RU2359963C2 - Производные нитросульфобензамида, способ их получения и их применение для получения производных сульфонилмочевины и их предшественников - Google Patents
Производные нитросульфобензамида, способ их получения и их применение для получения производных сульфонилмочевины и их предшественников Download PDFInfo
- Publication number
- RU2359963C2 RU2359963C2 RU2002118605/04A RU2002118605A RU2359963C2 RU 2359963 C2 RU2359963 C2 RU 2359963C2 RU 2002118605/04 A RU2002118605/04 A RU 2002118605/04A RU 2002118605 A RU2002118605 A RU 2002118605A RU 2359963 C2 RU2359963 C2 RU 2359963C2
- Authority
- RU
- Russia
- Prior art keywords
- formula
- carbon atoms
- compound
- compounds
- alkyl
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 29
- VGBRFYULSSMNKX-UHFFFAOYSA-N 2-carbamoyl-6-nitrobenzenesulfonic acid Chemical class NC(=O)C1=CC=CC([N+]([O-])=O)=C1S(O)(=O)=O VGBRFYULSSMNKX-UHFFFAOYSA-N 0.000 title claims abstract description 8
- 238000002360 preparation method Methods 0.000 title abstract description 7
- 239000002243 precursor Substances 0.000 title abstract description 6
- 238000004519 manufacturing process Methods 0.000 title abstract description 4
- YROXIXLRRCOBKF-UHFFFAOYSA-N sulfonylurea Chemical class OC(=N)N=S(=O)=O YROXIXLRRCOBKF-UHFFFAOYSA-N 0.000 title description 5
- 150000001875 compounds Chemical class 0.000 claims abstract description 134
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 76
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 50
- 239000001257 hydrogen Substances 0.000 claims abstract description 50
- 150000003839 salts Chemical class 0.000 claims abstract description 49
- -1 alkali metal cation Chemical class 0.000 claims abstract description 39
- 230000003993 interaction Effects 0.000 claims abstract description 35
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 28
- 229910052751 metal Inorganic materials 0.000 claims abstract description 21
- 239000002184 metal Substances 0.000 claims abstract description 21
- 229910052783 alkali metal Inorganic materials 0.000 claims abstract description 18
- 150000001412 amines Chemical class 0.000 claims abstract description 16
- 150000001768 cations Chemical class 0.000 claims abstract description 8
- 125000000217 alkyl group Chemical group 0.000 claims description 40
- 239000003054 catalyst Substances 0.000 claims description 24
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 claims description 18
- 239000007825 activation reagent Substances 0.000 claims description 18
- 150000002431 hydrogen Chemical group 0.000 claims description 17
- 239000002904 solvent Substances 0.000 claims description 17
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 14
- 150000001408 amides Chemical class 0.000 claims description 12
- 125000003545 alkoxy group Chemical group 0.000 claims description 11
- 229910052736 halogen Inorganic materials 0.000 claims description 10
- 150000002367 halogens Chemical class 0.000 claims description 10
- 229910052757 nitrogen Inorganic materials 0.000 claims description 10
- 125000002252 acyl group Chemical group 0.000 claims description 9
- 125000004414 alkyl thio group Chemical group 0.000 claims description 9
- 238000005984 hydrogenation reaction Methods 0.000 claims description 9
- QKPIQNZNRWDBFG-UHFFFAOYSA-N 1-(benzenesulfonyl)-1-nitrourea Chemical class NC(=O)N([N+]([O-])=O)S(=O)(=O)C1=CC=CC=C1 QKPIQNZNRWDBFG-UHFFFAOYSA-N 0.000 claims description 7
- 150000008064 anhydrides Chemical class 0.000 claims description 7
