RU2268260C2 - Производные хиназолина или хинолина и лекарственные средства на их основе - Google Patents
Производные хиназолина или хинолина и лекарственные средства на их основе Download PDFInfo
- Publication number
- RU2268260C2 RU2268260C2 RU2002129100/04A RU2002129100A RU2268260C2 RU 2268260 C2 RU2268260 C2 RU 2268260C2 RU 2002129100/04 A RU2002129100/04 A RU 2002129100/04A RU 2002129100 A RU2002129100 A RU 2002129100A RU 2268260 C2 RU2268260 C2 RU 2268260C2
- Authority
- RU
- Russia
- Prior art keywords
- group
- alkyl
- compound
- hydrogen atom
- alkoxy
- Prior art date
Links
- 125000002943 quinolinyl group Chemical class N1=C(C=CC2=CC=CC=C12)* 0.000 title description 2
- 229940027991 antiseptic and disinfectant quinoline derivative Drugs 0.000 title 1
- JWVCLYRUEFBMGU-UHFFFAOYSA-N quinazoline Chemical compound N1=CN=CC2=CC=CC=C21 JWVCLYRUEFBMGU-UHFFFAOYSA-N 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims abstract description 229
- 230000000202 analgesic effect Effects 0.000 claims abstract description 21
- 150000003839 salts Chemical class 0.000 claims abstract description 12
- 239000000730 antalgic agent Substances 0.000 claims abstract description 5
- -1 nitro, hydroxy Chemical group 0.000 claims description 68
- 125000000217 alkyl group Chemical group 0.000 claims description 52
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 37
- 125000003545 alkoxy group Chemical group 0.000 claims description 29
- 125000001424 substituent group Chemical group 0.000 claims description 22
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 20
- 229910052757 nitrogen Inorganic materials 0.000 claims description 19
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 17
- 229910052736 halogen Inorganic materials 0.000 claims description 15
- 150000002367 halogens Chemical class 0.000 claims description 15
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 14
- 125000002993 cycloalkylene group Chemical group 0.000 claims description 14
- 125000005117 dialkylcarbamoyl group Chemical group 0.000 claims description 14
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 13
- 125000005678 ethenylene group Chemical group [H]C([*:1])=C([H])[*:2] 0.000 claims description 12
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 12
- 125000002947 alkylene group Chemical group 0.000 claims description 11
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 11
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 10
- 239000004480 active ingredient Substances 0.000 claims description 9
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 9
- 125000001931 aliphatic group Chemical group 0.000 claims description 7
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 7
- 125000005842 heteroatom Chemical group 0.000 claims description 7
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 7
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 claims description 6
- 230000015572 biosynthetic process Effects 0.000 claims description 6
- 239000008194 pharmaceutical composition Substances 0.000 claims description 6
- 125000005650 substituted phenylene group Chemical group 0.000 claims description 6
- 229910052717 sulfur Inorganic materials 0.000 claims description 6
- 125000006294 amino alkylene group Chemical group 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 229910052760 oxygen Inorganic materials 0.000 claims description 5
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 claims description 5
- 229920006395 saturated elastomer Polymers 0.000 claims description 5
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 4
- 125000005677 ethinylene group Chemical group [*:2]C#C[*:1] 0.000 claims description 4
- 125000002950 monocyclic group Chemical group 0.000 claims description 4
- 239000001301 oxygen Substances 0.000 claims description 4
- 125000000547 substituted alkyl group Chemical group 0.000 claims description 4
- 239000011593 sulfur Substances 0.000 claims description 4
- PAFZNILMFXTMIY-UHFFFAOYSA-N Cyclohexylamine Natural products NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 claims description 3
- 125000002795 guanidino group Chemical group C(N)(=N)N* 0.000 claims description 3
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 claims description 2
- 125000004656 alkyl sulfonylamino group Chemical group 0.000 claims description 2
- RWMMBMNJAIPOKT-UHFFFAOYSA-N 2-phenylethanamine trihydrochloride Chemical compound Cl.Cl.Cl.C1(=CC=CC=C1)CCN RWMMBMNJAIPOKT-UHFFFAOYSA-N 0.000 claims 1
- FZSCIKWCCZBNPP-UHFFFAOYSA-N CC1C(CCCC1)NC1=NC(=NC2=CC=C(C=C12)OC)C=CC1=NC=CC=C1.Cl.Cl.Cl Chemical compound CC1C(CCCC1)NC1=NC(=NC2=CC=C(C=C12)OC)C=CC1=NC=CC=C1.Cl.Cl.Cl FZSCIKWCCZBNPP-UHFFFAOYSA-N 0.000 claims 1
- 208000002193 Pain Diseases 0.000 abstract description 14
- 239000000126 substance Substances 0.000 abstract description 12
- 239000003814 drug Substances 0.000 abstract description 6
- 230000000694 effects Effects 0.000 abstract description 6
- 239000003795 chemical substances by application Substances 0.000 abstract description 4
- 230000007721 medicinal effect Effects 0.000 abstract 1
- 210000000929 nociceptor Anatomy 0.000 abstract 1
- 108091008700 nociceptors Proteins 0.000 abstract 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 150
- 239000000243 solution Substances 0.000 description 129
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 116
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 84
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 78
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 66
- 238000002143 fast-atom bombardment mass spectrum Methods 0.000 description 65
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 60
- 239000002904 solvent Substances 0.000 description 55
- 238000006243 chemical reaction Methods 0.000 description 49
- 239000000843 powder Substances 0.000 description 47
- 238000000921 elemental analysis Methods 0.000 description 44
- 238000000034 method Methods 0.000 description 44
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 42
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 38
- 239000000203 mixture Substances 0.000 description 37
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 36
- 238000010898 silica gel chromatography Methods 0.000 description 35
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 33
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 24
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical compound C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 23
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 22
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 21
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 21
- 238000009835 boiling Methods 0.000 description 20
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 19
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 18
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 18
- 125000006239 protecting group Chemical group 0.000 description 18
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 16
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 16
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 15
- 238000012360 testing method Methods 0.000 description 15
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 14
- 125000000623 heterocyclic group Chemical group 0.000 description 14
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 12
- 239000002585 base Substances 0.000 description 12
- DYHSDKLCOJIUFX-UHFFFAOYSA-N tert-butoxycarbonyl anhydride Chemical compound CC(C)(C)OC(=O)OC(=O)OC(C)(C)C DYHSDKLCOJIUFX-UHFFFAOYSA-N 0.000 description 12
- 125000004432 carbon atom Chemical group C* 0.000 description 11
- 230000003287 optical effect Effects 0.000 description 11
