SU467520A1 - Способ получени производных бензо (в) тиофена - Google Patents
Способ получени производных бензо (в) тиофенаInfo
- Publication number
- SU467520A1 SU467520A1 SU1917607A SU1917607A SU467520A1 SU 467520 A1 SU467520 A1 SU 467520A1 SU 1917607 A SU1917607 A SU 1917607A SU 1917607 A SU1917607 A SU 1917607A SU 467520 A1 SU467520 A1 SU 467520A1
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- solution
- chloro
- acid
- thien
- benzo
- Prior art date
Links
- 238000000034 method Methods 0.000 title description 4
- LYTMVABTDYMBQK-UHFFFAOYSA-N 2-benzothiophene Chemical class C1=CC=CC2=CSC=C21 LYTMVABTDYMBQK-UHFFFAOYSA-N 0.000 title description 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 21
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 18
- 239000000243 solution Substances 0.000 description 17
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 15
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 13
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 9
- 239000000203 mixture Substances 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 239000002253 acid Substances 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- -1 5 - Chloro-3-methyl-benzo (c) -thien-2-yl Chemical group 0.000 description 6
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 6
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 5
- 125000000217 alkyl group Chemical group 0.000 description 5
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Substances CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- 125000005605 benzo group Chemical group 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 125000004985 dialkyl amino alkyl group Chemical group 0.000 description 2
- 150000002431 hydrogen Chemical class 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- KPZGRMZPZLOPBS-UHFFFAOYSA-N 1,3-dichloro-2,2-bis(chloromethyl)propane Chemical compound ClCC(CCl)(CCl)CCl KPZGRMZPZLOPBS-UHFFFAOYSA-N 0.000 description 1
- SMJRBWINMFUUDS-UHFFFAOYSA-N 2-thienylacetic acid Chemical compound OC(=O)CC1=CC=CS1 SMJRBWINMFUUDS-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Divinylene sulfide Natural products C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- UEEJHVSXFDXPFK-UHFFFAOYSA-N N-dimethylaminoethanol Chemical compound CN(C)CCO UEEJHVSXFDXPFK-UHFFFAOYSA-N 0.000 description 1
- 101710181917 Serine proteinase inhibitor 1 Proteins 0.000 description 1
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- XENVCRGQTABGKY-ZHACJKMWSA-N chlorohydrin Chemical compound CC#CC#CC#CC#C\C=C\C(Cl)CO XENVCRGQTABGKY-ZHACJKMWSA-N 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- RDYMFSUJUZBWLH-UHFFFAOYSA-N endosulfan Chemical compound C12COS(=O)OCC2C2(Cl)C(Cl)=C(Cl)C1(Cl)C2(Cl)Cl RDYMFSUJUZBWLH-UHFFFAOYSA-N 0.000 description 1
- AEOCXXJPGCBFJA-UHFFFAOYSA-N ethionamide Chemical compound CCC1=CC(C(N)=S)=CC=N1 AEOCXXJPGCBFJA-UHFFFAOYSA-N 0.000 description 1
- 239000000446 fuel Substances 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 238000009940 knitting Methods 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 230000000392 somatic effect Effects 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 229930192474 thiophene Natural products 0.000 description 1
- 238000004804 winding Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/50—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom condensed with carbocyclic rings or ring systems
- C07D333/52—Benzo[b]thiophenes; Hydrogenated benzo[b]thiophenes
- C07D333/54—Benzo[b]thiophenes; Hydrogenated benzo[b]thiophenes with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to carbon atoms of the hetero ring
- C07D333/60—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/50—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom condensed with carbocyclic rings or ring systems
