PT73685B - Processo para a preparacao de novos peptidos de carboxialquilo e tioesteres e eteres de peptidos como agentes antihipertensivos - Google Patents
Processo para a preparacao de novos peptidos de carboxialquilo e tioesteres e eteres de peptidos como agentes antihipertensivos Download PDFInfo
- Publication number
- PT73685B PT73685B PT73685A PT7368581A PT73685B PT 73685 B PT73685 B PT 73685B PT 73685 A PT73685 A PT 73685A PT 7368581 A PT7368581 A PT 7368581A PT 73685 B PT73685 B PT 73685B
- Authority
- PT
- Portugal
- Prior art keywords
- general formula
- group
- novel compounds
- compounds according
- preparation
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 182
- 108090000765 processed proteins & peptides Proteins 0.000 title description 12
- 102000004196 processed proteins & peptides Human genes 0.000 title description 8
- 239000002220 antihypertensive agent Substances 0.000 title description 4
- 229940030600 antihypertensive agent Drugs 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims description 309
- -1 mercaptomethyl Chemical group 0.000 claims description 220
- 238000002360 preparation method Methods 0.000 claims description 145
- 230000008569 process Effects 0.000 claims description 125
- 125000004432 carbon atom Chemical group C* 0.000 claims description 98
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 76
- 239000000203 mixture Substances 0.000 claims description 74
- 125000000217 alkyl group Chemical group 0.000 claims description 41
- 102000004190 Enzymes Human genes 0.000 claims description 25
- 108090000790 Enzymes Proteins 0.000 claims description 25
- 150000003839 salts Chemical class 0.000 claims description 25
- 125000002947 alkylene group Chemical group 0.000 claims description 21
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 21
- 230000002401 inhibitory effect Effects 0.000 claims description 18
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 18
- 241000124008 Mammalia Species 0.000 claims description 17
- 150000002148 esters Chemical group 0.000 claims description 17
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 16
- 230000009471 action Effects 0.000 claims description 16
- 125000003118 aryl group Chemical group 0.000 claims description 16
- 206010020772 Hypertension Diseases 0.000 claims description 15
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 15
- 101800000733 Angiotensin-2 Proteins 0.000 claims description 14
- CZGUSIXMZVURDU-JZXHSEFVSA-N Ile(5)-angiotensin II Chemical compound C([C@@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CC=1C=CC=CC=1)C([O-])=O)NC(=O)[C@@H](NC(=O)[C@H](CCCNC(N)=[NH2+])NC(=O)[C@@H]([NH3+])CC([O-])=O)C(C)C)C1=CC=C(O)C=C1 CZGUSIXMZVURDU-JZXHSEFVSA-N 0.000 claims description 14
- 229950006323 angiotensin ii Drugs 0.000 claims description 14
- 229910052799 carbon Inorganic materials 0.000 claims description 14
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 14
- 229910052739 hydrogen Inorganic materials 0.000 claims description 12
- 102000015427 Angiotensins Human genes 0.000 claims description 11
- 108010064733 Angiotensins Proteins 0.000 claims description 11
- 230000036772 blood pressure Effects 0.000 claims description 11
- 229910052757 nitrogen Inorganic materials 0.000 claims description 11
- 125000003396 thiol group Chemical class [H]S* 0.000 claims description 11
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 10
- 239000001257 hydrogen Substances 0.000 claims description 10
- 239000008194 pharmaceutical composition Substances 0.000 claims description 10
- 239000013543 active substance Substances 0.000 claims description 8
- 125000000623 heterocyclic group Chemical group 0.000 claims description 8
- 125000004464 hydroxyphenyl group Chemical group 0.000 claims description 8
- 238000000338 in vitro Methods 0.000 claims description 8
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 7
- 231100000252 nontoxic Toxicity 0.000 claims description 7
- 230000003000 nontoxic effect Effects 0.000 claims description 7
- 210000002966 serum Anatomy 0.000 claims description 7
- 125000001424 substituent group Chemical group 0.000 claims description 7
