Br)=CC2=C(Cl)C(C(=O)C)=CN=C21 TZSUMDMNMCGUEP-UHFFFAOYSA-N 0.000 description 29
- CEBBVCKDURRDBD-UHFFFAOYSA-N 2-chloro-6-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol Chemical compound O1C(C)(C)C(C)(C)OB1C1=CC(F)=C(O)C(Cl)=C1 CEBBVCKDURRDBD-UHFFFAOYSA-N 0.000 description 29
- XBEJPOZGAPQFPL-UHFFFAOYSA-N 2-chloro-6-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol Chemical compound ClC1=C(O)C(OC)=CC(B2OC(C)(C)C(C)(C)O2)=C1 XBEJPOZGAPQFPL-UHFFFAOYSA-N 0.000 description 29
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 29
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 29
- 239000007795 chemical reaction product Substances 0.000 description 29
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 29
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 28
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 26
- FDPIMTJIUBPUKL-UHFFFAOYSA-N dimethylacetone Natural products CCC(=O)CC FDPIMTJIUBPUKL-UHFFFAOYSA-N 0.000 description 25
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 24
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 24
- 229910000420 cerium oxide Inorganic materials 0.000 description 24
- BMMGVYCKOGBVEV-UHFFFAOYSA-N oxo(oxoceriooxy)cerium Chemical compound [Ce]=O.O=[Ce]=O BMMGVYCKOGBVEV-UHFFFAOYSA-N 0.000 description 24
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 22
- 238000004440 column chromatography Methods 0.000 description 21
- 239000002585 base Substances 0.000 description 20
- 239000002244 precipitate Substances 0.000 description 20
- DCKVNWZUADLDEH-UHFFFAOYSA-N sec-butyl acetate Chemical compound CCC(C)OC(C)=O DCKVNWZUADLDEH-UHFFFAOYSA-N 0.000 description 20
- KZPYGQFFRCFCPP-UHFFFAOYSA-N 1,1'-bis(diphenylphosphino)ferrocene Chemical compound [Fe+2].C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1 KZPYGQFFRCFCPP-UHFFFAOYSA-N 0.000 description 19
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 19
- 150000002148 esters Chemical class 0.000 description 19
- 239000007789 gas Substances 0.000 description 19
- 239000000543 intermediate Substances 0.000 description 19
- 238000000668 atmospheric pressure chemical ionisation mass spectrometry Methods 0.000 description 18
- 239000012043 crude product Substances 0.000 description 18
- BAZVFQBTJPBRTJ-UHFFFAOYSA-N 2-chloro-5-nitropyridine Chemical compound [O-][N+](=O)C1=CC=C(Cl)N=C1 BAZVFQBTJPBRTJ-UHFFFAOYSA-N 0.000 description 17
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 17
- 238000002953 preparative HPLC Methods 0.000 description 17
- 125000003107 substituted aryl group Chemical group 0.000 description 17
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 16
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 15
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 15
- RWTNPBWLLIMQHL-UHFFFAOYSA-N fexofenadine Chemical compound C1=CC(C(C)(C(O)=O)C)=CC=C1C(O)CCCN1CCC(C(O)(C=2C=CC=CC=2)C=2C=CC=CC=2)CC1 RWTNPBWLLIMQHL-UHFFFAOYSA-N 0.000 description 15
- 230000002829 reductive effect Effects 0.000 description 15
- 239000011777 magnesium Substances 0.000 description 14
- 230000000007 visual effect Effects 0.000 description 14
- 239000003921 oil Substances 0.000 description 13
- 235000019198 oils Nutrition 0.000 description 13
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 12
- 125000000753 cycloalkyl group Chemical group 0.000 description 12
- GKASDNZWUGIAMG-UHFFFAOYSA-N triethyl orthoformate Chemical compound CCOC(OCC)OCC GKASDNZWUGIAMG-UHFFFAOYSA-N 0.000 description 12
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 11
- 239000000706 filtrate Substances 0.000 description 11
- 238000003818 flash chromatography Methods 0.000 description 11
- MBABOKRGFJTBAE-UHFFFAOYSA-N methyl methanesulfonate Chemical compound COS(C)(=O)=O MBABOKRGFJTBAE-UHFFFAOYSA-N 0.000 description 11
- DXASQZJWWGZNSF-UHFFFAOYSA-N n,n-dimethylmethanamine;sulfur trioxide Chemical group CN(C)C.O=S(=O)=O DXASQZJWWGZNSF-UHFFFAOYSA-N 0.000 description 11
- 125000004076 pyridyl group Chemical group 0.000 description 11
- MHCVCKDNQYMGEX-UHFFFAOYSA-N 1,1'-biphenyl;phenoxybenzene Chemical compound C1=CC=CC=C1C1=CC=CC=C1.C=1C=CC=CC=1OC1=CC=CC=C1 MHCVCKDNQYMGEX-UHFFFAOYSA-N 0.000 description 10
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 10
- 125000004429 atom Chemical group 0.000 description 10
- NZNMSOFKMUBTKW-UHFFFAOYSA-N cyclohexanecarboxylic acid Chemical compound OC(=O)C1CCCCC1 NZNMSOFKMUBTKW-UHFFFAOYSA-N 0.000 description 10
- 239000012458 free base Substances 0.000 description 10
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 10
- 239000000463 material Substances 0.000 description 10
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 10
- 239000007864 aqueous solution Substances 0.000 description 9
- 239000012267 brine Substances 0.000 description 9
- 125000006222 dimethylaminomethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])* 0.000 description 9
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 9
- 238000004895 liquid chromatography mass spectrometry Methods 0.000 description 9
- 239000011734 sodium Substances 0.000 description 9
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 9
- 229910052717 sulfur Inorganic materials 0.000 description 9
- OLOLNAQGBLYQRK-UHFFFAOYSA-N 1-(6-bromo-4-chloroquinolin-3-yl)propan-1-one Chemical compound C1=CC(Br)=CC2=C(Cl)C(C(=O)CC)=CN=C21 OLOLNAQGBLYQRK-UHFFFAOYSA-N 0.000 description 8
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 8
- 235000011054 acetic acid Nutrition 0.000 description 8
- NMJJFJNHVMGPGM-UHFFFAOYSA-N butyl formate Chemical compound CCCCOC=O NMJJFJNHVMGPGM-UHFFFAOYSA-N 0.000 description 8
- 125000004432 carbon atom Chemical group C* 0.000 description 8
- 210000004027 cell Anatomy 0.000 description 8
- OJCSPXHYDFONPU-UHFFFAOYSA-N etoac etoac Chemical compound CCOC(C)=O.CCOC(C)=O OJCSPXHYDFONPU-UHFFFAOYSA-N 0.000 description 8
- 150000002576 ketones Chemical class 0.000 description 8
- 239000010410 layer Substances 0.000 description 8
- 125000001820 oxy group Chemical group [*:1]O[*:2] 0.000 description 8
- 125000004430 oxygen atom Chemical group O* 0.000 description 8
- 238000003756 stirring Methods 0.000 description 8
- 125000004434 sulfur atom Chemical group 0.000 description 8
- 125000001544 thienyl group Chemical group 0.000 description 8
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical group CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 7
- BDAGIHXWWSANSR-UHFFFAOYSA-N Formic acid Chemical class OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 7
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 7
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 7
- 125000001951 carbamoylamino group Chemical group C(N)(=O)N* 0.000 description 7
- 230000008570 general process Effects 0.000 description 7
- 125000005842 heteroatom Chemical group 0.000 description 7
- 125000003226 pyrazolyl group Chemical group 0.000 description 7
- 125000000246 pyrimidin-2-yl group Chemical group [H]C1=NC(*)=NC([H])=C1[H] 0.000 description 7
- 125000000714 pyrimidinyl group Chemical group 0.000 description 7
- LFKDJXLFVYVEFG-UHFFFAOYSA-N tert-butyl carbamate Chemical compound CC(C)(C)OC(N)=O LFKDJXLFVYVEFG-UHFFFAOYSA-N 0.000 description 7
- NNCCQALFJIMRKB-UHFFFAOYSA-N 4-[(dimethylamino)methyl]aniline Chemical compound CN(C)CC1=CC=C(N)C=C1 NNCCQALFJIMRKB-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 6
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 6
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 6
- FKEZOXMCQQPVAW-UHFFFAOYSA-N [6-bromo-4-[4-[(dimethylamino)methyl]piperidin-1-yl]quinolin-3-yl]-cyclopropylmethanone Chemical compound C1CC(CN(C)C)CCN1C1=C(C(=O)C2CC2)C=NC2=CC=C(Br)C=C12 FKEZOXMCQQPVAW-UHFFFAOYSA-N 0.000 description 6
- GOQJNJAWPXMPOZ-UHFFFAOYSA-N [6-bromo-4-[[4-(diethylamino)cyclohexyl]amino]quinolin-3-yl]-cyclopropylmethanone Chemical compound C1CC(N(CC)CC)CCC1NC1=C(C(=O)C2CC2)C=NC2=CC=C(Br)C=C12 GOQJNJAWPXMPOZ-UHFFFAOYSA-N 0.000 description 6
- QTBSBXVTEAMEQO-GUEYOVJQSA-N acetic acid-d4 Chemical compound [2H]OC(=O)C([2H])([2H])[2H] QTBSBXVTEAMEQO-GUEYOVJQSA-N 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 6
- JMYVMOUINOAAPA-UHFFFAOYSA-N cyclopropanecarbaldehyde Chemical compound O=CC1CC1 JMYVMOUINOAAPA-UHFFFAOYSA-N 0.000 description 6
- 239000006260 foam Substances 0.000 description 6
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 6
- 229910052708 sodium Inorganic materials 0.000 description 6
- RUPAXCPQAAOIPB-UHFFFAOYSA-N tert-butyl formate Chemical compound CC(C)(C)OC=O RUPAXCPQAAOIPB-UHFFFAOYSA-N 0.000 description 6
- LPTMGLRSJZIYAE-UHFFFAOYSA-N 1-(6-bromo-4-chloroquinolin-3-yl)-2-methylpropan-1-one Chemical compound C1=CC(Br)=CC2=C(Cl)C(C(=O)C(C)C)=CN=C21 LPTMGLRSJZIYAE-UHFFFAOYSA-N 0.000 description 5
- RGCFVPSBPNJZAU-UHFFFAOYSA-N 1-(6-bromo-4-chloroquinolin-3-yl)butan-1-one Chemical compound C1=CC(Br)=CC2=C(Cl)C(C(=O)CCC)=CN=C21 RGCFVPSBPNJZAU-UHFFFAOYSA-N 0.000 description 5
- DNUTZBZXLPWRJG-UHFFFAOYSA-N 1-Piperidine carboxylic acid Chemical compound OC(=O)N1CCCCC1 DNUTZBZXLPWRJG-UHFFFAOYSA-N 0.000 description 5
- ZENKESXKWBIZCV-UHFFFAOYSA-N 2,2,4,4-tetrafluoro-1,3-benzodioxin-6-amine Chemical group O1C(F)(F)OC(F)(F)C2=CC(N)=CC=C21 ZENKESXKWBIZCV-UHFFFAOYSA-N 0.000 description 5
- KTQYJNVSVKKLGQ-UHFFFAOYSA-N 2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol Chemical compound O1C(C)(C)C(C)(C)OB1C1=CC(F)=C(O)C(F)=C1 KTQYJNVSVKKLGQ-UHFFFAOYSA-N 0.000 description 5
- OFCBNMYNAHUDGE-UHFFFAOYSA-N 2-chloro-5-nitropyrimidine Chemical compound [O-][N+](=O)C1=CN=C(Cl)N=C1 OFCBNMYNAHUDGE-UHFFFAOYSA-N 0.000 description 5
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 5
- WFSJROCEOJANPD-UHFFFAOYSA-N 2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol Chemical compound C1=C(O)C(OC)=CC(B2OC(C)(C)C(C)(C)O2)=C1 WFSJROCEOJANPD-UHFFFAOYSA-N 0.000 description 5
- WDFQBORIUYODSI-UHFFFAOYSA-N 4-bromoaniline Chemical compound NC1=CC=C(Br)C=C1 WDFQBORIUYODSI-UHFFFAOYSA-N 0.000 description 5
- DKLRMTJDWREBQA-UHFFFAOYSA-N 6-bromo-4-chloro-3-methylsulfonylquinoline Chemical compound C1=CC(Br)=CC2=C(Cl)C(S(=O)(=O)C)=CN=C21 DKLRMTJDWREBQA-UHFFFAOYSA-N 0.000 description 5
- 241000156724 Antirhea Species 0.000 description 5
- UBRXCANDFSOLLE-HDJSIYSDSA-N C1C[C@@H](N(C)C)CC[C@@H]1NC1=C(C(=O)C2CC2)C=NC2=CC(F)=C(Br)C=C12 Chemical compound C1C[C@@H](N(C)C)CC[C@@H]1NC1=C(C(=O)C2CC2)C=NC2=CC(F)=C(Br)C=C12 UBRXCANDFSOLLE-HDJSIYSDSA-N 0.000 description 5
- 101000933374 Gallus gallus Brain-specific homeobox/POU domain protein 3 Proteins 0.000 description 5
- LYERWNWLCXUXLV-UHFFFAOYSA-N [6-bromo-4-[4-(pyrrolidin-1-ylmethyl)piperidin-1-yl]quinolin-3-yl]-cyclopropylmethanone Chemical compound C1CC(CN2CCCC2)CCN1C=1C2=CC(Br)=CC=C2N=CC=1C(=O)C1CC1 LYERWNWLCXUXLV-UHFFFAOYSA-N 0.000 description 5
- NZJOXDUTUYSKPN-UHFFFAOYSA-N [6-bromo-4-[4-[1-(dimethylamino)ethyl]piperidin-1-yl]quinolin-3-yl]-cyclopropylmethanone Chemical compound C1CC(C(C)N(C)C)CCN1C1=C(C(=O)C2CC2)C=NC2=CC=C(Br)C=C12 NZJOXDUTUYSKPN-UHFFFAOYSA-N 0.000 description 5
- 125000005236 alkanoylamino group Chemical group 0.000 description 5
- PCDHSSHKDZYLLI-UHFFFAOYSA-N butan-1-one Chemical compound CCC[C]=O PCDHSSHKDZYLLI-UHFFFAOYSA-N 0.000 description 5
- VZFUCHSFHOYXIS-UHFFFAOYSA-N cycloheptane carboxylic acid Natural products OC(=O)C1CCCCCC1 VZFUCHSFHOYXIS-UHFFFAOYSA-N 0.000 description 5
- IDITVISEENJSMD-UHFFFAOYSA-N cyclopropylidenemethanone Chemical compound O=C=C1CC1 IDITVISEENJSMD-UHFFFAOYSA-N 0.000 description 5
- 239000011521 glass Substances 0.000 description 5
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 5
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 5
- 235000017557 sodium bicarbonate Nutrition 0.000 description 5
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 5
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- UOUFRTFWWBCVPV-UHFFFAOYSA-N tert-butyl 4-(2,4-dioxo-1H-thieno[3,2-d]pyrimidin-3-yl)piperidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC(CC1)n1c(=O)[nH]c2ccsc2c1=O UOUFRTFWWBCVPV-UHFFFAOYSA-N 0.000 description 5
- FREUJQIYZGGHID-UHFFFAOYSA-N (6-bromo-4-chloro-7-fluoroquinolin-3-yl)-cyclopropylmethanone Chemical compound ClC1=C2C=C(Br)C(F)=CC2=NC=C1C(=O)C1CC1 FREUJQIYZGGHID-UHFFFAOYSA-N 0.000 description 4
- 125000004738 (C1-C6) alkyl sulfinyl group Chemical group 0.000 description 4
- BGJSXRVXTHVRSN-UHFFFAOYSA-N 1,3,5-trioxane Chemical compound C1OCOCO1 BGJSXRVXTHVRSN-UHFFFAOYSA-N 0.000 description 4
- CUYKNJBYIJFRCU-UHFFFAOYSA-N 3-aminopyridine Chemical compound NC1=CC=CN=C1 CUYKNJBYIJFRCU-UHFFFAOYSA-N 0.000 description 4
- WONYQZCHGNGJRW-UHFFFAOYSA-N 6-piperidin-1-ylpyridin-3-amine Chemical compound N1=CC(N)=CC=C1N1CCCCC1 WONYQZCHGNGJRW-UHFFFAOYSA-N 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- 208000032791 BCR-ABL1 positive chronic myelogenous leukemia Diseases 0.000 description 4
- SGSNDOXLTJUILY-JCNLHEQBSA-N C1C[C@@H](CCN(C)C)CC[C@@H]1NC1=C(C(C)=O)C=NC2=CC=C(Br)C=C12 Chemical compound C1C[C@@H](CCN(C)C)CC[C@@H]1NC1=C(C(C)=O)C=NC2=CC=C(Br)C=C12 SGSNDOXLTJUILY-JCNLHEQBSA-N 0.000 description 4
- GPQCSKIKJMBVHH-CZIWCDLHSA-N C1C[C@@H](N(C)C)CC[C@@H]1CNC1=C(C(=O)C2CC2)C=NC2=CC=C(Br)C=C12 Chemical compound C1C[C@@H](N(C)C)CC[C@@H]1CNC1=C(C(=O)C2CC2)C=NC2=CC=C(Br)C=C12 GPQCSKIKJMBVHH-CZIWCDLHSA-N 0.000 description 4
- GAWQKEGDIGBNFK-WKILWMFISA-N C1C[C@@H](N(C)C)CC[C@@H]1NC1=C(C(=O)C2CC2)C=NC2=CC=C(Br)C=C12 Chemical compound C1C[C@@H](N(C)C)CC[C@@H]1NC1=C(C(=O)C2CC2)C=NC2=CC=C(Br)C=C12 GAWQKEGDIGBNFK-WKILWMFISA-N 0.000 description 4
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 4
- 208000010833 Chronic myeloid leukaemia Diseases 0.000 description 4
- 239000007821 HATU Substances 0.000 description 4
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 4
