SU557758A3 - Способ получени 4-азабензимидазолов или их солей - Google Patents
Способ получени 4-азабензимидазолов или их солейInfo
- Publication number
- SU557758A3 SU557758A3 SU1821216A SU1821216A SU557758A3 SU 557758 A3 SU557758 A3 SU 557758A3 SU 1821216 A SU1821216 A SU 1821216A SU 1821216 A SU1821216 A SU 1821216A SU 557758 A3 SU557758 A3 SU 557758A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- aza
- water
- alcohol
- solution
- acid
- Prior art date
Links
- 238000000034 method Methods 0.000 title description 4
- 150000003839 salts Chemical class 0.000 title description 3
- GAMYYCRTACQSBR-UHFFFAOYSA-N 4-azabenzimidazole Chemical class C1=CC=C2NC=NC2=N1 GAMYYCRTACQSBR-UHFFFAOYSA-N 0.000 title 1
- 150000002391 heterocyclic compounds Chemical class 0.000 claims 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Natural products CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 28
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 21
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 18
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 17
- 239000000243 solution Substances 0.000 description 17
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 16
- -1 alkyl radicals Chemical class 0.000 description 14
- 229960000583 acetic acid Drugs 0.000 description 13
- 235000011054 acetic acid Nutrition 0.000 description 13
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- 239000002253 acid Substances 0.000 description 8
- 239000013078 crystal Substances 0.000 description 8
- 150000001875 compounds Chemical class 0.000 description 7
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 4
- 125000003545 alkoxy group Chemical group 0.000 description 4
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 4
- 150000008050 dialkyl sulfates Chemical class 0.000 description 4
- 239000001257 hydrogen Substances 0.000 description 4
- 229910052739 hydrogen Inorganic materials 0.000 description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 3
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- CWERGRDVMFNCDR-UHFFFAOYSA-N thioglycolic acid Chemical compound OC(=O)CS CWERGRDVMFNCDR-UHFFFAOYSA-N 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- GOJUJUVQIVIZAV-UHFFFAOYSA-N 2-amino-4,6-dichloropyrimidine-5-carbaldehyde Chemical group NC1=NC(Cl)=C(C=O)C(Cl)=N1 GOJUJUVQIVIZAV-UHFFFAOYSA-N 0.000 description 2
- YATVGOHRVZELJH-UHFFFAOYSA-N 5-chloro-2-methyl-1h-imidazo[4,5-b]pyridine Chemical compound ClC1=CC=C2NC(C)=NC2=N1 YATVGOHRVZELJH-UHFFFAOYSA-N 0.000 description 2
- QEIRYIILFUVXAM-UHFFFAOYSA-N 6-chloropyridine-2,3-diamine Chemical compound NC1=CC=C(Cl)N=C1N QEIRYIILFUVXAM-UHFFFAOYSA-N 0.000 description 2
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 125000003282 alkyl amino group Chemical group 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 150000001350 alkyl halides Chemical class 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 2
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- VEUUMBGHMNQHGO-UHFFFAOYSA-N ethyl chloroacetate Chemical compound CCOC(=O)CCl VEUUMBGHMNQHGO-UHFFFAOYSA-N 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002431 hydrogen Chemical group 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- 101150032584 oxy-4 gene Proteins 0.000 description 2
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical compound OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- PXQLVRUNWNTZOS-UHFFFAOYSA-N sulfanyl Chemical group [SH] PXQLVRUNWNTZOS-UHFFFAOYSA-N 0.000 description 2
- ICSNLGPSRYBMBD-UHFFFAOYSA-N 2-aminopyridine Chemical compound NC1=CC=CC=N1 ICSNLGPSRYBMBD-UHFFFAOYSA-N 0.000 description 1
