SU1039439A3 - Способ получени 2-(3-феноксифенил)-пропионовой кислоты или ее кальциевой соли - Google Patents
Способ получени 2-(3-феноксифенил)-пропионовой кислоты или ее кальциевой соли Download PDFInfo
- Publication number
- SU1039439A3 SU1039439A3 SU792860205A SU2860205A SU1039439A3 SU 1039439 A3 SU1039439 A3 SU 1039439A3 SU 792860205 A SU792860205 A SU 792860205A SU 2860205 A SU2860205 A SU 2860205A SU 1039439 A3 SU1039439 A3 SU 1039439A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- phenoxyphenyl
- solution
- acid
- water
- alcohol
- Prior art date
Links
- 159000000007 calcium salts Chemical class 0.000 title claims description 5
- 238000004519 manufacturing process Methods 0.000 title claims description 4
- 150000001875 compounds Chemical class 0.000 claims abstract description 11
- RDJGLLICXDHJDY-UHFFFAOYSA-N fenoprofen Chemical compound OC(=O)C(C)C1=CC=CC(OC=2C=CC=CC=2)=C1 RDJGLLICXDHJDY-UHFFFAOYSA-N 0.000 claims abstract description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 37
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 19
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 18
- 238000000034 method Methods 0.000 claims description 12
- 239000000203 mixture Substances 0.000 claims description 12
- 239000011541 reaction mixture Substances 0.000 claims description 11
- 238000009835 boiling Methods 0.000 claims description 8
- 239000002253 acid Substances 0.000 claims description 5
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical class C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 claims description 3
- 238000002955 isolation Methods 0.000 claims description 2
- 239000011575 calcium Substances 0.000 claims 1
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 abstract 2
- 230000003110 anti-inflammatory effect Effects 0.000 abstract 1
- 230000000911 decarboxylating effect Effects 0.000 abstract 1
- 230000003301 hydrolyzing effect Effects 0.000 abstract 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 abstract 1
- 238000011282 treatment Methods 0.000 abstract 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 37
- 239000000243 solution Substances 0.000 description 36
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 22
- 235000019441 ethanol Nutrition 0.000 description 20
- 238000003756 stirring Methods 0.000 description 14
- 239000000047 product Substances 0.000 description 11
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 10
- 238000006243 chemical reaction Methods 0.000 description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 238000002844 melting Methods 0.000 description 9
- 230000008018 melting Effects 0.000 description 9
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 8
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 8
- 229910052938 sodium sulfate Inorganic materials 0.000 description 8
- 235000011152 sodium sulphate Nutrition 0.000 description 8
- 239000007858 starting material Substances 0.000 description 7
- OIFBSDVPJOWBCH-UHFFFAOYSA-N Diethyl carbonate Chemical compound CCOC(=O)OCC OIFBSDVPJOWBCH-UHFFFAOYSA-N 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 5
- 238000000746 purification Methods 0.000 description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- 229910021529 ammonia Inorganic materials 0.000 description 4
- 125000003118 aryl group Chemical group 0.000 description 4
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 238000004821 distillation Methods 0.000 description 4
- 238000001035 drying Methods 0.000 description 4
- RFALKMQNBPHELA-UHFFFAOYSA-N ethyl 2-cyano-2-(3-phenoxyphenyl)propanoate Chemical compound CCOC(=O)C(C)(C#N)C1=CC=CC(OC=2C=CC=CC=2)=C1 RFALKMQNBPHELA-UHFFFAOYSA-N 0.000 description 4
