SE451739B - Papperstillverkningsforfarande och pappersprodukt varvid som avvattnings- och retentionsforbettrande kemikalie anvends katjonisk polyakrylamid och en speciell oorganisk kolloid - Google Patents
Papperstillverkningsforfarande och pappersprodukt varvid som avvattnings- och retentionsforbettrande kemikalie anvends katjonisk polyakrylamid och en speciell oorganisk kolloidInfo
- Publication number
- SE451739B SE451739B SE8501652A SE8501652A SE451739B SE 451739 B SE451739 B SE 451739B SE 8501652 A SE8501652 A SE 8501652A SE 8501652 A SE8501652 A SE 8501652A SE 451739 B SE451739 B SE 451739B
- Authority
- SE
- Sweden
- Prior art keywords
- paper
- pulp
- retention
- sol
- polyacrylamide
- Prior art date
Links
- 229920002401 polyacrylamide Polymers 0.000 title claims abstract description 41
- 239000000126 substance Substances 0.000 title claims abstract description 34
- 239000000084 colloidal system Substances 0.000 title description 7
- 238000004519 manufacturing process Methods 0.000 title description 2
- 125000002091 cationic group Chemical group 0.000 claims abstract description 31
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical class O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 claims abstract description 31
- 230000014759 maintenance of location Effects 0.000 claims abstract description 15
- 238000000034 method Methods 0.000 claims abstract description 15
- 239000002344 surface layer Substances 0.000 claims abstract description 7
- 229910000323 aluminium silicate Inorganic materials 0.000 claims abstract description 6
- 230000008569 process Effects 0.000 claims abstract description 6
- 239000010954 inorganic particle Substances 0.000 claims abstract 3
- 239000002245 particle Substances 0.000 claims description 19
- 239000012764 mineral filler Substances 0.000 claims description 7
- 239000000835 fiber Substances 0.000 claims description 6
- 229910052710 silicon Inorganic materials 0.000 claims description 6
- 239000010703 silicon Substances 0.000 claims description 6
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical group [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 claims description 5
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 claims description 5
- 229920002678 cellulose Polymers 0.000 claims 2
- 239000001913 cellulose Substances 0.000 claims 2
- 229920003043 Cellulose fiber Polymers 0.000 claims 1
- 239000003623 enhancer Substances 0.000 claims 1
- 238000000465 moulding Methods 0.000 claims 1
- 230000001105 regulatory effect Effects 0.000 claims 1
- 229920001131 Pulp (paper) Polymers 0.000 abstract description 17
- 239000005995 Aluminium silicate Substances 0.000 abstract description 2
- 235000012211 aluminium silicate Nutrition 0.000 abstract description 2
- PZZYQPZGQPZBDN-UHFFFAOYSA-N aluminium silicate Chemical compound O=[Al]O[Si](=O)O[Al]=O PZZYQPZGQPZBDN-UHFFFAOYSA-N 0.000 abstract 1
- 238000007792 addition Methods 0.000 description 15
- 230000006872 improvement Effects 0.000 description 13
- 235000012239 silicon dioxide Nutrition 0.000 description 13
- 229920002907 Guar gum Polymers 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- 229920002472 Starch Polymers 0.000 description 12
- 239000000665 guar gum Substances 0.000 description 12
- 229960002154 guar gum Drugs 0.000 description 12
- 235000010417 guar gum Nutrition 0.000 description 12
- 239000000047 product Substances 0.000 description 12
- 235000019698 starch Nutrition 0.000 description 12
- 239000008107 starch Substances 0.000 description 12
- 230000000694 effects Effects 0.000 description 11
- 238000002474 experimental method Methods 0.000 description 9
- 239000000725 suspension Substances 0.000 description 9
- 238000012360 testing method Methods 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 8