- GKQDGTBDVTVIDS-UHFFFAOYSA-N 2-chloro-5-methylsulfanylpyridine Chemical compound CSC1=CC=C(Cl)N=C1 GKQDGTBDVTVIDS-UHFFFAOYSA-N 0.000 description 1
- KNOJSVBRYKBZNV-UHFFFAOYSA-N 3-N-benzyl-6-chloropyridine-2,3-diamine Chemical compound NC1=NC(=CC=C1NCC1=CC=CC=C1)Cl KNOJSVBRYKBZNV-UHFFFAOYSA-N 0.000 description 1
- XJFIKRXIJXAJGH-UHFFFAOYSA-N 5-chloro-1,3-dihydroimidazo[4,5-b]pyridin-2-one Chemical compound ClC1=CC=C2NC(=O)NC2=N1 XJFIKRXIJXAJGH-UHFFFAOYSA-N 0.000 description 1
- LHDMCRKGLAMXJH-UHFFFAOYSA-N 5-chloro-1,3-dihydroimidazo[4,5-b]pyridine-2-thione Chemical compound ClC1=CC=C2NC(=S)NC2=N1 LHDMCRKGLAMXJH-UHFFFAOYSA-N 0.000 description 1
- JIFFIOLNCXHOHH-UHFFFAOYSA-N 5-chloro-2-(trifluoromethyl)-1h-imidazo[4,5-b]pyridine Chemical compound ClC1=CC=C2NC(C(F)(F)F)=NC2=N1 JIFFIOLNCXHOHH-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical class ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- VOBMIXPTKODTPM-UHFFFAOYSA-N N-(2-amino-6-chloropyridin-3-yl)acetamide Chemical compound NC1=NC(=CC=C1NC(C)=O)Cl VOBMIXPTKODTPM-UHFFFAOYSA-N 0.000 description 1
- 239000007983 Tris buffer Substances 0.000 description 1
- 150000001243 acetic acids Chemical class 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 1
- 150000008046 alkali metal hydrides Chemical class 0.000 description 1
- 229910052977 alkali metal sulfide Inorganic materials 0.000 description 1
- 150000003973 alkyl amines Chemical group 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- XKMRRTOUMJRJIA-UHFFFAOYSA-N ammonia nh3 Chemical class N.N XKMRRTOUMJRJIA-UHFFFAOYSA-N 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 150000007514 bases Chemical class 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- VNWKTOKETHGBQD-AKLPVKDBSA-N carbane Chemical compound [15CH4] VNWKTOKETHGBQD-AKLPVKDBSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- FOCAUTSVDIKZOP-UHFFFAOYSA-N chloroacetic acid Chemical compound OC(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-N 0.000 description 1
- 229940106681 chloroacetic acid Drugs 0.000 description 1
- UXTMROKLAAOEQO-UHFFFAOYSA-N chloroform;ethanol Chemical compound CCO.ClC(Cl)Cl UXTMROKLAAOEQO-UHFFFAOYSA-N 0.000 description 1
- XENVCRGQTABGKY-ZHACJKMWSA-N chlorohydrin Chemical compound CC#CC#CC#CC#C\C=C\C(Cl)CO XENVCRGQTABGKY-ZHACJKMWSA-N 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- WBJINCZRORDGAQ-UHFFFAOYSA-N ethyl formate Chemical compound CCOC=O WBJINCZRORDGAQ-UHFFFAOYSA-N 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- GQPLMRYTRLFLPF-UHFFFAOYSA-N nitrous oxide Inorganic materials [O-][N+]#N GQPLMRYTRLFLPF-UHFFFAOYSA-N 0.000 description 1
- 125000001820 oxy group Chemical group [*:1]O[*:2] 0.000 description 1
- 125000005429 oxyalkyl group Chemical group 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 229960003424 phenylacetic acid Drugs 0.000 description 1
- 239000003279 phenylacetic acid Substances 0.000 description 1
- 239000012063 pure reaction product Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- WBHQBSYUUJJSRZ-UHFFFAOYSA-M sodium bisulfate Chemical compound [Na+].OS([O-])(=O)=O WBHQBSYUUJJSRZ-UHFFFAOYSA-M 0.000 description 1
- 229910000342 sodium bisulfate Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
- C07D213/64—One oxygen atom attached in position 2 or 6
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/73—Unsubstituted amino or imino radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/74—Amino or imino radicals substituted by hydrocarbon or substituted hydrocarbon radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/75—Amino or imino radicals, acylated by carboxylic or carbonic acids, or by sulfur or nitrogen analogues thereof, e.g. carbamates
