TW201900180A - 嘧啶衍生物 - Google Patents
嘧啶衍生物 Download PDFInfo
- Publication number
- TW201900180A TW201900180A TW107116760A TW107116760A TW201900180A TW 201900180 A TW201900180 A TW 201900180A TW 107116760 A TW107116760 A TW 107116760A TW 107116760 A TW107116760 A TW 107116760A TW 201900180 A TW201900180 A TW 201900180A
- Authority
- TW
- Taiwan
- Prior art keywords
- pyrimidin
- ethoxy
- ethylamino
- alkyl
- methoxy
- Prior art date
Links
- 150000003230 pyrimidines Chemical class 0.000 title abstract description 8
- 150000001875 compounds Chemical class 0.000 claims abstract description 354
- 206010028980 Neoplasm Diseases 0.000 claims abstract description 117
- 201000011510 cancer Diseases 0.000 claims abstract description 71
- 238000011282 treatment Methods 0.000 claims abstract description 47
- 150000003839 salts Chemical class 0.000 claims abstract description 43
- 239000003814 drug Substances 0.000 claims abstract description 27
- 239000008194 pharmaceutical composition Substances 0.000 claims abstract description 11
- 230000028993 immune response Effects 0.000 claims abstract description 10
- 210000000987 immune system Anatomy 0.000 claims abstract description 10
- 238000002360 preparation method Methods 0.000 claims abstract description 9
- 230000007420 reactivation Effects 0.000 claims abstract description 5
- -1 cyclopropyl-1,1-diyl Chemical group 0.000 claims description 939
- 125000000217 alkyl group Chemical group 0.000 claims description 253
- 238000000034 method Methods 0.000 claims description 150
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 149
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 123
- 229910052739 hydrogen Inorganic materials 0.000 claims description 117
- 239000001257 hydrogen Substances 0.000 claims description 117
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 94
- 125000001424 substituent group Chemical group 0.000 claims description 85
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 73
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 65
- 125000004429 atom Chemical group 0.000 claims description 62
- 125000002947 alkylene group Chemical group 0.000 claims description 61
- 125000003709 fluoroalkyl group Chemical group 0.000 claims description 59
- 239000004593 Epoxy Substances 0.000 claims description 58
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 57
- 125000003545 alkoxy group Chemical group 0.000 claims description 51
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims description 50
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 39
- 125000004428 fluoroalkoxy group Chemical group 0.000 claims description 38
- 125000003118 aryl group Chemical group 0.000 claims description 34
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 33
- 150000002367 halogens Chemical class 0.000 claims description 29
- 229910052736 halogen Inorganic materials 0.000 claims description 28
- 229910052757 nitrogen Inorganic materials 0.000 claims description 26
- 239000000460 chlorine Substances 0.000 claims description 25
- 239000012634 fragment Substances 0.000 claims description 25
- 125000001072 heteroaryl group Chemical group 0.000 claims description 25
- 125000004432 carbon atom Chemical group C* 0.000 claims description 24
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 22
- 239000011737 fluorine Substances 0.000 claims description 22
- 229910052731 fluorine Inorganic materials 0.000 claims description 22
- 238000001959 radiotherapy Methods 0.000 claims description 22
- 125000006163 5-membered heteroaryl group Chemical group 0.000 claims description 21
- 150000002431 hydrogen Chemical class 0.000 claims description 21
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Substances CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 20
- 229910052760 oxygen Inorganic materials 0.000 claims description 20
- 239000001301 oxygen Substances 0.000 claims description 20
- 150000001412 amines Chemical class 0.000 claims description 18
- 229910052801 chlorine Inorganic materials 0.000 claims description 18
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 18
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 18
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 17
- 125000001544 thienyl group Chemical group 0.000 claims description 17
- 125000006570 (C5-C6) heteroaryl group Chemical group 0.000 claims description 16
- 239000004480 active ingredient Substances 0.000 claims description 16
- 238000002626 targeted therapy Methods 0.000 claims description 15
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 14
- 125000002619 bicyclic group Chemical group 0.000 claims description 14
- 125000005842 heteroatom Chemical group 0.000 claims description 14
- 125000001041 indolyl group Chemical group 0.000 claims description 14
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 claims description 14
- 229920006395 saturated elastomer Polymers 0.000 claims description 14
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 13
- 201000010099 disease Diseases 0.000 claims description 13
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims description 13
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 claims description 13
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 claims description 12
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 claims description 11
- 239000002246 antineoplastic agent Substances 0.000 claims description 11
- 208000007097 Urinary Bladder Neoplasms Diseases 0.000 claims description 10
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 10
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 10
- 201000005112 urinary bladder cancer Diseases 0.000 claims description 10
- 125000004607 1,2,3,4-tetrahydroquinolinyl group Chemical group N1(CCCC2=CC=CC=C12)* 0.000 claims description 9
- 206010005003 Bladder cancer Diseases 0.000 claims description 9
- 206010029260 Neuroblastoma Diseases 0.000 claims description 9
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 claims description 9
- 206010058467 Lung neoplasm malignant Diseases 0.000 claims description 8
- 206010061535 Ovarian neoplasm Diseases 0.000 claims description 8
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 claims description 8
- 229910052799 carbon Inorganic materials 0.000 claims description 8
- 229940127089 cytotoxic agent Drugs 0.000 claims description 8
- 125000005843 halogen group Chemical group 0.000 claims description 8
- 201000005202 lung cancer Diseases 0.000 claims description 8
- 208000020816 lung neoplasm Diseases 0.000 claims description 8
- 201000001441 melanoma Diseases 0.000 claims description 8
- 125000001624 naphthyl group Chemical group 0.000 claims description 8
- 230000004770 neurodegeneration Effects 0.000 claims description 8
- 230000002265 prevention Effects 0.000 claims description 8
- 229910052717 sulfur Chemical group 0.000 claims description 8
- CTQPPUPWHLGKOB-UHFFFAOYSA-N 4h-oxadiazol-5-one Chemical compound O=C1CN=NO1 CTQPPUPWHLGKOB-UHFFFAOYSA-N 0.000 claims description 7
- 206010008342 Cervix carcinoma Diseases 0.000 claims description 7
- 206010014733 Endometrial cancer Diseases 0.000 claims description 7
- 206010014759 Endometrial neoplasm Diseases 0.000 claims description 7
- 208000008839 Kidney Neoplasms Diseases 0.000 claims description 7
- 206010033128 Ovarian cancer Diseases 0.000 claims description 7
- 208000002193 Pain Diseases 0.000 claims description 7
- 206010038389 Renal cancer Diseases 0.000 claims description 7
- 208000006105 Uterine Cervical Neoplasms Diseases 0.000 claims description 7
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 claims description 7
- 201000010881 cervical cancer Diseases 0.000 claims description 7
- 201000010982 kidney cancer Diseases 0.000 claims description 7
- 208000015122 neurodegenerative disease Diseases 0.000 claims description 7
- 208000011580 syndromic disease Diseases 0.000 claims description 7
- 201000009273 Endometriosis Diseases 0.000 claims description 6
- 206010035664 Pneumonia Diseases 0.000 claims description 6
- 230000001154 acute effect Effects 0.000 claims description 6
- 125000003342 alkenyl group Chemical group 0.000 claims description 6
- 125000000304 alkynyl group Chemical group 0.000 claims description 6
- 125000000000 cycloalkoxy group Chemical group 0.000 claims description 6
- 230000000302 ischemic effect Effects 0.000 claims description 6
- 208000030761 polycystic kidney disease Diseases 0.000 claims description 6
- 230000000392 somatic effect Effects 0.000 claims description 6
- 239000011593 sulfur Chemical group 0.000 claims description 6
- 230000035558 fertility Effects 0.000 claims description 5
- 125000004043 oxo group Chemical group O=* 0.000 claims description 5
- 125000004527 pyrimidin-4-yl group Chemical group N1=CN=C(C=C1)* 0.000 claims description 5
- 201000001320 Atherosclerosis Diseases 0.000 claims description 4
- 239000005711 Benzoic acid Substances 0.000 claims description 4
- 125000005605 benzo group Chemical group 0.000 claims description 4
- 229960004365 benzoic acid Drugs 0.000 claims description 4
- 239000012829 chemotherapy agent Substances 0.000 claims description 4
- 150000003553 thiiranes Chemical group 0.000 claims description 4
- VUEONTPMDHNVHR-UHFFFAOYSA-N C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=C2C=CNC2=CC=C1)C1=NOC(N1)=O Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=C2C=CNC2=CC=C1)C1=NOC(N1)=O VUEONTPMDHNVHR-UHFFFAOYSA-N 0.000 claims description 3
- BKLHWNXTURQKNF-UHFFFAOYSA-N C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC=1C=CC=C2C=CC=NC=12)C1=NOC(N1)=O Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC=1C=CC=C2C=CC=NC=12)C1=NOC(N1)=O BKLHWNXTURQKNF-UHFFFAOYSA-N 0.000 claims description 3
- YZZPXLJBWJDUCV-UHFFFAOYSA-N N1C=CC2=CC=CC(=C12)CCNC1=CC(=NC=N1)C1=CC(=C(S1)C1=NOC(=N1)O)OCC Chemical compound N1C=CC2=CC=CC(=C12)CCNC1=CC(=NC=N1)C1=CC(=C(S1)C1=NOC(=N1)O)OCC YZZPXLJBWJDUCV-UHFFFAOYSA-N 0.000 claims description 3
- BOWYQHCFTNADQJ-UHFFFAOYSA-N OC1=CN=NO1 Chemical compound OC1=CN=NO1 BOWYQHCFTNADQJ-UHFFFAOYSA-N 0.000 claims description 3
- 150000001335 aliphatic alkanes Chemical class 0.000 claims description 3
- YELLUWAGQVKCEQ-ZHACJKMWSA-N (E)-3-[3-ethoxy-5-[6-[2-(2-methoxynaphthalen-1-yl)ethylamino]pyrimidin-4-yl]thiophen-2-yl]prop-2-enoic acid Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=C(C=CC2=CC=CC=C12)OC)/C=C/C(=O)O YELLUWAGQVKCEQ-ZHACJKMWSA-N 0.000 claims description 2
- PDQRQJVPEFGVRK-UHFFFAOYSA-N 2,1,3-benzothiadiazole Chemical compound C1=CC=CC2=NSN=C21 PDQRQJVPEFGVRK-UHFFFAOYSA-N 0.000 claims description 2
- LGPAAAVNLKVZLA-UHFFFAOYSA-N 2-(2-hydroxyethoxy)-4-[6-[2-(2-methoxynaphthalen-1-yl)ethylamino]pyrimidin-4-yl]benzoic acid Chemical compound OCCOC1=C(C(=O)O)C=CC(=C1)C1=NC=NC(=C1)NCCC1=C(C=CC2=CC=CC=C12)OC LGPAAAVNLKVZLA-UHFFFAOYSA-N 0.000 claims description 2
- MSOOEGZULITGAO-UHFFFAOYSA-N 2-[2-ethoxy-4-[6-[2-(5-fluoronaphthalen-1-yl)ethylamino]pyrimidin-4-yl]phenyl]acetic acid Chemical compound C(C)OC1=C(C=CC(=C1)C1=NC=NC(=C1)NCCC1=CC=CC2=C(C=CC=C12)F)CC(=O)O MSOOEGZULITGAO-UHFFFAOYSA-N 0.000 claims description 2
- GEKANDQYTKFKRR-UHFFFAOYSA-N 2-[2-ethoxy-4-[6-[2-(5-methylnaphthalen-1-yl)ethylamino]pyrimidin-4-yl]phenyl]acetic acid Chemical compound C(C)OC1=C(C=CC(=C1)C1=NC=NC(=C1)NCCC1=CC=CC2=C(C=CC=C12)C)CC(=O)O GEKANDQYTKFKRR-UHFFFAOYSA-N 0.000 claims description 2
- AGTHGFJXPNXZFV-UHFFFAOYSA-N 2-[3-ethoxy-5-[6-[2-(2-methoxynaphthalen-1-yl)ethylamino]pyrimidin-4-yl]thiophen-2-yl]acetic acid Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=C(C=CC2=CC=CC=C12)OC)CC(=O)O AGTHGFJXPNXZFV-UHFFFAOYSA-N 0.000 claims description 2
- BCMUZUWYJVPNHI-UHFFFAOYSA-N 2-butoxy-4-[6-[2-(2-methoxynaphthalen-1-yl)ethylamino]pyrimidin-4-yl]benzoic acid Chemical compound C(CCC)OC1=C(C(=O)O)C=CC(=C1)C1=NC=NC(=C1)NCCC1=C(C=CC2=CC=CC=C12)OC BCMUZUWYJVPNHI-UHFFFAOYSA-N 0.000 claims description 2
- FJSYNQADNPNRDP-UHFFFAOYSA-N 2-butoxy-6-fluoro-4-[6-[2-(2-methoxynaphthalen-1-yl)ethylamino]pyrimidin-4-yl]benzoic acid Chemical compound C(CCC)OC1=C(C(=O)O)C(=CC(=C1)C1=NC=NC(=C1)NCCC1=C(C=CC2=CC=CC=C12)OC)F FJSYNQADNPNRDP-UHFFFAOYSA-N 0.000 claims description 2
- HLCCSAMCKPNYDS-UHFFFAOYSA-N 2-cyclobutyloxy-4-[6-[2-(1-methylindol-4-yl)ethylamino]pyrimidin-4-yl]benzoic acid Chemical compound C1(CCC1)OC1=C(C(=O)O)C=CC(=C1)C1=NC=NC(=C1)NCCC1=C2C=CN(C2=CC=C1)C HLCCSAMCKPNYDS-UHFFFAOYSA-N 0.000 claims description 2
- RNQHJLHFYFKDHR-UHFFFAOYSA-N 2-cyclobutyloxy-4-[6-[2-(2-ethoxynaphthalen-1-yl)ethylamino]pyrimidin-4-yl]benzoic acid Chemical compound C1(CCC1)OC1=C(C(=O)O)C=CC(=C1)C1=NC=NC(=C1)NCCC1=C(C=CC2=CC=CC=C12)OCC RNQHJLHFYFKDHR-UHFFFAOYSA-N 0.000 claims description 2
- HONGSMWWUADXNX-UHFFFAOYSA-N 2-cyclobutyloxy-4-[6-[2-(2-methoxynaphthalen-1-yl)ethylamino]pyrimidin-4-yl]benzoic acid Chemical compound C1(CCC1)OC1=C(C(=O)O)C=CC(=C1)C1=NC=NC(=C1)NCCC1=C(C=CC2=CC=CC=C12)OC HONGSMWWUADXNX-UHFFFAOYSA-N 0.000 claims description 2
- MNBJSMFQNPTKBK-UHFFFAOYSA-N 2-ethoxy-4-[6-[2-(2-ethoxynaphthalen-1-yl)ethylamino]pyrimidin-4-yl]benzoic acid Chemical compound C(C)OC1=C(C(=O)O)C=CC(=C1)C1=NC=NC(=C1)NCCC1=C(C=CC2=CC=CC=C12)OCC MNBJSMFQNPTKBK-UHFFFAOYSA-N 0.000 claims description 2
- PNXLIMSFSSKCDO-UHFFFAOYSA-N 2-ethoxy-4-[6-[2-(2-fluoronaphthalen-1-yl)ethylamino]pyrimidin-4-yl]benzoic acid Chemical compound C(C)OC1=C(C(=O)O)C=CC(=C1)C1=NC=NC(=C1)NCCC1=C(C=CC2=CC=CC=C12)F PNXLIMSFSSKCDO-UHFFFAOYSA-N 0.000 claims description 2
- DUVRDYGFJRKPBT-UHFFFAOYSA-N 2-ethoxy-4-[6-[2-(2-methoxynaphthalen-1-yl)ethylamino]pyrimidin-4-yl]benzoic acid Chemical compound C(C)OC1=C(C(=O)O)C=CC(=C1)C1=NC=NC(=C1)NCCC1=C(C=CC2=CC=CC=C12)OC DUVRDYGFJRKPBT-UHFFFAOYSA-N 0.000 claims description 2
- FUPVSZQXWQQSMJ-UHFFFAOYSA-N 2-ethoxy-4-[6-[2-(5-fluoronaphthalen-1-yl)ethylamino]pyrimidin-4-yl]benzoic acid Chemical compound C(C)OC1=C(C(=O)O)C=CC(=C1)C1=NC=NC(=C1)NCCC1=CC=CC2=C(C=CC=C12)F FUPVSZQXWQQSMJ-UHFFFAOYSA-N 0.000 claims description 2
- DFURTOXHJRTLLB-UHFFFAOYSA-N 2-ethoxy-4-[6-[2-(5-methoxy-1-benzothiophen-4-yl)ethylamino]pyrimidin-4-yl]benzoic acid Chemical compound C(C)OC1=C(C(=O)O)C=CC(=C1)C1=NC=NC(=C1)NCCC1=C(C=CC=2SC=CC=21)OC DFURTOXHJRTLLB-UHFFFAOYSA-N 0.000 claims description 2
- GHKDPVZDNVYMIO-UHFFFAOYSA-N 2-ethoxy-4-[6-[2-(5-methoxy-1-methylindol-4-yl)ethylamino]pyrimidin-4-yl]benzoic acid Chemical compound C(C)OC1=C(C(=O)O)C=CC(=C1)C1=NC=NC(=C1)NCCC1=C2C=CN(C2=CC=C1OC)C GHKDPVZDNVYMIO-UHFFFAOYSA-N 0.000 claims description 2
- LUQYWVDQSWLMKV-UHFFFAOYSA-N 2-ethoxy-4-[6-[2-(5-methylnaphthalen-1-yl)ethylamino]pyrimidin-4-yl]benzoic acid Chemical compound C(C)OC1=C(C(=O)O)C=CC(=C1)C1=NC=NC(=C1)NCCC1=CC=CC2=C(C=CC=C12)C LUQYWVDQSWLMKV-UHFFFAOYSA-N 0.000 claims description 2
- HYWOJAFGCKEDNG-UHFFFAOYSA-N 2-ethylsulfanyl-4-[6-[2-(4-methylnaphthalen-1-yl)ethylamino]pyrimidin-4-yl]benzoic acid Chemical compound C(C)SC1=C(C(=O)O)C=CC(=C1)C1=NC=NC(=C1)NCCC1=CC=C(C2=CC=CC=C12)C HYWOJAFGCKEDNG-UHFFFAOYSA-N 0.000 claims description 2
- YGTPBBJTFZKRQW-UHFFFAOYSA-N 2-fluoro-4-[6-[2-(2-methoxynaphthalen-1-yl)ethylamino]pyrimidin-4-yl]-6-propylbenzoic acid Chemical compound FC1=C(C(=O)O)C(=CC(=C1)C1=NC=NC(=C1)NCCC1=C(C=CC2=CC=CC=C12)OC)CCC YGTPBBJTFZKRQW-UHFFFAOYSA-N 0.000 claims description 2
- BIGWXAGEQONZGD-UHFFFAOYSA-N 2h-oxadiazol-5-one Chemical compound O=C1C=NNO1 BIGWXAGEQONZGD-UHFFFAOYSA-N 0.000 claims description 2
- SILSNVVREOXZHF-UHFFFAOYSA-N 3-(2-hydroxyethoxy)-5-[6-[2-(2-methoxynaphthalen-1-yl)ethylamino]pyrimidin-4-yl]thiophene-2-carboxylic acid Chemical compound OCCOC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=C(C=CC2=CC=CC=C12)OC)C(=O)O SILSNVVREOXZHF-UHFFFAOYSA-N 0.000 claims description 2
- RCAFKJJOITZWSR-UHFFFAOYSA-N 3-[2-ethoxy-4-[6-[2-(2-methoxynaphthalen-1-yl)ethylamino]pyrimidin-4-yl]phenoxy]propanoic acid Chemical compound C(C)OC1=C(OCCC(=O)O)C=CC(=C1)C1=NC=NC(=C1)NCCC1=C(C=CC2=CC=CC=C12)OC RCAFKJJOITZWSR-UHFFFAOYSA-N 0.000 claims description 2
- ZUQABPPYELXLDD-UHFFFAOYSA-N 3-ethoxy-5-[6-(2-naphthalen-1-ylethylamino)pyrimidin-4-yl]thiophene-2-carboxylic acid Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=CC=CC2=CC=CC=C12)C(=O)O ZUQABPPYELXLDD-UHFFFAOYSA-N 0.000 claims description 2
- IQNHIKGMXFLXSO-UHFFFAOYSA-N 3-ethoxy-5-[6-[2-(1-methylindol-7-yl)ethylamino]pyrimidin-4-yl]thiophene-2-carboxylic acid Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC=1C=CC=C2C=CN(C=12)C)C(=O)O IQNHIKGMXFLXSO-UHFFFAOYSA-N 0.000 claims description 2
- SGRMZVRSGGTJLE-UHFFFAOYSA-N 3-ethoxy-5-[6-[2-(1H-indol-7-yl)ethylamino]pyrimidin-4-yl]thiophene-2-carboxylic acid Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC=1C=CC=C2C=CNC=12)C(=O)O SGRMZVRSGGTJLE-UHFFFAOYSA-N 0.000 claims description 2
- NQKZSEZXQCGBRT-UHFFFAOYSA-N 3-ethoxy-5-[6-[2-(2-ethoxynaphthalen-1-yl)ethylamino]pyrimidin-4-yl]thiophene-2-carboxylic acid Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=C(C=CC2=CC=CC=C12)OCC)C(=O)O NQKZSEZXQCGBRT-UHFFFAOYSA-N 0.000 claims description 2
- VMSHRTRYIKWZHJ-UHFFFAOYSA-N 3-ethoxy-5-[6-[2-(2-fluoronaphthalen-1-yl)ethylamino]pyrimidin-4-yl]thiophene-2-carboxylic acid Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=C(C=CC2=CC=CC=C12)F)C(=O)O VMSHRTRYIKWZHJ-UHFFFAOYSA-N 0.000 claims description 2
- CLZFKCUEKMVYPW-UHFFFAOYSA-N 3-ethoxy-5-[6-[2-(2-methoxynaphthalen-1-yl)ethylamino]pyrimidin-4-yl]-N-methylsulfonylthiophene-2-carboxamide Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=C(C=CC2=CC=CC=C12)OC)C(=O)NS(=O)(=O)C CLZFKCUEKMVYPW-UHFFFAOYSA-N 0.000 claims description 2
- CLGNJZIJDCXZBQ-UHFFFAOYSA-N 3-ethoxy-5-[6-[2-(2-methylnaphthalen-1-yl)ethylamino]pyrimidin-4-yl]thiophene-2-carboxylic acid Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=C(C=CC2=CC=CC=C12)C)C(=O)O CLGNJZIJDCXZBQ-UHFFFAOYSA-N 0.000 claims description 2
- PUXGNSONFSSFQA-UHFFFAOYSA-N 3-ethoxy-5-[6-[2-(4-methylnaphthalen-1-yl)ethylamino]pyrimidin-4-yl]thiophene-2-carboxylic acid Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=CC=C(C2=CC=CC=C12)C)C(=O)O PUXGNSONFSSFQA-UHFFFAOYSA-N 0.000 claims description 2
- SYYCBQUXFHSPNO-UHFFFAOYSA-N 3-ethoxy-5-[6-[2-(5-methoxy-2,3-dihydro-1-benzofuran-4-yl)ethylamino]pyrimidin-4-yl]thiophene-2-carboxylic acid Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=C(C=CC2=C1CCO2)OC)C(=O)O SYYCBQUXFHSPNO-UHFFFAOYSA-N 0.000 claims description 2
- VNGITZAGBSQOEY-UHFFFAOYSA-N 3-ethoxy-5-[6-[2-(6-methoxy-2-methylquinolin-5-yl)ethylamino]pyrimidin-4-yl]thiophene-2-carboxylic acid Chemical compound CCOc1cc(sc1C(O)=O)-c1cc(NCCc2c(OC)ccc3nc(C)ccc23)ncn1 VNGITZAGBSQOEY-UHFFFAOYSA-N 0.000 claims description 2
- GKGVPMSRMXRVGT-UHFFFAOYSA-N 3-ethoxy-5-[6-[2-(6-methoxyquinolin-5-yl)ethylamino]pyrimidin-4-yl]thiophene-2-carboxylic acid Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=C2C=CC=NC2=CC=C1OC)C(=O)O GKGVPMSRMXRVGT-UHFFFAOYSA-N 0.000 claims description 2
- HIZGNKJOCWLWQS-UHFFFAOYSA-N 3-ethoxy-5-[6-[2-(6-methylisoquinolin-5-yl)ethylamino]pyrimidin-4-yl]thiophene-2-carboxylic acid Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=C2C=CN=CC2=CC=C1C)C(=O)O HIZGNKJOCWLWQS-UHFFFAOYSA-N 0.000 claims description 2
- GZAQANOOURDUQG-UHFFFAOYSA-N 3-ethoxy-5-[6-[2-(6-methylquinolin-5-yl)ethylamino]pyrimidin-4-yl]thiophene-2-carboxylic acid Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=C2C=CC=NC2=CC=C1C)C(=O)O GZAQANOOURDUQG-UHFFFAOYSA-N 0.000 claims description 2
- FRVDGQBAQDNGFU-UHFFFAOYSA-N 3-ethoxy-5-[6-[2-(7-methoxyquinolin-8-yl)ethylamino]pyrimidin-4-yl]thiophene-2-carboxylic acid Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC=1C(=CC=C2C=CC=NC=12)OC)C(=O)O FRVDGQBAQDNGFU-UHFFFAOYSA-N 0.000 claims description 2
- OCLSVQJGEXMNFL-UHFFFAOYSA-N 4-[6-[2-(2-bromonaphthalen-1-yl)ethylamino]pyrimidin-4-yl]-2-ethoxybenzoic acid Chemical compound BrC1=C(C2=CC=CC=C2C=C1)CCNC1=CC(=NC=N1)C1=CC(=C(C(=O)O)C=C1)OCC OCLSVQJGEXMNFL-UHFFFAOYSA-N 0.000 claims description 2
- NUSKQWDTFRVYMO-UHFFFAOYSA-N 4-[6-[2-(2-cyanonaphthalen-1-yl)ethylamino]pyrimidin-4-yl]-2-ethoxybenzoic acid Chemical compound C(#N)C1=C(C2=CC=CC=C2C=C1)CCNC1=CC(=NC=N1)C1=CC(=C(C(=O)O)C=C1)OCC NUSKQWDTFRVYMO-UHFFFAOYSA-N 0.000 claims description 2
- OTIKGNGBCNRSAK-UHFFFAOYSA-N 4-[6-[2-(2-methoxynaphthalen-1-yl)ethylamino]pyrimidin-4-yl]-2-propylbenzoic acid Chemical compound COC1=C(C2=CC=CC=C2C=C1)CCNC1=CC(=NC=N1)C1=CC(=C(C(=O)O)C=C1)CCC OTIKGNGBCNRSAK-UHFFFAOYSA-N 0.000 claims description 2
- IYJTYQBSNSCPKT-UHFFFAOYSA-N 4-[6-[2-(4-bromonaphthalen-1-yl)ethylamino]pyrimidin-4-yl]-2-ethoxybenzoic acid Chemical compound BrC1=CC=C(C2=CC=CC=C12)CCNC1=CC(=NC=N1)C1=CC(=C(C(=O)O)C=C1)OCC IYJTYQBSNSCPKT-UHFFFAOYSA-N 0.000 claims description 2
- BECNDXIUBGQOAP-UHFFFAOYSA-N 4-ethoxy-2-[6-[2-(2-methoxynaphthalen-1-yl)ethylamino]pyrimidin-4-yl]-1,3-thiazole-5-carboxylic acid Chemical compound C(C)OC=1N=C(SC=1C(=O)O)C1=NC=NC(=C1)NCCC1=C(C=CC2=CC=CC=C12)OC BECNDXIUBGQOAP-UHFFFAOYSA-N 0.000 claims description 2
- MSFNGRGILKGVDQ-UHFFFAOYSA-N 4-ethyl-2-[6-[2-(2-methoxynaphthalen-1-yl)ethylamino]pyrimidin-4-yl]-1,3-thiazole-5-carboxylic acid Chemical compound C(C)C=1N=C(SC=1C(=O)O)C1=NC=NC(=C1)NCCC1=C(C=CC2=CC=CC=C12)OC MSFNGRGILKGVDQ-UHFFFAOYSA-N 0.000 claims description 2
- WQIDKTIIMKNVBQ-UHFFFAOYSA-N 5-[6-[2-(1,5-dimethylindazol-4-yl)ethylamino]pyrimidin-4-yl]-3-ethoxythiophene-2-carboxylic acid Chemical compound CN1N=CC2=C(C(=CC=C12)C)CCNC1=CC(=NC=N1)C1=CC(=C(S1)C(=O)O)OCC WQIDKTIIMKNVBQ-UHFFFAOYSA-N 0.000 claims description 2
- LHNMNZGUAOZSQY-UHFFFAOYSA-N 5-[6-[2-(1-benzofuran-7-yl)ethylamino]pyrimidin-4-yl]-3-ethoxythiophene-2-carboxylic acid Chemical compound O1C=CC2=C1C(=CC=C2)CCNC1=CC(=NC=N1)C1=CC(=C(S1)C(=O)O)OCC LHNMNZGUAOZSQY-UHFFFAOYSA-N 0.000 claims description 2
- SFUBAYJOJMYVPM-UHFFFAOYSA-N 5-[6-[2-(1-benzothiophen-4-yl)ethylamino]pyrimidin-4-yl]-3-ethoxythiophene-2-carboxylic acid Chemical compound S1C2=C(C=C1)C(=CC=C2)CCNC1=CC(=NC=N1)C1=CC(=C(S1)C(=O)O)OCC SFUBAYJOJMYVPM-UHFFFAOYSA-N 0.000 claims description 2
- XDQSKBNMZJVGCA-UHFFFAOYSA-N 5-[6-[2-(1-benzothiophen-7-yl)ethylamino]pyrimidin-4-yl]-3-ethoxythiophene-2-carboxylic acid Chemical compound S1C2=C(C=C1)C=CC=C2CCNC1=CC(=NC=N1)C1=CC(=C(S1)C(=O)O)OCC XDQSKBNMZJVGCA-UHFFFAOYSA-N 0.000 claims description 2
- NMRGOCVSRAFKHL-UHFFFAOYSA-N 5-[6-[2-(2,3-dimethoxynaphthalen-1-yl)ethylamino]pyrimidin-4-yl]-3-ethoxythiophene-2-carboxylic acid Chemical compound COC1=C(C2=CC=CC=C2C=C1OC)CCNC1=CC(=NC=N1)C1=CC(=C(S1)C(=O)O)OCC NMRGOCVSRAFKHL-UHFFFAOYSA-N 0.000 claims description 2
