SU691078A3 - Способ получени сложных эфиров малоновой кислоты - Google Patents
Способ получени сложных эфиров малоновой кислотыInfo
- Publication number
- SU691078A3 SU691078A3 SU762373644A SU2373644A SU691078A3 SU 691078 A3 SU691078 A3 SU 691078A3 SU 762373644 A SU762373644 A SU 762373644A SU 2373644 A SU2373644 A SU 2373644A SU 691078 A3 SU691078 A3 SU 691078A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- acid
- ester
- mol
- solution
- chloride
- Prior art date
Links
- 150000002148 esters Chemical class 0.000 title description 38
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 title description 12
- 238000000034 method Methods 0.000 title description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 51
- 239000000243 solution Substances 0.000 description 37
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 37
- -1 acetone-nitroacetonitrile Chemical compound 0.000 description 36
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 30
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 29
- 239000002253 acid Substances 0.000 description 25
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 21
- IZUPBVBPLAPZRR-UHFFFAOYSA-N pentachlorophenol Chemical compound OC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl IZUPBVBPLAPZRR-UHFFFAOYSA-N 0.000 description 20
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 15
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Substances ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 15
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 12
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 10
- 239000002904 solvent Substances 0.000 description 10
- 239000000126 substance Substances 0.000 description 9
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 8
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 8
- 229910052799 carbon Inorganic materials 0.000 description 8
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- 238000002329 infrared spectrum Methods 0.000 description 8
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 7
- 239000000725 suspension Substances 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 6
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- 239000002244 precipitate Substances 0.000 description 6
- 238000001228 spectrum Methods 0.000 description 6
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- 238000001035 drying Methods 0.000 description 4
- 229910052736 halogen Inorganic materials 0.000 description 4
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 4
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 4
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridin-1-ium;chloride Chemical compound [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 3
- 150000002367 halogens Chemical group 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 3
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- WWYDYZMNFQIYPT-UHFFFAOYSA-N ru78191 Chemical compound OC(=O)C(C(O)=O)C1=CC=CC=C1 WWYDYZMNFQIYPT-UHFFFAOYSA-N 0.000 description 3
- 150000003512 tertiary amines Chemical class 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- TVZRAEYQIKYCPH-UHFFFAOYSA-N 3-(trimethylsilyl)propane-1-sulfonic acid Chemical compound C[Si](C)(C)CCCS(O)(=O)=O TVZRAEYQIKYCPH-UHFFFAOYSA-N 0.000 description 2
- WXNZTHHGJRFXKQ-UHFFFAOYSA-N 4-chlorophenol Chemical compound OC1=CC=C(Cl)C=C1 WXNZTHHGJRFXKQ-UHFFFAOYSA-N 0.000 description 2
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- HJPOKQICBCJGHE-UHFFFAOYSA-J [C+4].[Cl-].[Cl-].[Cl-].[Cl-] Chemical compound [C+4].[Cl-].[Cl-].[Cl-].[Cl-] HJPOKQICBCJGHE-UHFFFAOYSA-J 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 238000007405 data analysis Methods 0.000 description 2
- RCJVRSBWZCNNQT-UHFFFAOYSA-N dichloridooxygen Chemical compound ClOCl RCJVRSBWZCNNQT-UHFFFAOYSA-N 0.000 description 2