- 125000001544 thienyl group Chemical group 0.000 claims description 7
- 125000003342 alkenyl group Chemical group 0.000 claims description 6
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 6
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims description 6
- 230000001631 hypertensive effect Effects 0.000 claims description 6
- 229910052740 iodine Inorganic materials 0.000 claims description 6
- 150000003568 thioethers Chemical class 0.000 claims description 6
- 125000003545 alkoxy group Chemical group 0.000 claims description 5
- 125000003806 alkyl carbonyl amino group Chemical group 0.000 claims description 5
- 125000005130 alkyl carbonyl thio group Chemical group 0.000 claims description 5
- 125000004429 atom Chemical group 0.000 claims description 5
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 5
- 229910052794 bromium Inorganic materials 0.000 claims description 5
- 125000004122 cyclic group Chemical group 0.000 claims description 5
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 5
- UUUHXMGGBIUAPW-UHFFFAOYSA-N 1-[1-[2-[[5-amino-2-[[1-[5-(diaminomethylideneamino)-2-[[1-[3-(1h-indol-3-yl)-2-[(5-oxopyrrolidine-2-carbonyl)amino]propanoyl]pyrrolidine-2-carbonyl]amino]pentanoyl]pyrrolidine-2-carbonyl]amino]-5-oxopentanoyl]amino]-3-methylpentanoyl]pyrrolidine-2-carbon Chemical compound C1CCC(C(=O)N2C(CCC2)C(O)=O)N1C(=O)C(C(C)CC)NC(=O)C(CCC(N)=O)NC(=O)C1CCCN1C(=O)C(CCCN=C(N)N)NC(=O)C1CCCN1C(=O)C(CC=1C2=CC=CC=C2NC=1)NC(=O)C1CCC(=O)N1 UUUHXMGGBIUAPW-UHFFFAOYSA-N 0.000 claims description 4
- 108090000882 Peptidyl-Dipeptidase A Proteins 0.000 claims description 4
- 150000001450 anions Chemical class 0.000 claims description 4
- 125000004982 dihaloalkyl group Chemical group 0.000 claims description 4
- 125000001188 haloalkyl group Chemical group 0.000 claims description 4
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 claims description 4
- 125000002883 imidazolyl group Chemical group 0.000 claims description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 4
- 125000004076 pyridyl group Chemical group 0.000 claims description 4
- 125000004953 trihalomethyl group Chemical group 0.000 claims description 4
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 4
- 101100386054 Saccharomyces cerevisiae (strain ATCC 204508 / S288c) CYS3 gene Proteins 0.000 claims description 3
- 150000003973 alkyl amines Chemical class 0.000 claims description 3
- 125000004448 alkyl carbonyl group Chemical group 0.000 claims description 3
- 125000005196 alkyl carbonyloxy group Chemical group 0.000 claims description 3
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 125000004970 halomethyl group Chemical group 0.000 claims description 3
- 125000002349 hydroxyamino group Chemical group [H]ON([H])[*] 0.000 claims description 3
- 125000004372 methylthioethyl group Chemical group [H]C([H])([H])SC([H])([H])C([H])([H])* 0.000 claims description 3
- 125000003386 piperidinyl group Chemical group 0.000 claims description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 3
- 125000003373 pyrazinyl group Chemical group 0.000 claims description 3
- 101150035983 str1 gene Proteins 0.000 claims description 3
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 claims description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 claims description 2
- 125000005236 alkanoylamino group Chemical group 0.000 claims description 2
- 125000006307 alkoxy benzyl group Chemical group 0.000 claims description 2
- 125000005036 alkoxyphenyl group Chemical group 0.000 claims description 2
- 125000004414 alkyl thio group Chemical group 0.000 claims description 2
- 125000005336 allyloxy group Chemical group 0.000 claims description 2
- 125000005334 azaindolyl group Chemical group N1N=C(C2=CC=CC=C12)* 0.000 claims description 2
- 125000000043 benzamido group Chemical group [H]N([*])C(=O)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 2
- 125000001231 benzoyloxy group Chemical group C(C1=CC=CC=C1)(=O)O* 0.000 claims description 2
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 2