- 238000003756 stirring Methods 0.000 description 8
- 125000000129 anionic group Chemical group 0.000 description 7
- 239000000945 filler Substances 0.000 description 7
- 229920000642 polymer Polymers 0.000 description 7
- 239000011230 binding agent Substances 0.000 description 6
- 239000008367 deionised water Substances 0.000 description 6
- 229910021641 deionized water Inorganic materials 0.000 description 6
- 239000002023 wood Substances 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 5
- 239000000654 additive Substances 0.000 description 5
- 230000000996 additive effect Effects 0.000 description 5
- 229910021653 sulphate ion Inorganic materials 0.000 description 5
- YKTSYUJCYHOUJP-UHFFFAOYSA-N [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] Chemical compound [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] YKTSYUJCYHOUJP-UHFFFAOYSA-N 0.000 description 4
- -1 alkyl ketene dimer Chemical compound 0.000 description 4
- 230000002452 interceptive effect Effects 0.000 description 4
- 239000000377 silicon dioxide Substances 0.000 description 4
- 229920000945 Amylopectin Polymers 0.000 description 3
- 241000218657 Picea Species 0.000 description 3
- 229910004298 SiO 2 Inorganic materials 0.000 description 3
- 239000000853 adhesive Substances 0.000 description 3
- 230000001070 adhesive effect Effects 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- 229910052782 aluminium Inorganic materials 0.000 description 3
- 239000000440 bentonite Substances 0.000 description 3
- 229910000278 bentonite Inorganic materials 0.000 description 3
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 3
- 229920006317 cationic polymer Polymers 0.000 description 3
- 150000001768 cations Chemical class 0.000 description 3
- 229910052681 coesite Inorganic materials 0.000 description 3
- 229910052906 cristobalite Inorganic materials 0.000 description 3
- 239000010410 layer Substances 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 239000000049 pigment Substances 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 229910052682 stishovite Inorganic materials 0.000 description 3
- 229910052905 tridymite Inorganic materials 0.000 description 3
- RSWGJHLUYNHPMX-UHFFFAOYSA-N 1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carboxylic acid Chemical compound C12CCC(C(C)C)=CC2=CCC2C1(C)CCCC2(C)C(O)=O RSWGJHLUYNHPMX-UHFFFAOYSA-N 0.000 description 2
- KKCBUQHMOMHUOY-UHFFFAOYSA-N Na2O Inorganic materials [O-2].[Na+].[Na+] KKCBUQHMOMHUOY-UHFFFAOYSA-N 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- 238000013019 agitation Methods 0.000 description 2
- ANBBXQWFNXMHLD-UHFFFAOYSA-N aluminum;sodium;oxygen(2-) Chemical compound [O-2].[O-2].[Na+].[Al+3] ANBBXQWFNXMHLD-UHFFFAOYSA-N 0.000 description 2
- 229920006318 anionic polymer Polymers 0.000 description 2
- 238000010009 beating Methods 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- 238000005119 centrifugation Methods 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000004927 clay Substances 0.000 description 2
- 235000013601 eggs Nutrition 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- 238000011160 research Methods 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 238000002791 soaking Methods 0.000 description 2
- 229910001388 sodium aluminate Inorganic materials 0.000 description 2
- 230000000930 thermomechanical effect Effects 0.000 description 2
- FALRKNHUBBKYCC-UHFFFAOYSA-N 2-(chloromethyl)pyridine-3-carbonitrile Chemical compound ClCC1=NC=CC=C1C#N FALRKNHUBBKYCC-UHFFFAOYSA-N 0.000 description 1
- GHCVXTFBVDVFGE-UHFFFAOYSA-N 4-amino-6-chloro-1,3,5-triazin-2-ol Chemical compound NC1=NC(O)=NC(Cl)=N1 GHCVXTFBVDVFGE-UHFFFAOYSA-N 0.000 description 1
- 229910018072 Al 2 O 3 Inorganic materials 0.000 description 1