- 238000010992 reflux Methods 0.000 description 11
- 239000003826 tablet Substances 0.000 description 11
- 150000001412 amines Chemical class 0.000 description 10
- 239000013078 crystal Substances 0.000 description 10
- 125000004546 quinazolin-4-yl group Chemical group N1=CN=C(C2=CC=CC=C12)* 0.000 description 10
- 239000000725 suspension Substances 0.000 description 10
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 10
- 238000001816 cooling Methods 0.000 description 9
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 9
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 9
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 8
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 8
- 102100028646 Nociceptin receptor Human genes 0.000 description 8
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 8
- 230000027455 binding Effects 0.000 description 8
- 239000002775 capsule Substances 0.000 description 8
- 150000002170 ethers Chemical class 0.000 description 8
- 239000007788 liquid Substances 0.000 description 8
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 8
- 235000019341 magnesium sulphate Nutrition 0.000 description 8
- 108010020615 nociceptin receptor Proteins 0.000 description 8
- 239000007858 starting material Substances 0.000 description 8
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 8
- 238000010511 deprotection reaction Methods 0.000 description 7
- 238000001035 drying Methods 0.000 description 7
- 238000009472 formulation Methods 0.000 description 7
- 229930195733 hydrocarbon Natural products 0.000 description 7
- 150000002430 hydrocarbons Chemical class 0.000 description 7
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 6
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- 125000003282 alkyl amino group Chemical group 0.000 description 6
- BQJCRHHNABKAKU-KBQPJGBKSA-N morphine Chemical compound O([C@H]1[C@H](C=C[C@H]23)O)C4=C5[C@@]12CCN(C)[C@@H]3CC5=CC=C4O BQJCRHHNABKAKU-KBQPJGBKSA-N 0.000 description 6
- PULGYDLMFSFVBL-SMFNREODSA-N nociceptin Chemical compound C([C@@H](C(=O)N[C@H](C(=O)NCC(=O)N[C@@H](C)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CCC(N)=O)C(O)=O)[C@@H](C)O)NC(=O)CNC(=O)CNC(=O)[C@@H](N)CC=1C=CC=CC=1)C1=CC=CC=C1 PULGYDLMFSFVBL-SMFNREODSA-N 0.000 description 6
- 239000002245 particle Substances 0.000 description 6
- 102400001111 Nociceptin Human genes 0.000 description 5
- 108090000622 Nociceptin Proteins 0.000 description 5
- 239000007864 aqueous solution Substances 0.000 description 5
- 125000002102 aryl alkyloxo group Chemical group 0.000 description 5
- 238000011049 filling Methods 0.000 description 5
- 150000008282 halocarbons Chemical class 0.000 description 5
- 238000002156 mixing Methods 0.000 description 5
- 231100000252 nontoxic Toxicity 0.000 description 5
- 230000003000 nontoxic effect Effects 0.000 description 5
- 239000006188 syrup Substances 0.000 description 5
- 235000020357 syrup Nutrition 0.000 description 5
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 4
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 4
- QKNYBSVHEMOAJP-UHFFFAOYSA-N 2-amino-2-(hydroxymethyl)propane-1,3-diol;hydron;chloride Chemical compound Cl.OCC(N)(CO)CO QKNYBSVHEMOAJP-UHFFFAOYSA-N 0.000 description 4
- KMLUBVZGTQLNRK-DPSPSOFVSA-N 4-chloro-n-[4-[[(1s,2r)-2-(diaminomethylideneamino)cyclohexyl]amino]-6-methoxyquinazolin-2-yl]benzamide;dihydrochloride Chemical compound Cl.Cl.N1=C(N[C@@H]2[C@@H](CCCC2)N=C(N)N)C2=CC(OC)=CC=C2N=C1NC(=O)C1=CC=C(Cl)C=C1 KMLUBVZGTQLNRK-DPSPSOFVSA-N 0.000 description 4
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 239000007983 Tris buffer Substances 0.000 description 4
- 150000001299 aldehydes Chemical class 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- 239000012300 argon atmosphere Substances 0.000 description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 4
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 230000003197 catalytic effect Effects 0.000 description 4
- 229940079593 drug Drugs 0.000 description 4
- MDKXBBPLEGPIRI-UHFFFAOYSA-N ethoxyethane;methanol Chemical compound OC.CCOCC MDKXBBPLEGPIRI-UHFFFAOYSA-N 0.000 description 4
- 239000008187 granular material Substances 0.000 description 4
- 238000000227 grinding Methods 0.000 description 4
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 4
- 230000009871 nonspecific binding Effects 0.000 description 4
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 4
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 4
- XKJCHHZQLQNZHY-UHFFFAOYSA-N phthalimide Chemical compound C1=CC=C2C(=O)NC(=O)C2=C1 XKJCHHZQLQNZHY-UHFFFAOYSA-N 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- 102000005962 receptors Human genes 0.000 description 4
- 108020003175 receptors Proteins 0.000 description 4
- 229910052938 sodium sulfate Inorganic materials 0.000 description 4
- 235000011152 sodium sulphate Nutrition 0.000 description 4
- MFRIHAYPQRLWNB-UHFFFAOYSA-N sodium tert-butoxide Chemical compound [Na+].CC(C)(C)[O-] MFRIHAYPQRLWNB-UHFFFAOYSA-N 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 239000000829 suppository Substances 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 4
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 3
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 3
- DRNGLYHKYPNTEA-UHFFFAOYSA-N 4-azaniumylcyclohexane-1-carboxylate Chemical compound NC1CCC(C(O)=O)CC1 DRNGLYHKYPNTEA-UHFFFAOYSA-N 0.000 description 3
- 208000000094 Chronic Pain Diseases 0.000 description 3
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 3
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 3
- 241000699670 Mus sp. Species 0.000 description 3
- 239000002202 Polyethylene glycol Substances 0.000 description 3
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 3
- 229920002472 Starch Polymers 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 239000003708 ampul Substances 0.000 description 3
- 229910052786 argon Inorganic materials 0.000 description 3
- 239000012267 brine Substances 0.000 description 3
- 239000001768 carboxy methyl cellulose Substances 0.000 description 3
- 239000012320 chlorinating reagent Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000002425 crystallisation Methods 0.000 description 3
- 230000008025 crystallization Effects 0.000 description 3
- LHQRDAIAWDPZGH-UHFFFAOYSA-N cyclohexylhydrazine Chemical compound NNC1CCCCC1 LHQRDAIAWDPZGH-UHFFFAOYSA-N 0.000 description 3
- VLTYOULRIIMFKF-UHFFFAOYSA-N cyclohexylhydrazine;trihydrochloride Chemical compound Cl.Cl.Cl.NNC1CCCCC1 VLTYOULRIIMFKF-UHFFFAOYSA-N 0.000 description 3
- MKRTXPORKIRPDG-UHFFFAOYSA-N diphenylphosphoryl azide Chemical compound C=1C=CC=CC=1P(=O)(N=[N+]=[N-])C1=CC=CC=C1 MKRTXPORKIRPDG-UHFFFAOYSA-N 0.000 description 3
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 239000002552 dosage form Substances 0.000 description 3
- FAMRKDQNMBBFBR-UHFFFAOYSA-N ethyl n-ethoxycarbonyliminocarbamate Chemical group CCOC(=O)N=NC(=O)OCC FAMRKDQNMBBFBR-UHFFFAOYSA-N 0.000 description 3
- 239000000796 flavoring agent Substances 0.000 description 3
- 235000013355 food flavoring agent Nutrition 0.000 description 3
- 238000005469 granulation Methods 0.000 description 3
- 230000003179 granulation Effects 0.000 description 3
- 230000005764 inhibitory process Effects 0.000 description 3
- 238000002347 injection Methods 0.000 description 3
- 239000007924 injection Substances 0.000 description 3
- 239000012280 lithium aluminium hydride Substances 0.000 description 3
- 239000000314 lubricant Substances 0.000 description 3
- 239000012528 membrane Substances 0.000 description 3
- 229960005181 morphine Drugs 0.000 description 3
