SE464193B - Foerfarande foer framstaellning av klordioxid - Google Patents
Foerfarande foer framstaellning av klordioxidInfo
- Publication number
- SE464193B SE464193B SE8803761A SE8803761A SE464193B SE 464193 B SE464193 B SE 464193B SE 8803761 A SE8803761 A SE 8803761A SE 8803761 A SE8803761 A SE 8803761A SE 464193 B SE464193 B SE 464193B
- Authority
- SE
- Sweden
- Prior art keywords
- palladium
- catalyst
- reaction
- chlorine dioxide
- antimony
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 title description 9
- OSVXSBDYLRYLIG-UHFFFAOYSA-N dioxidochlorine(.) Chemical compound O=Cl=O OSVXSBDYLRYLIG-UHFFFAOYSA-N 0.000 claims description 38
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 36
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical group [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 22
- 239000003054 catalyst Substances 0.000 claims description 20
- 239000004155 Chlorine dioxide Substances 0.000 claims description 19
- 235000019398 chlorine dioxide Nutrition 0.000 claims description 19
- 238000006243 chemical reaction Methods 0.000 claims description 18
- 239000002253 acid Substances 0.000 claims description 12
- 239000011572 manganese Substances 0.000 claims description 11
- 229910052763 palladium Inorganic materials 0.000 claims description 9
- -1 alkali metal chlorate Chemical class 0.000 claims description 8
- 239000003638 chemical reducing agent Substances 0.000 claims description 8
- XTEGARKTQYYJKE-UHFFFAOYSA-M chlorate Inorganic materials [O-]Cl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-M 0.000 claims description 8
- 229910052748 manganese Inorganic materials 0.000 claims description 8
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 claims description 7
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 claims description 6
- 229910052783 alkali metal Inorganic materials 0.000 claims description 6
- 229910052787 antimony Inorganic materials 0.000 claims description 6
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 claims description 6
- 229910052750 molybdenum Inorganic materials 0.000 claims description 6
- 239000011733 molybdenum Substances 0.000 claims description 6
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 4
- 239000011707 mineral Substances 0.000 claims description 4
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 claims description 4
- 229910052720 vanadium Inorganic materials 0.000 claims description 4
- LEONUFNNVUYDNQ-UHFFFAOYSA-N vanadium atom Chemical compound [V] LEONUFNNVUYDNQ-UHFFFAOYSA-N 0.000 claims description 4
- 239000012429 reaction media Substances 0.000 claims description 3
- 150000003839 salts Chemical class 0.000 claims description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 3
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 claims description 2
- 229910052741 iridium Inorganic materials 0.000 claims description 2
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052751 metal Inorganic materials 0.000 claims description 2
- 239000002184 metal Substances 0.000 claims description 2
- 150000002739 metals Chemical class 0.000 claims description 2
- 229910052762 osmium Inorganic materials 0.000 claims description 2
- SYQBFIAQOQZEGI-UHFFFAOYSA-N osmium atom Chemical compound [Os] SYQBFIAQOQZEGI-UHFFFAOYSA-N 0.000 claims description 2
- 229910052697 platinum Inorganic materials 0.000 claims description 2
- 229910052702 rhenium Inorganic materials 0.000 claims description 2
- WUAPFZMCVAUBPE-UHFFFAOYSA-N rhenium atom Chemical compound [Re] WUAPFZMCVAUBPE-UHFFFAOYSA-N 0.000 claims description 2
- 229910052703 rhodium Inorganic materials 0.000 claims description 2
- 239000010948 rhodium Substances 0.000 claims description 2
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 claims description 2