- C07D333/52—Benzo[b]thiophenes; Hydrogenated benzo[b]thiophenes
- C07D333/54—Benzo[b]thiophenes; Hydrogenated benzo[b]thiophenes with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to carbon atoms of the hetero ring
- C07D333/56—Radicals substituted by oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB2569872A GB1382282A (en) | 1972-06-01 | 1972-06-01 | Benzo b thiophene compounds and processes for preparing the same |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU467520A1 true SU467520A1 (ru) | 1975-04-15 |
Family
ID=10231857
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1917607A SU467520A1 (ru) | 1972-06-01 | 1973-05-23 | Способ получени производных бензо (в) тиофена |
Country Status (23)
| Country | Link |
|---|---|
| US (1) | US3928384A (enExample) |
| JP (1) | JPS5125026B2 (enExample) |
| AR (1) | AR195330A1 (enExample) |
| AT (1) | AT323732B (enExample) |
| AU (1) | AU465332B2 (enExample) |
| BE (1) | BE799719A (enExample) |
| CA (1) | CA1000284A (enExample) |
| CH (1) | CH572051A5 (enExample) |
| DE (1) | DE2328060C3 (enExample) |
| DK (1) | DK131630C (enExample) |
| ES (1) | ES415406A1 (enExample) |
| FI (1) | FI55337C (enExample) |
| FR (1) | FR2186255B1 (enExample) |
| GB (1) | GB1382282A (enExample) |
| HU (1) | HU165214B (enExample) |
| IE (1) | IE38010B1 (enExample) |
| NL (1) | NL148317B (enExample) |
| NO (1) | NO136889C (enExample) |
| OA (1) | OA04415A (enExample) |
| SE (1) | SE395004B (enExample) |
| SU (1) | SU467520A1 (enExample) |
| YU (1) | YU34894B (enExample) |
| ZA (1) | ZA732943B (enExample) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DK312376A (da) * | 1975-07-11 | 1977-01-12 | Kyowa Hakko Kogyo Kk | Benzo(b)furyleddikesyrederivater og fremgangsmader til deres fremstilling |
| JPS5218518U (enExample) * | 1975-07-28 | 1977-02-09 | ||
| JPS5672919A (en) * | 1979-11-19 | 1981-06-17 | Suzuki Sogyo Kk | Molding method for printing film |
| JPS6034834A (ja) * | 1983-08-05 | 1985-02-22 | Sekisui Seikei Kogyo Kk | ポリプロピレン積層化粧シ−トの製法 |
| JPS63104816A (ja) * | 1986-10-23 | 1988-05-10 | Dainippon Printing Co Ltd | 成形用絵付きフイルム |
| US4873259A (en) * | 1987-06-10 | 1989-10-10 | Abbott Laboratories | Indole, benzofuran, benzothiophene containing lipoxygenase inhibiting compounds |
| US4897422A (en) * | 1987-02-10 | 1990-01-30 | Abbott Laboratories | Lipoxygenase inhibiting compounds |
| JPH0651352B2 (ja) * | 1988-08-31 | 1994-07-06 | アキレス株式会社 | 合成樹脂シートの製造方法 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3134774A (en) * | 1962-09-21 | 1964-05-26 | Smith Kline French Lab | Heterocyclic carboxylic acid derivatives of 7-aminocephalosporanic acid compounds |
| US3476760A (en) * | 1967-03-06 | 1969-11-04 | Smithkline Corp | Substituted piperidinoalkylthianaphthenes and benzofurans |
| US3546232A (en) * | 1968-10-25 | 1970-12-08 | Smithkline Corp | 3 - phenyl - 8 - thianaphthenylalkyl derivatives of nortropine and nortropidine |
-
1972
- 1972-06-01 GB GB2569872A patent/GB1382282A/en not_active Expired
-
1973
- 1973-04-16 YU YU1005/73A patent/YU34894B/xx unknown
- 1973-04-23 AR AR247654A patent/AR195330A1/es active
- 1973-05-01 IE IE686/73A patent/IE38010B1/xx unknown
- 1973-05-01 ZA ZA732943A patent/ZA732943B/xx unknown
- 1973-05-07 US US357871A patent/US3928384A/en not_active Expired - Lifetime
- 1973-05-11 NL NL737306597A patent/NL148317B/xx not_active IP Right Cessation
- 1973-05-11 SE SE7306695A patent/SE395004B/xx unknown
- 1973-05-18 BE BE131262A patent/BE799719A/xx not_active IP Right Cessation
- 1973-05-23 SU SU1917607A patent/SU467520A1/ru active
- 1973-05-23 JP JP48058503A patent/JPS5125026B2/ja not_active Expired
- 1973-05-25 FR FR7319051A patent/FR2186255B1/fr not_active Expired
- 1973-05-28 AU AU56195/73A patent/AU465332B2/en not_active Expired
- 1973-05-28 FI FI1711/73A patent/FI55337C/fi active