- 208000033761 Myelogenous Chronic BCR-ABL Positive Leukemia Diseases 0.000 description 4
- VVIDCYGIVSAREB-SAZUREKKSA-N OS(CC[C@H](CC1)CC[C@@H]1NC(C1=CC(Br)=CC=C1N=C1)=C1C(C1CC1)=O)(=O)=O Chemical compound OS(CC[C@H](CC1)CC[C@@H]1NC(C1=CC(Br)=CC=C1N=C1)=C1C(C1CC1)=O)(=O)=O VVIDCYGIVSAREB-SAZUREKKSA-N 0.000 description 4
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 206010041067 Small cell lung cancer Diseases 0.000 description 4
- 241000009298 Trigla lyra Species 0.000 description 4
- MWPLVEDNUUSJAV-UHFFFAOYSA-N anthracene Chemical compound C1=CC=CC2=CC3=CC=CC=C3C=C21 MWPLVEDNUUSJAV-UHFFFAOYSA-N 0.000 description 4
- 125000002619 bicyclic group Chemical group 0.000 description 4
- 230000003197 catalytic effect Effects 0.000 description 4
- USJRLGNYCQWLPF-UHFFFAOYSA-N chlorophosphane Chemical compound ClP USJRLGNYCQWLPF-UHFFFAOYSA-N 0.000 description 4
- 239000012230 colorless oil Substances 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- 125000000392 cycloalkenyl group Chemical group 0.000 description 4
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 4
- 230000014509 gene expression Effects 0.000 description 4
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 4
- 150000003840 hydrochlorides Chemical class 0.000 description 4
- 239000001257 hydrogen Substances 0.000 description 4
- 229910052739 hydrogen Inorganic materials 0.000 description 4
- 125000002883 imidazolyl group Chemical group 0.000 description 4
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 4
- 125000002950 monocyclic group Chemical group 0.000 description 4
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 4
- 230000000069 prophylactic effect Effects 0.000 description 4
- 238000000746 purification Methods 0.000 description 4
- 239000000377 silicon dioxide Substances 0.000 description 4
- 235000012239 silicon dioxide Nutrition 0.000 description 4
- 208000000587 small cell lung carcinoma Diseases 0.000 description 4
- DYHSDKLCOJIUFX-UHFFFAOYSA-N tert-butoxycarbonyl anhydride Chemical compound CC(C)(C)OC(=O)OC(=O)OC(C)(C)C DYHSDKLCOJIUFX-UHFFFAOYSA-N 0.000 description 4
- XBXCNNQPRYLIDE-UHFFFAOYSA-N tert-butylcarbamic acid Chemical compound CC(C)(C)NC(O)=O XBXCNNQPRYLIDE-UHFFFAOYSA-N 0.000 description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 4
- 230000001225 therapeutic effect Effects 0.000 description 4
- 125000004454 (C1-C6) alkoxycarbonyl group Chemical group 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- XBNGSFRSHCZYCX-UHFFFAOYSA-N 1-(6-bromo-4-chloroquinolin-3-yl)-3-methylbutan-1-one Chemical compound C1=CC(Br)=CC2=C(Cl)C(C(=O)CC(C)C)=CN=C21 XBNGSFRSHCZYCX-UHFFFAOYSA-N 0.000 description 3
- QGQJOJFBUPHXJU-UHFFFAOYSA-N 1-[1-(6-bromo-3-methylsulfonylquinolin-4-yl)piperidin-4-yl]-n,n-dimethylethanamine Chemical compound C1CC(C(C)N(C)C)CCN1C1=C(S(C)(=O)=O)C=NC2=CC=C(Br)C=C12 QGQJOJFBUPHXJU-UHFFFAOYSA-N 0.000 description 3
- VIWFABRENYMAEN-UHFFFAOYSA-N 1-[6-bromo-4-[4-(pyrrolidin-1-ylmethyl)anilino]quinolin-3-yl]ethanone Chemical compound CC(=O)C1=CN=C2C=CC(Br)=CC2=C1NC(C=C1)=CC=C1CN1CCCC1 VIWFABRENYMAEN-UHFFFAOYSA-N 0.000 description 3
- ZTSMUEWAZRPIOC-UHFFFAOYSA-N 1-[6-bromo-4-[4-(pyrrolidin-1-ylmethyl)piperidin-1-yl]quinolin-3-yl]ethanone Chemical compound CC(=O)C1=CN=C2C=CC(Br)=CC2=C1N(CC1)CCC1CN1CCCC1 ZTSMUEWAZRPIOC-UHFFFAOYSA-N 0.000 description 3
- WGQNVJPACHZCLS-UHFFFAOYSA-N 1-[6-bromo-4-[4-[(dimethylamino)methyl]anilino]quinolin-3-yl]-2-methylpropan-1-one Chemical compound CC(C)C(=O)C1=CN=C2C=CC(Br)=CC2=C1NC1=CC=C(CN(C)C)C=C1 WGQNVJPACHZCLS-UHFFFAOYSA-N 0.000 description 3
- ZSSQEHLCQDAWRD-UHFFFAOYSA-N 1-[6-bromo-4-[[1-(1-methylpyrrolidin-3-yl)pyrazol-4-yl]amino]quinolin-3-yl]ethanone Chemical compound C1N(C)CCC1N1N=CC(NC=2C3=CC(Br)=CC=C3N=CC=2C(C)=O)=C1 ZSSQEHLCQDAWRD-UHFFFAOYSA-N 0.000 description 3
- FVCUMESAHSEOQX-UHFFFAOYSA-N 1-[6-bromo-4-[[4-(diethylamino)cyclohexyl]amino]quinolin-3-yl]ethanone Chemical compound C1CC(N(CC)CC)CCC1NC1=C(C(C)=O)C=NC2=CC=C(Br)C=C12 FVCUMESAHSEOQX-UHFFFAOYSA-N 0.000 description 3
- 238000005160 1H NMR spectroscopy Methods 0.000 description 3
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 3
- SFEAIUCOZWDYMJ-UHFFFAOYSA-N 4-(pyrrolidin-1-ylmethyl)aniline Chemical compound C1=CC(N)=CC=C1CN1CCCC1 SFEAIUCOZWDYMJ-UHFFFAOYSA-N 0.000 description 3
- UZOFELREXGAFOI-UHFFFAOYSA-N 4-methylpiperidine Chemical compound CC1CCNCC1 UZOFELREXGAFOI-UHFFFAOYSA-N 0.000 description 3
- PURAXXHYQSQHAA-UHFFFAOYSA-N 6-pyrrolidin-1-ylpyridin-3-amine Chemical compound N1=CC(N)=CC=C1N1CCCC1 PURAXXHYQSQHAA-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- OHTCNNLJCIEVGN-CZIWCDLHSA-N C1C[C@@H](CN(C)C)CC[C@@H]1NC1=C(C(=O)C2CC2)C=NC2=CC=C(Br)C=C12 Chemical compound C1C[C@@H](CN(C)C)CC[C@@H]1NC1=C(C(=O)C2CC2)C=NC2=CC=C(Br)C=C12 OHTCNNLJCIEVGN-CZIWCDLHSA-N 0.000 description 3
- JDKNDLXNXKHINQ-KOMQPUFPSA-N C1C[C@@H](CN(C)C)CC[C@@H]1NC1=C(C(C)=O)C=NC2=CC=C(Br)C=C12 Chemical compound C1C[C@@H](CN(C)C)CC[C@@H]1NC1=C(C(C)=O)C=NC2=CC=C(Br)C=C12 JDKNDLXNXKHINQ-KOMQPUFPSA-N 0.000 description 3
- IYDKPYWZQWHEQF-KOMQPUFPSA-N CCC(=O)C1=CN=C2C=CC(Br)=CC2=C1N[C@H]1CC[C@H](CN(C)C)CC1 Chemical compound CCC(=O)C1=CN=C2C=CC(Br)=CC2=C1N[C@H]1CC[C@H](CN(C)C)CC1 IYDKPYWZQWHEQF-KOMQPUFPSA-N 0.000 description 3
- 206010008342 Cervix carcinoma Diseases 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 3
- KXMHLXIKAVEOMD-RUCARUNLSA-N N([C@@H]1CC[C@@H](CN2CCCC2)CC1)C=1C2=CC(Br)=CC=C2N=CC=1C(=O)C1CC1 Chemical compound N([C@@H]1CC[C@@H](CN2CCCC2)CC1)C=1C2=CC(Br)=CC=C2N=CC=1C(=O)C1CC1 KXMHLXIKAVEOMD-RUCARUNLSA-N 0.000 description 3
- RLMBCBIGDSADNE-IYARVYRRSA-N N([C@@H]1CC[C@H](CC1)N1CCCC1)C=1C2=CC(Br)=CC=C2N=CC=1C(=O)C1CC1 Chemical compound N([C@@H]1CC[C@H](CC1)N1CCCC1)C=1C2=CC(Br)=CC=C2N=CC=1C(=O)C1CC1 RLMBCBIGDSADNE-IYARVYRRSA-N 0.000 description 3
- VKIRRGRTJUUZHS-IZLXSQMJSA-N N[C@H]1CC[C@H](N)CC1 Chemical compound N[C@H]1CC[C@H](N)CC1 VKIRRGRTJUUZHS-IZLXSQMJSA-N 0.000 description 3
- 235000019502 Orange oil Nutrition 0.000 description 3
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 208000006105 Uterine Cervical Neoplasms Diseases 0.000 description 3
- OJGWKUWRPPDLJI-UHFFFAOYSA-N [6-bromo-4-[(1-methylpiperidin-4-yl)methylamino]quinolin-3-yl]-cyclopropylmethanone Chemical compound C1CN(C)CCC1CNC1=C(C(=O)C2CC2)C=NC2=CC=C(Br)C=C12 OJGWKUWRPPDLJI-UHFFFAOYSA-N 0.000 description 3
- ZGBDGASQDXNNBX-UHFFFAOYSA-N [6-bromo-4-[4-(morpholin-4-ylmethyl)piperidin-1-yl]quinolin-3-yl]-cyclopropylmethanone Chemical compound C1CC(CN2CCOCC2)CCN1C=1C2=CC(Br)=CC=C2N=CC=1C(=O)C1CC1 ZGBDGASQDXNNBX-UHFFFAOYSA-N 0.000 description 3
- BTBLSGJJBAFOMC-UHFFFAOYSA-N [6-bromo-4-[4-[(dimethylamino)methyl]anilino]-7-fluoroquinolin-3-yl]-cyclopropylmethanone Chemical compound C1=CC(CN(C)C)=CC=C1NC1=C(C(=O)C2CC2)C=NC2=CC(F)=C(Br)C=C12 BTBLSGJJBAFOMC-UHFFFAOYSA-N 0.000 description 3
- CPHCUAYXDMSJEM-UHFFFAOYSA-N [6-bromo-4-[4-[(dimethylamino)methyl]anilino]quinolin-3-yl]-cyclopropylmethanone Chemical compound C1=CC(CN(C)C)=CC=C1NC1=C(C(=O)C2CC2)C=NC2=CC=C(Br)C=C12 CPHCUAYXDMSJEM-UHFFFAOYSA-N 0.000 description 3
- 125000002252 acyl group Chemical group 0.000 description 3
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 3
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 3
- 201000010881 cervical cancer Diseases 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 3
- AMDKTRJOEQYGRW-UHFFFAOYSA-N ethyl 2-[(4-bromoanilino)methylidene]-3-oxobutanoate Chemical compound CCOC(=O)C(C(C)=O)=CNC1=CC=C(Br)C=C1 AMDKTRJOEQYGRW-UHFFFAOYSA-N 0.000 description 3
- 235000019253 formic acid Nutrition 0.000 description 3
- 150000002430 hydrocarbons Chemical group 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 230000002401 inhibitory effect Effects 0.000 description 3
- 238000005342 ion exchange Methods 0.000 description 3
- 125000002911 monocyclic heterocycle group Chemical group 0.000 description 3
- 208000002154 non-small cell lung carcinoma Diseases 0.000 description 3
- 239000010502 orange oil Substances 0.000 description 3
- 230000008569 process Effects 0.000 description 3
- 239000012264 purified product Substances 0.000 description 3
- JHHZLHWJQPUNKB-UHFFFAOYSA-N pyrrolidin-3-ol Chemical compound OC1CCNC1 JHHZLHWJQPUNKB-UHFFFAOYSA-N 0.000 description 3
- 125000000168 pyrrolyl group Chemical group 0.000 description 3
- 125000004549 quinolin-4-yl group Chemical group N1=CC=C(C2=CC=CC=C12)* 0.000 description 3
- 238000007670 refining Methods 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- 238000006467 substitution reaction Methods 0.000 description 3
- WFYWVWNFVSGLFT-UHFFFAOYSA-N tert-butyl cyclohexanecarboxylate Chemical compound CC(C)(C)OC(=O)C1CCCCC1 WFYWVWNFVSGLFT-UHFFFAOYSA-N 0.000 description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 3
- 208000029729 tumor suppressor gene on chromosome 11 Diseases 0.000 description 3
- 238000003828 vacuum filtration Methods 0.000 description 3
- ZQEBQGAAWMOMAI-ZETCQYMHSA-N (2s)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid Chemical compound CC(C)(C)OC(=O)N1CCC[C@H]1C(O)=O ZQEBQGAAWMOMAI-ZETCQYMHSA-N 0.000 description 2
- WWQIKFZZILXJHG-UHFFFAOYSA-N (3-chloro-4-hydroxyphenyl)boronic acid Chemical compound OB(O)C1=CC=C(O)C(Cl)=C1 WWQIKFZZILXJHG-UHFFFAOYSA-N 0.000 description 2
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 description 2
- UMIZSQHLRMYXHY-UHFFFAOYSA-N 1-[6-bromo-4-[3-(2-pyrrolidin-1-ylethyl)anilino]quinolin-3-yl]ethanone Chemical compound CC(=O)C1=CN=C2C=CC(Br)=CC2=C1NC(C=1)=CC=CC=1CCN1CCCC1 UMIZSQHLRMYXHY-UHFFFAOYSA-N 0.000 description 2
- IXGGSOUIQOESBL-UHFFFAOYSA-N 1-[6-bromo-4-[4-[(dimethylamino)methyl]piperidin-1-yl]quinolin-3-yl]ethanone Chemical compound C1CC(CN(C)C)CCN1C1=C(C(C)=O)C=NC2=CC=C(Br)C=C12 IXGGSOUIQOESBL-UHFFFAOYSA-N 0.000 description 2
- ANMAZJANLOBJJA-UHFFFAOYSA-N 1-[6-bromo-4-[[1-(1-methylpiperidin-4-yl)pyrazol-4-yl]amino]quinolin-3-yl]ethanone Chemical compound C1CN(C)CCC1N1N=CC(NC=2C3=CC(Br)=CC=C3N=CC=2C(C)=O)=C1 ANMAZJANLOBJJA-UHFFFAOYSA-N 0.000 description 2
- DWFQYSNYIDKLCP-UHFFFAOYSA-N 1-methylcyclohexane-1,4-diamine Chemical compound CC1(N)CCC(N)CC1 DWFQYSNYIDKLCP-UHFFFAOYSA-N 0.000 description 2
- LKUWRGTWTITFMB-UHFFFAOYSA-N 1-n-(6-bromo-3-methylsulfonylquinolin-4-yl)-4-n,4-n-diethylcyclohexane-1,4-diamine Chemical compound C1CC(N(CC)CC)CCC1NC1=C(S(C)(=O)=O)C=NC2=CC=C(Br)C=C12 LKUWRGTWTITFMB-UHFFFAOYSA-N 0.000 description 2
- 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 2
- AXINVSXSGNSVLV-UHFFFAOYSA-N 1h-pyrazol-4-amine Chemical compound NC=1C=NNC=1 AXINVSXSGNSVLV-UHFFFAOYSA-N 0.000 description 2
- QIKMZFVTMUKPER-UHFFFAOYSA-N 2,5-dichloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol Chemical compound O1C(C)(C)C(C)(C)OB1C1=CC(Cl)=C(O)C=C1Cl QIKMZFVTMUKPER-UHFFFAOYSA-N 0.000 description 2
- WZBDAQFLSMLMMK-UHFFFAOYSA-N 2-(dimethylamino)-1-(4-nitrophenyl)ethanol Chemical compound CN(C)CC(O)C1=CC=C([N+]([O-])=O)C=C1 WZBDAQFLSMLMMK-UHFFFAOYSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- UTJLLJSPQKFQGP-UHFFFAOYSA-N 2-ethoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol Chemical compound C1=C(O)C(OCC)=CC(B2OC(C)(C)C(C)(C)O2)=C1 UTJLLJSPQKFQGP-UHFFFAOYSA-N 0.000 description 2
- 229940061334 2-phenylphenol Drugs 0.000 description 2
- KTPJWCNUYFLRRS-UHFFFAOYSA-N 2-piperidin-1-ylpyrimidin-5-amine Chemical compound N1=CC(N)=CN=C1N1CCCCC1 KTPJWCNUYFLRRS-UHFFFAOYSA-N 0.000 description 2
- YGYGASJNJTYNOL-CQSZACIVSA-N 3-[(4r)-2,2-dimethyl-1,1-dioxothian-4-yl]-5-(4-fluorophenyl)-1h-indole-7-carboxamide Chemical compound C1CS(=O)(=O)C(C)(C)C[C@@H]1C1=CNC2=C(C(N)=O)C=C(C=3C=CC(F)=CC=3)C=C12 YGYGASJNJTYNOL-CQSZACIVSA-N 0.000 description 2
- WOJBIBHVUSZAGS-UHFFFAOYSA-N 3-[(dimethylamino)methyl]aniline Chemical compound CN(C)CC1=CC=CC(N)=C1 WOJBIBHVUSZAGS-UHFFFAOYSA-N 0.000 description 2
- UBLWMJYFIKZUAC-UHFFFAOYSA-N 3-[2-(dimethylamino)ethyl]aniline Chemical compound CN(C)CCC1=CC=CC(N)=C1 UBLWMJYFIKZUAC-UHFFFAOYSA-N 0.000 description 2
- KGVYTHOAATULPK-UHFFFAOYSA-N 3-acetyl-6-bromo-1h-quinolin-4-one Chemical compound C1=CC(Br)=CC2=C(O)C(C(=O)C)=CN=C21 KGVYTHOAATULPK-UHFFFAOYSA-N 0.000 description 2
- XIFBZSQYHIGPDC-UHFFFAOYSA-N 3-ethynyl-5-nitropyridine Chemical compound [O-][N+](=O)C1=CN=CC(C#C)=C1 XIFBZSQYHIGPDC-UHFFFAOYSA-N 0.000 description 2
- NMCMCSHJONWGMS-UHFFFAOYSA-N 4-(pyrrolidin-1-ylmethyl)piperidine Chemical compound C1CCCN1CC1CCNCC1 NMCMCSHJONWGMS-UHFFFAOYSA-N 0.000 description 2
- RAIYJEGJVCUJGX-UHFFFAOYSA-N 4-[(dimethylamino)methyl]aniline;hydrochloride Chemical compound [Cl-].C[NH+](C)CC1=CC=C(N)C=C1 RAIYJEGJVCUJGX-UHFFFAOYSA-N 0.000 description 2
- XPKKPVBDOPPWJU-UHFFFAOYSA-N 4-[2-(dimethylamino)ethyl]aniline Chemical compound CN(C)CCC1=CC=C(N)C=C1 XPKKPVBDOPPWJU-UHFFFAOYSA-N 0.000 description 2
- YPSXFMHXRZAGTG-UHFFFAOYSA-N 4-methoxy-2-[2-(5-methoxy-2-nitrosophenyl)ethyl]-1-nitrosobenzene Chemical compound COC1=CC=C(N=O)C(CCC=2C(=CC=C(OC)C=2)N=O)=C1 YPSXFMHXRZAGTG-UHFFFAOYSA-N 0.000 description 2
- GNGZZWTXFNFCMU-UHFFFAOYSA-N 4-n,4-n-dimethylcyclohexane-1,4-diamine Chemical compound CN(C)C1CCC(N)CC1 GNGZZWTXFNFCMU-UHFFFAOYSA-N 0.000 description 2
- BOSOZKXCBWSCNH-UHFFFAOYSA-N 6-bromo-3-(2-methylpropanoyl)-1h-quinolin-4-one Chemical compound C1=CC(Br)=CC2=C(O)C(C(=O)C(C)C)=CN=C21 BOSOZKXCBWSCNH-UHFFFAOYSA-N 0.000 description 2
- SWIAVUUWLHHVQV-UHFFFAOYSA-N 6-bromo-3-(3-methylbutanoyl)-1h-quinolin-4-one Chemical compound C1=CC(Br)=CC2=C(O)C(C(=O)CC(C)C)=CN=C21 SWIAVUUWLHHVQV-UHFFFAOYSA-N 0.000 description 2
- MJQSRPAZUHCLKN-UHFFFAOYSA-N 6-bromo-3-(cyclopropanecarbonyl)-1h-quinolin-4-one Chemical compound C1=NC2=CC=C(Br)C=C2C(O)=C1C(=O)C1CC1 MJQSRPAZUHCLKN-UHFFFAOYSA-N 0.000 description 2
- TURJULYUAUOPII-UHFFFAOYSA-N 6-bromo-3-(cyclopropanecarbonyl)-7-fluoro-1h-quinolin-4-one Chemical compound C1=NC2=CC(F)=C(Br)C=C2C(O)=C1C(=O)C1CC1 TURJULYUAUOPII-UHFFFAOYSA-N 0.000 description 2
