SU448639A3 - Способ получени аминоспиртовых производных о-транс-оксикоричной кислоты - Google Patents
Способ получени аминоспиртовых производных о-транс-оксикоричной кислотыInfo
- Publication number
- SU448639A3 SU448639A3 SU1772371A SU1772371A SU448639A3 SU 448639 A3 SU448639 A3 SU 448639A3 SU 1772371 A SU1772371 A SU 1772371A SU 1772371 A SU1772371 A SU 1772371A SU 448639 A3 SU448639 A3 SU 448639A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- mol
- trans
- propoxy
- hydroxy
- cinnamic acid
- Prior art date
Links
- 238000000034 method Methods 0.000 title description 7
- 150000001414 amino alcohols Chemical class 0.000 title description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 24
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 22
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 22
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 21
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 20
- 238000009835 boiling Methods 0.000 description 14
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 12
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 11
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 11
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- -1 isopropylamino-3-hydroxy - 2 - propoxy Chemical group 0.000 description 9
- 150000002924 oxiranes Chemical class 0.000 description 9
- 239000000047 product Substances 0.000 description 9
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- 239000000203 mixture Substances 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 6
- 229910000027 potassium carbonate Inorganic materials 0.000 description 6
- 238000001953 recrystallisation Methods 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 5
- 150000001412 amines Chemical class 0.000 description 5
- 239000013078 crystal Substances 0.000 description 5
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 229940114081 cinnamate Drugs 0.000 description 2
- ZYGHJZDHTFUPRJ-UHFFFAOYSA-N coumarin Chemical compound C1=CC=C2OC(=O)C=CC2=C1 ZYGHJZDHTFUPRJ-UHFFFAOYSA-N 0.000 description 2
- 229960000956 coumarin Drugs 0.000 description 2
- 229910052736 halogen Chemical group 0.000 description 2
- 150000002367 halogens Chemical group 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 150000004702 methyl esters Chemical class 0.000 description 2
- 239000004593 Epoxy Substances 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 150000003862 amino acid derivatives Chemical class 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 235000001671 coumarin Nutrition 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 125000003700 epoxy group Chemical group 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 229930005346 hydroxycinnamic acid Natural products 0.000 description 1
- 235000010359 hydroxycinnamic acids Nutrition 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- CLTUKDYUSFOGQE-BQYQJAHWSA-N propan-2-yl (e)-3-(2-hydroxyphenyl)prop-2-enoate Chemical compound CC(C)OC(=O)\C=C\C1=CC=CC=C1O CLTUKDYUSFOGQE-BQYQJAHWSA-N 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- NGSWKAQJJWESNS-ZZXKWVIFSA-N trans-4-coumaric acid Chemical compound OC(=O)\C=C\C1=CC=C(O)C=C1 NGSWKAQJJWESNS-ZZXKWVIFSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D303/00—Compounds containing three-membered rings having one oxygen atom as the only ring hetero atom
- C07D303/02—Compounds containing oxirane rings
- C07D303/12—Compounds containing oxirane rings with hydrocarbon radicals, substituted by singly or doubly bound oxygen atoms
- C07D303/18—Compounds containing oxirane rings with hydrocarbon radicals, substituted by singly or doubly bound oxygen atoms by etherified hydroxyl radicals
- C07D303/20—Ethers with hydroxy compounds containing no oxirane rings
- C07D303/22—Ethers with hydroxy compounds containing no oxirane rings with monohydroxy compounds
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/13—Amines
- A61K31/135—Amines having aromatic rings, e.g. ketamine, nortriptyline
- A61K31/138—Aryloxyalkylamines, e.g. propranolol, tamoxifen, phenoxybenzamine
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C217/00—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton
- C07C217/02—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C217/04—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated
- C07C217/28—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having one amino group and at least two singly-bound oxygen atoms, with at least one being part of an etherified hydroxy group, bound to the carbon skeleton, e.g. ethers of polyhydroxy amines
- C07C217/30—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having one amino group and at least two singly-bound oxygen atoms, with at least one being part of an etherified hydroxy group, bound to the carbon skeleton, e.g. ethers of polyhydroxy amines having the oxygen atom of at least one of the etherified hydroxy groups further bound to a carbon atom of a six-membered aromatic ring
- C07C217/32—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having one amino group and at least two singly-bound oxygen atoms, with at least one being part of an etherified hydroxy group, bound to the carbon skeleton, e.g. ethers of polyhydroxy amines having the oxygen atom of at least one of the etherified hydroxy groups further bound to a carbon atom of a six-membered aromatic ring the six-membered aromatic ring or condensed ring system containing that ring being further substituted
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C217/00—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton
- C07C217/02—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C217/04—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated
- C07C217/28—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having one amino group and at least two singly-bound oxygen atoms, with at least one being part of an etherified hydroxy group, bound to the carbon skeleton, e.g. ethers of polyhydroxy amines
- C07C217/30—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having one amino group and at least two singly-bound oxygen atoms, with at least one being part of an etherified hydroxy group, bound to the carbon skeleton, e.g. ethers of polyhydroxy amines having the oxygen atom of at least one of the etherified hydroxy groups further bound to a carbon atom of a six-membered aromatic ring
- C07C217/32—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having one amino group and at least two singly-bound oxygen atoms, with at least one being part of an etherified hydroxy group, bound to the carbon skeleton, e.g. ethers of polyhydroxy amines having the oxygen atom of at least one of the etherified hydroxy groups further bound to a carbon atom of a six-membered aromatic ring the six-membered aromatic ring or condensed ring system containing that ring being further substituted
- C07C217/34—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having one amino group and at least two singly-bound oxygen atoms, with at least one being part of an etherified hydroxy group, bound to the carbon skeleton, e.g. ethers of polyhydroxy amines having the oxygen atom of at least one of the etherified hydroxy groups further bound to a carbon atom of a six-membered aromatic ring the six-membered aromatic ring or condensed ring system containing that ring being further substituted by halogen atoms, by trihalomethyl, nitro or nitroso groups, or by singly-bound oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C279/00—Derivatives of guanidine, i.e. compounds containing the group, the singly-bound nitrogen atoms not being part of nitro or nitroso groups
- C07C279/20—Derivatives of guanidine, i.e. compounds containing the group, the singly-bound nitrogen atoms not being part of nitro or nitroso groups containing any of the groups, X being a hetero atom, Y being any atom, e.g. acylguanidines
- C07C279/22—Y being a hydrogen or a carbon atom, e.g. benzoylguanidines
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Epidemiology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Epoxy Compounds (AREA)
- Medicinal Preparation (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7112668A FR2132570B1 (enExample) | 1971-04-09 | 1971-04-09 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU448639A3 true SU448639A3 (ru) | 1974-10-30 |
Family
ID=9075074
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1772371A SU448639A3 (ru) | 1971-04-09 | 1972-04-07 | Способ получени аминоспиртовых производных о-транс-оксикоричной кислоты |