- 229910052707 ruthenium Inorganic materials 0.000 claims description 2
- 229910052713 technetium Inorganic materials 0.000 claims description 2
- GKLVYJBZJHMRIY-UHFFFAOYSA-N technetium atom Chemical compound [Tc] GKLVYJBZJHMRIY-UHFFFAOYSA-N 0.000 claims description 2
- 150000001413 amino acids Chemical class 0.000 claims 1
- 238000002425 crystallisation Methods 0.000 claims 1
- 230000008025 crystallization Effects 0.000 claims 1
- 230000008020 evaporation Effects 0.000 claims 1
- 238000001704 evaporation Methods 0.000 claims 1
- 239000000203 mixture Substances 0.000 claims 1
- MUJIDPITZJWBSW-UHFFFAOYSA-N palladium(2+) Chemical compound [Pd+2] MUJIDPITZJWBSW-UHFFFAOYSA-N 0.000 claims 1
- 230000001376 precipitating effect Effects 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 description 16
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 8
- 239000000460 chlorine Substances 0.000 description 5
- 229910052709 silver Inorganic materials 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 238000007792 addition Methods 0.000 description 4
- 238000002474 experimental method Methods 0.000 description 4
- 239000004332 silver Substances 0.000 description 4
- 239000011780 sodium chloride Substances 0.000 description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- 101150003085 Pdcl gene Proteins 0.000 description 3
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- 238000005260 corrosion Methods 0.000 description 2
- 230000007797 corrosion Effects 0.000 description 2
- GNTDGMZSJNCJKK-UHFFFAOYSA-N divanadium pentaoxide Chemical compound O=[V](=O)O[V](=O)=O GNTDGMZSJNCJKK-UHFFFAOYSA-N 0.000 description 2
- 229910001437 manganese ion Inorganic materials 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- HGUFODBRKLSHSI-UHFFFAOYSA-N 2,3,7,8-tetrachloro-dibenzo-p-dioxin Chemical compound O1C2=CC(Cl)=C(Cl)C=C2OC2=C1C=C(Cl)C(Cl)=C2 HGUFODBRKLSHSI-UHFFFAOYSA-N 0.000 description 1
- BZSXEZOLBIJVQK-UHFFFAOYSA-N 2-methylsulfonylbenzoic acid Chemical compound CS(=O)(=O)C1=CC=CC=C1C(O)=O BZSXEZOLBIJVQK-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 238000009621 Solvay process Methods 0.000 description 1
- 229910001514 alkali metal chloride Inorganic materials 0.000 description 1
- 229910052936 alkali metal sulfate Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052785 arsenic Inorganic materials 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000004061 bleaching Methods 0.000 description 1
- 239000007844 bleaching agent Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B11/00—Oxides or oxyacids of halogens; Salts thereof
- C01B11/02—Oxides of chlorine
- C01B11/022—Chlorine dioxide (ClO2)
- C01B11/023—Preparation from chlorites or chlorates
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01J—CHEMICAL OR PHYSICAL PROCESSES, e.g. CATALYSIS OR COLLOID CHEMISTRY; THEIR RELEVANT APPARATUS
- B01J23/00—Catalysts comprising metals or metal oxides or hydroxides, not provided for in group B01J21/00
- B01J23/38—Catalysts comprising metals or metal oxides or hydroxides, not provided for in group B01J21/00 of noble metals
- B01J23/54—Catalysts comprising metals or metal oxides or hydroxides, not provided for in group B01J21/00 of noble metals combined with metals, oxides or hydroxides provided for in groups B01J23/02 - B01J23/36
- B01J23/56—Platinum group metals
- B01J23/64—Platinum group metals with arsenic, antimony, bismuth, vanadium, niobium, tantalum, polonium, chromium, molybdenum, tungsten, manganese, technetium or rhenium
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Geology (AREA)
- Inorganic Chemistry (AREA)
- General Life Sciences & Earth Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Materials Engineering (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Catalysts (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Inorganic Compounds Of Heavy Metals (AREA)