- AKMUXRHTWYTBRB-UHFFFAOYSA-N n-[(4-aminocyclohexyl)methyl]-2,2,2-trifluoroacetamide Chemical compound NC1CCC(CNC(=O)C(F)(F)F)CC1 AKMUXRHTWYTBRB-UHFFFAOYSA-N 0.000 description 3
- 239000004084 narcotic analgesic agent Substances 0.000 description 3
- 239000012044 organic layer Substances 0.000 description 3
- 229920001223 polyethylene glycol Polymers 0.000 description 3
- 239000003755 preservative agent Substances 0.000 description 3
- 125000004353 pyrazol-1-yl group Chemical group [H]C1=NN(*)C([H])=C1[H] 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 3
- 238000005507 spraying Methods 0.000 description 3
- 235000019698 starch Nutrition 0.000 description 3
- AKVIZYGPJIWKOS-DTWKUNHWSA-N tert-butyl n-[(1r,2s)-2-aminocyclohexyl]carbamate Chemical compound CC(C)(C)OC(=O)N[C@@H]1CCCC[C@@H]1N AKVIZYGPJIWKOS-DTWKUNHWSA-N 0.000 description 3
- AKVIZYGPJIWKOS-BDAKNGLRSA-N tert-butyl n-[(1s,2r)-2-aminocyclohexyl]carbamate Chemical compound CC(C)(C)OC(=O)N[C@H]1CCCC[C@H]1N AKVIZYGPJIWKOS-BDAKNGLRSA-N 0.000 description 3
- VJTFVESJYZUCHP-LOSJGSFVSA-N tert-butyl n-[n'-[(1r,2s)-2-[[2-[(4-chlorobenzoyl)amino]-6-methoxyquinazolin-4-yl]amino]cyclohexyl]-n-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate Chemical compound N1=C(N[C@@H]2[C@@H](CCCC2)NC(NC(=O)OC(C)(C)C)=NC(=O)OC(C)(C)C)C2=CC(OC)=CC=C2N=C1NC(=O)C1=CC=C(Cl)C=C1 VJTFVESJYZUCHP-LOSJGSFVSA-N 0.000 description 3
- 239000001993 wax Substances 0.000 description 3
- MIOPJNTWMNEORI-GMSGAONNSA-N (S)-camphorsulfonic acid Chemical compound C1C[C@@]2(CS(O)(=O)=O)C(=O)C[C@@H]1C2(C)C MIOPJNTWMNEORI-GMSGAONNSA-N 0.000 description 2
- RVNUEBBCFRLWHL-DDZPGPNZSA-N 2-[(1r,2s)-2-[[2-[2-(4-chlorophenyl)ethenyl]-6-methoxyquinazolin-4-yl]amino]cyclohexyl]guanidine;dihydrochloride Chemical compound Cl.Cl.N1=C(N[C@@H]2[C@@H](CCCC2)N=C(N)N)C2=CC(OC)=CC=C2N=C1C=CC1=CC=C(Cl)C=C1 RVNUEBBCFRLWHL-DDZPGPNZSA-N 0.000 description 2
- KDSNLYIMUZNERS-UHFFFAOYSA-N 2-methylpropanamine Chemical compound CC(C)CN KDSNLYIMUZNERS-UHFFFAOYSA-N 0.000 description 2
- KMLUBVZGTQLNRK-QNCHGCKQSA-N 4-chloro-n-[4-[[(1r,2s)-2-(diaminomethylideneamino)cyclohexyl]amino]-6-methoxyquinazolin-2-yl]benzamide;dihydrochloride Chemical compound Cl.Cl.N1=C(N[C@H]2[C@H](CCCC2)N=C(N)N)C2=CC(OC)=CC=C2N=C1NC(=O)C1=CC=C(Cl)C=C1 KMLUBVZGTQLNRK-QNCHGCKQSA-N 0.000 description 2
- RKIDDEGICSMIJA-UHFFFAOYSA-N 4-chlorobenzoyl chloride Chemical compound ClC(=O)C1=CC=C(Cl)C=C1 RKIDDEGICSMIJA-UHFFFAOYSA-N 0.000 description 2
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- 208000000044 Amnesia Diseases 0.000 description 2
- 208000031091 Amnestic disease Diseases 0.000 description 2
- 208000019901 Anxiety disease Diseases 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 2
- 229920002261 Corn starch Polymers 0.000 description 2
- 229920002785 Croscarmellose sodium Polymers 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 2
- 239000005977 Ethylene Substances 0.000 description 2
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- 108010010803 Gelatin Proteins 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- 229920002153 Hydroxypropyl cellulose Polymers 0.000 description 2
- 208000004454 Hyperalgesia Diseases 0.000 description 2
- 102000018697 Membrane Proteins Human genes 0.000 description 2
- 108010052285 Membrane Proteins Proteins 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- 241000699666 Mus <mouse, genus> Species 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical compound CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 description 2
- LFTLOKWAGJYHHR-UHFFFAOYSA-N N-methylmorpholine N-oxide Chemical compound CN1(=O)CCOCC1 LFTLOKWAGJYHHR-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 2
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 2
- OIJXLIIMXHRJJH-ZXJLXYCOSA-N [3h]diprenorphine Chemical compound N1([C@@H]2CC=3C4=C(C(=CC=3)O)O[C@@H]3[C@]4([C@]22C[C@@H]([C@]3(OC)CC2)C(C)(C)O)C([3H])C1[3H])CC1CC1 OIJXLIIMXHRJJH-ZXJLXYCOSA-N 0.000 description 2
- YIMQCDZDWXUDCA-UHFFFAOYSA-N [4-(hydroxymethyl)cyclohexyl]methanol Chemical compound OCC1CCC(CO)CC1 YIMQCDZDWXUDCA-UHFFFAOYSA-N 0.000 description 2
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 2
- 206010053552 allodynia Diseases 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 230000006986 amnesia Effects 0.000 description 2
- 239000012491 analyte Substances 0.000 description 2
- 230000036506 anxiety Effects 0.000 description 2
- MUALRAIOVNYAIW-UHFFFAOYSA-N binap Chemical group C1=CC=CC=C1P(C=1C(=C2C=CC=CC2=CC=1)C=1C2=CC=CC=C2C=CC=1P(C=1C=CC=CC=1)C=1C=CC=CC=1)C1=CC=CC=C1 MUALRAIOVNYAIW-UHFFFAOYSA-N 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical compound [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 2
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 2
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 2
- 210000004027 cell Anatomy 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 230000002920 convulsive effect Effects 0.000 description 2
- 239000008120 corn starch Substances 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- LNGAGQAGYITKCW-UHFFFAOYSA-N dimethyl cyclohexane-1,4-dicarboxylate Chemical compound COC(=O)C1CCC(C(=O)OC)CC1 LNGAGQAGYITKCW-UHFFFAOYSA-N 0.000 description 2
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 2
- 208000035475 disorder Diseases 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- DEFVIWRASFVYLL-UHFFFAOYSA-N ethylene glycol bis(2-aminoethyl)tetraacetic acid Chemical compound OC(=O)CN(CC(O)=O)CCOCCOCCN(CC(O)=O)CC(O)=O DEFVIWRASFVYLL-UHFFFAOYSA-N 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 239000008273 gelatin Substances 0.000 description 2
- 229920000159 gelatin Polymers 0.000 description 2
- 235000019322 gelatine Nutrition 0.000 description 2
- 235000011852 gelatine desserts Nutrition 0.000 description 2
- ZRALSGWEFCBTJO-UHFFFAOYSA-N guanidine group Chemical group NC(=N)N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 description 2
- 210000005260 human cell Anatomy 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- 239000001863 hydroxypropyl cellulose Substances 0.000 description 2
- 235000010977 hydroxypropyl cellulose Nutrition 0.000 description 2
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 description 2
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 2
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 description 2
- UFVKGYZPFZQRLF-UHFFFAOYSA-N hydroxypropyl methyl cellulose Chemical compound OC1C(O)C(OC)OC(CO)C1OC1C(O)C(O)C(OC2C(C(O)C(OC3C(C(O)C(O)C(CO)O3)O)C(CO)O2)O)C(CO)O1 UFVKGYZPFZQRLF-UHFFFAOYSA-N 0.000 description 2
- CGIGDMFJXJATDK-UHFFFAOYSA-N indomethacin Chemical compound CC1=C(CC(O)=O)C2=CC(OC)=CC=C2N1C(=O)C1=CC=C(Cl)C=C1 CGIGDMFJXJATDK-UHFFFAOYSA-N 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- 238000001990 intravenous administration Methods 0.000 description 2
- 238000010253 intravenous injection Methods 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 229940031703 low substituted hydroxypropyl cellulose Drugs 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- 235000010355 mannitol Nutrition 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- RKOQMDUDKCMVFW-UHFFFAOYSA-N methyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylate Chemical compound COC(=O)C1CCC(NC(=O)OC(C)(C)C)CC1 RKOQMDUDKCMVFW-UHFFFAOYSA-N 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 102000051367 mu Opioid Receptors Human genes 0.000 description 2
- UZHSEJADLWPNLE-GRGSLBFTSA-N naloxone Chemical compound O=C([C@@H]1O2)CC[C@@]3(O)[C@H]4CC5=CC=C(O)C2=C5[C@@]13CCN4CC=C UZHSEJADLWPNLE-GRGSLBFTSA-N 0.000 description 2
- 229960004127 naloxone Drugs 0.000 description 2
- 230000008533 pain sensitivity Effects 0.000 description 2
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 2