- 239000003795 chemical substances by application Substances 0.000 claims description 7
- 125000003342 alkenyl group Chemical group 0.000 claims description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 6
- 125000000304 alkynyl group Chemical group 0.000 claims description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 5
- 230000010933 acylation Effects 0.000 claims description 4
- 238000005917 acylation reaction Methods 0.000 claims description 4
- 125000003302 alkenyloxy group Chemical group 0.000 claims description 4
- 125000005133 alkynyloxy group Chemical group 0.000 claims description 4
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 4
- GNFTZDOKVXKIBK-UHFFFAOYSA-N 3-(2-methoxyethoxy)benzohydrazide Chemical compound COCCOC1=CC=CC(C(=O)NN)=C1 GNFTZDOKVXKIBK-UHFFFAOYSA-N 0.000 claims description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical group C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 3
- 229910052708 sodium Inorganic materials 0.000 claims description 3
- 239000011734 sodium Chemical group 0.000 claims description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical group [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 2
- 229910052700 potassium Chemical group 0.000 claims description 2
- 239000011591 potassium Chemical group 0.000 claims description 2
- 229940100389 Sulfonylurea Drugs 0.000 abstract description 9
- 239000000126 substance Substances 0.000 abstract description 2
- 229940124530 sulfonamide Drugs 0.000 abstract description 2
- 150000003456 sulfonamides Chemical class 0.000 abstract description 2
- XTHPWXDJESJLNJ-UHFFFAOYSA-N sulfurochloridic acid Chemical class OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 abstract 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 27
- 239000000203 mixture Substances 0.000 description 25
- 238000006243 chemical reaction Methods 0.000 description 24
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 18
- VTOWSZKEPNGZRY-UHFFFAOYSA-N n,n-dimethyl-4-nitro-2-sulfamoylbenzamide Chemical compound CN(C)C(=O)C1=CC=C([N+]([O-])=O)C=C1S(N)(=O)=O VTOWSZKEPNGZRY-UHFFFAOYSA-N 0.000 description 18
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 13
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 12
- HLLOPYBKLGMVDA-UHFFFAOYSA-N 2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-n,n-dimethyl-4-nitrobenzamide Chemical compound COC1=CC(OC)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=C(C=2)[N+]([O-])=O)C(=O)N(C)C)=N1 HLLOPYBKLGMVDA-UHFFFAOYSA-N 0.000 description 11
- 229910052799 carbon Inorganic materials 0.000 description 10
- 125000001188 haloalkyl group Chemical group 0.000 description 10
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 10
- 125000002877 alkyl aryl group Chemical group 0.000 description 9
- 229930195733 hydrocarbon Natural products 0.000 description 9
- 150000002430 hydrocarbons Chemical class 0.000 description 9
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 9
- 125000000547 substituted alkyl group Chemical group 0.000 description 9
- 125000003107 substituted aryl group Chemical group 0.000 description 9
- 150000002170 ethers Chemical class 0.000 description 8
- 125000003106 haloaryl group Chemical group 0.000 description 8
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 7
- 150000002148 esters Chemical class 0.000 description 7
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 6
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 6