- 239000012065 filter cake Substances 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 description 2
- 239000001630 malic acid Substances 0.000 description 2
- 235000011090 malic acid Nutrition 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 239000012266 salt solution Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- KPZGRMZPZLOPBS-UHFFFAOYSA-N 1,3-dichloro-2,2-bis(chloromethyl)propane Chemical compound ClCC(CCl)(CCl)CCl KPZGRMZPZLOPBS-UHFFFAOYSA-N 0.000 description 1
- ADFXKUOMJKEIND-UHFFFAOYSA-N 1,3-dicyclohexylurea Chemical compound C1CCCCC1NC(=O)NC1CCCCC1 ADFXKUOMJKEIND-UHFFFAOYSA-N 0.000 description 1
- YQRRFIKLPFQWAO-UHFFFAOYSA-N 1-(2,3-dihydro-1h-inden-1-yloxy)-2,3-dihydro-1h-indene Chemical compound C1CC2=CC=CC=C2C1OC1C2=CC=CC=C2CC1 YQRRFIKLPFQWAO-UHFFFAOYSA-N 0.000 description 1
- MTBXQWQXBWXCQD-UHFFFAOYSA-N 2,2-bis(4-chlorophenoxy)propanedioic acid Chemical compound ClC1=CC=C(OC(C(=O)O)(C(=O)O)OC2=CC=C(C=C2)Cl)C=C1 MTBXQWQXBWXCQD-UHFFFAOYSA-N 0.000 description 1
- DUKLUIAXHKCMQI-UHFFFAOYSA-N 2,2-dichloropropanedioic acid Chemical compound OC(=O)C(Cl)(Cl)C(O)=O DUKLUIAXHKCMQI-UHFFFAOYSA-N 0.000 description 1
- FWKCXFPQSXNCBW-UHFFFAOYSA-N 2,2-diethylpropanedioyl dichloride Chemical compound CCC(CC)(C(Cl)=O)C(Cl)=O FWKCXFPQSXNCBW-UHFFFAOYSA-N 0.000 description 1
- ISPYQTSUDJAMAB-UHFFFAOYSA-N 2-chlorophenol Chemical compound OC1=CC=CC=C1Cl ISPYQTSUDJAMAB-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- ZDZVKPXKLLLOOA-UHFFFAOYSA-N Allylmalonic acid Chemical compound OC(=O)C(C(O)=O)CC=C ZDZVKPXKLLLOOA-UHFFFAOYSA-N 0.000 description 1
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 1
- LEVWYRKDKASIDU-IMJSIDKUSA-N L-cystine Chemical compound [O-]C(=O)[C@@H]([NH3+])CSSC[C@H]([NH3+])C([O-])=O LEVWYRKDKASIDU-IMJSIDKUSA-N 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- XAKBSHICSHRJCL-UHFFFAOYSA-N [CH2]C(=O)C1=CC=CC=C1 Chemical class [CH2]C(=O)C1=CC=CC=C1 XAKBSHICSHRJCL-UHFFFAOYSA-N 0.000 description 1
- YBGJZYCWGNYUMA-UHFFFAOYSA-M [Cl-].[P+]=O Chemical compound [Cl-].[P+]=O YBGJZYCWGNYUMA-UHFFFAOYSA-M 0.000 description 1
- JNXCXKQWFLLIEC-UHFFFAOYSA-N [Na].ClF Chemical compound [Na].ClF JNXCXKQWFLLIEC-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- ZPHQBFRCXUIIAZ-UHFFFAOYSA-N benzene;hydrochloride Chemical compound Cl.C1=CC=CC=C1 ZPHQBFRCXUIIAZ-UHFFFAOYSA-N 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- QQVDYSUDFZZPSU-UHFFFAOYSA-M chloromethylidene(dimethyl)azanium;chloride Chemical compound [Cl-].C[N+](C)=CCl QQVDYSUDFZZPSU-UHFFFAOYSA-M 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- 239000002178 crystalline material Substances 0.000 description 1
- 229960003067 cystine Drugs 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 150000002690 malonic acid derivatives Chemical class 0.000 description 1
- OHZZTXYKLXZFSZ-UHFFFAOYSA-I manganese(3+) 5,10,15-tris(1-methylpyridin-1-ium-4-yl)-20-(1-methylpyridin-4-ylidene)porphyrin-22-ide pentachloride Chemical compound [Cl-].[Cl-].[Cl-].[Cl-].[Cl-].[Mn+3].C1=CN(C)C=CC1=C1C(C=C2)=NC2=C(C=2C=C[N+](C)=CC=2)C([N-]2)=CC=C2C(C=2C=C[N+](C)=CC=2)=C(C=C2)N=C2C(C=2C=C[N+](C)=CC=2)=C2N=C1C=C2 OHZZTXYKLXZFSZ-UHFFFAOYSA-I 0.000 description 1
- 229940050176 methyl chloride Drugs 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- HJSRRUNWOFLQRG-UHFFFAOYSA-N propanedioic acid Chemical compound OC(=O)CC(O)=O.OC(=O)CC(O)=O HJSRRUNWOFLQRG-UHFFFAOYSA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 235000014347 soups Nutrition 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- 125000003944 tolyl group Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/38—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/54—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C69/00—Esters of carboxylic acids; Esters of carbonic or haloformic acids