- CKDWPUIZGOQOOM-UHFFFAOYSA-N Carbamyl chloride Chemical compound NC(Cl)=O CKDWPUIZGOQOOM-UHFFFAOYSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 241001274216 Naso Species 0.000 description 1
- 235000008331 Pinus X rigitaeda Nutrition 0.000 description 1
- 235000011613 Pinus brutia Nutrition 0.000 description 1
- 241000018646 Pinus brutia Species 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 229920002873 Polyethylenimine Polymers 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 1
- 229940037003 alum Drugs 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 235000012216 bentonite Nutrition 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 229920006319 cationized starch Polymers 0.000 description 1
- 239000000701 coagulant Substances 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000002657 fibrous material Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001879 gelation Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- 239000003292 glue Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 239000010440 gypsum Substances 0.000 description 1
- 229910052602 gypsum Inorganic materials 0.000 description 1
- 239000011121 hardwood Substances 0.000 description 1
- 235000009973 maize Nutrition 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 235000012054 meals Nutrition 0.000 description 1
- 238000000691 measurement method Methods 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 239000010451 perlite Substances 0.000 description 1
- 235000019362 perlite Nutrition 0.000 description 1
- 229920000058 polyacrylate Polymers 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920000768 polyamine Polymers 0.000 description 1
- 235000019353 potassium silicate Nutrition 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 238000007639 printing Methods 0.000 description 1
- 239000010802 sludge Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011122 softwood Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 229940014800 succinic anhydride Drugs 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- 230000001960 triggered effect Effects 0.000 description 1
- 239000010456 wollastonite Substances 0.000 description 1
- 229910052882 wollastonite Inorganic materials 0.000 description 1
Classifications
-
- D—TEXTILES; PAPER
- D21—PAPER-MAKING; PRODUCTION OF CELLULOSE
- D21H—PULP COMPOSITIONS; PREPARATION THEREOF NOT COVERED BY SUBCLASSES D21C OR D21D; IMPREGNATING OR COATING OF PAPER; TREATMENT OF FINISHED PAPER NOT COVERED BY CLASS B31 OR SUBCLASS D21G; PAPER NOT OTHERWISE PROVIDED FOR
- D21H17/00—Non-fibrous material added to the pulp, characterised by its constitution; Paper-impregnating material characterised by its constitution
- D21H17/63—Inorganic compounds
- D21H17/67—Water-insoluble compounds, e.g. fillers, pigments
- D21H17/68—Water-insoluble compounds, e.g. fillers, pigments siliceous, e.g. clays
-
- D—TEXTILES; PAPER
- D21—PAPER-MAKING; PRODUCTION OF CELLULOSE
- D21H—PULP COMPOSITIONS; PREPARATION THEREOF NOT COVERED BY SUBCLASSES D21C OR D21D; IMPREGNATING OR COATING OF PAPER; TREATMENT OF FINISHED PAPER NOT COVERED BY CLASS B31 OR SUBCLASS D21G; PAPER NOT OTHERWISE PROVIDED FOR
- D21H17/00—Non-fibrous material added to the pulp, characterised by its constitution; Paper-impregnating material characterised by its constitution
- D21H17/20—Macromolecular organic compounds
- D21H17/33—Synthetic macromolecular compounds
- D21H17/34—Synthetic macromolecular compounds obtained by reactions only involving carbon-to-carbon unsaturated bonds
- D21H17/37—Polymers of unsaturated acids or derivatives thereof, e.g. polyacrylates
- D21H17/375—Poly(meth)acrylamide
-
- D—TEXTILES; PAPER
- D21—PAPER-MAKING; PRODUCTION OF CELLULOSE
- D21H—PULP COMPOSITIONS; PREPARATION THEREOF NOT COVERED BY SUBCLASSES D21C OR D21D; IMPREGNATING OR COATING OF PAPER; TREATMENT OF FINISHED PAPER NOT COVERED BY CLASS B31 OR SUBCLASS D21G; PAPER NOT OTHERWISE PROVIDED FOR