- 239000007789 gas Substances 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- -1 phenoxyphenylpropionic acid aldehyde Chemical class 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- DKGMALJGFUHPGB-UHFFFAOYSA-N 2-(3-phenoxyphenyl)acetonitrile Chemical compound N#CCC1=CC=CC(OC=2C=CC=CC=2)=C1 DKGMALJGFUHPGB-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 3
- 150000004702 methyl esters Chemical class 0.000 description 3
- 239000012022 methylating agents Substances 0.000 description 3
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical class O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 3
- FPJBPTQTHPZNBE-UHFFFAOYSA-N 2-cyano-2-(3-phenoxyphenyl)propanoic acid Chemical compound N#CC(C)(C(O)=O)C1=CC=CC(OC=2C=CC=CC=2)=C1 FPJBPTQTHPZNBE-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- PHSPJQZRQAJPPF-UHFFFAOYSA-N N-alpha-Methylhistamine Chemical compound CNCCC1=CN=CN1 PHSPJQZRQAJPPF-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 125000004494 ethyl ester group Chemical group 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 230000003993 interaction Effects 0.000 description 2
- 239000013067 intermediate product Substances 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- XUDXNGUORATCNY-UHFFFAOYSA-N methyl 2-cyano-2-(3-phenoxyphenyl)propanoate Chemical compound COC(=O)C(C)(C#N)C1=CC=CC(OC=2C=CC=CC=2)=C1 XUDXNGUORATCNY-UHFFFAOYSA-N 0.000 description 2
- 230000011987 methylation Effects 0.000 description 2
- 238000007069 methylation reaction Methods 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 235000019260 propionic acid Nutrition 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 238000004809 thin layer chromatography Methods 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- OBTDVRGUJLGMIN-UHFFFAOYSA-N 1-phenoxy-3-prop-1-ynylbenzene Chemical compound CC#CC1=CC=CC(OC=2C=CC=CC=2)=C1 OBTDVRGUJLGMIN-UHFFFAOYSA-N 0.000 description 1
- AVCXUPSTLHKNGB-UHFFFAOYSA-N 2-cyano-2-(3-phenoxyphenyl)acetic acid Chemical compound OC(=O)C(C#N)C1=CC=CC(OC=2C=CC=CC=2)=C1 AVCXUPSTLHKNGB-UHFFFAOYSA-N 0.000 description 1
- UMTRHZBMIRLIKP-UHFFFAOYSA-N 2-phenoxy-2-phenylacetonitrile Chemical compound C=1C=CC=CC=1C(C#N)OC1=CC=CC=C1 UMTRHZBMIRLIKP-UHFFFAOYSA-N 0.000 description 1
- LUJMEECXHPYQOF-UHFFFAOYSA-N 3-hydroxyacetophenone Chemical compound CC(=O)C1=CC=CC(O)=C1 LUJMEECXHPYQOF-UHFFFAOYSA-N 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- ZASYXXGNNSUIBS-UHFFFAOYSA-N CC(=O)C.[N+](=O)([O-])C1=C(C=CC(=C1)[N+](=O)[O-])NN Chemical compound CC(=O)C.[N+](=O)([O-])C1=C(C=CC(=C1)[N+](=O)[O-])NN ZASYXXGNNSUIBS-UHFFFAOYSA-N 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 238000001159 Fisher's combined probability test Methods 0.000 description 1
- 235000010469 Glycine max Nutrition 0.000 description 1
- 244000068988 Glycine max Species 0.000 description 1
- 241001139947 Mida Species 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- LKPVHTAWGPBJMM-UHFFFAOYSA-M [O-]C1=CC=CC=C1.[Mg+]C1=CC=CC=C1 Chemical compound [O-]C1=CC=CC=C1.[Mg+]C1=CC=CC=C1 LKPVHTAWGPBJMM-UHFFFAOYSA-M 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 1
- 238000006114 decarboxylation reaction Methods 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- IEJIGPNLZYLLBP-UHFFFAOYSA-N dimethyl carbonate Chemical compound COC(=O)OC IEJIGPNLZYLLBP-UHFFFAOYSA-N 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- VGLCBSOALKYKJU-UHFFFAOYSA-N ethyl 2-cyano-2-(3-phenoxyphenyl)acetate Chemical compound CCOC(=O)C(C#N)C1=CC=CC(OC=2C=CC=CC=2)=C1 VGLCBSOALKYKJU-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- XLYOFNOQVPJJNP-ZSJDYOACSA-N heavy water Substances [2H]O[2H] XLYOFNOQVPJJNP-ZSJDYOACSA-N 0.000 description 1