- QUWBTFZWJJSFDK-UHFFFAOYSA-N 6-bromo-3-butanoyl-1h-quinolin-4-one Chemical compound C1=CC(Br)=CC2=C(O)C(C(=O)CCC)=CN=C21 QUWBTFZWJJSFDK-UHFFFAOYSA-N 0.000 description 2
- XFLROLUTIQMONL-UHFFFAOYSA-N 6-bromo-3-methylsulfonyl-1h-quinolin-4-one Chemical compound C1=CC(Br)=CC2=C(O)C(S(=O)(=O)C)=CN=C21 XFLROLUTIQMONL-UHFFFAOYSA-N 0.000 description 2
- PFIQLPSXGVBYGY-UHFFFAOYSA-N 6-bromo-3-propanoyl-1h-quinolin-4-one Chemical compound C1=CC(Br)=CC2=C(O)C(C(=O)CC)=CN=C21 PFIQLPSXGVBYGY-UHFFFAOYSA-N 0.000 description 2
- MJVHVAGRZOKINU-UHFFFAOYSA-N 6-bromo-n-[4-[(dimethylamino)methyl]phenyl]-3-methylsulfonylquinolin-4-amine Chemical compound C1=CC(CN(C)C)=CC=C1NC1=C(S(C)(=O)=O)C=NC2=CC=C(Br)C=C12 MJVHVAGRZOKINU-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- BTBUEUYNUDRHOZ-UHFFFAOYSA-N Borate Chemical compound [O-]B([O-])[O-] BTBUEUYNUDRHOZ-UHFFFAOYSA-N 0.000 description 2
- SOGAXMICEFXMKE-UHFFFAOYSA-N Butylmethacrylate Chemical compound CCCCOC(=O)C(C)=C SOGAXMICEFXMKE-UHFFFAOYSA-N 0.000 description 2
- ASCJOGRFNFZIJV-QHARRCRTSA-N C1C(OC)CCN1C[C@@H]1CC[C@@H](NC=2C3=CC(Br)=CC=C3N=CC=2C(=O)C2CC2)CC1 Chemical compound C1C(OC)CCN1C[C@@H]1CC[C@@H](NC=2C3=CC(Br)=CC=C3N=CC=2C(=O)C2CC2)CC1 ASCJOGRFNFZIJV-QHARRCRTSA-N 0.000 description 2
- YOOMNJQRBXTDLK-SAZUREKKSA-N C1C[C@@H](CNC)CC[C@@H]1NC1=C(C(=O)C2CC2)C=NC2=CC=C(Br)C=C12 Chemical compound C1C[C@@H](CNC)CC[C@@H]1NC1=C(C(=O)C2CC2)C=NC2=CC=C(Br)C=C12 YOOMNJQRBXTDLK-SAZUREKKSA-N 0.000 description 2
- UWVDTBAUMFCYCT-NNUKFRKNSA-N C1C[C@@H](CO)CC[C@@H]1NC1=C(C(=O)C2CC2)C=NC2=CC=C(Br)C=C12 Chemical compound C1C[C@@H](CO)CC[C@@H]1NC1=C(C(=O)C2CC2)C=NC2=CC=C(Br)C=C12 UWVDTBAUMFCYCT-NNUKFRKNSA-N 0.000 description 2
- LZXFQBLHTJJUAZ-SHTZXODSSA-N C1C[C@@H](N(C)C)CC[C@@H]1NC1=C(C#N)C=NC2=CC=C(Br)C=C12 Chemical compound C1C[C@@H](N(C)C)CC[C@@H]1NC1=C(C#N)C=NC2=CC=C(Br)C=C12 LZXFQBLHTJJUAZ-SHTZXODSSA-N 0.000 description 2
- NYTITVHPBFLDRF-SHTZXODSSA-N C1C[C@@H](N(C)C)CC[C@@H]1NC1=C(C(C)=O)C=NC2=CC=C(Br)C=C12 Chemical compound C1C[C@@H](N(C)C)CC[C@@H]1NC1=C(C(C)=O)C=NC2=CC=C(Br)C=C12 NYTITVHPBFLDRF-SHTZXODSSA-N 0.000 description 2
- DTWGSDMOFLQSJW-QAQDUYKDSA-N CC(C)CC(=O)C1=CN=C2C=CC(Br)=CC2=C1N[C@H]1CC[C@H](N(C)C)CC1 Chemical compound CC(C)CC(=O)C1=CN=C2C=CC(Br)=CC2=C1N[C@H]1CC[C@H](N(C)C)CC1 DTWGSDMOFLQSJW-QAQDUYKDSA-N 0.000 description 2
- HQYVJHSCMGQYII-SHTZXODSSA-N CC(C)CC(=O)C1=CN=C2C=CC(Br)=CC2=C1N[C@H]1CC[C@H](N)CC1 Chemical compound CC(C)CC(=O)C1=CN=C2C=CC(Br)=CC2=C1N[C@H]1CC[C@H](N)CC1 HQYVJHSCMGQYII-SHTZXODSSA-N 0.000 description 2
- VLYWGPPEUCEXOK-JZDLBZJVSA-N CC(O)=O.CC(O)=O.CN(C)C[C@H]1CC[C@H](N)CC1 Chemical compound CC(O)=O.CC(O)=O.CN(C)C[C@H]1CC[C@H](N)CC1 VLYWGPPEUCEXOK-JZDLBZJVSA-N 0.000 description 2
- KESQRPWALLFBLQ-SHTZXODSSA-N CCC(=O)C1=CN=C2C=CC(Br)=CC2=C1N[C@H]1CC[C@H](N(C)C)CC1 Chemical compound CCC(=O)C1=CN=C2C=CC(Br)=CC2=C1N[C@H]1CC[C@H](N(C)C)CC1 KESQRPWALLFBLQ-SHTZXODSSA-N 0.000 description 2
- JDYWFZJIINVRGG-KYZUINATSA-N CN(C)C[C@H]1CC[C@H](N)CC1 Chemical compound CN(C)C[C@H]1CC[C@H](N)CC1 JDYWFZJIINVRGG-KYZUINATSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 206010009944 Colon cancer Diseases 0.000 description 2
- 208000001333 Colorectal Neoplasms Diseases 0.000 description 2
- 201000009273 Endometriosis Diseases 0.000 description 2
- 208000000461 Esophageal Neoplasms Diseases 0.000 description 2
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Chemical compound OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 2
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical class NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- 208000008839 Kidney Neoplasms Diseases 0.000 description 2
- 239000005909 Kieselgur Substances 0.000 description 2
- ROHFNLRQFUQHCH-YFKPBYRVSA-N L-leucine Chemical compound CC(C)C[C@H](N)C(O)=O ROHFNLRQFUQHCH-YFKPBYRVSA-N 0.000 description 2
- ROHFNLRQFUQHCH-UHFFFAOYSA-N Leucine Natural products CC(C)CC(N)C(O)=O ROHFNLRQFUQHCH-UHFFFAOYSA-N 0.000 description 2
- 206010025323 Lymphomas Diseases 0.000 description 2
- FFDGPVCHZBVARC-UHFFFAOYSA-N N,N-dimethylglycine Chemical compound CN(C)CC(O)=O FFDGPVCHZBVARC-UHFFFAOYSA-N 0.000 description 2
- UEEJHVSXFDXPFK-UHFFFAOYSA-N N-dimethylaminoethanol Chemical compound CN(C)CCO UEEJHVSXFDXPFK-UHFFFAOYSA-N 0.000 description 2
- LQZMLBORDGWNPD-UHFFFAOYSA-N N-iodosuccinimide Chemical compound IN1C(=O)CCC1=O LQZMLBORDGWNPD-UHFFFAOYSA-N 0.000 description 2
- 206010030155 Oesophageal carcinoma Diseases 0.000 description 2
- 206010033128 Ovarian cancer Diseases 0.000 description 2
- 206010061535 Ovarian neoplasm Diseases 0.000 description 2
- 206010061902 Pancreatic neoplasm Diseases 0.000 description 2
- 206010060862 Prostate cancer Diseases 0.000 description 2
- 208000000236 Prostatic Neoplasms Diseases 0.000 description 2
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
- 206010038389 Renal cancer Diseases 0.000 description 2
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical group [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 2
- 208000005718 Stomach Neoplasms Diseases 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- FNXWNOUGPDCXRB-UHFFFAOYSA-N [4-[(4-aminocyclohexyl)amino]-6-(3,5-dichloro-4-hydroxyphenyl)quinolin-3-yl]-cyclopropylmethanone Chemical compound C1CC(N)CCC1NC1=C(C(=O)C2CC2)C=NC2=CC=C(C=3C=C(Cl)C(O)=C(Cl)C=3)C=C12 FNXWNOUGPDCXRB-UHFFFAOYSA-N 0.000 description 2
- VMDQFYOKUOLFSZ-UHFFFAOYSA-N [4-[(4-aminocyclohexyl)amino]-6-(3,5-difluoro-4-hydroxyphenyl)quinolin-3-yl]-cyclopropylmethanone Chemical compound C1CC(N)CCC1NC1=C(C(=O)C2CC2)C=NC2=CC=C(C=3C=C(F)C(O)=C(F)C=3)C=C12 VMDQFYOKUOLFSZ-UHFFFAOYSA-N 0.000 description 2
- FXVKYEQFXIXMCA-UHFFFAOYSA-N [4-[(4-aminocyclohexyl)amino]-6-(4-hydroxy-3-methoxyphenyl)quinolin-3-yl]-cyclopropylmethanone Chemical compound C1=C(O)C(OC)=CC(C=2C=C3C(NC4CCC(N)CC4)=C(C(=O)C4CC4)C=NC3=CC=2)=C1 FXVKYEQFXIXMCA-UHFFFAOYSA-N 0.000 description 2
- ODIILEUJANKRIB-UHFFFAOYSA-N [4-chloro-6-(3-chloro-4-hydroxy-5-methoxyphenyl)quinolin-3-yl]-cyclopropylmethanone Chemical compound ClC1=C(O)C(OC)=CC(C=2C=C3C(Cl)=C(C(=O)C4CC4)C=NC3=CC=2)=C1 ODIILEUJANKRIB-UHFFFAOYSA-N 0.000 description 2
- DYIDCYKYUPJJTQ-UHFFFAOYSA-N [6-(3-chloro-4-hydroxy-5-methoxyphenyl)-4-[[4-(diethylamino)cyclohexyl]amino]quinolin-3-yl]-cyclopropylmethanone Chemical compound C1CC(N(CC)CC)CCC1NC1=C(C(=O)C2CC2)C=NC2=CC=C(C=3C=C(OC)C(O)=C(Cl)C=3)C=C12 DYIDCYKYUPJJTQ-UHFFFAOYSA-N 0.000 description 2
- ORILYTVJVMAKLC-UHFFFAOYSA-N adamantane Chemical compound C1C(C2)CC3CC1CC2C3 ORILYTVJVMAKLC-UHFFFAOYSA-N 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- DKNWSYNQZKUICI-UHFFFAOYSA-N amantadine Chemical compound C1C(C2)CC3CC2CC1(N)C3 DKNWSYNQZKUICI-UHFFFAOYSA-N 0.000 description 2
- 229960003805 amantadine Drugs 0.000 description 2
- 230000006229 amino acid addition Effects 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 239000000908 ammonium hydroxide Substances 0.000 description 2
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- 125000002029 aromatic hydrocarbon group Chemical group 0.000 description 2
- 125000003725 azepanyl group Chemical group 0.000 description 2
- 125000003943 azolyl group Chemical group 0.000 description 2
- RJNJWHFSKNJCTB-UHFFFAOYSA-N benzylurea Chemical compound NC(=O)NCC1=CC=CC=C1 RJNJWHFSKNJCTB-UHFFFAOYSA-N 0.000 description 2
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical group CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 2
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 2
- SKKTUOZKZKCGTB-UHFFFAOYSA-N butyl carbamate Chemical compound CCCCOC(N)=O SKKTUOZKZKCGTB-UHFFFAOYSA-N 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- CETPSERCERDGAM-UHFFFAOYSA-N ceric oxide Chemical compound O=[Ce]=O CETPSERCERDGAM-UHFFFAOYSA-N 0.000 description 2
- 229910000422 cerium(IV) oxide Inorganic materials 0.000 description 2
- 230000008878 coupling Effects 0.000 description 2
- 238000010168 coupling process Methods 0.000 description 2
- 238000005859 coupling reaction Methods 0.000 description 2
- 238000004132 cross linking Methods 0.000 description 2
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 238000010511 deprotection reaction Methods 0.000 description 2
- BIPUHAHGLJKIPK-UHFFFAOYSA-N dicyclopropylmethanone Chemical compound C1CC1C(=O)C1CC1 BIPUHAHGLJKIPK-UHFFFAOYSA-N 0.000 description 2
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 2
- 125000006264 diethylaminomethyl group Chemical group [H]C([H])([H])C([H])([H])N(C([H])([H])*)C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 125000002474 dimethylaminoethoxy group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])C([H])([H])O* 0.000 description 2
- WJJMNDUMQPNECX-UHFFFAOYSA-N dipicolinic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=N1 WJJMNDUMQPNECX-UHFFFAOYSA-N 0.000 description 2
- 201000004101 esophageal cancer Diseases 0.000 description 2
- CACSRMCFCHYYIW-UHFFFAOYSA-N ethyl 2-[(4-bromoanilino)methylidene]-5-methyl-3-oxohexanoate Chemical compound CCOC(=O)C(C(=O)CC(C)C)=CNC1=CC=C(Br)C=C1 CACSRMCFCHYYIW-UHFFFAOYSA-N 0.000 description 2
- LFRYXOUTBZLMLJ-UHFFFAOYSA-N ethyl 3-(4-bromoanilino)-2-methylsulfonylprop-2-enoate Chemical compound CCOC(=O)C(S(C)(=O)=O)=CNC1=CC=C(Br)C=C1 LFRYXOUTBZLMLJ-UHFFFAOYSA-N 0.000 description 2
- 125000004494 ethyl ester group Chemical group 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 125000003983 fluorenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3CC12)* 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 206010017758 gastric cancer Diseases 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 2
- 125000004464 hydroxyphenyl group Chemical group 0.000 description 2
- 239000003112 inhibitor Substances 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 238000001990 intravenous administration Methods 0.000 description 2
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 2
- 201000010982 kidney cancer Diseases 0.000 description 2
- 201000007270 liver cancer Diseases 0.000 description 2
- 208000014018 liver neoplasm Diseases 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 208000015486 malignant pancreatic neoplasm Diseases 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- RPXRQFTZGCPNKB-UHFFFAOYSA-N methyl 3-(4-bromo-3-fluoroanilino)-2-(cyclopropanecarbonyl)prop-2-enoate Chemical compound C1CC1C(=O)C(C(=O)OC)=CNC1=CC=C(Br)C(F)=C1 RPXRQFTZGCPNKB-UHFFFAOYSA-N 0.000 description 2
- SDPKFJAISOEZAT-UHFFFAOYSA-N methyl 3-(4-bromoanilino)-2-(cyclopropanecarbonyl)prop-2-enoate Chemical compound C1CC1C(=O)C(C(=O)OC)=CNC1=CC=C(Br)C=C1 SDPKFJAISOEZAT-UHFFFAOYSA-N 0.000 description 2
- RIJWDPRXCXJDPK-UHFFFAOYSA-N methyl 3-cyclopropyl-3-oxopropanoate Chemical compound COC(=O)CC(=O)C1CC1 RIJWDPRXCXJDPK-UHFFFAOYSA-N 0.000 description 2
- 125000006533 methyl amino methyl group Chemical group [H]N(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 125000006216 methylsulfinyl group Chemical group [H]C([H])([H])S(*)=O 0.000 description 2
- ILCQYORZHHFLNL-UHFFFAOYSA-N n-bromoaniline Chemical compound BrNC1=CC=CC=C1 ILCQYORZHHFLNL-UHFFFAOYSA-N 0.000 description 2
- RIVIDPPYRINTTH-UHFFFAOYSA-N n-ethylpropan-2-amine Chemical compound CCNC(C)C RIVIDPPYRINTTH-UHFFFAOYSA-N 0.000 description 2
- OTTPWWFPWBCJBS-UHFFFAOYSA-N o-(trifluoromethyl)hydroxylamine Chemical compound NOC(F)(F)F OTTPWWFPWBCJBS-UHFFFAOYSA-N 0.000 description 2
- 201000008968 osteosarcoma Diseases 0.000 description 2
- 201000002528 pancreatic cancer Diseases 0.000 description 2
- 208000008443 pancreatic carcinoma Diseases 0.000 description 2
- 238000007911 parenteral administration Methods 0.000 description 2
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 2
- 239000000546 pharmaceutical excipient Substances 0.000 description 2
- 125000005328 phosphinyl group Chemical group [PH2](=O)* 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- PEUGKEHLRUVPAN-UHFFFAOYSA-N piperidin-3-amine Chemical compound NC1CCCNC1 PEUGKEHLRUVPAN-UHFFFAOYSA-N 0.000 description 2
- 125000006239 protecting group Chemical group 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 150000003222 pyridines Chemical class 0.000 description 2
- 125000004528 pyrimidin-5-yl group Chemical group N1=CN=CC(=C1)* 0.000 description 2
- 150000003230 pyrimidines Chemical class 0.000 description 2
- 238000006722 reduction reaction Methods 0.000 description 2
- 230000001105 regulatory effect Effects 0.000 description 2
- 229910052707 ruthenium Inorganic materials 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 201000011549 stomach cancer Diseases 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- XTDXZSGSIMLARD-UHFFFAOYSA-N tert-butyl 2h-pyridine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CC=CC=C1 XTDXZSGSIMLARD-UHFFFAOYSA-N 0.000 description 2
- RFUMADBIVIXJOQ-UHFFFAOYSA-N tert-butyl 4-[4-[[6-(3-chloro-5-fluoro-4-hydroxyphenyl)-3-(cyclopropanecarbonyl)quinolin-4-yl]amino]pyrazol-1-yl]piperidine-1-carboxylate Chemical compound C1CN(C(=O)OC(C)(C)C)CCC1N1N=CC(NC=2C3=CC(=CC=C3N=CC=2C(=O)C2CC2)C=2C=C(Cl)C(O)=C(F)C=2)=C1 RFUMADBIVIXJOQ-UHFFFAOYSA-N 0.000 description 2
- DQCVYSJMZRTJPO-UHFFFAOYSA-N tert-butyl 8-[6-(3-chloro-4-hydroxy-5-methoxyphenyl)-3-(cyclopropanecarbonyl)quinolin-4-yl]-2,8-diazaspiro[4.5]decane-2-carboxylate Chemical compound ClC1=C(O)C(OC)=CC(C=2C=C3C(N4CCC5(CN(CC5)C(=O)OC(C)(C)C)CC4)=C(C(=O)C4CC4)C=NC3=CC=2)=C1 DQCVYSJMZRTJPO-UHFFFAOYSA-N 0.000 description 2
- RQCNHUCCQJMSRG-UHFFFAOYSA-N tert-butyl piperidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCCCC1 RQCNHUCCQJMSRG-UHFFFAOYSA-N 0.000 description 2