- HBBOMLRGNGQWSR-UHFFFAOYSA-N 5-[6-[2-(2,3-dimethylnaphthalen-1-yl)ethylamino]pyrimidin-4-yl]-3-ethoxythiophene-2-carboxylic acid Chemical compound CC1=C(C2=CC=CC=C2C=C1C)CCNC1=CC(=NC=N1)C1=CC(=C(S1)C(=O)O)OCC HBBOMLRGNGQWSR-UHFFFAOYSA-N 0.000 claims description 2
- QQCJVAXSNKFTIW-UHFFFAOYSA-N 5-[6-[2-(2-aminonaphthalen-1-yl)ethylamino]pyrimidin-4-yl]-3-ethoxythiophene-2-carboxylic acid Chemical compound NC1=C(C2=CC=CC=C2C=C1)CCNC1=CC(=NC=N1)C1=CC(=C(S1)C(=O)O)OCC QQCJVAXSNKFTIW-UHFFFAOYSA-N 0.000 claims description 2
- WKOBOVDFXBAZHH-UHFFFAOYSA-N 5-[6-[2-(2-bromonaphthalen-1-yl)ethylamino]pyrimidin-4-yl]-3-ethoxythiophene-2-carboxylic acid Chemical compound BrC1=C(C2=CC=CC=C2C=C1)CCNC1=CC(=NC=N1)C1=CC(=C(S1)C(=O)O)OCC WKOBOVDFXBAZHH-UHFFFAOYSA-N 0.000 claims description 2
- MSDYKXGURLIEJA-UHFFFAOYSA-N 5-[6-[2-(4-chloronaphthalen-1-yl)ethylamino]pyrimidin-4-yl]-3-ethoxythiophene-2-carboxylic acid Chemical compound ClC1=CC=C(C2=CC=CC=C12)CCNC1=CC(=NC=N1)C1=CC(=C(S1)C(=O)O)OCC MSDYKXGURLIEJA-UHFFFAOYSA-N 0.000 claims description 2
- BJXHJCQVQMALDH-UHFFFAOYSA-N 5-[6-[2-(4-cyanonaphthalen-1-yl)ethylamino]pyrimidin-4-yl]-3-ethoxythiophene-2-carboxylic acid Chemical compound C(#N)C1=CC=C(C2=CC=CC=C12)CCNC1=CC(=NC=N1)C1=CC(=C(S1)C(=O)O)OCC BJXHJCQVQMALDH-UHFFFAOYSA-N 0.000 claims description 2
- SGZSEOHQPAWAMJ-UHFFFAOYSA-N 5-[6-[2-(6-methoxyquinolin-5-yl)ethylamino]pyrimidin-4-yl]-3-(trifluoromethyl)thiophene-2-carboxylic acid Chemical compound COC=1C(=C2C=CC=NC2=CC=1)CCNC1=CC(=NC=N1)C1=CC(=C(S1)C(=O)O)C(F)(F)F SGZSEOHQPAWAMJ-UHFFFAOYSA-N 0.000 claims description 2
- BXRUBKHQLOACQJ-UHFFFAOYSA-N 5-[6-[2-(7-chloroquinolin-8-yl)ethylamino]pyrimidin-4-yl]-3-ethoxythiophene-2-carboxylic acid Chemical compound ClC1=CC=C2C=CC=NC2=C1CCNC1=CC(=NC=N1)C1=CC(=C(S1)C(=O)O)OCC BXRUBKHQLOACQJ-UHFFFAOYSA-N 0.000 claims description 2
- BIHKQCMQPNBTQD-UHFFFAOYSA-N 5-[6-[2-[4-(difluoromethyl)naphthalen-1-yl]ethylamino]pyrimidin-4-yl]-3-ethoxythiophene-2-carboxylic acid Chemical compound FC(C1=CC=C(C2=CC=CC=C12)CCNC1=CC(=NC=N1)C1=CC(=C(S1)C(=O)O)OCC)F BIHKQCMQPNBTQD-UHFFFAOYSA-N 0.000 claims description 2
- LENICUJNEITKNA-UHFFFAOYSA-N 6-[3-ethoxy-4-(2H-tetrazol-5-yl)phenyl]-N-[2-(2-methoxynaphthalen-1-yl)ethyl]pyrimidin-4-amine Chemical compound C(C)OC=1C=C(C=CC=1C1=NN=NN1)C1=CC(=NC=N1)NCCC1=C(C=CC2=CC=CC=C12)OC LENICUJNEITKNA-UHFFFAOYSA-N 0.000 claims description 2
- YVLNQPNWBWKERE-UHFFFAOYSA-N C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=C2C=CN=CC2=CC=C1)C1=NOC(N1)=O Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=C2C=CN=CC2=CC=C1)C1=NOC(N1)=O YVLNQPNWBWKERE-UHFFFAOYSA-N 0.000 claims description 2
- LZDUJKANULCQMR-UHFFFAOYSA-N C(C)OC=1N=C(SC=1C1=NOC(N1)=O)C1=NC=NC(=C1)NCCC1=C(C=CC2=CC=CC=C12)OC Chemical compound C(C)OC=1N=C(SC=1C1=NOC(N1)=O)C1=NC=NC(=C1)NCCC1=C(C=CC2=CC=CC=C12)OC LZDUJKANULCQMR-UHFFFAOYSA-N 0.000 claims description 2
- MOBYSZRTIQZWTA-UHFFFAOYSA-N CCc1nc(sc1-c1nc(=O)o[nH]1)-c1cc(NCCc2c(OC)ccc3ccccc23)ncn1 Chemical compound CCc1nc(sc1-c1nc(=O)o[nH]1)-c1cc(NCCc2c(OC)ccc3ccccc23)ncn1 MOBYSZRTIQZWTA-UHFFFAOYSA-N 0.000 claims description 2
- 230000003143 atherosclerotic effect Effects 0.000 claims description 2
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 2
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 claims 3
- NRRVOLSTQHJDEG-UHFFFAOYSA-N 1,2,3-trimethylindole Chemical compound C1=CC=C2N(C)C(C)=C(C)C2=C1 NRRVOLSTQHJDEG-UHFFFAOYSA-N 0.000 claims 1
- NKYVKUVRUYQSNA-UHFFFAOYSA-N 2-(difluoromethoxy)-4-[6-[2-(2-methoxynaphthalen-1-yl)ethylamino]pyrimidin-4-yl]benzoic acid Chemical compound FC(OC1=C(C(=O)O)C=CC(=C1)C1=NC=NC(=C1)NCCC1=C(C=CC2=CC=CC=C12)OC)F NKYVKUVRUYQSNA-UHFFFAOYSA-N 0.000 claims 1
- YVBVAXYJWJSXLQ-UHFFFAOYSA-N 2-[2-ethoxy-4-[6-[2-(2-methoxynaphthalen-1-yl)ethylamino]pyrimidin-4-yl]anilino]-2-oxoacetic acid Chemical compound C(C)OC1=C(C=CC(=C1)C1=NC=NC(=C1)NCCC1=C(C=CC2=CC=CC=C12)OC)NC(C(=O)O)=O YVBVAXYJWJSXLQ-UHFFFAOYSA-N 0.000 claims 1
- LBJPNTLBHDXUGV-UHFFFAOYSA-N 2-[2-ethoxy-4-[6-[2-(2-methoxynaphthalen-1-yl)ethylamino]pyrimidin-4-yl]phenyl]acetic acid Chemical compound C(C)OC1=C(C=CC(=C1)C1=NC=NC(=C1)NCCC1=C(C=CC2=CC=CC=C12)OC)CC(=O)O LBJPNTLBHDXUGV-UHFFFAOYSA-N 0.000 claims 1
- QULBLXOBUFTFGY-UHFFFAOYSA-N 2-[2-ethoxy-4-[6-[2-(5-methoxy-1-benzothiophen-4-yl)ethylamino]pyrimidin-4-yl]phenyl]acetic acid Chemical compound C(C)OC1=C(C=CC(=C1)C1=NC=NC(=C1)NCCC1=C(C=CC=2SC=CC=21)OC)CC(=O)O QULBLXOBUFTFGY-UHFFFAOYSA-N 0.000 claims 1
- VBOATZJDTYSZFC-UHFFFAOYSA-N 2-cyclobutyloxy-4-[6-[2-(6-methoxyquinolin-5-yl)ethylamino]pyrimidin-4-yl]benzoic acid Chemical compound C1(CCC1)OC1=C(C(=O)O)C=CC(=C1)C1=NC=NC(=C1)NCCC1=C2C=CC=NC2=CC=C1OC VBOATZJDTYSZFC-UHFFFAOYSA-N 0.000 claims 1
- HYGFYVIPXZPNOK-UHFFFAOYSA-N 3-[3-ethoxy-5-[6-[2-(2-methoxynaphthalen-1-yl)ethylamino]pyrimidin-4-yl]thiophen-2-yl]propanoic acid Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=C(C=CC2=CC=CC=C12)OC)CCC(=O)O HYGFYVIPXZPNOK-UHFFFAOYSA-N 0.000 claims 1
- MVTDDRPBCZUSDO-UHFFFAOYSA-N 3-ethoxy-5-[6-[2-(1-methylindol-4-yl)ethylamino]pyrimidin-4-yl]thiophene-2-carboxylic acid Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=C2C=CN(C2=CC=C1)C)C(=O)O MVTDDRPBCZUSDO-UHFFFAOYSA-N 0.000 claims 1
- GLOWKHRUZLQLFT-UHFFFAOYSA-N 3-ethoxy-5-[6-[2-(1H-indol-4-yl)ethylamino]pyrimidin-4-yl]thiophene-2-carboxylic acid Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=C2C=CNC2=CC=C1)C(=O)O GLOWKHRUZLQLFT-UHFFFAOYSA-N 0.000 claims 1
- YSOPCSFNSCQQGE-UHFFFAOYSA-N 3-ethoxy-5-[6-[2-(2-methoxynaphthalen-1-yl)ethylamino]pyrimidin-4-yl]-N-sulfamoylthiophene-2-carboxamide Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=C(C=CC2=CC=CC=C12)OC)C(=O)NS(N)(=O)=O YSOPCSFNSCQQGE-UHFFFAOYSA-N 0.000 claims 1
- KSXNYVRIRDTHRZ-UHFFFAOYSA-N 3-ethoxy-5-[6-[2-(2-methoxynaphthalen-1-yl)ethylamino]pyrimidin-4-yl]thiophene-2-carboxylic acid Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=C(C=CC2=CC=CC=C12)OC)C(=O)O KSXNYVRIRDTHRZ-UHFFFAOYSA-N 0.000 claims 1
- SVZQKWSPVXPEJZ-UHFFFAOYSA-N 3-ethoxy-5-[6-[2-(2-methyl-1-benzofuran-7-yl)ethylamino]pyrimidin-4-yl]thiophene-2-carboxylic acid Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=CC=CC=2C=C(OC=21)C)C(=O)O SVZQKWSPVXPEJZ-UHFFFAOYSA-N 0.000 claims 1
- FURRWRLYJJNYNH-UHFFFAOYSA-N 3-ethoxy-5-[6-[2-(2-methyl-1H-indol-7-yl)ethylamino]pyrimidin-4-yl]thiophene-2-carboxylic acid Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC=1C=CC=C2C=C(NC=12)C)C(=O)O FURRWRLYJJNYNH-UHFFFAOYSA-N 0.000 claims 1
- IQYYOBZWOODJJP-UHFFFAOYSA-N 3-ethoxy-5-[6-[2-(2-propan-2-yloxynaphthalen-1-yl)ethylamino]pyrimidin-4-yl]thiophene-2-carboxylic acid Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=C(C=CC2=CC=CC=C12)OC(C)C)C(=O)O IQYYOBZWOODJJP-UHFFFAOYSA-N 0.000 claims 1
- JHNAMJQXWCCCEJ-UHFFFAOYSA-N 3-ethoxy-5-[6-[2-(3-methoxynaphthalen-1-yl)ethylamino]pyrimidin-4-yl]thiophene-2-carboxylic acid Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=CC(=CC2=CC=CC=C12)OC)C(=O)O JHNAMJQXWCCCEJ-UHFFFAOYSA-N 0.000 claims 1
- XORUXRPBXGWXLP-UHFFFAOYSA-N 3-ethoxy-5-[6-[2-(5-ethoxy-1,3-benzodioxol-4-yl)ethylamino]pyrimidin-4-yl]thiophene-2-carboxylic acid Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=C(C=CC=2OCOC=21)OCC)C(=O)O XORUXRPBXGWXLP-UHFFFAOYSA-N 0.000 claims 1
- LRKCBKGLDBHDSV-UHFFFAOYSA-N 3-ethoxy-5-[6-[2-(5-methoxy-1,3-benzodioxol-4-yl)ethylamino]pyrimidin-4-yl]thiophene-2-carboxylic acid Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=C(C=CC=2OCOC=21)OC)C(=O)O LRKCBKGLDBHDSV-UHFFFAOYSA-N 0.000 claims 1
- HGWDUOQYKOTABD-UHFFFAOYSA-N 4-[6-[2-(2-methoxynaphthalen-1-yl)ethylamino]pyrimidin-4-yl]-2-(2-methylpropyl)benzoic acid Chemical compound COc1ccc2ccccc2c1CCNc1cc(ncn1)-c1ccc(C(O)=O)c(CC(C)C)c1 HGWDUOQYKOTABD-UHFFFAOYSA-N 0.000 claims 1
- MNVQXGLUPCHWDO-UHFFFAOYSA-N 5-[6-[2-(2,5-dimethoxynaphthalen-1-yl)ethylamino]pyrimidin-4-yl]-3-ethoxythiophene-2-carboxylic acid Chemical compound COC1=C(C2=CC=CC(=C2C=C1)OC)CCNC1=CC(=NC=N1)C1=CC(=C(S1)C(=O)O)OCC MNVQXGLUPCHWDO-UHFFFAOYSA-N 0.000 claims 1
- KNMCKLMWFYDLBY-UHFFFAOYSA-N 5-[6-[2-(2-cyano-8-fluoro-5-methoxynaphthalen-1-yl)ethylamino]pyrimidin-4-yl]-3-ethoxythiophene-2-carboxylic acid Chemical compound C(#N)C1=C(C2=C(C=CC(=C2C=C1)OC)F)CCNC1=CC(=NC=N1)C1=CC(=C(S1)C(=O)O)OCC KNMCKLMWFYDLBY-UHFFFAOYSA-N 0.000 claims 1
- VTYCMWGQRNABBQ-UHFFFAOYSA-N 5-[6-[2-(2-cyanonaphthalen-1-yl)ethylamino]pyrimidin-4-yl]-3-ethoxythiophene-2-carboxylic acid Chemical compound C(#N)C1=C(C2=CC=CC=C2C=C1)CCNC1=CC(=NC=N1)C1=CC(=C(S1)C(=O)O)OCC VTYCMWGQRNABBQ-UHFFFAOYSA-N 0.000 claims 1
- JQGQIRPONOJDCO-UHFFFAOYSA-N 6-methylcyclohexa-2,4-dien-1-one Chemical compound CC1C=CC=CC1=O JQGQIRPONOJDCO-UHFFFAOYSA-N 0.000 claims 1
- 229920003026 Acene Polymers 0.000 claims 1
- CWDQVZBCJXQWDE-UHFFFAOYSA-N C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=C2C=CC=NC2=CC=C1OC)C1=NOC(=N1)O Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=C2C=CC=NC2=CC=C1OC)C1=NOC(=N1)O CWDQVZBCJXQWDE-UHFFFAOYSA-N 0.000 claims 1
- ZVGWIVKKFFFOOT-UHFFFAOYSA-N C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=CC=C(C2=CC=CC=C12)OC)C1=NOC(=N1)O Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=CC=C(C2=CC=CC=C12)OC)C1=NOC(=N1)O ZVGWIVKKFFFOOT-UHFFFAOYSA-N 0.000 claims 1
- DTXKOLKFOCYAPU-UHFFFAOYSA-N C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC=1C=CC=C2C=CN=CC=12)C1=NOC(N1)=O Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC=1C=CC=C2C=CN=CC=12)C1=NOC(N1)=O DTXKOLKFOCYAPU-UHFFFAOYSA-N 0.000 claims 1
- MWPLVEDNUUSJAV-UHFFFAOYSA-N anthracene Chemical compound C1=CC=CC2=CC3=CC=CC=C3C=C21 MWPLVEDNUUSJAV-UHFFFAOYSA-N 0.000 claims 1
- PQNFLJBBNBOBRQ-UHFFFAOYSA-N benzocyclopentane Natural products C1=CC=C2CCCC2=C1 PQNFLJBBNBOBRQ-UHFFFAOYSA-N 0.000 claims 1
- 210000000349 chromosome Anatomy 0.000 claims 1
- MGNZXYYWBUKAII-UHFFFAOYSA-N cyclohexa-1,3-diene Chemical group C1CC=CC=C1 MGNZXYYWBUKAII-UHFFFAOYSA-N 0.000 claims 1
- 125000003700 epoxy group Chemical group 0.000 claims 1
- 239000002414 female fertility agent Substances 0.000 claims 1
- 150000003180 prostaglandins Chemical class 0.000 abstract description 9
- 229940083082 pyrimidine derivative acting on arteriolar smooth muscle Drugs 0.000 abstract description 6
- IANQTJSKSUMEQM-UHFFFAOYSA-N 1-benzofuran Chemical compound C1=CC=C2OC=CC2=C1 IANQTJSKSUMEQM-UHFFFAOYSA-N 0.000 abstract 1
- FCEHBMOGCRZNNI-UHFFFAOYSA-N 1-benzothiophene Chemical class C1=CC=C2SC=CC2=C1 FCEHBMOGCRZNNI-UHFFFAOYSA-N 0.000 abstract 1
- 238000004895 liquid chromatography mass spectrometry Methods 0.000 description 176
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 135
- 239000011541 reaction mixture Substances 0.000 description 104
- 239000007787 solid Substances 0.000 description 92
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 80
- 101001117519 Homo sapiens Prostaglandin E2 receptor EP2 subtype Proteins 0.000 description 69
- 102100024448 Prostaglandin E2 receptor EP2 subtype Human genes 0.000 description 69
- 235000019439 ethyl acetate Nutrition 0.000 description 65
- 239000000243 solution Substances 0.000 description 55
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 55
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 48
- 102100024450 Prostaglandin E2 receptor EP4 subtype Human genes 0.000 description 44
- 230000002829 reductive effect Effects 0.000 description 38
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 36
- XJPZKYIHCLDXST-UHFFFAOYSA-N 4,6-dichloropyrimidine Chemical compound ClC1=CC(Cl)=NC=N1 XJPZKYIHCLDXST-UHFFFAOYSA-N 0.000 description 33
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 31
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 30
- 239000012044 organic layer Substances 0.000 description 30
- 210000004027 cell Anatomy 0.000 description 29
- 239000005557 antagonist Substances 0.000 description 27
- 239000012267 brine Substances 0.000 description 26
- 238000002512 chemotherapy Methods 0.000 description 26
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 26
- 239000003921 oil Substances 0.000 description 26
- 235000019198 oils Nutrition 0.000 description 26
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 26
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 25
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 24
- 150000001491 aromatic compounds Chemical class 0.000 description 24
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 23
- 239000000203 mixture Substances 0.000 description 23
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 21
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 21
- XEYBRNLFEZDVAW-ARSRFYASSA-N dinoprostone Chemical compound CCCCC[C@H](O)\C=C\[C@H]1[C@H](O)CC(=O)[C@@H]1C\C=C/CCCC(O)=O XEYBRNLFEZDVAW-ARSRFYASSA-N 0.000 description 20
- 238000002953 preparative HPLC Methods 0.000 description 20
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 19
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 19
- 229960002986 dinoprostone Drugs 0.000 description 19
- XEYBRNLFEZDVAW-UHFFFAOYSA-N prostaglandin E2 Natural products CCCCCC(O)C=CC1C(O)CC(=O)C1CC=CCCCC(O)=O XEYBRNLFEZDVAW-UHFFFAOYSA-N 0.000 description 19
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 18
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 18
- 239000003795 chemical substances by application Substances 0.000 description 17
- DCKVNWZUADLDEH-UHFFFAOYSA-N sec-butyl acetate Chemical compound CCC(C)OC(C)=O DCKVNWZUADLDEH-UHFFFAOYSA-N 0.000 description 17
- 125000000335 thiazolyl group Chemical group 0.000 description 17
- 101150109738 Ptger4 gene Proteins 0.000 description 16
- 239000002253 acid Substances 0.000 description 16
- 239000007858 starting material Substances 0.000 description 16
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 15
- 125000001309 chloro group Chemical group Cl* 0.000 description 15
- 229940079593 drug Drugs 0.000 description 15
- 239000010410 layer Substances 0.000 description 15
- 125000006299 oxetan-3-yl group Chemical group [H]C1([H])OC([H])([H])C1([H])* 0.000 description 15
- 239000002904 solvent Substances 0.000 description 15
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 14
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 13
- 230000015572 biosynthetic process Effects 0.000 description 13
- 238000006243 chemical reaction Methods 0.000 description 13
- 125000001153 fluoro group Chemical group F* 0.000 description 13
- 239000003112 inhibitor Substances 0.000 description 13
- 125000001715 oxadiazolyl group Chemical group 0.000 description 13
- KDLHZDBZIXYQEI-UHFFFAOYSA-N palladium Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 13
- 239000000725 suspension Substances 0.000 description 13
- 230000009977 dual effect Effects 0.000 description 12
- 239000000706 filtrate Substances 0.000 description 12
- 125000000842 isoxazolyl group Chemical group 0.000 description 12
- 238000003786 synthesis reaction Methods 0.000 description 12
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 11
- 230000000694 effects Effects 0.000 description 11
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 11
- 229940002612 prodrug Drugs 0.000 description 11
- 239000000651 prodrug Substances 0.000 description 11
- GQHTUMJGOHRCHB-UHFFFAOYSA-N 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine Chemical compound C1CCCCN2CCCN=C21 GQHTUMJGOHRCHB-UHFFFAOYSA-N 0.000 description 10
- LZPWAYBEOJRFAX-UHFFFAOYSA-N 4,4,5,5-tetramethyl-1,3,2$l^{2}-dioxaborolane Chemical compound CC1(C)O[B]OC1(C)C LZPWAYBEOJRFAX-UHFFFAOYSA-N 0.000 description 10
- 206010006187 Breast cancer Diseases 0.000 description 10
- 208000026310 Breast neoplasm Diseases 0.000 description 10
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 10
- OIRDTQYFTABQOQ-KQYNXXCUSA-N adenosine Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O OIRDTQYFTABQOQ-KQYNXXCUSA-N 0.000 description 10
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 10
- 201000006417 multiple sclerosis Diseases 0.000 description 10
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 10
- 125000003226 pyrazolyl group Chemical group 0.000 description 10
- 230000011664 signaling Effects 0.000 description 10
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 9
- 206010061902 Pancreatic neoplasm Diseases 0.000 description 9
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 9
- 229910052794 bromium Inorganic materials 0.000 description 9
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 9
- 125000002883 imidazolyl group Chemical group 0.000 description 9
- 238000009169 immunotherapy Methods 0.000 description 9
- 125000001786 isothiazolyl group Chemical group 0.000 description 9
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 9
- 125000002971 oxazolyl group Chemical group 0.000 description 9
- 150000003141 primary amines Chemical class 0.000 description 9
- 125000003831 tetrazolyl group Chemical group 0.000 description 9
- 125000001425 triazolyl group Chemical group 0.000 description 9
- KZPYGQFFRCFCPP-UHFFFAOYSA-N 1,1'-bis(diphenylphosphino)ferrocene Chemical compound [Fe+2].C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1 KZPYGQFFRCFCPP-UHFFFAOYSA-N 0.000 description 8
- 208000003174 Brain Neoplasms Diseases 0.000 description 8
- 102100038280 Prostaglandin G/H synthase 2 Human genes 0.000 description 8
- 206010060862 Prostate cancer Diseases 0.000 description 8
- 208000000236 Prostatic Neoplasms Diseases 0.000 description 8
- 230000004913 activation Effects 0.000 description 8
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 8
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 8
- 239000000284 extract Substances 0.000 description 8
- 208000015486 malignant pancreatic neoplasm Diseases 0.000 description 8
- 201000002528 pancreatic cancer Diseases 0.000 description 8
- 208000008443 pancreatic carcinoma Diseases 0.000 description 8
- 238000003756 stirring Methods 0.000 description 8
- 238000006467 substitution reaction Methods 0.000 description 8
- 125000001113 thiadiazolyl group Chemical group 0.000 description 8
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 7
- 208000001333 Colorectal Neoplasms Diseases 0.000 description 7
- 201000006107 Familial adenomatous polyposis Diseases 0.000 description 7
- 206010017993 Gastrointestinal neoplasms Diseases 0.000 description 7
- 101000725401 Homo sapiens Cytochrome c oxidase subunit 2 Proteins 0.000 description 7
- 101000605127 Homo sapiens Prostaglandin G/H synthase 2 Proteins 0.000 description 7
- 210000001744 T-lymphocyte Anatomy 0.000 description 7
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 7
- 208000029664 classic familial adenomatous polyposis Diseases 0.000 description 7
- 229940111134 coxibs Drugs 0.000 description 7
- 239000003255 cyclooxygenase 2 inhibitor Substances 0.000 description 7
- 125000004786 difluoromethoxy group Chemical group [H]C(F)(F)O* 0.000 description 7
- 239000003480 eluent Substances 0.000 description 7
- 150000002148 esters Chemical class 0.000 description 7
- 125000002140 imidazol-4-yl group Chemical group [H]N1C([H])=NC([*])=C1[H] 0.000 description 7
- 230000005764 inhibitory process Effects 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N monobenzene Natural products C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 7
- 238000000746 purification Methods 0.000 description 7
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 description 7
- 210000004881 tumor cell Anatomy 0.000 description 7
- 230000004614 tumor growth Effects 0.000 description 7
- HNSDLXPSAYFUHK-UHFFFAOYSA-N 1,4-bis(2-ethylhexyl) sulfosuccinate Chemical compound CCCCC(CC)COC(=O)CC(S(O)(=O)=O)C(=O)OCC(CC)CCCC HNSDLXPSAYFUHK-UHFFFAOYSA-N 0.000 description 6
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 6
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 6
- 241000699666 Mus <mouse, genus> Species 0.000 description 6
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 6
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 6
- 235000019502 Orange oil Nutrition 0.000 description 6
- 230000002378 acidificating effect Effects 0.000 description 6
- 238000007792 addition Methods 0.000 description 6
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 6
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 6
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 6
- 239000012230 colorless oil Substances 0.000 description 6
- 239000012043 crude product Substances 0.000 description 6
- 210000004443 dendritic cell Anatomy 0.000 description 6
- 238000001514 detection method Methods 0.000 description 6
- 230000002496 gastric effect Effects 0.000 description 6
- 125000000623 heterocyclic group Chemical group 0.000 description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 6
- 125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 description 6
- 238000011813 knockout mouse model Methods 0.000 description 6
- 239000010502 orange oil Substances 0.000 description 6
- 125000001820 oxy group Chemical group [*:1]O[*:2] 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 6
- 108090000623 proteins and genes Proteins 0.000 description 6
- 238000012552 review Methods 0.000 description 6
- 229910000104 sodium hydride Inorganic materials 0.000 description 6
- 230000004083 survival effect Effects 0.000 description 6
- ITMCEJHCFYSIIV-UHFFFAOYSA-M triflate Chemical compound [O-]S(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-M 0.000 description 6
- 239000003643 water by type Substances 0.000 description 6
- 208000024827 Alzheimer disease Diseases 0.000 description 5
- 239000002126 C01EB10 - Adenosine Substances 0.000 description 5
- 206010009944 Colon cancer Diseases 0.000 description 5
- 102000004190 Enzymes Human genes 0.000 description 5
- 108090000790 Enzymes Proteins 0.000 description 5
- 208000000461 Esophageal Neoplasms Diseases 0.000 description 5
- 206010065390 Inflammatory pain Diseases 0.000 description 5
- 108010074328 Interferon-gamma Proteins 0.000 description 5
- 102000000588 Interleukin-2 Human genes 0.000 description 5
- 108010002350 Interleukin-2 Proteins 0.000 description 5
- 208000005718 Stomach Neoplasms Diseases 0.000 description 5
- 108010073929 Vascular Endothelial Growth Factor A Proteins 0.000 description 5
- 102000005789 Vascular Endothelial Growth Factors Human genes 0.000 description 5
- 108010019530 Vascular Endothelial Growth Factors Proteins 0.000 description 5
- 229960005305 adenosine Drugs 0.000 description 5
- 230000006907 apoptotic process Effects 0.000 description 5
- 125000004618 benzofuryl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 5