- D21H17/00—Non-fibrous material added to the pulp, characterised by its constitution; Paper-impregnating material characterised by its constitution
- D21H17/20—Macromolecular organic compounds
- D21H17/33—Synthetic macromolecular compounds
- D21H17/34—Synthetic macromolecular compounds obtained by reactions only involving carbon-to-carbon unsaturated bonds
- D21H17/41—Synthetic macromolecular compounds obtained by reactions only involving carbon-to-carbon unsaturated bonds containing ionic groups
- D21H17/44—Synthetic macromolecular compounds obtained by reactions only involving carbon-to-carbon unsaturated bonds containing ionic groups cationic
- D21H17/45—Nitrogen-containing groups
- D21H17/455—Nitrogen-containing groups comprising tertiary amine or being at least partially quaternised
Landscapes
- Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Dispersion Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Paper (AREA)
- Making Paper Articles (AREA)
- Diaphragms For Electromechanical Transducers (AREA)
- Inorganic Insulating Materials (AREA)
- Steroid Compounds (AREA)
Priority Applications (17)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SE8501652A SE451739B (sv) | 1985-04-03 | 1985-04-03 | Papperstillverkningsforfarande och pappersprodukt varvid som avvattnings- och retentionsforbettrande kemikalie anvends katjonisk polyakrylamid och en speciell oorganisk kolloid |
| CN86102961.5A CN1003799B (zh) | 1985-04-03 | 1986-03-31 | 造纸方法 |
| DE198686902560T DE218674T1 (de) | 1985-04-03 | 1986-04-02 | Papierherstellung. |
| BR8607094A BR8607094A (pt) | 1985-04-03 | 1986-04-02 | Processo para a fabricacao de papel |
| JP61502255A JPS63500190A (ja) | 1985-04-03 | 1986-04-02 | 製紙法 |
| DE8686902560T DE3662113D1 (en) | 1985-04-03 | 1986-04-02 | Papermaking process |
| EP86902560A EP0218674B1 (en) | 1985-04-03 | 1986-04-02 | Papermaking process |
| AU56960/86A AU579729B2 (en) | 1985-04-03 | 1986-04-02 | Papermaking process |
| CA000505607A CA1276413C (en) | 1985-04-03 | 1986-04-02 | Papermaking process |
| NZ215658A NZ215658A (en) | 1985-04-03 | 1986-04-02 | Papermaking process using cationic polyacrylamide and sol of colloidal particles as drainage and retention improving agent |
| AT86902560T ATE40841T1 (de) | 1985-04-03 | 1986-04-02 | Papierherstellung. |
| PCT/SE1986/000152 WO1986005826A1 (en) | 1985-04-03 | 1986-04-02 | Papermaking process |
| ZA862475A ZA862475B (en) | 1985-04-03 | 1986-04-03 | Papermaking process |
| NO864847A NO166958C (no) | 1985-04-03 | 1986-12-02 | Fremgangsmaate for fremstilling av papir, samt papirprodukt |
| FI874295A FI87672C (fi) | 1985-04-03 | 1987-09-30 | Papperstillverkningsfoerfarande |
| SU874203473A RU2023783C1 (ru) | 1985-04-03 | 1987-10-02 | Способ изготовления бумаги |
| US07/380,737 US4980025A (en) | 1985-04-03 | 1989-07-17 | Papermaking process |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SE8501652A SE451739B (sv) | 1985-04-03 | 1985-04-03 | Papperstillverkningsforfarande och pappersprodukt varvid som avvattnings- och retentionsforbettrande kemikalie anvends katjonisk polyakrylamid och en speciell oorganisk kolloid |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| SE8501652D0 SE8501652D0 (sv) | 1985-04-03 |
| SE8501652L SE8501652L (sv) | 1986-10-04 |
| SE451739B true SE451739B (sv) | 1987-10-26 |
Family
ID=20359755
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE8501652A SE451739B (sv) | 1985-04-03 | 1985-04-03 | Papperstillverkningsforfarande och pappersprodukt varvid som avvattnings- och retentionsforbettrande kemikalie anvends katjonisk polyakrylamid och en speciell oorganisk kolloid |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US4980025A (esLanguage) |
| EP (1) | EP0218674B1 (esLanguage) |
| JP (1) | JPS63500190A (esLanguage) |