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 6
- 238000009835 boiling Methods 0.000 description 6
- MGNZXYYWBUKAII-UHFFFAOYSA-N cyclohexa-1,3-diene Chemical compound C1CC=CC=C1 MGNZXYYWBUKAII-UHFFFAOYSA-N 0.000 description 6
- 238000004821 distillation Methods 0.000 description 6
- PXDNXJSDGQBLKS-UHFFFAOYSA-N foramsulfuron Chemical compound COC1=CC(OC)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=C(NC=O)C=2)C(=O)N(C)C)=N1 PXDNXJSDGQBLKS-UHFFFAOYSA-N 0.000 description 6
- 235000019253 formic acid Nutrition 0.000 description 6
- 150000002825 nitriles Chemical class 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- 239000008096 xylene Substances 0.000 description 6
- 239000002253 acid Substances 0.000 description 5
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- 150000003457 sulfones Chemical class 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- UVHYGHWGKRANTD-UHFFFAOYSA-N 2-(dimethylcarbamoyl)-5-nitrobenzenesulfonic acid Chemical compound CN(C)C(=O)C1=CC=C([N+]([O-])=O)C=C1S(O)(=O)=O UVHYGHWGKRANTD-UHFFFAOYSA-N 0.000 description 4
- LCOPFDUKOIUDFD-UHFFFAOYSA-N 4-nitro-2-sulfobenzoic acid Chemical compound OC(=O)C1=CC=C([N+]([O-])=O)C=C1S(O)(=O)=O LCOPFDUKOIUDFD-UHFFFAOYSA-N 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- 239000004009 herbicide Substances 0.000 description 4
- 150000002576 ketones Chemical class 0.000 description 4
- 0 *C(c(c(*)c1)ccc1[N+]([O-])=O)=O Chemical compound *C(c(c(*)c1)ccc1[N+]([O-])=O)=O 0.000 description 3
- PUAJWUAQHGYYAI-UHFFFAOYSA-N 2-(diethylcarbamoyl)-5-nitrobenzenesulfonic acid Chemical compound CCN(CC)C(=O)C1=CC=C([N+]([O-])=O)C=C1S(O)(=O)=O PUAJWUAQHGYYAI-UHFFFAOYSA-N 0.000 description 3
- LTJMHCGDSFTOHA-UHFFFAOYSA-N 2-carbamoylbenzenesulfonic acid Chemical class NC(=O)C1=CC=CC=C1S(O)(=O)=O LTJMHCGDSFTOHA-UHFFFAOYSA-N 0.000 description 3
- CTMWXPULBICBQU-UHFFFAOYSA-N CCC1=C(C=CC(=C1S(=O)(=O)O)C(=O)NC)[N+](=O)[O-] Chemical compound CCC1=C(C=CC(=C1S(=O)(=O)O)C(=O)NC)[N+](=O)[O-] CTMWXPULBICBQU-UHFFFAOYSA-N 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 229910000564 Raney nickel Inorganic materials 0.000 description 3
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 229940054066 benzamide antipsychotics Drugs 0.000 description 3
- 150000003936 benzamides Chemical class 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 229910017052 cobalt Inorganic materials 0.000 description 3
- 239000010941 cobalt Substances 0.000 description 3
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 230000002363 herbicidal effect Effects 0.000 description 3
- 229910052742 iron Inorganic materials 0.000 description 3
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 3
- 229910052750 molybdenum Inorganic materials 0.000 description 3
- 239000011733 molybdenum Substances 0.000 description 3
- 229910052697 platinum Inorganic materials 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 229910052707 ruthenium Inorganic materials 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 3
- 229910052721 tungsten Inorganic materials 0.000 description 3
- 239000010937 tungsten Substances 0.000 description 3
- FEWLNYSYJNLUOO-UHFFFAOYSA-N 1-Piperidinecarboxaldehyde Chemical compound O=CN1CCCCC1 FEWLNYSYJNLUOO-UHFFFAOYSA-N 0.000 description 2
- FYZIKEKHLDPREF-UHFFFAOYSA-N 4-formamido-n,n-dimethyl-2-sulfamoylbenzamide Chemical compound CN(C)C(=O)C1=CC=C(NC=O)C=C1S(N)(=O)=O FYZIKEKHLDPREF-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- 125000004448 alkyl carbonyl group Chemical group 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 150000003863 ammonium salts Chemical class 0.000 description 2
