SK103494A3 - Method of preparation of gama-mercaptocarboxylic acid derivatives - Google Patents
Method of preparation of gama-mercaptocarboxylic acid derivatives Download PDFInfo
- Publication number
- SK103494A3 SK103494A3 SK1034-94A SK103494A SK103494A3 SK 103494 A3 SK103494 A3 SK 103494A3 SK 103494 A SK103494 A SK 103494A SK 103494 A3 SK103494 A3 SK 103494A3
- Authority
- SK
- Slovakia
- Prior art keywords
- formula
- nucleophile
- alkyl
- thiocarboxylate
- defined above
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 19
- 238000002360 preparation method Methods 0.000 title claims description 7
- 238000006243 chemical reaction Methods 0.000 claims abstract description 11
- -1 alkali metal alkoxides Chemical class 0.000 claims abstract description 9
- 229910052783 alkali metal Inorganic materials 0.000 claims abstract description 4
- 239000002798 polar solvent Substances 0.000 claims abstract 3
- 239000012038 nucleophile Substances 0.000 claims description 12
- 150000003839 salts Chemical class 0.000 claims description 9
- RLQTWVHIEDBLNJ-UHFFFAOYSA-N 5-thiaspiro[2.4]heptan-6-one Chemical compound C1SC(=O)CC11CC1 RLQTWVHIEDBLNJ-UHFFFAOYSA-N 0.000 claims description 8
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 8
- JYWKEVKEKOTYEX-UHFFFAOYSA-N 2,6-dibromo-4-chloroiminocyclohexa-2,5-dien-1-one Chemical compound ClN=C1C=C(Br)C(=O)C(Br)=C1 JYWKEVKEKOTYEX-UHFFFAOYSA-N 0.000 claims description 5
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 claims description 4
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 4
- 229910021529 ammonia Inorganic materials 0.000 claims description 4
- 125000003118 aryl group Chemical group 0.000 claims description 4
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 claims description 4
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 4
- 125000004209 (C1-C8) alkyl group Chemical group 0.000 claims description 3
- 150000001340 alkali metals Chemical class 0.000 claims description 3
- 150000001450 anions Chemical class 0.000 claims description 3
- 150000003974 aralkylamines Chemical class 0.000 claims description 3
- 150000004982 aromatic amines Chemical class 0.000 claims description 3
- 125000004104 aryloxy group Chemical group 0.000 claims description 3
- 125000003180 beta-lactone group Chemical group 0.000 claims description 3
- 150000001875 compounds Chemical class 0.000 claims description 3
- 125000000000 cycloalkoxy group Chemical group 0.000 claims description 3
- GUVUOGQBMYCBQP-UHFFFAOYSA-N dmpu Chemical compound CN1CCCN(C)C1=O GUVUOGQBMYCBQP-UHFFFAOYSA-N 0.000 claims description 3
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 claims description 3
- 229910015900 BF3 Inorganic materials 0.000 claims description 2
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 claims description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 2
- 125000002102 aryl alkyloxo group Chemical group 0.000 claims description 2
- OROGUZVNAFJPHA-UHFFFAOYSA-N 3-hydroxy-2,4-dimethyl-2H-thiophen-5-one Chemical compound CC1SC(=O)C(C)=C1O OROGUZVNAFJPHA-UHFFFAOYSA-N 0.000 claims 2
- 150000002431 hydrogen Chemical class 0.000 claims 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 1
- 150000001412 amines Chemical class 0.000 claims 1
- 239000003054 catalyst Substances 0.000 claims 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 claims 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 1
- 239000003880 polar aprotic solvent Substances 0.000 claims 1