- 229910052731 fluorine Inorganic materials 0.000 claims description 2
- 125000002541 furyl group Chemical group 0.000 claims description 2
- 125000005059 halophenyl group Chemical group 0.000 claims description 2
- 125000001041 indolyl group Chemical group 0.000 claims description 2
- 125000005358 mercaptoalkyl group Chemical group 0.000 claims description 2
- HRDXJKGNWSUIBT-UHFFFAOYSA-N methoxybenzene Chemical group [CH2]OC1=CC=CC=C1 HRDXJKGNWSUIBT-UHFFFAOYSA-N 0.000 claims description 2
- 125000002757 morpholinyl group Chemical group 0.000 claims description 2
- 125000004998 naphthylethyl group Chemical group C1(=CC=CC2=CC=CC=C12)CC* 0.000 claims description 2
- 125000006501 nitrophenyl group Chemical group 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 2
- 125000004193 piperazinyl group Chemical group 0.000 claims description 2
- 125000001500 prolyl group Chemical group [H]N1C([H])(C(=O)[*])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 2
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 2
- 125000001984 thiazolidinyl group Chemical group 0.000 claims description 2
- 125000000335 thiazolyl group Chemical group 0.000 claims description 2
- 229920002554 vinyl polymer Polymers 0.000 claims description 2
- 125000004454 (C1-C6) alkoxycarbonyl group Chemical group 0.000 claims 8
- 238000001727 in vivo Methods 0.000 claims 6
- 102000005862 Angiotensin II Human genes 0.000 claims 3
- 238000004519 manufacturing process Methods 0.000 claims 3
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims 2
- 125000000686 lactone group Chemical group 0.000 claims 2
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 claims 1
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 claims 1
- 102000004270 Peptidyl-Dipeptidase A Human genes 0.000 claims 1
- 230000006978 adaptation Effects 0.000 claims 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims 1
- 125000005094 alkyl carbonyl amino alkyl group Chemical group 0.000 claims 1
- 125000005037 alkyl phenyl group Chemical group 0.000 claims 1
- 125000004103 aminoalkyl group Chemical group 0.000 claims 1
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 claims 1
- VZGDMQKNWNREIO-UHFFFAOYSA-N carbon tetrachloride Substances ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 claims 1
- 125000004981 cycloalkylmethyl group Chemical group 0.000 claims 1
- 125000001475 halogen functional group Chemical group 0.000 claims 1
- 238000012986 modification Methods 0.000 claims 1
- 230000004048 modification Effects 0.000 claims 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims 1
- YWAKXRMUMFPDSH-UHFFFAOYSA-N pentene Chemical compound CCCC=C YWAKXRMUMFPDSH-UHFFFAOYSA-N 0.000 claims 1
- 125000001484 phenothiazinyl group Chemical group C1(=CC=CC=2SC3=CC=CC=C3NC12)* 0.000 claims 1
- 230000004962 physiological condition Effects 0.000 claims 1
- 229960005235 piperonyl butoxide Drugs 0.000 claims 1
- 125000004591 piperonyl group Chemical group C(C1=CC=2OCOC2C=C1)* 0.000 claims 1
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 claims 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 claims 1
- 125000000168 pyrrolyl group Chemical group 0.000 claims 1
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 claims 1
- 229910052717 sulfur Inorganic materials 0.000 claims 1
- 239000000047 product Substances 0.000 description 141
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 116
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 108
- 239000000243 solution Substances 0.000 description 90
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 75
- 239000002253 acid Substances 0.000 description 71
- 229960002429 proline Drugs 0.000 description 69
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 62
- 239000002904 solvent Substances 0.000 description 60
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 54
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 48
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 44
- 235000019439 ethyl acetate Nutrition 0.000 description 40
- 239000011541 reaction mixture Substances 0.000 description 39
- 229960003767 alanine Drugs 0.000 description 36