- LPQZERIRKRYGGM-UHFFFAOYSA-N tert-butyl pyrrolidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCCC1 LPQZERIRKRYGGM-UHFFFAOYSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- AGTPSAZJSOQXHJ-UHFFFAOYSA-N (1-methylpiperidin-4-yl)methanamine Chemical compound CN1CCC(CN)CC1 AGTPSAZJSOQXHJ-UHFFFAOYSA-N 0.000 description 1
- DOMQFIFVDIAOOT-ROUUACIJSA-N (2S,3R)-N-[4-(2,6-dimethoxyphenyl)-5-(5-methylpyridin-3-yl)-1,2,4-triazol-3-yl]-3-(5-methylpyrimidin-2-yl)butane-2-sulfonamide Chemical compound COC1=C(C(=CC=C1)OC)N1C(=NN=C1C=1C=NC=C(C=1)C)NS(=O)(=O)[C@@H](C)[C@H](C)C1=NC=C(C=N1)C DOMQFIFVDIAOOT-ROUUACIJSA-N 0.000 description 1
- GHUJZOFJZVGTSN-UHFFFAOYSA-N (4-aminocyclohexyl)methanol Chemical compound NC1CCC(CO)CC1 GHUJZOFJZVGTSN-UHFFFAOYSA-N 0.000 description 1
- HGRWHBQLRXWSLV-DEOSSOPVSA-N (4s)-3'-(3,6-dihydro-2h-pyran-5-yl)-1'-fluoro-7'-(3-fluoropyridin-2-yl)spiro[5h-1,3-oxazole-4,5'-chromeno[2,3-c]pyridine]-2-amine Chemical compound C1OC(N)=N[C@]21C1=CC(C=3COCCC=3)=NC(F)=C1OC1=CC=C(C=3C(=CC=CN=3)F)C=C12 HGRWHBQLRXWSLV-DEOSSOPVSA-N 0.000 description 1
- 125000004916 (C1-C6) alkylcarbonyl group Chemical group 0.000 description 1
- IQDGSYLLQPDQDV-TXHXQZCNSA-N 1,1,1-trideuterio-n-(trideuteriomethyl)methanamine;hydrochloride Chemical compound Cl.[2H]C([2H])([2H])NC([2H])([2H])[2H] IQDGSYLLQPDQDV-TXHXQZCNSA-N 0.000 description 1
- 125000005943 1,2,3,6-tetrahydropyridyl group Chemical group 0.000 description 1
- 125000005918 1,2-dimethylbutyl group Chemical group 0.000 description 1
- ULTHEAFYOOPTTB-UHFFFAOYSA-N 1,4-dibromobutane Chemical compound BrCCCCBr ULTHEAFYOOPTTB-UHFFFAOYSA-N 0.000 description 1
- MJUVRTYWUMPBTR-MRXNPFEDSA-N 1-(2,2-difluoro-1,3-benzodioxol-5-yl)-n-[1-[(2r)-2,3-dihydroxypropyl]-6-fluoro-2-(1-hydroxy-2-methylpropan-2-yl)indol-5-yl]cyclopropane-1-carboxamide Chemical compound FC=1C=C2N(C[C@@H](O)CO)C(C(C)(CO)C)=CC2=CC=1NC(=O)C1(C=2C=C3OC(F)(F)OC3=CC=2)CC1 MJUVRTYWUMPBTR-MRXNPFEDSA-N 0.000 description 1
- CINBORSIEJDADO-UHFFFAOYSA-N 1-(4-aminophenyl)-2-(dimethylamino)ethanol Chemical compound CN(C)CC(O)C1=CC=C(N)C=C1 CINBORSIEJDADO-UHFFFAOYSA-N 0.000 description 1
- KTZANZYEZRAGNO-UHFFFAOYSA-N 1-(5-aminopyridin-2-yl)pyrrolidin-3-ol Chemical compound N1=CC(N)=CC=C1N1CC(O)CC1 KTZANZYEZRAGNO-UHFFFAOYSA-N 0.000 description 1
- RYPFKQKRYACDBU-UHFFFAOYSA-N 1-[4-[(4-aminocyclohexyl)amino]-6-(3,5-dichloro-4-hydroxyphenyl)quinolin-3-yl]butan-1-one Chemical compound CCCC(=O)C1=CN=C2C=CC(C=3C=C(Cl)C(O)=C(Cl)C=3)=CC2=C1NC1CCC(N)CC1 RYPFKQKRYACDBU-UHFFFAOYSA-N 0.000 description 1
- GRQOFQACZYDELG-UHFFFAOYSA-N 1-[4-[(4-aminocyclohexyl)amino]-6-(3,5-dichloro-4-hydroxyphenyl)quinolin-3-yl]ethanone Chemical compound CC(=O)C1=CN=C2C=CC(C=3C=C(Cl)C(O)=C(Cl)C=3)=CC2=C1NC1CCC(N)CC1 GRQOFQACZYDELG-UHFFFAOYSA-N 0.000 description 1
- LACAMLFDNRZKLY-UHFFFAOYSA-N 1-[4-[(4-aminocyclohexyl)amino]-6-(3,5-difluoro-4-hydroxyphenyl)quinolin-3-yl]ethanone Chemical compound CC(=O)C1=CN=C2C=CC(C=3C=C(F)C(O)=C(F)C=3)=CC2=C1NC1CCC(N)CC1 LACAMLFDNRZKLY-UHFFFAOYSA-N 0.000 description 1
- SZWHUQYFOGMNID-UHFFFAOYSA-N 1-[4-[(4-aminocyclohexyl)amino]-6-(3-chloro-4-hydroxy-5-methoxyphenyl)quinolin-3-yl]-2-methylpropan-1-one Chemical compound ClC1=C(O)C(OC)=CC(C=2C=C3C(NC4CCC(N)CC4)=C(C(=O)C(C)C)C=NC3=CC=2)=C1 SZWHUQYFOGMNID-UHFFFAOYSA-N 0.000 description 1
- HGXBCQGRQAYWQA-UHFFFAOYSA-N 1-[4-[(4-aminocyclohexyl)amino]-6-(3-chloro-4-hydroxy-5-methoxyphenyl)quinolin-3-yl]ethanone Chemical compound ClC1=C(O)C(OC)=CC(C=2C=C3C(NC4CCC(N)CC4)=C(C(C)=O)C=NC3=CC=2)=C1 HGXBCQGRQAYWQA-UHFFFAOYSA-N 0.000 description 1
- ZHAXZYLQDLZGHC-UHFFFAOYSA-N 1-[4-[(4-aminocyclohexyl)amino]-6-(3-chloro-4-hydroxyphenyl)quinolin-3-yl]-2-methylpropan-1-one Chemical compound CC(C)C(=O)C1=CN=C2C=CC(C=3C=C(Cl)C(O)=CC=3)=CC2=C1NC1CCC(N)CC1 ZHAXZYLQDLZGHC-UHFFFAOYSA-N 0.000 description 1
- GNIFDAAWIQTMJX-UHFFFAOYSA-N 1-[4-[(4-aminocyclohexyl)amino]-6-(3-chloro-5-fluoro-4-hydroxyphenyl)quinolin-3-yl]butan-1-one Chemical compound CCCC(=O)C1=CN=C2C=CC(C=3C=C(Cl)C(O)=C(F)C=3)=CC2=C1NC1CCC(N)CC1 GNIFDAAWIQTMJX-UHFFFAOYSA-N 0.000 description 1
- OEMIEXFZVWMXMI-UHFFFAOYSA-N 1-[4-[(4-aminocyclohexyl)amino]-6-(3-chloro-5-fluoro-4-hydroxyphenyl)quinolin-3-yl]ethanone Chemical compound CC(=O)C1=CN=C2C=CC(C=3C=C(Cl)C(O)=C(F)C=3)=CC2=C1NC1CCC(N)CC1 OEMIEXFZVWMXMI-UHFFFAOYSA-N 0.000 description 1
- VOFCTVCTXXVANH-UHFFFAOYSA-N 1-[6-(3,5-dichloro-4-hydroxyphenyl)-4-[4-(pyrrolidin-1-ylmethyl)anilino]quinolin-3-yl]ethanone;hydrobromide Chemical compound Br.CC(=O)C1=CN=C2C=CC(C=3C=C(Cl)C(O)=C(Cl)C=3)=CC2=C1NC(C=C1)=CC=C1CN1CCCC1 VOFCTVCTXXVANH-UHFFFAOYSA-N 0.000 description 1
- VEOAADXBLJDRBU-UHFFFAOYSA-N 1-[6-(3,5-dichloro-4-hydroxyphenyl)-4-[4-[(dimethylamino)methyl]anilino]quinolin-3-yl]-2-methylpropan-1-one Chemical compound CC(C)C(=O)C1=CN=C2C=CC(C=3C=C(Cl)C(O)=C(Cl)C=3)=CC2=C1NC1=CC=C(CN(C)C)C=C1 VEOAADXBLJDRBU-UHFFFAOYSA-N 0.000 description 1
- GKKUYXXBFUBTJA-UHFFFAOYSA-N 1-[6-(3,5-dichloro-4-hydroxyphenyl)-4-[4-[(dimethylamino)methyl]anilino]quinolin-3-yl]ethanone Chemical compound C1=CC(CN(C)C)=CC=C1NC1=C(C(C)=O)C=NC2=CC=C(C=3C=C(Cl)C(O)=C(Cl)C=3)C=C12 GKKUYXXBFUBTJA-UHFFFAOYSA-N 0.000 description 1
- DKZYXHCYPUVGAF-UHFFFAOYSA-N 1-[6-(3,5-dichloro-4-hydroxyphenyl)-4-[[4-[(dimethylamino)methyl]cyclohexyl]amino]-1,5-naphthyridin-3-yl]ethanone Chemical compound CN(C)CC1CCC(CC1)Nc1c(cnc2ccc(nc12)-c1cc(Cl)c(O)c(Cl)c1)C(C)=O DKZYXHCYPUVGAF-UHFFFAOYSA-N 0.000 description 1
- QEFZJIIAVNJJOQ-UHFFFAOYSA-N 1-[6-(3,5-dichloro-4-hydroxyphenyl)-4-[[6-[3-(methylamino)piperidin-1-yl]pyridin-3-yl]amino]quinolin-3-yl]ethanone;trihydrochloride Chemical compound Cl.Cl.Cl.C1C(NC)CCCN1C(N=C1)=CC=C1NC1=C(C(C)=O)C=NC2=CC=C(C=3C=C(Cl)C(O)=C(Cl)C=3)C=C12 QEFZJIIAVNJJOQ-UHFFFAOYSA-N 0.000 description 1
- FVKAUQDGAXGGEB-UHFFFAOYSA-N 1-[6-(3,5-dichloro-4-hydroxyphenyl)-4-[[6-[3-(methylamino)pyrrolidin-1-yl]pyridin-3-yl]amino]quinolin-3-yl]ethanone;trihydrochloride Chemical compound Cl.Cl.Cl.C1C(NC)CCN1C(N=C1)=CC=C1NC1=C(C(C)=O)C=NC2=CC=C(C=3C=C(Cl)C(O)=C(Cl)C=3)C=C12 FVKAUQDGAXGGEB-UHFFFAOYSA-N 0.000 description 1
- QRHOBVQUJWMUII-UHFFFAOYSA-N 1-[6-(3-chloro-4-hydroxy-5-methoxyphenyl)-4-[[4-(diethylamino)cyclohexyl]amino]quinolin-3-yl]ethanone Chemical compound C1CC(N(CC)CC)CCC1NC1=C(C(C)=O)C=NC2=CC=C(C=3C=C(OC)C(O)=C(Cl)C=3)C=C12 QRHOBVQUJWMUII-UHFFFAOYSA-N 0.000 description 1
- JDYQGZNDVPWOBA-UHFFFAOYSA-N 1-[6-(3-chloro-4-hydroxy-5-methoxyphenyl)-4-[[4-(dimethylamino)cyclohexyl]amino]quinolin-3-yl]-3-methylbutan-1-one Chemical compound ClC1=C(O)C(OC)=CC(C=2C=C3C(NC4CCC(CC4)N(C)C)=C(C(=O)CC(C)C)C=NC3=CC=2)=C1 JDYQGZNDVPWOBA-UHFFFAOYSA-N 0.000 description 1
- OSRDFHWWFIEYDB-UHFFFAOYSA-N 1-[6-(3-chloro-4-hydroxyphenyl)-4-[[4-(diethylamino)cyclohexyl]amino]quinolin-3-yl]ethanone Chemical compound C1CC(N(CC)CC)CCC1NC1=C(C(C)=O)C=NC2=CC=C(C=3C=C(Cl)C(O)=CC=3)C=C12 OSRDFHWWFIEYDB-UHFFFAOYSA-N 0.000 description 1
- PMQCQMRHYRVPLT-UHFFFAOYSA-N 1-[6-(3-chloro-5-fluoro-4-hydroxyphenyl)-4-[4-(pyrrolidin-1-ylmethyl)piperidin-1-yl]quinolin-3-yl]-2-methylpropan-1-one Chemical compound CC(C)C(=O)C1=CN=C2C=CC(C=3C=C(Cl)C(O)=C(F)C=3)=CC2=C1N(CC1)CCC1CN1CCCC1 PMQCQMRHYRVPLT-UHFFFAOYSA-N 0.000 description 1
- FYVATBGOHRFWGV-UHFFFAOYSA-N 1-[6-(3-chloro-5-fluoro-4-hydroxyphenyl)-4-[[1-(1-methylpyrrolidin-3-yl)pyrazol-4-yl]amino]quinolin-3-yl]ethanone;dihydrochloride Chemical compound Cl.Cl.C1N(C)CCC1N1N=CC(NC=2C3=CC(=CC=C3N=CC=2C(C)=O)C=2C=C(Cl)C(O)=C(F)C=2)=C1 FYVATBGOHRFWGV-UHFFFAOYSA-N 0.000 description 1
- GYOFMIHJSIRWQS-UHFFFAOYSA-N 1-[6-(3-chloro-5-fluoro-4-hydroxyphenyl)-4-[[6-[3-(methylamino)piperidin-1-yl]pyridin-3-yl]amino]quinolin-3-yl]ethanone;trihydrochloride Chemical compound Cl.Cl.Cl.C1C(NC)CCCN1C(N=C1)=CC=C1NC1=C(C(C)=O)C=NC2=CC=C(C=3C=C(Cl)C(O)=C(F)C=3)C=C12 GYOFMIHJSIRWQS-UHFFFAOYSA-N 0.000 description 1
- XPFNGMNARNTHBW-UHFFFAOYSA-N 1-[6-bromo-4-[3-[2-(dimethylamino)ethyl]anilino]quinolin-3-yl]ethanone Chemical compound CN(C)CCC1=CC=CC(NC=2C3=CC(Br)=CC=C3N=CC=2C(C)=O)=C1 XPFNGMNARNTHBW-UHFFFAOYSA-N 0.000 description 1
- UIRMVFNKPHVZIV-UHFFFAOYSA-N 1-[6-bromo-4-[4-(pyrrolidin-1-ylmethyl)piperidin-1-yl]quinolin-3-yl]-2-methylpropan-1-one Chemical compound CC(C)C(=O)C1=CN=C2C=CC(Br)=CC2=C1N(CC1)CCC1CN1CCCC1 UIRMVFNKPHVZIV-UHFFFAOYSA-N 0.000 description 1
- PHJOQCVXKGKDRW-UHFFFAOYSA-N 1-[6-bromo-4-[4-[(dimethylamino)methyl]anilino]quinolin-3-yl]ethanone Chemical compound C1=CC(CN(C)C)=CC=C1NC1=C(C(C)=O)C=NC2=CC=C(Br)C=C12 PHJOQCVXKGKDRW-UHFFFAOYSA-N 0.000 description 1
- SENSVDCOTUSLTE-UHFFFAOYSA-N 1-[6-bromo-4-[4-[2-(dimethylamino)ethyl]anilino]quinolin-3-yl]ethanone Chemical compound C1=CC(CCN(C)C)=CC=C1NC1=C(C(C)=O)C=NC2=CC=C(Br)C=C12 SENSVDCOTUSLTE-UHFFFAOYSA-N 0.000 description 1
- 125000006218 1-ethylbutyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- BMVXCPBXGZKUPN-UHFFFAOYSA-N 1-hexanamine Chemical compound CCCCCCN BMVXCPBXGZKUPN-UHFFFAOYSA-N 0.000 description 1
- ALOCUZOKRULSAA-UHFFFAOYSA-N 1-methylpiperidin-4-amine Chemical compound CN1CCC(N)CC1 ALOCUZOKRULSAA-UHFFFAOYSA-N 0.000 description 1
- 125000004484 1-methylpiperidin-4-yl group Chemical group CN1CCC(CC1)* 0.000 description 1
- PAMIQIKDUOTOBW-UHFFFAOYSA-N 1-methylpiperidine Chemical compound CN1CCCCC1 PAMIQIKDUOTOBW-UHFFFAOYSA-N 0.000 description 1
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 description 1
- 125000001462 1-pyrrolyl group Chemical group [*]N1C([H])=C([H])C([H])=C1[H] 0.000 description 1
- WYZZNMWIWHRXRM-UHFFFAOYSA-N 2,8-diazaspiro[4.5]decane Chemical compound C1NCCC21CCNCC2 WYZZNMWIWHRXRM-UHFFFAOYSA-N 0.000 description 1
- XAQIUCRPNBNEKR-UHFFFAOYSA-N 2-(4-bromophenoxy)-n-[[4-(dimethylamino)phenyl]methyl]-n-(1,1-dioxothiolan-3-yl)acetamide Chemical compound C1=CC(N(C)C)=CC=C1CN(C(=O)COC=1C=CC(Br)=CC=1)C1CS(=O)(=O)CC1 XAQIUCRPNBNEKR-UHFFFAOYSA-N 0.000 description 1
- HHLRHCXMURYDHN-UHFFFAOYSA-N 2-(4-nitrophenyl)propan-2-amine Chemical compound CC(C)(N)C1=CC=C([N+]([O-])=O)C=C1 HHLRHCXMURYDHN-UHFFFAOYSA-N 0.000 description 1
- QVHJQCGUWFKTSE-UHFFFAOYSA-N 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid Chemical compound OC(=O)C(C)NC(=O)OC(C)(C)C QVHJQCGUWFKTSE-UHFFFAOYSA-N 0.000 description 1
- QGMHMZOHCYYHBA-UHFFFAOYSA-N 2-amino-1-(4-nitrophenyl)ethanone Chemical compound NCC(=O)C1=CC=C([N+]([O-])=O)C=C1 QGMHMZOHCYYHBA-UHFFFAOYSA-N 0.000 description 1
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 description 1
- NWQYAEIPDPFWGB-UHFFFAOYSA-N 2-chloro-4-[4-[4-[1-(dimethylamino)ethyl]piperidin-1-yl]-3-methylsulfonylquinolin-6-yl]-6-methoxyphenol Chemical compound ClC1=C(O)C(OC)=CC(C=2C=C3C(N4CCC(CC4)C(C)N(C)C)=C(C=NC3=CC=2)S(C)(=O)=O)=C1 NWQYAEIPDPFWGB-UHFFFAOYSA-N 0.000 description 1
- UUWUGRZCKQWTPA-UHFFFAOYSA-N 2-chloro-4-[4-[4-[1-(dimethylamino)ethyl]piperidin-1-yl]-3-methylsulfonylquinolin-6-yl]phenol Chemical compound C1CC(C(C)N(C)C)CCN1C1=C(S(C)(=O)=O)C=NC2=CC=C(C=3C=C(Cl)C(O)=CC=3)C=C12 UUWUGRZCKQWTPA-UHFFFAOYSA-N 0.000 description 1
- KHVUOPWNBSVGJD-UHFFFAOYSA-N 2-chloro-4-[4-[[4-(diethylamino)cyclohexyl]amino]-3-methylsulfonylquinolin-6-yl]-6-methoxyphenol;dihydrochloride Chemical compound Cl.Cl.C1CC(N(CC)CC)CCC1NC1=C(S(C)(=O)=O)C=NC2=CC=C(C=3C=C(OC)C(O)=C(Cl)C=3)C=C12 KHVUOPWNBSVGJD-UHFFFAOYSA-N 0.000 description 1
- LIEPVGBDUYKPLC-UHFFFAOYSA-N 2-chloro-4-nitropyridine Chemical compound [O-][N+](=O)C1=CC=NC(Cl)=C1 LIEPVGBDUYKPLC-UHFFFAOYSA-N 0.000 description 1
- FFNVQNRYTPFDDP-UHFFFAOYSA-N 2-cyanopyridine Chemical compound N#CC1=CC=CC=N1 FFNVQNRYTPFDDP-UHFFFAOYSA-N 0.000 description 1
- 125000006176 2-ethylbutyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(C([H])([H])*)C([H])([H])C([H])([H])[H] 0.000 description 1
- BAAKYYQPUBMXHR-UHFFFAOYSA-N 2-fluoro-6-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol Chemical compound FC1=C(O)C(OC)=CC(B2OC(C)(C)C(C)(C)O2)=C1 BAAKYYQPUBMXHR-UHFFFAOYSA-N 0.000 description 1
- 125000004493 2-methylbut-1-yl group Chemical group CC(C*)CC 0.000 description 1
- 125000005916 2-methylpentyl group Chemical group 0.000 description 1
- KDSNLYIMUZNERS-UHFFFAOYSA-N 2-methylpropanamine Chemical group CC(C)CN KDSNLYIMUZNERS-UHFFFAOYSA-N 0.000 description 1
- AASLFZACKQKOAQ-UHFFFAOYSA-N 2-n-[2-(dimethylamino)ethyl]pyridine-2,5-diamine Chemical compound CN(C)CCNC1=CC=C(N)C=N1 AASLFZACKQKOAQ-UHFFFAOYSA-N 0.000 description 1
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 description 1
- XTCJYQFQKXYIMZ-UHFFFAOYSA-N 2-piperidin-1-ylpyridin-4-amine Chemical compound NC1=CC=NC(N2CCCCC2)=C1 XTCJYQFQKXYIMZ-UHFFFAOYSA-N 0.000 description 1
- QCYAPZWTGRFURH-UHFFFAOYSA-N 2-pyrrolidin-1-ylpyrimidin-5-amine Chemical compound N1=CC(N)=CN=C1N1CCCC1 QCYAPZWTGRFURH-UHFFFAOYSA-N 0.000 description 1
- UBWBVRSSIHWAQL-UHFFFAOYSA-N 2-tert-butylpiperidine-1-carboxylic acid Chemical compound CC(C)(C)C1CCCCN1C(O)=O UBWBVRSSIHWAQL-UHFFFAOYSA-N 0.000 description 1
- YYVPZQADFREIFR-UHFFFAOYSA-N 3,3-difluoropyrrolidine;hydrochloride Chemical compound [Cl-].FC1(F)CC[NH2+]C1 YYVPZQADFREIFR-UHFFFAOYSA-N 0.000 description 1
- QLOPCUSAJYNOBR-UHFFFAOYSA-N 3-(2-oxoethyl)hexanoic acid Chemical compound CCCC(CC=O)CC(O)=O QLOPCUSAJYNOBR-UHFFFAOYSA-N 0.000 description 1
- UZELPSWMWQYMQZ-UHFFFAOYSA-N 3-(2-pyrrolidin-1-ylethyl)aniline Chemical compound NC1=CC=CC(CCN2CCCC2)=C1 UZELPSWMWQYMQZ-UHFFFAOYSA-N 0.000 description 1
- CGWOEOXQHIMZEQ-UHFFFAOYSA-N 3-[1-[[4-(2-phenylquinolin-3-yl)phenyl]methyl]piperidin-4-yl]-1h-benzimidazol-2-one Chemical compound OC1=NC2=CC=CC=C2N1C(CC1)CCN1CC(C=C1)=CC=C1C1=CC2=CC=CC=C2N=C1C1=CC=CC=C1 CGWOEOXQHIMZEQ-UHFFFAOYSA-N 0.000 description 1
- WHYJVHQKKJHXTB-UHFFFAOYSA-N 3-bromo-5-nitropyridine Chemical compound [O-][N+](=O)C1=CN=CC(Br)=C1 WHYJVHQKKJHXTB-UHFFFAOYSA-N 0.000 description 1
- SQMYKVUSWPIFEQ-UHFFFAOYSA-N 3-methoxypyrrolidine;hydrochloride Chemical compound Cl.COC1CCNC1 SQMYKVUSWPIFEQ-UHFFFAOYSA-N 0.000 description 1
- MZQMXZDYYODELO-UHFFFAOYSA-N 3-methyl-5-oxopentanoic acid Chemical compound O=CCC(C)CC(O)=O MZQMXZDYYODELO-UHFFFAOYSA-N 0.000 description 1