- C07C69/34—Esters of acyclic saturated polycarboxylic acids having an esterified carboxyl group bound to an acyclic carbon atom
- C07C69/38—Malonic acid esters
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyridine Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Heterocyclic Compounds Containing Sulfur Atoms (AREA)
- Furan Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HU75CI00001592A HU171729B (hu) | 1975-06-20 | 1975-06-20 | Sposob poluchenija slozhnykh pentagalogenofenil-ehfirov malonovoj kisloty |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU691078A3 true SU691078A3 (ru) | 1979-10-05 |
Family
ID=10994572
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU762373644A SU691078A3 (ru) | 1975-06-20 | 1976-06-18 | Способ получени сложных эфиров малоновой кислоты |
Country Status (27)
| Country | Link |
|---|---|
| US (2) | US4324903A (OSRAM) |
| JP (1) | JPS5214736A (OSRAM) |
| AR (1) | AR219282A1 (OSRAM) |
| AT (1) | AT347924B (OSRAM) |
| AU (1) | AU509007B2 (OSRAM) |
| BE (1) | BE843106A (OSRAM) |
| BG (1) | BG24945A3 (OSRAM) |
| CA (1) | CA1080716A (OSRAM) |
| CH (1) | CH625778A5 (OSRAM) |
| CS (1) | CS191977B2 (OSRAM) |
| DD (1) | DD124725A5 (OSRAM) |
| DE (1) | DE2627709C2 (OSRAM) |
| DK (1) | DK155729C (OSRAM) |
| ES (1) | ES448967A1 (OSRAM) |
| FI (1) | FI761773A7 (OSRAM) |
| FR (1) | FR2316212A1 (OSRAM) |
| GB (1) | GB1546147A (OSRAM) |
| GR (1) | GR60049B (OSRAM) |
| HU (1) | HU171729B (OSRAM) |
| IL (1) | IL49808A0 (OSRAM) |
| IN (1) | IN144126B (OSRAM) |
| IT (1) | IT1078624B (OSRAM) |
| NL (1) | NL7606620A (OSRAM) |
| NO (1) | NO762117L (OSRAM) |
| PL (1) | PL103443B1 (OSRAM) |
| SE (1) | SE433607B (OSRAM) |
| SU (1) | SU691078A3 (OSRAM) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| HU179000B (en) * | 1977-07-13 | 1982-07-28 | Chinoin Gyogyszer Es Vegyeszet | Process for preparing new malonic acid esters |
| US6288879B1 (en) * | 1998-09-25 | 2001-09-11 | Seagate Technolocy Llc | Top down assembly of a disk drive actuator using a tolerance ring and a post |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2419865A (en) * | 1944-07-31 | 1947-04-29 | Abbott Lab | Carbalkoxylation of phenylacetates |
| GB1199249A (en) * | 1968-09-20 | 1970-07-15 | Pfizer & Co C | Direct Mono-Esterification of Aryl Malonic Acids |
| US3824275A (en) * | 1969-01-23 | 1974-07-16 | Pfizer | Direct mono-esterification of arylmalonic acids |
| BE747295A (fr) * | 1970-03-13 | 1970-09-14 | Pfizer | Monoesterification directe d'acides arylmaloniques |
-
1975
- 1975-06-20 HU HU75CI00001592A patent/HU171729B/hu not_active IP Right Cessation
-
1976
- 1976-06-12 GR GR50981A patent/GR60049B/el unknown
- 1976-06-15 BG BG033484A patent/BG24945A3/xx unknown
- 1976-06-16 ES ES448967A patent/ES448967A1/es not_active Expired
- 1976-06-16 IL IL49808A patent/IL49808A0/xx unknown
- 1976-06-16 IT IT68479/76A patent/IT1078624B/it active
- 1976-06-16 AT AT439176A patent/AT347924B/de not_active IP Right Cessation
- 1976-06-16 IN IN1057/CAL/76A patent/IN144126B/en unknown
- 1976-06-16 GB GB24999/76A patent/GB1546147A/en not_active Expired
- 1976-06-17 DD DD193413A patent/DD124725A5/xx unknown
- 1976-06-17 FR FR7618418A patent/FR2316212A1/fr active Granted
- 1976-06-18 BE BE168053A patent/BE843106A/xx not_active IP Right Cessation
- 1976-06-18 CS CS764032A patent/CS191977B2/cs unknown
- 1976-06-18 NL NL7606620A patent/NL7606620A/xx not_active Application Discontinuation
- 1976-06-18 FI FI761773A patent/FI761773A7/fi not_active Application Discontinuation
- 1976-06-18 DK DK273576A patent/DK155729C/da not_active IP Right Cessation
- 1976-06-18 AU AU15033/76A patent/AU509007B2/en not_active Expired
- 1976-06-18 JP JP51071301A patent/JPS5214736A/ja active Pending
- 1976-06-18 AR AR263665A patent/AR219282A1/es active