- 230000004071 biological effect Effects 0.000 description 5
- 231100000504 carcinogenesis Toxicity 0.000 description 5
- 238000006880 cross-coupling reaction Methods 0.000 description 5
- 210000002865 immune cell Anatomy 0.000 description 5
- 230000001965 increasing effect Effects 0.000 description 5
- 229910052740 iodine Inorganic materials 0.000 description 5
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 5
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 5
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 5
- 230000004048 modification Effects 0.000 description 5
- 238000012986 modification Methods 0.000 description 5
- 210000000822 natural killer cell Anatomy 0.000 description 5
- 229940094443 oxytocics prostaglandins Drugs 0.000 description 5
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 description 5
- 230000001105 regulatory effect Effects 0.000 description 5
- 229940124597 therapeutic agent Drugs 0.000 description 5
- 238000002560 therapeutic procedure Methods 0.000 description 5
- 238000002255 vaccination Methods 0.000 description 5
- 125000004793 2,2,2-trifluoroethoxy group Chemical group FC(CO*)(F)F 0.000 description 4
- CAAGZPJPCKMFBD-UHFFFAOYSA-N 2-(1-methyl-3-indolyl)ethanamine Chemical compound C1=CC=C2N(C)C=C(CCN)C2=C1 CAAGZPJPCKMFBD-UHFFFAOYSA-N 0.000 description 4
- LBVUFZJYMWUZIW-UHFFFAOYSA-N 4,6-diiodopyrimidine Chemical compound IC1=CC(I)=NC=N1 LBVUFZJYMWUZIW-UHFFFAOYSA-N 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- 208000005623 Carcinogenesis Diseases 0.000 description 4
- 102000001301 EGF receptor Human genes 0.000 description 4
- 108060006698 EGF receptor Proteins 0.000 description 4
- 206010018338 Glioma Diseases 0.000 description 4
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 4
- 229930012538 Paclitaxel Natural products 0.000 description 4
- 238000006069 Suzuki reaction reaction Methods 0.000 description 4
- BPEGJWRSRHCHSN-UHFFFAOYSA-N Temozolomide Chemical compound O=C1N(C)N=NC2=C(C(N)=O)N=CN21 BPEGJWRSRHCHSN-UHFFFAOYSA-N 0.000 description 4
- 241000700605 Viruses Species 0.000 description 4
- 206010002026 amyotrophic lateral sclerosis Diseases 0.000 description 4
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 4
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 4
- NMJJFJNHVMGPGM-UHFFFAOYSA-N butyl formate Chemical compound CCCCOC=O NMJJFJNHVMGPGM-UHFFFAOYSA-N 0.000 description 4
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 4
- 229910000024 caesium carbonate Inorganic materials 0.000 description 4
- 230000036952 cancer formation Effects 0.000 description 4
- KXDHJXZQYSOELW-UHFFFAOYSA-N carbonic acid monoamide Natural products NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 4
- 230000030833 cell death Effects 0.000 description 4
- 229940000425 combination drug Drugs 0.000 description 4
- 230000001472 cytotoxic effect Effects 0.000 description 4
- 210000002919 epithelial cell Anatomy 0.000 description 4
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 4
- 238000000605 extraction Methods 0.000 description 4
- SDUQYLNIPVEERB-QPPQHZFASA-N gemcitabine Chemical compound O=C1N=C(N)C=CN1[C@H]1C(F)(F)[C@H](O)[C@@H](CO)O1 SDUQYLNIPVEERB-QPPQHZFASA-N 0.000 description 4
- 229960005277 gemcitabine Drugs 0.000 description 4
- 230000014509 gene expression Effects 0.000 description 4
- 238000004128 high performance liquid chromatography Methods 0.000 description 4
- 239000003446 ligand Substances 0.000 description 4
- 210000002540 macrophage Anatomy 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 238000010172 mouse model Methods 0.000 description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 description 4
- 239000012074 organic phase Substances 0.000 description 4
- 229960001592 paclitaxel Drugs 0.000 description 4
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 4
- 125000006239 protecting group Chemical group 0.000 description 4
- 102000004169 proteins and genes Human genes 0.000 description 4
- 125000000714 pyrimidinyl group Chemical group 0.000 description 4
- 102000005962 receptors Human genes 0.000 description 4
- 108020003175 receptors Proteins 0.000 description 4
- 210000003289 regulatory T cell Anatomy 0.000 description 4
- 238000001356 surgical procedure Methods 0.000 description 4
- RCINICONZNJXQF-MZXODVADSA-N taxol Chemical compound O([C@@H]1[C@@]2(C[C@@H](C(C)=C(C2(C)C)[C@H](C([C@]2(C)[C@@H](O)C[C@H]3OC[C@]3([C@H]21)OC(C)=O)=O)OC(=O)C)OC(=O)[C@H](O)[C@@H](NC(=O)C=1C=CC=CC=1)C=1C=CC=CC=1)O)C(=O)C1=CC=CC=C1 RCINICONZNJXQF-MZXODVADSA-N 0.000 description 4
- 229960004964 temozolomide Drugs 0.000 description 4
- 238000004704 ultra performance liquid chromatography Methods 0.000 description 4
- FDKXTQMXEQVLRF-ZHACJKMWSA-N (E)-dacarbazine Chemical compound CN(C)\N=N\c1[nH]cnc1C(N)=O FDKXTQMXEQVLRF-ZHACJKMWSA-N 0.000 description 3
- PIAOLBVUVDXHHL-UHFFFAOYSA-N 2-nitroethenylbenzene Chemical compound [O-][N+](=O)C=CC1=CC=CC=C1 PIAOLBVUVDXHHL-UHFFFAOYSA-N 0.000 description 3
- ACANHJHERCBOJU-SNAWJCMRSA-N 5-methoxy-4-[(E)-2-nitroethenyl]-1,3-benzodioxole Chemical compound COc1ccc2OCOc2c1\C=C\[N+]([O-])=O ACANHJHERCBOJU-SNAWJCMRSA-N 0.000 description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 3
- 206010065040 AIDS dementia complex Diseases 0.000 description 3
- 208000031261 Acute myeloid leukaemia Diseases 0.000 description 3
- 208000009746 Adult T-Cell Leukemia-Lymphoma Diseases 0.000 description 3
- 208000016683 Adult T-cell leukemia/lymphoma Diseases 0.000 description 3
- 208000036170 B-Cell Marginal Zone Lymphoma Diseases 0.000 description 3
- 206010004593 Bile duct cancer Diseases 0.000 description 3
- 208000006386 Bone Resorption Diseases 0.000 description 3
- 208000011691 Burkitt lymphomas Diseases 0.000 description 3
- WPHJWKAXYUFQNA-UHFFFAOYSA-N C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)O)C1=NOC(=N1)O Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)O)C1=NOC(=N1)O WPHJWKAXYUFQNA-UHFFFAOYSA-N 0.000 description 3
- 229940045513 CTLA4 antagonist Drugs 0.000 description 3
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 3
- 208000006332 Choriocarcinoma Diseases 0.000 description 3
- 208000030808 Clear cell renal carcinoma Diseases 0.000 description 3
- 206010052358 Colorectal cancer metastatic Diseases 0.000 description 3
- CMSMOCZEIVJLDB-UHFFFAOYSA-N Cyclophosphamide Chemical compound ClCCN(CCCl)P1(=O)NCCCO1 CMSMOCZEIVJLDB-UHFFFAOYSA-N 0.000 description 3
- YZCKVEUIGOORGS-OUBTZVSYSA-N Deuterium Chemical compound [2H] YZCKVEUIGOORGS-OUBTZVSYSA-N 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 3
- 208000005171 Dysmenorrhea Diseases 0.000 description 3
- 206010013935 Dysmenorrhoea Diseases 0.000 description 3
- 208000006168 Ewing Sarcoma Diseases 0.000 description 3
- 206010061850 Extranodal marginal zone B-cell lymphoma (MALT type) Diseases 0.000 description 3
- 208000022072 Gallbladder Neoplasms Diseases 0.000 description 3
- 201000010915 Glioblastoma multiforme Diseases 0.000 description 3
- 208000017604 Hodgkin disease Diseases 0.000 description 3
- 208000021519 Hodgkin lymphoma Diseases 0.000 description 3
- 208000010747 Hodgkins lymphoma Diseases 0.000 description 3
- 229940076838 Immune checkpoint inhibitor Drugs 0.000 description 3
- 102000037984 Inhibitory immune checkpoint proteins Human genes 0.000 description 3
- 108091008026 Inhibitory immune checkpoint proteins Proteins 0.000 description 3
- 102100037850 Interferon gamma Human genes 0.000 description 3
- 108090000467 Interferon-beta Proteins 0.000 description 3
- 206010025323 Lymphomas Diseases 0.000 description 3
- 201000003791 MALT lymphoma Diseases 0.000 description 3
- 206010027476 Metastases Diseases 0.000 description 3
- 206010059282 Metastases to central nervous system Diseases 0.000 description 3
- 206010027480 Metastatic malignant melanoma Diseases 0.000 description 3
- 206010050513 Metastatic renal cell carcinoma Diseases 0.000 description 3
- 229920001410 Microfiber Polymers 0.000 description 3
- 208000034578 Multiple myelomas Diseases 0.000 description 3
- 241000699670 Mus sp. Species 0.000 description 3
- 208000033776 Myeloid Acute Leukemia Diseases 0.000 description 3
- ZDZOTLJHXYCWBA-VCVYQWHSSA-N N-debenzoyl-N-(tert-butoxycarbonyl)-10-deacetyltaxol Chemical compound O([C@H]1[C@H]2[C@@](C([C@H](O)C3=C(C)[C@@H](OC(=O)[C@H](O)[C@@H](NC(=O)OC(C)(C)C)C=4C=CC=CC=4)C[C@]1(O)C3(C)C)=O)(C)[C@@H](O)C[C@H]1OC[C@]12OC(=O)C)C(=O)C1=CC=CC=C1 ZDZOTLJHXYCWBA-VCVYQWHSSA-N 0.000 description 3
- 208000001894 Nasopharyngeal Neoplasms Diseases 0.000 description 3
- YGACXVRLDHEXKY-WXRXAMBDSA-N O[C@H](C[C@H]1c2c(cccc2F)-c2cncn12)[C@H]1CC[C@H](O)CC1 Chemical compound O[C@H](C[C@H]1c2c(cccc2F)-c2cncn12)[C@H]1CC[C@H](O)CC1 YGACXVRLDHEXKY-WXRXAMBDSA-N 0.000 description 3
- 206010030155 Oesophageal carcinoma Diseases 0.000 description 3
- 102000038030 PI3Ks Human genes 0.000 description 3
- 108091007960 PI3Ks Proteins 0.000 description 3
- 208000008900 Pancreatic Ductal Carcinoma Diseases 0.000 description 3
- 206010033701 Papillary thyroid cancer Diseases 0.000 description 3
- 208000018737 Parkinson disease Diseases 0.000 description 3
- 206010035226 Plasma cell myeloma Diseases 0.000 description 3
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Substances CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 3
- 241000700159 Rattus Species 0.000 description 3
- 208000006265 Renal cell carcinoma Diseases 0.000 description 3
- 208000000728 Thymus Neoplasms Diseases 0.000 description 3
- 208000024770 Thyroid neoplasm Diseases 0.000 description 3
- 208000003721 Triple Negative Breast Neoplasms Diseases 0.000 description 3
- 239000007983 Tris buffer Substances 0.000 description 3
- 208000009956 adenocarcinoma Diseases 0.000 description 3
- 201000006966 adult T-cell leukemia Diseases 0.000 description 3
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 3
- 125000003277 amino group Chemical group 0.000 description 3
- 230000033115 angiogenesis Effects 0.000 description 3
- 230000000259 anti-tumor effect Effects 0.000 description 3
- 229910052786 argon Inorganic materials 0.000 description 3
- 239000003886 aromatase inhibitor Substances 0.000 description 3
- 229940046844 aromatase inhibitors Drugs 0.000 description 3
- 125000003354 benzotriazolyl group Chemical group N1N=NC2=C1C=CC=C2* 0.000 description 3
- 208000026900 bile duct neoplasm Diseases 0.000 description 3
- ACWZRVQXLIRSDF-UHFFFAOYSA-N binimetinib Chemical compound OCCONC(=O)C=1C=C2N(C)C=NC2=C(F)C=1NC1=CC=C(Br)C=C1F ACWZRVQXLIRSDF-UHFFFAOYSA-N 0.000 description 3
- 230000000903 blocking effect Effects 0.000 description 3
- 230000024279 bone resorption Effects 0.000 description 3
- SKKTUOZKZKCGTB-UHFFFAOYSA-N butyl carbamate Chemical compound CCCCOC(N)=O SKKTUOZKZKCGTB-UHFFFAOYSA-N 0.000 description 3
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 3
- 208000006990 cholangiocarcinoma Diseases 0.000 description 3
- 206010073251 clear cell renal cell carcinoma Diseases 0.000 description 3
- 229960002271 cobimetinib Drugs 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 229960004397 cyclophosphamide Drugs 0.000 description 3
- 231100000433 cytotoxic Toxicity 0.000 description 3
- 210000001151 cytotoxic T lymphocyte Anatomy 0.000 description 3
- 238000011393 cytotoxic chemotherapy Methods 0.000 description 3
- 230000003013 cytotoxicity Effects 0.000 description 3
- 231100000135 cytotoxicity Toxicity 0.000 description 3
- 229960003901 dacarbazine Drugs 0.000 description 3
- 238000010511 deprotection reaction Methods 0.000 description 3
- 229910052805 deuterium Inorganic materials 0.000 description 3
- ZOCHARZZJNPSEU-UHFFFAOYSA-N diboron Chemical compound B#B ZOCHARZZJNPSEU-UHFFFAOYSA-N 0.000 description 3
- MXFYYFVVIIWKFE-UHFFFAOYSA-N dicyclohexyl-[2-[2,6-di(propan-2-yloxy)phenyl]phenyl]phosphane Chemical compound CC(C)OC1=CC=CC(OC(C)C)=C1C1=CC=CC=C1P(C1CCCCC1)C1CCCCC1 MXFYYFVVIIWKFE-UHFFFAOYSA-N 0.000 description 3
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 description 3
- 229960003668 docetaxel Drugs 0.000 description 3
- 239000012636 effector Substances 0.000 description 3
- 201000004101 esophageal cancer Diseases 0.000 description 3
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 3
- VJJPUSNTGOMMGY-MRVIYFEKSA-N etoposide Chemical compound COC1=C(O)C(OC)=CC([C@@H]2C3=CC=4OCOC=4C=C3[C@@H](O[C@H]3[C@@H]([C@@H](O)[C@@H]4O[C@H](C)OC[C@H]4O3)O)[C@@H]3[C@@H]2C(OC3)=O)=C1 VJJPUSNTGOMMGY-MRVIYFEKSA-N 0.000 description 3
- 229960005420 etoposide Drugs 0.000 description 3
- 238000000105 evaporative light scattering detection Methods 0.000 description 3
- OVBPIULPVIDEAO-LBPRGKRZSA-N folic acid Chemical compound C=1N=C2NC(N)=NC(=O)C2=NC=1CNC1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 OVBPIULPVIDEAO-LBPRGKRZSA-N 0.000 description 3
- 201000010175 gallbladder cancer Diseases 0.000 description 3
- 206010017758 gastric cancer Diseases 0.000 description 3
- 239000011521 glass Substances 0.000 description 3
- 208000005017 glioblastoma Diseases 0.000 description 3
- 150000004820 halides Chemical class 0.000 description 3
- 201000010536 head and neck cancer Diseases 0.000 description 3
- 208000014829 head and neck neoplasm Diseases 0.000 description 3
- 206010073071 hepatocellular carcinoma Diseases 0.000 description 3
- 231100000844 hepatocellular carcinoma Toxicity 0.000 description 3
- 150000002430 hydrocarbons Chemical group 0.000 description 3
- 125000005945 imidazopyridyl group Chemical group 0.000 description 3
- 239000012274 immune-checkpoint protein inhibitor Substances 0.000 description 3
- 238000000338 in vitro Methods 0.000 description 3
- 238000001727 in vivo Methods 0.000 description 3
- 230000006698 induction Effects 0.000 description 3
- 239000011630 iodine Substances 0.000 description 3
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 3
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 3
- 208000032839 leukemia Diseases 0.000 description 3
- 230000000670 limiting effect Effects 0.000 description 3
- 239000012280 lithium aluminium hydride Substances 0.000 description 3
- 230000001404 mediated effect Effects 0.000 description 3
- 206010027191 meningioma Diseases 0.000 description 3
- 230000001394 metastastic effect Effects 0.000 description 3
- 208000021039 metastatic melanoma Diseases 0.000 description 3
- 206010061289 metastatic neoplasm Diseases 0.000 description 3
- 239000003658 microfiber Substances 0.000 description 3
- 125000002950 monocyclic group Chemical group 0.000 description 3
- 208000002154 non-small cell lung carcinoma Diseases 0.000 description 3
- 201000008482 osteoarthritis Diseases 0.000 description 3
- 201000008968 osteosarcoma Diseases 0.000 description 3
- 230000002018 overexpression Effects 0.000 description 3
- 201000008129 pancreatic ductal adenocarcinoma Diseases 0.000 description 3
- 229960002621 pembrolizumab Drugs 0.000 description 3
- 230000000144 pharmacologic effect Effects 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 3
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 239000002243 precursor Substances 0.000 description 3
- KAQKFAOMNZTLHT-OZUDYXHBSA-N prostaglandin I2 Chemical compound O1\C(=C/CCCC(O)=O)C[C@@H]2[C@@H](/C=C/[C@@H](O)CCCCC)[C@H](O)C[C@@H]21 KAQKFAOMNZTLHT-OZUDYXHBSA-N 0.000 description 3
- 125000004076 pyridyl group Chemical group 0.000 description 3
- 125000006085 pyrrolopyridyl group Chemical group 0.000 description 3
- 230000009467 reduction Effects 0.000 description 3
- 201000011549 stomach cancer Diseases 0.000 description 3
- 230000002195 synergetic effect Effects 0.000 description 3
- 125000000437 thiazol-2-yl group Chemical group [H]C1=C([H])N=C(*)S1 0.000 description 3
- 125000004495 thiazol-4-yl group Chemical group S1C=NC(=C1)* 0.000 description 3
- QERYCTSHXKAMIS-UHFFFAOYSA-N thiophene-2-carboxylic acid Chemical compound OC(=O)C1=CC=CS1 QERYCTSHXKAMIS-UHFFFAOYSA-N 0.000 description 3
- 201000002510 thyroid cancer Diseases 0.000 description 3
- 208000030045 thyroid gland papillary carcinoma Diseases 0.000 description 3
- KJAMZCVTJDTESW-UHFFFAOYSA-N tiracizine Chemical compound C1CC2=CC=CC=C2N(C(=O)CN(C)C)C2=CC(NC(=O)OCC)=CC=C21 KJAMZCVTJDTESW-UHFFFAOYSA-N 0.000 description 3
- PBIMIGNDTBRRPI-UHFFFAOYSA-N trifluoro borate Chemical compound FOB(OF)OF PBIMIGNDTBRRPI-UHFFFAOYSA-N 0.000 description 3
- 208000022679 triple-negative breast carcinoma Diseases 0.000 description 3
- 208000029729 tumor suppressor gene on chromosome 11 Diseases 0.000 description 3
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 3
- 229920002554 vinyl polymer Polymers 0.000 description 3
- MZOFCQQQCNRIBI-VMXHOPILSA-N (3s)-4-[[(2s)-1-[[(2s)-1-[[(1s)-1-carboxy-2-hydroxyethyl]amino]-4-methyl-1-oxopentan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-3-[[2-[[(2s)-2,6-diaminohexanoyl]amino]acetyl]amino]-4-oxobutanoic acid Chemical compound OC[C@@H](C(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](CC(O)=O)NC(=O)CNC(=O)[C@@H](N)CCCCN MZOFCQQQCNRIBI-VMXHOPILSA-N 0.000 description 2
- 125000006555 (C3-C5) cycloalkyl group Chemical group 0.000 description 2
- QUJSQTQQDOSBSV-BQYQJAHWSA-N 1,2,3-trimethyl-7-[(E)-2-nitroethenyl]indole Chemical compound CN1C(=C(C2=CC=CC(=C12)\C=C\[N+](=O)[O-])C)C QUJSQTQQDOSBSV-BQYQJAHWSA-N 0.000 description 2
- HQGDOYUGLQUKJN-VOTSOKGWSA-N 1,2-dimethyl-7-[(E)-2-nitroethenyl]indole Chemical compound CN1C(=CC2=CC=CC(=C12)\C=C\[N+](=O)[O-])C HQGDOYUGLQUKJN-VOTSOKGWSA-N 0.000 description 2
- IOOJQTNWLJIOBG-UHFFFAOYSA-N 1-(2-aminoethyl)naphthalen-2-amine hydrochloride Chemical compound Cl.NCCc1c(N)ccc2ccccc12 IOOJQTNWLJIOBG-UHFFFAOYSA-N 0.000 description 2
- SPBKJUKLBGTOSF-BQYQJAHWSA-N 1-bromo-4-[(E)-2-nitroethenyl]naphthalene Chemical compound BrC1=CC=C(C2=CC=CC=C12)\C=C\[N+](=O)[O-] SPBKJUKLBGTOSF-BQYQJAHWSA-N 0.000 description 2
- 125000004066 1-hydroxyethyl group Chemical group [H]OC([H])([*])C([H])([H])[H] 0.000 description 2
- DNCYBUMDUBHIJZ-UHFFFAOYSA-N 1h-pyrimidin-6-one Chemical class O=C1C=CN=CN1 DNCYBUMDUBHIJZ-UHFFFAOYSA-N 0.000 description 2
- RSGAYBVGRQVPPE-BQYQJAHWSA-N 2,3-dimethoxy-1-[(E)-2-nitroethenyl]naphthalene Chemical compound COC1=C(C2=CC=CC=C2C=C1OC)\C=C\[N+](=O)[O-] RSGAYBVGRQVPPE-BQYQJAHWSA-N 0.000 description 2
- XLNFIBTYAJUVOA-BQYQJAHWSA-N 2,3-dimethyl-1-[(E)-2-nitroethenyl]naphthalene Chemical compound Cc1cc2ccccc2c(\C=C\[N+]([O-])=O)c1C XLNFIBTYAJUVOA-BQYQJAHWSA-N 0.000 description 2
- AJVOUURUSYFBKV-CMDGGOBGSA-N 2,5-dimethoxy-1-[(E)-2-nitroethenyl]naphthalene Chemical compound COC1=C(C2=CC=CC(=C2C=C1)OC)\C=C\[N+](=O)[O-] AJVOUURUSYFBKV-CMDGGOBGSA-N 0.000 description 2
- BKGMGTQCFHUDHQ-UHFFFAOYSA-N 2,5-dimethoxynaphthalene-1-carbaldehyde Chemical compound COC1=C(C2=CC=CC(=C2C=C1)OC)C=O BKGMGTQCFHUDHQ-UHFFFAOYSA-N 0.000 description 2
- CEMWEZCYAKZMAY-UHFFFAOYSA-N 2-(4-bromo-2-ethoxyphenyl)acetic acid Chemical compound BrC1=CC(=C(C=C1)CC(=O)O)OCC CEMWEZCYAKZMAY-UHFFFAOYSA-N 0.000 description 2
- YWZFGVDBRFDRON-BQYQJAHWSA-N 2-bromo-1-[(E)-2-nitroethenyl]naphthalene Chemical compound [O-][N+](=O)\C=C\c1c(Br)ccc2ccccc12 YWZFGVDBRFDRON-BQYQJAHWSA-N 0.000 description 2
- YBQBWTLSROWKOJ-UHFFFAOYSA-N 3-(3-methoxythiophen-2-yl)oxetan-3-ol Chemical compound COC1=C(SC=C1)C1(COC1)O YBQBWTLSROWKOJ-UHFFFAOYSA-N 0.000 description 2
- RORUTVAAZYUSSQ-UHFFFAOYSA-N 3-(trifluoromethyl)thiophene-2-carboxylic acid Chemical compound OC(=O)C=1SC=CC=1C(F)(F)F RORUTVAAZYUSSQ-UHFFFAOYSA-N 0.000 description 2
- QAUQWUDQPYFXLX-UHFFFAOYSA-N 3-ethoxy-5-(6-methoxypyrimidin-4-yl)thiophene-2-carbonitrile Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)OC)C#N QAUQWUDQPYFXLX-UHFFFAOYSA-N 0.000 description 2
- LPUHUJFHCZVPSH-UHFFFAOYSA-N 3-ethoxy-5-[6-[2-(6-methoxyquinolin-5-yl)ethylamino]pyrimidin-4-yl]thiophene-2-carbonitrile Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=C2C=CC=NC2=CC=C1OC)C#N LPUHUJFHCZVPSH-UHFFFAOYSA-N 0.000 description 2
- VSCIFRBYEAHGSK-UHFFFAOYSA-N 3-ethoxy-N'-hydroxy-5-(6-methoxypyrimidin-4-yl)thiophene-2-carboximidamide Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)OC)C(N)=NO VSCIFRBYEAHGSK-UHFFFAOYSA-N 0.000 description 2
- XQOQAOUNBVWXQX-AATRIKPKSA-N 3-fluoro-1-[(E)-2-nitroethenyl]naphthalene Chemical compound [O-][N+](=O)\C=C\c1cc(F)cc2ccccc12 XQOQAOUNBVWXQX-AATRIKPKSA-N 0.000 description 2
- JLEXTNHKFNVKNS-VOTSOKGWSA-N 3-methoxy-1-[(E)-2-nitroethenyl]naphthalene Chemical compound COc1cc(\C=C\[N+]([O-])=O)c2ccccc2c1 JLEXTNHKFNVKNS-VOTSOKGWSA-N 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- DNSDEMIMOPEDDQ-UHFFFAOYSA-N 4-[4-ethoxy-5-(2H-tetrazol-5-yl)thiophen-2-yl]-6-methoxypyrimidine Chemical compound C(C)OC=1C=C(SC=1C1=NN=NN1)C1=NC=NC(=C1)OC DNSDEMIMOPEDDQ-UHFFFAOYSA-N 0.000 description 2
- HNZIFVCVIVUGIK-UHFFFAOYSA-N 4-bromo-1,5-dimethylindole Chemical compound CC1=CC=C2N(C)C=CC2=C1Br HNZIFVCVIVUGIK-UHFFFAOYSA-N 0.000 description 2
- SHPQUWTWPNYVGP-QPJJXVBHSA-N 4-bromo-1-methyl-7-[(E)-2-nitroethenyl]indole Chemical compound BrC1=C2C=CN(C2=C(C=C1)\C=C\[N+](=O)[O-])C SHPQUWTWPNYVGP-QPJJXVBHSA-N 0.000 description 2
- GVYNMMCVDFVCPB-UHFFFAOYSA-N 4-bromo-1-methylindole-7-carbaldehyde Chemical compound BrC1=C2C=CN(C2=C(C=C1)C=O)C GVYNMMCVDFVCPB-UHFFFAOYSA-N 0.000 description 2
- FRYQWMDMRFFGRO-UHFFFAOYSA-N 4-bromo-2-ethoxyaniline Chemical compound CCOC1=CC(Br)=CC=C1N FRYQWMDMRFFGRO-UHFFFAOYSA-N 0.000 description 2
- UYDAONQHEUSARR-UHFFFAOYSA-N 4-bromo-2-fluoro-6-propylbenzoic acid Chemical compound BrC1=CC(=C(C(=O)O)C(=C1)CCC)F UYDAONQHEUSARR-UHFFFAOYSA-N 0.000 description 2
- 102100022464 5'-nucleotidase Human genes 0.000 description 2
- OUUHNILHLKCAPG-UHFFFAOYSA-N 6-[4-ethoxy-5-(2H-tetrazol-5-yl)thiophen-2-yl]-N-[2-(6-methoxyquinolin-5-yl)ethyl]pyrimidin-4-amine Chemical compound C(C)OC=1C=C(SC=1C1=NN=NN1)C1=CC(=NC=N1)NCCC1=C2C=CC=NC2=CC=C1OC OUUHNILHLKCAPG-UHFFFAOYSA-N 0.000 description 2
- YADQRGTXIBPGHK-SOFGYWHQSA-N 6-methyl-5-[(E)-2-nitroethenyl]quinoline Chemical compound Cc1ccc2ncccc2c1\C=C\[N+]([O-])=O YADQRGTXIBPGHK-SOFGYWHQSA-N 0.000 description 2
- PUZVAJFZUVRHEB-UHFFFAOYSA-N 7-bromo-6-methoxy-1h-indole Chemical compound COC1=CC=C2C=CNC2=C1Br PUZVAJFZUVRHEB-UHFFFAOYSA-N 0.000 description 2
- JENDMJAHYUODJR-SOFGYWHQSA-N 7-methoxy-8-[(E)-2-nitroethenyl]quinoline Chemical compound COC1=CC=C2C=CC=NC2=C1\C=C\[N+](=O)[O-] JENDMJAHYUODJR-SOFGYWHQSA-N 0.000 description 2
- BRYUSMOTMZPNDV-UHFFFAOYSA-N 8-fluoro-1-hydroxy-5-methoxynaphthalene-2-carbaldehyde Chemical compound O=CC1=CC=C2C(OC)=CC=C(F)C2=C1O BRYUSMOTMZPNDV-UHFFFAOYSA-N 0.000 description 2