- 125000003542 3-methylbutan-2-yl group Chemical group [H]C([H])([H])C([H])(*)C([H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000005917 3-methylpentyl group Chemical group 0.000 description 1
- 125000004575 3-pyrrolidinyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- DJKXYDZAXRFXCF-UHFFFAOYSA-N 4-(2-aminopropan-2-yl)aniline Chemical compound CC(C)(N)C1=CC=C(N)C=C1 DJKXYDZAXRFXCF-UHFFFAOYSA-N 0.000 description 1
- YBGZUKHMTOLKEQ-UHFFFAOYSA-N 4-(3,3-difluoropyrrolidin-1-yl)cyclohexan-1-amine Chemical compound C1CC(N)CCC1N1CC(F)(F)CC1 YBGZUKHMTOLKEQ-UHFFFAOYSA-N 0.000 description 1
- NJYWMOICVCOYSG-UHFFFAOYSA-N 4-(3-methoxypyrrolidin-1-yl)cyclohexan-1-amine Chemical compound C1C(OC)CCN1C1CCC(N)CC1 NJYWMOICVCOYSG-UHFFFAOYSA-N 0.000 description 1
- KFEICRNRUSAILQ-UHFFFAOYSA-N 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethoxy)phenol Chemical compound O1C(C)(C)C(C)(C)OB1C1=CC=C(O)C(OC(F)(F)F)=C1 KFEICRNRUSAILQ-UHFFFAOYSA-N 0.000 description 1
- ZXPDVRCLICXEDW-UHFFFAOYSA-N 4-(aminomethyl)piperidine-1-carboxylic acid Chemical compound NCC1CCN(C(O)=O)CC1 ZXPDVRCLICXEDW-UHFFFAOYSA-N 0.000 description 1
- DEZJKGVJDMAGPI-UHFFFAOYSA-N 4-(piperidin-4-ylmethyl)morpholine Chemical compound C1COCCN1CC1CCNCC1 DEZJKGVJDMAGPI-UHFFFAOYSA-N 0.000 description 1
- XAGOJJLKHUDMBW-XNWIYYODSA-N 4-[(3r)-3-fluoropyrrolidin-1-yl]cyclohexan-1-amine Chemical compound C1CC(N)CCC1N1C[C@H](F)CC1 XAGOJJLKHUDMBW-XNWIYYODSA-N 0.000 description 1
- JDYWFZJIINVRGG-UHFFFAOYSA-N 4-[(dimethylamino)methyl]cyclohexan-1-amine Chemical compound CN(C)CC1CCC(N)CC1 JDYWFZJIINVRGG-UHFFFAOYSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- KVCQTKNUUQOELD-UHFFFAOYSA-N 4-amino-n-[1-(3-chloro-2-fluoroanilino)-6-methylisoquinolin-5-yl]thieno[3,2-d]pyrimidine-7-carboxamide Chemical compound N=1C=CC2=C(NC(=O)C=3C4=NC=NC(N)=C4SC=3)C(C)=CC=C2C=1NC1=CC=CC(Cl)=C1F KVCQTKNUUQOELD-UHFFFAOYSA-N 0.000 description 1
- OTCYOBLTAQTFPW-UHFFFAOYSA-N 4-aminocyclohexan-1-one Chemical compound NC1CCC(=O)CC1 OTCYOBLTAQTFPW-UHFFFAOYSA-N 0.000 description 1
- HWWKEEKUMAZJLL-UHFFFAOYSA-N 4-bromo-2,5-dichlorophenol Chemical compound OC1=CC(Cl)=C(Br)C=C1Cl HWWKEEKUMAZJLL-UHFFFAOYSA-N 0.000 description 1
- KGURSDWHGSLAPP-UHFFFAOYSA-N 4-bromo-2,6-dichlorophenol Chemical compound OC1=C(Cl)C=C(Br)C=C1Cl KGURSDWHGSLAPP-UHFFFAOYSA-N 0.000 description 1
- GPRPSJPFAAGLCA-UHFFFAOYSA-N 4-bromo-2,6-difluorophenol Chemical compound OC1=C(F)C=C(Br)C=C1F GPRPSJPFAAGLCA-UHFFFAOYSA-N 0.000 description 1
- QEYONPKSDTUPAX-UHFFFAOYSA-N 4-bromo-2-chloro-6-fluorophenol Chemical compound OC1=C(F)C=C(Br)C=C1Cl QEYONPKSDTUPAX-UHFFFAOYSA-N 0.000 description 1
- FHIRTCZQNMPCJR-UHFFFAOYSA-N 4-bromo-2-ethoxyphenol Chemical compound CCOC1=CC(Br)=CC=C1O FHIRTCZQNMPCJR-UHFFFAOYSA-N 0.000 description 1
- YTMVYYAKOPIJCZ-UHFFFAOYSA-N 4-bromo-3-fluoroaniline Chemical compound NC1=CC=C(Br)C(F)=C1 YTMVYYAKOPIJCZ-UHFFFAOYSA-N 0.000 description 1
- HAAZMOAXEMIBAJ-UHFFFAOYSA-N 4-chloro-2-methylquinazoline Chemical compound C1=CC=CC2=NC(C)=NC(Cl)=C21 HAAZMOAXEMIBAJ-UHFFFAOYSA-N 0.000 description 1
- KNDOFJFSHZCKGT-UHFFFAOYSA-N 4-chloroquinoline Chemical compound C1=CC=C2C(Cl)=CC=NC2=C1 KNDOFJFSHZCKGT-UHFFFAOYSA-N 0.000 description 1
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- QTUOGSLVMUEPHC-UHFFFAOYSA-N 5-(2-pyrrolidin-1-ylethyl)pyridin-3-amine Chemical compound NC1=CN=CC(CCN2CCCC2)=C1 QTUOGSLVMUEPHC-UHFFFAOYSA-N 0.000 description 1
- KJQVHJSIJTVCMN-UHFFFAOYSA-N 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine-2-carbonitrile Chemical compound O1C(C)(C)C(C)(C)OB1C1=CN=C(C#N)N=C1 KJQVHJSIJTVCMN-UHFFFAOYSA-N 0.000 description 1
- DSCFNLMKJIJOGC-UHFFFAOYSA-N 5-[4-[(4-aminocyclohexyl)amino]-3-(cyclopropanecarbonyl)quinolin-6-yl]pyrimidine-2-carbonitrile Chemical compound C1CC(N)CCC1NC1=C(C(=O)C2CC2)C=NC2=CC=C(C=3C=NC(=NC=3)C#N)C=C12 DSCFNLMKJIJOGC-UHFFFAOYSA-N 0.000 description 1
- TYXARYCYNYDFQO-UHFFFAOYSA-N 5-[4-[(4-aminocyclohexyl)amino]-3-(cyclopropanecarbonyl)quinolin-6-yl]thiophene-2-carbonitrile Chemical compound C1CC(N)CCC1NC1=C(C(=O)C2CC2)C=NC2=CC=C(C=3SC(=CC=3)C#N)C=C12 TYXARYCYNYDFQO-UHFFFAOYSA-N 0.000 description 1
- UGSBCCAHDVCHGI-UHFFFAOYSA-N 5-nitropyridin-2-amine Chemical compound NC1=CC=C([N+]([O-])=O)C=N1 UGSBCCAHDVCHGI-UHFFFAOYSA-N 0.000 description 1
- ZXEKJPFIYUSIAG-UHFFFAOYSA-N 6-(3-chloro-4-hydroxy-5-methoxyphenyl)-4-[[4-(dimethylamino)cyclohexyl]amino]quinoline-3-carbonitrile Chemical compound ClC1=C(O)C(OC)=CC(C=2C=C3C(NC4CCC(CC4)N(C)C)=C(C#N)C=NC3=CC=2)=C1 ZXEKJPFIYUSIAG-UHFFFAOYSA-N 0.000 description 1
- GXXKHIYFTNGUKM-UHFFFAOYSA-N 6-[2-(dimethylamino)ethoxy]pyridin-3-amine Chemical compound CN(C)CCOC1=CC=C(N)C=N1 GXXKHIYFTNGUKM-UHFFFAOYSA-N 0.000 description 1
- YMTSCQAEHHZTLJ-UHFFFAOYSA-N 6-[3-(dimethylamino)pyrrolidin-1-yl]pyridin-3-amine Chemical compound C1C(N(C)C)CCN1C1=CC=C(N)C=N1 YMTSCQAEHHZTLJ-UHFFFAOYSA-N 0.000 description 1
- KJILYZMXTLCPDQ-UHFFFAOYSA-N 6-bromo-4-chloroquinoline Chemical compound C1=C(Br)C=C2C(Cl)=CC=NC2=C1 KJILYZMXTLCPDQ-UHFFFAOYSA-N 0.000 description 1
- OCILRHPBZATKKG-UHFFFAOYSA-N 6-bromo-4-chloroquinoline-3-carbonitrile Chemical compound C1=C(Br)C=C2C(Cl)=C(C#N)C=NC2=C1 OCILRHPBZATKKG-UHFFFAOYSA-N 0.000 description 1
- GIIQBDSNDJOXAW-UHFFFAOYSA-N 6-piperidin-4-ylpyridin-3-amine Chemical compound N1=CC(N)=CC=C1C1CCNCC1 GIIQBDSNDJOXAW-UHFFFAOYSA-N 0.000 description 1
- ZYTKOPQBRLXOHO-UHFFFAOYSA-N 6-pyrrol-1-ylpyridin-3-amine Chemical compound N1=CC(N)=CC=C1N1C=CC=C1 ZYTKOPQBRLXOHO-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 206010004593 Bile duct cancer Diseases 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- GTJKWTMHHTUFSX-UHFFFAOYSA-N C(CCC)C1CCC(CC1)ONC1CCCCC1 Chemical compound C(CCC)C1CCC(CC1)ONC1CCCCC1 GTJKWTMHHTUFSX-UHFFFAOYSA-N 0.000 description 1
- FEPFNCWLEDRJRH-SAABIXHNSA-N C([C@H]1CC[C@@H](CC1)NC1=C2C=C(Br)C=CC2=NC=C1C(=O)C)N1CCCC1 Chemical compound C([C@H]1CC[C@@H](CC1)NC1=C2C=C(Br)C=CC2=NC=C1C(=O)C)N1CCCC1 FEPFNCWLEDRJRH-SAABIXHNSA-N 0.000 description 1
- KUHSFMJRJUXBEC-LBZQVFOQSA-N C1=C(Cl)C(O)=C(F)C=C1C1=CC=C(N=CC(C(=O)C2CC2)=C2N[C@@H]3CC[C@@H](CN4CCCC4)CC3)C2=C1 Chemical compound C1=C(Cl)C(O)=C(F)C=C1C1=CC=C(N=CC(C(=O)C2CC2)=C2N[C@@H]3CC[C@@H](CN4CCCC4)CC3)C2=C1 KUHSFMJRJUXBEC-LBZQVFOQSA-N 0.000 description 1
- WCUMPWPVSHRFOL-UKIBZPOASA-N C1C[C@@H](N(C)C)CC[C@@H]1CNC1=C(C(=O)C2CC2)C=NC2=CC=C(C=3C=C(Cl)C(O)=C(Cl)C=3)C=C12 Chemical compound C1C[C@@H](N(C)C)CC[C@@H]1CNC1=C(C(=O)C2CC2)C=NC2=CC=C(C=3C=C(Cl)C(O)=C(Cl)C=3)C=C12 WCUMPWPVSHRFOL-UKIBZPOASA-N 0.000 description 1
- UUUPKSWSKGUYBT-IYARVYRRSA-N C1C[C@@H](N(C)C)CC[C@@H]1NC1=C(C(C)=O)C=NC2=CC=C(C=3C=C(Cl)C(O)=C(Cl)C=3)C=C12 Chemical class C1C[C@@H](N(C)C)CC[C@@H]1NC1=C(C(C)=O)C=NC2=CC=C(C=3C=C(Cl)C(O)=C(Cl)C=3)C=C12 UUUPKSWSKGUYBT-IYARVYRRSA-N 0.000 description 1
- CDCOFSZGRLCRHC-HAQNSBGRSA-N C1C[C@@H](N)CC[C@@H]1NC1=C(C(=O)C2CC2)C=NC2=CC(F)=C(Br)C=C12 Chemical compound C1C[C@@H](N)CC[C@@H]1NC1=C(C(=O)C2CC2)C=NC2=CC(F)=C(Br)C=C12 CDCOFSZGRLCRHC-HAQNSBGRSA-N 0.000 description 1
- RSAXOUMJDDKPOJ-MGCOHNPYSA-N C1C[C@@H](NC)CC[C@@H]1N1N=CC(N)=C1 Chemical compound C1C[C@@H](NC)CC[C@@H]1N1N=CC(N)=C1 RSAXOUMJDDKPOJ-MGCOHNPYSA-N 0.000 description 1
- SGNKPJPMWHKOJO-MGCOHNPYSA-N CC(C)(C)OC(=O)N[C@H]1CC[C@H](CO)CC1 Chemical compound CC(C)(C)OC(=O)N[C@H]1CC[C@H](CO)CC1 SGNKPJPMWHKOJO-MGCOHNPYSA-N 0.000 description 1
- SMECPQKFGGWXQS-UHFFFAOYSA-N CC(C)C(CC(=O)O)OCC=O Chemical compound CC(C)C(CC(=O)O)OCC=O SMECPQKFGGWXQS-UHFFFAOYSA-N 0.000 description 1
- WZYYGSQRYDSAON-RUCARUNLSA-N CCC(=O)C1=CN=C2C=CC(C=3C=C(Cl)C(O)=C(F)C=3)=CC2=C1N[C@H]1CC[C@H](CN(C)C)CC1 Chemical compound CCC(=O)C1=CN=C2C=CC(C=3C=C(Cl)C(O)=C(F)C=3)=CC2=C1N[C@H]1CC[C@H](CN(C)C)CC1 WZYYGSQRYDSAON-RUCARUNLSA-N 0.000 description 1
- NQOQVZDHSWVXQN-JCNLHEQBSA-N CCCC(=O)C1=CN=C2C=CC(Br)=CC2=C1N[C@H]1CC[C@H](CN(C)C)CC1 Chemical compound CCCC(=O)C1=CN=C2C=CC(Br)=CC2=C1N[C@H]1CC[C@H](CN(C)C)CC1 NQOQVZDHSWVXQN-JCNLHEQBSA-N 0.000 description 1
- GTTIXUNXAHRAHG-JOCQHMNTSA-N CN(C)CC[C@H]1CC[C@H](NC(=O)OC(C)(C)C)CC1 Chemical compound CN(C)CC[C@H]1CC[C@H](NC(=O)OC(C)(C)C)CC1 GTTIXUNXAHRAHG-JOCQHMNTSA-N 0.000 description 1
- AQRWDLOWHDZKAQ-KYZUINATSA-N CN(C)[C@H]1CC[C@H](CN)CC1 Chemical compound CN(C)[C@H]1CC[C@H](CN)CC1 AQRWDLOWHDZKAQ-KYZUINATSA-N 0.000 description 1
- DCERHCFNWRGHLK-UHFFFAOYSA-N C[Si](C)C Chemical compound C[Si](C)C DCERHCFNWRGHLK-UHFFFAOYSA-N 0.000 description 1
- UWNXGZKSIKQKAH-UHFFFAOYSA-N Cc1cc(CNC(CO)C(O)=O)c(OCc2cccc(c2)C#N)cc1OCc1cccc(c1C)-c1ccc2OCCOc2c1 Chemical compound Cc1cc(CNC(CO)C(O)=O)c(OCc2cccc(c2)C#N)cc1OCc1cccc(c1C)-c1ccc2OCCOc2c1 UWNXGZKSIKQKAH-UHFFFAOYSA-N 0.000 description 1
- 244000248349 Citrus limon Species 0.000 description 1
- 235000005979 Citrus limon Nutrition 0.000 description 1
- JEJQLPFWZSTROF-AWLKUTLJSA-N Cl.C1C[C@@H](N)CC[C@@H]1N1CCCC1 Chemical compound Cl.C1C[C@@H](N)CC[C@@H]1N1CCCC1 JEJQLPFWZSTROF-AWLKUTLJSA-N 0.000 description 1
- XUOPQUUZAXZXMM-NURFIRCWSA-N Cl.Cl.C1C[C@@H](CN(C)C)CC[C@@H]1NC1=C(C(C)=O)C=NC2=CC=C(C=3C=C(Cl)C(O)=C(F)C=3)C=C12 Chemical compound Cl.Cl.C1C[C@@H](CN(C)C)CC[C@@H]1NC1=C(C(C)=O)C=NC2=CC=C(C=3C=C(Cl)C(O)=C(F)C=3)C=C12 XUOPQUUZAXZXMM-NURFIRCWSA-N 0.000 description 1
- WTHNXXUMHGRWNY-SOBFFWEGSA-N Cl.Cl.C1C[C@@H](N)CC[C@@H]1CN1CCCC1 Chemical compound Cl.Cl.C1C[C@@H](N)CC[C@@H]1CN1CCCC1 WTHNXXUMHGRWNY-SOBFFWEGSA-N 0.000 description 1
- GKGFFKDMRGBQQN-VAJGKAQFSA-N Cl.Cl.C1C[C@@H](N)CC[C@@H]1NC1=C(C(=O)C2CC2)C=NC2=CC=C(C=3C=C(Cl)C(O)=C(Cl)C=3)C=C12 Chemical compound Cl.Cl.C1C[C@@H](N)CC[C@@H]1NC1=C(C(=O)C2CC2)C=NC2=CC=C(C=3C=C(Cl)C(O)=C(Cl)C=3)C=C12 GKGFFKDMRGBQQN-VAJGKAQFSA-N 0.000 description 1
- UVYCNIHVMSGMAB-PMXFUEHMSA-N Cl.Cl.N[C@@H]1CC[C@H](CC1)NC1=C(C=NC2=CC=C(C=C12)C1=CC(=C(C=C1OC)O)Cl)C(CC(C)C)=O Chemical compound Cl.Cl.N[C@@H]1CC[C@H](CC1)NC1=C(C=NC2=CC=C(C=C12)C1=CC(=C(C=C1OC)O)Cl)C(CC(C)C)=O UVYCNIHVMSGMAB-PMXFUEHMSA-N 0.000 description 1
- CTFFUKCCILBDCS-MXVIHJGJSA-N ClC1=C(O)C(OC)=CC(C=2C=C3C(N[C@@H]4CC[C@H](CC4)N(C)C)=C(C(=O)C4CC4)C=NC3=CC=2)=C1 Chemical compound ClC1=C(O)C(OC)=CC(C=2C=C3C(N[C@@H]4CC[C@H](CC4)N(C)C)=C(C(=O)C4CC4)C=NC3=CC=2)=C1 CTFFUKCCILBDCS-MXVIHJGJSA-N 0.000 description 1
- QBXVXKRWOVBUDB-GRKNLSHJSA-N ClC=1C(=CC(=C(CN2[C@H](C[C@H](C2)O)C(=O)O)C1)OCC1=CC(=CC=C1)C#N)OCC1=C(C(=CC=C1)C1=CC2=C(OCCO2)C=C1)C Chemical compound ClC=1C(=CC(=C(CN2[C@H](C[C@H](C2)O)C(=O)O)C1)OCC1=CC(=CC=C1)C#N)OCC1=C(C(=CC=C1)C1=CC2=C(OCCO2)C=C1)C QBXVXKRWOVBUDB-GRKNLSHJSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- JGFDZZLUDWMUQH-UHFFFAOYSA-N Didecyldimethylammonium Chemical compound CCCCCCCCCC[N+](C)(C)CCCCCCCCCC JGFDZZLUDWMUQH-UHFFFAOYSA-N 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 1
- WHUUTDBJXJRKMK-UHFFFAOYSA-N Glutamic acid Chemical class OC(=O)C(N)CCC(O)=O WHUUTDBJXJRKMK-UHFFFAOYSA-N 0.000 description 1
- 239000004471 Glycine Chemical class 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- 101000783681 Homo sapiens 5'-AMP-activated protein kinase catalytic subunit alpha-2 Proteins 0.000 description 1
- 229920002153 Hydroxypropyl cellulose Polymers 0.000 description 1
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical class OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 1
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical class OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 1
- COLNVLDHVKWLRT-QMMMGPOBSA-N L-phenylalanine Chemical class OC(=O)[C@@H](N)CC1=CC=CC=C1 COLNVLDHVKWLRT-QMMMGPOBSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- SVYKKECYCPFKGB-UHFFFAOYSA-N N,N-dimethylcyclohexylamine Chemical compound CN(C)C1CCCCC1 SVYKKECYCPFKGB-UHFFFAOYSA-N 0.000 description 1
- XTUVJUMINZSXGF-UHFFFAOYSA-N N-methylcyclohexylamine Chemical compound CNC1CCCCC1 XTUVJUMINZSXGF-UHFFFAOYSA-N 0.000 description 1
- 238000000636 Northern blotting Methods 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 102100026450 POU domain, class 3, transcription factor 4 Human genes 0.000 description 1
- 101710133389 POU domain, class 3, transcription factor 4 Proteins 0.000 description 1
- 102100037483 POU domain, class 6, transcription factor 1 Human genes 0.000 description 1
- 101710196406 POU domain, class 6, transcription factor 1 Proteins 0.000 description 1
- 229930040373 Paraformaldehyde Natural products 0.000 description 1
- 102000001253 Protein Kinase Human genes 0.000 description 1
- 108020004459 Small interfering RNA Proteins 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 1
- GYDJEQRTZSCIOI-UHFFFAOYSA-N Tranexamic acid Chemical compound NCC1CCC(C(O)=O)CC1 GYDJEQRTZSCIOI-UHFFFAOYSA-N 0.000 description 1
- LXRZVMYMQHNYJB-UNXOBOICSA-N [(1R,2S,4R)-4-[[5-[4-[(1R)-7-chloro-1,2,3,4-tetrahydroisoquinolin-1-yl]-5-methylthiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl]methyl sulfamate Chemical compound CC1=C(C=C(S1)C(=O)C1=C(N[C@H]2C[C@H](O)[C@@H](COS(N)(=O)=O)C2)N=CN=C1)[C@@H]1NCCC2=C1C=C(Cl)C=C2 LXRZVMYMQHNYJB-UNXOBOICSA-N 0.000 description 1
- JRZCCUKNNXDEIG-UHFFFAOYSA-N [4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]methyl methanesulfonate Chemical compound CC(C)(C)OC(=O)NC1CCC(COS(C)(=O)=O)CC1 JRZCCUKNNXDEIG-UHFFFAOYSA-N 0.000 description 1
- VWNSIQYHGDMMSL-UHFFFAOYSA-N [4-[(4-aminocyclohexyl)amino]-6-(1h-pyrazol-4-yl)quinolin-3-yl]-cyclopropylmethanone Chemical compound C1CC(N)CCC1NC1=C(C(=O)C2CC2)C=NC2=CC=C(C3=CNN=C3)C=C12 VWNSIQYHGDMMSL-UHFFFAOYSA-N 0.000 description 1
- JVNQZNGPPVHMQY-UHFFFAOYSA-N [4-[(4-aminocyclohexyl)amino]-6-(2,5-dichloro-4-hydroxyphenyl)quinolin-3-yl]-cyclopropylmethanone Chemical compound C1CC(N)CCC1NC1=C(C(=O)C2CC2)C=NC2=CC=C(C=3C(=CC(O)=C(Cl)C=3)Cl)C=C12 JVNQZNGPPVHMQY-UHFFFAOYSA-N 0.000 description 1