- HTZCNXWZYVXIMZ-UHFFFAOYSA-M benzyl(triethyl)azanium;chloride Chemical compound [Cl-].CC[N+](CC)(CC)CC1=CC=CC=C1 HTZCNXWZYVXIMZ-UHFFFAOYSA-M 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- CFHIDWOYWUOIHU-UHFFFAOYSA-N oxomethyl Chemical compound O=[CH] CFHIDWOYWUOIHU-UHFFFAOYSA-N 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 239000011684 sodium molybdate Substances 0.000 description 2
- 235000015393 sodium molybdate Nutrition 0.000 description 2
- TVXXNOYZHKPKGW-UHFFFAOYSA-N sodium molybdate (anhydrous) Chemical compound [Na+].[Na+].[O-][Mo]([O-])(=O)=O TVXXNOYZHKPKGW-UHFFFAOYSA-N 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical class ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 2
- 150000003512 tertiary amines Chemical class 0.000 description 2
- AGRIQBHIKABLPJ-UHFFFAOYSA-N 1-Pyrrolidinecarboxaldehyde Chemical compound O=CN1CCCC1 AGRIQBHIKABLPJ-UHFFFAOYSA-N 0.000 description 1
- BJNZHRVKTMSBRQ-UHFFFAOYSA-N 1-nitro-1-phenylurea Chemical class NC(=O)N([N+]([O-])=O)C1=CC=CC=C1 BJNZHRVKTMSBRQ-UHFFFAOYSA-N 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- 125000000069 2-butynyl group Chemical group [H]C([H])([H])C#CC([H])([H])* 0.000 description 1
- ATBCVDQLBMRUGZ-UHFFFAOYSA-N 2-carbamoyl-5-nitrobenzenesulfonic acid Chemical compound NC(=O)C1=CC=C([N+]([O-])=O)C=C1S(O)(=O)=O ATBCVDQLBMRUGZ-UHFFFAOYSA-N 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- 125000000474 3-butynyl group Chemical group [H]C#CC([H])([H])C([H])([H])* 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- LVFRCHIUUKWBLR-UHFFFAOYSA-N 4,6-dimethoxypyrimidin-2-amine Chemical compound COC1=CC(OC)=NC(N)=N1 LVFRCHIUUKWBLR-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 241000208202 Linaceae Species 0.000 description 1
- 235000004431 Linum usitatissimum Nutrition 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- SUAKHGWARZSWIH-UHFFFAOYSA-N N,N‐diethylformamide Chemical compound CCN(CC)C=O SUAKHGWARZSWIH-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 125000004644 alkyl sulfinyl group Chemical group 0.000 description 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- VBQDSLGFSUGBBE-UHFFFAOYSA-N benzyl(triethyl)azanium Chemical compound CC[N+](CC)(CC)CC1=CC=CC=C1 VBQDSLGFSUGBBE-UHFFFAOYSA-N 0.000 description 1
- YOUGRGFIHBUKRS-UHFFFAOYSA-N benzyl(trimethyl)azanium Chemical compound C[N+](C)(C)CC1=CC=CC=C1 YOUGRGFIHBUKRS-UHFFFAOYSA-N 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- 238000007664 blowing Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-N carbonic acid monoamide Natural products NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 1
- RLGQACBPNDBWTB-UHFFFAOYSA-N cetyltrimethylammonium ion Chemical compound CCCCCCCCCCCCCCCC[N+](C)(C)C RLGQACBPNDBWTB-UHFFFAOYSA-N 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 238000005352 clarification Methods 0.000 description 1
- XHFGWHUWQXTGAT-UHFFFAOYSA-N dimethylamine hydrochloride Natural products CNC(C)C XHFGWHUWQXTGAT-UHFFFAOYSA-N 0.000 description 1