Priority Applications (12)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SE8803761A SE464193B (sv) | 1988-10-20 | 1988-10-20 | Foerfarande foer framstaellning av klordioxid |
| US07/372,469 US5002746A (en) | 1988-10-20 | 1989-06-28 | Process for production of chlorine dioxide |
| CA000612660A CA1333518C (en) | 1988-10-20 | 1989-09-22 | Process for production of chlorine dioxide |
| EP89850343A EP0365501A1 (en) | 1988-10-20 | 1989-10-10 | Process for production of chlorine dioxide |
| FI894901A FI94950C (fi) | 1988-10-20 | 1989-10-16 | Menetelmä klooridioksidin valmistamiseksi |
| AU42915/89A AU606537B2 (en) | 1988-10-20 | 1989-10-16 | Process for production of chlorine dioxide |
| NZ231045A NZ231045A (en) | 1988-10-20 | 1989-10-17 | Production of chlorine dioxide by reduction of an alkali metal chlorate |
| BR898905262A BR8905262A (pt) | 1988-10-20 | 1989-10-17 | Processo para a producao de dioxido de cloro |
| JP1269260A JPH02157103A (ja) | 1988-10-20 | 1989-10-18 | 二酸化塩素の製造方法 |
| PT92033A PT92033B (pt) | 1988-10-20 | 1989-10-19 | Processo para a preparacao de dioxido de cloro |
| NO89894173A NO894173L (no) | 1988-10-20 | 1989-10-19 | Fremgangsmaate ved fremstilling av kloridoksid. |
| AR89315227A AR245675A1 (es) | 1988-10-20 | 1989-10-20 | Procedimiento para la produccion de dioxido de cloro haciendo reaccionar un clorato de metal alcalino un acido mineral y metanol como agente reductor. |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SE8803761A SE464193B (sv) | 1988-10-20 | 1988-10-20 | Foerfarande foer framstaellning av klordioxid |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| SE8803761D0 SE8803761D0 (sv) | 1988-10-20 |
| SE8803761L SE8803761L (sv) | 1990-04-21 |
| SE464193B true SE464193B (sv) | 1991-03-18 |
Family
ID=20373696
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE8803761A SE464193B (sv) | 1988-10-20 | 1988-10-20 | Foerfarande foer framstaellning av klordioxid |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US5002746A (cs) |
| EP (1) | EP0365501A1 (cs) |
| JP (1) | JPH02157103A (cs) |
| AR (1) | AR245675A1 (cs) |
| AU (1) | AU606537B2 (cs) |
| BR (1) | BR8905262A (cs) |
| CA (1) | CA1333518C (cs) |
| FI (1) | FI94950C (cs) |
| NO (1) | NO894173L (cs) |
| NZ (1) | NZ231045A (cs) |
| PT (1) | PT92033B (cs) |
| SE (1) | SE464193B (cs) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5242554A (en) * | 1990-02-06 | 1993-09-07 | Olin Corporation | Electrolytic production of chloric acid and sodium chlorate mixtures for the generation of chlorine dioxide |
| US5322598A (en) * | 1990-02-06 | 1994-06-21 | Olin Corporation | Chlorine dioxide generation using inert load of sodium perchlorate |
| US5348683A (en) * | 1990-02-06 | 1994-09-20 | Olin Corporation | Chloric acid - alkali metal chlorate mixtures and chlorine dioxide generation |
| US5770171A (en) * | 1990-03-05 | 1998-06-23 | Eka Nobel Inc. | Process for production of chlorine dioxide |
| CA2019389A1 (en) * | 1990-06-20 | 1991-12-20 | Maurice C.J. Fredette | Methanol-based chlorine dioxide process |
| US5435984A (en) * | 1992-04-28 | 1995-07-25 | Degussa Corporation | Catalyst for the synthesis of chlorine dioxide |
| US5599518A (en) * | 1994-12-01 | 1997-02-04 | Olin Corporation | Catalytic process for chlorine dioxide generation from chloric acid |
| US6322768B1 (en) | 1998-09-29 | 2001-11-27 | International Paper Company | Recovery of chlorine dioxide from gas streams |
| US6306281B1 (en) | 1999-11-30 | 2001-10-23 | Joseph Matthew Kelley | Electrolytic process for the generation of stable solutions of chlorine dioxide |
| US7087208B2 (en) * | 2001-08-02 | 2006-08-08 | Sampson Allison H | Methods for making chlorous acid and chlorine dioxide |