- ZKLOBRDZUOFVJQ-UHFFFAOYSA-N 8-fluoro-1-hydroxy-5-methoxynaphthalene-2-carbonitrile Chemical compound FC=1C=CC(=C2C=CC(=C(C=12)O)C#N)OC ZKLOBRDZUOFVJQ-UHFFFAOYSA-N 0.000 description 2
- 102000009346 Adenosine receptors Human genes 0.000 description 2
- 108050000203 Adenosine receptors Proteins 0.000 description 2
- 101710137189 Amyloid-beta A4 protein Proteins 0.000 description 2
- 102100022704 Amyloid-beta precursor protein Human genes 0.000 description 2
- 101710151993 Amyloid-beta precursor protein Proteins 0.000 description 2
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 2
- 108010074708 B7-H1 Antigen Proteins 0.000 description 2
- 102000008096 B7-H1 Antigen Human genes 0.000 description 2
- MLDQJTXFUGDVEO-UHFFFAOYSA-N BAY-43-9006 Chemical compound C1=NC(C(=O)NC)=CC(OC=2C=CC(NC(=O)NC=3C=C(C(Cl)=CC=3)C(F)(F)F)=CC=2)=C1 MLDQJTXFUGDVEO-UHFFFAOYSA-N 0.000 description 2
- PZLJCTAKFWJHHS-UHFFFAOYSA-N BrC1=CC(=C(C=C1)C1=NOC(N1)=O)OCC Chemical compound BrC1=CC(=C(C=C1)C1=NOC(N1)=O)OCC PZLJCTAKFWJHHS-UHFFFAOYSA-N 0.000 description 2
- VITVMGHYLOGXEF-UHFFFAOYSA-N C(C)OC=1C=C(SC=1C1=NN=NN1)C1=CC(=NC=N1)O Chemical compound C(C)OC=1C=C(SC=1C1=NN=NN1)C1=CC(=NC=N1)O VITVMGHYLOGXEF-UHFFFAOYSA-N 0.000 description 2
- NWKMQUUGEYZBEG-UHFFFAOYSA-N CCOC(CC(C=C1)(N)Br)=C1C(C=C1)=CC=C1NO Chemical compound CCOC(CC(C=C1)(N)Br)=C1C(C=C1)=CC=C1NO NWKMQUUGEYZBEG-UHFFFAOYSA-N 0.000 description 2
- 229940124638 COX inhibitor Drugs 0.000 description 2
- GAGWJHPBXLXJQN-UORFTKCHSA-N Capecitabine Chemical compound C1=C(F)C(NC(=O)OCCCCC)=NC(=O)N1[C@H]1[C@H](O)[C@H](O)[C@@H](C)O1 GAGWJHPBXLXJQN-UORFTKCHSA-N 0.000 description 2
- GAGWJHPBXLXJQN-UHFFFAOYSA-N Capecitabine Natural products C1=C(F)C(NC(=O)OCCCCC)=NC(=O)N1C1C(O)C(O)C(C)O1 GAGWJHPBXLXJQN-UHFFFAOYSA-N 0.000 description 2
- 201000009030 Carcinoma Diseases 0.000 description 2
- DLGOEMSEDOSKAD-UHFFFAOYSA-N Carmustine Chemical compound ClCCNC(=O)N(N=O)CCCl DLGOEMSEDOSKAD-UHFFFAOYSA-N 0.000 description 2
- 108010019670 Chimeric Antigen Receptors Proteins 0.000 description 2
- 101000862089 Clarkia lewisii Glucose-6-phosphate isomerase, cytosolic 1A Proteins 0.000 description 2
- 102100039498 Cytotoxic T-lymphocyte protein 4 Human genes 0.000 description 2
- 102000009058 Death Domain Receptors Human genes 0.000 description 2
- 108010049207 Death Domain Receptors Proteins 0.000 description 2
- AOJJSUZBOXZQNB-TZSSRYMLSA-N Doxorubicin Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(=O)CO)[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 AOJJSUZBOXZQNB-TZSSRYMLSA-N 0.000 description 2
- 102100029722 Ectonucleoside triphosphate diphosphohydrolase 1 Human genes 0.000 description 2
- 102000003688 G-Protein-Coupled Receptors Human genes 0.000 description 2
- 108090000045 G-Protein-Coupled Receptors Proteins 0.000 description 2
- 239000004471 Glycine Substances 0.000 description 2
- 102100029100 Hematopoietic prostaglandin D synthase Human genes 0.000 description 2
- 101000678236 Homo sapiens 5'-nucleotidase Proteins 0.000 description 2
- 101000919849 Homo sapiens Cytochrome c oxidase subunit 1 Proteins 0.000 description 2
- 101000889276 Homo sapiens Cytotoxic T-lymphocyte protein 4 Proteins 0.000 description 2
- 101001012447 Homo sapiens Ectonucleoside triphosphate diphosphohydrolase 1 Proteins 0.000 description 2
- 101000988802 Homo sapiens Hematopoietic prostaglandin D synthase Proteins 0.000 description 2
- 101000605122 Homo sapiens Prostaglandin G/H synthase 1 Proteins 0.000 description 2
- 206010062016 Immunosuppression Diseases 0.000 description 2
- 102000003996 Interferon-beta Human genes 0.000 description 2
- 102000008070 Interferon-gamma Human genes 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 102000002698 KIR Receptors Human genes 0.000 description 2
- 108010043610 KIR Receptors Proteins 0.000 description 2
- FBOZXECLQNJBKD-ZDUSSCGKSA-N L-methotrexate Chemical compound C=1N=C2N=C(N)N=C(N)C2=NC=1CN(C)C1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 FBOZXECLQNJBKD-ZDUSSCGKSA-N 0.000 description 2
- 239000005511 L01XE05 - Sorafenib Substances 0.000 description 2
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 2
- 210000004322 M2 macrophage Anatomy 0.000 description 2
- 102000043136 MAP kinase family Human genes 0.000 description 2
- 108091054455 MAP kinase family Proteins 0.000 description 2
- 206010027406 Mesothelioma Diseases 0.000 description 2
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 2
- PGBFYLVIMDQYMS-UHFFFAOYSA-N Methyl thiophene-2-carboxylate Chemical compound COC(=O)C1=CC=CS1 PGBFYLVIMDQYMS-UHFFFAOYSA-N 0.000 description 2
- NWIBSHFKIJFRCO-WUDYKRTCSA-N Mytomycin Chemical compound C1N2C(C(C(C)=C(N)C3=O)=O)=C3[C@@H](COC(N)=O)[C@@]2(OC)[C@@H]2[C@H]1N2 NWIBSHFKIJFRCO-WUDYKRTCSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 description 2
- 102100040678 Programmed cell death protein 1 Human genes 0.000 description 2
- 101710089372 Programmed cell death protein 1 Proteins 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 2
- 102000008866 Prostaglandin E receptors Human genes 0.000 description 2
- 108010088540 Prostaglandin E receptors Proteins 0.000 description 2
- 102100024447 Prostaglandin E2 receptor EP3 subtype Human genes 0.000 description 2
- 102100038277 Prostaglandin G/H synthase 1 Human genes 0.000 description 2
- 108090000459 Prostaglandin-endoperoxide synthases Proteins 0.000 description 2
- 102000004005 Prostaglandin-endoperoxide synthases Human genes 0.000 description 2
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
- 206010039491 Sarcoma Diseases 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- 229940126547 T-cell immunoglobulin mucin-3 Drugs 0.000 description 2
- 101710136122 Tryptophan 2,3-dioxygenase Proteins 0.000 description 2
- 102000057288 Tryptophan 2,3-dioxygenases Human genes 0.000 description 2
- 108060008682 Tumor Necrosis Factor Proteins 0.000 description 2
- 108060008683 Tumor Necrosis Factor Receptor Proteins 0.000 description 2
- 102100040247 Tumor necrosis factor Human genes 0.000 description 2
- 102100022153 Tumor necrosis factor receptor superfamily member 4 Human genes 0.000 description 2
- 240000001717 Vaccinium macrocarpon Species 0.000 description 2
- JXLYSJRDGCGARV-WWYNWVTFSA-N Vinblastine Natural products O=C(O[C@H]1[C@](O)(C(=O)OC)[C@@H]2N(C)c3c(cc(c(OC)c3)[C@]3(C(=O)OC)c4[nH]c5c(c4CCN4C[C@](O)(CC)C[C@H](C3)C4)cccc5)[C@@]32[C@H]2[C@@]1(CC)C=CCN2CC3)C JXLYSJRDGCGARV-WWYNWVTFSA-N 0.000 description 2
- OJASFSDWNBWIRU-GQCTYLIASA-N [O-][N+](=O)\C=C\c1cccc2sccc12 Chemical compound [O-][N+](=O)\C=C\c1cccc2sccc12 OJASFSDWNBWIRU-GQCTYLIASA-N 0.000 description 2
- 229960001138 acetylsalicylic acid Drugs 0.000 description 2
- RJURFGZVJUQBHK-UHFFFAOYSA-N actinomycin D Natural products CC1OC(=O)C(C(C)C)N(C)C(=O)CN(C)C(=O)C2CCCN2C(=O)C(C(C)C)NC(=O)C1NC(=O)C1=C(N)C(=O)C(C)=C2OC(C(C)=CC=C3C(=O)NC4C(=O)NC(C(N5CCCC5C(=O)N(C)CC(=O)N(C)C(C(C)C)C(=O)OC4C)=O)C(C)C)=C3N=C21 RJURFGZVJUQBHK-UHFFFAOYSA-N 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 230000000996 additive effect Effects 0.000 description 2
- 108060000200 adenylate cyclase Proteins 0.000 description 2
- 102000030621 adenylate cyclase Human genes 0.000 description 2
- 238000011226 adjuvant chemotherapy Methods 0.000 description 2
- 238000009098 adjuvant therapy Methods 0.000 description 2
- 229940100198 alkylating agent Drugs 0.000 description 2
- 239000002168 alkylating agent Substances 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- DZHSAHHDTRWUTF-SIQRNXPUSA-N amyloid-beta polypeptide 42 Chemical compound C([C@@H](C(=O)N[C@@H](C)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@H](C(=O)NCC(=O)N[C@@H](CO)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CCCCN)C(=O)NCC(=O)N[C@@H](C)C(=O)N[C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](C(C)C)C(=O)NCC(=O)NCC(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](C)C(O)=O)[C@@H](C)CC)C(C)C)NC(=O)[C@H](CC=1C=CC=CC=1)NC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CC=1N=CNC=1)NC(=O)[C@H](CC=1N=CNC=1)NC(=O)[C@@H](NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)CNC(=O)[C@H](CO)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC=1N=CNC=1)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CC=1C=CC=CC=1)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](C)NC(=O)[C@@H](N)CC(O)=O)C(C)C)C(C)C)C1=CC=CC=C1 DZHSAHHDTRWUTF-SIQRNXPUSA-N 0.000 description 2
- 239000000427 antigen Substances 0.000 description 2
- 102000036639 antigens Human genes 0.000 description 2
- 108091007433 antigens Proteins 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- VSRXQHXAPYXROS-UHFFFAOYSA-N azanide;cyclobutane-1,1-dicarboxylic acid;platinum(2+) Chemical compound [NH2-].[NH2-].[Pt+2].OC(=O)C1(C(O)=O)CCC1 VSRXQHXAPYXROS-UHFFFAOYSA-N 0.000 description 2
- 125000004566 azetidin-1-yl group Chemical group N1(CCC1)* 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- 229940050390 benzoate Drugs 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 210000004369 blood Anatomy 0.000 description 2
- 239000008280 blood Substances 0.000 description 2
- 210000004204 blood vessel Anatomy 0.000 description 2
- 210000001185 bone marrow Anatomy 0.000 description 2
- 230000005587 bubbling Effects 0.000 description 2
- 229960004117 capecitabine Drugs 0.000 description 2
- 229960004562 carboplatin Drugs 0.000 description 2
- 125000002843 carboxylic acid group Chemical group 0.000 description 2
- 229960005243 carmustine Drugs 0.000 description 2
- 229960004316 cisplatin Drugs 0.000 description 2
- DQLATGHUWYMOKM-UHFFFAOYSA-L cisplatin Chemical compound N[Pt](N)(Cl)Cl DQLATGHUWYMOKM-UHFFFAOYSA-L 0.000 description 2
- BSMCAPRUBJMWDF-KRWDZBQOSA-N cobimetinib Chemical compound C1C(O)([C@H]2NCCCC2)CN1C(=O)C1=CC=C(F)C(F)=C1NC1=CC=C(I)C=C1F BSMCAPRUBJMWDF-KRWDZBQOSA-N 0.000 description 2
- 210000001072 colon Anatomy 0.000 description 2
- 238000009096 combination chemotherapy Methods 0.000 description 2
- 238000011441 consolidation chemotherapy Methods 0.000 description 2
- BERDEBHAJNAUOM-UHFFFAOYSA-N copper(i) oxide Chemical compound [Cu]O[Cu] BERDEBHAJNAUOM-UHFFFAOYSA-N 0.000 description 2
- 230000008878 coupling Effects 0.000 description 2
- 238000010168 coupling process Methods 0.000 description 2
- 238000005859 coupling reaction Methods 0.000 description 2
- 230000016396 cytokine production Effects 0.000 description 2
- 230000001086 cytosolic effect Effects 0.000 description 2
- 238000011161 development Methods 0.000 description 2
- 230000018109 developmental process Effects 0.000 description 2
- 239000003937 drug carrier Substances 0.000 description 2
- 230000002526 effect on cardiovascular system Effects 0.000 description 2
- 229940056913 eftilagimod alfa Drugs 0.000 description 2
- 210000005168 endometrial cell Anatomy 0.000 description 2
- 210000004696 endometrium Anatomy 0.000 description 2
- 210000002889 endothelial cell Anatomy 0.000 description 2
- 230000002708 enhancing effect Effects 0.000 description 2
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 2
- WQJQSIOFHZWEQD-UHFFFAOYSA-N ethyl 2-(4-bromo-2-ethoxyphenyl)acetate Chemical compound BrC1=CC(=C(C=C1)CC(=O)OCC)OCC WQJQSIOFHZWEQD-UHFFFAOYSA-N 0.000 description 2
- 239000012467 final product Substances 0.000 description 2
- 238000003818 flash chromatography Methods 0.000 description 2
- QEWYKACRFQMRMB-UHFFFAOYSA-N fluoroacetic acid Chemical compound OC(=O)CF QEWYKACRFQMRMB-UHFFFAOYSA-N 0.000 description 2
- 229960002949 fluorouracil Drugs 0.000 description 2
- 239000006260 foam Substances 0.000 description 2
- 235000019152 folic acid Nutrition 0.000 description 2
- 239000011724 folic acid Substances 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 230000006870 function Effects 0.000 description 2
- 230000012010 growth Effects 0.000 description 2
- 230000035876 healing Effects 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 229960001101 ifosfamide Drugs 0.000 description 2
- HOMGKSMUEGBAAB-UHFFFAOYSA-N ifosfamide Chemical compound ClCCNP1(=O)OCCCN1CCCl HOMGKSMUEGBAAB-UHFFFAOYSA-N 0.000 description 2
- 125000000336 imidazol-5-yl group Chemical group [H]N1C([H])=NC([H])=C1[*] 0.000 description 2
- 230000002519 immonomodulatory effect Effects 0.000 description 2
- 230000001506 immunosuppresive effect Effects 0.000 description 2
- 210000005008 immunosuppressive cell Anatomy 0.000 description 2
- 125000002249 indol-2-yl group Chemical group [H]C1=C([H])C([H])=C2N([H])C([*])=C([H])C2=C1[H] 0.000 description 2
- KMAKOBLIOCQGJP-UHFFFAOYSA-N indole-3-carboxylic acid Chemical compound C1=CC=C2C(C(=O)O)=CNC2=C1 KMAKOBLIOCQGJP-UHFFFAOYSA-N 0.000 description 2
- 102000006639 indoleamine 2,3-dioxygenase Human genes 0.000 description 2
- 108020004201 indoleamine 2,3-dioxygenase Proteins 0.000 description 2
- 230000004054 inflammatory process Effects 0.000 description 2
- 229960003130 interferon gamma Drugs 0.000 description 2
- 229960001388 interferon-beta Drugs 0.000 description 2
- UWKQSNNFCGGAFS-XIFFEERXSA-N irinotecan Chemical compound C1=C2C(CC)=C3CN(C(C4=C([C@@](C(=O)OC4)(O)CC)C=4)=O)C=4C3=NC2=CC=C1OC(=O)N(CC1)CCC1N1CCCCC1 UWKQSNNFCGGAFS-XIFFEERXSA-N 0.000 description 2
- 229960004768 irinotecan Drugs 0.000 description 2
- 125000001977 isobenzofuranyl group Chemical group C=1(OC=C2C=CC=CC12)* 0.000 description 2
- 125000000904 isoindolyl group Chemical group C=1(NC=C2C=CC=CC12)* 0.000 description 2
- 150000002632 lipids Chemical class 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 238000012423 maintenance Methods 0.000 description 2
- 230000014759 maintenance of location Effects 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 239000011159 matrix material Substances 0.000 description 2
- 230000007246 mechanism Effects 0.000 description 2
- 229960004961 mechlorethamine Drugs 0.000 description 2
- HAWPXGHAZFHHAD-UHFFFAOYSA-N mechlorethamine Chemical compound ClCCN(C)CCCl HAWPXGHAZFHHAD-UHFFFAOYSA-N 0.000 description 2
- 239000002609 medium Substances 0.000 description 2
- SGDBTWWWUNNDEQ-LBPRGKRZSA-N melphalan Chemical compound OC(=O)[C@@H](N)CC1=CC=C(N(CCCl)CCCl)C=C1 SGDBTWWWUNNDEQ-LBPRGKRZSA-N 0.000 description 2
- 229960001924 melphalan Drugs 0.000 description 2
- GLVAUDGFNGKCSF-UHFFFAOYSA-N mercaptopurine Chemical compound S=C1NC=NC2=C1NC=N2 GLVAUDGFNGKCSF-UHFFFAOYSA-N 0.000 description 2
- 230000009401 metastasis Effects 0.000 description 2
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 2
- 229960000485 methotrexate Drugs 0.000 description 2
- YJLVEWVNFFFEAF-UHFFFAOYSA-N methyl 4-bromo-2-methylsulfanylbenzoate Chemical compound BrC1=CC(=C(C(=O)OC)C=C1)SC YJLVEWVNFFFEAF-UHFFFAOYSA-N 0.000 description 2
- 125000006533 methyl amino methyl group Chemical group [H]N(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 230000000394 mitotic effect Effects 0.000 description 2
- 239000002808 molecular sieve Substances 0.000 description 2
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 2
- 150000002828 nitro derivatives Chemical class 0.000 description 2
- 229940021182 non-steroidal anti-inflammatory drug Drugs 0.000 description 2
- 238000007339 nucleophilic aromatic substitution reaction Methods 0.000 description 2
- 210000002997 osteoclast Anatomy 0.000 description 2
- DWAFYCQODLXJNR-BNTLRKBRSA-L oxaliplatin Chemical compound O1C(=O)C(=O)O[Pt]11N[C@@H]2CCCC[C@H]2N1 DWAFYCQODLXJNR-BNTLRKBRSA-L 0.000 description 2
- 229960001756 oxaliplatin Drugs 0.000 description 2
- MUJIDPITZJWBSW-UHFFFAOYSA-N palladium(2+) Chemical compound [Pd+2] MUJIDPITZJWBSW-UHFFFAOYSA-N 0.000 description 2
- 230000036961 partial effect Effects 0.000 description 2
- WBXPDJSOTKVWSJ-ZDUSSCGKSA-N pemetrexed Chemical compound C=1NC=2NC(N)=NC(=O)C=2C=1CCC1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 WBXPDJSOTKVWSJ-ZDUSSCGKSA-N 0.000 description 2
- 229960005079 pemetrexed Drugs 0.000 description 2
- 125000004592 phthalazinyl group Chemical group C1(=NN=CC2=CC=CC=C12)* 0.000 description 2
- 229950010773 pidilizumab Drugs 0.000 description 2
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 2
- 229910052697 platinum Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 230000008569 process Effects 0.000 description 2
- 108090000765 processed proteins & peptides Proteins 0.000 description 2
- 230000001737 promoting effect Effects 0.000 description 2
- BHMBVRSPMRCCGG-OUTUXVNYSA-N prostaglandin D2 Chemical compound CCCCC[C@H](O)\C=C\[C@@H]1[C@@H](C\C=C/CCCC(O)=O)[C@@H](O)CC1=O BHMBVRSPMRCCGG-OUTUXVNYSA-N 0.000 description 2
- BHMBVRSPMRCCGG-UHFFFAOYSA-N prostaglandine D2 Natural products CCCCCC(O)C=CC1C(CC=CCCCC(O)=O)C(O)CC1=O BHMBVRSPMRCCGG-UHFFFAOYSA-N 0.000 description 2
- 125000000246 pyrimidin-2-yl group Chemical group [H]C1=NC(*)=NC([H])=C1[H] 0.000 description 2
- 125000000168 pyrrolyl group Chemical group 0.000 description 2
- 230000005855 radiation Effects 0.000 description 2
- 229940044551 receptor antagonist Drugs 0.000 description 2
- 239000002464 receptor antagonist Substances 0.000 description 2
- 230000004044 response Effects 0.000 description 2
- 201000009410 rhabdomyosarcoma Diseases 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- 150000003384 small molecules Chemical class 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229960003787 sorafenib Drugs 0.000 description 2
- 230000004936 stimulating effect Effects 0.000 description 2
- 210000002536 stromal cell Anatomy 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 125000004434 sulfur atom Chemical group 0.000 description 2
- JSLRDMSXVULWPZ-UHFFFAOYSA-N tert-butyl N-[2-(1,5-dimethylindol-4-yl)ethyl]carbamate Chemical compound CN1C=CC2=C(C(=CC=C12)C)CCNC(OC(C)(C)C)=O JSLRDMSXVULWPZ-UHFFFAOYSA-N 0.000 description 2
- 238000004809 thin layer chromatography Methods 0.000 description 2
- DSNBHJFQCNUKMA-SCKDECHMSA-N thromboxane A2 Chemical compound OC(=O)CCC\C=C/C[C@@H]1[C@@H](/C=C/[C@@H](O)CCCCC)O[C@@H]2O[C@H]1C2 DSNBHJFQCNUKMA-SCKDECHMSA-N 0.000 description 2
- 230000000699 topical effect Effects 0.000 description 2
- ONDSBJMLAHVLMI-UHFFFAOYSA-N trimethylsilyldiazomethane Chemical compound C[Si](C)(C)[CH-][N+]#N ONDSBJMLAHVLMI-UHFFFAOYSA-N 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 2
- 230000005747 tumor angiogenesis Effects 0.000 description 2
- 229940030325 tumor cell vaccine Drugs 0.000 description 2
- 230000005740 tumor formation Effects 0.000 description 2
- 102000003298 tumor necrosis factor receptor Human genes 0.000 description 2
- 229950005972 urelumab Drugs 0.000 description 2
- 229960005486 vaccine Drugs 0.000 description 2
- 229960003048 vinblastine Drugs 0.000 description 2
- JXLYSJRDGCGARV-XQKSVPLYSA-N vincaleukoblastine Chemical compound C([C@@H](C[C@]1(C(=O)OC)C=2C(=CC3=C([C@]45[C@H]([C@@]([C@H](OC(C)=O)[C@]6(CC)C=CCN([C@H]56)CC4)(O)C(=O)OC)N3C)C=2)OC)C[C@@](C2)(O)CC)N2CCC2=C1NC1=CC=CC=C21 JXLYSJRDGCGARV-XQKSVPLYSA-N 0.000 description 2
- OGWKCGZFUXNPDA-XQKSVPLYSA-N vincristine Chemical compound C([N@]1C[C@@H](C[C@]2(C(=O)OC)C=3C(=CC4=C([C@]56[C@H]([C@@]([C@H](OC(C)=O)[C@]7(CC)C=CCN([C@H]67)CC5)(O)C(=O)OC)N4C=O)C=3)OC)C[C@@](C1)(O)CC)CC1=C2NC2=CC=CC=C12 OGWKCGZFUXNPDA-XQKSVPLYSA-N 0.000 description 2
- 229960004528 vincristine Drugs 0.000 description 2
- OGWKCGZFUXNPDA-UHFFFAOYSA-N vincristine Natural products C1C(CC)(O)CC(CC2(C(=O)OC)C=3C(=CC4=C(C56C(C(C(OC(C)=O)C7(CC)C=CCN(C67)CC5)(O)C(=O)OC)N4C=O)C=3)OC)CN1CCC1=C2NC2=CC=CC=C12 OGWKCGZFUXNPDA-UHFFFAOYSA-N 0.000 description 2
- MNKCGUKVRJZKEQ-MIXQCLKLSA-N (1z,5z)-cycloocta-1,5-diene;iridium;methanol Chemical compound [Ir].[Ir].OC.OC.C\1C\C=C/CC\C=C/1.C\1C\C=C/CC\C=C/1 MNKCGUKVRJZKEQ-MIXQCLKLSA-N 0.000 description 1
- GJBNKBIBEAIXNJ-UHFFFAOYSA-N (2-cyano-8-fluoro-5-methoxynaphthalen-1-yl) trifluoromethanesulfonate Chemical compound FC(S(=O)(=O)OC1=C(C=CC2=C(C=CC(=C12)F)OC)C#N)(F)F GJBNKBIBEAIXNJ-UHFFFAOYSA-N 0.000 description 1
- UQURMYGWEOWWLQ-SREVYHEPSA-N (2Z)-8-fluoro-2-(hydroxymethylidene)-5-methoxy-3,4-dihydronaphthalen-1-one Chemical compound O=C1\C(=C/O)CCC2=C1C(F)=CC=C2OC UQURMYGWEOWWLQ-SREVYHEPSA-N 0.000 description 1
- ZADWXFSZEAPBJS-SNVBAGLBSA-N (2r)-2-amino-3-(1-methylindol-3-yl)propanoic acid Chemical compound C1=CC=C2N(C)C=C(C[C@@H](N)C(O)=O)C2=C1 ZADWXFSZEAPBJS-SNVBAGLBSA-N 0.000 description 1
- YPBKTZBXSBLTDK-PKNBQFBNSA-N (3e)-3-[(3-bromo-4-fluoroanilino)-nitrosomethylidene]-4-[2-(sulfamoylamino)ethylamino]-1,2,5-oxadiazole Chemical compound NS(=O)(=O)NCCNC1=NON\C1=C(N=O)/NC1=CC=C(F)C(Br)=C1 YPBKTZBXSBLTDK-PKNBQFBNSA-N 0.000 description 1
- SSOORFWOBGFTHL-OTEJMHTDSA-N (4S)-5-[[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2S)-6-amino-1-[[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2S)-1-[[2-[(2S)-2-[[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2S)-6-amino-1-[[(2S)-1-[[(2S)-1-[[(2S,3S)-1-[[(2S)-1-[[(2S)-1-[[(2S)-6-amino-1-[[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2S)-5-amino-1-[[(2S)-1-[[(2S)-1-[[(2S)-6-amino-1-[[(2S)-6-amino-1-[[(2S)-1-[[(2S)-1-[[(2S)-5-amino-1-[[(2S)-5-carbamimidamido-1-[[(2S)-5-carbamimidamido-1-[[(1S)-4-carbamimidamido-1-carboxybutyl]amino]-1-oxopentan-2-yl]amino]-1-oxopentan-2-yl]amino]-1,5-dioxopentan-2-yl]amino]-5-carbamimidamido-1-oxopentan-2-yl]amino]-5-carbamimidamido-1-oxopentan-2-yl]amino]-1-oxohexan-2-yl]amino]-1-oxohexan-2-yl]amino]-5-carbamimidamido-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-1,5-dioxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]amino]-1-oxohexan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]amino]-3-methyl-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-5-carbamimidamido-1-oxopentan-2-yl]amino]-1-oxohexan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-5-carbamimidamido-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-1-oxopropan-2-yl]amino]-5-carbamimidamido-1-oxopentan-2-yl]carbamoyl]pyrrolidin-1-yl]-2-oxoethyl]amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]amino]-5-carbamimidamido-1-oxopentan-2-yl]amino]-1-oxohexan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-5-carbamimidamido-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]amino]-3-(1H-imidazol-4-yl)-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-4-[[(2S)-2-[[(2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]-3-methylbutanoyl]amino]propanoyl]amino]-5-oxopentanoic acid Chemical compound CC[C@H](C)[C@H](NC(=O)[C@@H](NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](C)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@@H]1CCCN1C(=O)CNC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](C)NC(=O)[C@@H](NC(=O)[C@@H](N)CCCCN)C(C)C)C(C)C)C(C)C)C(C)C)C(C)C)C(C)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C)C(=O)N[C@@H](CO)C(=O)N[C@@H](CO)C(=O)N[C@@H](CO)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCCNC(N)=N)C(O)=O SSOORFWOBGFTHL-OTEJMHTDSA-N 0.000 description 1