- 1976-06-18 CH CH783476A patent/CH625778A5/de not_active IP Right Cessation
- 1976-06-18 NO NO762117A patent/NO762117L/no unknown
- 1976-06-18 SU SU762373644A patent/SU691078A3/ru active
- 1976-06-18 CA CA255,260A patent/CA1080716A/en not_active Expired
- 1976-06-18 SE SE7607044A patent/SE433607B/xx not_active IP Right Cessation
- 1976-06-19 PL PL1976190557A patent/PL103443B1/pl unknown
- 1976-06-21 US US05/698,063 patent/US4324903A/en not_active Expired - Lifetime
- 1976-06-21 DE DE2627709A patent/DE2627709C2/de not_active Expired
-
1979
- 1979-03-06 US US06/017,835 patent/US4289894A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| NL7606620A (nl) | 1976-12-22 |
| IT1078624B (it) | 1985-05-08 |
| DE2627709C2 (de) | 1983-01-05 |
| CH625778A5 (OSRAM) | 1981-10-15 |
| SE433607B (sv) | 1984-06-04 |
| FR2316212A1 (fr) | 1977-01-28 |
| FR2316212B1 (OSRAM) | 1980-01-25 |
| PL103443B1 (pl) | 1979-06-30 |
| ATA439176A (de) | 1978-06-15 |
| SE7607044L (sv) | 1976-12-21 |
| FI761773A7 (OSRAM) | 1976-12-21 |
| BE843106A (fr) | 1976-10-18 |
| GR60049B (en) | 1978-04-01 |
| AU509007B2 (en) | 1980-04-17 |
| DK273576A (da) | 1976-12-21 |
| DK155729B (da) | 1989-05-08 |
| DK155729C (da) | 1989-10-16 |
| GB1546147A (en) | 1979-05-16 |
| ES448967A1 (es) | 1977-11-16 |
| US4289894A (en) | 1981-09-15 |
| HU171729B (hu) | 1978-03-28 |
| BG24945A3 (bg) | 1978-06-15 |
| CA1080716A (en) | 1980-07-01 |
| US4324903A (en) | 1982-04-13 |
| AR219282A1 (es) | 1980-08-15 |
| CS191977B2 (en) | 1979-07-31 |
| JPS5214736A (en) | 1977-02-03 |
| AT347924B (de) | 1979-01-25 |
| DE2627709A1 (de) | 1976-12-30 |
| IN144126B (OSRAM) | 1978-03-25 |
| DD124725A5 (OSRAM) | 1977-03-09 |
| AU1503376A (en) | 1977-12-22 |
| NO762117L (OSRAM) | 1976-12-21 |
| IL49808A0 (en) | 1976-08-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU691078A3 (ru) | Способ получени сложных эфиров малоновой кислоты | |
| SU498912A3 (ru) | Способ получени триазолотиазоловых эфиров кислот фосфора | |
| RU2214998C2 (ru) | Способ получения 3-циано-2,4-дигалоген-5-фторбензойных кислот (варианты) и промежуточные соединения | |
| SU460629A3 (ru) | Способ получени производных 6аминопенициллановой кислоты или их солей или эфиров | |
| US4438276A (en) | Process for synthesizing N-isopropyl-N'-o-carbomethoxyphenylsulphamide | |
| KR20040039430A (ko) | (2-니트로페닐)아세토니트릴 유도체의 제조방법 및 그합성중간체 | |
| JPS595595B2 (ja) | 15−ヒドロキシイミノ−e−ホモエブルナン誘導体の製造方法 | |
| SU364613A1 (ru) | Способ получения производных 2-аминотиено- | |
| JPH02111747A (ja) | 炭素13標識5‐アミノレブリン酸及びその誘導体の製造方法 | |
| KR880001850B1 (ko) | 5-플루오로 피리돈 유도체의 제조방법 | |
| JP3646224B2 (ja) | ベンゾイルアセトニトリル誘導体の製造方法 | |
| SU1685938A1 (ru) | Способ получени 2-алкил (арил) тиофенов | |
| US4215057A (en) | Process for the production of substituted furans | |
| SU539038A1 (ru) | Способ получени замещенных 4-галоген2-алкокси-2-оксо-1,2-оксафосфол-3енов | |
| SU423790A1 (ru) | СПОСОБ ПОЛУЧЕНИЯ ы, а, р,р ТЕТРАХЛОРПРОПИОНОВОЙ КИСЛОТЫ | |
| SU1712357A1 (ru) | Способ получени 4,4 @ -ди-тиобис-(2,6-ди-трет-бутилфенола) | |
| US4297503A (en) | Novel benzamide derivative and method of preparing metoclopramide using same | |
| SU657746A3 (ru) | Способ получени 3-замещенных -(2-хиноксалинилметилен)-карбазат , диоксида | |
| SU1721051A1 (ru) | Способ получени 2-галоидпроизводных фурана | |
| SU594095A1 (ru) | Способ получени 2,2,2-трихлор-1-0хлорфенилэтанола | |
| SU753091A1 (ru) | Способ получени производных @ -тиофенуксусной кислоты | |
| US4208526A (en) | Process for the preparation of thiazolidin-4-one-acetic acid derivatives | |
| SU173787A1 (ru) | СПОСОБ ПОЛУЧЕНИЯ а-НАФТИЛХЛОРКАРБОНАТ^ ]1>& t | |
| SU777032A1 (ru) | Способ получени солей 2,6-диметил- 4-арилвинилпирилил | |
| SU1525164A1 (ru) | Способ получени арил-(N, N-диалкиламино)-галогенарсинов |