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 230000002335 preservative effect Effects 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 238000001525 receptor binding assay Methods 0.000 description 2
- JPJALAQPGMAKDF-UHFFFAOYSA-N selenium dioxide Chemical compound O=[Se]=O JPJALAQPGMAKDF-UHFFFAOYSA-N 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- 230000009870 specific binding Effects 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 235000000346 sugar Nutrition 0.000 description 2
- 208000024891 symptom Diseases 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- 235000012222 talc Nutrition 0.000 description 2
- 239000011975 tartaric acid Substances 0.000 description 2
- 235000002906 tartaric acid Nutrition 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- LGQYRVQKKHRMNB-UHFFFAOYSA-N tert-butyl n-(6-aminoheptyl)carbamate Chemical compound CC(N)CCCCCNC(=O)OC(C)(C)C LGQYRVQKKHRMNB-UHFFFAOYSA-N 0.000 description 2
- FJMAIZKRMSRGHG-UHFFFAOYSA-N tert-butyl n-(6-hydroxyheptyl)carbamate Chemical compound CC(O)CCCCCNC(=O)OC(C)(C)C FJMAIZKRMSRGHG-UHFFFAOYSA-N 0.000 description 2
- VLXBTPVTHZTXBN-UHFFFAOYSA-N tert-butyl n-(6-oxohexyl)carbamate Chemical compound CC(C)(C)OC(=O)NCCCCCC=O VLXBTPVTHZTXBN-UHFFFAOYSA-N 0.000 description 2
- XVROWZPERFUOCE-RKDXNWHRSA-N tert-butyl n-[(1r,2r)-2-hydroxycyclohexyl]carbamate Chemical compound CC(C)(C)OC(=O)N[C@@H]1CCCC[C@H]1O XVROWZPERFUOCE-RKDXNWHRSA-N 0.000 description 2
- MOYILOWCZPYTQW-HZPDHXFCSA-N tert-butyl n-[(1r,2r)-2-phenylmethoxycyclohexyl]carbamate Chemical compound CC(C)(C)OC(=O)N[C@@H]1CCCC[C@H]1OCC1=CC=CC=C1 MOYILOWCZPYTQW-HZPDHXFCSA-N 0.000 description 2
- NPFQKJGOPNBNCU-JKSUJKDBSA-N tert-butyl n-[(1r,2s)-2-[(2-chloro-6-methoxyquinazolin-4-yl)amino]cyclohexyl]carbamate Chemical compound C12=CC(OC)=CC=C2N=C(Cl)N=C1N[C@H]1CCCC[C@H]1NC(=O)OC(C)(C)C NPFQKJGOPNBNCU-JKSUJKDBSA-N 0.000 description 2
- VWOVVZWSGCHNCI-BJKOFHAPSA-N tert-butyl n-[(1r,2s)-2-[[6-methoxy-2-[(4-methoxyphenyl)methylamino]quinazolin-4-yl]amino]cyclohexyl]carbamate Chemical compound C1=CC(OC)=CC=C1CNC1=NC(N[C@@H]2[C@@H](CCCC2)NC(=O)OC(C)(C)C)=C(C=C(OC)C=C2)C2=N1 VWOVVZWSGCHNCI-BJKOFHAPSA-N 0.000 description 2
- SGNKPJPMWHKOJO-UHFFFAOYSA-N tert-butyl n-[4-(hydroxymethyl)cyclohexyl]carbamate Chemical compound CC(C)(C)OC(=O)NC1CCC(CO)CC1 SGNKPJPMWHKOJO-UHFFFAOYSA-N 0.000 description 2
- ZYSURDPTHWVESU-RBUKOAKNSA-N tert-butyl n-[n'-[(1r,2s)-2-[(2-amino-6-methoxyquinazolin-4-yl)amino]cyclohexyl]-n-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate Chemical compound C12=CC(OC)=CC=C2N=C(N)N=C1N[C@H]1CCCC[C@H]1NC(NC(=O)OC(C)(C)C)=NC(=O)OC(C)(C)C ZYSURDPTHWVESU-RBUKOAKNSA-N 0.000 description 2
- ZIJNPPYJZDDOJX-RRPNLBNLSA-N tert-butyl n-[n'-[(1r,2s)-2-[[6-methoxy-2-[(4-methoxyphenyl)methylamino]quinazolin-4-yl]amino]cyclohexyl]-n-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate Chemical compound C1=CC(OC)=CC=C1CNC1=NC(N[C@@H]2[C@@H](CCCC2)NC(NC(=O)OC(C)(C)C)=NC(=O)OC(C)(C)C)=C(C=C(OC)C=C2)C2=N1 ZIJNPPYJZDDOJX-RRPNLBNLSA-N 0.000 description 2
- OSBSFAARYOCBHB-UHFFFAOYSA-N tetrapropylammonium Chemical compound CCC[N+](CCC)(CCC)CCC OSBSFAARYOCBHB-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 238000010792 warming Methods 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- 239000008215 water for injection Substances 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- 108020001612 μ-opioid receptors Proteins 0.000 description 2
- AKVIZYGPJIWKOS-RKDXNWHRSA-N (1R,2R)-trans-N-Boc-1,2-cyclohexanediamine Chemical compound CC(C)(C)OC(=O)N[C@@H]1CCCC[C@H]1N AKVIZYGPJIWKOS-RKDXNWHRSA-N 0.000 description 1
- NTHNRYLIXJZHRZ-CHWSQXEVSA-N (1r,2r)-2-phenylmethoxycyclohexan-1-amine Chemical compound N[C@@H]1CCCC[C@H]1OCC1=CC=CC=C1 NTHNRYLIXJZHRZ-CHWSQXEVSA-N 0.000 description 1
- QBYIENPQHBMVBV-HFEGYEGKSA-N (2R)-2-hydroxy-2-phenylacetic acid Chemical compound O[C@@H](C(O)=O)c1ccccc1.O[C@@H](C(O)=O)c1ccccc1 QBYIENPQHBMVBV-HFEGYEGKSA-N 0.000 description 1
- USVVENVKYJZFMW-ONEGZZNKSA-N (e)-carboxyiminocarbamic acid Chemical compound OC(=O)\N=N\C(O)=O USVVENVKYJZFMW-ONEGZZNKSA-N 0.000 description 1
- PXGZQGDTEZPERC-UHFFFAOYSA-N 1,4-cyclohexanedicarboxylic acid Chemical compound OC(=O)C1CCC(C(O)=O)CC1 PXGZQGDTEZPERC-UHFFFAOYSA-N 0.000 description 1
- FQUYSHZXSKYCSY-UHFFFAOYSA-N 1,4-diazepane Chemical compound C1CNCCNC1 FQUYSHZXSKYCSY-UHFFFAOYSA-N 0.000 description 1
- IDPURXSQCKYKIJ-UHFFFAOYSA-N 1-(4-methoxyphenyl)methanamine Chemical compound COC1=CC=C(CN)C=C1 IDPURXSQCKYKIJ-UHFFFAOYSA-N 0.000 description 1
- PFMLKZTUFFFJOS-YUMKVYMKSA-N 1-amino-1-[(1R,2S)-2-[6-methoxy-2-[(Z)-2-pyridin-3-ylethenyl]quinazolin-4-yl]cyclohexyl]guanidine trihydrochloride Chemical compound Cl.Cl.Cl.N1=C([C@@H]2[C@@H](CCCC2)N(N)C(N)=N)C2=CC(OC)=CC=C2N=C1\C=C/C1=CC=CN=C1 PFMLKZTUFFFJOS-YUMKVYMKSA-N 0.000 description 1
- WSHZXAKBZYJLTH-UHFFFAOYSA-N 1-hexyl-3-phenylthiourea Chemical compound CCCCCCNC(=S)NC1=CC=CC=C1 WSHZXAKBZYJLTH-UHFFFAOYSA-N 0.000 description 1
- WEAMQTSRMCCGSJ-UHFFFAOYSA-N 2,4-dichloro-6-methoxyquinazoline Chemical compound N1=C(Cl)N=C(Cl)C2=CC(OC)=CC=C21 WEAMQTSRMCCGSJ-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- MPRLNCSLKHFNKV-UHFFFAOYSA-N 2-[2-(4-chlorophenyl)ethenyl]-4-(4-pyrimidin-2-ylpiperazin-1-yl)quinazoline;dihydrochloride Chemical compound Cl.Cl.C1=CC(Cl)=CC=C1C=CC1=NC(N2CCN(CC2)C=2N=CC=CN=2)=C(C=CC=C2)C2=N1 MPRLNCSLKHFNKV-UHFFFAOYSA-N 0.000 description 1
- BRKKWQXIUNXPNE-UHFFFAOYSA-N 2-[2-[3-[[6-methyl-2-(2-pyridin-2-ylethenyl)quinazolin-4-yl]amino]propoxy]ethyl]guanidine;trihydrochloride Chemical compound Cl.Cl.Cl.N1=C(NCCCOCCN=C(N)N)C2=CC(C)=CC=C2N=C1C=CC1=CC=CC=N1 BRKKWQXIUNXPNE-UHFFFAOYSA-N 0.000 description 1
- KMGUEILFFWDGFV-UHFFFAOYSA-N 2-benzoyl-2-benzoyloxy-3-hydroxybutanedioic acid Chemical compound C=1C=CC=CC=1C(=O)C(C(C(O)=O)O)(C(O)=O)OC(=O)C1=CC=CC=C1 KMGUEILFFWDGFV-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- VDFALRUKZDXJCN-UHFFFAOYSA-N 4-chloro-2-[2-(4-chlorophenyl)ethenyl]-6-methoxyquinazoline Chemical compound N1=C(Cl)C2=CC(OC)=CC=C2N=C1C=CC1=CC=C(Cl)C=C1 VDFALRUKZDXJCN-UHFFFAOYSA-N 0.000 description 1
- POGDZKKREAOPSA-UHFFFAOYSA-N 4-chloro-6-methoxy-2-(2-pyridin-2-ylethenyl)quinazoline Chemical compound N1=C(Cl)C2=CC(OC)=CC=C2N=C1C=CC1=CC=CC=N1 POGDZKKREAOPSA-UHFFFAOYSA-N 0.000 description 1
- 125000004217 4-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C([H])([H])* 0.000 description 1
- LOMPNXDREJPCDV-UHFFFAOYSA-N 4-n-[2-[2-(4-chlorophenyl)ethenyl]-6-methylquinazolin-4-yl]cyclohexane-1,4-diamine Chemical compound N1=C(NC2CCC(N)CC2)C2=CC(C)=CC=C2N=C1C=CC1=CC=C(Cl)C=C1 LOMPNXDREJPCDV-UHFFFAOYSA-N 0.000 description 1
- SUTWPJHCRAITLU-UHFFFAOYSA-N 6-aminohexan-1-ol Chemical compound NCCCCCCO SUTWPJHCRAITLU-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 206010000060 Abdominal distension Diseases 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 208000024827 Alzheimer disease Diseases 0.000 description 1
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- NYXOBVVHJZENCO-XYPYZODXSA-N CC(C)(C)OC(=O)NC[C@H]1CC[C@H](CN)CC1 Chemical compound CC(C)(C)OC(=O)NC[C@H]1CC[C@H](CN)CC1 NYXOBVVHJZENCO-XYPYZODXSA-N 0.000 description 1
- JXRBVNNNVAFQDN-HDJSIYSDSA-N CC(C)(C)OC(=O)NC[C@H]1CC[C@H](CNC(=O)OC(C)(C)C)CC1 Chemical compound CC(C)(C)OC(=O)NC[C@H]1CC[C@H](CNC(=O)OC(C)(C)C)CC1 JXRBVNNNVAFQDN-HDJSIYSDSA-N 0.000 description 1
- FEYLUKDSKVSMSZ-KYZUINATSA-N CC(C)(C)OC(=O)N[C@H]1CC[C@H](N)CC1 Chemical compound CC(C)(C)OC(=O)N[C@H]1CC[C@H](N)CC1 FEYLUKDSKVSMSZ-KYZUINATSA-N 0.000 description 1