Country Status (26)
| Country | Link |
|---|---|
| US (1) | US3828095A (enExample) |
| JP (1) | JPS5544738B1 (enExample) |
| AR (1) | AR192925A1 (enExample) |
| AT (1) | AT315151B (enExample) |
| AU (1) | AU463651B2 (enExample) |
| BE (1) | BE781805A (enExample) |
| BR (1) | BR7202015D0 (enExample) |
| CA (1) | CA999010A (enExample) |
| CH (1) | CH551942A (enExample) |
| CS (1) | CS171256B2 (enExample) |
| DD (1) | DD100459A5 (enExample) |
| DE (1) | DE2216537C2 (enExample) |
| ES (1) | ES401500A1 (enExample) |
| FR (1) | FR2132570B1 (enExample) |
| GB (1) | GB1358803A (enExample) |
| HU (1) | HU164931B (enExample) |
| IE (1) | IE36247B1 (enExample) |
| IL (1) | IL39147A (enExample) |
| IT (1) | IT998066B (enExample) |
| NL (1) | NL176453C (enExample) |
| NO (1) | NO139169C (enExample) |
| OA (1) | OA03987A (enExample) |
| SE (1) | SE385692B (enExample) |
| SU (1) | SU448639A3 (enExample) |
| YU (1) | YU35102B (enExample) |
| ZA (1) | ZA722318B (enExample) |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2623314C2 (de) * | 1976-05-25 | 1984-08-02 | Hoechst Ag, 6230 Frankfurt | 1-Aryloxy-2-Hydroxy-3-aminopropane, Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel |
| DE2818765A1 (de) * | 1978-04-28 | 1979-11-08 | Basf Ag | Aminoderivate des 2-methyl-5-(2-hydroxystyrol)-1,3,4-thiadiazols |
| IT1122012B (it) * | 1978-07-05 | 1986-04-23 | Beiersdorf Ag | 4-aril-2,5-diidro-furan-2-oni e 4-aril-1,5-diidro-2h-pirrol-2-oni e processi per la loro preparazione |
| EP0025331B1 (en) * | 1979-09-06 | 1983-03-02 | Beecham Group Plc | Cinnamic acid derivatives, their preparation, and pharmaceutical compositions containing them |
| SE8004087L (sv) | 1980-06-02 | 1981-12-03 | Haessle Ab | Nya parasubstituerade 3-fenoxi-1-alkylaminopropanol-2-er med betareceptorblockerande egenskaper, samt forfarande for deras framstellning, farmaceutiska beredningar innehallande desamma, och metod att behandla akut ... |
| SE8004088L (sv) * | 1980-06-02 | 1981-12-03 | Haessle Ab | Nya substituerade 3-fenoxi-l-alkoxikarbonylalkylamino-propanol-2-er med beta-receptorblockerande egenskaper samt forfarande for deras framstellning, farmaceutiska beredningar innehallande desamma och metod att ... |
| US4454154A (en) * | 1981-06-23 | 1984-06-12 | American Hospital Supply Corporation | Method for treating glaucoma by the topical administration of selectively metabolized beta-blocking agents |
| ZA827646B (en) * | 1981-11-12 | 1983-08-31 | American Hospital Supply Corp | Esters of aryloxypropanolamine derivatives |
| US4508725A (en) * | 1982-12-22 | 1985-04-02 | American Hospital Supply Corporation | Esters of 3-(3-substituted-amino-2-hydroxypropoxy)-4-substituted-1,2,5-thiadiazole derivatives |
| US4593039A (en) * | 1984-04-02 | 1986-06-03 | Merck & Co., Inc. | 1-aryloxy-3-(substituted aminoalkylamino)-2-propanols |
| US5232948A (en) * | 1990-09-10 | 1993-08-03 | Rhone-Poulenc Rorer Pharmaceuticals Inc. | Substituted monocyclic aryl compounds exhibiting selective leukotriene b4 antagonist activity |
| US10491066B2 (en) | 2015-06-16 | 2019-11-26 | Danfoss Editron Oy | Method and arrangement for adjusting the magnetization of a permanent magnet machine |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3660230A (en) * | 1968-11-26 | 1972-05-02 | Gen Electric | Nuclear reactor control system |
| CA945172A (en) * | 1969-02-21 | 1974-04-09 | Imperial Chemical Industries Limited | Alkanolamine derivatives |
-
1971
- 1971-04-09 FR FR7112668A patent/FR2132570B1/fr not_active Expired
-
1972
- 1972-03-23 YU YU771/72A patent/YU35102B/xx unknown
- 1972-03-29 OA OA54528A patent/OA03987A/xx unknown
- 1972-03-30 IE IE423/72A patent/IE36247B1/xx unknown
- 1972-04-04 NO NO1128/72A patent/NO139169C/no unknown
- 1972-04-04 SE SE7204266A patent/SE385692B/xx unknown
- 1972-04-05 US US00241381A patent/US3828095A/en not_active Expired - Lifetime
- 1972-04-06 DE DE2216537A patent/DE2216537C2/de not_active Expired
- 1972-04-06 CA CA139,108A patent/CA999010A/en not_active Expired
- 1972-04-06 GB GB1595072A patent/GB1358803A/en not_active Expired
- 1972-04-06 IL IL39147A patent/IL39147A/en unknown
- 1972-04-06 JP JP3396972A patent/JPS5544738B1/ja active Pending