| US8513176B2 (en) | 2006-08-02 | 2013-08-20 | Ch2O Incorporated | Disinfecting and mineral deposit eliminating composition and methods |
| US8748188B2 (en) | 2010-12-23 | 2014-06-10 | Allison H. Sampson | Method of preparing, storing, transporting and testing chlorine dioxide solutions |
| CN105417497B (zh) * | 2015-12-15 | 2017-12-08 | 刘学思 | 一种高浓度二氧化氯稳态液的生产装置及工艺 |
| CN106395749B (zh) * | 2016-09-14 | 2018-06-22 | 华东师范大学 | 一种固态多相催化制备高纯度二氧化氯的方法 |
| US11168005B2 (en) | 2019-02-19 | 2021-11-09 | Dripping Wet Water, Inc | Conductivity control of aqueous chemical dosing in water treatment systems |
| US11142455B2 (en) | 2019-06-05 | 2021-10-12 | Dripping Wet Water, Inc. | Pressurized catalytic production of dioxide species |
Family Cites Families (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3864456A (en) * | 1964-08-13 | 1975-02-04 | Electric Reduction Co | Manufacture of chlorine dioxide, chlorine and anhydrous sodium sulphate |
| US3933988A (en) * | 1966-10-24 | 1976-01-20 | Hooker Chemicals & Plastics Corporation | Method of simultaneously producing chlorine dioxide and a sulfate salt |
| US3563702A (en) * | 1968-03-05 | 1971-02-16 | Hooker Chemical Corp | Production of chlorine dioxide |
| SE328854B (cs) * | 1969-07-15 | 1970-09-28 | Nippon Soda Co | |
| US4154809A (en) * | 1976-03-19 | 1979-05-15 | Erco Industries Limited | High efficiency chlorine dioxide production using HCl as acid and methanol addition |
| CA1080434A (en) * | 1976-03-19 | 1980-07-01 | Richard Swindells | High efficiency chlorine dioxide production using hc1 as acid |
| US4145401A (en) * | 1976-03-19 | 1979-03-20 | Erco Industries Limited | High efficiency chlorine dioxide production at low acidity with methanol addition |
| JPS538398A (en) * | 1976-07-12 | 1978-01-25 | Japan Carlit Co Ltd | Manufacturing method of chlorine dioxide |
| JPS5444278A (en) * | 1977-09-16 | 1979-04-07 | Tateishi Roka Kougiyou Kk | Method of producing filter cylinder for cartridge filter |
| JPS5474296A (en) * | 1977-11-26 | 1979-06-14 | Japan Carlit Co Ltd | Manufacture of chlorine dioxide |
| US4178356A (en) * | 1977-12-02 | 1979-12-11 | The Japan Carlit Co., Ltd. | Process for manufacturing chlorine dioxide |
| US4169134A (en) * | 1977-12-02 | 1979-09-25 | The Japan Carlit Co., Ltd. | Manufacturing chlorine dioxide with thallium and silver or palladium catalysts |
| NZ190344A (en) * | 1978-05-18 | 1981-02-11 | Hooker Chemicals Plastics Corp | Continuous production of a mixture of chlorine dioxide, chlorine and a neutral alkali metal salt |
| JPS5545483A (en) * | 1978-09-29 | 1980-03-31 | Matsushita Electric Works Ltd | Outer edge device of reciprocating electric razor |
| SE8005942L (sv) * | 1979-08-28 | 1981-03-01 | Erco Ind Ltd | Katalytisk framstellning av klordioxid |
| US4381290A (en) * | 1981-04-23 | 1983-04-26 | Diamond Shamrock Corporation | Method and catalyst for making chlorine dioxide |
| AU8282782A (en) * | 1981-04-23 | 1982-10-28 | Diamond Shamrock Chemicals Company | Catalyst for making chlorine dioxide |
| EP0131378B2 (en) * | 1983-06-10 | 1996-10-09 | Sterling Canada, Inc. | Process for the production of chlorine dioxide |
| US4465658A (en) * | 1983-06-13 | 1984-08-14 | Erco Industries Limited | Chlorine dioxide process |
| US4473540A (en) * | 1983-07-07 | 1984-09-25 | Erco Industries Limited | High efficiency chlorine dioxide process |
| SE452756B (sv) * | 1985-03-04 | 1987-12-14 | Eka Nobel Ab | Forfarande for framstellning av klordioxid |
| SE460046B (sv) * | 1987-03-27 | 1989-09-04 | Eka Nobel Ab | Foerfarande foer framstaellning av klordioxid |
-
1988
- 1988-10-20 SE SE8803761A patent/SE464193B/sv not_active Application Discontinuation
-
1989
- 1989-06-28 US US07/372,469 patent/US5002746A/en not_active Expired - Fee Related