- WRPWOPNJAIACGK-UHFFFAOYSA-N [4-[(4-aminocyclohexyl)amino]-6-(3-chloro-5-fluoro-4-hydroxyphenyl)quinolin-3-yl]-cyclopropylmethanone Chemical compound C1CC(N)CCC1NC1=C(C(=O)C2CC2)C=NC2=CC=C(C=3C=C(Cl)C(O)=C(F)C=3)C=C12 WRPWOPNJAIACGK-UHFFFAOYSA-N 0.000 description 1
- FIECCWJMPTXXLB-UHFFFAOYSA-N [4-[(4-aminocyclohexyl)amino]-6-(3h-benzimidazol-5-yl)quinolin-3-yl]-cyclopropylmethanone Chemical compound C1CC(N)CCC1NC1=C(C(=O)C2CC2)C=NC2=CC=C(C=3C=C4NC=NC4=CC=3)C=C12 FIECCWJMPTXXLB-UHFFFAOYSA-N 0.000 description 1
- OXFLRMSGADYGMO-UHFFFAOYSA-N [4-[(4-aminocyclohexyl)amino]-6-(4-hydroxyphenyl)quinolin-3-yl]-cyclopropylmethanone Chemical compound C1CC(N)CCC1NC1=C(C(=O)C2CC2)C=NC2=CC=C(C=3C=CC(O)=CC=3)C=C12 OXFLRMSGADYGMO-UHFFFAOYSA-N 0.000 description 1
- YXWULLZXPZGCHJ-UHFFFAOYSA-N [4-[(4-aminocyclohexyl)amino]-6-pyridin-4-ylquinolin-3-yl]-cyclopropylmethanone Chemical compound C1CC(N)CCC1NC1=C(C(=O)C2CC2)C=NC2=CC=C(C=3C=CN=CC=3)C=C12 YXWULLZXPZGCHJ-UHFFFAOYSA-N 0.000 description 1
- YYTZMVHMHBXKEI-UHFFFAOYSA-N [4-[[4-[bis(prop-2-enyl)amino]-4-methylcyclohexyl]amino]-6-bromoquinolin-3-yl]-cyclopropylmethanone Chemical compound C1CC(C)(N(CC=C)CC=C)CCC1NC1=C(C(=O)C2CC2)C=NC2=CC=C(Br)C=C12 YYTZMVHMHBXKEI-UHFFFAOYSA-N 0.000 description 1
- KVYXBFBBJZWCIX-UHFFFAOYSA-N [6-(3-chloro-4-hydroxy-5-methoxyphenyl)-4-[(4-pyrrolidin-1-ylcyclohexyl)amino]quinolin-3-yl]-cyclopropylmethanone Chemical compound ClC1=C(O)C(OC)=CC(C=2C=C3C(NC4CCC(CC4)N4CCCC4)=C(C(=O)C4CC4)C=NC3=CC=2)=C1 KVYXBFBBJZWCIX-UHFFFAOYSA-N 0.000 description 1
- BSUROGRRTPDFFP-UHFFFAOYSA-N [6-(3-chloro-4-hydroxy-5-methoxyphenyl)-4-[4-(pyrrolidin-1-ylmethyl)piperidin-1-yl]quinolin-3-yl]-cyclopropylmethanone Chemical compound ClC1=C(O)C(OC)=CC(C=2C=C3C(N4CCC(CN5CCCC5)CC4)=C(C(=O)C4CC4)C=NC3=CC=2)=C1 BSUROGRRTPDFFP-UHFFFAOYSA-N 0.000 description 1
- KBEIMUAZVQXFGN-UHFFFAOYSA-N [6-(3-chloro-4-hydroxy-5-methoxyphenyl)-4-[4-[(dimethylamino)methyl]piperidin-1-yl]quinolin-3-yl]-cyclopropylmethanone Chemical compound ClC1=C(O)C(OC)=CC(C=2C=C3C(N4CCC(CN(C)C)CC4)=C(C(=O)C4CC4)C=NC3=CC=2)=C1 KBEIMUAZVQXFGN-UHFFFAOYSA-N 0.000 description 1
- IQFRMJUSBZIJLH-UHFFFAOYSA-N [6-(3-chloro-4-hydroxy-5-methoxyphenyl)-4-[[4-(diethylamino)cyclohexyl]amino]quinolin-3-yl]-cyclopropylmethanone;dihydrochloride Chemical compound Cl.Cl.C1CC(N(CC)CC)CCC1NC1=C(C(=O)C2CC2)C=NC2=CC=C(C=3C=C(OC)C(O)=C(Cl)C=3)C=C12 IQFRMJUSBZIJLH-UHFFFAOYSA-N 0.000 description 1
- AHXXKCAUCZIOKC-UHFFFAOYSA-N [6-(3-chloro-4-hydroxyphenyl)-4-[(4-pyrrolidin-1-ylcyclohexyl)amino]quinolin-3-yl]-cyclopropylmethanone Chemical compound C1=C(Cl)C(O)=CC=C1C1=CC=C(N=CC(C(=O)C2CC2)=C2NC3CCC(CC3)N3CCCC3)C2=C1 AHXXKCAUCZIOKC-UHFFFAOYSA-N 0.000 description 1
- MALPONILHDQNAC-UHFFFAOYSA-N [6-(3-chloro-4-hydroxyphenyl)-4-[4-(morpholin-4-ylmethyl)piperidin-1-yl]quinolin-3-yl]-cyclopropylmethanone Chemical compound C1=C(Cl)C(O)=CC=C1C1=CC=C(N=CC(C(=O)C2CC2)=C2N3CCC(CN4CCOCC4)CC3)C2=C1 MALPONILHDQNAC-UHFFFAOYSA-N 0.000 description 1
- CQYBWZJGQAUHAU-UHFFFAOYSA-N [6-(3-chloro-4-hydroxyphenyl)-4-[[4-(diethylamino)cyclohexyl]amino]quinolin-3-yl]-cyclopropylmethanone Chemical compound C1CC(N(CC)CC)CCC1NC1=C(C(=O)C2CC2)C=NC2=CC=C(C=3C=C(Cl)C(O)=CC=3)C=C12 CQYBWZJGQAUHAU-UHFFFAOYSA-N 0.000 description 1
- FOCACBBGBBDUHT-UHFFFAOYSA-N [6-(3-chloro-5-fluoro-4-hydroxyphenyl)-4-[(1-methylpiperidin-4-yl)methylamino]quinolin-3-yl]-cyclopropylmethanone Chemical compound C1CN(C)CCC1CNC1=C(C(=O)C2CC2)C=NC2=CC=C(C=3C=C(Cl)C(O)=C(F)C=3)C=C12 FOCACBBGBBDUHT-UHFFFAOYSA-N 0.000 description 1
- ROGFASLHJRCSFL-UHFFFAOYSA-N [6-(3-chloro-5-fluoro-4-hydroxyphenyl)-4-[4-[1-(dimethylamino)ethyl]piperidin-1-yl]quinolin-3-yl]-cyclopropylmethanone Chemical compound C1CC(C(C)N(C)C)CCN1C1=C(C(=O)C2CC2)C=NC2=CC=C(C=3C=C(Cl)C(O)=C(F)C=3)C=C12 ROGFASLHJRCSFL-UHFFFAOYSA-N 0.000 description 1
- XCFIRPXNNQOZIH-UHFFFAOYSA-N [6-bromo-4-[3-(2-pyrrolidin-1-ylethyl)anilino]quinolin-3-yl]-cyclopropylmethanone Chemical compound C=1C=CC(CCN2CCCC2)=CC=1NC=1C2=CC(Br)=CC=C2N=CC=1C(=O)C1CC1 XCFIRPXNNQOZIH-UHFFFAOYSA-N 0.000 description 1
- HQLGBWKFNJPCGT-UHFFFAOYSA-N [6-bromo-4-[3-[(dimethylamino)methyl]anilino]quinolin-3-yl]-cyclopropylmethanone Chemical compound CN(C)CC1=CC=CC(NC=2C3=CC(Br)=CC=C3N=CC=2C(=O)C2CC2)=C1 HQLGBWKFNJPCGT-UHFFFAOYSA-N 0.000 description 1
- KNQTUPYJVAOIJC-UHFFFAOYSA-N [6-bromo-4-[3-[2-(dimethylamino)ethyl]anilino]quinolin-3-yl]-cyclopropylmethanone Chemical compound CN(C)CCC1=CC=CC(NC=2C3=CC(Br)=CC=C3N=CC=2C(=O)C2CC2)=C1 KNQTUPYJVAOIJC-UHFFFAOYSA-N 0.000 description 1
- NYEQXTJJBJQXFW-UHFFFAOYSA-N [6-bromo-4-[4-(pyrrolidin-1-ylmethyl)anilino]quinolin-3-yl]-cyclopropylmethanone Chemical compound C=1C=C(CN2CCCC2)C=CC=1NC=1C2=CC(Br)=CC=C2N=CC=1C(=O)C1CC1 NYEQXTJJBJQXFW-UHFFFAOYSA-N 0.000 description 1
- QKWDUZFRDWNIRP-UHFFFAOYSA-N [6-bromo-4-[4-[2-(dimethylamino)-1-hydroxyethyl]anilino]quinolin-3-yl]-cyclopropylmethanone Chemical compound C1=CC(C(O)CN(C)C)=CC=C1NC1=C(C(=O)C2CC2)C=NC2=CC=C(Br)C=C12 QKWDUZFRDWNIRP-UHFFFAOYSA-N 0.000 description 1
- ROLQMXFBOOEPLW-UHFFFAOYSA-N [6-bromo-4-[4-[2-(dimethylamino)ethyl]anilino]quinolin-3-yl]-cyclopropylmethanone Chemical compound C1=CC(CCN(C)C)=CC=C1NC1=C(C(=O)C2CC2)C=NC2=CC=C(Br)C=C12 ROLQMXFBOOEPLW-UHFFFAOYSA-N 0.000 description 1
- MZFHPGLKEDJPRK-UHFFFAOYSA-N [6-bromo-4-[[4-(3,3-difluoropyrrolidin-1-yl)cyclohexyl]amino]quinolin-3-yl]-cyclopropylmethanone Chemical compound C1C(F)(F)CCN1C1CCC(NC=2C3=CC(Br)=CC=C3N=CC=2C(=O)C2CC2)CC1 MZFHPGLKEDJPRK-UHFFFAOYSA-N 0.000 description 1
- CQHRUUATRNCCPZ-UHFFFAOYSA-N [6-bromo-4-[[4-(3-methoxypyrrolidin-1-yl)cyclohexyl]amino]quinolin-3-yl]-cyclopropylmethanone Chemical compound C1C(OC)CCN1C1CCC(NC=2C3=CC(Br)=CC=C3N=CC=2C(=O)C2CC2)CC1 CQHRUUATRNCCPZ-UHFFFAOYSA-N 0.000 description 1
- NMDHQNVMUJJFPF-WWDZGPRUSA-N [6-bromo-4-[[4-[(3r)-3-fluoropyrrolidin-1-yl]cyclohexyl]amino]quinolin-3-yl]-cyclopropylmethanone Chemical compound C1[C@H](F)CCN1C1CCC(NC=2C3=CC(Br)=CC=C3N=CC=2C(=O)C2CC2)CC1 NMDHQNVMUJJFPF-WWDZGPRUSA-N 0.000 description 1
- MZVQCMJNVPIDEA-UHFFFAOYSA-N [CH2]CN(CC)CC Chemical group [CH2]CN(CC)CC MZVQCMJNVPIDEA-UHFFFAOYSA-N 0.000 description 1
- RQJAEYPEJZZMHT-UHFFFAOYSA-N [Cl-].Cl[PH3+] Chemical compound [Cl-].Cl[PH3+] RQJAEYPEJZZMHT-UHFFFAOYSA-N 0.000 description 1
- PJNXAZUZWKCGRS-UHFFFAOYSA-N [N+](=O)([O-])C=1C=NC=C(C1)C#CCCCCCCCCCC(C)(C)C Chemical compound [N+](=O)([O-])C=1C=NC=C(C1)C#CCCCCCCCCCC(C)(C)C PJNXAZUZWKCGRS-UHFFFAOYSA-N 0.000 description 1
- AMUSYIUKEYMNEE-UHFFFAOYSA-N [P].ClO Chemical compound [P].ClO AMUSYIUKEYMNEE-UHFFFAOYSA-N 0.000 description 1
- JVFDYPYETAEUBX-UHFFFAOYSA-N [methoxy(trifluoromethoxy)amino]oxyethane Chemical compound CON(OC(F)(F)F)OCC JVFDYPYETAEUBX-UHFFFAOYSA-N 0.000 description 1
- ZVDDJPSHRNMSKV-UHFFFAOYSA-N acetaldehyde;hydrochloride Chemical compound Cl.CC=O ZVDDJPSHRNMSKV-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 125000005073 adamantyl group Chemical group C12(CC3CC(CC(C1)C3)C2)* 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 235000001014 amino acid Nutrition 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- MDFFNEOEWAXZRQ-UHFFFAOYSA-N aminyl Chemical group [NH2] MDFFNEOEWAXZRQ-UHFFFAOYSA-N 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 239000002246 antineoplastic agent Substances 0.000 description 1
- 150000001499 aryl bromides Chemical class 0.000 description 1
- 235000003704 aspartic acid Nutrition 0.000 description 1
- 125000002393 azetidinyl group Chemical group 0.000 description 1
- 125000004069 aziridinyl group Chemical group 0.000 description 1
- 125000005605 benzo group Chemical group 0.000 description 1
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 125000003354 benzotriazolyl group Chemical group N1N=NC2=C1C=CC=C2* 0.000 description 1
- FFBHFFJDDLITSX-UHFFFAOYSA-N benzyl N-[2-hydroxy-4-(3-oxomorpholin-4-yl)phenyl]carbamate Chemical compound OC1=C(NC(=O)OCC2=CC=CC=C2)C=CC(=C1)N1CCOCC1=O FFBHFFJDDLITSX-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- OQFSQFPPLPISGP-UHFFFAOYSA-N beta-carboxyaspartic acid Chemical class OC(=O)C(N)C(C(O)=O)C(O)=O OQFSQFPPLPISGP-UHFFFAOYSA-N 0.000 description 1
- 208000026900 bile duct neoplasm Diseases 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 1
- 239000004327 boric acid Substances 0.000 description 1
- ZADPBFCGQRWHPN-UHFFFAOYSA-N boronic acid Chemical compound OBO ZADPBFCGQRWHPN-UHFFFAOYSA-N 0.000 description 1
- 150000001649 bromium compounds Chemical group 0.000 description 1
- KVNRLNFWIYMESJ-UHFFFAOYSA-N butyronitrile Chemical compound CCCC#N KVNRLNFWIYMESJ-UHFFFAOYSA-N 0.000 description 1
- FGNLEIGUMSBZQP-UHFFFAOYSA-N cadaverine dihydrochloride Chemical compound Cl.Cl.NCCCCCN FGNLEIGUMSBZQP-UHFFFAOYSA-N 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 230000006369 cell cycle progression Effects 0.000 description 1
- VYLVYHXQOHJDJL-UHFFFAOYSA-K cerium trichloride Chemical compound Cl[Ce](Cl)Cl VYLVYHXQOHJDJL-UHFFFAOYSA-K 0.000 description 1
- DGLFSNZWRYADFC-UHFFFAOYSA-N chembl2334586 Chemical compound C1CCC2=CN=C(N)N=C2C2=C1NC1=CC=C(C#CC(C)(O)C)C=C12 DGLFSNZWRYADFC-UHFFFAOYSA-N 0.000 description 1
- SFZULDYEOVSIKM-UHFFFAOYSA-N chembl321317 Chemical compound C1=CC(C(=N)NO)=CC=C1C1=CC=C(C=2C=CC(=CC=2)C(=N)NO)O1 SFZULDYEOVSIKM-UHFFFAOYSA-N 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 239000002299 complementary DNA Substances 0.000 description 1
- JNGZXGGOCLZBFB-IVCQMTBJSA-N compound E Chemical compound N([C@@H](C)C(=O)N[C@@H]1C(N(C)C2=CC=CC=C2C(C=2C=CC=CC=2)=N1)=O)C(=O)CC1=CC(F)=CC(F)=C1 JNGZXGGOCLZBFB-IVCQMTBJSA-N 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- GBRBMTNGQBKBQE-UHFFFAOYSA-L copper;diiodide Chemical compound I[Cu]I GBRBMTNGQBKBQE-UHFFFAOYSA-L 0.000 description 1
- 239000013058 crude material Substances 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- KZZKOVLJUKWSKX-UHFFFAOYSA-N cyclobutanamine Chemical compound NC1CCC1 KZZKOVLJUKWSKX-UHFFFAOYSA-N 0.000 description 1
- 125000001047 cyclobutenyl group Chemical group C1(=CCC1)* 0.000 description 1
- 125000001162 cycloheptenyl group Chemical group C1(=CCCCCC1)* 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- ICCFICYRAVUJNK-UHFFFAOYSA-N cyclohexanamine;dihydrochloride Chemical compound Cl.Cl.NC1CCCCC1 ICCFICYRAVUJNK-UHFFFAOYSA-N 0.000 description 1
- VKIRRGRTJUUZHS-UHFFFAOYSA-N cyclohexane-1,4-diamine Chemical compound NC1CCC(N)CC1 VKIRRGRTJUUZHS-UHFFFAOYSA-N 0.000 description 1
- ZJUGSKJHHWASAF-UHFFFAOYSA-N cyclohexylazanium;chloride Chemical compound [Cl-].[NH3+]C1CCCCC1 ZJUGSKJHHWASAF-UHFFFAOYSA-N 0.000 description 1
- 125000000522 cyclooctenyl group Chemical group C1(=CCCCCCC1)* 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 1
- 125000000298 cyclopropenyl group Chemical group [H]C1=C([H])C1([H])* 0.000 description 1
- ILGYQUQOLKKSEH-UHFFFAOYSA-N cyclopropyl-[4-[4-[(dimethylamino)methyl]piperidin-1-yl]-6-(3-ethoxy-4-hydroxyphenyl)quinolin-3-yl]methanone Chemical compound C1=C(O)C(OCC)=CC(C=2C=C3C(N4CCC(CN(C)C)CC4)=C(C(=O)C4CC4)C=NC3=CC=2)=C1 ILGYQUQOLKKSEH-UHFFFAOYSA-N 0.000 description 1
- HGOLBSUJLUMWHR-UHFFFAOYSA-N cyclopropyl-[4-[4-[(dimethylamino)methyl]piperidin-1-yl]-6-(4-hydroxy-3-methoxyphenyl)quinolin-3-yl]methanone Chemical compound C1=C(O)C(OC)=CC(C=2C=C3C(N4CCC(CN(C)C)CC4)=C(C(=O)C4CC4)C=NC3=CC=2)=C1 HGOLBSUJLUMWHR-UHFFFAOYSA-N 0.000 description 1
- PAYGDCKLJCPRJA-UHFFFAOYSA-N cyclopropyl-[4-[[4-(diethylamino)cyclohexyl]amino]-6-(4-hydroxy-3-methoxyphenyl)quinolin-3-yl]methanone Chemical compound C1CC(N(CC)CC)CCC1NC1=C(C(=O)C2CC2)C=NC2=CC=C(C=3C=C(OC)C(O)=CC=3)C=C12 PAYGDCKLJCPRJA-UHFFFAOYSA-N 0.000 description 1
- TXOZSGUOHRWWLL-UHFFFAOYSA-N cyclopropyl-[4-[[4-(dimethylamino)cyclohexyl]amino]-6-(4-hydroxy-3-methoxyphenyl)quinolin-3-yl]methanone Chemical compound C1=C(O)C(OC)=CC(C=2C=C3C(NC4CCC(CC4)N(C)C)=C(C(=O)C4CC4)C=NC3=CC=2)=C1 TXOZSGUOHRWWLL-UHFFFAOYSA-N 0.000 description 1
- YPHVNXPTVFQMKI-UHFFFAOYSA-N cyclopropyl-[6-(3,5-dichloro-4-hydroxyphenyl)-4-[4-[(dimethylamino)methyl]anilino]quinolin-3-yl]methanone Chemical compound C1=CC(CN(C)C)=CC=C1NC1=C(C(=O)C2CC2)C=NC2=CC=C(C=3C=C(Cl)C(O)=C(Cl)C=3)C=C12 YPHVNXPTVFQMKI-UHFFFAOYSA-N 0.000 description 1
- WCXXTMBYNRBVOK-UHFFFAOYSA-N cyclopropyl-[6-(3,5-dichloro-4-hydroxyphenyl)-4-[[4-(dimethylamino)cyclohexyl]amino]quinolin-3-yl]methanone Chemical compound C1CC(N(C)C)CCC1NC1=C(C(=O)C2CC2)C=NC2=CC=C(C=3C=C(Cl)C(O)=C(Cl)C=3)C=C12 WCXXTMBYNRBVOK-UHFFFAOYSA-N 0.000 description 1
- QRSQORZQFCDLOK-UHFFFAOYSA-N cyclopropyl-[6-(3,5-dichloro-4-hydroxyphenyl)-4-[[6-[3-(methylamino)pyrrolidin-1-yl]pyridin-3-yl]amino]quinolin-3-yl]methanone;trihydrochloride Chemical compound Cl.Cl.Cl.C1C(NC)CCN1C(N=C1)=CC=C1NC1=C(C(=O)C2CC2)C=NC2=CC=C(C=3C=C(Cl)C(O)=C(Cl)C=3)C=C12 QRSQORZQFCDLOK-UHFFFAOYSA-N 0.000 description 1
- XXRPLDZJYFXXSR-UHFFFAOYSA-N cyclopropyl-[6-(3,5-difluoro-4-hydroxyphenyl)-4-[[4-(dimethylamino)cyclohexyl]amino]-7-fluoroquinolin-3-yl]methanone Chemical compound C1CC(N(C)C)CCC1NC1=C(C(=O)C2CC2)C=NC2=CC(F)=C(C=3C=C(F)C(O)=C(F)C=3)C=C12 XXRPLDZJYFXXSR-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-DYCDLGHISA-N deuterio acetate Chemical compound [2H]OC(C)=O QTBSBXVTEAMEQO-DYCDLGHISA-N 0.000 description 1
- 239000008121 dextrose Substances 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- 229910003460 diamond Chemical group 0.000 description 1
- 239000010432 diamond Chemical group 0.000 description 1
- 125000002720 diazolyl group Chemical group 0.000 description 1
- ZOCHARZZJNPSEU-UHFFFAOYSA-N diboron Chemical compound B#B ZOCHARZZJNPSEU-UHFFFAOYSA-N 0.000 description 1
- 125000003963 dichloro group Chemical group Cl* 0.000 description 1
- 125000001664 diethylamino group Chemical group [H]C([H])([H])C([H])([H])N(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000000723 dihydrobenzofuranyl group Chemical group O1C(CC2=C1C=CC=C2)* 0.000 description 1