- IQDGSYLLQPDQDV-UHFFFAOYSA-N dimethylazanium;chloride Chemical compound Cl.CNC IQDGSYLLQPDQDV-UHFFFAOYSA-N 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- VGGRCVDNFAQIKO-UHFFFAOYSA-N formic anhydride Chemical compound O=COC=O VGGRCVDNFAQIKO-UHFFFAOYSA-N 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 125000004438 haloalkoxy group Chemical group 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- LCEDQNDDFOCWGG-UHFFFAOYSA-N morpholine-4-carbaldehyde Chemical compound O=CN1CCOCC1 LCEDQNDDFOCWGG-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003136 n-heptyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- LMTGCJANOQOGPI-UHFFFAOYSA-N n-methyl-n-phenylacetamide Chemical compound CC(=O)N(C)C1=CC=CC=C1 LMTGCJANOQOGPI-UHFFFAOYSA-N 0.000 description 1
- JIKUXBYRTXDNIY-UHFFFAOYSA-N n-methyl-n-phenylformamide Chemical compound O=CN(C)C1=CC=CC=C1 JIKUXBYRTXDNIY-UHFFFAOYSA-N 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 230000000269 nucleophilic effect Effects 0.000 description 1
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 239000003444 phase transfer catalyst Substances 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- 150000003009 phosphonic acids Chemical class 0.000 description 1
- XYFCBTPGUUZFHI-UHFFFAOYSA-O phosphonium Chemical compound [PH4+] XYFCBTPGUUZFHI-UHFFFAOYSA-O 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- JUJWROOIHBZHMG-UHFFFAOYSA-O pyridinium Chemical compound C1=CC=[NH+]C=C1 JUJWROOIHBZHMG-UHFFFAOYSA-O 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 150000003455 sulfinic acids Chemical class 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- BUXTXUBQAKIQKS-UHFFFAOYSA-N sulfuryl diisocyanate Chemical compound O=C=NS(=O)(=O)N=C=O BUXTXUBQAKIQKS-UHFFFAOYSA-N 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- DZLFLBLQUQXARW-UHFFFAOYSA-N tetrabutylammonium Chemical compound CCCC[N+](CCCC)(CCCC)CCCC DZLFLBLQUQXARW-UHFFFAOYSA-N 0.000 description 1
- JRMUNVKIHCOMHV-UHFFFAOYSA-M tetrabutylammonium bromide Chemical compound [Br-].CCCC[N+](CCCC)(CCCC)CCCC JRMUNVKIHCOMHV-UHFFFAOYSA-M 0.000 description 1
- CBXCPBUEXACCNR-UHFFFAOYSA-N tetraethylammonium Chemical compound CC[N+](CC)(CC)CC CBXCPBUEXACCNR-UHFFFAOYSA-N 0.000 description 1
- QEMXHQIAXOOASZ-UHFFFAOYSA-N tetramethylammonium Chemical compound C[N+](C)(C)C QEMXHQIAXOOASZ-UHFFFAOYSA-N 0.000 description 1
- USFPINLPPFWTJW-UHFFFAOYSA-N tetraphenylphosphonium Chemical compound C1=CC=CC=C1[P+](C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 USFPINLPPFWTJW-UHFFFAOYSA-N 0.000 description 1
- 150000003566 thiocarboxylic acids Chemical class 0.000 description 1
- KJAMZCVTJDTESW-UHFFFAOYSA-N tiracizine Chemical class C1CC2=CC=CC=C2N(C(=O)CN(C)C)C2=CC(NC(=O)OCC)=CC=C21 KJAMZCVTJDTESW-UHFFFAOYSA-N 0.000 description 1
- IMFACGCPASFAPR-UHFFFAOYSA-O tributylazanium Chemical compound CCCC[NH+](CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-O 0.000 description 1
- ZMANZCXQSJIPKH-UHFFFAOYSA-O triethylammonium ion Chemical compound CC[NH+](CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-O 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C303/00—Preparation of esters or amides of sulfuric acids; Preparation of sulfonic acids or of their esters, halides, anhydrides or amides
- C07C303/36—Preparation of esters or amides of sulfuric acids; Preparation of sulfonic acids or of their esters, halides, anhydrides or amides of amides of sulfonic acids
- C07C303/38—Preparation of esters or amides of sulfuric acids; Preparation of sulfonic acids or of their esters, halides, anhydrides or amides of amides of sulfonic acids by reaction of ammonia or amines with sulfonic acids, or with esters, anhydrides, or halides thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C303/00—Preparation of esters or amides of sulfuric acids; Preparation of sulfonic acids or of their esters, halides, anhydrides or amides