| CN (1) | CN1003799B (esLanguage) |
| AT (1) | ATE40841T1 (esLanguage) |
| AU (1) | AU579729B2 (esLanguage) |
| BR (1) | BR8607094A (esLanguage) |
| CA (1) | CA1276413C (esLanguage) |
| DE (2) | DE3662113D1 (esLanguage) |
| FI (1) | FI87672C (esLanguage) |
| NO (1) | NO166958C (esLanguage) |
| NZ (1) | NZ215658A (esLanguage) |
| RU (1) | RU2023783C1 (esLanguage) |
| SE (1) | SE451739B (esLanguage) |
| WO (1) | WO1986005826A1 (esLanguage) |
| ZA (1) | ZA862475B (esLanguage) |
Families Citing this family (85)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4913775A (en) * | 1986-01-29 | 1990-04-03 | Allied Colloids Ltd. | Production of paper and paper board |
| GB8602121D0 (en) * | 1986-01-29 | 1986-03-05 | Allied Colloids Ltd | Paper & paper board |
| GB8621680D0 (en) * | 1986-09-09 | 1986-10-15 | Du Pont | Filler compositions |
| SE8701252D0 (sv) * | 1987-03-03 | 1987-03-25 | Eka Nobel Ab | Sett vid framstellning av papper |
| US4795531A (en) * | 1987-09-22 | 1989-01-03 | Nalco Chemical Company | Method for dewatering paper |
| DE3738830C1 (de) * | 1987-11-16 | 1989-02-09 | Thyssen Industrie | Einrichtung zur UEberwachung des Schliesszustands eines Verschlussorgans |
| US4927498A (en) * | 1988-01-13 | 1990-05-22 | E. I. Du Pont De Nemours And Company | Retention and drainage aid for papermaking |
| US5176891A (en) * | 1988-01-13 | 1993-01-05 | Eka Chemicals, Inc. | Polyaluminosilicate process |
| US4798653A (en) * | 1988-03-08 | 1989-01-17 | Procomp, Inc. | Retention and drainage aid for papermaking |
| SE462721B (sv) * | 1988-03-08 | 1990-08-20 | Eka Nobel Ab | Saett vid framstaellning av papper genom formning och avvattning av en suspension av cellulosainnehaallande fibrer |
| SE461156B (sv) * | 1988-05-25 | 1990-01-15 | Eka Nobel Ab | Saett foer framstaellning av papper varvid formning och avvattning aeger rum i naervaro av en aluminiumfoerening, ett katjoniskt retentionsmedel och en polymer kiselsyra |
| US5221436A (en) * | 1988-06-29 | 1993-06-22 | Ecc International Limited | Pitch control using clay coated with an inorganic gel |
| SE467627B (sv) * | 1988-09-01 | 1992-08-17 | Eka Nobel Ab | Saett vid framstaellning av papper |
| SE500367C2 (sv) * | 1989-11-09 | 1994-06-13 | Eka Nobel Ab | Silikasoler och förfarande för framställning av papper |
| SE500387C2 (sv) * | 1989-11-09 | 1994-06-13 | Eka Nobel Ab | Silikasoler, förfarande för framställning av silikasoler samt användning av solerna i pappersframställning |
| US5098520A (en) * | 1991-01-25 | 1992-03-24 | Nalco Chemcial Company | Papermaking process with improved retention and drainage |
| US5194120A (en) * | 1991-05-17 | 1993-03-16 | Delta Chemicals | Production of paper and paper products |
| US5221435A (en) * | 1991-09-27 | 1993-06-22 | Nalco Chemical Company | Papermaking process |
| US5695609A (en) * | 1992-01-20 | 1997-12-09 | Kemira Oy | Process for producing paper |
| SE501216C2 (sv) * | 1992-08-31 | 1994-12-12 | Eka Nobel Ab | Vattenhaltig, stabil suspension av kolloidala partiklar samt framställning och användning av densamma |
| US5458679A (en) * | 1993-12-10 | 1995-10-17 | Minerals Technologies, Inc. | Treatment of inorganic filler material for paper with polysaccharides |
| US5707494A (en) * | 1994-03-14 | 1998-01-13 | E. I. Du Pont De Nemours And Company | Process for preparing water soluble polyaluminosilicates |
| SE9404201D0 (sv) * | 1994-12-02 | 1994-12-02 | Eka Nobel Ab | Sizing dispersions |
| US5571494A (en) * | 1995-01-20 | 1996-11-05 | J. M. Huber Corporation | Temperature-activated polysilicic acids |
| SE9501769D0 (sv) * | 1995-05-12 | 1995-05-12 | Eka Nobel Ab | A process for the production of paper |
| US5846384A (en) * | 1995-06-15 | 1998-12-08 | Eka Chemicals Ab | Process for the production of paper |