- 0 CN(*)C(N(*)*)=N*=C=C Chemical compound CN(*)C(N(*)*)=N*=C=C 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- OFUMUDFMOABSEG-FFUVTKDNSA-N Cl.Cl.C(N)(=N)N([C@@H]1C[C@H](CCC1)C1=NC(=NC2=CC=C(C=C12)C)C=CC1=CC=C(C=C1)Cl)N Chemical compound Cl.Cl.C(N)(=N)N([C@@H]1C[C@H](CCC1)C1=NC(=NC2=CC=C(C=C12)C)C=CC1=CC=C(C=C1)Cl)N OFUMUDFMOABSEG-FFUVTKDNSA-N 0.000 description 1
- FQLRUWOJBKFIDE-KJHBKDRRSA-N Cl.Cl.C(N)(=N)N([C@@H]1[C@@H](CCC1)C1=NC(=NC2=CC=C(C=C12)OC)C=CC1=CC=C(C=C1)Cl)N Chemical compound Cl.Cl.C(N)(=N)N([C@@H]1[C@@H](CCC1)C1=NC(=NC2=CC=C(C=C12)OC)C=CC1=CC=C(C=C1)Cl)N FQLRUWOJBKFIDE-KJHBKDRRSA-N 0.000 description 1
- BMOUDERNHQPQLD-UITHODHBSA-N Cl.Cl.C(N)(=N)N([C@@H]1[C@@H](CCCC1)C1=NC(=NC2=CC=C(C=C12)C)C=CC1=CC=C(C=C1)Cl)N Chemical compound Cl.Cl.C(N)(=N)N([C@@H]1[C@@H](CCCC1)C1=NC(=NC2=CC=C(C=C12)C)C=CC1=CC=C(C=C1)Cl)N BMOUDERNHQPQLD-UITHODHBSA-N 0.000 description 1
- DIBOJBBQVFISEU-UITHODHBSA-N Cl.Cl.C(N)(=N)N([C@@H]1[C@@H](CCCC1)C1=NC(=NC2=CC=C(C=C12)OC)C=CC1=CC=C(C=C1)Cl)N Chemical compound Cl.Cl.C(N)(=N)N([C@@H]1[C@@H](CCCC1)C1=NC(=NC2=CC=C(C=C12)OC)C=CC1=CC=C(C=C1)Cl)N DIBOJBBQVFISEU-UITHODHBSA-N 0.000 description 1
- FQLRUWOJBKFIDE-RHXOVYDGSA-N Cl.Cl.C(N)(=N)N([C@H]1[C@H](CCC1)C1=NC(=NC2=CC=C(C=C12)OC)C=CC1=CC=C(C=C1)Cl)N Chemical compound Cl.Cl.C(N)(=N)N([C@H]1[C@H](CCC1)C1=NC(=NC2=CC=C(C=C12)OC)C=CC1=CC=C(C=C1)Cl)N FQLRUWOJBKFIDE-RHXOVYDGSA-N 0.000 description 1
- BMOUDERNHQPQLD-GQYJSNKSSA-N Cl.Cl.C(N)(=N)N([C@H]1[C@H](CCCC1)C1=NC(=NC2=CC=C(C=C12)C)C=CC1=CC=C(C=C1)Cl)N Chemical compound Cl.Cl.C(N)(=N)N([C@H]1[C@H](CCCC1)C1=NC(=NC2=CC=C(C=C12)C)C=CC1=CC=C(C=C1)Cl)N BMOUDERNHQPQLD-GQYJSNKSSA-N 0.000 description 1
- DIBOJBBQVFISEU-GQYJSNKSSA-N Cl.Cl.C(N)(=N)N([C@H]1[C@H](CCCC1)C1=NC(=NC2=CC=C(C=C12)OC)C=CC1=CC=C(C=C1)Cl)N Chemical compound Cl.Cl.C(N)(=N)N([C@H]1[C@H](CCCC1)C1=NC(=NC2=CC=C(C=C12)OC)C=CC1=CC=C(C=C1)Cl)N DIBOJBBQVFISEU-GQYJSNKSSA-N 0.000 description 1
- HFFWDNNRTUNTNN-UHFFFAOYSA-N Cl.Cl.Cl.C(N)(=N)N(CC(C1=NC(=NC2=CC=C(C=C12)OC)C=CC1=NC=CC=C1)C1=CC=CC=C1)CCN Chemical compound Cl.Cl.Cl.C(N)(=N)N(CC(C1=NC(=NC2=CC=C(C=C12)OC)C=CC1=NC=CC=C1)C1=CC=CC=C1)CCN HFFWDNNRTUNTNN-UHFFFAOYSA-N 0.000 description 1
- GALPDISVRIVGGE-LTVKSBECSA-N Cl.Cl.Cl.C(N)(=N)N([C@@H]1[C@@H](CCCC1)C1=NC(=NC2=CC=C(C=C12)OC)\C=C/C1=NC=CC=C1)N Chemical compound Cl.Cl.Cl.C(N)(=N)N([C@@H]1[C@@H](CCCC1)C1=NC(=NC2=CC=C(C=C12)OC)\C=C/C1=NC=CC=C1)N GALPDISVRIVGGE-LTVKSBECSA-N 0.000 description 1
- GALPDISVRIVGGE-OHXDRLKFSA-N Cl.Cl.Cl.C(N)(=N)N([C@H]1[C@H](CCCC1)C1=NC(=NC2=CC=C(C=C12)OC)\C=C/C1=NC=CC=C1)N Chemical compound Cl.Cl.Cl.C(N)(=N)N([C@H]1[C@H](CCCC1)C1=NC(=NC2=CC=C(C=C12)OC)\C=C/C1=NC=CC=C1)N GALPDISVRIVGGE-OHXDRLKFSA-N 0.000 description 1
- JJNYRELAHOEJDY-UHFFFAOYSA-N Cl.Cl.Cl.N(C(=N)N)C(CON(C1=NC(=NC2=CC=C(C=C12)C)C=CC1=NC=CC=C1)CC)C Chemical compound Cl.Cl.Cl.N(C(=N)N)C(CON(C1=NC(=NC2=CC=C(C=C12)C)C=CC1=NC=CC=C1)CC)C JJNYRELAHOEJDY-UHFFFAOYSA-N 0.000 description 1
- UUTWXIJQZHKIHB-UHFFFAOYSA-N Cl.Cl.Cl.N(C(=N)N)CCON(C1=NC(=NC2=CC=C(C=C12)C)C=CC1=NC=CC=C1)CC Chemical compound Cl.Cl.Cl.N(C(=N)N)CCON(C1=NC(=NC2=CC=C(C=C12)C)C=CC1=NC=CC=C1)CC UUTWXIJQZHKIHB-UHFFFAOYSA-N 0.000 description 1
- 206010010904 Convulsion Diseases 0.000 description 1
- 206010012289 Dementia Diseases 0.000 description 1
- 208000030814 Eating disease Diseases 0.000 description 1
- 208000019454 Feeding and Eating disease Diseases 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- WZELXJBMMZFDDU-UHFFFAOYSA-N Imidazol-2-one Chemical class O=C1N=CC=N1 WZELXJBMMZFDDU-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- 208000019695 Migraine disease Diseases 0.000 description 1
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 1
- 102000003797 Neuropeptides Human genes 0.000 description 1
- 108090000189 Neuropeptides Proteins 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 208000008589 Obesity Diseases 0.000 description 1
- BHHGXPLMPWCGHP-UHFFFAOYSA-N Phenethylamine Chemical compound NCCC1=CC=CC=C1 BHHGXPLMPWCGHP-UHFFFAOYSA-N 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 1
- IWYDHOAUDWTVEP-UHFFFAOYSA-N R-2-phenyl-2-hydroxyacetic acid Natural products OC(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-N 0.000 description 1
- 229920001800 Shellac Polymers 0.000 description 1
- 208000005392 Spasm Diseases 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- 238000000692 Student's t-test Methods 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- STSCVKRWJPWALQ-UHFFFAOYSA-N TRIFLUOROACETIC ACID ETHYL ESTER Chemical compound CCOC(=O)C(F)(F)F STSCVKRWJPWALQ-UHFFFAOYSA-N 0.000 description 1
- 210000000683 abdominal cavity Anatomy 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- VJHCJDRQFCCTHL-UHFFFAOYSA-N acetic acid 2,3,4,5,6-pentahydroxyhexanal Chemical compound CC(O)=O.OCC(O)C(O)C(O)C(O)C=O VJHCJDRQFCCTHL-UHFFFAOYSA-N 0.000 description 1
- 229960001138 acetylsalicylic acid Drugs 0.000 description 1
- 230000001154 acute effect Effects 0.000 description 1
- 208000005298 acute pain Diseases 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 239000003463 adsorbent Substances 0.000 description 1
- 239000000556 agonist Substances 0.000 description 1
- 230000001270 agonistic effect Effects 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 125000004419 alkynylene group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 238000011938 amidation process Methods 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 230000003444 anaesthetic effect Effects 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 230000003042 antagnostic effect Effects 0.000 description 1
- 239000005557 antagonist Substances 0.000 description 1
- 230000001430 anti-depressive effect Effects 0.000 description 1
- 229940121363 anti-inflammatory agent Drugs 0.000 description 1
- 239000002260 anti-inflammatory agent Substances 0.000 description 1
- 239000000883 anti-obesity agent Substances 0.000 description 1
- 229940125682 antidementia agent Drugs 0.000 description 1
- 239000000935 antidepressant agent Substances 0.000 description 1
- 229940005513 antidepressants Drugs 0.000 description 1
- 239000002220 antihypertensive agent Substances 0.000 description 1
- 229940030600 antihypertensive agent Drugs 0.000 description 1
- 229940125710 antiobesity agent Drugs 0.000 description 1
- 230000037007 arousal Effects 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- 235000012216 bentonite Nutrition 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- WARCRYXKINZHGQ-UHFFFAOYSA-N benzohydrazide Chemical compound NNC(=O)C1=CC=CC=C1 WARCRYXKINZHGQ-UHFFFAOYSA-N 0.000 description 1
- KGNDCEVUMONOKF-UGPLYTSKSA-N benzyl n-[(2r)-1-[(2s,4r)-2-[[(2s)-6-amino-1-(1,3-benzoxazol-2-yl)-1,1-dihydroxyhexan-2-yl]carbamoyl]-4-[(4-methylphenyl)methoxy]pyrrolidin-1-yl]-1-oxo-4-phenylbutan-2-yl]carbamate Chemical compound C1=CC(C)=CC=C1CO[C@H]1CN(C(=O)[C@@H](CCC=2C=CC=CC=2)NC(=O)OCC=2C=CC=CC=2)[C@H](C(=O)N[C@@H](CCCCN)C(O)(O)C=2OC3=CC=CC=C3N=2)C1 KGNDCEVUMONOKF-UGPLYTSKSA-N 0.000 description 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 230000036772 blood pressure Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- JUNWLZAGQLJVLR-UHFFFAOYSA-J calcium diphosphate Chemical compound [Ca+2].[Ca+2].[O-]P([O-])(=O)OP([O-])([O-])=O JUNWLZAGQLJVLR-UHFFFAOYSA-J 0.000 description 1
- 239000008116 calcium stearate Substances 0.000 description 1
- 235000013539 calcium stearate Nutrition 0.000 description 1
- 235000014633 carbohydrates Nutrition 0.000 description 1
- 229940105329 carboxymethylcellulose Drugs 0.000 description 1
- 239000004359 castor oil Substances 0.000 description 1
- 235000019438 castor oil Nutrition 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 210000000170 cell membrane Anatomy 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 229940110456 cocoa butter Drugs 0.000 description 1
- 235000019868 cocoa butter Nutrition 0.000 description 1