- 1989-09-22 CA CA000612660A patent/CA1333518C/en not_active Expired - Fee Related
- 1989-10-10 EP EP89850343A patent/EP0365501A1/en not_active Withdrawn
- 1989-10-16 FI FI894901A patent/FI94950C/fi not_active IP Right Cessation
- 1989-10-16 AU AU42915/89A patent/AU606537B2/en not_active Ceased
- 1989-10-17 NZ NZ231045A patent/NZ231045A/xx unknown
- 1989-10-17 BR BR898905262A patent/BR8905262A/pt not_active Application Discontinuation
- 1989-10-18 JP JP1269260A patent/JPH02157103A/ja active Pending
- 1989-10-19 PT PT92033A patent/PT92033B/pt not_active IP Right Cessation
- 1989-10-19 NO NO89894173A patent/NO894173L/no unknown
- 1989-10-20 AR AR89315227A patent/AR245675A1/es active
Also Published As
| Publication number | Publication date |
|---|---|
| NZ231045A (en) | 1991-04-26 |
| EP0365501A1 (en) | 1990-04-25 |
| FI894901A0 (fi) | 1989-10-16 |
| SE8803761L (sv) | 1990-04-21 |
| NO894173D0 (no) | 1989-10-19 |
| JPH02157103A (ja) | 1990-06-15 |
| PT92033A (pt) | 1990-04-30 |
| SE8803761D0 (sv) | 1988-10-20 |
| PT92033B (pt) | 1995-05-31 |
| US5002746A (en) | 1991-03-26 |
| NO894173L (no) | 1990-04-23 |
| FI94950C (fi) | 1995-11-27 |
| US5002746B1 (cs) | 1993-02-16 |
| AR245675A1 (es) | 1994-02-28 |
| AU4291589A (en) | 1990-05-17 |
| FI94950B (fi) | 1995-08-15 |
| BR8905262A (pt) | 1990-05-22 |
| AU606537B2 (en) | 1991-02-07 |
| CA1333518C (en) | 1994-12-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SE464193B (sv) | Foerfarande foer framstaellning av klordioxid | |
| US3563702A (en) | Production of chlorine dioxide | |
| EP0473560B1 (en) | Process for the production of chlorine dioxide | |
| US5091166A (en) | Process for the production of chlorine dioxide | |
| CA1080434A (en) | High efficiency chlorine dioxide production using hc1 as acid | |
| US3810969A (en) | Process for the production of chlorine dioxide | |
| PL180391B1 (pl) | Sposób wytwarzania dwutlenku chloru PL | |
| EP0366636B1 (en) | A process for the production of chlorine dioxide | |
| SE460046B (sv) | Foerfarande foer framstaellning av klordioxid | |
| US3754081A (en) | Process for the production of chlorine dioxide,chlorine and a mixtureof an alkali metal sulfate and bisulfate | |
| SE467252B (sv) | Foerfarande foer framstaellning av klordioxid | |
| SE448864B (sv) | Sett att framstella en vattenlosning lemplig for framstellning av klordioxid och samtidig reducering av klorinnehallet i en gasformig klordioxidstrom | |
| SE465569B (sv) | Foerfarande foer framstaellning av klordioxid | |
| SE513568C2 (sv) | Förfarande för framställning av klordioxid | |
| CA1089628A (en) | Manufacture of chlorine dioxide by reduction of a specified chlorate | |
| SU1838230A3 (ru) | Cпocoб пoлучehия дbуokиcи xлopa | |
| SE438145B (sv) | Forfarande for framstellning av klordioxid, klor och alkalimetallsalt under vexelvis anvendning av saltsyra och svavelsyra | |
| CS216940B2 (en) | Method of continuous production of the chlorine oxide | |
| WO1998013296A1 (en) | Method for producing chlorine dioxide using methanol, chloride, and hydrogen peroxide as reducing agents | |
| WO1998013295A1 (en) | Method for producing chlorine dioxide using methanol and hydrogen peroxide as reducing agents | |
| WO1998013295A9 (en) | Method for producing chlorine dioxide using methanol and hydrogen peroxide as reducing agents | |
| CA2189289A1 (en) | High purity chlorine dioxide production | |
| CA2183806C (en) | Chlorine dioxide generating process | |
| WO2004037746A2 (en) | A method of producing chlorine dioxide using urea as a reducing agent | |
| SE453745B (sv) | Sett att framstella vesentligen klorfri klordioxid |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| NAV | Patent application has lapsed |
Ref document number: 8803761-9 Effective date: 19941017 Format of ref document f/p: F |