- 1973-05-30 NO NO2276/73A patent/NO136889C/no unknown
- 1973-05-30 CH CH783473A patent/CH572051A5/xx not_active IP Right Cessation
- 1973-05-30 OA OA54924A patent/OA04415A/xx unknown
- 1973-05-30 ES ES415406A patent/ES415406A1/es not_active Expired
- 1973-05-30 DK DK302473*A patent/DK131630C/da active
- 1973-05-31 HU HULA826A patent/HU165214B/hu unknown
- 1973-05-31 CA CA172,907A patent/CA1000284A/en not_active Expired
- 1973-06-01 DE DE2328060A patent/DE2328060C3/de not_active Expired
- 1973-06-01 AT AT481673A patent/AT323732B/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| YU34894B (en) | 1980-04-30 |
| IE38010B1 (en) | 1977-12-07 |
| NO136889C (no) | 1977-11-23 |
| DK131630B (da) | 1975-08-11 |
| FI55337B (fi) | 1979-03-30 |
| ZA732943B (en) | 1974-04-24 |
| AU5619573A (en) | 1974-11-28 |
| NL7306597A (enExample) | 1973-12-04 |
| DE2328060B2 (de) | 1975-05-15 |
| HU165214B (enExample) | 1974-07-27 |
| YU100573A (en) | 1979-10-31 |
| NO136889B (no) | 1977-08-15 |
| JPS4942665A (enExample) | 1974-04-22 |
| AU465332B2 (en) | 1975-09-25 |
| JPS5125026B2 (enExample) | 1976-07-28 |
| GB1382282A (en) | 1975-01-29 |
| DE2328060C3 (de) | 1976-01-08 |
| DE2328060A1 (de) | 1973-12-13 |
| IE38010L (en) | 1973-12-01 |
| CA1000284A (en) | 1976-11-23 |
| ES415406A1 (es) | 1976-02-01 |
| OA04415A (fr) | 1980-02-29 |
| NL148317B (nl) | 1976-01-15 |
| CH572051A5 (enExample) | 1976-01-30 |
| FR2186255B1 (enExample) | 1976-10-22 |
| FR2186255A1 (enExample) | 1974-01-11 |
| BE799719A (fr) | 1973-11-19 |
| DK131630C (da) | 1976-01-12 |
| AT323732B (de) | 1975-07-25 |
| AR195330A1 (es) | 1973-09-28 |
| US3928384A (en) | 1975-12-23 |
| SE395004B (sv) | 1977-07-25 |
| FI55337C (fi) | 1979-07-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3394125A (en) | 2-phenyl-3-tertiary-aminoalkoxy phenyl-and corresponding tertiaryaminoalkyl thio benzfurans substituted in the benzo nucleus with an alkoxy or tertiaryamino alkoxy or alkylthio group | |
| PL130584B1 (en) | Process for preparing derivatives of benzothiophene | |
| SU467520A1 (ru) | Способ получени производных бензо (в) тиофена | |
| SU679146A3 (ru) | Способ получени производных фузидиновой кислоты или их солей | |
| SU439983A1 (ru) | Способ получени производных этиленбензоила | |
| NO743186L (enExample) | ||
| SU582767A3 (ru) | Способ получени тиофенсахаринов или их солей | |
| US2895992A (en) | Process for the production of benzoic | |
| US3076817A (en) | New j-amino-thiophene-z | |
| FI59086C (fi) | Foerfarande foer framstaellning av 2,5-disubstituerade bensamider | |
| US4054585A (en) | Furan-3-carboxamide derivatives and method of preparing same | |
| SU747426A3 (ru) | Способ получени дитиенилалкиламинов или их солей | |
| SU786895A3 (ru) | Способ получени производных тиазолидин-,тиазан-или морфолинкарбоновых кислот или их кислотно-аддитивных солей | |
| US4127585A (en) | Isoxazol amides of 4-hydroxy-6H-thieno[2,3-b]thiopyran-5-carboxylic acid-7,7-dioxide | |
| US3597432A (en) | 4-piperidinomethyl - 3,4 - dihydro-1-benzothiepin-5(2h)-ones | |
| SU453844A3 (enExample) | ||
| DE2558356A1 (de) | Dehydrobiotinverbindungen | |
| SU502607A3 (ru) | Способ получени лактамов | |
| US3818023A (en) | 2-phenyl benzothiazolyl acetic acid derivatives | |
| STEFANYE et al. | ACYLATION OF 3, 6-PYRIDAZINEDIONES | |
| Mukaiyama et al. | Syntheses and Reactions of 2-Ethylthio-or 2-Phenylthio-2-cycloalkenones | |
| DE69928107T2 (de) | Heterozyklus mit thiophenol gruppe, intermediate zur herstellung und herstellungsverfahren für beide stoffgruppen | |
| US3828073A (en) | 4-hydroxy-2h-1-benzothiopyran-3-carboxamides and their corresponding s-oxides | |
| SU554810A3 (ru) | Способ получени производных бифенила или их солей, или рацематов, или оптически активных антиподов | |
| SU489334A3 (ru) | Способ получени производных тиепина |