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 description 1
- PXGPLTODNUVGFL-BRIYLRKRSA-N (E,Z)-(1R,2R,3R,5S)-7-(3,5-Dihydroxy-2-((3S)-(3-hydroxy-1-octenyl))cyclopentyl)-5-heptenoic acid Chemical compound CCCCC[C@H](O)C=C[C@H]1[C@H](O)C[C@H](O)[C@@H]1CC=CCCCC(O)=O PXGPLTODNUVGFL-BRIYLRKRSA-N 0.000 description 1
- MOWXJLUYGFNTAL-DEOSSOPVSA-N (s)-[2-chloro-4-fluoro-5-(7-morpholin-4-ylquinazolin-4-yl)phenyl]-(6-methoxypyridazin-3-yl)methanol Chemical compound N1=NC(OC)=CC=C1[C@@H](O)C1=CC(C=2C3=CC=C(C=C3N=CN=2)N2CCOCC2)=C(F)C=C1Cl MOWXJLUYGFNTAL-DEOSSOPVSA-N 0.000 description 1
- 125000004605 1,2,3,4-tetrahydroisoquinolinyl group Chemical group C1(NCCC2=CC=CC=C12)* 0.000 description 1
- PWSOBOYWXQCFLW-UHFFFAOYSA-N 1,2,3-trimethylindole-7-carbaldehyde Chemical compound C1=CC(C=O)=C2N(C)C(C)=C(C)C2=C1 PWSOBOYWXQCFLW-UHFFFAOYSA-N 0.000 description 1
- PQBOTZNYFQWRHU-UHFFFAOYSA-N 1,2-dichlorobutane Chemical compound CCC(Cl)CCl PQBOTZNYFQWRHU-UHFFFAOYSA-N 0.000 description 1
- CRXBTDWNHVBEIC-UHFFFAOYSA-N 1,2-dimethyl-9h-fluorene Chemical compound C1=CC=C2CC3=C(C)C(C)=CC=C3C2=C1 CRXBTDWNHVBEIC-UHFFFAOYSA-N 0.000 description 1
- GTBOUNPVPXFKLE-UHFFFAOYSA-N 1,2-dimethylindole-7-carbaldehyde Chemical compound C1=CC(C=O)=C2N(C)C(C)=CC2=C1 GTBOUNPVPXFKLE-UHFFFAOYSA-N 0.000 description 1
- FTNJQNQLEGKTGD-UHFFFAOYSA-N 1,3-benzodioxole Chemical compound C1=CC=C2OCOC2=C1 FTNJQNQLEGKTGD-UHFFFAOYSA-N 0.000 description 1
- TYLPQEIDYXVIPY-UHFFFAOYSA-N 1,5-dimethylindazole Chemical compound CC1=CC=C2N(C)N=CC2=C1 TYLPQEIDYXVIPY-UHFFFAOYSA-N 0.000 description 1
- RBUFUWIWCCOVOS-UHFFFAOYSA-N 1,6-dimethoxynaphthalene Chemical compound COC1=CC=CC2=CC(OC)=CC=C21 RBUFUWIWCCOVOS-UHFFFAOYSA-N 0.000 description 1
- KIKXHNJMDGVFGV-UHFFFAOYSA-N 1-[2-[(6-chloropyrimidin-4-yl)amino]ethyl]-8-fluoro-5-methoxynaphthalene-2-carbonitrile Chemical compound ClC1=CC(=NC=N1)NCCC1=C(C=CC2=C(C=CC(=C12)F)OC)C#N KIKXHNJMDGVFGV-UHFFFAOYSA-N 0.000 description 1
- SVXSQCKDNSDDGU-UHFFFAOYSA-N 1-[2-[(6-chloropyrimidin-4-yl)amino]ethyl]naphthalene-2-carbonitrile Chemical compound ClC1=CC(=NC=N1)NCCC1=C(C=CC2=CC=CC=C12)C#N SVXSQCKDNSDDGU-UHFFFAOYSA-N 0.000 description 1
- WTCQKBKVLYOTFC-UHFFFAOYSA-N 1-benzothiophene-4-carbaldehyde Chemical compound O=CC1=CC=CC2=C1C=CS2 WTCQKBKVLYOTFC-UHFFFAOYSA-N 0.000 description 1
- ZYBZDDMAAQTLEV-UHFFFAOYSA-N 1-bromo-5-fluoronaphthalene Chemical compound C1=CC=C2C(F)=CC=CC2=C1Br ZYBZDDMAAQTLEV-UHFFFAOYSA-N 0.000 description 1
- QFRWNUJVZXCUJG-UHFFFAOYSA-N 1-bromo-5-methylnaphthalene Chemical compound C1=CC=C2C(C)=CC=CC2=C1Br QFRWNUJVZXCUJG-UHFFFAOYSA-N 0.000 description 1
- WENXBAFANCRIGK-UHFFFAOYSA-N 1-bromonaphthalen-2-amine Chemical compound C1=CC=CC2=C(Br)C(N)=CC=C21 WENXBAFANCRIGK-UHFFFAOYSA-N 0.000 description 1
- KNYICIQRDGHINZ-UHFFFAOYSA-N 1-bromonaphthalene-2-carbonitrile Chemical compound C1=CC=C2C(Br)=C(C#N)C=CC2=C1 KNYICIQRDGHINZ-UHFFFAOYSA-N 0.000 description 1
- 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- BAXOFTOLAUCFNW-UHFFFAOYSA-N 1H-indazole Chemical compound C1=CC=C2C=NNC2=C1 BAXOFTOLAUCFNW-UHFFFAOYSA-N 0.000 description 1
- 125000004206 2,2,2-trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 1
- 125000004778 2,2-difluoroethyl group Chemical group [H]C([H])(*)C([H])(F)F 0.000 description 1
- HZNVUJQVZSTENZ-UHFFFAOYSA-N 2,3-dichloro-5,6-dicyano-p-benzoquinone Substances ClC1=C(Cl)C(=O)C(C#N)=C(C#N)C1=O HZNVUJQVZSTENZ-UHFFFAOYSA-N 0.000 description 1
- KGLPWQKSKUVKMJ-UHFFFAOYSA-N 2,3-dihydrophthalazine-1,4-dione Chemical compound C1=CC=C2C(=O)NNC(=O)C2=C1 KGLPWQKSKUVKMJ-UHFFFAOYSA-N 0.000 description 1
- VTUMHIXLEZHVEJ-UHFFFAOYSA-N 2,3-dimethoxynaphthalene-1-carbaldehyde Chemical compound C1=CC=C2C(C=O)=C(OC)C(OC)=CC2=C1 VTUMHIXLEZHVEJ-UHFFFAOYSA-N 0.000 description 1
- KCKAGGPNSPNAOR-UHFFFAOYSA-N 2,3-dimethylnaphthalene-1-carbaldehyde Chemical compound C1=CC=C2C(C=O)=C(C)C(C)=CC2=C1 KCKAGGPNSPNAOR-UHFFFAOYSA-N 0.000 description 1
- OQPTYNSVFRAORE-UHFFFAOYSA-N 2-(1,5-dimethylindazol-4-yl)ethanamine hydrochloride Chemical compound Cl.Cc1ccc2n(C)ncc2c1CCN OQPTYNSVFRAORE-UHFFFAOYSA-N 0.000 description 1
- UEJJHQNACJXSKW-UHFFFAOYSA-N 2-(2,6-dioxopiperidin-3-yl)-1H-isoindole-1,3(2H)-dione Chemical class O=C1C2=CC=CC=C2C(=O)N1C1CCC(=O)NC1=O UEJJHQNACJXSKW-UHFFFAOYSA-N 0.000 description 1
- GTXFWHPKTBZAON-UHFFFAOYSA-N 2-(2-bromonaphthalen-1-yl)ethanamine Chemical compound BrC1=C(C2=CC=CC=C2C=C1)CCN GTXFWHPKTBZAON-UHFFFAOYSA-N 0.000 description 1
- GIJMGBHHZPLOHP-UHFFFAOYSA-N 2-(4-bromo-2-hydroxyphenyl)acetic acid Chemical compound OC(=O)CC1=CC=C(Br)C=C1O GIJMGBHHZPLOHP-UHFFFAOYSA-N 0.000 description 1
- FRSOJYLDZKSOKP-UHFFFAOYSA-N 2-(5-ethoxy-1,3-benzodioxol-4-yl)ethanamine Chemical compound C(C)OC1=C(C2=C(OCO2)C=C1)CCN FRSOJYLDZKSOKP-UHFFFAOYSA-N 0.000 description 1
- PISNJOHPXZOJRD-UHFFFAOYSA-N 2-(5-ethoxy-1-benzothiophen-4-yl)ethanamine hydrochloride Chemical compound Cl.CCOc1ccc2sccc2c1CCN PISNJOHPXZOJRD-UHFFFAOYSA-N 0.000 description 1
- KBPFCQSEUBUWLE-UHFFFAOYSA-N 2-(5-methoxy-1,3-benzodioxol-4-yl)ethanamine Chemical compound COC1=CC=C2OCOC2=C1CCN KBPFCQSEUBUWLE-UHFFFAOYSA-N 0.000 description 1
- WPEKAUYAJKQPEB-UHFFFAOYSA-N 2-(5-methoxy-1-methylindol-4-yl)ethanamine hydrochloride Chemical compound Cl.COc1ccc2n(C)ccc2c1CCN WPEKAUYAJKQPEB-UHFFFAOYSA-N 0.000 description 1
- TYIKYOVSJUJLEA-UHFFFAOYSA-N 2-(5-methylnaphthalen-1-yl)ethanamine hydrochloride Chemical compound Cl.Cc1cccc2c(CCN)cccc12 TYIKYOVSJUJLEA-UHFFFAOYSA-N 0.000 description 1
- SBWXFAKYBFQXSX-UHFFFAOYSA-N 2-(6-fluoro-1-benzothiophen-4-yl)ethanamine hydrochloride Chemical compound Cl.NCCc1cc(F)cc2sccc12 SBWXFAKYBFQXSX-UHFFFAOYSA-N 0.000 description 1
- RVSXHXKYQAWHTK-UHFFFAOYSA-N 2-[2-(difluoromethyl)naphthalen-1-yl]ethanamine hydrochloride Chemical compound Cl.NCCc1c(ccc2ccccc12)C(F)F RVSXHXKYQAWHTK-UHFFFAOYSA-N 0.000 description 1
- LSAPIVLONBDMJJ-UHFFFAOYSA-N 2-[2-ethoxy-4-[6-[2-(5-methoxy-1-methylindol-4-yl)ethylamino]pyrimidin-4-yl]phenyl]acetic acid Chemical compound C(C)OC1=C(C=CC(=C1)C1=NC=NC(=C1)NCCC1=C2C=CN(C2=CC=C1OC)C)CC(=O)O LSAPIVLONBDMJJ-UHFFFAOYSA-N 0.000 description 1
- NWLPAUQNSPXWCT-UHFFFAOYSA-N 2-[2-ethoxy-4-[6-[2-(6-methylisoquinolin-5-yl)ethylamino]pyrimidin-4-yl]phenoxy]acetic acid Chemical compound C(C)OC1=C(OCC(=O)O)C=CC(=C1)C1=NC=NC(=C1)NCCC1=C2C=CN=CC2=CC=C1C NWLPAUQNSPXWCT-UHFFFAOYSA-N 0.000 description 1
- XWALBCKRUNURAF-UHFFFAOYSA-N 2-[4-(difluoromethyl)naphthalen-1-yl]ethanamine hydrochloride Chemical compound Cl.FC(C1=CC=C(C2=CC=CC=C12)CCN)F XWALBCKRUNURAF-UHFFFAOYSA-N 0.000 description 1
- JWXOVOSISXKOJI-UHFFFAOYSA-N 2-[6-[2-(2-methoxynaphthalen-1-yl)ethylamino]pyrimidin-4-yl]-1H-indole-4-carboxylic acid Chemical compound COC1=C(C2=CC=CC=C2C=C1)CCNC1=CC(=NC=N1)C=1NC=2C=CC=C(C=2C=1)C(=O)O JWXOVOSISXKOJI-UHFFFAOYSA-N 0.000 description 1
- FNLFIZJWCALKJP-UHFFFAOYSA-N 2-[6-[2-(2-methoxynaphthalen-1-yl)ethylamino]pyrimidin-4-yl]-1H-indole-5-carboxylic acid Chemical compound COC1=C(C2=CC=CC=C2C=C1)CCNC1=CC(=NC=N1)C=1NC2=CC=C(C=C2C=1)C(=O)O FNLFIZJWCALKJP-UHFFFAOYSA-N 0.000 description 1
- QDEYYGWQSXKHKY-UHFFFAOYSA-N 2-[6-[2-(2-methoxynaphthalen-1-yl)ethylamino]pyrimidin-4-yl]-1H-indole-6-carboxylic acid Chemical compound COC1=C(C2=CC=CC=C2C=C1)CCNC1=CC(=NC=N1)C=1NC2=CC(=CC=C2C=1)C(=O)O QDEYYGWQSXKHKY-UHFFFAOYSA-N 0.000 description 1
- 102100026660 2-aminoethanethiol dioxygenase Human genes 0.000 description 1
- IQHSSYROJYPFDV-UHFFFAOYSA-N 2-bromo-1,3-dichloro-5-(trifluoromethyl)benzene Chemical group FC(F)(F)C1=CC(Cl)=C(Br)C(Cl)=C1 IQHSSYROJYPFDV-UHFFFAOYSA-N 0.000 description 1
- KCFDURKFXBLIAY-UHFFFAOYSA-N 2-bromo-1-methoxy-3-nitrobenzene Chemical compound COC1=CC=CC([N+]([O-])=O)=C1Br KCFDURKFXBLIAY-UHFFFAOYSA-N 0.000 description 1
- RWXPRRHZBFMKOJ-AATRIKPKSA-N 2-bromo-4-fluoro-1-[(E)-2-nitroethenyl]naphthalene Chemical compound [O-][N+](=O)\C=C\c1c(Br)cc(F)c2ccccc12 RWXPRRHZBFMKOJ-AATRIKPKSA-N 0.000 description 1
- RMBKUEIUVUVJNB-UHFFFAOYSA-N 2-bromo-4-fluoronaphthalene-1-carbaldehyde Chemical compound C1=CC=C2C(F)=CC(Br)=C(C=O)C2=C1 RMBKUEIUVUVJNB-UHFFFAOYSA-N 0.000 description 1
- XJIPTTLNJAQLLR-UHFFFAOYSA-N 2-bromonaphthalene-1-carbaldehyde Chemical compound C1=CC=CC2=C(C=O)C(Br)=CC=C21 XJIPTTLNJAQLLR-UHFFFAOYSA-N 0.000 description 1
- ROIVISKTRQIUSL-UHFFFAOYSA-N 2-ethoxy-4-[6-(2-naphthalen-1-ylethylamino)pyrimidin-4-yl]benzoic acid Chemical compound C(C)OC1=C(C(=O)O)C=CC(=C1)C1=NC=NC(=C1)NCCC1=CC=CC2=CC=CC=C12 ROIVISKTRQIUSL-UHFFFAOYSA-N 0.000 description 1
- ILQRVBBBFCVXEZ-UHFFFAOYSA-N 2-ethoxy-4-[6-[2-(4-fluoronaphthalen-1-yl)ethylamino]pyrimidin-4-yl]benzoic acid Chemical compound C(C)OC1=C(C(=O)O)C=CC(=C1)C1=NC=NC(=C1)NCCC1=CC=C(C2=CC=CC=C12)F ILQRVBBBFCVXEZ-UHFFFAOYSA-N 0.000 description 1
- NQCQTAIJUGKBBP-UHFFFAOYSA-N 2-ethoxy-4-[6-[2-(5-ethoxy-1-benzothiophen-4-yl)ethylamino]pyrimidin-4-yl]benzoic acid Chemical compound C(C)OC1=C(C(=O)O)C=CC(=C1)C1=NC=NC(=C1)NCCC1=C(C=CC=2SC=CC=21)OCC NQCQTAIJUGKBBP-UHFFFAOYSA-N 0.000 description 1
- 125000004777 2-fluoroethyl group Chemical group [H]C([H])(F)C([H])([H])* 0.000 description 1
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- LNJMHEJAYSYZKK-UHFFFAOYSA-N 2-methylpyrimidine Chemical class CC1=NC=CC=N1 LNJMHEJAYSYZKK-UHFFFAOYSA-N 0.000 description 1
- IIQLCIPKSPJKEJ-UHFFFAOYSA-N 2-naphthalen-1-ylethylazanium;chloride Chemical compound Cl.C1=CC=C2C(CCN)=CC=CC2=C1 IIQLCIPKSPJKEJ-UHFFFAOYSA-N 0.000 description 1
- BXVSAYBZSGIURM-UHFFFAOYSA-N 2-phenoxy-4h-1,3,2$l^{5}-benzodioxaphosphinine 2-oxide Chemical compound O1CC2=CC=CC=C2OP1(=O)OC1=CC=CC=C1 BXVSAYBZSGIURM-UHFFFAOYSA-N 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- NDMPLJNOPCLANR-UHFFFAOYSA-N 3,4-dihydroxy-15-(4-hydroxy-18-methoxycarbonyl-5,18-seco-ibogamin-18-yl)-16-methoxy-1-methyl-6,7-didehydro-aspidospermidine-3-carboxylic acid methyl ester Natural products C1C(CC)(O)CC(CC2(C(=O)OC)C=3C(=CC4=C(C56C(C(C(O)C7(CC)C=CCN(C67)CC5)(O)C(=O)OC)N4C)C=3)OC)CN1CCC1=C2NC2=CC=CC=C12 NDMPLJNOPCLANR-UHFFFAOYSA-N 0.000 description 1
- OGTLOZRGFHYKIF-UHFFFAOYSA-N 3-(4-bromo-2-ethoxyphenoxy)propanoic acid Chemical compound CCOC1=CC(Br)=CC=C1OCCC(O)=O OGTLOZRGFHYKIF-UHFFFAOYSA-N 0.000 description 1
- CORHGUPIEQAJDV-UHFFFAOYSA-N 3-(trifluoromethyl)thiophene Chemical compound FC(F)(F)C=1C=CSC=1 CORHGUPIEQAJDV-UHFFFAOYSA-N 0.000 description 1
- FDWVFAZSUJQNNT-UHFFFAOYSA-N 3-[2-ethoxy-4-[6-[2-(2-methoxynaphthalen-1-yl)ethylamino]pyrimidin-4-yl]phenyl]-2H-1,2,4-oxadiazole-5-thione Chemical compound CCOc1cc(ccc1-c1nc(=S)o[nH]1)-c1cc(NCCc2c(OC)ccc3ccccc23)ncn1 FDWVFAZSUJQNNT-UHFFFAOYSA-N 0.000 description 1
- QEYMMOKECZBKAC-UHFFFAOYSA-N 3-chloropropanoic acid Chemical compound OC(=O)CCCl QEYMMOKECZBKAC-UHFFFAOYSA-N 0.000 description 1
- PJEZSEUYIQGWCM-UHFFFAOYSA-N 3-ethoxy-5-(6-methoxypyrimidin-4-yl)thiophene-2-carboxamide Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)OC)C(=O)N PJEZSEUYIQGWCM-UHFFFAOYSA-N 0.000 description 1
- PEXZZOIYPGOYTH-UHFFFAOYSA-N 3-ethoxy-5-(6-methoxypyrimidin-4-yl)thiophene-2-carboxylic acid Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)OC)C(=O)O PEXZZOIYPGOYTH-UHFFFAOYSA-N 0.000 description 1
- QZOTUKXHGVUTBK-UHFFFAOYSA-N 3-ethoxy-5-[6-[2-(1,2,3-trimethylindol-7-yl)ethylamino]pyrimidin-4-yl]thiophene-2-carboxylic acid Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC=1C=CC=C2C(=C(N(C=12)C)C)C)C(=O)O QZOTUKXHGVUTBK-UHFFFAOYSA-N 0.000 description 1
- IZOBYCVVUYOZLT-UHFFFAOYSA-N 3-ethoxy-5-[6-[2-(2-propoxynaphthalen-1-yl)ethylamino]pyrimidin-4-yl]thiophene-2-carboxylic acid Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=C(C=CC2=CC=CC=C12)OCCC)C(=O)O IZOBYCVVUYOZLT-UHFFFAOYSA-N 0.000 description 1
- UFXLKPLKQIKFNS-UHFFFAOYSA-N 3-ethoxy-5-[6-[2-(4-fluoronaphthalen-1-yl)ethylamino]pyrimidin-4-yl]thiophene-2-carboxylic acid Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=CC=C(C2=CC=CC=C12)F)C(=O)O UFXLKPLKQIKFNS-UHFFFAOYSA-N 0.000 description 1
- OMDRGANFQBFUOR-UHFFFAOYSA-N 3-ethoxy-5-[6-[2-(4-methoxynaphthalen-1-yl)ethylamino]pyrimidin-4-yl]thiophene-2-carboxylic acid Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=CC=C(C2=CC=CC=C12)OC)C(=O)O OMDRGANFQBFUOR-UHFFFAOYSA-N 0.000 description 1
- FTKDCOINUAYGTC-UHFFFAOYSA-N 3-ethoxythiophene-2-carboxylic acid Chemical compound CCOC=1C=CSC=1C(O)=O FTKDCOINUAYGTC-UHFFFAOYSA-N 0.000 description 1
- SQNYSXIZCRUTLT-UHFFFAOYSA-N 3-fluoronaphthalene-1-carbaldehyde Chemical compound C1=CC=CC2=CC(F)=CC(C=O)=C21 SQNYSXIZCRUTLT-UHFFFAOYSA-N 0.000 description 1
- LAKCSRAJVSQBIR-UHFFFAOYSA-N 3-methoxynaphthalene-1-carbaldehyde Chemical compound C1=CC=CC2=CC(OC)=CC(C=O)=C21 LAKCSRAJVSQBIR-UHFFFAOYSA-N 0.000 description 1
- RFSKGCVUDQRZSD-UHFFFAOYSA-N 3-methoxythiophene Chemical compound COC=1C=CSC=1 RFSKGCVUDQRZSD-UHFFFAOYSA-N 0.000 description 1
- ROADCYAOHVSOLQ-UHFFFAOYSA-N 3-oxetanone Chemical compound O=C1COC1 ROADCYAOHVSOLQ-UHFFFAOYSA-N 0.000 description 1
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- AOJJSUZBOXZQNB-VTZDEGQISA-N 4'-epidoxorubicin Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(=O)CO)[C@H]1C[C@H](N)[C@@H](O)[C@H](C)O1 AOJJSUZBOXZQNB-VTZDEGQISA-N 0.000 description 1
- RTDAMORRDXWYPT-UHFFFAOYSA-N 4,5-dichloro-3,6-dioxocyclohexa-1,4-diene-1,2-dicarbonitrile Chemical compound ClC1=C(Cl)C(=O)C(C#N)=C(C#N)C1=O.ClC1=C(Cl)C(=O)C(C#N)=C(C#N)C1=O RTDAMORRDXWYPT-UHFFFAOYSA-N 0.000 description 1
- 125000000972 4,5-dimethylthiazol-2-yl group Chemical group [H]C([H])([H])C1=C(N=C(*)S1)C([H])([H])[H] 0.000 description 1
- CLPFFLWZZBQMAO-UHFFFAOYSA-N 4-(5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-5-yl)benzonitrile Chemical compound C1=CC(C#N)=CC=C1C1N2C=NC=C2CCC1 CLPFFLWZZBQMAO-UHFFFAOYSA-N 0.000 description 1
- ZGKTZLKVUZAQSG-UHFFFAOYSA-N 4-aminobutyl formate Chemical compound NCCCCOC=O ZGKTZLKVUZAQSG-UHFFFAOYSA-N 0.000 description 1
- IRHPJGPQWZEZRX-UHFFFAOYSA-N 4-bromo-2,6-difluorobenzoic acid Chemical compound OC(=O)C1=C(F)C=C(Br)C=C1F IRHPJGPQWZEZRX-UHFFFAOYSA-N 0.000 description 1
- BWZLXDPXWIKMBI-UHFFFAOYSA-N 4-bromo-2-(difluoromethoxy)benzoic acid Chemical compound OC(=O)C1=CC=C(Br)C=C1OC(F)F BWZLXDPXWIKMBI-UHFFFAOYSA-N 0.000 description 1
- PCGDEZIPPWSPHJ-UHFFFAOYSA-N 4-bromo-2-butoxy-6-fluorobenzoic acid Chemical compound BrC1=CC(=C(C(=O)O)C(=C1)F)OCCCC PCGDEZIPPWSPHJ-UHFFFAOYSA-N 0.000 description 1
- BYYLYSYPEWKIPJ-UHFFFAOYSA-N 4-bromo-2-ethoxybenzonitrile Chemical compound CCOC1=CC(Br)=CC=C1C#N BYYLYSYPEWKIPJ-UHFFFAOYSA-N 0.000 description 1
- XIRFCGCJCHQCGH-UHFFFAOYSA-N 4-bromo-5-ethoxy-1-benzothiophene Chemical compound BrC1=C(C=CC=2SC=CC=21)OCC XIRFCGCJCHQCGH-UHFFFAOYSA-N 0.000 description 1
- URDZUVSOZSEYHQ-UHFFFAOYSA-N 4-bromo-5-methoxy-1-benzothiophene Chemical compound COC1=CC=C2SC=CC2=C1Br URDZUVSOZSEYHQ-UHFFFAOYSA-N 0.000 description 1
- WMCAKKZQDPDDGD-UHFFFAOYSA-N 4-bromo-5-methoxy-1-methylindole Chemical compound BrC1=C2C=CN(C2=CC=C1OC)C WMCAKKZQDPDDGD-UHFFFAOYSA-N 0.000 description 1
- DVCLJDAZHYRZHZ-UHFFFAOYSA-N 4-bromo-5-methyl-1h-indole Chemical compound CC1=CC=C2NC=CC2=C1Br DVCLJDAZHYRZHZ-UHFFFAOYSA-N 0.000 description 1
- UCWCAIRIHGTIIL-UHFFFAOYSA-N 4-bromo-6-fluoro-1-benzothiophene Chemical compound FC1=CC(Br)=C2C=CSC2=C1 UCWCAIRIHGTIIL-UHFFFAOYSA-N 0.000 description 1
- SESASPRCAIMYLA-UHFFFAOYSA-N 4-bromonaphthalene-1-carbaldehyde Chemical compound C1=CC=C2C(Br)=CC=C(C=O)C2=C1 SESASPRCAIMYLA-UHFFFAOYSA-N 0.000 description 1
- DLAFWIYXXOBITQ-UHFFFAOYSA-N 4-chloro-6-fluoropyrimidine Chemical compound FC1=CC(Cl)=NC=N1 DLAFWIYXXOBITQ-UHFFFAOYSA-N 0.000 description 1
- KLJGSQVYUGQOAW-UHFFFAOYSA-N 4-chloro-6-methoxypyrimidine Chemical compound COC1=CC(Cl)=NC=N1 KLJGSQVYUGQOAW-UHFFFAOYSA-N 0.000 description 1
- YZZNIXQDCYKZOJ-UHFFFAOYSA-N 5-[4-[6-[2-(2-methoxynaphthalen-1-yl)ethylamino]pyrimidin-4-yl]phenyl]-1,2-oxazol-3-one Chemical compound COc1ccc2ccccc2c1CCNc1cc(ncn1)-c1ccc(cc1)-c1cc(=O)[nH]o1 YZZNIXQDCYKZOJ-UHFFFAOYSA-N 0.000 description 1
- ZCFXNBLWXXDPPM-UHFFFAOYSA-N 5-[4-[6-[2-(6-methoxyquinolin-5-yl)ethylamino]pyrimidin-4-yl]phenyl]-1,3,4-thiadiazol-2-amine Chemical compound NC1=NN=C(S1)C1=CC=C(C=C1)C1=CC(=NC=N1)NCCC1=C2C=CC=NC2=CC=C1OC ZCFXNBLWXXDPPM-UHFFFAOYSA-N 0.000 description 1
- GNYGQDZHCPDJBL-UHFFFAOYSA-N 5-[6-[2-(1,2-dimethylindol-7-yl)ethylamino]pyrimidin-4-yl]-3-ethoxythiophene-2-carboxylic acid Chemical compound CN1C(=CC2=CC=CC(=C12)CCNC1=CC(=NC=N1)C1=CC(=C(S1)C(=O)O)OCC)C GNYGQDZHCPDJBL-UHFFFAOYSA-N 0.000 description 1
- PBMVEMRTKWZVIP-UHFFFAOYSA-N 5-[6-[2-(6-methoxy-1-methyl-3,4-dihydro-2H-quinolin-5-yl)ethylamino]pyrimidin-4-yl]-3-(trifluoromethyl)thiophene-2-carboxylic acid Chemical compound COC=1C(=C2CCCN(C2=CC=1)C)CCNC1=CC(=NC=N1)C1=CC(=C(S1)C(=O)O)C(F)(F)F PBMVEMRTKWZVIP-UHFFFAOYSA-N 0.000 description 1
- PNSKMCPEIGGUET-UHFFFAOYSA-N 5-[6-[2-[2-(difluoromethoxy)naphthalen-1-yl]ethylamino]pyrimidin-4-yl]-3-ethoxythiophene-2-carboxylic acid Chemical compound FC(OC1=C(C2=CC=CC=C2C=C1)CCNC1=CC(=NC=N1)C1=CC(=C(S1)C(=O)O)OCC)F PNSKMCPEIGGUET-UHFFFAOYSA-N 0.000 description 1
- CAZBCNFFPBHCRW-UHFFFAOYSA-N 5-bromo-6-methylisoquinoline Chemical compound C1=NC=CC2=C(Br)C(C)=CC=C21 CAZBCNFFPBHCRW-UHFFFAOYSA-N 0.000 description 1
- WIMQAPHMJJTFJY-UHFFFAOYSA-N 5-ethoxy-1,3-benzodioxole-4-carbaldehyde Chemical compound CCOC1=CC=C2OCOC2=C1C=O WIMQAPHMJJTFJY-UHFFFAOYSA-N 0.000 description 1
- ZWUKGTDGPSXXAO-AATRIKPKSA-N 5-ethoxy-4-[(E)-2-nitroethenyl]-1,3-benzodioxole Chemical compound C(C)OC1=C(C2=C(OCO2)C=C1)\C=C\[N+](=O)[O-] ZWUKGTDGPSXXAO-AATRIKPKSA-N 0.000 description 1
- IMLCPQOIRGAGOU-UHFFFAOYSA-N 5-methoxy-1,3-benzodioxole-4-carbaldehyde Chemical compound COC1=CC=C2OCOC2=C1C=O IMLCPQOIRGAGOU-UHFFFAOYSA-N 0.000 description 1
- CIJTYVNAGPHTGD-UHFFFAOYSA-N 5-methoxy-2,3-dihydro-1-benzofuran-4-carbaldehyde Chemical compound COC1=CC=C2OCCC2=C1C=O CIJTYVNAGPHTGD-UHFFFAOYSA-N 0.000 description 1
- YYQSAXCPAKNXLG-GQCTYLIASA-N 5-methoxy-4-[(E)-2-nitroethenyl]-2,3-dihydro-1-benzofuran Chemical compound COc1ccc2OCCc2c1\C=C\[N+]([O-])=O YYQSAXCPAKNXLG-GQCTYLIASA-N 0.000 description 1
- BBZHTDXJBIVUBC-UHFFFAOYSA-N 6-chloro-N-[2-(1,2,3-trimethylindol-7-yl)ethyl]pyrimidin-4-amine Chemical compound ClC1=CC(=NC=N1)NCCC=1C=CC=C2C(=C(N(C=12)C)C)C BBZHTDXJBIVUBC-UHFFFAOYSA-N 0.000 description 1
- MNCREJXPAUQGOF-UHFFFAOYSA-N 6-chloro-N-[2-(1,2-dimethylindol-7-yl)ethyl]pyrimidin-4-amine Chemical compound ClC1=CC(=NC=N1)NCCC=1C=CC=C2C=C(N(C=12)C)C MNCREJXPAUQGOF-UHFFFAOYSA-N 0.000 description 1
- AIALPRZNSMMSSH-UHFFFAOYSA-N 6-chloro-N-[2-(1,5-dimethylindazol-4-yl)ethyl]pyrimidin-4-amine Chemical compound ClC1=CC(=NC=N1)NCCC1=C2C=NN(C2=CC=C1C)C AIALPRZNSMMSSH-UHFFFAOYSA-N 0.000 description 1
- DGFRWXBXSOJQDY-UHFFFAOYSA-N 6-chloro-N-[2-(1,5-dimethylindol-4-yl)ethyl]pyrimidin-4-amine Chemical compound ClC1=CC(=NC=N1)NCCC1=C2C=CN(C2=CC=C1C)C DGFRWXBXSOJQDY-UHFFFAOYSA-N 0.000 description 1
- YNOXEACOLMVTCV-UHFFFAOYSA-N 6-chloro-N-[2-(2,3-dimethoxynaphthalen-1-yl)ethyl]pyrimidin-4-amine Chemical compound ClC1=CC(=NC=N1)NCCC1=C(C(=CC2=CC=CC=C12)OC)OC YNOXEACOLMVTCV-UHFFFAOYSA-N 0.000 description 1
- PCURWFMCTCFZFE-UHFFFAOYSA-N 6-chloro-N-[2-(2,3-dimethylnaphthalen-1-yl)ethyl]pyrimidin-4-amine Chemical compound ClC1=CC(=NC=N1)NCCC1=C(C(=CC2=CC=CC=C12)C)C PCURWFMCTCFZFE-UHFFFAOYSA-N 0.000 description 1
- GSTTXQQHHFLCPA-UHFFFAOYSA-N 6-chloro-N-[2-(2,5-dimethoxynaphthalen-1-yl)ethyl]pyrimidin-4-amine Chemical compound ClC1=CC(=NC=N1)NCCC1=C(C=CC2=C(C=CC=C12)OC)OC GSTTXQQHHFLCPA-UHFFFAOYSA-N 0.000 description 1
- DNGQFKFQZKXRJG-UHFFFAOYSA-N 6-chloro-N-[2-(2-methyl-1-benzofuran-7-yl)ethyl]pyrimidin-4-amine Chemical compound ClC1=CC(=NC=N1)NCCC1=CC=CC=2C=C(OC=21)C DNGQFKFQZKXRJG-UHFFFAOYSA-N 0.000 description 1
- UZCZEWPCHWFYHN-UHFFFAOYSA-N 6-chloro-N-[2-(3-fluoronaphthalen-1-yl)ethyl]pyrimidin-4-amine Chemical compound ClC1=CC(=NC=N1)NCCC1=CC(=CC2=CC=CC=C12)F UZCZEWPCHWFYHN-UHFFFAOYSA-N 0.000 description 1
- XIRVYRVLJWYFNI-UHFFFAOYSA-N 6-chloro-N-[2-(3-methoxynaphthalen-1-yl)ethyl]pyrimidin-4-amine Chemical compound ClC1=CC(=NC=N1)NCCC1=CC(=CC2=CC=CC=C12)OC XIRVYRVLJWYFNI-UHFFFAOYSA-N 0.000 description 1
- JYLDLUFPNYNVAI-UHFFFAOYSA-N 6-chloro-N-[2-(5-ethoxy-1-benzothiophen-4-yl)ethyl]pyrimidin-4-amine Chemical compound ClC1=CC(=NC=N1)NCCC1=C(C=CC=2SC=CC=21)OCC JYLDLUFPNYNVAI-UHFFFAOYSA-N 0.000 description 1
- FKWCXRDQILJBCF-UHFFFAOYSA-N 6-chloro-N-[2-(5-fluoronaphthalen-1-yl)ethyl]pyrimidin-4-amine Chemical compound ClC1=CC(=NC=N1)NCCC1=CC=CC2=C(C=CC=C12)F FKWCXRDQILJBCF-UHFFFAOYSA-N 0.000 description 1
- HUWLZKQBFCPSNR-UHFFFAOYSA-N 6-chloro-N-[2-(5-methoxy-1,3-benzodioxol-4-yl)ethyl]pyrimidin-4-amine Chemical compound ClC1=CC(=NC=N1)NCCC1=C(C=CC=2OCOC=21)OC HUWLZKQBFCPSNR-UHFFFAOYSA-N 0.000 description 1
- UAAQXIVFVSGCFO-UHFFFAOYSA-N 6-chloro-N-[2-(5-methoxy-1-benzothiophen-4-yl)ethyl]pyrimidin-4-amine Chemical compound ClC1=CC(=NC=N1)NCCC1=C(C=CC=2SC=CC=21)OC UAAQXIVFVSGCFO-UHFFFAOYSA-N 0.000 description 1
- KFWVWWLLUZQJMK-UHFFFAOYSA-N 6-chloro-N-[2-(5-methoxy-1-methylindol-4-yl)ethyl]pyrimidin-4-amine Chemical compound ClC1=CC(=NC=N1)NCCC1=C2C=CN(C2=CC=C1OC)C KFWVWWLLUZQJMK-UHFFFAOYSA-N 0.000 description 1
- VWCMPTBNPYFSDL-UHFFFAOYSA-N 6-chloro-N-[2-(5-methoxy-2,3-dihydro-1-benzofuran-4-yl)ethyl]pyrimidin-4-amine Chemical compound ClC1=CC(=NC=N1)NCCC1=C(C=CC2=C1CCO2)OC VWCMPTBNPYFSDL-UHFFFAOYSA-N 0.000 description 1
- ICQVONAPMAMOGH-UHFFFAOYSA-N 6-chloro-N-[2-(5-methylnaphthalen-1-yl)ethyl]pyrimidin-4-amine Chemical compound ClC1=CC(=NC=N1)NCCC1=CC=CC2=C(C=CC=C12)C ICQVONAPMAMOGH-UHFFFAOYSA-N 0.000 description 1
- RXSFXCXKSDAUNQ-UHFFFAOYSA-N 6-chloro-N-[2-(6-fluoro-1-benzothiophen-4-yl)ethyl]pyrimidin-4-amine Chemical compound ClC1=CC(=NC=N1)NCCC1=CC(=CC=2SC=CC=21)F RXSFXCXKSDAUNQ-UHFFFAOYSA-N 0.000 description 1
- CWRPIRIRTCKPIL-UHFFFAOYSA-N 6-chloro-N-[2-(6-methoxy-1-methylindol-7-yl)ethyl]pyrimidin-4-amine Chemical compound ClC1=CC(=NC=N1)NCCC=1C(=CC=C2C=CN(C=12)C)OC CWRPIRIRTCKPIL-UHFFFAOYSA-N 0.000 description 1
- IMFPUGZYDKXTTI-UHFFFAOYSA-N 6-chloro-N-[2-(6-methylisoquinolin-5-yl)ethyl]pyrimidin-4-amine Chemical compound ClC1=CC(=NC=N1)NCCC1=C2C=CN=CC2=CC=C1C IMFPUGZYDKXTTI-UHFFFAOYSA-N 0.000 description 1