- C07C303/02—Preparation of esters or amides of sulfuric acids; Preparation of sulfonic acids or of their esters, halides, anhydrides or amides of sulfonic acids or halides thereof
- C07C303/22—Preparation of esters or amides of sulfuric acids; Preparation of sulfonic acids or of their esters, halides, anhydrides or amides of sulfonic acids or halides thereof from sulfonic acids, by reactions not involving the formation of sulfo or halosulfonyl groups; from sulfonic halides by reactions not involving the formation of halosulfonyl groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C309/00—Sulfonic acids; Halides, esters, or anhydrides thereof
- C07C309/01—Sulfonic acids
- C07C309/28—Sulfonic acids having sulfo groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C309/57—Sulfonic acids having sulfo groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton containing carboxyl groups bound to the carbon skeleton
- C07C309/59—Nitrogen analogues of carboxyl groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/65—N-sulfonylisocyanates
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C327/00—Thiocarboxylic acids
- C07C327/02—Monothiocarboxylic acids
- C07C327/04—Monothiocarboxylic acids having carbon atoms of thiocarboxyl groups bound to hydrogen atoms or to acyclic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/46—Two or more oxygen, sulphur or nitrogen atoms
- C07D239/52—Two oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D327/00—Heterocyclic compounds containing rings having oxygen and sulfur atoms as the only ring hetero atoms
- C07D327/02—Heterocyclic compounds containing rings having oxygen and sulfur atoms as the only ring hetero atoms one oxygen atom and one sulfur atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D327/00—Heterocyclic compounds containing rings having oxygen and sulfur atoms as the only ring hetero atoms
- C07D327/02—Heterocyclic compounds containing rings having oxygen and sulfur atoms as the only ring hetero atoms one oxygen atom and one sulfur atom
- C07D327/04—Five-membered rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19959291 | 1999-12-09 | ||
| DE19959291.8 | 1999-12-09 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| RU2002118605A RU2002118605A (ru) | 2004-01-10 |
| RU2359963C2 true RU2359963C2 (ru) | 2009-06-27 |
Family
ID=7931941
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| RU2002118605/04A RU2359963C2 (ru) | 1999-12-09 | 2000-11-18 | Производные нитросульфобензамида, способ их получения и их применение для получения производных сульфонилмочевины и их предшественников |
Country Status (26)
| Country | Link |
|---|---|
| US (1) | US7781611B2 (enExample) |
| EP (1) | EP1242386B1 (enExample) |
| JP (1) | JP4536987B2 (enExample) |
| KR (1) | KR20020064339A (enExample) |
| CN (1) | CN1213034C (enExample) |
| AR (1) | AR035022A1 (enExample) |
| AT (1) | ATE440824T1 (enExample) |
| AU (1) | AU780969B2 (enExample) |
| BR (1) | BR0016739A (enExample) |
| CA (1) | CA2390669A1 (enExample) |
| CZ (1) | CZ20022003A3 (enExample) |
| DE (1) | DE60042839D1 (enExample) |
| DK (1) | DK1242386T3 (enExample) |
| ES (1) | ES2332208T3 (enExample) |
| HR (1) | HRP20020498A2 (enExample) |
| HU (1) | HUP0203678A3 (enExample) |
| IL (3) | IL150057A0 (enExample) |
| MX (1) | MXPA02005803A (enExample) |
| PL (1) | PL357573A1 (enExample) |
| RU (1) | RU2359963C2 (enExample) |