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| AT748871A AT315831B (de) | 1971-08-26 | 1971-08-26 | Verfahren zur Herstellung von neuen 4-Aza-benzimidazolderivaten und ihren Salzen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU557758A3 true SU557758A3 (ru) | 1977-05-05 |
Family
ID=3596529
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1821216A SU557758A3 (ru) | 1971-08-26 | 1972-08-18 | Способ получени 4-азабензимидазолов или их солей |
Country Status (19)
| Country | Link |
|---|---|
| JP (1) | JPS4832898A (enExample) |
| AR (1) | AR199879A1 (enExample) |
| AT (1) | AT315831B (enExample) |
| AU (1) | AU461671B2 (enExample) |
| BE (1) | BE788065A (enExample) |
| BR (1) | BR7205845A (enExample) |
| CA (1) | CA979907A (enExample) |
| CH (1) | CH592660A5 (enExample) |
| DD (1) | DD99580A5 (enExample) |
| DE (1) | DE2241575A1 (enExample) |
| ES (1) | ES405982A1 (enExample) |
| FR (1) | FR2150820B1 (enExample) |
| GB (1) | GB1397645A (enExample) |
| HU (1) | HU166382B (enExample) |
| IL (1) | IL40080A (enExample) |
| NL (1) | NL7211407A (enExample) |
| SU (1) | SU557758A3 (enExample) |
| YU (1) | YU34897B (enExample) |
| ZA (1) | ZA725868B (enExample) |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA1140119A (en) * | 1978-04-03 | 1983-01-25 | Joseph Torremans | N-heterocyclyl-4-piperidinamines |
| US4588722A (en) * | 1984-01-09 | 1986-05-13 | Janssen Pharmaceutica N.V. | N-(4-piperidinyl) bicyclic condensed 2-imidazolamine derivatives |
| US4772600A (en) * | 1986-06-09 | 1988-09-20 | A. H. Robins Company, Inc. | Fused imidazoheterocyclic compounds and pharmaceutical compositions |
| US5200407A (en) * | 1989-06-29 | 1993-04-06 | Meiji Seika Kaburhiki Kaisha | Azole derivatives and anti-ulcerative composition containing same |
| JP2679745B2 (ja) * | 1989-06-29 | 1997-11-19 | 明治製菓株式会社 | アゾール誘導体及びそれらを有効成分とする抗潰瘍剤 |
| US6093728A (en) | 1997-09-26 | 2000-07-25 | Asta Medica Aktiengesellschaft | Methods of modulating serine/threonine protein kinase function with azabenzimidazole-based compounds |
| US8227603B2 (en) | 2006-08-01 | 2012-07-24 | Cytokinetics, Inc. | Modulating skeletal muscle |
| EP2666777A1 (en) | 2006-08-02 | 2013-11-27 | Cytokinetics, Inc. | Certain chemical entities having an imidazo<4,5-b>pyrazin-2(3H)-one core, compositions and methods |
| US8299248B2 (en) | 2006-08-02 | 2012-10-30 | Cytokinetics, Incorporated | Certain 1H-imidazo[4,5-b]pyrazin-2(3H)-ones and 1H-imidazo[4,5-b]pyrazin-2-ols and methods for their use |
| EP2139478A4 (en) * | 2007-03-30 | 2010-05-05 | Cytokinetics Inc | CHEMICAL ENTITIES, COMPOSITIONS AND METHODS |
| WO2012152741A1 (de) | 2011-05-10 | 2012-11-15 | Bayer Intellectual Property Gmbh | Bicyclische (thio)carbonylamidine |
| WO2013010015A2 (en) | 2011-07-13 | 2013-01-17 | Cytokinetics, Inc. | Combination als therapy |
| EP3495366A1 (en) * | 2011-07-15 | 2019-06-12 | Shionogi & Co., Ltd | Azabenzimidazole derivative having ampk-activating activity |
-
0
- BE BE788065D patent/BE788065A/xx unknown
-
1971
- 1971-08-26 AT AT748871A patent/AT315831B/de not_active IP Right Cessation
-
1972
- 1972-07-26 DD DD164684A patent/DD99580A5/xx unknown
- 1972-08-09 IL IL40080A patent/IL40080A/xx unknown
- 1972-08-09 YU YU2041/72A patent/YU34897B/xx unknown
- 1972-08-14 CH CH1201872A patent/CH592660A5/xx not_active IP Right Cessation
- 1972-08-18 SU SU1821216A patent/SU557758A3/ru active
- 1972-08-19 ES ES405982A patent/ES405982A1/es not_active Expired