- WKJAUAKVVVHHGL-UHFFFAOYSA-N 6-chloro-N-[2-(6-methylquinolin-5-yl)ethyl]pyrimidin-4-amine Chemical compound ClC1=CC(=NC=N1)NCCC1=C2C=CC=NC2=CC=C1C WKJAUAKVVVHHGL-UHFFFAOYSA-N 0.000 description 1
- PFOIUKFLHBHGLB-UHFFFAOYSA-N 6-chloro-N-[2-(7-methoxy-4-methylquinolin-8-yl)ethyl]pyrimidin-4-amine Chemical compound ClC1=CC(=NC=N1)NCCC=1C(=CC=C2C(=CC=NC=12)C)OC PFOIUKFLHBHGLB-UHFFFAOYSA-N 0.000 description 1
- MXSBZXJAWBPXEC-UHFFFAOYSA-N 6-chloro-N-[2-(7-methoxyquinolin-8-yl)ethyl]pyrimidin-4-amine Chemical compound ClC1=CC(=NC=N1)NCCC=1C(=CC=C2C=CC=NC=12)OC MXSBZXJAWBPXEC-UHFFFAOYSA-N 0.000 description 1
- WDISHMSQJPWCAY-UHFFFAOYSA-N 6-chloro-N-[2-[2-(difluoromethyl)naphthalen-1-yl]ethyl]pyrimidin-4-amine Chemical compound ClC1=CC(=NC=N1)NCCC1=C(C=CC2=CC=CC=C12)C(F)F WDISHMSQJPWCAY-UHFFFAOYSA-N 0.000 description 1
- HNPRCUMCZXKDCP-UHFFFAOYSA-N 6-chloro-N-[2-[4-(difluoromethyl)naphthalen-1-yl]ethyl]pyrimidin-4-amine Chemical compound ClC1=CC(=NC=N1)NCCC1=CC=C(C2=CC=CC=C12)C(F)F HNPRCUMCZXKDCP-UHFFFAOYSA-N 0.000 description 1
- IAWIFBMBSZRKGZ-UHFFFAOYSA-N 6-fluoro-1-benzothiophene Chemical compound FC1=CC=C2C=CSC2=C1 IAWIFBMBSZRKGZ-UHFFFAOYSA-N 0.000 description 1
- VVIAGPKUTFNRDU-UHFFFAOYSA-N 6S-folinic acid Natural products C1NC=2NC(N)=NC(=O)C=2N(C=O)C1CNC1=CC=C(C(=O)NC(CCC(O)=O)C(O)=O)C=C1 VVIAGPKUTFNRDU-UHFFFAOYSA-N 0.000 description 1
- KURQKNMKCGYWRJ-HNNXBMFYSA-N 7-(5-methylfuran-2-yl)-3-[[6-[[(3s)-oxolan-3-yl]oxymethyl]pyridin-2-yl]methyl]triazolo[4,5-d]pyrimidin-5-amine Chemical compound O1C(C)=CC=C1C1=NC(N)=NC2=C1N=NN2CC1=CC=CC(CO[C@@H]2COCC2)=N1 KURQKNMKCGYWRJ-HNNXBMFYSA-N 0.000 description 1
- STQGQHZAVUOBTE-UHFFFAOYSA-N 7-Cyan-hept-2t-en-4,6-diinsaeure Natural products C1=2C(O)=C3C(=O)C=4C(OC)=CC=CC=4C(=O)C3=C(O)C=2CC(O)(C(C)=O)CC1OC1CC(N)C(O)C(C)O1 STQGQHZAVUOBTE-UHFFFAOYSA-N 0.000 description 1
- RLVGRFODLCTVTN-UHFFFAOYSA-N 7-bromo-2-methyl-1-benzofuran Chemical compound C1=CC(Br)=C2OC(C)=CC2=C1 RLVGRFODLCTVTN-UHFFFAOYSA-N 0.000 description 1
- AIJMQHYWYGIINY-UHFFFAOYSA-N 7-bromo-6-methoxy-1-methylindole Chemical compound BrC=1C(=CC=C2C=CN(C=12)C)OC AIJMQHYWYGIINY-UHFFFAOYSA-N 0.000 description 1
- LVJHDVPCJRWNNZ-UHFFFAOYSA-N 7-methoxy-4-methylquinoline Chemical compound CC1=CC=NC2=CC(OC)=CC=C21 LVJHDVPCJRWNNZ-UHFFFAOYSA-N 0.000 description 1
- DBWFMIRZBMJXOK-UHFFFAOYSA-N 8-bromo-7-methoxy-4-methylquinoline Chemical compound BrC=1C(=CC=C2C(=CC=NC=12)C)OC DBWFMIRZBMJXOK-UHFFFAOYSA-N 0.000 description 1
- UKTORPDEFRENTM-UHFFFAOYSA-N 8-fluoro-5-methoxy-3,4-dihydro-2h-naphthalen-1-one Chemical compound O=C1CCCC2=C1C(F)=CC=C2OC UKTORPDEFRENTM-UHFFFAOYSA-N 0.000 description 1
- 230000035502 ADME Effects 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 1
- 208000003200 Adenoma Diseases 0.000 description 1
- 206010001233 Adenoma benign Diseases 0.000 description 1
- 229940123702 Adenosine A2a receptor antagonist Drugs 0.000 description 1
- DHMQDGOQFOQNFH-UHFFFAOYSA-M Aminoacetate Chemical compound NCC([O-])=O DHMQDGOQFOQNFH-UHFFFAOYSA-M 0.000 description 1
- 239000004382 Amylase Substances 0.000 description 1
- 108010065511 Amylases Proteins 0.000 description 1
- 102000013142 Amylases Human genes 0.000 description 1
- 208000037260 Atherosclerotic Plaque Diseases 0.000 description 1
- 208000023275 Autoimmune disease Diseases 0.000 description 1
- 208000010061 Autosomal Dominant Polycystic Kidney Diseases 0.000 description 1
- 229940125565 BMS-986016 Drugs 0.000 description 1
- 108010006654 Bleomycin Proteins 0.000 description 1
- FGAZHFIVEFAILZ-UHFFFAOYSA-N BrC1=CC(=C(C(=O)OC)C(=C1)F)OCCCC.BrC1=CC(=C(C(=O)O)C(=C1)F)OCCCC Chemical compound BrC1=CC(=C(C(=O)OC)C(=C1)F)OCCCC.BrC1=CC(=C(C(=O)O)C(=C1)F)OCCCC FGAZHFIVEFAILZ-UHFFFAOYSA-N 0.000 description 1
- XORABJISZPMSMU-UHFFFAOYSA-N BrC1=CC=C(C2=CC=CC=C12)C(F)F Chemical compound BrC1=CC=C(C2=CC=CC=C12)C(F)F XORABJISZPMSMU-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- RSFUABFOEAUUMC-UHFFFAOYSA-N C(C)OC1=C(C=CC(=C1)C1=NC=NC(=C1)NCCC1=C2C=CC=NC2=CC=C1OC)O Chemical compound C(C)OC1=C(C=CC(=C1)C1=NC=NC(=C1)NCCC1=C2C=CC=NC2=CC=C1OC)O RSFUABFOEAUUMC-UHFFFAOYSA-N 0.000 description 1
- FJVAGFQJAVIAJM-UHFFFAOYSA-N C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=C(C=CC2=CC=CC=C12)OC)C1=NOC(=N1)O Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=C(C=CC2=CC=CC=C12)OC)C1=NOC(=N1)O FJVAGFQJAVIAJM-UHFFFAOYSA-N 0.000 description 1
- BDXZRRIUAKKXJW-UHFFFAOYSA-N C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)O)C#N Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)O)C#N BDXZRRIUAKKXJW-UHFFFAOYSA-N 0.000 description 1
- QFFHZVKCULCYMS-UHFFFAOYSA-N C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)OC)C1=NOC(=N1)O Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)OC)C1=NOC(=N1)O QFFHZVKCULCYMS-UHFFFAOYSA-N 0.000 description 1
- ZBAZHJRHCYZRSS-UHFFFAOYSA-N CCOc1cc(ccc1Cc1nc(=O)o[nH]1)-c1cc(NCCc2c(OC)ccc3ccccc23)ncn1 Chemical compound CCOc1cc(ccc1Cc1nc(=O)o[nH]1)-c1cc(NCCc2c(OC)ccc3ccccc23)ncn1 ZBAZHJRHCYZRSS-UHFFFAOYSA-N 0.000 description 1
- IYTODEIAADQJQH-UHFFFAOYSA-N COc1ccc2ccccc2c1CCNc1cc(ncn1)-c1ccc(cc1)-c1c(O)c(=O)c1=O Chemical compound COc1ccc2ccccc2c1CCNc1cc(ncn1)-c1ccc(cc1)-c1c(O)c(=O)c1=O IYTODEIAADQJQH-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 229940046168 CpG oligodeoxynucleotide Drugs 0.000 description 1
- 102000008130 Cyclic AMP-Dependent Protein Kinases Human genes 0.000 description 1
- 108010049894 Cyclic AMP-Dependent Protein Kinases Proteins 0.000 description 1
- UHDGCWIWMRVCDJ-CCXZUQQUSA-N Cytarabine Chemical compound O=C1N=C(N)C=CN1[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O1 UHDGCWIWMRVCDJ-CCXZUQQUSA-N 0.000 description 1
- 102000002004 Cytochrome P-450 Enzyme System Human genes 0.000 description 1
- 108010015742 Cytochrome P-450 Enzyme System Proteins 0.000 description 1
- 102000004127 Cytokines Human genes 0.000 description 1
- 108090000695 Cytokines Proteins 0.000 description 1
- GSNUFIFRDBKVIE-UHFFFAOYSA-N DMF Natural products CC1=CC=C(C)O1 GSNUFIFRDBKVIE-UHFFFAOYSA-N 0.000 description 1
- 230000033616 DNA repair Effects 0.000 description 1
- 108010092160 Dactinomycin Proteins 0.000 description 1
- 206010061818 Disease progression Diseases 0.000 description 1
- HTIJFSOGRVMCQR-UHFFFAOYSA-N Epirubicin Natural products COc1cccc2C(=O)c3c(O)c4CC(O)(CC(OC5CC(N)C(=O)C(C)O5)c4c(O)c3C(=O)c12)C(=O)CO HTIJFSOGRVMCQR-UHFFFAOYSA-N 0.000 description 1
- 108090000371 Esterases Proteins 0.000 description 1
- 108060002716 Exonuclease Proteins 0.000 description 1
- 208000009386 Experimental Arthritis Diseases 0.000 description 1
- 102000010834 Extracellular Matrix Proteins Human genes 0.000 description 1
- 108010037362 Extracellular Matrix Proteins Proteins 0.000 description 1
- GHASVSINZRGABV-UHFFFAOYSA-N Fluorouracil Chemical compound FC1=CNC(=O)NC1=O GHASVSINZRGABV-UHFFFAOYSA-N 0.000 description 1
- DEZZLWQELQORIU-RELWKKBWSA-N GDC-0879 Chemical compound N=1N(CCO)C=C(C=2C=C3CCC(/C3=CC=2)=N\O)C=1C1=CC=NC=C1 DEZZLWQELQORIU-RELWKKBWSA-N 0.000 description 1
- 229940032072 GVAX vaccine Drugs 0.000 description 1
- 208000032612 Glial tumor Diseases 0.000 description 1
- 102000006395 Globulins Human genes 0.000 description 1
- 108010044091 Globulins Proteins 0.000 description 1
- 238000006842 Henry reaction Methods 0.000 description 1
- 102100034458 Hepatitis A virus cellular receptor 2 Human genes 0.000 description 1
- 101710083479 Hepatitis A virus cellular receptor 2 homolog Proteins 0.000 description 1
- 101000946889 Homo sapiens Monocyte differentiation antigen CD14 Proteins 0.000 description 1
- 101001117317 Homo sapiens Programmed cell death 1 ligand 1 Proteins 0.000 description 1
- 101001117509 Homo sapiens Prostaglandin E2 receptor EP4 subtype Proteins 0.000 description 1
- 101000831007 Homo sapiens T-cell immunoreceptor with Ig and ITIM domains Proteins 0.000 description 1
- 101000712674 Homo sapiens TGF-beta receptor type-1 Proteins 0.000 description 1
- 101000801234 Homo sapiens Tumor necrosis factor receptor superfamily member 18 Proteins 0.000 description 1
- 208000004454 Hyperalgesia Diseases 0.000 description 1
- 208000035154 Hyperesthesia Diseases 0.000 description 1
- XDXDZDZNSLXDNA-TZNDIEGXSA-N Idarubicin Chemical compound C1[C@H](N)[C@H](O)[C@H](C)O[C@H]1O[C@@H]1C2=C(O)C(C(=O)C3=CC=CC=C3C3=O)=C3C(O)=C2C[C@@](O)(C(C)=O)C1 XDXDZDZNSLXDNA-TZNDIEGXSA-N 0.000 description 1
- XDXDZDZNSLXDNA-UHFFFAOYSA-N Idarubicin Natural products C1C(N)C(O)C(C)OC1OC1C2=C(O)C(C(=O)C3=CC=CC=C3C3=O)=C3C(O)=C2CC(O)(C(C)=O)C1 XDXDZDZNSLXDNA-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 108010021625 Immunoglobulin Fragments Proteins 0.000 description 1
- 102000008394 Immunoglobulin Fragments Human genes 0.000 description 1
- 206010061218 Inflammation Diseases 0.000 description 1
- 102100026720 Interferon beta Human genes 0.000 description 1
- 102000006992 Interferon-alpha Human genes 0.000 description 1
- 108010047761 Interferon-alpha Proteins 0.000 description 1
- 102000003812 Interleukin-15 Human genes 0.000 description 1
- 108090000172 Interleukin-15 Proteins 0.000 description 1
- 208000007766 Kaposi sarcoma Diseases 0.000 description 1
- 239000005411 L01XE02 - Gefitinib Substances 0.000 description 1
- 239000005551 L01XE03 - Erlotinib Substances 0.000 description 1
- 239000002136 L01XE07 - Lapatinib Substances 0.000 description 1
- 102000017578 LAG3 Human genes 0.000 description 1
- 101150030213 Lag3 gene Proteins 0.000 description 1
- 229910010084 LiAlH4 Inorganic materials 0.000 description 1
- 102000003960 Ligases Human genes 0.000 description 1
- 108090000364 Ligases Proteins 0.000 description 1
- GQYIWUVLTXOXAJ-UHFFFAOYSA-N Lomustine Chemical compound ClCCN(N=O)C(=O)NC1CCCCC1 GQYIWUVLTXOXAJ-UHFFFAOYSA-N 0.000 description 1
- 241000282553 Macaca Species 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 102000004232 Mitogen-Activated Protein Kinase Kinases Human genes 0.000 description 1
- 108090000744 Mitogen-Activated Protein Kinase Kinases Proteins 0.000 description 1
- 102100024193 Mitogen-activated protein kinase 1 Human genes 0.000 description 1
- 238000003461 Miyaura Borylation reaction Methods 0.000 description 1
- 102100035877 Monocyte differentiation antigen CD14 Human genes 0.000 description 1
- 102000007295 Mucin-3 Human genes 0.000 description 1
- 108010008701 Mucin-3 Proteins 0.000 description 1
- 241000699660 Mus musculus Species 0.000 description 1
- 101100335081 Mus musculus Flt3 gene Proteins 0.000 description 1
- FBKMWOJEPMPVTQ-UHFFFAOYSA-N N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[2-(sulfamoylamino)ethylamino]-1,2,5-oxadiazole-3-carboximidamide Chemical compound NS(=O)(=O)NCCNC1=NON=C1C(=NO)NC1=CC=C(F)C(Br)=C1 FBKMWOJEPMPVTQ-UHFFFAOYSA-N 0.000 description 1
- HYLBNYBBPNMIJC-UHFFFAOYSA-N N(=[N+]=[N-])CC(=O)C=1SC=CC1OCC Chemical compound N(=[N+]=[N-])CC(=O)C=1SC=CC1OCC HYLBNYBBPNMIJC-UHFFFAOYSA-N 0.000 description 1
- OVBPIULPVIDEAO-UHFFFAOYSA-N N-Pteroyl-L-glutaminsaeure Natural products C=1N=C2NC(N)=NC(=O)C2=NC=1CNC1=CC=C(C(=O)NC(CCC(O)=O)C(O)=O)C=C1 OVBPIULPVIDEAO-UHFFFAOYSA-N 0.000 description 1
- HVKXWZGDXHDSLE-UHFFFAOYSA-N N-[2-(1,5-dimethylindazol-4-yl)ethyl]-6-isoquinolin-7-ylpyrimidin-4-amine Chemical compound CN1N=CC2=C(C(=CC=C12)C)CCNC1=NC=NC(=C1)C1=CC=C2C=CN=CC2=C1 HVKXWZGDXHDSLE-UHFFFAOYSA-N 0.000 description 1
- BYKFPRNUQFZINQ-UHFFFAOYSA-N N-[2-(1,5-dimethylindazol-4-yl)ethyl]-6-quinolin-6-ylpyrimidin-4-amine Chemical compound CN1N=CC2=C(C(=CC=C12)C)CCNC1=NC=NC(=C1)C=1C=C2C=CC=NC2=CC=1 BYKFPRNUQFZINQ-UHFFFAOYSA-N 0.000 description 1
- XNUGLTMBUCWYLE-UHFFFAOYSA-N N-[2-(1-benzothiophen-4-yl)ethyl]-6-chloropyrimidin-4-amine Chemical compound S1C2=C(C=C1)C(=CC=C2)CCNC1=NC=NC(=C1)Cl XNUGLTMBUCWYLE-UHFFFAOYSA-N 0.000 description 1
- XFTOSQUVDZYDJK-UHFFFAOYSA-N N-[2-(2-aminonaphthalen-1-yl)ethyl]-6-chloropyrimidin-4-amine Chemical compound NC1=C(C2=CC=CC=C2C=C1)CCNC1=NC=NC(=C1)Cl XFTOSQUVDZYDJK-UHFFFAOYSA-N 0.000 description 1
- XPFJQKOFXPTHMD-UHFFFAOYSA-N N-[2-(2-bromonaphthalen-1-yl)ethyl]-6-chloropyrimidin-4-amine Chemical compound BrC1=C(C2=CC=CC=C2C=C1)CCNC1=NC=NC(=C1)Cl XPFJQKOFXPTHMD-UHFFFAOYSA-N 0.000 description 1
- KUJXHEGMTHTJSR-UHFFFAOYSA-N N-[2-(4-bromo-1-methylindol-7-yl)ethyl]-6-iodopyrimidin-4-amine Chemical compound BrC1=C2C=CN(C2=C(C=C1)CCNC1=NC=NC(=C1)I)C KUJXHEGMTHTJSR-UHFFFAOYSA-N 0.000 description 1
- LREBLTNTJMZLKU-UHFFFAOYSA-N N-[2-(4-bromonaphthalen-1-yl)ethyl]-6-iodopyrimidin-4-amine Chemical compound BrC1=CC=C(C2=CC=CC=C12)CCNC1=NC=NC(=C1)I LREBLTNTJMZLKU-UHFFFAOYSA-N 0.000 description 1
- HDFYODXAACBLNG-UHFFFAOYSA-N N-[2-(6-methoxyquinolin-5-yl)ethyl]-6-(2-piperidin-1-ylpyridin-4-yl)pyrimidin-4-amine Chemical compound COC=1C(=C2C=CC=NC2=CC=1)CCNC1=NC=NC(=C1)C1=CC(=NC=C1)N1CCCCC1 HDFYODXAACBLNG-UHFFFAOYSA-N 0.000 description 1
- 208000003788 Neoplasm Micrometastasis Diseases 0.000 description 1
- 208000036110 Neuroinflammatory disease Diseases 0.000 description 1
- 206010029350 Neurotoxicity Diseases 0.000 description 1
- 206010061534 Oesophageal squamous cell carcinoma Diseases 0.000 description 1
- 208000001132 Osteoporosis Diseases 0.000 description 1
- YZDJQTHVDDOVHR-UHFFFAOYSA-N PLX-4720 Chemical compound CCCS(=O)(=O)NC1=CC=C(F)C(C(=O)C=2C3=CC(Cl)=CN=C3NC=2)=C1F YZDJQTHVDDOVHR-UHFFFAOYSA-N 0.000 description 1
- 102000001105 Phosphofructokinases Human genes 0.000 description 1
- 108010069341 Phosphofructokinases Proteins 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 102100024216 Programmed cell death 1 ligand 1 Human genes 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- 108050000258 Prostaglandin D receptors Proteins 0.000 description 1
- 102100024212 Prostaglandin D2 receptor Human genes 0.000 description 1
- 102100035842 Prostaglandin E2 receptor EP1 subtype Human genes 0.000 description 1
- 101710115969 Prostaglandin E2 receptor EP2 subtype Proteins 0.000 description 1
- 101710195838 Prostaglandin E2 receptor EP4 subtype Proteins 0.000 description 1
- 108050003267 Prostaglandin G/H synthase 2 Proteins 0.000 description 1
- 102100020718 Receptor-type tyrosine-protein kinase FLT3 Human genes 0.000 description 1
- 101710151245 Receptor-type tyrosine-protein kinase FLT3 Proteins 0.000 description 1
- 208000034189 Sclerosis Diseases 0.000 description 1
- 208000000453 Skin Neoplasms Diseases 0.000 description 1
- 208000000102 Squamous Cell Carcinoma of Head and Neck Diseases 0.000 description 1
- 208000036765 Squamous cell carcinoma of the esophagus Diseases 0.000 description 1
- 101000677856 Stenotrophomonas maltophilia (strain K279a) Actin-binding protein Smlt3054 Proteins 0.000 description 1
- 241000193998 Streptococcus pneumoniae Species 0.000 description 1
- 238000006161 Suzuki-Miyaura coupling reaction Methods 0.000 description 1
- 230000006044 T cell activation Effects 0.000 description 1
- 102100024834 T-cell immunoreceptor with Ig and ITIM domains Human genes 0.000 description 1
- 102100033456 TGF-beta receptor type-1 Human genes 0.000 description 1
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 1
- FOCVUCIESVLUNU-UHFFFAOYSA-N Thiotepa Chemical compound C1CN1P(N1CC1)(=S)N1CC1 FOCVUCIESVLUNU-UHFFFAOYSA-N 0.000 description 1
- 208000033781 Thyroid carcinoma Diseases 0.000 description 1
- 102000002689 Toll-like receptor Human genes 0.000 description 1
- 108020000411 Toll-like receptor Proteins 0.000 description 1
- 229940123384 Toll-like receptor (TLR) agonist Drugs 0.000 description 1
- 206010044221 Toxic encephalopathy Diseases 0.000 description 1
- 102100033728 Tumor necrosis factor receptor superfamily member 18 Human genes 0.000 description 1
- 101710165473 Tumor necrosis factor receptor superfamily member 4 Proteins 0.000 description 1
- 235000012545 Vaccinium macrocarpon Nutrition 0.000 description 1
- 235000002118 Vaccinium oxycoccus Nutrition 0.000 description 1
- 235000009754 Vitis X bourquina Nutrition 0.000 description 1
- 235000012333 Vitis X labruscana Nutrition 0.000 description 1
- 240000006365 Vitis vinifera Species 0.000 description 1
- 235000014787 Vitis vinifera Nutrition 0.000 description 1
- WHXGJDDMDMRMBZ-UHFFFAOYSA-M [Br+].C(C)(=O)[O-] Chemical compound [Br+].C(C)(=O)[O-] WHXGJDDMDMRMBZ-UHFFFAOYSA-M 0.000 description 1
- UGAPHEBNTGUMBB-UHFFFAOYSA-N acetic acid;ethyl acetate Chemical compound CC(O)=O.CCOC(C)=O UGAPHEBNTGUMBB-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- RJURFGZVJUQBHK-IIXSONLDSA-N actinomycin D Chemical compound C[C@H]1OC(=O)[C@H](C(C)C)N(C)C(=O)CN(C)C(=O)[C@@H]2CCCN2C(=O)[C@@H](C(C)C)NC(=O)[C@H]1NC(=O)C1=C(N)C(=O)C(C)=C2OC(C(C)=CC=C3C(=O)N[C@@H]4C(=O)N[C@@H](C(N5CCC[C@H]5C(=O)N(C)CC(=O)N(C)[C@@H](C(C)C)C(=O)O[C@@H]4C)=O)C(C)C)=C3N=C21 RJURFGZVJUQBHK-IIXSONLDSA-N 0.000 description 1
- 239000012190 activator Substances 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 239000002467 adenosine A2a receptor antagonist Substances 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 229960001686 afatinib Drugs 0.000 description 1
- ULXXDDBFHOBEHA-CWDCEQMOSA-N afatinib Chemical compound N1=CN=C2C=C(O[C@@H]3COCC3)C(NC(=O)/C=C/CN(C)C)=CC2=C1NC1=CC=C(F)C(Cl)=C1 ULXXDDBFHOBEHA-CWDCEQMOSA-N 0.000 description 1
- 238000005882 aldol condensation reaction Methods 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 208000026935 allergic disease Diseases 0.000 description 1
- 230000000735 allogeneic effect Effects 0.000 description 1
- 230000003281 allosteric effect Effects 0.000 description 1
- VREFGVBLTWBCJP-UHFFFAOYSA-N alprazolam Chemical compound C12=CC(Cl)=CC=C2N2C(C)=NN=C2CN=C1C1=CC=CC=C1 VREFGVBLTWBCJP-UHFFFAOYSA-N 0.000 description 1
- 229960000473 altretamine Drugs 0.000 description 1
- IVHKZGYFKJRXBD-UHFFFAOYSA-N amino carbamate Chemical compound NOC(N)=O IVHKZGYFKJRXBD-UHFFFAOYSA-N 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 235000019418 amylase Nutrition 0.000 description 1
- 229960002932 anastrozole Drugs 0.000 description 1
- YBBLVLTVTVSKRW-UHFFFAOYSA-N anastrozole Chemical compound N#CC(C)(C)C1=CC(C(C)(C#N)C)=CC(CN2N=CN=C2)=C1 YBBLVLTVTVSKRW-UHFFFAOYSA-N 0.000 description 1
- 239000002870 angiogenesis inducing agent Substances 0.000 description 1
- 239000004037 angiogenesis inhibitor Substances 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- 230000008485 antagonism Effects 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 230000003110 anti-inflammatory effect Effects 0.000 description 1
- 230000000781 anti-lymphocytic effect Effects 0.000 description 1
- 230000001399 anti-metabolic effect Effects 0.000 description 1
- 229940088710 antibiotic agent Drugs 0.000 description 1
- 230000001640 apoptogenic effect Effects 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 150000003934 aromatic aldehydes Chemical class 0.000 description 1
- 206010003246 arthritis Diseases 0.000 description 1
- 150000001499 aryl bromides Chemical class 0.000 description 1
- 150000001502 aryl halides Chemical class 0.000 description 1
- 229960003852 atezolizumab Drugs 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 208000022185 autosomal dominant polycystic kidney disease Diseases 0.000 description 1
- 229940120638 avastin Drugs 0.000 description 1
- 229950002916 avelumab Drugs 0.000 description 1
- 229960003005 axitinib Drugs 0.000 description 1
- RITAVMQDGBJQJZ-FMIVXFBMSA-N axitinib Chemical compound CNC(=O)C1=CC=CC=C1SC1=CC=C(C(\C=C\C=2N=CC=CC=2)=NN2)C2=C1 RITAVMQDGBJQJZ-FMIVXFBMSA-N 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- UIJGNTRUPZPVNG-UHFFFAOYSA-N benzenecarbothioic s-acid Chemical compound SC(=O)C1=CC=CC=C1 UIJGNTRUPZPVNG-UHFFFAOYSA-N 0.000 description 1
- XSCHRSMBECNVNS-UHFFFAOYSA-N benzopyrazine Natural products N1=CC=NC2=CC=CC=C21 XSCHRSMBECNVNS-UHFFFAOYSA-N 0.000 description 1
- 125000005874 benzothiadiazolyl group Chemical group 0.000 description 1
- 125000002618 bicyclic heterocycle group Chemical group 0.000 description 1
- 229950003054 binimetinib Drugs 0.000 description 1
- 230000000975 bioactive effect Effects 0.000 description 1
- 229960001561 bleomycin Drugs 0.000 description 1
- OYVAGSVQBOHSSS-UAPAGMARSA-O bleomycin A2 Chemical compound N([C@H](C(=O)N[C@H](C)[C@@H](O)[C@H](C)C(=O)N[C@@H]([C@H](O)C)C(=O)NCCC=1SC=C(N=1)C=1SC=C(N=1)C(=O)NCCC[S+](C)C)[C@@H](O[C@H]1[C@H]([C@@H](O)[C@H](O)[C@H](CO)O1)O[C@@H]1[C@H]([C@@H](OC(N)=O)[C@H](O)[C@@H](CO)O1)O)C=1N=CNC=1)C(=O)C1=NC([C@H](CC(N)=O)NC[C@H](N)C(N)=O)=NC(N)=C1C OYVAGSVQBOHSSS-UAPAGMARSA-O 0.000 description 1
- 229960003008 blinatumomab Drugs 0.000 description 1
- 210000000988 bone and bone Anatomy 0.000 description 1
- 210000004556 brain Anatomy 0.000 description 1
- 210000000481 breast Anatomy 0.000 description 1
- KMGBZBJJOKUPIA-UHFFFAOYSA-N butyl iodide Chemical compound CCCCI KMGBZBJJOKUPIA-UHFFFAOYSA-N 0.000 description 1
- PNFBLCAFHFTYMT-UHFFFAOYSA-N butylamino formate Chemical compound CCCCNOC=O PNFBLCAFHFTYMT-UHFFFAOYSA-N 0.000 description 1
- 125000004744 butyloxycarbonyl group Chemical group 0.000 description 1
- 230000009702 cancer cell proliferation Effects 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000001951 carbamoylamino group Chemical group C(N)(=O)N* 0.000 description 1
- OWIUPIRUAQMTTK-UHFFFAOYSA-N carbazic acid Chemical compound NNC(O)=O OWIUPIRUAQMTTK-UHFFFAOYSA-N 0.000 description 1
- 125000002837 carbocyclic group Chemical group 0.000 description 1
- 150000001720 carbohydrates Chemical class 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 210000000845 cartilage Anatomy 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 229960000590 celecoxib Drugs 0.000 description 1
- RZEKVGVHFLEQIL-UHFFFAOYSA-N celecoxib Chemical compound C1=CC(C)=CC=C1C1=CC(C(F)(F)F)=NN1C1=CC=C(S(N)(=O)=O)C=C1 RZEKVGVHFLEQIL-UHFFFAOYSA-N 0.000 description 1
- 230000021164 cell adhesion Effects 0.000 description 1
- 230000010261 cell growth Effects 0.000 description 1
- 230000007969 cellular immunity Effects 0.000 description 1
- 229960005395 cetuximab Drugs 0.000 description 1
- 238000012512 characterization method Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000012627 chemopreventive agent Substances 0.000 description 1
- 229940124443 chemopreventive agent Drugs 0.000 description 1
- 229940044683 chemotherapy drug Drugs 0.000 description 1
- 229960004630 chlorambucil Drugs 0.000 description 1
- JCKYGMPEJWAADB-UHFFFAOYSA-N chlorambucil Chemical compound OC(=O)CCCC1=CC=C(N(CCCl)CCCl)C=C1 JCKYGMPEJWAADB-UHFFFAOYSA-N 0.000 description 1
- AVPBPSOSZLWRDN-UHFFFAOYSA-M chloropalladium(1+);methanidylbenzene;triphenylphosphane Chemical compound [Pd+]Cl.[CH2-]C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 AVPBPSOSZLWRDN-UHFFFAOYSA-M 0.000 description 1