- 229940075614 colloidal silicon dioxide Drugs 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 229940125833 compound 23 Drugs 0.000 description 1
- 229960005168 croscarmellose Drugs 0.000 description 1
- 229960001681 croscarmellose sodium Drugs 0.000 description 1
- 239000001767 crosslinked sodium carboxy methyl cellulose Substances 0.000 description 1
- 235000010947 crosslinked sodium carboxy methyl cellulose Nutrition 0.000 description 1
- 125000004976 cyclobutylene group Chemical group 0.000 description 1
- 125000004977 cycloheptylene group Chemical group 0.000 description 1
- 125000005725 cyclohexenylene group Chemical group 0.000 description 1
- 125000004956 cyclohexylene group Chemical group 0.000 description 1
- OASMNUIVJWKRRP-UHFFFAOYSA-N cyclohexylhydrazine;dihydrochloride Chemical compound Cl.Cl.NNC1CCCCC1 OASMNUIVJWKRRP-UHFFFAOYSA-N 0.000 description 1
- 125000004978 cyclooctylene group Chemical group 0.000 description 1
- 125000004979 cyclopentylene group Chemical group 0.000 description 1
- 125000004980 cyclopropylene group Chemical group 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 235000019821 dicalcium diphosphate Nutrition 0.000 description 1
- 229910000393 dicalcium diphosphate Inorganic materials 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- 235000014632 disordered eating Nutrition 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000002934 diuretic Substances 0.000 description 1
- 230000001882 diuretic effect Effects 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 239000006196 drop Substances 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 206010015037 epilepsy Diseases 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- BKBKGEHZTOGPIC-UHFFFAOYSA-N ethyl 4-chloro-6-methoxyquinazoline-2-carboxylate Chemical compound C1=C(OC)C=CC2=NC(C(=O)OCC)=NC(Cl)=C21 BKBKGEHZTOGPIC-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000010265 fast atom bombardment Methods 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 235000011087 fumaric acid Nutrition 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 239000003292 glue Substances 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 229960000905 indomethacin Drugs 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000007913 intrathecal administration Methods 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 230000001788 irregular Effects 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000003446 ligand Substances 0.000 description 1
- 239000008297 liquid dosage form Substances 0.000 description 1
- 239000012669 liquid formulation Substances 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- IMYHGORQCPYVBZ-NLFFAJNJSA-N lofentanil Chemical compound CCC(=O)N([C@@]1([C@@H](CN(CCC=2C=CC=CC=2)CC1)C)C(=O)OC)C1=CC=CC=C1 IMYHGORQCPYVBZ-NLFFAJNJSA-N 0.000 description 1
- 229950010274 lofentanil Drugs 0.000 description 1
- NXPHGHWWQRMDIA-UHFFFAOYSA-M magnesium;carbanide;bromide Chemical compound [CH3-].[Mg+2].[Br-] NXPHGHWWQRMDIA-UHFFFAOYSA-M 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 229960002510 mandelic acid Drugs 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 230000010534 mechanism of action Effects 0.000 description 1
- 239000001525 mentha piperita l. herb oil Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 1
- UCVIJKUSNFFFAY-UHFFFAOYSA-N methyl N'-hexyl-N-phenylcarbamimidothioate Chemical compound C(CCCCC)NC(SC)=NC1=CC=CC=C1 UCVIJKUSNFFFAY-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 125000004092 methylthiomethyl group Chemical group [H]C([H])([H])SC([H])([H])* 0.000 description 1
- 206010027599 migraine Diseases 0.000 description 1
- 238000003801 milling Methods 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- 125000001421 myristyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- RBKGITMPXMSJAX-UHFFFAOYSA-N n'-[2-[2-(4-chlorophenyl)ethenyl]quinazolin-4-yl]ethane-1,2-diamine;dihydrochloride Chemical compound Cl.Cl.N=1C2=CC=CC=C2C(NCCN)=NC=1C=CC1=CC=C(Cl)C=C1 RBKGITMPXMSJAX-UHFFFAOYSA-N 0.000 description 1
- NPPXHUXMBAZDLT-UHFFFAOYSA-N n'-[6-methoxy-2-(2-pyridin-2-ylethenyl)quinazolin-4-yl]hexane-1,6-diamine Chemical compound N1=C(NCCCCCCN)C2=CC(OC)=CC=C2N=C1C=CC1=CC=CC=N1 NPPXHUXMBAZDLT-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000004081 narcotic agent Substances 0.000 description 1
- 208000004296 neuralgia Diseases 0.000 description 1
- 201000001119 neuropathy Diseases 0.000 description 1
- 230000007823 neuropathy Effects 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 239000002762 nociceptin receptor agonist Substances 0.000 description 1
- 239000002764 nociceptin receptor antagonist Substances 0.000 description 1
- 239000002664 nootropic agent Substances 0.000 description 1
- 235000020824 obesity Nutrition 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 235000019198 oils Nutrition 0.000 description 1
- 239000006186 oral dosage form Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- VOKSWYLNZZRQPF-GDIGMMSISA-N pentazocine Chemical compound C1C2=CC=C(O)C=C2[C@@]2(C)[C@@H](C)[C@@H]1N(CC=C(C)C)CC2 VOKSWYLNZZRQPF-GDIGMMSISA-N 0.000 description 1
- 229960005301 pentazocine Drugs 0.000 description 1
- 235000019477 peppermint oil Nutrition 0.000 description 1
- 230000002093 peripheral effect Effects 0.000 description 1
- DGTNSSLYPYDJGL-UHFFFAOYSA-N phenyl isocyanate Chemical compound O=C=NC1=CC=CC=C1 DGTNSSLYPYDJGL-UHFFFAOYSA-N 0.000 description 1
- WVDDGKGOMKODPV-ZQBYOMGUSA-N phenyl(114C)methanol Chemical compound O[14CH2]C1=CC=CC=C1 WVDDGKGOMKODPV-ZQBYOMGUSA-N 0.000 description 1
- 239000002504 physiological saline solution Substances 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 229920000136 polysorbate Polymers 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 235000019422 polyvinyl alcohol Nutrition 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 239000011148 porous material Substances 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 108090000765 processed proteins & peptides Proteins 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 125000006410 propenylene group Chemical group 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 208000020016 psychiatric disease Diseases 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 125000004307 pyrazin-2-yl group Chemical group [H]C1=C([H])N=C(*)C([H])=N1 0.000 description 1
- 125000004944 pyrazin-3-yl group Chemical group [H]C1=C([H])N=C(*)C([H])=N1 0.000 description 1
- 125000002206 pyridazin-3-yl group Chemical group [H]C1=C([H])C([H])=C(*)N=N1 0.000 description 1
- 125000000246 pyrimidin-2-yl group Chemical group [H]C1=NC(*)=NC([H])=C1[H] 0.000 description 1
- 125000004527 pyrimidin-4-yl group Chemical group N1=CN=C(C=C1)* 0.000 description 1
- 125000004528 pyrimidin-5-yl group Chemical group N1=CN=CC(=C1)* 0.000 description 1
- 150000003246 quinazolines Chemical class 0.000 description 1
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 206010039073 rheumatoid arthritis Diseases 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- CVHZOJJKTDOEJC-UHFFFAOYSA-N saccharin Chemical compound C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-N 0.000 description 1
- 229940081974 saccharin Drugs 0.000 description 1
- 235000019204 saccharin Nutrition 0.000 description 1
- 239000000901 saccharin and its Na,K and Ca salt Substances 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 238000007789 sealing Methods 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000004062 sedimentation Methods 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 239000004208 shellac Substances 0.000 description 1