- 150000002148 esters Chemical class 0.000 abstract description 6
- 239000002253 acid Substances 0.000 abstract description 5
- 150000001408 amides Chemical class 0.000 abstract description 5
- 150000007513 acids Chemical class 0.000 abstract description 4
- 230000015572 biosynthetic process Effects 0.000 abstract description 4
- 239000000543 intermediate Substances 0.000 abstract description 4
- 150000002596 lactones Chemical class 0.000 abstract description 3
- 239000003199 leukotriene receptor blocking agent Substances 0.000 abstract description 3
- 238000003786 synthesis reaction Methods 0.000 abstract description 3
- 239000012434 nucleophilic reagent Substances 0.000 abstract 1
- 238000007142 ring opening reaction Methods 0.000 abstract 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 21
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 18
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 12
- 239000000203 mixture Substances 0.000 description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- 238000005160 1H NMR spectroscopy Methods 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 239000011541 reaction mixture Substances 0.000 description 7
- FAYOCELKCDKZCA-UHFFFAOYSA-N 5-hydroxy-2,4-dimethylthiophen-3-one Chemical compound CC1SC(O)=C(C)C1=O FAYOCELKCDKZCA-UHFFFAOYSA-N 0.000 description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 5
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 4
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 4
- 239000012071 phase Substances 0.000 description 4
- 150000003141 primary amines Chemical class 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- WRMNZCZEMHIOCP-UHFFFAOYSA-N 2-phenylethanol Chemical compound OCCC1=CC=CC=C1 WRMNZCZEMHIOCP-UHFFFAOYSA-N 0.000 description 2
- VAJVDSVGBWFCLW-UHFFFAOYSA-N 3-Phenyl-1-propanol Chemical compound OCCCC1=CC=CC=C1 VAJVDSVGBWFCLW-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 2
- BZLVMXJERCGZMT-UHFFFAOYSA-N Methyl tert-butyl ether Chemical compound COC(C)(C)C BZLVMXJERCGZMT-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical compound CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 150000001447 alkali salts Chemical class 0.000 description 2
- 150000004703 alkoxides Chemical class 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- ZSIAUFGUXNUGDI-UHFFFAOYSA-N hexan-1-ol Chemical compound CCCCCCO ZSIAUFGUXNUGDI-UHFFFAOYSA-N 0.000 description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 2
- 239000011261 inert gas Substances 0.000 description 2
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 150000003335 secondary amines Chemical class 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 239000002699 waste material Substances 0.000 description 2
- 125000004343 1-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000001644 13C nuclear magnetic resonance spectroscopy Methods 0.000 description 1
- VGVRPFIJEJYOFN-UHFFFAOYSA-N 2,3,4,6-tetrachlorophenol Chemical class OC1=C(Cl)C=C(Cl)C(Cl)=C1Cl VGVRPFIJEJYOFN-UHFFFAOYSA-N 0.000 description 1
- VFAXPOVKNPTBTM-UHFFFAOYSA-N 2-[1-(sulfanylmethyl)cyclopropyl]acetic acid Chemical compound OC(=O)CC1(CS)CC1 VFAXPOVKNPTBTM-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000006201 3-phenylpropyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- YBAMDXAVJKMQMC-UHFFFAOYSA-N 4,4-dimethylthiolan-2-one Chemical compound CC1(C)CSC(=O)C1 YBAMDXAVJKMQMC-UHFFFAOYSA-N 0.000 description 1