| SE9502522D0 (sv) * | 1995-07-07 | 1995-07-07 | Eka Nobel Ab | A process for the production of paper |
| US5595630A (en) * | 1995-08-31 | 1997-01-21 | E. I. Du Pont De Nemours And Company | Process for the manufacture of paper |
| SE9504081D0 (sv) * | 1995-11-15 | 1995-11-15 | Eka Nobel Ab | A process for the production of paper |
| US6113741A (en) * | 1996-12-06 | 2000-09-05 | Eka Chemicals Ab | Process for the production of paper |
| SE9704932D0 (sv) * | 1997-02-05 | 1997-12-30 | Akzo Nobel Nv | Aqueous dispersions of hydrophobic material |
| US5900116A (en) * | 1997-05-19 | 1999-05-04 | Sortwell & Co. | Method of making paper |
| GB2333290B (en) | 1997-05-19 | 1999-12-08 | Sortwell & Co | Method of water treatment using zeolite crystalloid coagulants |
| CA2292577C (en) | 1997-06-09 | 2005-02-08 | Akzo Nobel N.V. | Polysilicate microgels and silica-based materials |
| ATE321735T1 (de) | 1997-06-09 | 2006-04-15 | Akzo Nobel Nv | Polysilikat-mikrogele |
| EP0953680A1 (en) * | 1998-04-27 | 1999-11-03 | Akzo Nobel N.V. | A process for the production of paper |
| KR100403840B1 (ko) | 1998-04-27 | 2003-11-01 | 악조 노벨 엔.브이. | 제지 방법 |
| US7306700B1 (en) | 1998-04-27 | 2007-12-11 | Akzo Nobel Nv | Process for the production of paper |
| US7169261B2 (en) | 1999-05-04 | 2007-01-30 | Akzo Nobel N.V. | Silica-based sols |
| WO2000066492A1 (en) | 1999-05-04 | 2000-11-09 | Akzo Nobel N.V. | Silica-based sols |
| US6764726B1 (en) | 1999-05-12 | 2004-07-20 | Sen Yang | Ink jet recording sheet with improved image waterfastness |
| US6379501B1 (en) | 1999-12-14 | 2002-04-30 | Hercules Incorporated | Cellulose products and processes for preparing the same |
| CA2393797C (en) | 1999-12-20 | 2007-04-24 | Akzo Nobel N.V. | Silica-based sols |
| NO311713B1 (no) * | 2000-03-22 | 2002-01-14 | Stig Ovar Keller | Fellingskjemikalie samt fremgangsmåte ved, og anvendelse av, fellingskjemikaliet |
| AU2001288175A1 (en) | 2000-09-20 | 2002-04-02 | Akzo Nobel N.V. | A process for the production of paper |
| MY140287A (en) * | 2000-10-16 | 2009-12-31 | Ciba Spec Chem Water Treat Ltd | Manufacture of paper and paperboard |
| FR2819246B1 (fr) * | 2000-12-27 | 2003-10-03 | Rhodia Chimie Sa | Suspensions de silice precipitee, dopee et de faible granulometrie et leur application comme charge pour papier |
| JP4206344B2 (ja) | 2002-04-03 | 2009-01-07 | 星光Pmc株式会社 | 紙の製造方法及び歩留り向上剤 |
| CA2405649C (en) * | 2002-09-27 | 2006-05-16 | E.Qu.I.P. International Inc. | Papermaking furnish comprising solventless cationic polymer retention aid combined with phenolic resin and polyethylene oxide |
| US20040138438A1 (en) * | 2002-10-01 | 2004-07-15 | Fredrik Solhage | Cationised polysaccharide product |
| US20040104004A1 (en) * | 2002-10-01 | 2004-06-03 | Fredrik Solhage | Cationised polysaccharide product |
| CA2500545A1 (en) * | 2002-10-01 | 2004-04-15 | Akzo Nobel N.V. | Cationised polysaccharide product |
| US7303654B2 (en) | 2002-11-19 | 2007-12-04 | Akzo Nobel N.V. | Cellulosic product and process for its production |
| BR0316393A (pt) * | 2002-11-19 | 2005-09-27 | Akzo Nobel Nv | Produto celulósico e processo para a sua produção |
| MXPA04003942A (es) * | 2003-05-05 | 2007-06-29 | German Vergara Lopez | Un sistema de retencion y drenaje recomendado para la fabricacion de papel, cartulina, carton y otros productos similares. |
| US7244339B2 (en) * | 2003-05-05 | 2007-07-17 | Vergara Lopez German | Retention and drainage system for the manufacturing of paper |
| CN1784525A (zh) * | 2003-05-09 | 2006-06-07 | 阿克佐诺贝尔公司 | 一种造纸方法 |
| US6906404B2 (en) * | 2003-05-16 | 2005-06-14 | Ballard Power Systems Corporation | Power module with voltage overshoot limiting |
| AU2005206565A1 (en) * | 2004-01-23 | 2005-08-04 | Buckman Laboratories International Inc | Process for making paper |
