SU673135A3 - Гербицидный состав - Google Patents
Гербицидный составInfo
- Publication number
- SU673135A3 SU673135A3 SU721749422A SU1749422A SU673135A3 SU 673135 A3 SU673135 A3 SU 673135A3 SU 721749422 A SU721749422 A SU 721749422A SU 1749422 A SU1749422 A SU 1749422A SU 673135 A3 SU673135 A3 SU 673135A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- phenyl
- acetyl
- methyl
- carbamate
- acid
- Prior art date
Links
- 230000002363 herbicidal effect Effects 0.000 title description 10
- 239000004009 herbicide Substances 0.000 title description 4
- -1 -isopropyl ester Chemical class 0.000 description 13
- 241000196324 Embryophyta Species 0.000 description 10
- 239000013543 active substance Substances 0.000 description 7
- 239000002253 acid Substances 0.000 description 6
- 125000000217 alkyl group Chemical group 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- PWXJULSLLONQHY-UHFFFAOYSA-N phenylcarbamic acid Chemical compound OC(=O)NC1=CC=CC=C1 PWXJULSLLONQHY-UHFFFAOYSA-N 0.000 description 6
- CTSLUCNDVMMDHG-UHFFFAOYSA-N 5-bromo-3-(butan-2-yl)-6-methylpyrimidine-2,4(1H,3H)-dione Chemical compound CCC(C)N1C(=O)NC(C)=C(Br)C1=O CTSLUCNDVMMDHG-UHFFFAOYSA-N 0.000 description 5
- 229910052739 hydrogen Inorganic materials 0.000 description 5
- 239000001257 hydrogen Substances 0.000 description 5
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 4
- 125000002252 acyl group Chemical group 0.000 description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- 229910052760 oxygen Inorganic materials 0.000 description 4
- 239000001301 oxygen Substances 0.000 description 4
- BSCCSDNZEIHXOK-UHFFFAOYSA-N phenyl carbamate Chemical compound NC(=O)OC1=CC=CC=C1 BSCCSDNZEIHXOK-UHFFFAOYSA-N 0.000 description 4
- 229910052717 sulfur Inorganic materials 0.000 description 4
- 239000011593 sulfur Substances 0.000 description 4
- 230000000052 comparative effect Effects 0.000 description 3
- 239000000839 emulsion Substances 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 2
- KXDHJXZQYSOELW-UHFFFAOYSA-N carbonic acid monoamide Natural products NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 125000000068 chlorophenyl group Chemical group 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 230000006378 damage Effects 0.000 description 2
- 238000011156 evaluation Methods 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 238000003306 harvesting Methods 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- 125000003944 tolyl group Chemical group 0.000 description 2
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000013043 chemical agent Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 235000008216 herbs Nutrition 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000006072 paste Substances 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- BMBJSXKEXRFGAV-UHFFFAOYSA-N phenylcarbamothioic s-acid Chemical compound SC(=O)NC1=CC=CC=C1 BMBJSXKEXRFGAV-UHFFFAOYSA-N 0.000 description 1
- 239000005648 plant growth regulator Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- KJAMZCVTJDTESW-UHFFFAOYSA-N tiracizine Chemical compound C1CC2=CC=CC=C2N(C(=O)CN(C)C)C2=CC(NC(=O)OCC)=CC=C21 KJAMZCVTJDTESW-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C237/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups
- C07C237/02—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups having the carbon atoms of the carboxamide groups bound to acyclic carbon atoms of the carbon skeleton
- C07C237/22—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups having the carbon atoms of the carboxamide groups bound to acyclic carbon atoms of the carbon skeleton having nitrogen atoms of amino groups bound to the carbon skeleton of the acid part, further acylated
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C271/00—Derivatives of carbamic acids, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups
- C07C271/06—Esters of carbamic acids
- C07C271/08—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms
- C07C271/26—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms with the nitrogen atom of at least one of the carbamate groups bound to a carbon atom of a six-membered aromatic ring