- 239000012456 homogeneous solution Substances 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 238000011031 large-scale manufacturing process Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- NNICRUQPODTGRU-UHFFFAOYSA-N mandelonitrile Chemical compound N#CC(O)C1=CC=CC=C1 NNICRUQPODTGRU-UHFFFAOYSA-N 0.000 description 1
- JZMJDSHXVKJFKW-UHFFFAOYSA-M methyl sulfate(1-) Chemical compound COS([O-])(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-M 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- WBHQBSYUUJJSRZ-UHFFFAOYSA-M sodium bisulfate Chemical compound [Na+].OS([O-])(=O)=O WBHQBSYUUJJSRZ-UHFFFAOYSA-M 0.000 description 1
- 229910000342 sodium bisulfate Inorganic materials 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- NHEFSTXHZRGAIH-UHFFFAOYSA-M sodium;2-bromopropanoate Chemical compound [Na+].CC(Br)C([O-])=O NHEFSTXHZRGAIH-UHFFFAOYSA-M 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 210000002700 urine Anatomy 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/58—Unsaturated compounds containing ether groups, groups, groups, or groups
- C07C59/64—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings
- C07C59/66—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings the non-carboxylic part of the ether containing six-membered aromatic rings
- C07C59/68—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings the non-carboxylic part of the ether containing six-membered aromatic rings the oxygen atom of the ether group being bound to a non-condensed six-membered aromatic ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HUCI001894 | 1978-12-29 | ||
| HUCI001979 HU181672B (hu) | 1979-10-25 | 1979-10-25 | Eljárás 2-(3-fenoxi-fenil)-propionsav és sói új intermedieren keresztül történő előállítására |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU1039439A3 true SU1039439A3 (ru) | 1983-08-30 |
Family
ID=26318424
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU792860205A SU1039439A3 (ru) | 1978-12-29 | 1979-12-28 | Способ получени 2-(3-феноксифенил)-пропионовой кислоты или ее кальциевой соли |
Country Status (8)
| Country | Link |
|---|---|
| US (2) | US4304930A (cg-RX-API-DMAC10.html) |
| CH (1) | CH646944A5 (cg-RX-API-DMAC10.html) |
| DD (1) | DD149507A5 (cg-RX-API-DMAC10.html) |
| DE (1) | DE2950608A1 (cg-RX-API-DMAC10.html) |
| FR (1) | FR2445314A1 (cg-RX-API-DMAC10.html) |
| GB (1) | GB2039479B (cg-RX-API-DMAC10.html) |
| RO (1) | RO79023A (cg-RX-API-DMAC10.html) |
| SU (1) | SU1039439A3 (cg-RX-API-DMAC10.html) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| RU2451669C1 (ru) * | 2011-02-14 | 2012-05-27 | Государственное образовательное учреждение высшего профессионального образования Волгоградский государственный технический университет (ВолгГТУ) | Способ получения 3-феноксифенилацетонитрила |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB8318889D0 (en) * | 1983-07-13 | 1983-08-17 | Lilly Industries Ltd | Pharmaceutical compounds |
| US4760089A (en) * | 1985-09-09 | 1988-07-26 | Smithkline Beckman Corporation | Irreversible dopamine-β-hydroxylase inhibitors |
| RU2059603C1 (ru) * | 1991-05-09 | 1996-05-10 | Хоффманн-Ля Рош АГ | ПРОИЗВОДНЫЕ α -ЗАМЕЩЕННЫХ АРИЛУКСУСНЫХ КИСЛОТ И ФАРМАЦЕВТИЧЕСКАЯ КОМПОЗИЦИЯ |
| DE69209357D1 (de) * | 1991-05-09 | 1996-05-02 | Hoffmann La Roche | Substituierte Carbonsäurederivate |
| CA2345068C (en) * | 1998-09-26 | 2009-11-17 | Aventis Pharma Deutschland Gmbh | Process for the preparation of .alpha.,.alpha.-dimethylphenylacetic acid from .alpha.,.alpha.-dimethylbenzyl cyanide under normal pressure |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SE363818B (cg-RX-API-DMAC10.html) * | 1968-08-15 | 1974-02-04 | Lilly Co Eli | |
| US3853905A (en) * | 1968-08-15 | 1974-12-10 | Lilly Co Eli | Certain 5-(phenoxyphenalkyl) tetrazoles |
| CA1041531A (en) * | 1973-10-29 | 1978-10-31 | Eisai Co. Ltd. | M-phenoxyphenyl propionic acid derivatives and preparation thereof |