- ZLGIYFNHBLSMPS-ATJNOEHPSA-N shellac Chemical compound OCCCCCC(O)C(O)CCCCCCCC(O)=O.C1C23[C@H](C(O)=O)CCC2[C@](C)(CO)[C@@H]1C(C(O)=O)=C[C@@H]3O ZLGIYFNHBLSMPS-ATJNOEHPSA-N 0.000 description 1
- 229940113147 shellac Drugs 0.000 description 1
- 235000013874 shellac Nutrition 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229940083542 sodium Drugs 0.000 description 1
- 235000015424 sodium Nutrition 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- WRIKHQLVHPKCJU-UHFFFAOYSA-N sodium bis(trimethylsilyl)amide Chemical compound C[Si](C)(C)N([Na])[Si](C)(C)C WRIKHQLVHPKCJU-UHFFFAOYSA-N 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- 239000007901 soft capsule Substances 0.000 description 1
- 239000007909 solid dosage form Substances 0.000 description 1
- 238000000638 solvent extraction Methods 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 230000001954 sterilising effect Effects 0.000 description 1
- 238000004659 sterilization and disinfection Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 210000002330 subarachnoid space Anatomy 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 239000007940 sugar coated tablet Substances 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 230000002459 sustained effect Effects 0.000 description 1
- 238000013268 sustained release Methods 0.000 description 1
- 239000012730 sustained-release form Substances 0.000 description 1
- 238000012353 t test Methods 0.000 description 1
- RNULVIMVPASZND-UHFFFAOYSA-N tert-butyl 2-methylsulfanyl-4,5-dihydroimidazole-1-carboxylate Chemical compound CSC1=NCCN1C(=O)OC(C)(C)C RNULVIMVPASZND-UHFFFAOYSA-N 0.000 description 1
- IRUJRVAXEALDLJ-UHFFFAOYSA-N tert-butyl 4-[2-(methylamino)ethyl]piperazine-1-carboxylate Chemical compound CNCCN1CCN(C(=O)OC(C)(C)C)CC1 IRUJRVAXEALDLJ-UHFFFAOYSA-N 0.000 description 1
- LZRDHSFPLUWYAX-UHFFFAOYSA-N tert-butyl 4-aminopiperidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC(N)CC1 LZRDHSFPLUWYAX-UHFFFAOYSA-N 0.000 description 1
- POHWAQLZBIMPRN-UHFFFAOYSA-N tert-butyl n-(3-aminopropyl)carbamate Chemical compound CC(C)(C)OC(=O)NCCCN POHWAQLZBIMPRN-UHFFFAOYSA-N 0.000 description 1
- ZFQWJXFJJZUVPI-UHFFFAOYSA-N tert-butyl n-(4-aminobutyl)carbamate Chemical compound CC(C)(C)OC(=O)NCCCCN ZFQWJXFJJZUVPI-UHFFFAOYSA-N 0.000 description 1
- DPLOGSUBQDREOU-UHFFFAOYSA-N tert-butyl n-(5-aminopentyl)carbamate Chemical compound CC(C)(C)OC(=O)NCCCCCN DPLOGSUBQDREOU-UHFFFAOYSA-N 0.000 description 1
- RVZPDKXEHIRFPM-UHFFFAOYSA-N tert-butyl n-(6-aminohexyl)carbamate Chemical compound CC(C)(C)OC(=O)NCCCCCCN RVZPDKXEHIRFPM-UHFFFAOYSA-N 0.000 description 1
- BDLPJHZUTLGFON-UHFFFAOYSA-N tert-butyl n-(6-hydroxyhexyl)carbamate Chemical compound CC(C)(C)OC(=O)NCCCCCCO BDLPJHZUTLGFON-UHFFFAOYSA-N 0.000 description 1
- DTJYPERGUPPXRU-UHFFFAOYSA-N tert-butyl n-(7-aminoheptyl)carbamate Chemical compound CC(C)(C)OC(=O)NCCCCCCCN DTJYPERGUPPXRU-UHFFFAOYSA-N 0.000 description 1
- BEHVGNKIRNVBPF-UHFFFAOYSA-N tert-butyl n-(8-aminooctyl)carbamate Chemical compound CC(C)(C)OC(=O)NCCCCCCCCN BEHVGNKIRNVBPF-UHFFFAOYSA-N 0.000 description 1
- PAXDIBGWURAVIH-JGVFFNPUSA-N tert-butyl n-[(1r,2s)-2-aminocyclopentyl]carbamate Chemical compound CC(C)(C)OC(=O)N[C@@H]1CCC[C@@H]1N PAXDIBGWURAVIH-JGVFFNPUSA-N 0.000 description 1
- PAXDIBGWURAVIH-SFYZADRCSA-N tert-butyl n-[(1s,2r)-2-aminocyclopentyl]carbamate Chemical compound CC(C)(C)OC(=O)N[C@H]1CCC[C@H]1N PAXDIBGWURAVIH-SFYZADRCSA-N 0.000 description 1
- OBSACSBMTRJNPH-IUCAKERBSA-N tert-butyl n-[(1s,3s)-3-aminocyclohexyl]carbamate Chemical compound CC(C)(C)OC(=O)N[C@H]1CCC[C@H](N)C1 OBSACSBMTRJNPH-IUCAKERBSA-N 0.000 description 1
- CWXPZXBSDSIRCS-UHFFFAOYSA-N tert-butyl piperazine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCNCC1 CWXPZXBSDSIRCS-UHFFFAOYSA-N 0.000 description 1
- 125000001981 tert-butyldimethylsilyl group Chemical group [H]C([H])([H])[Si]([H])(C([H])([H])[H])[*]C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 1
- 229930192474 thiophene Natural products 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- 230000000472 traumatic effect Effects 0.000 description 1
- 125000004044 trifluoroacetyl group Chemical group FC(C(=O)*)(F)F 0.000 description 1
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 description 1
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 239000003039 volatile agent Substances 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/38—Nitrogen atoms
- C07D215/42—Nitrogen atoms attached in position 4
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/47—Quinolines; Isoquinolines
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/04—Centrally acting analgesics, e.g. opioids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/22—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to carbon atoms of the nitrogen-containing ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/70—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings condensed with carbocyclic rings or ring systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/70—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings condensed with carbocyclic rings or ring systems
- C07D239/72—Quinazolines; Hydrogenated quinazolines
- C07D239/86—Quinazolines; Hydrogenated quinazolines with hetero atoms directly attached in position 4
- C07D239/94—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/06—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- General Health & Medical Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Bioinformatics & Cheminformatics (AREA)
- General Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Neurosurgery (AREA)
- Neurology (AREA)
- Biomedical Technology (AREA)
- Engineering & Computer Science (AREA)
- Pain & Pain Management (AREA)
- Epidemiology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP2000098874 | 2000-03-31 | ||
| JP2000-98874 | 2000-03-31 | ||
| JP2000-336464 | 2000-11-02 | ||
| JP2000336464 | 2000-11-02 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| RU2002129100A RU2002129100A (ru) | 2004-02-27 |
| RU2268260C2 true RU2268260C2 (ru) | 2006-01-20 |
Family
ID=26589216
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| RU2002129100/04A RU2268260C2 (ru) | 2000-03-31 | 2001-03-30 | Производные хиназолина или хинолина и лекарственные средства на их основе |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US6794389B2 (enExample) |
| EP (1) | EP1306372B1 (enExample) |
| KR (1) | KR20020083533A (enExample) |
| CN (1) | CN1242993C (enExample) |
| AT (1) | ATE449084T1 (enExample) |
| AU (1) | AU2001244688A1 (enExample) |
| CA (1) | CA2403605A1 (enExample) |
| DE (1) | DE60140545D1 (enExample) |
| RU (1) | RU2268260C2 (enExample) |
| WO (1) | WO2001072710A1 (enExample) |
Families Citing this family (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2002024666A2 (en) * | 2000-09-20 | 2002-03-28 | Merck Patent Gmbh | 4-amino-quinazolines |
| ATE383860T1 (de) * | 2000-11-02 | 2008-02-15 | Nippon Shinyaku Co Ltd | Chinazolinderivate und -arzneimittel |
| RU2003130752A (ru) * | 2001-03-19 | 2005-03-10 | Ниппон Синяку Ко., Лтд. (Jp) | Противозудные средства |
| US6907295B2 (en) * | 2001-08-31 | 2005-06-14 | Biocontrol Medical Ltd. | Electrode assembly for nerve control |
| US7829566B2 (en) * | 2001-09-17 | 2010-11-09 | Werner Mederski | 4-amino-quinazolines |
| JP4513566B2 (ja) * | 2002-04-26 | 2010-07-28 | 日本新薬株式会社 | キナゾリン誘導体及び医薬 |
| JP4805234B2 (ja) * | 2002-12-16 | 2011-11-02 | キッセイ薬品工業株式会社 | 経口固形医薬 |
| WO2006074147A2 (en) | 2005-01-03 | 2006-07-13 | Myriad Genetics, Inc. | Nitrogen containing bicyclic compounds and therapeutical use thereof |
| JP5129957B2 (ja) | 2003-07-03 | 2013-01-30 | ミリアド ジェネティクス， インコーポレイテッド | カスパーゼの活性化因子およびアポトーシスの誘発因子としての４−アリールアミノ−キナゾリン |