- 125000004611 dihydroisoindolyl group Chemical group C1(NCC2=CC=CC=C12)* 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 230000013020 embryo development Effects 0.000 description 1
- MPUNXFHKIKBIFQ-UHFFFAOYSA-N ethyl 2-[(4-bromoanilino)methylidene]-3-oxohexanoate Chemical compound CCCC(=O)C(C(=O)OCC)=CNC1=CC=C(Br)C=C1 MPUNXFHKIKBIFQ-UHFFFAOYSA-N 0.000 description 1
- ODDCAKMSAKBYGM-UHFFFAOYSA-N ethyl 2-[(4-bromoanilino)methylidene]-3-oxopentanoate Chemical compound CCOC(=O)C(C(=O)CC)=CNC1=CC=C(Br)C=C1 ODDCAKMSAKBYGM-UHFFFAOYSA-N 0.000 description 1
- OCCWQCYBCZADCE-UHFFFAOYSA-N ethyl 2-methylsulfonylacetate Chemical compound CCOC(=O)CS(C)(=O)=O OCCWQCYBCZADCE-UHFFFAOYSA-N 0.000 description 1
- LIWAQLJGPBVORC-UHFFFAOYSA-N ethylmethylamine Chemical compound CCNC LIWAQLJGPBVORC-UHFFFAOYSA-N 0.000 description 1
- 125000006125 ethylsulfonyl group Chemical group 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- WTDFFADXONGQOM-UHFFFAOYSA-N formaldehyde;hydrochloride Chemical compound Cl.O=C WTDFFADXONGQOM-UHFFFAOYSA-N 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 238000011223 gene expression profiling Methods 0.000 description 1
- FVIZARNDLVOMSU-UHFFFAOYSA-N ginsenoside K Natural products C1CC(C2(CCC3C(C)(C)C(O)CCC3(C)C2CC2O)C)(C)C2C1C(C)(CCC=C(C)C)OC1OC(CO)C(O)C(O)C1O FVIZARNDLVOMSU-UHFFFAOYSA-N 0.000 description 1
- 235000013922 glutamic acid Nutrition 0.000 description 1
- 239000004220 glutamic acid Chemical class 0.000 description 1
- 230000012010 growth Effects 0.000 description 1
- 210000002216 heart Anatomy 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000003707 hexyloxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 1
- 229910052588 hydroxylapatite Inorganic materials 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 235000010977 hydroxypropyl cellulose Nutrition 0.000 description 1
- 239000001863 hydroxypropyl cellulose Substances 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 125000002632 imidazolidinyl group Chemical group 0.000 description 1
- 125000005945 imidazopyridyl group Chemical group 0.000 description 1
- 125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- QWXYZCJEXYQNEI-OSZHWHEXSA-N intermediate I Chemical compound COC(=O)[C@@]1(C=O)[C@H]2CC=[N+](C\C2=C\C)CCc2c1[nH]c1ccccc21 QWXYZCJEXYQNEI-OSZHWHEXSA-N 0.000 description 1
- 238000003402 intramolecular cyclocondensation reaction Methods 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 125000002510 isobutoxy group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])O* 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 description 1
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 1
- 125000001786 isothiazolyl group Chemical group 0.000 description 1
- 210000003734 kidney Anatomy 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 210000004185 liver Anatomy 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 230000008774 maternal effect Effects 0.000 description 1
- 108020004999 messenger RNA Proteins 0.000 description 1
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 1
- WUGKTJAKSVEAFG-UHFFFAOYSA-N methyl 5-methyl-3-oxohexanoate Chemical compound COC(=O)CC(=O)CC(C)C WUGKTJAKSVEAFG-UHFFFAOYSA-N 0.000 description 1
- 238000002493 microarray Methods 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 125000006203 morpholinoethyl group Chemical group [H]C([H])(*)C([H])([H])N1C([H])([H])C([H])([H])OC([H])([H])C1([H])[H] 0.000 description 1
- 125000001064 morpholinomethyl group Chemical group [H]C([H])(*)N1C([H])([H])C([H])([H])OC([H])([H])C1([H])[H] 0.000 description 1
- DILRJUIACXKSQE-UHFFFAOYSA-N n',n'-dimethylethane-1,2-diamine Chemical compound CN(C)CCN DILRJUIACXKSQE-UHFFFAOYSA-N 0.000 description 1
- PSHKMPUSSFXUIA-UHFFFAOYSA-N n,n-dimethylpyridin-2-amine Chemical compound CN(C)C1=CC=CC=N1 PSHKMPUSSFXUIA-UHFFFAOYSA-N 0.000 description 1
- AVAWMINJNRAQFS-UHFFFAOYSA-N n,n-dimethylpyrrolidin-3-amine Chemical compound CN(C)C1CCNC1 AVAWMINJNRAQFS-UHFFFAOYSA-N 0.000 description 1
- UEPXBTCUIIGYCY-UHFFFAOYSA-N n-[3-[2-(2-hydroxyethoxy)-6-morpholin-4-ylpyridin-4-yl]-4-methylphenyl]-2-(trifluoromethyl)pyridine-4-carboxamide Chemical compound C1=C(C=2C=C(N=C(OCCO)C=2)N2CCOCC2)C(C)=CC=C1NC(=O)C1=CC=NC(C(F)(F)F)=C1 UEPXBTCUIIGYCY-UHFFFAOYSA-N 0.000 description 1
- NNKPHNTWNILINE-UHFFFAOYSA-N n-cyclopropyl-3-fluoro-4-methyl-5-[3-[[1-[2-[2-(methylamino)ethoxy]phenyl]cyclopropyl]amino]-2-oxopyrazin-1-yl]benzamide Chemical compound CNCCOC1=CC=CC=C1C1(NC=2C(N(C=3C(=C(F)C=C(C=3)C(=O)NC3CC3)C)C=CN=2)=O)CC1 NNKPHNTWNILINE-UHFFFAOYSA-N 0.000 description 1
- DYUWTXWIYMHBQS-UHFFFAOYSA-N n-prop-2-enylprop-2-en-1-amine Chemical group C=CCNCC=C DYUWTXWIYMHBQS-UHFFFAOYSA-N 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- VACPZDQXUAOTFR-UHFFFAOYSA-N n-tert-butylbutan-1-amine Chemical compound CCCCNC(C)(C)C VACPZDQXUAOTFR-UHFFFAOYSA-N 0.000 description 1
- XBXCNNQPRYLIDE-UHFFFAOYSA-M n-tert-butylcarbamate Chemical compound CC(C)(C)NC([O-])=O XBXCNNQPRYLIDE-UHFFFAOYSA-M 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 238000011275 oncology therapy Methods 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 125000003566 oxetanyl group Chemical group 0.000 description 1
- 125000000466 oxiranyl group Chemical group 0.000 description 1
- NXJCBFBQEVOTOW-UHFFFAOYSA-L palladium(2+);dihydroxide Chemical compound O[Pd]O NXJCBFBQEVOTOW-UHFFFAOYSA-L 0.000 description 1
- 229920002866 paraformaldehyde Polymers 0.000 description 1
- XYJRXVWERLGGKC-UHFFFAOYSA-D pentacalcium;hydroxide;triphosphate Chemical compound [OH-].[Ca+2].[Ca+2].[Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O XYJRXVWERLGGKC-UHFFFAOYSA-D 0.000 description 1
- XDRYMKDFEDOLFX-UHFFFAOYSA-N pentamidine Chemical group C1=CC(C(=N)N)=CC=C1OCCCCCOC1=CC=C(C(N)=N)C=C1 XDRYMKDFEDOLFX-UHFFFAOYSA-N 0.000 description 1
- 125000003538 pentan-3-yl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004115 pentoxy group Chemical group [*]OC([H])([H])C([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- MYDQAEQZZKVJSL-UHFFFAOYSA-N pentyl carbamate Chemical compound CCCCCOC(N)=O MYDQAEQZZKVJSL-UHFFFAOYSA-N 0.000 description 1
- COLNVLDHVKWLRT-UHFFFAOYSA-N phenylalanine Chemical class OC(=O)C(N)CC1=CC=CC=C1 COLNVLDHVKWLRT-UHFFFAOYSA-N 0.000 description 1
- 235000008729 phenylalanine Nutrition 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- 125000004483 piperidin-3-yl group Chemical group N1CC(CCC1)* 0.000 description 1
- IUGYQRQAERSCNH-UHFFFAOYSA-N pivalic acid Chemical compound CC(C)(C)C(O)=O IUGYQRQAERSCNH-UHFFFAOYSA-N 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 229940086066 potassium hydrogencarbonate Drugs 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 125000006308 propyl amino group Chemical group 0.000 description 1
- 108060006633 protein kinase Proteins 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 125000002755 pyrazolinyl group Chemical group 0.000 description 1
- SHNUBALDGXWUJI-UHFFFAOYSA-N pyridin-2-ylmethanol Chemical compound OCC1=CC=CC=N1 SHNUBALDGXWUJI-UHFFFAOYSA-N 0.000 description 1
- MIROPXUFDXCYLG-UHFFFAOYSA-N pyridine-2,5-diamine Chemical compound NC1=CC=C(N)N=C1 MIROPXUFDXCYLG-UHFFFAOYSA-N 0.000 description 1
- LCDCPQHFCOBUEF-UHFFFAOYSA-N pyrrolidine-1-carboxamide Chemical group NC(=O)N1CCCC1 LCDCPQHFCOBUEF-UHFFFAOYSA-N 0.000 description 1
- 125000006085 pyrrolopyridyl group Chemical group 0.000 description 1
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 description 1
- 125000005493 quinolyl group Chemical group 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000006268 reductive amination reaction Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000002151 riboflavin Substances 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 125000003548 sec-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- XGVXKJKTISMIOW-ZDUSSCGKSA-N simurosertib Chemical compound N1N=CC(C=2SC=3C(=O)NC(=NC=3C=2)[C@H]2N3CCC(CC3)C2)=C1C XGVXKJKTISMIOW-ZDUSSCGKSA-N 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 239000012321 sodium triacetoxyborohydride Substances 0.000 description 1
- 239000012453 solvate Substances 0.000 description 1
- 125000003003 spiro group Chemical group 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 210000000130 stem cell Anatomy 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- FMNXFKVTZJWOAD-UHFFFAOYSA-N tert-butyl 1h-indole-2-carboxylate Chemical compound C1=CC=C2NC(C(=O)OC(C)(C)C)=CC2=C1 FMNXFKVTZJWOAD-UHFFFAOYSA-N 0.000 description 1
- AKQXKEBCONUWCL-UHFFFAOYSA-N tert-butyl 3-aminopiperidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCCC(N)C1 AKQXKEBCONUWCL-UHFFFAOYSA-N 0.000 description 1
- CMIBWIAICVBURI-UHFFFAOYSA-N tert-butyl 3-aminopyrrolidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC(N)C1 CMIBWIAICVBURI-UHFFFAOYSA-N 0.000 description 1
- YAIOKADNXGFBLP-UHFFFAOYSA-N tert-butyl 4-[4-[[6-bromo-3-(cyclopropanecarbonyl)quinolin-4-yl]amino]pyrazol-1-yl]piperidine-1-carboxylate Chemical compound C1CN(C(=O)OC(C)(C)C)CCC1N1N=CC(NC=2C3=CC(Br)=CC=C3N=CC=2C(=O)C2CC2)=C1 YAIOKADNXGFBLP-UHFFFAOYSA-N 0.000 description 1
- KUWDRMQCOMTRSZ-UHFFFAOYSA-N tert-butyl 8-[6-bromo-3-(cyclopropanecarbonyl)quinolin-4-yl]-2,8-diazaspiro[4.5]decane-2-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCC21CCN(C=1C3=CC(Br)=CC=C3N=CC=1C(=O)C1CC1)CC2 KUWDRMQCOMTRSZ-UHFFFAOYSA-N 0.000 description 1
- NBTNDUBSJWWOMC-GFCCVEGCSA-N tert-butyl n-[(3r)-1-(5-aminopyridin-2-yl)piperidin-3-yl]carbamate Chemical compound C1[C@H](NC(=O)OC(C)(C)C)CCCN1C1=CC=C(N)C=N1 NBTNDUBSJWWOMC-GFCCVEGCSA-N 0.000 description 1
- IREQGADLZFZRSN-UHFFFAOYSA-N tert-butyl n-[2-(4-nitrophenyl)propan-2-yl]carbamate Chemical compound CC(C)(C)OC(=O)NC(C)(C)C1=CC=C([N+]([O-])=O)C=C1 IREQGADLZFZRSN-UHFFFAOYSA-N 0.000 description 1
- WUOQXNWMYLFAHT-UHFFFAOYSA-N tert-butyl n-piperidin-3-ylcarbamate Chemical compound CC(C)(C)OC(=O)NC1CCCNC1 WUOQXNWMYLFAHT-UHFFFAOYSA-N 0.000 description 1
- CKXZPVPIDOJLLM-UHFFFAOYSA-N tert-butyl n-piperidin-4-ylcarbamate Chemical compound CC(C)(C)OC(=O)NC1CCNCC1 CKXZPVPIDOJLLM-UHFFFAOYSA-N 0.000 description 1
- YBRBMKDOPFTVDT-UHFFFAOYSA-N tert-butylamine Chemical compound CC(C)(C)N YBRBMKDOPFTVDT-UHFFFAOYSA-N 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 1
- 125000003039 tetrahydroisoquinolinyl group Chemical group C1(NCCC2=CC=CC=C12)* 0.000 description 1
- 125000005942 tetrahydropyridyl group Chemical group 0.000 description 1
- 125000003507 tetrahydrothiofenyl group Chemical group 0.000 description 1
- 125000003831 tetrazolyl group Chemical group 0.000 description 1
- 125000001113 thiadiazolyl group Chemical group 0.000 description 1
- 239000003451 thiazide diuretic agent Substances 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 125000004568 thiomorpholinyl group Chemical group 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- 125000001425 triazolyl group Chemical group 0.000 description 1
- 125000003258 trimethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- CWMFRHBXRUITQE-UHFFFAOYSA-N trimethylsilylacetylene Chemical compound C[Si](C)(C)C#C CWMFRHBXRUITQE-UHFFFAOYSA-N 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/48—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
- C07D215/54—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen attached in position 3
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/38—Nitrogen atoms
- C07D215/42—Nitrogen atoms attached in position 4
- C07D215/46—Nitrogen atoms attached in position 4 with hydrocarbon radicals, substituted by nitrogen atoms, attached to said nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/10—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a carbon chain containing aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D409/06—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/06—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D453/00—Heterocyclic compounds containing quinuclidine or iso-quinuclidine ring systems, e.g. quinine alkaloids
- C07D453/02—Heterocyclic compounds containing quinuclidine or iso-quinuclidine ring systems, e.g. quinine alkaloids containing not further condensed quinuclidine ring systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/47—Quinolines; Isoquinolines
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/47—Quinolines; Isoquinolines
- A61K31/4709—Non-condensed quinolines and containing further heterocyclic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/14—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D409/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings directly linked by a ring-member-to-ring-member bond
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Animal Behavior & Ethology (AREA)
- General Chemical & Material Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Quinoline Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US36951910P | 2010-07-30 | 2010-07-30 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| TW201208686A TW201208686A (en) | 2012-03-01 |
| TWI532483B true TWI532483B (zh) | 2016-05-11 |
Family
ID=45530500
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| TW100126942A TWI532483B (zh) | 2010-07-30 | 2011-07-29 | 喹啉衍生物及含此衍生物之melk抑制劑 |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US9120749B2 (enExample) |
| EP (1) | EP2597955B1 (enExample) |
| JP (1) | JP5849303B2 (enExample) |
| KR (1) | KR101826382B1 (enExample) |
| CN (1) | CN103153063B (enExample) |
| AU (1) | AU2011282588B2 (enExample) |
| BR (1) | BR112013002182B8 (enExample) |
| CA (1) | CA2806332C (enExample) |
| DK (1) | DK2597955T3 (enExample) |
| ES (1) | ES2565627T3 (enExample) |
| IL (1) | IL223871A (enExample) |
| MX (1) | MX342879B (enExample) |
| RU (1) | RU2582610C2 (enExample) |
| SG (2) | SG10201505951VA (enExample) |