- C07C271/28—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms with the nitrogen atom of at least one of the carbamate groups bound to a carbon atom of a six-membered aromatic ring to a carbon atom of a non-condensed six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C271/00—Derivatives of carbamic acids, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups
- C07C271/06—Esters of carbamic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C333/00—Derivatives of thiocarbamic acids, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups
- C07C333/02—Monothiocarbamic acids; Derivatives thereof
- C07C333/08—Monothiocarbamic acids; Derivatives thereof having nitrogen atoms of thiocarbamic groups bound to carbon atoms of six-membered aromatic rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2108975A DE2108975C3 (de) | 1971-02-16 | 1971-02-16 | N-Acyl-Diurethane sowie diese enthaltendes herbizides Mittel |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU673135A3 true SU673135A3 (ru) | 1979-07-05 |
Family
ID=5799808
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU721749422A SU673135A3 (ru) | 1971-02-16 | 1972-02-16 | Гербицидный состав |
Country Status (24)
| Country | Link |
|---|---|
| US (1) | US3904669A (show.php) |
| JP (1) | JPS5244371B1 (show.php) |
| AT (1) | AT329914B (show.php) |
| AU (1) | AU460282B2 (show.php) |
| BE (1) | BE779443A (show.php) |
| CH (1) | CH567357A5 (show.php) |
| CS (1) | CS170176B2 (show.php) |
| DE (1) | DE2108975C3 (show.php) |
| DK (1) | DK133001C (show.php) |
| ES (1) | ES399808A1 (show.php) |
| FI (1) | FI58634C (show.php) |
| FR (1) | FR2125913A5 (show.php) |
| GB (1) | GB1338985A (show.php) |
| HU (1) | HU164147B (show.php) |
| IE (1) | IE36086B1 (show.php) |
| IL (1) | IL38738A (show.php) |
| IT (1) | IT948533B (show.php) |
| LU (1) | LU64633A1 (show.php) |
| NL (1) | NL7202061A (show.php) |
| NO (1) | NO135471C (show.php) |
| SE (1) | SE368395B (show.php) |
| SU (1) | SU673135A3 (show.php) |
| YU (1) | YU36695B (show.php) |
| ZA (1) | ZA72741B (show.php) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| RU2810479C1 (ru) * | 2023-05-29 | 2023-12-27 | Акционерное общество "Щелково Агрохим" | Способ получения десмедифама |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4076518A (en) * | 1970-08-20 | 1978-02-28 | Schering Aktiengesellschaft | Substituted phenyl thiocarbamates with herbicidal action and method for their production |
| DE2413933A1 (de) * | 1974-03-20 | 1975-09-25 | Schering Ag | Diurethane mit selektiver herbizider wirkung |
| US4202684A (en) * | 1975-12-18 | 1980-05-13 | Schering Aktiengesellschaft | Carbanilic acid esters, process for making the same and herbicidal compositions containing same |
| GR66157B (show.php) * | 1976-08-28 | 1981-01-20 | Basf Ag | |
| DE2703838A1 (de) * | 1977-01-31 | 1978-08-10 | Basf Ag | Diurethane |
| DE2732848A1 (de) * | 1977-07-18 | 1979-02-08 | Schering Ag | Diurethane, herbizide mittel enthaltend diese verbindungen sowie verfahren zu ihrer herstellung |
| BG28977A3 (en) | 1978-02-02 | 1980-08-15 | Montedison Spa | Fungicide means and method for fungus fighting |
| US4226613A (en) * | 1978-05-25 | 1980-10-07 | Basf Aktiengesellschaft | Bisthiocarbamic acid esters and herbicidal use thereof |
| DE2943965A1 (de) * | 1979-10-31 | 1981-05-27 | Basf Ag, 6700 Ludwigshafen | 1,2-oxazolylalkylcarbamate, ein verfahren zu ihrer herstellung und ihre verwendung als herbizide |
| JPS56123633A (en) * | 1980-03-04 | 1981-09-28 | Tokyo Shibaura Electric Co | Electrode structure for vacuum breaker |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3546343A (en) * | 1966-01-18 | 1970-12-08 | Union Carbide Corp | 4-(methylcarbamoyloxy) carbanilates as insecticides and nematocides |
-
1971
- 1971-02-16 DE DE2108975A patent/DE2108975C3/de not_active Expired
-
1972
- 1972-01-20 LU LU64633D patent/LU64633A1/xx unknown
- 1972-02-04 ZA ZA720741A patent/ZA72741B/xx unknown
- 1972-02-07 CS CS757A patent/CS170176B2/cs unknown