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 34
- 235000019441 ethanol Nutrition 0.000 description 33
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 30
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 27
- 235000004279 alanine Nutrition 0.000 description 26
- 238000006243 chemical reaction Methods 0.000 description 26
- 238000001914 filtration Methods 0.000 description 26
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 24
- 239000012074 organic phase Substances 0.000 description 24
- QNAYBMKLOCPYGJ-REOHCLBHSA-N L-alanine Chemical compound C[C@H](N)C(O)=O QNAYBMKLOCPYGJ-REOHCLBHSA-N 0.000 description 23
- 239000004743 Polypropylene Substances 0.000 description 22
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 22
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 21
- 125000004494 ethyl ester group Chemical group 0.000 description 21
- 239000002808 molecular sieve Substances 0.000 description 21
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 21
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 19
- 238000003756 stirring Methods 0.000 description 19
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 18
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 17
- 239000000543 intermediate Substances 0.000 description 17
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 16
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 16
- 235000019341 magnesium sulphate Nutrition 0.000 description 16
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 16
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 15
- ONIBWKKTOPOVIA-BYPYZUCNSA-N L-Proline Chemical compound OC(=O)[C@@H]1CCCN1 ONIBWKKTOPOVIA-BYPYZUCNSA-N 0.000 description 15
- 125000000174 L-prolyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])([H])[C@@]1([H])C(*)=O 0.000 description 15
- 230000002829 reductive effect Effects 0.000 description 15
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 14
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 14
- 229940024606 amino acid Drugs 0.000 description 14
- 239000000706 filtrate Substances 0.000 description 14
- 239000003112 inhibitor Substances 0.000 description 14
- 239000000758 substrate Substances 0.000 description 14
- ONIBWKKTOPOVIA-UHFFFAOYSA-N Proline Natural products OC(=O)C1CCCN1 ONIBWKKTOPOVIA-UHFFFAOYSA-N 0.000 description 13
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 12
- 102400000344 Angiotensin-1 Human genes 0.000 description 12
- 101800000734 Angiotensin-1 Proteins 0.000 description 12
- ORWYRWWVDCYOMK-HBZPZAIKSA-N angiotensin I Chemical compound C([C@@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N[C@@H](CC(C)C)C(O)=O)NC(=O)[C@@H](NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H](N)CC(O)=O)C(C)C)C1=CC=C(O)C=C1 ORWYRWWVDCYOMK-HBZPZAIKSA-N 0.000 description 12
- 102400000345 Angiotensin-2 Human genes 0.000 description 11
- LCTONWCANYUPML-UHFFFAOYSA-N PYRUVIC-ACID Natural products CC(=O)C(O)=O LCTONWCANYUPML-UHFFFAOYSA-N 0.000 description 11
- 150000001413 amino acids Chemical group 0.000 description 11
- 238000004587 chromatography analysis Methods 0.000 description 11
- 230000000694 effects Effects 0.000 description 11
- 238000007127 saponification reaction Methods 0.000 description 11
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 10
- 102100030988 Angiotensin-converting enzyme Human genes 0.000 description 10
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 10
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 10
- 230000015572 biosynthetic process Effects 0.000 description 10
- 239000003153 chemical reaction reagent Substances 0.000 description 10
- 229910052708 sodium Inorganic materials 0.000 description 10
- 239000011734 sodium Substances 0.000 description 10
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 9
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- 235000001014 amino acid Nutrition 0.000 description 9
- FAKRSMQSSFJEIM-RQJHMYQMSA-N captopril Chemical compound SC[C@@H](C)C(=O)N1CCC[C@H]1C(O)=O FAKRSMQSSFJEIM-RQJHMYQMSA-N 0.000 description 9
- 229960000830 captopril Drugs 0.000 description 9