| US7732495B2 (en) | 2004-04-07 | 2010-06-08 | Akzo Nobel N.V. | Silica-based sols and their production and use |
| US7629392B2 (en) | 2004-04-07 | 2009-12-08 | Akzo Nobel N.V. | Silica-based sols and their production and use |
| US20050257909A1 (en) * | 2004-05-18 | 2005-11-24 | Erik Lindgren | Board, packaging material and package as well as production and uses thereof |
| RU2399050C2 (ru) * | 2004-12-08 | 2010-09-10 | Герт ХОРСТМЕЙЕР | Тестовая среда для экспресс-анализа моторных масел в двигателях внутреннего сгорания |
| US7955473B2 (en) * | 2004-12-22 | 2011-06-07 | Akzo Nobel N.V. | Process for the production of paper |
| US20060254464A1 (en) | 2005-05-16 | 2006-11-16 | Akzo Nobel N.V. | Process for the production of paper |
| ATE402013T1 (de) * | 2005-10-20 | 2008-08-15 | Agfa Graphics Nv | Verfahren zum herstellen eines lithographiedruckformvorläufers |
| PT1969183E (pt) | 2005-12-30 | 2015-03-06 | Akzo Nobel Nv | Processo para a produção de papel |
| US8273216B2 (en) * | 2005-12-30 | 2012-09-25 | Akzo Nobel N.V. | Process for the production of paper |
| US10087082B2 (en) | 2006-06-06 | 2018-10-02 | Florida State University Research Foundation, Inc. | Stabilized silica colloid |
| US8728274B2 (en) * | 2006-09-22 | 2014-05-20 | Akzo Nobel N.V. | Treatment of pulp |
| EP2086757A1 (en) * | 2006-12-01 | 2009-08-12 | Akzo Nobel N.V. | Packaging laminate |
| EP2122051B1 (en) * | 2006-12-21 | 2012-02-22 | Akzo Nobel N.V. | Process for the production of cellulosic product |
| EP2125978A1 (en) * | 2007-02-26 | 2009-12-02 | Akzo Nobel N.V. | Pigment composition |
| FI122734B (fi) * | 2007-05-21 | 2012-06-15 | Kemira Oyj | Prosessikemikaali käytettäväksi paperin tai kartongin valmistuksessa |
| CN101680191A (zh) * | 2007-05-23 | 2010-03-24 | 阿克佐诺贝尔股份有限公司 | 生产纤维素产品的方法 |
| AR066831A1 (es) | 2007-06-07 | 2009-09-16 | Akzo Nobel Nv | Soles a base de silice |
| CL2008002019A1 (es) * | 2007-07-16 | 2009-01-16 | Akzo Nobel Chemicals Int Bv | Composicion de carga que comprende una carga, un compuesto inorganico cationico, un compuesto organico cationico y un polisacarido anionico; metodo para preparar dicha composicion; uso como aditivo para una suspension celulosica acuosa; procedimiento para producir papel; y papel. |
| US20100330366A1 (en) * | 2009-06-30 | 2010-12-30 | Keiser Bruce A | Silica-based particle composition |
| EP2402503A1 (en) | 2010-06-30 | 2012-01-04 | Akzo Nobel Chemicals International B.V. | Process for the production of a cellulosic product |
| CA2803904C (en) | 2010-07-26 | 2014-01-28 | Sortwell & Co. | Method for dispersing and aggregating components of mineral slurries and high-molecular weight multivalent anionic polymers for clay aggregation |
| CN102154938A (zh) * | 2011-05-04 | 2011-08-17 | 南京林业大学 | 聚氧化乙烯-硅溶胶双元助留助滤体系 |
| US8721896B2 (en) | 2012-01-25 | 2014-05-13 | Sortwell & Co. | Method for dispersing and aggregating components of mineral slurries and low molecular weight multivalent polymers for mineral aggregation |
| KR20160048836A (ko) | 2013-08-23 | 2016-05-04 | 아크조 노벨 케미칼즈 인터내셔널 비.브이. | 실리카 졸 |
| CN104947499B (zh) | 2013-12-18 | 2018-01-19 | 艺康美国股份有限公司 | 硅溶胶、制备其的设备和方法和其在造纸中的应用 |
| CN109518521A (zh) * | 2018-12-25 | 2019-03-26 | 昆山裕锦环保包装有限公司 | 一种用于纸浆模塑包装制品防掉屑处理的浆内助剂 |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4309247A (en) * | 1976-03-15 | 1982-01-05 | Amf Incorporated | Filter and method of making same |
| SE419236B (sv) * | 1979-06-01 | 1981-07-20 | Eka Ab | Ytmodifierat pigment av naturligt kaolinmaterial, samt for dess framstellning |
| SE432951B (sv) * | 1980-05-28 | 1984-04-30 | Eka Ab | Pappersprodukt innehallande cellulosafibrer och ett bindemedelssystem som omfattar kolloidal kiselsyra och katjonisk sterkelse samt forfarande for framstellning av pappersprodukten |
| FI67736B (fi) * | 1981-04-10 | 1985-01-31 | Kasvioeljy Vaextolje Oy Ab | Aemneskomposition foer limning av papper |