- VDDTXNQOEDQFSZ-UHFFFAOYSA-N 5-oxaspiro[2.4]heptan-6-one Chemical compound C1OC(=O)CC11CC1 VDDTXNQOEDQFSZ-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- BIQPWLWZKATJEG-UHFFFAOYSA-N C(C)(=O)NC1(CC1)CS Chemical compound C(C)(=O)NC1(CC1)CS BIQPWLWZKATJEG-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- BWGNESOTFCXPMA-UHFFFAOYSA-N Dihydrogen disulfide Chemical compound SS BWGNESOTFCXPMA-UHFFFAOYSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical class CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- BHHGXPLMPWCGHP-UHFFFAOYSA-N Phenethylamine Chemical compound NCCC1=CC=CC=C1 BHHGXPLMPWCGHP-UHFFFAOYSA-N 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000002723 alicyclic group Chemical group 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 150000001448 anilines Chemical group 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000003975 aryl alkyl amines Chemical class 0.000 description 1
- HYGWNUKOUCZBND-UHFFFAOYSA-N azanide Chemical compound [NH2-] HYGWNUKOUCZBND-UHFFFAOYSA-N 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- UIJGNTRUPZPVNG-UHFFFAOYSA-N benzenecarbothioic s-acid Chemical class SC(=O)C1=CC=CC=C1 UIJGNTRUPZPVNG-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- RHDGNLCLDBVESU-UHFFFAOYSA-N but-3-en-4-olide Chemical compound O=C1CC=CO1 RHDGNLCLDBVESU-UHFFFAOYSA-N 0.000 description 1
- BTANRVKWQNVYAZ-UHFFFAOYSA-N butan-2-ol Chemical compound CCC(C)O BTANRVKWQNVYAZ-UHFFFAOYSA-N 0.000 description 1
- 235000013877 carbamide Nutrition 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- HDFRDWFLWVCOGP-UHFFFAOYSA-N carbonothioic O,S-acid Chemical class OC(S)=O HDFRDWFLWVCOGP-UHFFFAOYSA-N 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 238000012512 characterization method Methods 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 150000001896 cresols Chemical class 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- HPXRVTGHNJAIIH-UHFFFAOYSA-N cyclohexanol Chemical compound OC1CCCCC1 HPXRVTGHNJAIIH-UHFFFAOYSA-N 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- XCIXKGXIYUWCLL-UHFFFAOYSA-N cyclopentanol Chemical compound OC1CCCC1 XCIXKGXIYUWCLL-UHFFFAOYSA-N 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000005265 dialkylamine group Chemical group 0.000 description 1
- 125000005266 diarylamine group Chemical group 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- PQVSTLUFSYVLTO-UHFFFAOYSA-N ethyl n-ethoxycarbonylcarbamate Chemical compound CCOC(=O)NC(=O)OCC PQVSTLUFSYVLTO-UHFFFAOYSA-N 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000002366 halogen compounds Chemical class 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 1
- 229910052945 inorganic sulfide Inorganic materials 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- PHTQWCKDNZKARW-UHFFFAOYSA-N isoamylol Chemical compound CC(C)CCO PHTQWCKDNZKARW-UHFFFAOYSA-N 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- GLXDVVHUTZTUQK-UHFFFAOYSA-M lithium hydroxide monohydrate Substances [Li+].O.[OH-] GLXDVVHUTZTUQK-UHFFFAOYSA-M 0.000 description 1
- 229940040692 lithium hydroxide monohydrate Drugs 0.000 description 1
- UZQJSYQJWNBQJO-UHFFFAOYSA-M lithium;2-[1-(sulfanylmethyl)cyclopropyl]acetate Chemical compound [Li+].[O-]C(=O)CC1(CS)CC1 UZQJSYQJWNBQJO-UHFFFAOYSA-M 0.000 description 1
- JRHLVNAWLWIHDN-UHFFFAOYSA-N methyl 2-[1-(sulfanylmethyl)cyclopropyl]acetate Chemical compound COC(=O)CC1(CS)CC1 JRHLVNAWLWIHDN-UHFFFAOYSA-N 0.000 description 1
- QKBMSVCWJLYGLE-UHFFFAOYSA-N methyl 3,3-dimethyl-4-sulfanylbutanoate Chemical compound COC(=O)CC(C)(C)CS QKBMSVCWJLYGLE-UHFFFAOYSA-N 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 1