- 210000001612 chondrocyte Anatomy 0.000 description 1
- 208000037516 chromosome inversion disease Diseases 0.000 description 1
- RESIMIUSNACMNW-BXRWSSRYSA-N cobimetinib fumarate Chemical compound OC(=O)\C=C\C(O)=O.C1C(O)([C@H]2NCCCC2)CN1C(=O)C1=CC=C(F)C(F)=C1NC1=CC=C(I)C=C1F.C1C(O)([C@H]2NCCCC2)CN1C(=O)C1=CC=C(F)C(F)=C1NC1=CC=C(I)C=C1F RESIMIUSNACMNW-BXRWSSRYSA-N 0.000 description 1
- 230000003920 cognitive function Effects 0.000 description 1
- 238000011284 combination treatment Methods 0.000 description 1
- 238000004891 communication Methods 0.000 description 1
- 239000002131 composite material Substances 0.000 description 1
- 239000003433 contraceptive agent Substances 0.000 description 1
- 230000002254 contraceptive effect Effects 0.000 description 1
- 230000001276 controlling effect Effects 0.000 description 1
- 108091008034 costimulatory receptors Proteins 0.000 description 1
- 235000021019 cranberries Nutrition 0.000 description 1
- 235000004634 cranberry Nutrition 0.000 description 1
- 239000013058 crude material Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 150000001924 cycloalkanes Chemical class 0.000 description 1
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 description 1
- RGBVWCQARBEPPW-UHFFFAOYSA-N cyclobut-3-ene-1,2-dione Chemical compound O=C1C=CC1=O RGBVWCQARBEPPW-UHFFFAOYSA-N 0.000 description 1
- 125000001352 cyclobutyloxy group Chemical group C1(CCC1)O* 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- USVZFSNDGFNNJT-UHFFFAOYSA-N cyclopenta-1,4-dien-1-yl(diphenyl)phosphane (2,3-dichlorocyclopenta-1,4-dien-1-yl)-diphenylphosphane iron(2+) Chemical compound [Fe++].c1cc[c-](c1)P(c1ccccc1)c1ccccc1.Clc1c(cc[c-]1Cl)P(c1ccccc1)c1ccccc1 USVZFSNDGFNNJT-UHFFFAOYSA-N 0.000 description 1
- 125000001887 cyclopentyloxy group Chemical group C1(CCCC1)O* 0.000 description 1
- 230000037416 cystogenesis Effects 0.000 description 1
- 229960000684 cytarabine Drugs 0.000 description 1
- 229940127071 cytotoxic antineoplastic agent Drugs 0.000 description 1
- 229960002465 dabrafenib Drugs 0.000 description 1
- BFSMGDJOXZAERB-UHFFFAOYSA-N dabrafenib Chemical compound S1C(C(C)(C)C)=NC(C=2C(=C(NS(=O)(=O)C=3C(=CC=CC=3F)F)C=CC=2)F)=C1C1=CC=NC(N)=N1 BFSMGDJOXZAERB-UHFFFAOYSA-N 0.000 description 1
- 229950007409 dacetuzumab Drugs 0.000 description 1
- 229960000640 dactinomycin Drugs 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- STQGQHZAVUOBTE-VGBVRHCVSA-N daunorubicin Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(C)=O)[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 STQGQHZAVUOBTE-VGBVRHCVSA-N 0.000 description 1
- 229960000975 daunorubicin Drugs 0.000 description 1
- DEZRYPDIMOWBDS-UHFFFAOYSA-N dcm dichloromethane Chemical compound ClCCl.ClCCl DEZRYPDIMOWBDS-UHFFFAOYSA-N 0.000 description 1
- 230000020335 dealkylation Effects 0.000 description 1
- 238000006900 dealkylation reaction Methods 0.000 description 1
- 230000034994 death Effects 0.000 description 1
- 230000007812 deficiency Effects 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 125000004431 deuterium atom Chemical group 0.000 description 1
- JGFBRKRYDCGYKD-UHFFFAOYSA-N dibutyl(oxo)tin Chemical compound CCCC[Sn](=O)CCCC JGFBRKRYDCGYKD-UHFFFAOYSA-N 0.000 description 1
- BSHICDXRSZQYBP-UHFFFAOYSA-N dichloromethane;palladium(2+) Chemical compound [Pd+2].ClCCl BSHICDXRSZQYBP-UHFFFAOYSA-N 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- LFQCJSBXBZRMTN-OAQYLSRUSA-N diflomotecan Chemical compound CC[C@@]1(O)CC(=O)OCC(C2=O)=C1C=C1N2CC2=CC3=CC(F)=C(F)C=C3N=C21 LFQCJSBXBZRMTN-OAQYLSRUSA-N 0.000 description 1
- UXGNZZKBCMGWAZ-UHFFFAOYSA-N dimethylformamide dmf Chemical compound CN(C)C=O.CN(C)C=O UXGNZZKBCMGWAZ-UHFFFAOYSA-N 0.000 description 1
- 230000005750 disease progression Effects 0.000 description 1
- 229960004679 doxorubicin Drugs 0.000 description 1
- 229950009791 durvalumab Drugs 0.000 description 1
- 229940121647 egfr inhibitor Drugs 0.000 description 1
- 239000012039 electrophile Substances 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- KAQREZSTQZWNAG-GDLZYMKVSA-N elomotecan Chemical compound C([C@]1(O)CC)C(=O)OCC(C(N2CC3=4)=O)=C1C=C2C3=NC1=CC(Cl)=C(C)C=C1C=4CN1CCC(C)CC1 KAQREZSTQZWNAG-GDLZYMKVSA-N 0.000 description 1
- 229950003007 elomotecan Drugs 0.000 description 1
- 229950004647 emactuzumab Drugs 0.000 description 1
- 239000002532 enzyme inhibitor Substances 0.000 description 1
- 229950006370 epacadostat Drugs 0.000 description 1
- 229960001904 epirubicin Drugs 0.000 description 1
- 229960001123 epoprostenol Drugs 0.000 description 1
- 229960001433 erlotinib Drugs 0.000 description 1
- AAKJLRGGTJKAMG-UHFFFAOYSA-N erlotinib Chemical compound C=12C=C(OCCOC)C(OCCOC)=CC2=NC=NC=1NC1=CC=CC(C#C)=C1 AAKJLRGGTJKAMG-UHFFFAOYSA-N 0.000 description 1
- 208000007276 esophageal squamous cell carcinoma Diseases 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 238000010931 ester hydrolysis Methods 0.000 description 1
- FRPJXPJMRWBBIH-RBRWEJTLSA-N estramustine Chemical compound ClCCN(CCCl)C(=O)OC1=CC=C2[C@H]3CC[C@](C)([C@H](CC4)O)[C@@H]4[C@@H]3CCC2=C1 FRPJXPJMRWBBIH-RBRWEJTLSA-N 0.000 description 1
- 229960001842 estramustine Drugs 0.000 description 1
- OCLXJTCGWSSVOE-UHFFFAOYSA-N ethanol etoh Chemical compound CCO.CCO OCLXJTCGWSSVOE-UHFFFAOYSA-N 0.000 description 1
- 125000005448 ethoxyethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- PQJJJMRNHATNKG-UHFFFAOYSA-N ethyl bromoacetate Chemical compound CCOC(=O)CBr PQJJJMRNHATNKG-UHFFFAOYSA-N 0.000 description 1
- OJCSPXHYDFONPU-UHFFFAOYSA-N etoac etoac Chemical compound CCOC(C)=O.CCOC(C)=O OJCSPXHYDFONPU-UHFFFAOYSA-N 0.000 description 1
- 230000017188 evasion or tolerance of host immune response Effects 0.000 description 1
- 102000013165 exonuclease Human genes 0.000 description 1
- 210000002744 extracellular matrix Anatomy 0.000 description 1
- 229950011548 fadrozole Drugs 0.000 description 1
- 229940124981 favezelimab Drugs 0.000 description 1
- 231100000502 fertility decrease Toxicity 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 229960000390 fludarabine Drugs 0.000 description 1
- GIUYCYHIANZCFB-FJFJXFQQSA-N fludarabine phosphate Chemical compound C1=NC=2C(N)=NC(F)=NC=2N1[C@@H]1O[C@H](COP(O)(O)=O)[C@@H](O)[C@@H]1O GIUYCYHIANZCFB-FJFJXFQQSA-N 0.000 description 1
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 1
- 229940014144 folate Drugs 0.000 description 1
- 229960000304 folic acid Drugs 0.000 description 1
- VVIAGPKUTFNRDU-ABLWVSNPSA-N folinic acid Chemical compound C1NC=2NC(N)=NC(=O)C=2N(C=O)C1CNC1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 VVIAGPKUTFNRDU-ABLWVSNPSA-N 0.000 description 1
- 235000008191 folinic acid Nutrition 0.000 description 1
- 239000011672 folinic acid Substances 0.000 description 1
- 229960004421 formestane Drugs 0.000 description 1
- OSVMTWJCGUFAOD-KZQROQTASA-N formestane Chemical compound O=C1CC[C@]2(C)[C@H]3CC[C@](C)(C(CC4)=O)[C@@H]4[C@@H]3CCC2=C1O OSVMTWJCGUFAOD-KZQROQTASA-N 0.000 description 1
- WBJINCZRORDGAQ-UHFFFAOYSA-N formic acid ethyl ester Natural products CCOC=O WBJINCZRORDGAQ-UHFFFAOYSA-N 0.000 description 1
- 229960004783 fotemustine Drugs 0.000 description 1
- YAKWPXVTIGTRJH-UHFFFAOYSA-N fotemustine Chemical compound CCOP(=O)(OCC)C(C)NC(=O)N(CCCl)N=O YAKWPXVTIGTRJH-UHFFFAOYSA-N 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 102000037865 fusion proteins Human genes 0.000 description 1
- 108020001507 fusion proteins Proteins 0.000 description 1
- 210000001035 gastrointestinal tract Anatomy 0.000 description 1
- 229960002584 gefitinib Drugs 0.000 description 1
- XGALLCVXEZPNRQ-UHFFFAOYSA-N gefitinib Chemical compound C=12C=C(OCCCN3CCOCC3)C(OC)=CC2=NC=NC=1NC1=CC=C(F)C(Cl)=C1 XGALLCVXEZPNRQ-UHFFFAOYSA-N 0.000 description 1
- 238000003209 gene knockout Methods 0.000 description 1
- 238000012637 gene transfection Methods 0.000 description 1
- 230000002068 genetic effect Effects 0.000 description 1
- 239000003862 glucocorticoid Substances 0.000 description 1
- 150000002332 glycine derivatives Chemical class 0.000 description 1
- 230000034659 glycolysis Effects 0.000 description 1
- 201000000459 head and neck squamous cell carcinoma Diseases 0.000 description 1
- UUVWYPNAQBNQJQ-UHFFFAOYSA-N hexamethylmelamine Chemical compound CN(C)C1=NC(N(C)C)=NC(N(C)C)=N1 UUVWYPNAQBNQJQ-UHFFFAOYSA-N 0.000 description 1
- 230000005745 host immune response Effects 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 229950007440 icotinib Drugs 0.000 description 1
- QQLKULDARVNMAL-UHFFFAOYSA-N icotinib Chemical compound C#CC1=CC=CC(NC=2C3=CC=4OCCOCCOCCOC=4C=C3N=CN=2)=C1 QQLKULDARVNMAL-UHFFFAOYSA-N 0.000 description 1
- 229960000908 idarubicin Drugs 0.000 description 1
- 125000003037 imidazol-2-yl group Chemical group [H]N1C([*])=NC([H])=C1[H] 0.000 description 1
- 229960002751 imiquimod Drugs 0.000 description 1
- DOUYETYNHWVLEO-UHFFFAOYSA-N imiquimod Chemical compound C1=CC=CC2=C3N(CC(C)C)C=NC3=C(N)N=C21 DOUYETYNHWVLEO-UHFFFAOYSA-N 0.000 description 1
- 230000005934 immune activation Effects 0.000 description 1
- 102000027596 immune receptors Human genes 0.000 description 1
- 108091008915 immune receptors Proteins 0.000 description 1
- 229940127130 immunocytokine Drugs 0.000 description 1
- 230000004957 immunoregulator effect Effects 0.000 description 1
- 230000001976 improved effect Effects 0.000 description 1
- 238000000099 in vitro assay Methods 0.000 description 1
- 229910052738 indium Inorganic materials 0.000 description 1
- 125000000814 indol-3-yl group Chemical group [H]C1=C([H])C([H])=C2N([H])C([H])=C([*])C2=C1[H] 0.000 description 1
- 125000004531 indol-5-yl group Chemical group [H]N1C([H])=C([H])C2=C([H])C(*)=C([H])C([H])=C12 0.000 description 1
- IENZCGNHSIMFJE-UHFFFAOYSA-N indole-5-carboxylic acid Chemical compound OC(=O)C1=CC=C2NC=CC2=C1 IENZCGNHSIMFJE-UHFFFAOYSA-N 0.000 description 1
- 229950009034 indoximod Drugs 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 230000002757 inflammatory effect Effects 0.000 description 1
- 230000028709 inflammatory response Effects 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 238000011368 intensive chemotherapy Methods 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 238000007917 intracranial administration Methods 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- SNHMUERNLJLMHN-UHFFFAOYSA-N iodobenzene Chemical compound IC1=CC=CC=C1 SNHMUERNLJLMHN-UHFFFAOYSA-N 0.000 description 1
- 230000005865 ionizing radiation Effects 0.000 description 1
- 229960005386 ipilimumab Drugs 0.000 description 1
- 125000002510 isobutoxy group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])O* 0.000 description 1
- 125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 description 1
- 125000004501 isothiazol-5-yl group Chemical group S1N=CC=C1* 0.000 description 1
- 230000000155 isotopic effect Effects 0.000 description 1
- 125000004284 isoxazol-3-yl group Chemical group [H]C1=C([H])C(*)=NO1 0.000 description 1
- 125000004499 isoxazol-5-yl group Chemical group O1N=CC=C1* 0.000 description 1
- FABUFPQFXZVHFB-CFWQTKTJSA-N ixabepilone Chemical compound C/C([C@@H]1C[C@@H]2O[C@]2(C)CCC[C@@H]([C@@H]([C@H](C)C(=O)C(C)(C)[C@H](O)CC(=O)N1)O)C)=C\C1=CSC(C)=N1 FABUFPQFXZVHFB-CFWQTKTJSA-N 0.000 description 1
- 229960002014 ixabepilone Drugs 0.000 description 1
- 230000002147 killing effect Effects 0.000 description 1
- 229960004891 lapatinib Drugs 0.000 description 1
- BCFGMOOMADDAQU-UHFFFAOYSA-N lapatinib Chemical compound O1C(CNCCS(=O)(=O)C)=CC=C1C1=CC=C(N=CN=C2NC=3C=C(Cl)C(OCC=4C=C(F)C=CC=4)=CC=3)C2=C1 BCFGMOOMADDAQU-UHFFFAOYSA-N 0.000 description 1
- 229960004942 lenalidomide Drugs 0.000 description 1
- GOTYRUGSSMKFNF-UHFFFAOYSA-N lenalidomide Chemical compound C1C=2C(N)=CC=CC=2C(=O)N1C1CCC(=O)NC1=O GOTYRUGSSMKFNF-UHFFFAOYSA-N 0.000 description 1
- 229960003881 letrozole Drugs 0.000 description 1
- HPJKCIUCZWXJDR-UHFFFAOYSA-N letrozole Chemical compound C1=CC(C#N)=CC=C1C(N1N=CN=C1)C1=CC=C(C#N)C=C1 HPJKCIUCZWXJDR-UHFFFAOYSA-N 0.000 description 1
- 229960001691 leucovorin Drugs 0.000 description 1
- 210000000265 leukocyte Anatomy 0.000 description 1
- CMJCXYNUCSMDBY-ZDUSSCGKSA-N lgx818 Chemical compound COC(=O)N[C@@H](C)CNC1=NC=CC(C=2C(=NN(C=2)C(C)C)C=2C(=C(NS(C)(=O)=O)C=C(Cl)C=2)F)=N1 CMJCXYNUCSMDBY-ZDUSSCGKSA-N 0.000 description 1
- 125000005647 linker group Chemical group 0.000 description 1
- GZQKNULLWNGMCW-PWQABINMSA-N lipid A (E. coli) Chemical compound O1[C@H](CO)[C@@H](OP(O)(O)=O)[C@H](OC(=O)C[C@@H](CCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC)[C@@H](NC(=O)C[C@@H](CCCCCCCCCCC)OC(=O)CCCCCCCCCCC)[C@@H]1OC[C@@H]1[C@@H](O)[C@H](OC(=O)C[C@H](O)CCCCCCCCCCC)[C@@H](NC(=O)C[C@H](O)CCCCCCCCCCC)[C@@H](OP(O)(O)=O)O1 GZQKNULLWNGMCW-PWQABINMSA-N 0.000 description 1
- 238000002514 liquid chromatography mass spectrum Methods 0.000 description 1
- 229950011263 lirilumab Drugs 0.000 description 1
- 238000006138 lithiation reaction Methods 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- OVEHNNQXLPJPPL-UHFFFAOYSA-N lithium;n-propan-2-ylpropan-2-amine Chemical compound [Li].CC(C)NC(C)C OVEHNNQXLPJPPL-UHFFFAOYSA-N 0.000 description 1
- 229960002247 lomustine Drugs 0.000 description 1
- 229950004563 lucatumumab Drugs 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- 201000005243 lung squamous cell carcinoma Diseases 0.000 description 1
- RMGJCSHZTFKPNO-UHFFFAOYSA-M magnesium;ethene;bromide Chemical compound [Mg+2].[Br-].[CH-]=C RMGJCSHZTFKPNO-UHFFFAOYSA-M 0.000 description 1
- UGVPKMAWLOMPRS-UHFFFAOYSA-M magnesium;propane;bromide Chemical compound [Mg+2].[Br-].CC[CH2-] UGVPKMAWLOMPRS-UHFFFAOYSA-M 0.000 description 1
- 230000003211 malignant effect Effects 0.000 description 1
- 210000001161 mammalian embryo Anatomy 0.000 description 1
- 238000004949 mass spectrometry Methods 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 230000035800 maturation Effects 0.000 description 1
- 229950008001 matuzumab Drugs 0.000 description 1
- BCVXHSPFUWZLGQ-UHFFFAOYSA-N mecn acetonitrile Chemical compound CC#N.CC#N BCVXHSPFUWZLGQ-UHFFFAOYSA-N 0.000 description 1
- COTNUBDHGSIOTA-UHFFFAOYSA-N meoh methanol Chemical compound OC.OC COTNUBDHGSIOTA-UHFFFAOYSA-N 0.000 description 1
- 229960001428 mercaptopurine Drugs 0.000 description 1
- 230000002503 metabolic effect Effects 0.000 description 1
- HNQIVZYLYMDVSB-UHFFFAOYSA-N methanesulfonimidic acid Chemical compound CS(N)(=O)=O HNQIVZYLYMDVSB-UHFFFAOYSA-N 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- SVSWELAZKXYRAS-UHFFFAOYSA-N methyl 2-(3-ethoxythiophen-2-yl)acetate Chemical compound C(C)OC1=C(SC=C1)CC(=O)OC SVSWELAZKXYRAS-UHFFFAOYSA-N 0.000 description 1
- YDCHPLOFQATIDS-UHFFFAOYSA-N methyl 2-bromoacetate Chemical compound COC(=O)CBr YDCHPLOFQATIDS-UHFFFAOYSA-N 0.000 description 1
- USISXVGMIYAORQ-UHFFFAOYSA-N methyl 3-ethoxy-5-(6-methoxypyrimidin-4-yl)thiophene-2-carboxylate Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)OC)C(=O)OC USISXVGMIYAORQ-UHFFFAOYSA-N 0.000 description 1
- HCPPHYVWHKESMA-UHFFFAOYSA-N methyl 4-bromo-1-methylindole-7-carboxylate Chemical compound COC(=O)C1=CC=C(Br)C2=C1N(C)C=C2 HCPPHYVWHKESMA-UHFFFAOYSA-N 0.000 description 1
- KQSSATDQUYCRGS-UHFFFAOYSA-N methyl glycinate Chemical compound COC(=O)CN KQSSATDQUYCRGS-UHFFFAOYSA-N 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- 125000004092 methylthiomethyl group Chemical group [H]C([H])([H])SC([H])([H])* 0.000 description 1
- 210000000274 microglia Anatomy 0.000 description 1
- 230000003228 microsomal effect Effects 0.000 description 1
- 230000003278 mimic effect Effects 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 229960004857 mitomycin Drugs 0.000 description 1
- 229960001156 mitoxantrone Drugs 0.000 description 1
- KKZJGLLVHKMTCM-UHFFFAOYSA-N mitoxantrone Chemical compound O=C1C2=C(O)C=CC(O)=C2C(=O)C2=C1C(NCCNCCO)=CC=C2NCCNCCO KKZJGLLVHKMTCM-UHFFFAOYSA-N 0.000 description 1
- QUSNBJAOOMFDIB-UHFFFAOYSA-N monoethyl amine Natural products CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 1
- 125000002757 morpholinyl group Chemical group 0.000 description 1
- WOOWBQQQJXZGIE-UHFFFAOYSA-N n-ethyl-n-propan-2-ylpropan-2-amine Chemical compound CCN(C(C)C)C(C)C.CCN(C(C)C)C(C)C WOOWBQQQJXZGIE-UHFFFAOYSA-N 0.000 description 1
- KCXYZMFPZHYUFO-UHFFFAOYSA-N n-methyl-n-phosphanylmethanamine Chemical compound CN(C)P KCXYZMFPZHYUFO-UHFFFAOYSA-N 0.000 description 1
- 230000017074 necrotic cell death Effects 0.000 description 1
- 238000011227 neoadjuvant chemotherapy Methods 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 230000010309 neoplastic transformation Effects 0.000 description 1
- 210000000276 neural tube Anatomy 0.000 description 1
- 210000004498 neuroglial cell Anatomy 0.000 description 1
- 230000003959 neuroinflammation Effects 0.000 description 1
- 230000003961 neuronal insult Effects 0.000 description 1
- 230000000324 neuroprotective effect Effects 0.000 description 1
- 230000007135 neurotoxicity Effects 0.000 description 1
- 231100000228 neurotoxicity Toxicity 0.000 description 1
- 229950010203 nimotuzumab Drugs 0.000 description 1
- 125000000449 nitro group Chemical class [O-][N+](*)=O 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 1
- 229960003301 nivolumab Drugs 0.000 description 1
- 125000006574 non-aromatic ring group Chemical group 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 239000002773 nucleotide Substances 0.000 description 1
- 125000003729 nucleotide group Chemical group 0.000 description 1
- 235000015097 nutrients Nutrition 0.000 description 1
- 238000005457 optimization Methods 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 125000004287 oxazol-2-yl group Chemical group [H]C1=C([H])N=C(*)O1 0.000 description 1
- 125000004304 oxazol-5-yl group Chemical group O1C=NC=C1* 0.000 description 1
- 125000003566 oxetanyl group Chemical group 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 230000004792 oxidative damage Effects 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- LXNAVEXFUKBNMK-UHFFFAOYSA-N palladium(II) acetate Substances [Pd].CC(O)=O.CC(O)=O LXNAVEXFUKBNMK-UHFFFAOYSA-N 0.000 description 1
- PIBWKRNGBLPSSY-UHFFFAOYSA-L palladium(II) chloride Chemical compound Cl[Pd]Cl PIBWKRNGBLPSSY-UHFFFAOYSA-L 0.000 description 1
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 1
- 229960001972 panitumumab Drugs 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 230000037361 pathway Effects 0.000 description 1
- 239000013610 patient sample Substances 0.000 description 1
- JGWRKYUXBBNENE-UHFFFAOYSA-N pexidartinib Chemical compound C1=NC(C(F)(F)F)=CC=C1CNC(N=C1)=CC=C1CC1=CNC2=NC=C(Cl)C=C12 JGWRKYUXBBNENE-UHFFFAOYSA-N 0.000 description 1
- 230000009038 pharmacological inhibition Effects 0.000 description 1
- DLRJIFUOBPOJNS-UHFFFAOYSA-N phenetole Chemical compound CCOC1=CC=CC=C1 DLRJIFUOBPOJNS-UHFFFAOYSA-N 0.000 description 1
- 229910000073 phosphorus hydride Inorganic materials 0.000 description 1
- 238000002428 photodynamic therapy Methods 0.000 description 1
- IVDFJHOHABJVEH-UHFFFAOYSA-N pinacol Chemical class CC(C)(O)C(C)(C)O IVDFJHOHABJVEH-UHFFFAOYSA-N 0.000 description 1
- 231100000614 poison Toxicity 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 208000015768 polyposis Diseases 0.000 description 1
- 229960000688 pomalidomide Drugs 0.000 description 1
- UVSMNLNDYGZFPF-UHFFFAOYSA-N pomalidomide Chemical compound O=C1C=2C(N)=CC=CC=2C(=O)N1C1CCC(=O)NC1=O UVSMNLNDYGZFPF-UHFFFAOYSA-N 0.000 description 1
- 235000011056 potassium acetate Nutrition 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 230000035935 pregnancy Effects 0.000 description 1
- 230000002062 proliferating effect Effects 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 238000010926 purge Methods 0.000 description 1
- 125000004307 pyrazin-2-yl group Chemical group [H]C1=C([H])N=C(*)C([H])=N1 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- OYRRZWATULMEPF-UHFFFAOYSA-N pyrimidin-4-amine Chemical compound NC1=CC=NC=N1 OYRRZWATULMEPF-UHFFFAOYSA-N 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- JWVCLYRUEFBMGU-UHFFFAOYSA-N quinazoline Chemical compound N1=CN=CC2=CC=CC=C21 JWVCLYRUEFBMGU-UHFFFAOYSA-N 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 125000004550 quinolin-6-yl group Chemical group N1=CC=CC2=CC(=CC=C12)* 0.000 description 1
- 229960002633 ramucirumab Drugs 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 229940075993 receptor modulator Drugs 0.000 description 1
- 230000007115 recruitment Effects 0.000 description 1
- 238000006722 reduction reaction Methods 0.000 description 1
- 230000000246 remedial effect Effects 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- BXNMTOQRYBFHNZ-UHFFFAOYSA-N resiquimod Chemical compound C1=CC=CC2=C(N(C(COCC)=N3)CC(C)(C)O)C3=C(N)N=C21 BXNMTOQRYBFHNZ-UHFFFAOYSA-N 0.000 description 1
- 229950010550 resiquimod Drugs 0.000 description 1
- 230000004043 responsiveness Effects 0.000 description 1
- 206010039073 rheumatoid arthritis Diseases 0.000 description 1
- 125000006413 ring segment Chemical group 0.000 description 1
- 238000011808 rodent model Methods 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- CYOHGALHFOKKQC-UHFFFAOYSA-N selumetinib Chemical compound OCCONC(=O)C=1C=C2N(C)C=NC2=C(F)C=1NC1=CC=C(Br)C=C1Cl CYOHGALHFOKKQC-UHFFFAOYSA-N 0.000 description 1
- 230000001235 sensitizing effect Effects 0.000 description 1
- CLDWGXZGFUNWKB-UHFFFAOYSA-M silver;benzoate Chemical compound [Ag+].[O-]C(=O)C1=CC=CC=C1 CLDWGXZGFUNWKB-UHFFFAOYSA-M 0.000 description 1
- 201000000849 skin cancer Diseases 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- WRIKHQLVHPKCJU-UHFFFAOYSA-N sodium bis(trimethylsilyl)amide Chemical compound C[Si](C)(C)N([Na])[Si](C)(C)C WRIKHQLVHPKCJU-UHFFFAOYSA-N 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 229950007213 spartalizumab Drugs 0.000 description 1
- VNFWTIYUKDMAOP-UHFFFAOYSA-N sphos Chemical compound COC1=CC=CC(OC)=C1C1=CC=CC=C1P(C1CCCCC1)C1CCCCC1 VNFWTIYUKDMAOP-UHFFFAOYSA-N 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 150000003431 steroids Chemical class 0.000 description 1
- 238000005728 strengthening Methods 0.000 description 1
- 229940031000 streptococcus pneumoniae Drugs 0.000 description 1
- 229960001052 streptozocin Drugs 0.000 description 1
- ZSJLQEPLLKMAKR-GKHCUFPYSA-N streptozocin Chemical compound O=NN(C)C(=O)N[C@H]1[C@@H](O)O[C@H](CO)[C@@H](O)[C@@H]1O ZSJLQEPLLKMAKR-GKHCUFPYSA-N 0.000 description 1