- 238000010168 coupling process Methods 0.000 description 9
- 229960002989 glutamic acid Drugs 0.000 description 9
- 235000011121 sodium hydroxide Nutrition 0.000 description 9
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 9
- WHUUTDBJXJRKMK-UHFFFAOYSA-N Glutamic acid Natural products OC(=O)C(N)CCC(O)=O WHUUTDBJXJRKMK-UHFFFAOYSA-N 0.000 description 8
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 8
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 8
- 150000007513 acids Chemical class 0.000 description 8
- 238000001816 cooling Methods 0.000 description 8
- 229940107700 pyruvic acid Drugs 0.000 description 8
- 239000003795 chemical substances by application Substances 0.000 description 7
- 238000005859 coupling reaction Methods 0.000 description 7
- 239000004220 glutamic acid Substances 0.000 description 7
- 229960005190 phenylalanine Drugs 0.000 description 7
- 235000017557 sodium bicarbonate Nutrition 0.000 description 7
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 7
- 239000007787 solid Substances 0.000 description 7
- 239000000126 substance Substances 0.000 description 7
- 238000004809 thin layer chromatography Methods 0.000 description 7
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 239000008346 aqueous phase Substances 0.000 description 6
- 239000003054 catalyst Substances 0.000 description 6
- 230000008878 coupling Effects 0.000 description 6
- 239000012467 final product Substances 0.000 description 6
- 230000007935 neutral effect Effects 0.000 description 6
- COLNVLDHVKWLRT-QMMMGPOBSA-N phenylalanine group Chemical group N[C@@H](CC1=CC=CC=C1)C(=O)O COLNVLDHVKWLRT-QMMMGPOBSA-N 0.000 description 6
- 125000006239 protecting group Chemical group 0.000 description 6
- 238000003786 synthesis reaction Methods 0.000 description 6
- XJJBXZIKXFOMLP-ZETCQYMHSA-N tert-butyl (2s)-pyrrolidine-2-carboxylate Chemical compound CC(C)(C)OC(=O)[C@@H]1CCCN1 XJJBXZIKXFOMLP-ZETCQYMHSA-N 0.000 description 6
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical compound SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 6
- ADFXKUOMJKEIND-UHFFFAOYSA-N 1,3-dicyclohexylurea Chemical compound C1CCCCC1NC(=O)NC1CCCCC1 ADFXKUOMJKEIND-UHFFFAOYSA-N 0.000 description 5
- 239000005541 ACE inhibitor Substances 0.000 description 5
- 239000004475 Arginine Substances 0.000 description 5
- 229930182821 L-proline Natural products 0.000 description 5
- 229910004809 Na2 SO4 Inorganic materials 0.000 description 5
- 229940044094 angiotensin-converting-enzyme inhibitor Drugs 0.000 description 5
- 239000007864 aqueous solution Substances 0.000 description 5
- 238000003556 assay Methods 0.000 description 5
- 239000000872 buffer Substances 0.000 description 5
- 239000012043 crude product Substances 0.000 description 5
- 235000013922 glutamic acid Nutrition 0.000 description 5
- 238000001990 intravenous administration Methods 0.000 description 5
- 150000004702 methyl esters Chemical class 0.000 description 5
- 230000020477 pH reduction Effects 0.000 description 5
- 239000012071 phase Substances 0.000 description 5
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 5
- 239000000376 reactant Substances 0.000 description 5
- 239000011780 sodium chloride Substances 0.000 description 5
- 159000000000 sodium salts Chemical class 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- 238000012360 testing method Methods 0.000 description 5
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 description 4
- PMNLUUOXGOOLSP-UHFFFAOYSA-N 2-mercaptopropanoic acid Chemical compound CC(S)C(O)=O PMNLUUOXGOOLSP-UHFFFAOYSA-N 0.000 description 4
- XMIIGOLPHOKFCH-UHFFFAOYSA-N 3-phenylpropionic acid Chemical compound OC(=O)CCC1=CC=CC=C1 XMIIGOLPHOKFCH-UHFFFAOYSA-N 0.000 description 4
- ODHCTXKNWHHXJC-VKHMYHEASA-N 5-oxo-L-proline Chemical compound OC(=O)[C@@H]1CCC(=O)N1 ODHCTXKNWHHXJC-VKHMYHEASA-N 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- 239000004471 Glycine Substances 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- NQTADLQHYWFPDB-UHFFFAOYSA-N N-Hydroxysuccinimide Chemical compound ON1C(=O)CCC1=O NQTADLQHYWFPDB-UHFFFAOYSA-N 0.000 description 4