- 150000004780 naphthols Chemical class 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 239000012454 non-polar solvent Substances 0.000 description 1
- 238000010534 nucleophilic substitution reaction Methods 0.000 description 1
- 150000002898 organic sulfur compounds Chemical class 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- WVDDGKGOMKODPV-ZQBYOMGUSA-N phenyl(114C)methanol Chemical compound O[14CH2]C1=CC=CC=C1 WVDDGKGOMKODPV-ZQBYOMGUSA-N 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 150000003388 sodium compounds Chemical class 0.000 description 1
- HRZFUMHJMZEROT-UHFFFAOYSA-L sodium disulfite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])(=O)=O HRZFUMHJMZEROT-UHFFFAOYSA-L 0.000 description 1
- 229940001584 sodium metabisulfite Drugs 0.000 description 1
- 235000010262 sodium metabisulphite Nutrition 0.000 description 1
- LFURPMCPSFAXJY-UHFFFAOYSA-N sodium;3-trimethylsilylpropanoic acid Chemical compound [Na].C[Si](C)(C)CCC(O)=O LFURPMCPSFAXJY-UHFFFAOYSA-N 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 150000003459 sulfonic acid esters Chemical class 0.000 description 1
- 125000004149 thio group Chemical group *S* 0.000 description 1
- 150000003566 thiocarboxylic acids Chemical class 0.000 description 1
- 125000003396 thiol group Chemical group [H]S* 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 125000005490 tosylate group Chemical group 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- 150000003739 xylenols Chemical class 0.000 description 1
- 125000005023 xylyl group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/50—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom condensed with carbocyclic rings or ring systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C319/00—Preparation of thiols, sulfides, hydropolysulfides or polysulfides
- C07C319/02—Preparation of thiols, sulfides, hydropolysulfides or polysulfides of thiols
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/26—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D333/30—Hetero atoms other than halogen
- C07D333/32—Oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/02—Systems containing only non-condensed rings with a three-membered ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Heterocyclic Compounds Containing Sulfur Atoms (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH262693 | 1993-09-03 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SK103494A3 true SK103494A3 (en) | 1995-03-08 |
Family
ID=4237994
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SK1034-94A SK103494A3 (en) | 1993-09-03 | 1994-08-26 | Method of preparation of gama-mercaptocarboxylic acid derivatives |
Country Status (21)
| Country | Link |
|---|---|
| US (1) | US5534651A (cs) |
| EP (1) | EP0641775B1 (cs) |
| JP (1) | JP3843464B2 (cs) |
| KR (1) | KR100318102B1 (cs) |
| CN (1) | CN1059677C (cs) |
| AT (1) | ATE165086T1 (cs) |
| AU (1) | AU685477B2 (cs) |
| BR (1) | BR9403427A (cs) |
| CA (1) | CA2130723C (cs) |
| CZ (1) | CZ288652B6 (cs) |
| DE (1) | DE59405698D1 (cs) |
| DK (1) | DK0641775T3 (cs) |
| ES (1) | ES2117178T3 (cs) |
| HU (2) | HU216808B (cs) |
| IL (1) | IL110841A (cs) |
| PL (1) | PL176613B1 (cs) |
| RU (1) | RU94031752A (cs) |
| SI (1) | SI0641775T1 (cs) |
| SK (1) | SK103494A3 (cs) |
| TR (1) | TR27849A (cs) |
| ZA (1) | ZA946755B (cs) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA2371048C (en) | 2002-02-06 | 2011-01-04 | Delmar Chemicals Inc. | Process for the preparation of 1-(mercaptomethyl)-cyclopropaneacetic acid |