| SK (1) | SK8122002A3 (enExample) |
| TW (1) | TWI221151B (enExample) |
| UA (1) | UA81596C2 (enExample) |
| WO (1) | WO2001042226A1 (enExample) |
| YU (1) | YU41702A (enExample) |
| ZA (1) | ZA200204581B (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AR053410A1 (es) * | 2004-08-19 | 2007-05-09 | Wyeth Corp | Proceso para la sintesis de indoles n-alquilados c-2, c-3 sustituidos. compuestos intermediarios |
| CN105399687B (zh) * | 2015-10-29 | 2019-01-15 | 江苏省农用激素工程技术研究中心有限公司 | 甲酰胺磺隆的制备方法 |
| CN106349168A (zh) * | 2016-08-12 | 2017-01-25 | 淮安国瑞化工有限公司 | 磺酰脲类除草剂甲酰胺磺隆中间体的制备方法 |
| CN110437112B (zh) * | 2019-09-19 | 2021-08-17 | 河北兴柏农业科技有限公司 | 一种甲酰氨基嘧磺隆或其衍生物中间体的制备方法 |
| CN116903545A (zh) * | 2023-07-07 | 2023-10-20 | 江苏省农用激素工程技术研究中心有限公司 | 甲酰胺磺隆的合成方法 |
Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3055928A (en) * | 1960-03-28 | 1962-09-25 | Smith Kline French Lab | Esters of 2-carbamoylbenzenesulfonic acids |
| WO1995029899A1 (de) * | 1994-04-29 | 1995-11-09 | Hoechst Schering Agrevo Gmbh | Acylierte aminophenylsulfonylharnstoffe, verfahren zu deren herstellung und verwendung als herbizide und pflanzenwachstumsregulatoren |
| WO1997016419A1 (de) * | 1995-11-02 | 1997-05-09 | Hoechst Schering Agrevo Gmbh | Verfahren zur herstellung von aminophenylsulfonylharnstoffen und zwischenprodukte zu den verfahren |
| RU2107683C1 (ru) * | 1996-06-17 | 1998-03-27 | Любовь Дмитриевна Погорелая | Калиевая соль n-(4,6-диметилпиримидин-2-ил)-n'-[2-(метоксикарбонил)фенилсульфонил]мочевины |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4018245A1 (de) * | 1990-06-07 | 1991-12-12 | Basf Ag | Verfahren zur herstellung von sulfonierten anthranilsaeuren |
| DE4334949A1 (de) * | 1992-10-14 | 1994-05-19 | Bard Inc C R | Aminosubstituiertes Phenolrot als pH-Indikator und Verfahren zu seiner Herstellung |
| DE4411682A1 (de) | 1994-04-05 | 1995-10-12 | Hoechst Schering Agrevo Gmbh | Verfahren zur Herstellung von Carboxy-arensulfonsäuren und deren Carbonsäurederivaten |
| DE19521668A1 (de) | 1995-06-14 | 1996-12-19 | Hoechst Schering Agrevo Gmbh | Substituierte Hydrazinophenylsulfonylharnstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung als Herbizide und Pflanzenwachstumsregulatoren |
| DE19735879A1 (de) * | 1997-08-19 | 1999-02-25 | Hoechst Schering Agrevo Gmbh | Verfahren zur Herstellung von 2-Carboxy-5-nitro-benzolsulfonsäure und deren Salzen durch Oxidation |
| DE19749723A1 (de) * | 1997-11-11 | 1999-05-12 | Bayer Ag | Verfahren zur Herstellung von 4-Nitro-2-sulfo-benzoesäure |
-
2000
- 2000-11-18 AU AU13954/01A patent/AU780969B2/en not_active Ceased
- 2000-11-18 KR KR1020027007389A patent/KR20020064339A/ko not_active Ceased
- 2000-11-18 UA UA2002075618A patent/UA81596C2/ru unknown
- 2000-11-18 ES ES00976048T patent/ES2332208T3/es not_active Expired - Lifetime
- 2000-11-18 EP EP00976048A patent/EP1242386B1/en not_active Expired - Lifetime
- 2000-11-18 SK SK812-2002A patent/SK8122002A3/sk not_active Application Discontinuation
- 2000-11-18 CZ CZ20022003A patent/CZ20022003A3/cs unknown
- 2000-11-18 IL IL15005700A patent/IL150057A0/xx unknown
- 2000-11-18 WO PCT/EP2000/011501 patent/WO2001042226A1/en not_active Ceased
- 2000-11-18 HU HU0203678A patent/HUP0203678A3/hu unknown
- 2000-11-18 PL PL00357573A patent/PL357573A1/xx not_active Application Discontinuation
- 2000-11-18 HR HR20020498A patent/HRP20020498A2/hr not_active Application Discontinuation
- 2000-11-18 AT AT00976048T patent/ATE440824T1/de not_active IP Right Cessation