| JPS582934B2 (ja) * | 1974-07-29 | 1983-01-19 | ニツシンセイフン カブシキガイシヤ | 2−(置換アリ−ル)−プロピオン酸の製法 |
| JPS5312835A (en) * | 1976-07-22 | 1978-02-04 | Grelan Pharmaceut Co Ltd | Preparation of 2-(3-phenoxyphenyl) propionic acid |
| HU180811B (en) * | 1976-11-23 | 1983-04-29 | Chinoin Gyogyszer Es Vegyeszet | Process for preparing phenyl-alkyl-carboxylic acids |
-
1979
- 1979-12-15 DE DE19792950608 patent/DE2950608A1/de active Granted
- 1979-12-20 GB GB7943954A patent/GB2039479B/en not_active Expired
- 1979-12-21 US US06/105,988 patent/US4304930A/en not_active Expired - Lifetime
- 1979-12-27 FR FR7931784A patent/FR2445314A1/fr active Granted
- 1979-12-28 DD DD79218215A patent/DD149507A5/de not_active IP Right Cessation
- 1979-12-28 RO RO7999753A patent/RO79023A/ro unknown
- 1979-12-28 CH CH1151279A patent/CH646944A5/de not_active IP Right Cessation
- 1979-12-28 SU SU792860205A patent/SU1039439A3/ru active
-
1981
- 1981-08-12 US US06/292,194 patent/US4393008A/en not_active Expired - Fee Related
Non-Patent Citations (1)
| Title |
|---|
| 1. Патент Венгрии 168376, кл. С 07 С 93/06, опублик. 1977.. 2. За вка DE 2533397, кл. С 07 С 63/52, опублик. 1976. ,3. Патент Швейцарии 527155, кл, С 07 С 63/52, опублик. 1972 (прототип). * |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| RU2451669C1 (ru) * | 2011-02-14 | 2012-05-27 | Государственное образовательное учреждение высшего профессионального образования Волгоградский государственный технический университет (ВолгГТУ) | Способ получения 3-феноксифенилацетонитрила |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2445314B1 (cg-RX-API-DMAC10.html) | 1984-09-07 |
| GB2039479A (en) | 1980-08-13 |
| DE2950608A1 (de) | 1980-07-10 |
| DD149507A5 (de) | 1981-07-15 |
| FR2445314A1 (fr) | 1980-07-25 |
| RO79023A (ro) | 1982-12-06 |
| DE2950608C2 (cg-RX-API-DMAC10.html) | 1990-09-13 |
| GB2039479B (en) | 1982-11-24 |
| US4393008A (en) | 1983-07-12 |
| CH646944A5 (de) | 1984-12-28 |
| US4304930A (en) | 1981-12-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3829453A (en) | Octahydroanthracene-2-aminoacetic acids and esters and mixed anhydrides thereof | |
| SU1039439A3 (ru) | Способ получени 2-(3-феноксифенил)-пропионовой кислоты или ее кальциевой соли | |
| JPH0368026B2 (cg-RX-API-DMAC10.html) | ||
| JP3756205B2 (ja) | 芳香族ニトリルの製造方法 | |
| NO761142L (cg-RX-API-DMAC10.html) | ||
| JP2000327603A (ja) | プロピオン酸誘導体の製造方法 | |
| JPS584699B2 (ja) | 置換フエニル酢酸誘導体及びその製法 | |
| US4264773A (en) | Preparation of 2-chloro-thioxanthone | |
| CA1056848A (en) | Process for the preparation of 3-alkyl-cyclopentane-1,2-diones, and intermediates therefor | |
| US4005146A (en) | Resolution of dl-allethrolone | |
| US4131747A (en) | Process for preparing α-substituted phenylalkanecarboxylic acid | |
| JP3563424B2 (ja) | 4h−ピラン−4−オンの製造方法 | |
| US5208342A (en) | Conversion of pyridine-2,3-dicarboxylic acid esters to cyclic anhydrides | |
| SU793379A3 (ru) | Способ получени производных -нафтилпропионовой кислоты | |
| JP3869531B2 (ja) | ビフェニル誘導体の製造法 | |
| Rice et al. | Spirans. VI. Azadispirans1 | |
| NO149387B (no) | Fremgangsmaate til fremstilling av 6,11-dihydro-11-oksodibenz(b,e)-oksepinalkansyrer | |
| RU2015966C1 (ru) | Способ получения алкил-(не)замещенных 2-[4-(1-оксо-2-изоиндолинил)фенил]уксусных кислот или их нитрилов | |
| KR790001825B1 (ko) | 스틸벤 유도체의 제조법 | |
| JPH0129793B2 (cg-RX-API-DMAC10.html) | ||
| US5113012A (en) | Process for the production of 1,3-cyclopentanedione | |
| JPH0324468B2 (cg-RX-API-DMAC10.html) | ||
| JPS6011690B2 (ja) | 修酸誘導体およびその製法 | |
| HU181672B (hu) | Eljárás 2-(3-fenoxi-fenil)-propionsav és sói új intermedieren keresztül történő előállítására | |
| SU528864A3 (ru) | Способ получени производных -фенилжирной кислоты |