| EP1474386B1 (en) * | 2002-02-06 | 2006-12-27 | Delmar Chemicals Inc. | Process for the preparation of 1-(mercaptomethyl)-cyclopropaneacetic acid |
| US7271268B1 (en) | 2006-12-22 | 2007-09-18 | Formosa Laboratories Inc. | Process for preparation of [1-(mercaptomethyl)cyclopropyl]acetic acid and related derivatives |
| KR101095706B1 (ko) * | 2009-06-16 | 2011-12-20 | 화일약품주식회사 | 몬테루카스트산 또는 그 나트륨염의 신규한 제조 방법 |
| ES2602118T3 (es) * | 2010-12-09 | 2017-02-17 | Immunogen, Inc. | Métodos para la preparación de agentes de reticulación cargados |
| KR101431678B1 (ko) | 2012-01-10 | 2014-08-22 | (주)위즈켐 | 1-(1'-(카복시메틸)시클로프로판메틸디설파닐메틸)시클로프로판아세트산과 그 유도체의 제조방법 |
| CN103467276B (zh) * | 2013-09-13 | 2015-05-06 | 天津速研医药科技有限公司 | 一种孟鲁司特钠侧链关键中间体的合成方法 |
| CN105461671B (zh) * | 2015-11-17 | 2017-11-07 | 苏州大学 | 酮酸与炔制备α,β‑不饱和丁内酯的方法 |
| KR102384780B1 (ko) * | 2020-02-27 | 2022-04-11 | (주) 파마젠 | 호모시스테인 티오락톤 또는 셀레노락톤의 제조방법 |
| CN114181121B (zh) * | 2021-12-08 | 2024-04-26 | 江苏阿尔法药业股份有限公司 | 一种1-巯甲基环丙基乙酸的制备方法 |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1199276B (de) * | 1962-09-20 | 1965-08-26 | Degussa | Verfahren zur Herstellung von D, L-Homo-cysteinderivaten |
| US4219562A (en) * | 1979-03-08 | 1980-08-26 | Shell Oil Company | 3-(Hydrocarbylthiomethyl)-2,2-dimethylcyclopropanecarboxylate pesticides |
| DK304185A (da) * | 1984-07-27 | 1986-01-28 | Hoffmann La Roche | Fremgangsmaade til fremstilling af furanon |
| US5028725A (en) * | 1985-12-16 | 1991-07-02 | Polaroid Corporation | Thiolactone metal complexes |
| US4707491A (en) * | 1985-12-20 | 1987-11-17 | Washington University | Anticonvulsant γ-thiobutyrolactone derivatives |
| DE3801479A1 (de) * | 1987-01-31 | 1988-08-11 | Sandoz Ag | Pilocarpinderivate |
| ATE165088T1 (de) * | 1990-10-12 | 1998-05-15 | Merck Frosst Canada Inc | Ungesättigte hydroxyalkylchinolinsäuren als leukotrien-antagonisten |
| US5270324A (en) * | 1992-04-10 | 1993-12-14 | Merck Frosst Canada, Inc. | Fluorinated hydroxyalkylquinoline acids as leukotriene antagonists |
-
1994
- 1994-08-23 CA CA002130723A patent/CA2130723C/en not_active Expired - Lifetime
- 1994-08-26 SK SK1034-94A patent/SK103494A3/sk unknown
- 1994-08-30 US US08/297,756 patent/US5534651A/en not_active Expired - Lifetime
- 1994-08-31 CN CN94109296A patent/CN1059677C/zh not_active Expired - Fee Related
- 1994-09-01 IL IL11084194A patent/IL110841A/xx not_active IP Right Cessation
- 1994-09-01 RU RU94031752/04A patent/RU94031752A/ru unknown
- 1994-09-02 BR BR9403427A patent/BR9403427A/pt not_active Application Discontinuation
- 1994-09-02 TR TR00862/94A patent/TR27849A/xx unknown
- 1994-09-02 SI SI9430129T patent/SI0641775T1/xx not_active IP Right Cessation
- 1994-09-02 AT AT94113811T patent/ATE165086T1/de active
- 1994-09-02 JP JP21019594A patent/JP3843464B2/ja not_active Expired - Fee Related
- 1994-09-02 ZA ZA946755A patent/ZA946755B/xx unknown
- 1994-09-02 HU HU9701400A patent/HU216808B/hu not_active IP Right Cessation
- 1994-09-02 EP EP94113811A patent/EP0641775B1/de not_active Expired - Lifetime
- 1994-09-02 HU HU9402537A patent/HU214204B/hu not_active IP Right Cessation
- 1994-09-02 AU AU71646/94A patent/AU685477B2/en not_active Ceased
- 1994-09-02 CZ CZ19942115A patent/CZ288652B6/cs not_active IP Right Cessation
- 1994-09-02 ES ES94113811T patent/ES2117178T3/es not_active Expired - Lifetime
- 1994-09-02 KR KR1019940022139A patent/KR100318102B1/ko not_active Expired - Fee Related