| FI67735B (fi) * | 1981-09-16 | 1985-01-31 | Kasvioeljy Vaextolje Oy Ab | Foerfarande foer limning av papper eller liknande produkt |
| SE8107078L (sv) * | 1981-11-27 | 1983-05-28 | Eka Ab | Forfarande for papperstillverkning |
| US4578150A (en) * | 1982-07-23 | 1986-03-25 | Amf Inc. | Fibrous media containing millimicron-sized particulates |
| SE8403062L (sv) * | 1984-06-07 | 1985-12-08 | Eka Ab | Forfarande vid papperstillverkning |
-
1985
- 1985-04-03 SE SE8501652A patent/SE451739B/sv not_active IP Right Cessation
-
1986
- 1986-03-31 CN CN86102961.5A patent/CN1003799B/zh not_active Expired
- 1986-04-02 NZ NZ215658A patent/NZ215658A/xx unknown
- 1986-04-02 AT AT86902560T patent/ATE40841T1/de not_active IP Right Cessation
- 1986-04-02 BR BR8607094A patent/BR8607094A/pt not_active IP Right Cessation
- 1986-04-02 WO PCT/SE1986/000152 patent/WO1986005826A1/en not_active Ceased
- 1986-04-02 DE DE8686902560T patent/DE3662113D1/de not_active Expired
- 1986-04-02 EP EP86902560A patent/EP0218674B1/en not_active Expired
- 1986-04-02 DE DE198686902560T patent/DE218674T1/de active Pending
- 1986-04-02 JP JP61502255A patent/JPS63500190A/ja active Granted
- 1986-04-02 CA CA000505607A patent/CA1276413C/en not_active Expired - Lifetime
- 1986-04-02 AU AU56960/86A patent/AU579729B2/en not_active Expired
- 1986-04-03 ZA ZA862475A patent/ZA862475B/xx unknown
- 1986-12-02 NO NO864847A patent/NO166958C/no unknown
-
1987
- 1987-09-30 FI FI874295A patent/FI87672C/fi not_active IP Right Cessation
- 1987-10-02 RU SU874203473A patent/RU2023783C1/ru active
-
1989
- 1989-07-17 US US07/380,737 patent/US4980025A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| CN1003799B (zh) | 1989-04-05 |
| NO166958B (no) | 1991-06-10 |
| EP0218674A1 (en) | 1987-04-22 |
| SE8501652L (sv) | 1986-10-04 |
| SE8501652D0 (sv) | 1985-04-03 |
| FI874295L (fi) | 1987-09-30 |
| NO166958C (no) | 1991-09-18 |
| AU579729B2 (en) | 1988-12-08 |
| JPH0327676B2 (esLanguage) | 1991-04-16 |
| CN86102961A (zh) | 1986-12-17 |
| US4980025A (en) | 1990-12-25 |
| FI87672C (fi) | 1993-02-10 |
| ATE40841T1 (de) | 1989-03-15 |
| ZA862475B (en) | 1986-12-30 |
| BR8607094A (pt) | 1988-01-19 |
| DE218674T1 (de) | 1987-08-13 |
| CA1276413C (en) | 1990-11-20 |
| NZ215658A (en) | 1988-08-30 |
| FI87672B (fi) | 1992-10-30 |
| DE3662113D1 (en) | 1989-03-23 |
| NO864847L (no) | 1986-12-02 |
| JPS63500190A (ja) | 1988-01-21 |
| FI874295A0 (fi) | 1987-09-30 |
| RU2023783C1 (ru) | 1994-11-30 |
| WO1986005826A1 (en) | 1986-10-09 |
| AU5696086A (en) | 1986-10-23 |
| NO864847D0 (no) | 1986-12-02 |
| EP0218674B1 (en) | 1989-02-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SE451739B (sv) | Papperstillverkningsforfarande och pappersprodukt varvid som avvattnings- och retentionsforbettrande kemikalie anvends katjonisk polyakrylamid och en speciell oorganisk kolloid | |
| FI76392C (fi) | Foerfarande foer framstaellning av papper. | |
| KR960015749B1 (ko) | 시이트나 웨브(web)형 세룰로오스 섬유함유 제품의 제조방법 | |
| FI70954B (fi) | Foerfarande foer framstaellning av papper | |
| EP0348366B1 (en) | A process for the production of paper | |
| SE500367C2 (sv) | Silikasoler och förfarande för framställning av papper | |
| EP0500770B1 (en) | A process for the production of paper | |
| JP2521539B2 (ja) | 製紙方法 | |
| FI72557B (fi) | Pappersframstaellningsfoerfarande och aemneskomposition foer anvaendning daeri. | |
| WO1995023021A1 (en) | Silica-based sols, preparation and use of the sols | |
| KR920011032B1 (ko) | 제지방법 | |
| SE462923B (sv) | Saett vid framstaellning av papper genom formning och avvattning av en suspension av cellulosainnehaallande fibrer |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| NUG | Patent has lapsed |
Ref document number: 8501652-5 Effective date: 19910117 Format of ref document f/p: F |