- 1972-02-08 DK DK55172*#A patent/DK133001C/da not_active IP Right Cessation
- 1972-02-09 AU AU38824/72A patent/AU460282B2/en not_active Expired
- 1972-02-10 IL IL38738A patent/IL38738A/xx unknown
- 1972-02-10 GB GB628972A patent/GB1338985A/en not_active Expired
- 1972-02-10 JP JP47014768A patent/JPS5244371B1/ja active Pending
- 1972-02-11 US US225626A patent/US3904669A/en not_active Expired - Lifetime
- 1972-02-11 SE SE01668/72A patent/SE368395B/xx unknown
- 1972-02-12 IT IT20512/72A patent/IT948533B/it active
- 1972-02-14 FI FI403/72A patent/FI58634C/fi active
- 1972-02-14 YU YU0360/72A patent/YU36695B/xx unknown
- 1972-02-15 HU HUSCHE374*1A patent/HU164147B/hu unknown
- 1972-02-15 NO NO434/72A patent/NO135471C/no unknown
- 1972-02-15 FR FR7204979A patent/FR2125913A5/fr not_active Expired
- 1972-02-15 ES ES399808A patent/ES399808A1/es not_active Expired
- 1972-02-15 IE IE185/72A patent/IE36086B1/xx unknown
- 1972-02-16 SU SU721749422A patent/SU673135A3/ru active
- 1972-02-16 CH CH220572A patent/CH567357A5/xx not_active IP Right Cessation
- 1972-02-16 NL NL7202061A patent/NL7202061A/xx not_active Application Discontinuation
- 1972-02-16 BE BE779443A patent/BE779443A/xx not_active IP Right Cessation
- 1972-02-16 AT AT126172A patent/AT329914B/de not_active IP Right Cessation
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| RU2810479C1 (ru) * | 2023-05-29 | 2023-12-27 | Акционерное общество "Щелково Агрохим" | Способ получения десмедифама |
| RU2813459C1 (ru) * | 2023-07-12 | 2024-02-12 | Акционерное общество "Щелково Агрохим" | Способ получения фенмедифама |
Also Published As
| Publication number | Publication date |
|---|---|
| FI58634B (fi) | 1980-11-28 |
| YU36072A (en) | 1982-02-25 |
| CS170176B2 (show.php) | 1976-08-27 |
| ES399808A1 (es) | 1974-12-01 |
| AT329914B (de) | 1976-06-10 |
| HU164147B (show.php) | 1973-12-28 |
| IL38738A (en) | 1975-04-25 |
| NL7202061A (show.php) | 1972-08-18 |
| DE2108975C3 (de) | 1979-12-20 |
| FR2125913A5 (show.php) | 1972-09-29 |
| CH567357A5 (show.php) | 1975-10-15 |
| YU36695B (en) | 1984-08-31 |
| ZA72741B (en) | 1972-10-25 |
| IT948533B (it) | 1973-06-11 |
| SE368395B (show.php) | 1974-07-01 |
| LU64633A1 (show.php) | 1972-06-26 |
| GB1338985A (en) | 1973-11-28 |
| BE779443A (fr) | 1972-08-16 |
| IL38738A0 (en) | 1972-04-27 |
| AU460282B2 (en) | 1975-04-24 |
| IE36086L (en) | 1972-08-16 |
| DE2108975A1 (de) | 1972-08-24 |
| ATA126172A (de) | 1975-08-15 |
| AU3882472A (en) | 1973-08-16 |
| DK133001C (da) | 1976-08-02 |
| JPS5244371B1 (show.php) | 1977-11-08 |
| FI58634C (fi) | 1981-03-10 |
| US3904669A (en) | 1975-09-09 |
| IE36086B1 (en) | 1976-08-18 |
| NO135471C (show.php) | 1977-04-13 |
| DE2108975B2 (de) | 1979-04-19 |
| NO135471B (show.php) | 1977-01-03 |
| DK133001B (da) | 1976-03-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0337263B1 (de) | Isoxazol(Isothiazol)-5-carbonsäure-amide | |
| SU510984A3 (ru) | Гербицидный состав | |
| DE2463046C2 (de) | Fungizide Mittel auf Ammoniumphosphonatbasis | |
| SU673135A3 (ru) | Гербицидный состав | |
| ES8105985A1 (es) | Procedimiento para preparar derivados de quinoxalina | |
| SU708977A3 (ru) | Гербицидное средство | |
| SU552010A3 (ru) | Гербицидное средство | |
| SU651645A3 (ru) | Гербицидна композици | |
| SU523626A3 (ru) | Гербицидный состав | |
| SU472487A3 (ru) | Фунгицидное средство | |
| SU629851A3 (ru) | Способ борьбы с нежелательным ростом растений | |
| SU628799A3 (ru) | Гербицидна композици | |
| SU667098A3 (ru) | Фунгицидное средство | |
| SU540551A3 (ru) | Гербицидный состав | |
| SU580801A3 (ru) | Гербицидное средство | |
| SU576893A3 (ru) | Способ борьбы с сорн ками | |
| SU639410A3 (ru) | Гербицидное средство | |
| SU843696A3 (ru) | Гербицидный состав | |
| SU555827A3 (ru) | Гербицидный состав | |
| SU576892A3 (ru) | Гербицидный состав | |
| SU589884A3 (ru) | Гербицидный состав | |
| US3591682A (en) | Aminoalkyl phosphite fungicides and use thereof in agriculture | |
| SU651644A3 (ru) | Гербицидное средство | |
| SU579845A3 (ru) | Гербицидное средство | |
| SU931088A3 (ru) | Фунгицидное средство |