- 1994-09-02 DE DE59405698T patent/DE59405698D1/de not_active Expired - Lifetime
- 1994-09-02 DK DK94113811.7T patent/DK0641775T3/da active
- 1994-09-03 PL PL94304884A patent/PL176613B1/pl not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| CA2130723A1 (en) | 1995-03-04 |
| HU214204B (hu) | 1998-01-28 |
| PL176613B1 (pl) | 1999-06-30 |
| PL304884A1 (en) | 1995-03-06 |
| ES2117178T3 (es) | 1998-08-01 |
| EP0641775A1 (de) | 1995-03-08 |
| CN1108256A (zh) | 1995-09-13 |
| HU216808B (hu) | 1999-08-30 |
| KR950008480A (ko) | 1995-04-17 |
| HUT68782A (en) | 1995-07-28 |
| SI0641775T1 (en) | 1998-08-31 |
| AU7164694A (en) | 1995-03-16 |
| AU685477B2 (en) | 1998-01-22 |
| ZA946755B (en) | 1995-04-21 |
| CN1059677C (zh) | 2000-12-20 |
| HU9402537D0 (en) | 1994-11-28 |
| DK0641775T3 (da) | 1998-05-25 |
| US5534651A (en) | 1996-07-09 |
| TR27849A (tr) | 1995-09-01 |
| EP0641775B1 (de) | 1998-04-15 |
| CZ211594A3 (en) | 1995-03-15 |
| IL110841A (en) | 2000-07-26 |
| HU9701400D0 (en) | 1997-10-28 |
| ATE165086T1 (de) | 1998-05-15 |
| RU94031752A (ru) | 1996-07-20 |
| KR100318102B1 (ko) | 2002-11-27 |
| CA2130723C (en) | 2006-01-31 |
| DE59405698D1 (de) | 1998-05-20 |
| JPH0782241A (ja) | 1995-03-28 |
| CZ288652B6 (cs) | 2001-08-15 |
| JP3843464B2 (ja) | 2006-11-08 |
| IL110841A0 (en) | 1994-11-28 |
| BR9403427A (pt) | 1995-05-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IE59324B1 (en) | Preparation of substituted and disubstituted pyridine-2,3-dicarboxylate esters | |
| SK103494A3 (en) | Method of preparation of gama-mercaptocarboxylic acid derivatives | |
| IE50061B1 (en) | 1-(1-cyclohexenylmethyl)pyrrolidine derivatives and process for their preparation | |
| KR840002007B1 (ko) | 푸란유도체의 제조방법 | |
| SU950188A3 (ru) | Способ получени производных 4(5)-меркаптометилимидазолов | |
| KR850001934B1 (ko) | 푸란 유도체의 제조방법 | |
| Okajima et al. | Synthesis and reaction of 2‐imino‐1, 3‐thiazetidines and 2‐imino‐1, 3‐dithietanes | |
| US5177247A (en) | Process for the preparation of hydroxyphenylpropionates | |
| Shimadzu et al. | Studies on furan derivatives. XIV. Nucleophilic substitution of methyl 5‐nitro‐2‐furancarboxylate and 5‐Nitrofuran‐2‐nitrile | |
| US4468518A (en) | Imidazole guanidine compounds and method of making same | |
| US6114527A (en) | Process for preparing substituted pyrimidine derivatives | |
| JP3031279B2 (ja) | ２−アルコキシ−６−（トリフルオロメチル）ピリミジン−４−オルの製造方法 | |
| US5777154A (en) | Method for preparing 3-amino substituted crotonates | |
| WO1992015562A2 (en) | Preparation of omega-substituted alkanamide | |
| US5210218A (en) | 2- and 3-chloropyrroles and process for preparing the same | |
| SU1512481A3 (ru) | Способ получени тиотетроновой кислоты | |
| US5254713A (en) | 2- and 3-chloropyrroles and process for preparing the same | |
| US5208337A (en) | Process for the preparation of aminopyrimidines | |
| NO315157B1 (no) | 1-cyano-1-acylaminosyklo-pentanforbindelser og fremgangsmåte for fremstilling derav | |
| CA2584349A1 (en) | Process for the preparation of 2-methylspiro(1,3-oxathiolane-5,3') quiniclidine | |
| HU180058B (en) | Process for producing n-cyano-azomethine derivatives | |
| US5414108A (en) | Process for the preparation of carboxylic acids and derivatives of them | |
| IL93228A (en) | Process for the preparation of cyclopropenecarbaldheims and intermediate compounds | |
| US20030022908A1 (en) | 2-alkoxy-5-methoxypyrimidines or their tautomeric forms and methods for producing the same | |
| US4775756A (en) | 5-(4-amino-3,5-dimethoxyphenyl)-5-hydroxy-barbituric acid |