- 1972-04-06 CS CS2304A patent/CS171256B2/cs unknown
- 1972-04-06 AU AU40818/72A patent/AU463651B2/en not_active Expired
- 1972-04-06 BR BR722015A patent/BR7202015D0/pt unknown
- 1972-04-06 ES ES401500A patent/ES401500A1/es not_active Expired
- 1972-04-07 BE BE116056A patent/BE781805A/xx not_active IP Right Cessation
- 1972-04-07 ZA ZA722318A patent/ZA722318B/xx unknown
- 1972-04-07 IT IT22835/72A patent/IT998066B/it active
- 1972-04-07 SU SU1772371A patent/SU448639A3/ru active
- 1972-04-07 NL NLAANVRAGE7204726,A patent/NL176453C/xx not_active IP Right Cessation
- 1972-04-07 CH CH516072A patent/CH551942A/fr not_active IP Right Cessation
- 1972-04-08 HU HULI227A patent/HU164931B/hu unknown
- 1972-04-10 AR AR241388A patent/AR192925A1/es active
- 1972-04-10 AT AT308272A patent/AT315151B/de not_active IP Right Cessation
- 1972-04-10 DD DD162185A patent/DD100459A5/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| ZA722318B (en) | 1972-12-27 |
| NL176453C (nl) | 1985-04-16 |
| DE2216537A1 (de) | 1972-10-19 |
| CH551942A (fr) | 1974-07-31 |
| AT315151B (de) | 1974-05-10 |
| IL39147A0 (en) | 1972-06-28 |
| GB1358803A (en) | 1974-07-03 |
| NO139169B (no) | 1978-10-09 |
| HU164931B (enExample) | 1974-05-28 |
| ES401500A1 (es) | 1975-09-16 |
| US3828095A (en) | 1974-08-06 |
| NO139169C (no) | 1979-01-31 |
| JPS5544738B1 (enExample) | 1980-11-13 |
| YU35102B (en) | 1980-09-25 |
| CS171256B2 (enExample) | 1976-10-29 |
| IE36247L (en) | 1972-10-09 |
| NL7204726A (enExample) | 1972-10-11 |
| BE781805A (fr) | 1972-10-09 |
| DD100459A5 (enExample) | 1973-09-20 |
| NL176453B (nl) | 1984-11-16 |
| CA999010A (en) | 1976-10-26 |
| BR7202015D0 (pt) | 1975-02-12 |
| AU463651B2 (en) | 1975-07-16 |
| IT998066B (it) | 1976-01-20 |
| IL39147A (en) | 1976-12-31 |
| IE36247B1 (en) | 1976-09-15 |
| AR192925A1 (es) | 1973-03-21 |
| DE2216537C2 (de) | 1984-08-02 |
| FR2132570A1 (enExample) | 1972-11-24 |
| FR2132570B1 (enExample) | 1974-08-02 |
| AU4081872A (en) | 1973-10-11 |
| OA03987A (fr) | 1979-09-15 |
| YU77172A (en) | 1980-03-15 |
| SE385692B (sv) | 1976-07-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4152326A (en) | Cyclic sulphonyloxyimides | |
| SU448639A3 (ru) | Способ получени аминоспиртовых производных о-транс-оксикоричной кислоты | |
| RS49626B (sr) | Novi postupak za dobijanje farmakološki aktivne supstance | |
| SU651704A3 (ru) | Способ получени производных дибензоциклогептена, рацемических или оптически активных, или их солей | |
| SU578870A3 (ru) | Способ получени -(метоксиметил) фурилметил-6,7-бензоморфанов или морфинанов или их солей | |
| KR20220114626A (ko) | 6-카르복시 벤족사졸 유도체의 효율적인 제조 방법 | |
| SU747426A3 (ru) | Способ получени дитиенилалкиламинов или их солей | |
| US2502451A (en) | Amino-alkyl esters of diphenylamine 2-monocarboxylic acids | |
| SU508176A3 (ru) | Способ получени аминопроизводных бензофенона | |
| SU860696A1 (ru) | Способ получени N-замещенных тиобутирамидов или их солей | |
| US5534651A (en) | Process for preparing γ-mercaptocarboxylic acid derivatives | |
| FI59086C (fi) | Foerfarande foer framstaellning av 2,5-disubstituerade bensamider | |
| US8163942B2 (en) | Salt of (2S, 3S)-3-[[(1S)-1-isobutoxymethyl-3-methylbutyl]carbamoyl]oxirane-2-carboxylic acid | |
| US3345416A (en) | Preparation and rearrangement of beta-ketosulfoxides | |
| US2762815A (en) | 3-isoxazolidones, derivatives and process | |
| US4201870A (en) | Process for the preparation of 2-(3-benzoylphenyl)-propionic acid | |
| SU862822A3 (ru) | Способ получени N-циано-N -метил-N 2 @ /4-метил-5-имидазолил/-метилтио @ -этил @ гуанидина | |
| US3226379A (en) | Novel 1,3-bis(polyhydroxyalkyl)-2-imidazolidinones and 1,3-bis(polyhydroxyalkyl)-imidazolidine-2-thiones | |
| SU458130A3 (ru) | Способ получени нитрофурилпириидиновых производных | |
| DK164501B (da) | Fremgangsmaade til fremstilling af nizatidin og mellemprodukt til brug ved fremgangsmaaden | |
| SU489319A3 (ru) | Способ получени производных кумарина | |
| US4125728A (en) | Method for preparing 2,3,7,8-tetraazaspiro[4,4]nona-2,7-diene | |
| US4299968A (en) | Novel thiophene compounds | |
| SU374815A1 (ru) | Способ получения феноксиэтиламинов | |
| SU407905A1 (ru) | Способ получения 4-аминометилтиазол-2-олов |