- 230000001629 suppression Effects 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 210000001179 synovial fluid Anatomy 0.000 description 1
- ATFXVNUWQOXRRU-UHFFFAOYSA-N taminadenant Chemical compound BrC=1C(N)=NC(N2N=CC=C2)=NC=1N1C=CC=N1 ATFXVNUWQOXRRU-UHFFFAOYSA-N 0.000 description 1
- 230000008685 targeting Effects 0.000 description 1
- 229940126625 tavolimab Drugs 0.000 description 1
- NRUKOCRGYNPUPR-QBPJDGROSA-N teniposide Chemical compound COC1=C(O)C(OC)=CC([C@@H]2C3=CC=4OCOC=4C=C3[C@@H](O[C@H]3[C@@H]([C@@H](O)[C@@H]4O[C@@H](OC[C@H]4O3)C=3SC=CC=3)O)[C@@H]3[C@@H]2C(OC3)=O)=C1 NRUKOCRGYNPUPR-QBPJDGROSA-N 0.000 description 1
- 229960001278 teniposide Drugs 0.000 description 1
- BCYMNAIYZYQOGK-UHFFFAOYSA-N tert-butyl N-[2-(2-aminonaphthalen-1-yl)ethyl]carbamate Chemical compound NC1=C(C2=CC=CC=C2C=C1)CCNC(OC(C)(C)C)=O BCYMNAIYZYQOGK-UHFFFAOYSA-N 0.000 description 1
- BSXGOCXELMSKFP-UHFFFAOYSA-N tert-butyl N-[2-(2-cyano-8-fluoro-5-methoxynaphthalen-1-yl)ethyl]carbamate Chemical compound C(#N)C1=C(C2=C(C=CC(=C2C=C1)OC)F)CCNC(OC(C)(C)C)=O BSXGOCXELMSKFP-UHFFFAOYSA-N 0.000 description 1
- OWURNDFTIGIKBM-UHFFFAOYSA-N tert-butyl N-[2-(5-methoxy-1-benzothiophen-4-yl)ethyl]carbamate Chemical compound COC1=C(C2=C(SC=C2)C=C1)CCNC(OC(C)(C)C)=O OWURNDFTIGIKBM-UHFFFAOYSA-N 0.000 description 1
- KIDUMALDNRQMTC-UHFFFAOYSA-N tert-butyl N-[2-(5-methoxy-1-methylindol-4-yl)ethyl]carbamate Chemical compound COC=1C(=C2C=CN(C2=CC=1)C)CCNC(OC(C)(C)C)=O KIDUMALDNRQMTC-UHFFFAOYSA-N 0.000 description 1
- JVAILOHAIMECJP-UHFFFAOYSA-N tert-butyl N-[2-(5-methylnaphthalen-1-yl)ethyl]carbamate Chemical compound CC1=C2C=CC=C(C2=CC=C1)CCNC(OC(C)(C)C)=O JVAILOHAIMECJP-UHFFFAOYSA-N 0.000 description 1
- GCZQSTSVHSGYRG-UHFFFAOYSA-N tert-butyl N-[2-(6-methoxy-1-methylindol-7-yl)ethyl]carbamate Chemical compound COC1=CC=C2C=CN(C2=C1CCNC(OC(C)(C)C)=O)C GCZQSTSVHSGYRG-UHFFFAOYSA-N 0.000 description 1
- XVDAIDNRLKKQDB-UHFFFAOYSA-N tert-butyl N-[2-(6-methylisoquinolin-5-yl)ethyl]carbamate Chemical compound CC=1C(=C2C=CN=CC2=CC=1)CCNC(OC(C)(C)C)=O XVDAIDNRLKKQDB-UHFFFAOYSA-N 0.000 description 1
- LFKDJXLFVYVEFG-UHFFFAOYSA-N tert-butyl carbamate Chemical compound CC(C)(C)OC(N)=O LFKDJXLFVYVEFG-UHFFFAOYSA-N 0.000 description 1
- WHRNULOCNSKMGB-UHFFFAOYSA-N tetrahydrofuran thf Chemical compound C1CCOC1.C1CCOC1 WHRNULOCNSKMGB-UHFFFAOYSA-N 0.000 description 1
- VLLMWSRANPNYQX-UHFFFAOYSA-N thiadiazole Chemical compound C1=CSN=N1.C1=CSN=N1 VLLMWSRANPNYQX-UHFFFAOYSA-N 0.000 description 1
- 125000004588 thienopyridyl group Chemical group S1C(=CC2=C1C=CC=N2)* 0.000 description 1
- CUPOOAWTRIURFT-UHFFFAOYSA-N thiophene-2-carbonitrile Chemical compound N#CC1=CC=CS1 CUPOOAWTRIURFT-UHFFFAOYSA-N 0.000 description 1
- QSELGEUCFNFITD-UHFFFAOYSA-N thiophene-2-carboximidamide Chemical compound NC(=N)C1=CC=CS1 QSELGEUCFNFITD-UHFFFAOYSA-N 0.000 description 1
- 229960001196 thiotepa Drugs 0.000 description 1
- RZWIIPASKMUIAC-VQTJNVASSA-N thromboxane Chemical compound CCCCCCCC[C@H]1OCCC[C@@H]1CCCCCCC RZWIIPASKMUIAC-VQTJNVASSA-N 0.000 description 1
- 208000013077 thyroid gland carcinoma Diseases 0.000 description 1
- 108010078373 tisagenlecleucel Proteins 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 1
- 238000011200 topical administration Methods 0.000 description 1
- UCFGDBYHRUNTLO-QHCPKHFHSA-N topotecan Chemical compound C1=C(O)C(CN(C)C)=C2C=C(CN3C4=CC5=C(C3=O)COC(=O)[C@]5(O)CC)C4=NC2=C1 UCFGDBYHRUNTLO-QHCPKHFHSA-N 0.000 description 1
- 229960000303 topotecan Drugs 0.000 description 1
- 125000002088 tosyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])S(*)(=O)=O 0.000 description 1
- 239000003440 toxic substance Substances 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 231100000440 toxicity profile Toxicity 0.000 description 1
- 230000002110 toxicologic effect Effects 0.000 description 1
- 231100000759 toxicological effect Toxicity 0.000 description 1
- LIRYPHYGHXZJBZ-UHFFFAOYSA-N trametinib Chemical compound CC(=O)NC1=CC=CC(N2C(N(C3CC3)C(=O)C3=C(NC=4C(=CC(I)=CC=4)F)N(C)C(=O)C(C)=C32)=O)=C1 LIRYPHYGHXZJBZ-UHFFFAOYSA-N 0.000 description 1
- 238000011830 transgenic mouse model Methods 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- JKVRTUCVPZTEQZ-UHFFFAOYSA-N tributyltin azide Chemical compound CCCC[Sn](CCCC)(CCCC)N=[N+]=[N-] JKVRTUCVPZTEQZ-UHFFFAOYSA-N 0.000 description 1
- 125000005951 trifluoromethanesulfonyloxy group Chemical group 0.000 description 1
- SEDZOYHHAIAQIW-UHFFFAOYSA-N trimethylsilyl azide Chemical compound C[Si](C)(C)N=[N+]=[N-] SEDZOYHHAIAQIW-UHFFFAOYSA-N 0.000 description 1
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- RMNIZOOYFMNEJJ-UHFFFAOYSA-K tripotassium;phosphate;hydrate Chemical compound O.[K+].[K+].[K+].[O-]P([O-])([O-])=O RMNIZOOYFMNEJJ-UHFFFAOYSA-K 0.000 description 1
- NHDIQVFFNDKAQU-UHFFFAOYSA-N tripropan-2-yl borate Chemical compound CC(C)OB(OC(C)C)OC(C)C NHDIQVFFNDKAQU-UHFFFAOYSA-N 0.000 description 1
- 238000005533 tritiation Methods 0.000 description 1
- 230000036326 tumor accumulation Effects 0.000 description 1
- 230000005751 tumor progression Effects 0.000 description 1
- 210000004981 tumor-associated macrophage Anatomy 0.000 description 1
- 241000701161 unidentified adenovirus Species 0.000 description 1
- 230000003827 upregulation Effects 0.000 description 1
- 230000002485 urinary effect Effects 0.000 description 1
- 230000006444 vascular growth Effects 0.000 description 1
- GPXBXXGIAQBQNI-UHFFFAOYSA-N vemurafenib Chemical compound CCCS(=O)(=O)NC1=CC=C(F)C(C(=O)C=2C3=CC(=CN=C3NC=2)C=2C=CC(Cl)=CC=2)=C1F GPXBXXGIAQBQNI-UHFFFAOYSA-N 0.000 description 1
- 229960003862 vemurafenib Drugs 0.000 description 1
- UGGWPQSBPIFKDZ-KOTLKJBCSA-N vindesine Chemical compound C([C@@H](C[C@]1(C(=O)OC)C=2C(=CC3=C([C@]45[C@H]([C@@]([C@H](O)[C@]6(CC)C=CCN([C@H]56)CC4)(O)C(N)=O)N3C)C=2)OC)C[C@@](C2)(O)CC)N2CCC2=C1N=C1[C]2C=CC=C1 UGGWPQSBPIFKDZ-KOTLKJBCSA-N 0.000 description 1
- 229960004355 vindesine Drugs 0.000 description 1
- GBABOYUKABKIAF-GHYRFKGUSA-N vinorelbine Chemical compound C1N(CC=2C3=CC=CC=C3NC=22)CC(CC)=C[C@H]1C[C@]2(C(=O)OC)C1=CC([C@]23[C@H]([C@]([C@H](OC(C)=O)[C@]4(CC)C=CCN([C@H]34)CC2)(O)C(=O)OC)N2C)=C2C=C1OC GBABOYUKABKIAF-GHYRFKGUSA-N 0.000 description 1
- 229960002066 vinorelbine Drugs 0.000 description 1
- 229960001771 vorozole Drugs 0.000 description 1
- XLMPPFTZALNBFS-INIZCTEOSA-N vorozole Chemical compound C1([C@@H](C2=CC=C3N=NN(C3=C2)C)N2N=CN=C2)=CC=C(Cl)C=C1 XLMPPFTZALNBFS-INIZCTEOSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D409/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/495—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with two or more nitrogen atoms as the only ring heteroatoms, e.g. piperazine or tetrazines
- A61K31/505—Pyrimidines; Hydrogenated pyrimidines, e.g. trimethoprim
- A61K31/506—Pyrimidines; Hydrogenated pyrimidines, e.g. trimethoprim not condensed and containing further heterocyclic rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/495—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with two or more nitrogen atoms as the only ring heteroatoms, e.g. piperazine or tetrazines
- A61K31/505—Pyrimidines; Hydrogenated pyrimidines, e.g. trimethoprim
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K45/00—Medicinal preparations containing active ingredients not provided for in groups A61K31/00 - A61K41/00
- A61K45/06—Mixtures of active ingredients without chemical characterisation, e.g. antiphlogistics and cardiaca
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/32—One oxygen, sulfur or nitrogen atom
- C07D239/42—One nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/10—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings linked by a carbon chain containing aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/12—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D409/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/10—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings linked by a carbon chain containing aromatic rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Epidemiology (AREA)
- General Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| EP2017062022 | 2017-05-18 | ||
| ??PCT/EP2017/062022 | 2017-05-18 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| TW201900180A true TW201900180A (zh) | 2019-01-01 |
Family
ID=62186478
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| TW107116760A TW201900180A (zh) | 2017-05-18 | 2018-05-17 | 嘧啶衍生物 |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US11446298B2 (https=) |
| EP (1) | EP3625223B1 (https=) |
| JP (1) | JP7253500B2 (https=) |
| KR (1) | KR102612140B1 (https=) |
| CN (1) | CN110621667A (https=) |
| AR (1) | AR111874A1 (https=) |
| CA (1) | CA3063788A1 (https=) |
| ES (1) | ES2896476T3 (https=) |
| TW (1) | TW201900180A (https=) |
| WO (1) | WO2018210992A1 (https=) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CR20180323A (es) | 2015-11-20 | 2018-08-06 | Idorsia Pharmaceuticals Ltd | Derivados de indol n-sustituídos como moduladores de los receptores de pge2 |
| EA201992676A1 (ru) | 2017-05-18 | 2020-05-06 | Идорсия Фармасьютиклз Лтд | Фенильные производные в качестве модуляторов pge2 рецепторов |
| CN110621671A (zh) | 2017-05-18 | 2019-12-27 | 爱杜西亚药品有限公司 | 作为pge2受体调节剂的苯并呋喃及苯并噻吩衍生物 |
| PL3625228T3 (pl) | 2017-05-18 | 2021-12-20 | Idorsia Pharmaceuticals Ltd | Pochodne pirymidyny jako modulatory receptora pge2 |
| US20220048987A1 (en) * | 2020-08-13 | 2022-02-17 | The Board Of Trustees Of The Leland Stanford Junior University | Method of treatment to prevent or reverse age-associated inflammation, cognitive decline, and neurodegeneration |
| US20230390303A1 (en) | 2020-11-13 | 2023-12-07 | Ono Pharmaceutical Co., Ltd. | Cancer treatment by combination of ep4 antagonist and immune checkpoint inhibitor |
| WO2022272062A1 (en) | 2021-06-24 | 2022-12-29 | Reservoir Neuroscience, Inc. | Ep2 antagonist compounds |
| WO2025118034A1 (en) * | 2023-12-06 | 2025-06-12 | Psylo Pty Ltd | Compounds active at the serotonergic 5-ht2a receptor |
| WO2025229177A1 (en) | 2024-05-02 | 2025-11-06 | Idorsia Pharmaceuticals Ltd | Crystalline forms of an n-substituted indole derivative |
| CN120718354B (zh) * | 2025-09-01 | 2025-11-14 | 陕西西特电缆有限公司 | 一种耐高温阻燃计算机电缆 |
Family Cites Families (86)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5948786A (en) | 1996-04-12 | 1999-09-07 | Sumitomo Pharmaceuticals Company, Limited | Piperidinylpyrimidine derivatives |
| AU3445100A (en) | 2000-03-24 | 2001-10-08 | Pharmagene Lab Ltd | Use of prostanoid ep4 receptor antagonists for the treatment of headache and assays for such antagonists |
| HN2001000224A (es) | 2000-10-19 | 2002-06-13 | Pfizer | Compuestos de imidazol condensado con arilo o heteroarilo como agentes anti - inflamatorios y analgesicos. |
| GB0031302D0 (en) | 2000-12-21 | 2001-01-31 | Glaxo Group Ltd | Napthalene derivatives |
| GB0031295D0 (en) | 2000-12-21 | 2001-01-31 | Glaxo Group Ltd | Naphthalene derivatives |
| GB0103269D0 (en) | 2001-02-09 | 2001-03-28 | Glaxo Group Ltd | Napthalene derivatives |
| WO2003087061A1 (en) | 2002-04-12 | 2003-10-23 | Pfizer Japan Inc. | Pyrazole compounds as anti-inflammatory and analgesic agents |
| WO2003086390A1 (en) | 2002-04-12 | 2003-10-23 | Pfizer Japan Inc. | Imidazole compounds as anti-inflammatory and analgesic agents |
| JP2006506327A (ja) | 2002-05-23 | 2006-02-23 | セラテクノロジーズ インコーポレイティド | プロスタグランジンe2の受容体サブタイプep4のアンタゴニスト・ポリペプチド |
| ES2308139T3 (es) | 2003-01-29 | 2008-12-01 | Asterand Uk Limited | Antagonista de receptos ep4. |
| CA2536887C (en) | 2003-08-26 | 2012-03-06 | Teijin Pharma Limited | Pyrrolopyrimidinone derivatives |
| CN1867551B (zh) | 2003-09-03 | 2013-09-11 | 拉夸里亚创药株式会社 | 作为前列腺素e2拮抗剂的苯基或吡啶基酰胺化合物 |
| WO2005026129A1 (en) | 2003-09-15 | 2005-03-24 | Gpc Biotech Ag | Pharmaceutically active 4,6-disubstituted aminopyrimidine derivatives as modulators of protein kinases |
| GB0324269D0 (en) | 2003-10-16 | 2003-11-19 | Pharmagene Lab Ltd | EP4 receptor antagonists |
| CN1950333A (zh) | 2004-05-04 | 2007-04-18 | 辉瑞大药厂 | 取代的甲基芳基或杂芳基酰胺化合物 |
| AP2006003769A0 (en) | 2004-05-04 | 2006-10-31 | Pfizer | Ortho substituted aryl or heteroaryl amide compounds |
| HN2005000795A (es) | 2004-10-15 | 2010-08-19 | Aventis Pharma Inc | Pirimidinas como antagonistas del receptor de prostaglandina d2 |
| US8013159B2 (en) | 2005-05-19 | 2011-09-06 | Merck Canada Inc. | Quinoline derivatives as EP4 antagonists |
| WO2006128129A2 (en) | 2005-05-26 | 2006-11-30 | Synta Pharmaceuticals Corp. | Method for treating cancer |
| DOP2007000068A (es) | 2006-04-12 | 2007-10-31 | Sanofi Aventis Us Llc | Compuestos de amino-pirimidina 2,6-sustituidos-4-monosustituidos como antagonistas del receptor de prostaglandina d2 |
| EP2013169B1 (en) | 2006-04-24 | 2012-08-22 | Merck Canada Inc. | Indole amide derivatives as ep4 receptor antagonists |
| EP2035376B1 (en) | 2006-06-12 | 2014-08-27 | Merck Canada Inc. | Indoline amide derivatives as ep4 receptor ligands |
| US20080280891A1 (en) | 2006-06-27 | 2008-11-13 | Locus Pharmaceuticals, Inc. | Anti-cancer agents and uses thereof |
| WO2008008059A1 (en) | 2006-07-12 | 2008-01-17 | Locus Pharmaceuticals, Inc. | Anti-cancer agents ans uses thereof |
| BRPI0714409A2 (pt) | 2006-07-14 | 2013-03-12 | Novartis Ag | derivados de pirimidina como inibidores de alk-5 |
| EP2054401B1 (en) | 2006-08-11 | 2013-05-01 | Merck Canada Inc. | Thiophenecarboxamide derivatives as ep4 receptor ligands |
| WO2008039882A1 (en) | 2006-09-30 | 2008-04-03 | Sanofi-Aventis U.S. Llc | A combination of niacin and a prostaglandin d2 receptor antagonist |
| JP5301469B2 (ja) | 2007-02-26 | 2013-09-25 | メルク カナダ インコーポレイテッド | Ep4受容体アンタゴニストとしてのインドール及びインドリンシクロプロピルアミド誘導体 |
| JPWO2008123207A1 (ja) | 2007-03-26 | 2010-07-15 | アステラス製薬株式会社 | オルニチン誘導体 |
| US8003661B2 (en) | 2007-03-26 | 2011-08-23 | Merck Canada Inc. | Naphthalene and quinoline sulfonylurea derivatives as EP4 receptor antagonists |
| EP2014657A1 (de) * | 2007-06-21 | 2009-01-14 | Bayer Schering Pharma Aktiengesellschaft | Diaminopyrimidine als Modulatoren des EP2-Rezeptors |
| JP5408434B2 (ja) | 2007-07-03 | 2014-02-05 | アステラス製薬株式会社 | アミド化合物 |
| AU2008309517B2 (en) | 2007-10-12 | 2013-03-14 | Astrazeneca Ab | Inhibitors of protein kinases |
| CA2714743C (en) | 2008-02-19 | 2017-01-17 | Janssen Pharmaceutica N.V. | Aryl-hydroxyethylamino-pyrimidines and triazines as modulators of fatty acid amide hydrolase |
| EP2565191B1 (en) | 2008-05-14 | 2014-10-08 | Astellas Pharma Inc. | 4-(Indol-7-ylcarbonylaminomethyl)cyclohexanecarboxylic acid derivatives as EP4 receptor antagonists useful for the treatment of chronic renal failure or diabetic nephropathy |
| US20130225528A1 (en) | 2008-05-21 | 2013-08-29 | Ariad Pharmaceuticals, Inc. | Phosphorus Derivatives as Kinase Inhibitors |
| WO2010019796A1 (en) | 2008-08-14 | 2010-02-18 | Chemietek, Llc | Heterocyclic amide derivatives as ep4 receptor antagonists |
| CN102164942B (zh) | 2008-09-19 | 2017-02-15 | 生物科技研究有限公司 | 三萜系化合物及其使用的方法 |
| CA2737618A1 (en) | 2008-09-25 | 2010-04-01 | Merck Frosst Canada Ltd. | Beta-carboline sulphonylurea derivatives as ep4 receptor antagonists |
| US8906914B2 (en) | 2009-08-18 | 2014-12-09 | Janssen Pharmaceutica Nv | Ethylene diamine modulators of fatty acid hydrolase |
| WO2011063181A1 (en) | 2009-11-23 | 2011-05-26 | Lexicon Pharmaceuticals, Inc. | Methods and assays for the treatment of irritable bowel syndrome |
| US8927547B2 (en) | 2010-05-21 | 2015-01-06 | Noviga Research Ab | Pyrimidine derivatives |
| CA2806121C (en) | 2010-09-21 | 2018-10-09 | Eisai R&D Management Co., Ltd. | Pharmaceutical composition |
| JP5273689B2 (ja) | 2010-09-29 | 2013-08-28 | 株式会社エヌビィー健康研究所 | ヒトプロスタグランジンe2受容体ep4に対する抗体 |
| WO2012066065A1 (en) | 2010-11-17 | 2012-05-24 | Novartis Ag | Phenyl-heteroaryl amine compounds and their uses |
| JP2013542967A (ja) | 2010-11-17 | 2013-11-28 | ノバルティス アーゲー | 3−(アミノアリール)−ピリジン化合物 |
| WO2012076063A1 (en) | 2010-12-10 | 2012-06-14 | Rottapharm S.P.A. | Pyridine amide derivatives as ep4 receptor antagonists |
| WO2012103071A2 (en) | 2011-01-25 | 2012-08-02 | Eisai R&D Management Co., Ltd. | Compounds and compositions |
| DK2688883T3 (en) | 2011-03-24 | 2016-09-05 | Noviga Res Ab | pyrimidine |
| WO2012149528A1 (en) | 2011-04-29 | 2012-11-01 | Exelixis, Inc. | Inhibitors of inducible form of 6-phosphofructose-2-kinase |
| WO2012177618A1 (en) | 2011-06-20 | 2012-12-27 | Emory University | Prostaglandin receptor ep2 antagonists, derivatives, compositions, and uses related thereto |
| EP2729445B1 (en) | 2011-07-04 | 2015-10-21 | Rottapharm Biotech S.r.l. | Cyclic amine derivatives as ep4 receptor antagonists |
| EP2554662A1 (en) | 2011-08-05 | 2013-02-06 | M Maria Pia Cosma | Methods of treatment of retinal degeneration diseases |
| US20150004175A1 (en) | 2011-12-13 | 2015-01-01 | Yale University | Compositions and Methods for Reducing CTL Exhaustion |
| JP6378171B2 (ja) * | 2012-04-24 | 2018-08-22 | バーテックス ファーマシューティカルズ インコーポレイテッドVertex Pharmaceuticals Incorporated | Dna−pk阻害剤 |
| TWI572597B (zh) | 2012-06-29 | 2017-03-01 | 美國禮來大藥廠 | 二甲基-苯甲酸化合物 |
| AR091429A1 (es) | 2012-06-29 | 2015-02-04 | Lilly Co Eli | Compuestos de fenoxietil piperidina |
| EP2711364A1 (en) | 2012-09-21 | 2014-03-26 | Chemilia AB | 4-(Indolyl or benzimidazolyl)amino-2-(2-(indol-3-yl)ethyl)aminopyrimidines useful for the treatment of cancer |
| US9604937B2 (en) | 2012-11-27 | 2017-03-28 | Thomas Helledays Stiftelse For Medicinsk Forskning | Pyrimidine-2,4-diamine derivatives for treatment of cancer |
| UA115576C2 (uk) | 2012-12-06 | 2017-11-27 | Байєр Фарма Акцієнгезелльшафт | Похідні бензимідазолу як антагоністи ер4 |
| EP2765128A1 (en) | 2013-02-07 | 2014-08-13 | Almirall, S.A. | Substituted benzamides with activity towards EP4 receptors |
| TW201443004A (zh) | 2013-02-15 | 2014-11-16 | Lilly Co Eli | 苯氧基乙氧基化合物 |
| TWI636046B (zh) | 2013-05-17 | 2018-09-21 | 美國禮來大藥廠 | 苯氧基乙基二氫-1h-異喹啉化合物 |
| HRP20180703T1 (hr) | 2013-06-12 | 2018-06-15 | Kaken Pharmaceutical Co., Ltd. | Derivat 4-alkinil imidazola i lijek koji kao aktivni sastojak sadrži isti |
| JP6417419B2 (ja) | 2013-09-04 | 2018-11-07 | ブリストル−マイヤーズ スクイブ カンパニーBristol−Myers Squibb Company | 免疫調節剤として有用な化合物 |
| HRP20181052T1 (hr) | 2013-09-06 | 2018-09-07 | Aurigene Discovery Technologies Limited | Derivati 1,2,4-oksadiazola kao imunomodulatori |
| WO2015044900A1 (en) | 2013-09-27 | 2015-04-02 | Aurigene Discovery Technologies Limited | Therapeutic immunomodulating compounds |
| RU2675270C2 (ru) | 2013-10-17 | 2018-12-18 | Вертекс Фармасьютикалз Инкорпорейтед | Сокристаллы и содержащие их фармацевтические композиции |
| PT3057959T (pt) * | 2013-10-17 | 2018-06-04 | Vertex Pharma | Inibidores de adn-pk |
| CN105793236B (zh) | 2013-12-17 | 2017-10-10 | 伊莱利利公司 | 二甲基苯甲酸化合物 |
| ME02896B (me) | 2013-12-17 | 2018-04-20 | Lilly Co Eli | Fenoksietilni derivati prstenastog amina i njihova aktivnost kao modulatora receptora ep4 |
| TW201607943A (zh) | 2013-12-19 | 2016-03-01 | 拜耳製藥公司 | 作為ep4配體之新穎苯并咪唑衍生物 |
| TW201623277A (zh) | 2014-03-26 | 2016-07-01 | 安斯泰來製藥股份有限公司 | 醯胺化合物 |
| WO2015167825A1 (en) | 2014-04-29 | 2015-11-05 | Emory University | Prostaglandin receptor ep2 antagonists, derivatives, compositions, and uses related thereto |
| KR102535283B1 (ko) | 2014-05-23 | 2023-05-22 | 에자이 알앤드디 매니지먼트 가부시키가이샤 | 암의 치료를 위한 조합 요법 |
| CN106794181A (zh) | 2014-06-04 | 2017-05-31 | 托马斯·黑勒戴药物研究基金会 | 用于治疗炎性和自身免疫性病况的mth1抑制剂 |
| WO2016021742A1 (en) | 2014-08-07 | 2016-02-11 | Takeda Pharmaceutical Company Limited | Heterocyclic compounds as ep4 receptor antagonists |
| NZ733575A (en) | 2015-01-09 | 2022-10-28 | Ono Pharmaceutical Co | Tricyclic spiro compound |
| EP3325490B1 (en) | 2015-07-23 | 2019-12-18 | Takeda Pharmaceutical Company Limited | 1-substituted 1,2,3,4-tetrahydro-1,7-naphthyridin-8-amine derivatives and their use as ep4 receptor antagonists |
| BR112018007664B1 (pt) | 2015-10-16 | 2023-12-19 | Eisai R&D Management Co., Ltd | Compostos antagonistas de ep4, composição compreendendo o composto e uso dos mesmos para tratar câncer |
| CR20180323A (es) | 2015-11-20 | 2018-08-06 | Idorsia Pharmaceuticals Ltd | Derivados de indol n-sustituídos como moduladores de los receptores de pge2 |
| EP3484870B1 (en) | 2016-07-13 | 2022-11-16 | Vertex Pharmaceuticals Incorporated | Methods, compositions and kits for increasing genome editing efficiency |
| PL3625228T3 (pl) | 2017-05-18 | 2021-12-20 | Idorsia Pharmaceuticals Ltd | Pochodne pirymidyny jako modulatory receptora pge2 |
| CN110621671A (zh) | 2017-05-18 | 2019-12-27 | 爱杜西亚药品有限公司 | 作为pge2受体调节剂的苯并呋喃及苯并噻吩衍生物 |
| EP3625224B1 (en) | 2017-05-18 | 2021-08-04 | Idorsia Pharmaceuticals Ltd | N-substituted indole derivatives |
| EA201992676A1 (ru) | 2017-05-18 | 2020-05-06 | Идорсия Фармасьютиклз Лтд | Фенильные производные в качестве модуляторов pge2 рецепторов |
-
2018
- 2018-05-17 CN CN201880031882.4A patent/CN110621667A/zh active Pending
- 2018-05-17 TW TW107116760A patent/TW201900180A/zh unknown
- 2018-05-17 KR KR1020197037359A patent/KR102612140B1/ko active Active
- 2018-05-17 EP EP18725219.2A patent/EP3625223B1/en active Active
- 2018-05-17 WO PCT/EP2018/062858 patent/WO2018210992A1/en not_active Ceased
- 2018-05-17 JP JP2019563368A patent/JP7253500B2/ja active Active
- 2018-05-17 CA CA3063788A patent/CA3063788A1/en active Pending
- 2018-05-17 US US16/614,605 patent/US11446298B2/en active Active
- 2018-05-17 ES ES18725219T patent/ES2896476T3/es active Active
- 2018-05-17 AR ARP180101314A patent/AR111874A1/es unknown
Also Published As
| Publication number | Publication date |
|---|---|
| CA3063788A1 (en) | 2018-11-22 |
| EP3625223A1 (en) | 2020-03-25 |
| EP3625223B1 (en) | 2021-08-11 |
| JP7253500B2 (ja) | 2023-04-06 |
| KR20200007049A (ko) | 2020-01-21 |
| CN110621667A (zh) | 2019-12-27 |
| JP2020520354A (ja) | 2020-07-09 |
| ES2896476T3 (es) | 2022-02-24 |
| AR111874A1 (es) | 2019-08-28 |
| WO2018210992A1 (en) | 2018-11-22 |
| KR102612140B1 (ko) | 2023-12-08 |
| US11446298B2 (en) | 2022-09-20 |
| US20200108068A1 (en) | 2020-04-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US12011444B2 (en) | N-substituted indole derivatives as PGE2 receptor modulators | |
| JP7159215B2 (ja) | Pge2レセプター調節剤としてのピリミジン誘導体 | |
| TWI765041B (zh) | 作為pge2受體調節劑之苯基衍生物 | |
| JP7253500B2 (ja) | ピリミジン誘導体 | |
| JP7093791B2 (ja) | Pge2レセプター調節剤としてのベンゾフラン及びベンゾチオフェン誘導体 | |
| HK40020598A (en) | Phenyl derivatives as pge2 receptor modulators | |
| HK40020598B (en) | Phenyl derivatives as pge2 receptor modulators |