- 1972-08-21 NL NL7211407A patent/NL7211407A/xx not_active Application Discontinuation
- 1972-08-22 FR FR7229915A patent/FR2150820B1/fr not_active Expired
- 1972-08-24 DE DE2241575A patent/DE2241575A1/de active Pending
- 1972-08-24 GB GB3940272A patent/GB1397645A/en not_active Expired
- 1972-08-25 HU HUDE789A patent/HU166382B/hu unknown
- 1972-08-25 CA CA150,204A patent/CA979907A/en not_active Expired
- 1972-08-25 ZA ZA725868A patent/ZA725868B/xx unknown
- 1972-08-25 AU AU45981/72A patent/AU461671B2/en not_active Expired
- 1972-08-25 JP JP47085203A patent/JPS4832898A/ja active Pending
- 1972-08-25 BR BR5845/72A patent/BR7205845A/pt unknown
- 1972-08-28 AR AR243765A patent/AR199879A1/es active
Also Published As
| Publication number | Publication date |
|---|---|
| CH592660A5 (enExample) | 1977-10-31 |
| HU166382B (enExample) | 1975-03-28 |
| IL40080A0 (en) | 1972-10-29 |
| YU204172A (en) | 1979-10-31 |
| ZA725868B (en) | 1973-05-30 |
| BR7205845D0 (pt) | 1973-07-03 |
| ES405982A1 (es) | 1975-09-16 |
| DD99580A5 (enExample) | 1973-08-12 |
| IL40080A (en) | 1975-12-31 |
| DE2241575A1 (de) | 1973-03-08 |
| GB1397645A (en) | 1975-06-11 |
| AT315831B (de) | 1974-06-10 |
| AU4598172A (en) | 1974-02-28 |
| FR2150820B1 (enExample) | 1975-10-17 |
| CA979907A (en) | 1975-12-16 |
| AU461671B2 (en) | 1975-06-05 |
| NL7211407A (enExample) | 1973-02-28 |
| BR7205845A (pt) | 1976-05-04 |
| AR199879A1 (es) | 1974-10-08 |
| YU34897B (en) | 1980-04-30 |
| FR2150820A1 (enExample) | 1973-04-13 |
| JPS4832898A (enExample) | 1973-05-02 |
| BE788065A (fr) | 1973-02-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4113731A (en) | Fused isoquinoline derivatives | |
| US3853915A (en) | 9-or 10-halo-4h-benzo{8 4,5{9 cyclo-hepta{8 1,2-b{9 thiophen-4-ones | |
| SU557758A3 (ru) | Способ получени 4-азабензимидазолов или их солей | |
| US2691655A (en) | 2-amino-4-substituted amino-6-aryl pyrimidines and process of preparing same | |
| SU526292A3 (ru) | Способ получени производных 8-азапурин-6-она | |
| SU1436873A3 (ru) | Способ получени производных 1,2,4-триазолокарбамата или их кислотно-аддитивных солей | |
| US2744908A (en) | Process for preparing substitutedmercapto-1, 3, 4-thiadiazoles | |
| DK153150B (da) | Analogifremgangsmaade til fremstilling af 4-oxo-1,6,7,8-tetrahydro-4h-pyridooe1,2aaapyrimidinderivater | |
| DK175838B1 (da) | Fremgangsmåde til fremstilling af 2,6-dichlordiphenylamineddikesyrederivater | |
| NO764039L (enExample) | ||
| US3176017A (en) | Aroylalkyl derivatives of diazabicyclo-nonanes and-decanes | |
| JPS6332073B2 (enExample) | ||
| SU856382A3 (ru) | Способ получени циннолин-3-ил-карбоновых кислот или их солей | |
| SU474142A3 (ru) | Способ получени производных 2-/5-нитро-2-фурил/-тиено/2,3-пиримидина | |
| US2970147A (en) | 3-hydroxy-nu-(heterocyclic-ethyl)-morphinans | |
| SU639450A3 (ru) | Способ получени гетероциклических соединений или их солей | |
| SU419028A3 (ru) | Способ получения 2- | |
| NO130329B (enExample) | ||
| US2532547A (en) | Z-aminoalkyl-glyoxaline derivatives | |
| US3036081A (en) | 4, 5-benzo tryptamine and process of producing same | |
| US3655665A (en) | Process for the production of 5-cyano-uracils | |
| US3320272A (en) | Process for preparing z-alkoxycyclo- heptimidazole derivatives | |
| JPS5973590A (ja) | 新規なセフアロスポリン誘導体,その製造法およびそれを含有する抗生物質薬剤 | |
| Shishoo et al. | A facile synthesis of 3‐amino‐5‐substitutedaminoisothiazole‐4‐carboxylic acid derivatives | |
| BARKENBUS et al. | THE PREPARATION OF SOME PHENYL SUBSTITUTED 3, 5-THIAMORPHOLINEDIONES AS POSSIBLE ANTICONVULSANTS |