| US8309562B2 (en) | 2003-07-03 | 2012-11-13 | Myrexis, Inc. | Compounds and therapeutical use thereof |
| US20050165032A1 (en) * | 2004-01-23 | 2005-07-28 | Norman Mark H. | Vanilloid receptor ligands and their use in treatments |
| US8258145B2 (en) | 2005-01-03 | 2012-09-04 | Myrexis, Inc. | Method of treating brain cancer |
| WO2007040231A1 (ja) | 2005-10-03 | 2007-04-12 | Nippon Shinyaku Co., Ltd. | キナゾリン誘導体及び医薬 |
| RU2314295C2 (ru) * | 2006-03-01 | 2008-01-10 | Федеральное Государственное Образовательное Учреждение Высшего Профессионального Образования "Южный Федеральный Университет" | 2-гетарилзамещенные 1,3-трополона, способ их получения (варианты) и фармацевтическая композиция антимикробного действия |
| MX2009012117A (es) * | 2007-05-09 | 2009-11-23 | Pfizer | Composiciones y derivados heterociclicos sustituidos y su uso farmaceutico como antibacterianos. |
| EP2017294A1 (de) | 2007-07-16 | 2009-01-21 | Sika Technology AG | Hitzehärtender Schaum |
| BRPI0923786C8 (pt) | 2008-12-30 | 2021-05-25 | Arqule Inc | compostos 5,6-dihidro-6-fenilbenzo(f) isoquinolina-2- amina substituidos e composições farmacêuticas compreendendo ditos compostos |
| WO2012027495A1 (en) | 2010-08-27 | 2012-03-01 | University Of The Pacific | Piperazinylpyrimidine analogues as protein kinase inhibitors |
| SG11201403744YA (en) | 2011-12-28 | 2014-09-26 | Fujifilm Corp | Novel nicotinamide derivative or salt thereof |
| WO2024258849A2 (en) * | 2023-06-13 | 2024-12-19 | The Trustees Of Indiana University | Small molecule antiviral drug treatment for human papillomavirus infections |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1997020821A1 (en) * | 1995-12-01 | 1997-06-12 | Novartis Ag | Heteroaryl derivatives |
| WO1999048492A1 (en) * | 1998-03-26 | 1999-09-30 | Japan Tobacco Inc. | Amide derivatives and nociceptin antagonists |
| RU98114078A (ru) * | 1995-12-23 | 2000-03-27 | Пфайзер Рисерч энд Дивелопмент Компани, Н.В./С.А. Ла Тоуч Хаус | Хинолиновые и хиназолиновые соединения, использующиеся в терапии |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3753981A (en) | 1970-07-15 | 1973-08-21 | Squibb & Sons Inc | 4-amino-2-styrylquinazoline compounds |
| PT100905A (pt) | 1991-09-30 | 1994-02-28 | Eisai Co Ltd | Compostos heterociclicos azotados biciclicos contendo aneis de benzeno, ciclo-hexano ou piridina e de pirimidina, piridina ou imidazol substituidos e composicoes farmaceuticas que os contem |
| JP2657760B2 (ja) | 1992-07-15 | 1997-09-24 | 小野薬品工業株式会社 | ４−アミノキナゾリン誘導体およびそれを含有する医薬品 |
| EP0973513A4 (en) | 1996-10-23 | 2003-03-19 | Zymogenetics Inc | COMPILATIONS AND METHOD FOR TREATING BONE DEFICIENCY |
| CA2226058C (en) | 1997-01-30 | 2008-01-29 | F. Hoffmann-La Roche Ag | 8-substituted-1,3,8-triaza-spiro[4.5]decan-4-one derivatives |
| AR012634A1 (es) | 1997-05-02 | 2000-11-08 | Sugen Inc | Compuesto basado en quinazolina, composicion famaceutica que lo comprende, metodo para sintetizarlo, su uso, metodos de modulacion de la funcion deserina/treonina proteinaquinasa con dicho compuesto y metodo in vitro para identificar compuestos que modulan dicha funcion |
| DE69826278T2 (de) | 1997-05-30 | 2005-11-10 | Banyu Pharmaceutical Co., Ltd. | 2-oxoimidazol-derivate |
| AU8748798A (en) | 1997-08-22 | 1999-03-16 | Kyowa Hakko Kogyo Co. Ltd. | 4-aminoquinazoline derivatives |
| RU2003130752A (ru) | 2001-03-19 | 2005-03-10 | Ниппон Синяку Ко., Лтд. (Jp) | Противозудные средства |
-
2001
- 2001-03-30 DE DE60140545T patent/DE60140545D1/de not_active Expired - Lifetime
- 2001-03-30 KR KR1020027012917A patent/KR20020083533A/ko not_active Withdrawn
- 2001-03-30 CN CNB018075347A patent/CN1242993C/zh not_active Expired - Fee Related
- 2001-03-30 AU AU2001244688A patent/AU2001244688A1/en not_active Abandoned
- 2001-03-30 EP EP01917752A patent/EP1306372B1/en not_active Expired - Lifetime
- 2001-03-30 CA CA002403605A patent/CA2403605A1/en not_active Abandoned
- 2001-03-30 WO PCT/JP2001/002822 patent/WO2001072710A1/ja not_active Ceased
- 2001-03-30 AT AT01917752T patent/ATE449084T1/de not_active IP Right Cessation
- 2001-03-30 RU RU2002129100/04A patent/RU2268260C2/ru not_active IP Right Cessation
- 2001-03-30 US US10/239,750 patent/US6794389B2/en not_active Expired - Fee Related
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1997020821A1 (en) * | 1995-12-01 | 1997-06-12 | Novartis Ag | Heteroaryl derivatives |
| RU98114078A (ru) * | 1995-12-23 | 2000-03-27 | Пфайзер Рисерч энд Дивелопмент Компани, Н.В./С.А. Ла Тоуч Хаус | Хинолиновые и хиназолиновые соединения, использующиеся в терапии |
| WO1999048492A1 (en) * | 1998-03-26 | 1999-09-30 | Japan Tobacco Inc. | Amide derivatives and nociceptin antagonists |
Also Published As
| Publication number | Publication date |
|---|---|
| CN1242993C (zh) | 2006-02-22 |
| KR20020083533A (ko) | 2002-11-02 |
| AU2001244688A1 (en) | 2001-10-08 |
| RU2002129100A (ru) | 2004-02-27 |
| CA2403605A1 (en) | 2002-09-18 |
| US6794389B2 (en) | 2004-09-21 |
| ATE449084T1 (de) | 2009-12-15 |
| CN1422255A (zh) | 2003-06-04 |
| EP1306372A1 (en) | 2003-05-02 |
| US20030119855A1 (en) | 2003-06-26 |
| WO2001072710A1 (en) | 2001-10-04 |
| EP1306372B1 (en) | 2009-11-18 |
| EP1306372A4 (en) | 2004-03-17 |
| DE60140545D1 (enExample) | 2009-12-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| RU2268260C2 (ru) | Производные хиназолина или хинолина и лекарственные средства на их основе | |
| RU2197493C2 (ru) | Производные 5h-тиазол[3,2-а]пиримидина, промежуточные продукты и лекарственное средство | |
| TWI300351B (en) | Pharmaceutical compositions for the treatment of neoplasms | |
| CN102292338B (zh) | 酪氨酸激酶蛋白受体拮抗剂 | |
| RU2434851C1 (ru) | Циклические n, n'-диарилтиомочевины или n, n'-диарилмочевины - антагонисты андрогенных рецепторов, противораковое средство, способ получения и применения | |
| KR100797430B1 (ko) | ｛6,7-비스(2-메톡시-에톡시)-퀴나졸린-4-일｝-(3ｅ)의동질다상체 | |
| TW200307539A (en) | Cycloalkyl inhibitors of potassium channel function | |
| PL201191B1 (pl) | Piperazynowa pochodna i jej zastosowanie, zawierająca ją farmaceutyczna kompozycja oraz sposób wytwarzania piperazynowej pochodnej | |
| NL1037569C2 (en) | Crystalline pimobendan, process for the preparation thereof, pharmaceutical composition and use. | |
| DE69330497T2 (de) | Chinazolin-derivate | |
| TW201629063A (zh) | 經取代胺基嘌呤化合物、其組合物及用其之治療方法 | |
| TW200526196A (en) | Substituted nitrogen-containing six-membered amino-heterocycles as vanilloid-1 receptor antagonists for treating pain | |
| JPWO2002074341A1 (ja) | 鎮痒剤 | |
| JP2009539854A (ja) | ６−メトキシ−８−［４−（１−（５−フルオロ）−キノリン−８−イル−ピペリジン−４−イル）−ピペラジン−１−イル］−キノリンの塩酸塩 | |
| JPWO2002036577A1 (ja) | キナゾリン誘導体及び医薬 | |
| RU2300532C2 (ru) | Производные бензо[g]хинолина для лечения глаукомы и близорукости, способ их получения и фармацевтическая композиция | |
| US20080045510A1 (en) | Succinate salts of 6-methoxy-8-[4-(1-(5-fluoro)-quinolin-8-yl-piperidin-4-yl)-piperazin-1-yl]-quinoline and crystalline forms thereof | |
| US9085539B2 (en) | Cyclic N,N′-diarylthiourea—androgen receptor antagonist, anti breast cancer composition and use thereof | |
| TW200811144A (en) | Crystalline forms of 6-methoxy-8-[4-(1-(5-fluoro)-quinolin-8-yl-piperidin-4-yl)-piperazin-1-yl]-quinoline | |
| US7115620B2 (en) | 1,3-disubstituted-2-thioxo-imidazolidine-4,5-diones as potassium channel openers | |
| JPWO2001072710A1 (ja) | 複素環誘導体及び医薬 | |
| HK1232885A (en) | Compositions of protein receptor tyrosine kinase inhibitors | |
| HK1232885A1 (en) | Compositions of protein receptor tyrosine kinase inhibitors | |
| MXPA98005698A (en) | Derivatives of 5h-tiazolo [3,2-a] pyramid |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM4A | The patent is invalid due to non-payment of fees |
Effective date: 20070331 |