- 2000-11-18 DK DK00976048T patent/DK1242386T3/da active
- 2000-11-18 CA CA002390669A patent/CA2390669A1/en not_active Abandoned
- 2000-11-18 BR BR0016739-8A patent/BR0016739A/pt not_active Application Discontinuation
- 2000-11-18 JP JP2001543527A patent/JP4536987B2/ja not_active Expired - Lifetime
- 2000-11-18 DE DE60042839T patent/DE60042839D1/de not_active Expired - Lifetime
- 2000-11-18 CN CNB00817816XA patent/CN1213034C/zh not_active Expired - Lifetime
- 2000-11-18 MX MXPA02005803A patent/MXPA02005803A/es active IP Right Grant
- 2000-11-18 RU RU2002118605/04A patent/RU2359963C2/ru not_active IP Right Cessation
- 2000-11-18 YU YU41702A patent/YU41702A/sh unknown
- 2000-12-07 AR ARP000106513A patent/AR035022A1/es unknown
- 2000-12-07 US US09/732,006 patent/US7781611B2/en not_active Expired - Fee Related
- 2000-12-07 TW TW089126114A patent/TWI221151B/zh not_active IP Right Cessation
-
2002
- 2002-06-05 IL IL150057A patent/IL150057A/en active IP Right Grant
- 2002-06-07 ZA ZA200204581A patent/ZA200204581B/xx unknown
-
2010
- 2010-08-05 IL IL207454A patent/IL207454A/en active IP Right Grant
Patent Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3055928A (en) * | 1960-03-28 | 1962-09-25 | Smith Kline French Lab | Esters of 2-carbamoylbenzenesulfonic acids |
| WO1995029899A1 (de) * | 1994-04-29 | 1995-11-09 | Hoechst Schering Agrevo Gmbh | Acylierte aminophenylsulfonylharnstoffe, verfahren zu deren herstellung und verwendung als herbizide und pflanzenwachstumsregulatoren |
| WO1997016419A1 (de) * | 1995-11-02 | 1997-05-09 | Hoechst Schering Agrevo Gmbh | Verfahren zur herstellung von aminophenylsulfonylharnstoffen und zwischenprodukte zu den verfahren |
| RU2107683C1 (ru) * | 1996-06-17 | 1998-03-27 | Любовь Дмитриевна Погорелая | Калиевая соль n-(4,6-диметилпиримидин-2-ил)-n'-[2-(метоксикарбонил)фенилсульфонил]мочевины |
Non-Patent Citations (1)
| Title |
|---|
| Grob C.A. et al. Versuche zur Herstellung Kunstlicher Komplexantigene der Steroidreine, HELVETICA ACTA, 1949, v.32, pp.172-184. * |
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| KR100733207B1 (ko) | 치환된 설포닐아미노메틸벤조산(유도체) 및 이의 제조 방법 | |
| RU2359963C2 (ru) | Производные нитросульфобензамида, способ их получения и их применение для получения производных сульфонилмочевины и их предшественников | |
| KR20010012732A (ko) | 구아니딘화 시약 | |
| JP3754460B2 (ja) | スルホニル尿素類の製造方法 | |
| US6500952B1 (en) | Processes for preparing aminophenylsulfonylureas, and intermediates therefor | |
| US20050070593A1 (en) | Novel process for the preparation of trans-3-ethyl-2,5-dihydro-4-methyl-N-[2-[4-[[[[(4-methyl cyclohexyl) amino]carbonyl] amino]sulfonyl] phenyl]ethyl]-2-oxo-1H-pyrrole-1-carboxamide | |
| RU2309948C2 (ru) | Метиловый эфир 4-йод-2-[n-(n-алкиламинокарбонил)аминосульфонил]-бензойной кислоты, его производные и способ их получения | |
| KR20010092263A (ko) | 4,6-이치환된 2-이소시아네이토피리미딘의 제조방법 및활성 성분을 합성하기 위한 중간체로서의 그의 용도 | |
| IL98877A (en) | Method for preparing N-alkylsulfonyl minusulfonyl ureas | |
| HU210673B (en) | Method for producing of sulfonyl-urea-derivatives | |
| JPWO2004067500A1 (ja) | 新規なｏ−イソプロピルイソ尿素塩及びその製造方法 | |
| SU1482523A3 (ru) | Способ получени производных сульфонилдиамида | |
| CA2386655A1 (en) | Process for preparing substituted phenylsulfonylureas from sulfonyl halides | |
| EP0922695A1 (en) | Preparation of esters |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM4A | The patent is invalid due to non-payment of fees |
Effective date: 20091119 |