| TW (1) | TWI532483B (enExample) |
| WO (1) | WO2012016082A1 (enExample) |
Families Citing this family (59)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US20130225524A1 (en) * | 2010-11-05 | 2013-08-29 | Deping Chai | Chemical Compounds |
| RU2645339C1 (ru) | 2012-01-19 | 2018-02-21 | Онкотерапи Сайенс, Инк. | Производные 1,5-нафтиридина и ингибиторы melk, содержащие их |
| US9227978B2 (en) | 2013-03-15 | 2016-01-05 | Araxes Pharma Llc | Covalent inhibitors of Kras G12C |
| US9745319B2 (en) | 2013-03-15 | 2017-08-29 | Araxes Pharma Llc | Irreversible covalent inhibitors of the GTPase K-Ras G12C |
| TWI659021B (zh) | 2013-10-10 | 2019-05-11 | 亞瑞克西斯製藥公司 | Kras g12c之抑制劑 |
| US10254283B2 (en) | 2013-11-12 | 2019-04-09 | Dana-Farber Cancer Institute, Inc. | Biomarker for MELK activity and methods of using same |
| EP3085700B1 (en) * | 2013-12-20 | 2018-10-31 | Institute of Pharmacology and Toxicology Academy of Military Medical Sciences P.L.A. China | Novel piperidine carboxamide compound, preparation method, and usage thereof |
| JO3556B1 (ar) | 2014-09-18 | 2020-07-05 | Araxes Pharma Llc | علاجات مدمجة لمعالجة السرطان |
| US10011600B2 (en) | 2014-09-25 | 2018-07-03 | Araxes Pharma Llc | Methods and compositions for inhibition of Ras |
| EP3197870B1 (en) | 2014-09-25 | 2020-08-19 | Araxes Pharma LLC | Inhibitors of kras g12c mutant proteins |
| US10206924B2 (en) | 2014-12-15 | 2019-02-19 | The Regents Of The University Of Michigan | Small molecule inhibitors of EGFR and PI3K |
| CN107530353A (zh) | 2015-03-04 | 2018-01-02 | 丹娜法伯癌症研究院 | Melk的三环激酶抑制剂和使用方法 |
| AU2016245864C1 (en) | 2015-04-10 | 2021-09-09 | Araxes Pharma Llc | Substituted quinazoline compounds and methods of use thereof |
| WO2016168540A1 (en) | 2015-04-15 | 2016-10-20 | Araxes Pharma Llc | Fused-tricyclic inhibitors of kras and methods of use thereof |
| US10144724B2 (en) | 2015-07-22 | 2018-12-04 | Araxes Pharma Llc | Substituted quinazoline compounds and methods of use thereof |
| CN108026046B (zh) * | 2015-07-22 | 2021-12-21 | 亚瑞克西斯制药公司 | 取代的喹唑啉化合物及其作为g12c突变体kras、hras和/或nras蛋白质的抑制剂的用途 |
| CA2993013A1 (en) * | 2015-07-22 | 2017-01-26 | Araxes Pharma Llc | Substituted quinazoline compounds and their use as inhibitors of g12c mutant kras, hras and/or nras proteins |
| HK1252623A1 (zh) * | 2015-08-03 | 2019-05-31 | Bristol-Myers Squibb Company | 可用作TNFα调节剂的杂环化合物 |
| EP3356351A1 (en) | 2015-09-28 | 2018-08-08 | Araxes Pharma LLC | Inhibitors of kras g12c mutant proteins |
| WO2017058805A1 (en) | 2015-09-28 | 2017-04-06 | Araxes Pharma Llc | Inhibitors of kras g12c mutant proteins |
| EP3356353A1 (en) | 2015-09-28 | 2018-08-08 | Araxes Pharma LLC | Inhibitors of kras g12c mutant proteins |
| EP3356349A1 (en) | 2015-09-28 | 2018-08-08 | Araxes Pharma LLC | Inhibitors of kras g12c mutant proteins |
| US10882847B2 (en) | 2015-09-28 | 2021-01-05 | Araxes Pharma Llc | Inhibitors of KRAS G12C mutant proteins |
| EP3356347A1 (en) | 2015-09-28 | 2018-08-08 | Araxes Pharma LLC | Inhibitors of kras g12c mutant proteins |
| EP3356339A1 (en) | 2015-09-28 | 2018-08-08 | Araxes Pharma LLC | Inhibitors of kras g12c mutant proteins |
| WO2017070256A2 (en) | 2015-10-19 | 2017-04-27 | Araxes Pharma Llc | Method for screening inhibitors of ras |
| KR20240113606A (ko) | 2015-11-16 | 2024-07-22 | 아락세스 파마 엘엘씨 | 치환된 헤테로사이클릭 그룹을 포함하는 2-치환된 퀴나졸린 화합물 및 이의 사용 방법 |
| WO2017100546A1 (en) | 2015-12-09 | 2017-06-15 | Araxes Pharma Llc | Methods for preparation of quinazoline derivatives |
| MX2018007703A (es) * | 2015-12-22 | 2018-11-09 | Vitae Pharmaceuticals Inc | Inhibidores de la interaccion de menina-linaje leucemico mixto. |
| US10822312B2 (en) | 2016-03-30 | 2020-11-03 | Araxes Pharma Llc | Substituted quinazoline compounds and methods of use |
| US10646488B2 (en) | 2016-07-13 | 2020-05-12 | Araxes Pharma Llc | Conjugates of cereblon binding compounds and G12C mutant KRAS, HRAS or NRAS protein modulating compounds and methods of use thereof |
| NZ750174A (en) | 2016-07-14 | 2023-04-28 | Crinetics Pharmaceuticals Inc | Somatostatin modulators and uses thereof |
| CN109890963B (zh) | 2016-08-31 | 2023-10-03 | 肿瘤疗法科学股份有限公司 | 针对melk的单克隆抗体及其使用 |
| WO2018064510A1 (en) | 2016-09-29 | 2018-04-05 | Araxes Pharma Llc | Inhibitors of kras g12c mutant proteins |
| US10377743B2 (en) | 2016-10-07 | 2019-08-13 | Araxes Pharma Llc | Inhibitors of RAS and methods of use thereof |
| EP3558321B1 (en) * | 2016-12-23 | 2023-02-01 | Felicitex Therapeutics, Inc. | Derivatives of quinolines as inhibitors of dyrk1a and/or dyrk1b kinases |
| CN110382482A (zh) | 2017-01-26 | 2019-10-25 | 亚瑞克西斯制药公司 | 稠合的杂-杂二环化合物及其使用方法 |
| WO2018140512A1 (en) | 2017-01-26 | 2018-08-02 | Araxes Pharma Llc | Fused bicyclic benzoheteroaromatic compounds and methods of use thereof |
| US11136308B2 (en) | 2017-01-26 | 2021-10-05 | Araxes Pharma Llc | Substituted quinazoline and quinazolinone compounds and methods of use thereof |
| WO2018140599A1 (en) | 2017-01-26 | 2018-08-02 | Araxes Pharma Llc | Benzothiophene and benzothiazole compounds and methods of use thereof |
| US11279689B2 (en) | 2017-01-26 | 2022-03-22 | Araxes Pharma Llc | 1-(3-(6-(3-hydroxynaphthalen-1-yl)benzofuran-2-yl)azetidin-1 yl)prop-2-en-1-one derivatives and similar compounds as KRAS G12C modulators for treating cancer |
| KR20200010306A (ko) | 2017-05-25 | 2020-01-30 | 아락세스 파마 엘엘씨 | Kras의 공유적 억제제 |
| US11639346B2 (en) | 2017-05-25 | 2023-05-02 | Araxes Pharma Llc | Quinazoline derivatives as modulators of mutant KRAS, HRAS or NRAS |
| US10736897B2 (en) | 2017-05-25 | 2020-08-11 | Araxes Pharma Llc | Compounds and methods of use thereof for treatment of cancer |
| US11028068B2 (en) | 2017-07-25 | 2021-06-08 | Crinetics Pharmaceuticals, Inc. | Somatostatin modulators and uses thereof |
| AU2019209469B2 (en) | 2018-01-17 | 2022-09-08 | Crinetics Pharmaceuticals, Inc. | Process of making somatostatin modulators |
| WO2019229765A1 (en) * | 2018-05-29 | 2019-12-05 | Council Of Scientific & Industrial Research, India | Bicycle topoisomerase i inhibiting compounds, process for preparation and use thereof |
| US12134620B2 (en) | 2018-08-01 | 2024-11-05 | Araxes Pharma Llc | Heterocyclic spiro compounds and methods of use thereof for the treatment of cancer |
| CN109705037A (zh) * | 2019-01-24 | 2019-05-03 | 广西师范大学 | 4-氨基喹啉-3-甲酸酯衍生物及其制备方法和应用 |
| CN109651355A (zh) * | 2019-01-24 | 2019-04-19 | 广西师范大学 | 3-(2-苯并五元杂环)-4-(3-二甲胺丙氨基)喹啉衍生物及其制备方法和应用 |
| JP7617020B2 (ja) * | 2019-04-24 | 2025-01-17 | チルドレンズ メディカル センター コーポレイション | Papd5阻害剤およびその使用方法 |
| US11926632B2 (en) | 2020-06-22 | 2024-03-12 | Pmv Pharmaceuticals, Inc. | Methods and compounds for restoring mutant p53 function |
| US20240246941A1 (en) * | 2020-07-15 | 2024-07-25 | St. Jude Children's Research Hospital, Inc. | Substituted 4-(3-aminoprop-1-yl)aminoquinoline analogs as modulators of melanoma-associated antigen 11 ubiquitin ligase |
| IL301038A (en) | 2020-09-09 | 2023-05-01 | Crinetics Pharmaceuticals Inc | Somatostatin modulator formulations |
| AU2021365836A1 (en) * | 2020-10-21 | 2023-06-08 | Escient Pharmaceuticals, Inc. | Modulators of mas-related g-protein receptor x2 and related products and their use |
| EP4267554A1 (en) | 2020-12-22 | 2023-11-01 | Mekanistic Therapeutics LLC | Substituted aminobenzyl heteroaryl compounds as egfr and/or pi3k inhibitors |
| WO2024220236A2 (en) * | 2023-04-21 | 2024-10-24 | University Of Georgia Research Foundation, Inc. | Hydroxylamine-based bcr-abl1 inhibitors for treatment of cancer |
| US20250092031A1 (en) * | 2023-09-20 | 2025-03-20 | Momentum Therapeutics, Inc. | Ripk3 inhibitors and methods of use |
| WO2025147609A1 (en) * | 2024-01-05 | 2025-07-10 | Dewpoint Therapeutics, Inc. | Amino quinoline compounds and uses thereof |
Family Cites Families (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1168801A (en) | 1966-05-13 | 1969-10-29 | May & Baker Ltd | Quinoline Derivatives |
| US6521618B2 (en) | 2000-03-28 | 2003-02-18 | Wyeth | 3-cyanoquinolines, 3-cyano-1,6-naphthyridines, and 3-cyano-1,7-naphthyridines as protein kinase inhibitors |
| SE0101675D0 (sv) | 2001-05-11 | 2001-05-11 | Astrazeneca Ab | Novel composition |
| US20060024692A1 (en) | 2002-09-30 | 2006-02-02 | Oncotherapy Science, Inc. | Method for diagnosing non-small cell lung cancers |
| TW200413725A (en) | 2002-09-30 | 2004-08-01 | Oncotherapy Science Inc | Method for diagnosing non-small cell lung cancers |
| TW200423938A (en) | 2003-02-21 | 2004-11-16 | Wyeth Corp | 4-[(2,4-dichloro-5-methoxyphenyl)amino]-6-alkoxy-3-quinolinecarbonitriles for the treatment of ischemic injury |
| MXPA05012839A (es) | 2003-05-27 | 2006-05-17 | Pfizer Prod Inc | Quinazolinas y pirido[3,4-d] pirimidinas como inhibidores de receptores tirosina quinasa. |
| JP5028601B2 (ja) | 2004-08-10 | 2012-09-19 | オンコセラピー・サイエンス株式会社 | 乳癌に関連する遺伝子およびポリペプチド |
| JP5109131B2 (ja) | 2005-02-10 | 2012-12-26 | オンコセラピー・サイエンス株式会社 | 膀胱癌を診断する方法 |
| EP2305811A1 (en) | 2005-07-27 | 2011-04-06 | Oncotherapy Science, Inc. | Method of diagnosing smal cell lung cancer |
| RU2008122070A (ru) * | 2005-11-03 | 2009-12-10 | Вертекс Фармасьютикалз Инкорпорейтед (Us) | Аминопиридины, используемые в качестве ингибиторов киназ |
| UY30282A1 (es) | 2006-04-14 | 2007-11-30 | Astrazeneca Ab | Compuestos quimicos |
| WO2007139496A1 (en) | 2006-05-30 | 2007-12-06 | Clanotech Ab | Quinoline derivatives acting as tyrosine kinase inhibitors |
| WO2008023841A1 (en) | 2006-08-25 | 2008-02-28 | Oncotherapy Science, Inc. | Breast cancer-associated gene, melk, and its interactions with bcl-g |
| TW200829555A (en) * | 2006-11-10 | 2008-07-16 | Astrazeneca Ab | Chemical compounds |
| JP5211063B2 (ja) | 2006-11-30 | 2013-06-12 | ジェネンテック, インコーポレイテッド | アザ−インドリル化合物及び使用方法 |
| CN100540551C (zh) | 2007-02-01 | 2009-09-16 | 中国药科大学 | 喹啉衍生物、其制备方法及其医药用途 |
| PE20090717A1 (es) * | 2007-05-18 | 2009-07-18 | Smithkline Beecham Corp | Derivados de quinolina como inhibidores de la pi3 quinasa |
| US20100056524A1 (en) * | 2008-04-02 | 2010-03-04 | Mciver Edward Giles | Compound |
| WO2009155527A2 (en) * | 2008-06-19 | 2009-12-23 | Progenics Pharmaceuticals, Inc. | Phosphatidylinositol 3 kinase inhibitors |
| DK2467141T3 (en) * | 2009-08-17 | 2019-02-18 | Intellikine Llc | HETEROCYCLIC COMPOUNDS AND APPLICATIONS THEREOF |
| RU2645339C1 (ru) * | 2012-01-19 | 2018-02-21 | Онкотерапи Сайенс, Инк. | Производные 1,5-нафтиридина и ингибиторы melk, содержащие их |
-
2011
- 2011-07-28 KR KR1020137005377A patent/KR101826382B1/ko active Active
- 2011-07-28 US US13/813,134 patent/US9120749B2/en active Active
- 2011-07-28 EP EP11813209.1A patent/EP2597955B1/en active Active
- 2011-07-28 SG SG10201505951VA patent/SG10201505951VA/en unknown
- 2011-07-28 DK DK11813209.1T patent/DK2597955T3/en active
- 2011-07-28 CA CA2806332A patent/CA2806332C/en active Active
- 2011-07-28 MX MX2013001201A patent/MX342879B/es active IP Right Grant
- 2011-07-28 AU AU2011282588A patent/AU2011282588B2/en active Active
- 2011-07-28 BR BR112013002182A patent/BR112013002182B8/pt active IP Right Grant
- 2011-07-28 SG SG2013006903A patent/SG187633A1/en unknown
- 2011-07-28 RU RU2013108865/04A patent/RU2582610C2/ru active
- 2011-07-28 WO PCT/US2011/045792 patent/WO2012016082A1/en not_active Ceased
- 2011-07-28 CN CN201180047405.5A patent/CN103153063B/zh active Active
- 2011-07-28 ES ES11813209.1T patent/ES2565627T3/es active Active
- 2011-07-28 JP JP2013523213A patent/JP5849303B2/ja active Active
- 2011-07-29 TW TW100126942A patent/TWI532483B/zh active
-
2012
- 2012-12-25 IL IL223871A patent/IL223871A/en active IP Right Grant
Also Published As
| Publication number | Publication date |
|---|---|
| BR112013002182B8 (pt) | 2023-02-28 |
| SG187633A1 (en) | 2013-03-28 |
| BR112013002182B1 (pt) | 2022-05-03 |
| KR20130094312A (ko) | 2013-08-23 |
| AU2011282588B2 (en) | 2016-01-07 |
| IL223871A (en) | 2016-11-30 |
| MX2013001201A (es) | 2013-04-03 |
| DK2597955T3 (en) | 2016-03-14 |
| EP2597955A4 (en) | 2014-02-19 |
| CN103153063B (zh) | 2016-02-17 |
| RU2582610C2 (ru) | 2016-04-27 |
| US9120749B2 (en) | 2015-09-01 |
| CA2806332A1 (en) | 2012-02-02 |
| RU2013108865A (ru) | 2014-09-10 |
| JP5849303B2 (ja) | 2016-01-27 |
| HK1184331A1 (zh) | 2014-01-24 |
| EP2597955B1 (en) | 2016-01-20 |
| TW201208686A (en) | 2012-03-01 |
| WO2012016082A1 (en) | 2012-02-02 |
| SG10201505951VA (en) | 2015-08-28 |
| ES2565627T3 (es) | 2016-04-06 |
| AU2011282588A1 (en) | 2013-03-21 |
| JP2013532727A (ja) | 2013-08-19 |
| EP2597955A1 (en) | 2013-06-05 |
| BR112013002182A2 (pt) | 2016-05-31 |
| CN103153063A (zh) | 2013-06-12 |
| US20130217671A1 (en) | 2013-08-22 |
| CA2806332C (en) | 2017-11-14 |
| KR101826382B1 (ko) | 2018-02-06 |
| MX342879B (es) | 2016-10-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| TWI532483B (zh) | 喹啉衍生物及含此衍生物之melk抑制劑 | |
| TWI531572B (zh) | 作為jak1抑制劑之哌啶-4-基三亞甲亞胺衍生物 | |
| US10487075B2 (en) | Substituted mono- and polyazanaphthalene derivatives and their use | |
| US10358446B2 (en) | Bruton's tyrosine kinase inhibitors | |
| JP5369173B2 (ja) | キノリン若しくはイソキノリン置換p2x7アンタゴニスト | |
| AU2017208998B2 (en) | Bruton's tyrosine kinase inhibitors | |
| KR20210040368A (ko) | 사이클린 의존성 키나제의 억제제 | |
| CN102227409A (zh) | 吡啶-3-甲酰胺衍生物 | |
| AU2008235456A1 (en) | [2, 6] naphthyridines useful as protein kinase inhibitors | |
| TW201333005A (zh) | 1,5-萘啶衍生物與含此之melk抑制劑 | |
| EP4267137A1 (en) | Lactam (hetero)arylfusedpyrimidine derivatives as inhibitors of erbb2 | |
| ES2771151T3 (es) | Derivados de piperidina como inhibidor de señalización wnt | |
| RU2818563C2 (ru) | Фармацевтически активные производные пиразолотриазина и/или пиразолопиримидина | |
| CN116490499A (zh) | Myc家族原癌基因蛋白的调节剂 | |
| HK1184331B (en) | Quinoline derivatives and melk inhibitors containing the same |