SU511008A3 - Способ получени 3-/ диалкиламиноэтил/-4-алкил7-карбоэтоксиметоксикумаринов - Google Patents
Способ получени 3-/ диалкиламиноэтил/-4-алкил7-карбоэтоксиметоксикумариновInfo
- Publication number
- SU511008A3 SU511008A3 SU1809606A SU1809606A SU511008A3 SU 511008 A3 SU511008 A3 SU 511008A3 SU 1809606 A SU1809606 A SU 1809606A SU 1809606 A SU1809606 A SU 1809606A SU 511008 A3 SU511008 A3 SU 511008A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- weight
- formula
- parts
- zinc chloride
- methyl
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 15
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 claims description 14
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 12
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 9
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 9
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 claims description 9
- 239000000047 product Substances 0.000 claims description 7
- 239000000243 solution Substances 0.000 claims description 7
- 235000005074 zinc chloride Nutrition 0.000 claims description 7
- 239000011592 zinc chloride Substances 0.000 claims description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 claims description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 6
- 239000011541 reaction mixture Substances 0.000 claims description 6
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 claims description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 5
- 229910000288 alkali metal carbonate Inorganic materials 0.000 claims description 5
- 150000001875 compounds Chemical class 0.000 claims description 5
- 235000019441 ethanol Nutrition 0.000 claims description 5
- 150000008041 alkali metal carbonates Chemical class 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 3
- 239000007864 aqueous solution Substances 0.000 claims description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052794 bromium Chemical group 0.000 claims description 3
- 239000000460 chlorine Substances 0.000 claims description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 claims description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 claims description 3
- 239000012433 hydrogen halide Substances 0.000 claims description 3
- 229910000039 hydrogen halide Inorganic materials 0.000 claims description 3
- 239000002244 precipitate Substances 0.000 claims description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 3
- 229920006395 saturated elastomer Polymers 0.000 claims description 3
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 claims description 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 2
- 239000003054 catalyst Substances 0.000 claims description 2
- 238000006243 chemical reaction Methods 0.000 claims description 2
- 238000001816 cooling Methods 0.000 claims description 2
- 125000005265 dialkylamine group Chemical group 0.000 claims description 2
- 150000003839 salts Chemical class 0.000 claims description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims 4
- 239000002253 acid Substances 0.000 claims 2
- 229910021529 ammonia Inorganic materials 0.000 claims 2
- 230000003993 interaction Effects 0.000 claims 2
- 229910052783 alkali metal Inorganic materials 0.000 claims 1
- 150000001340 alkali metals Chemical class 0.000 claims 1
- 125000004432 carbon atom Chemical group C* 0.000 claims 1
- 239000003153 chemical reaction reagent Substances 0.000 claims 1
- 125000001309 chloro group Chemical group Cl* 0.000 claims 1
- 150000002148 esters Chemical class 0.000 claims 1
- 238000002360 preparation method Methods 0.000 claims 1
- 239000002904 solvent Substances 0.000 claims 1
- 239000000126 substance Substances 0.000 claims 1
- ISIJQEHRDSCQIU-UHFFFAOYSA-N tert-butyl 2,7-diazaspiro[4.5]decane-7-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCCC11CNCC1 ISIJQEHRDSCQIU-UHFFFAOYSA-N 0.000 claims 1
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 8
- 238000009835 boiling Methods 0.000 description 5
- 229910000027 potassium carbonate Inorganic materials 0.000 description 4
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- 125000004494 ethyl ester group Chemical group 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- 239000011574 phosphorus Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- -1 ammonium alkali metal carbonate Chemical class 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 229940106681 chloroacetic acid Drugs 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/04—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring
- C07D311/06—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 2
- C07D311/08—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 2 not hydrogenated in the hetero ring
- C07D311/16—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 2 not hydrogenated in the hetero ring substituted in position 7
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyrane Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| PL14953171A PL74614B1 (enExample) | 1971-07-19 | 1971-07-19 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU511008A3 true SU511008A3 (ru) | 1976-04-15 |
Family
ID=19955081
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1809606A SU511008A3 (ru) | 1971-07-19 | 1972-07-12 | Способ получени 3-/ диалкиламиноэтил/-4-алкил7-карбоэтоксиметоксикумаринов |
Country Status (6)
| Country | Link |
|---|---|
| JP (1) | JPS4875577A (enExample) |
| DE (1) | DE2235428B2 (enExample) |
| ES (1) | ES405171A1 (enExample) |
| GB (1) | GB1362337A (enExample) |
| PL (1) | PL74614B1 (enExample) |
| SU (1) | SU511008A3 (enExample) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IT1088554B (it) * | 1977-11-17 | 1985-06-10 | F I D I A Spa | Procedimento sellettivo per la preparazione di derivati della 7-indrossi cumarina |
-
1971
- 1971-07-19 PL PL14953171A patent/PL74614B1/xx unknown
-
1972
- 1972-07-03 GB GB3101972A patent/GB1362337A/en not_active Expired
- 1972-07-12 ES ES405171A patent/ES405171A1/es not_active Expired
- 1972-07-12 SU SU1809606A patent/SU511008A3/ru active
- 1972-07-18 JP JP7195472A patent/JPS4875577A/ja active Pending
- 1972-07-19 DE DE19722235428 patent/DE2235428B2/de not_active Withdrawn
Also Published As
| Publication number | Publication date |
|---|---|
| GB1362337A (en) | 1974-08-07 |
| ES405171A1 (es) | 1975-07-01 |
| PL74614B1 (enExample) | 1974-12-31 |
| JPS4875577A (enExample) | 1973-10-11 |
| DE2235428A1 (de) | 1973-02-15 |
| DE2235428B2 (de) | 1974-01-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU727142A3 (ru) | Способ получени замещенных 1-сульфонилбензимидазолов | |
| US2734904A (en) | Xcxnhxc-nh | |
| SU837321A3 (ru) | Способ получени производныхпРОСТАглАНдиНА | |
| SU481155A3 (ru) | Способ получени -(фурил-метил)морфинанов | |
| SU546280A3 (ru) | Способ получени 2-(3-) 4-дифенилметил-1-пиперазинил (-пропил)- -триазоло (1,5- ) пиридина или его дигидрохлорида | |
| SU511008A3 (ru) | Способ получени 3-/ диалкиламиноэтил/-4-алкил7-карбоэтоксиметоксикумаринов | |
| US3481948A (en) | 2,2 - disubstituted - 3 - acyl - 5alpha - azidothiazolidine-4-carboxylic acids and derivatives | |
| SU577986A3 (ru) | Способ получени производных фталазона или их солей | |
| SU619098A3 (ru) | Способ получени карбоновых кислот или их минеральных,или органических солей,или сложных эфиров | |
| US2772280A (en) | Synthesis of 4-amino-3-isoxazolidone and its derivatives | |
| CA1082695A (en) | Process for preparing adenosine-5'-carboxamides | |
| US3813415A (en) | Process for the preparation of 3-(beta dialkylamino-ethyl)-4-alkyl-7-carboethoxymethoxycoumarins | |
| SU685156A3 (ru) | Способ получени -(5-тетразолил(1-оксо-1н-пиримидо-)1,2-а) хинолин-2-карбоксамида | |
| SU730303A3 (ru) | Способ получени производных тиазолидинкарбоновых кислот или их кислотно-аддитивных солей | |
| JPS5829793B2 (ja) | 7−アルコキシカルボニル−8−メチルインドリジノ〔1,2−b〕キノリン−9(11H)−オンの製法 | |
| SU426366A3 (ru) | Способ получения производных1-арил-2,3,4,5 тетрагидро-1 н-1,5-бензодиазепин-2-она | |
| US2827466A (en) | Bis-quaternary ammonium salts of amsonic acid | |
| US3277096A (en) | Process for the preparation of aminohalogeno isoquinolines | |
| US2492373A (en) | Imidazolone preparation | |
| SU457698A1 (ru) | Способ получени производных индолил-2-уксусной кислоты | |
| US2489233A (en) | Imidazolido-tetrahydrofurans | |
| US3347864A (en) | Production of aminoquinolines | |
| SU1490121A1 (ru) | Способ получени 5-гидрокси-5-метил-4-оксо-3-арилпирролидино[1,2- @ ]пиразолов | |
| US3998822A (en) | Morpholino containing pyrido (3,4-d) pyridazines | |
| SU376387A1 (ru) | Способ получения фосфорилированных дифениламинов |