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Substances CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 4
- 241000700159 Rattus Species 0.000 description 4
- 229920005654 Sephadex Polymers 0.000 description 4
- 239000012507 Sephadex™ Substances 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 235000008206 alpha-amino acids Nutrition 0.000 description 4
- 150000008064 anhydrides Chemical class 0.000 description 4
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 4
- 239000012298 atmosphere Substances 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N benzene Substances C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 4
- 210000004369 blood Anatomy 0.000 description 4
- 239000008280 blood Substances 0.000 description 4
- 238000004440 column chromatography Methods 0.000 description 4
- 229960002449 glycine Drugs 0.000 description 4
- 230000007062 hydrolysis Effects 0.000 description 4
- 238000006460 hydrolysis reaction Methods 0.000 description 4
- 239000007924 injection Substances 0.000 description 4
- 238000002347 injection Methods 0.000 description 4
- 150000002596 lactones Chemical group 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 4
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 4
- 239000012047 saturated solution Substances 0.000 description 4
- NDVLTYZPCACLMA-UHFFFAOYSA-N silver oxide Chemical compound [O-2].[Ag+].[Ag+] NDVLTYZPCACLMA-UHFFFAOYSA-N 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- ZITOPJKFJBLAMM-LURJTMIESA-N (2s)-1-(2-oxopropanoyl)pyrrolidine-2-carboxylic acid Chemical compound CC(=O)C(=O)N1CCC[C@H]1C(O)=O ZITOPJKFJBLAMM-LURJTMIESA-N 0.000 description 3
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 3
- 125000003762 3,4-dimethoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1* 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 3
- CKLJMWTZIZZHCS-UWTATZPHSA-N D-aspartic acid Chemical compound OC(=O)[C@H](N)CC(O)=O CKLJMWTZIZZHCS-UWTATZPHSA-N 0.000 description 3
- FFFHZYDWPBMWHY-VKHMYHEASA-N L-homocysteine Chemical compound OC(=O)[C@@H](N)CCS FFFHZYDWPBMWHY-VKHMYHEASA-N 0.000 description 3
- AYFVYJQAPQTCCC-GBXIJSLDSA-N L-threonine Chemical compound C[C@@H](O)[C@H](N)C(O)=O AYFVYJQAPQTCCC-GBXIJSLDSA-N 0.000 description 3
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 3
- 239000004472 Lysine Substances 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- IDGQXGPQOGUGIX-VIFPVBQESA-N O-BENZYL-l-SERINE Chemical compound OC(=O)[C@@H](N)COCC1=CC=CC=C1 IDGQXGPQOGUGIX-VIFPVBQESA-N 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- 239000004473 Threonine Substances 0.000 description 3
- 230000004872 arterial blood pressure Effects 0.000 description 3
- OQFSQFPPLPISGP-UHFFFAOYSA-N beta-carboxyaspartic acid Natural products OC(=O)C(N)C(C(O)=O)C(O)=O OQFSQFPPLPISGP-UHFFFAOYSA-N 0.000 description 3
- 150000001721 carbon Chemical group 0.000 description 3
- 235000011089 carbon dioxide Nutrition 0.000 description 3
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- SBBWEQLNKVHYCX-JTQLQIEISA-N ethyl L-tyrosinate Chemical compound CCOC(=O)[C@@H](N)CC1=CC=C(O)C=C1 SBBWEQLNKVHYCX-JTQLQIEISA-N 0.000 description 3
- 238000004108 freeze drying Methods 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 3
- XELZGAJCZANUQH-UHFFFAOYSA-N methyl 1-acetylthieno[3,2-c]pyrazole-5-carboxylate Chemical compound CC(=O)N1N=CC2=C1C=C(C(=O)OC)S2 XELZGAJCZANUQH-UHFFFAOYSA-N 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 239000012299 nitrogen atmosphere Substances 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 235000019198 oils Nutrition 0.000 description 3
- 210000002381 plasma Anatomy 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- 230000009467 reduction Effects 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 239000013557 residual solvent Substances 0.000 description 3
- 238000002390 rotary evaporation Methods 0.000 description 3
- 229920006395 saturated elastomer Polymers 0.000 description 3
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 description 3
- 229960001153 serine Drugs 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- 229960004441 tyrosine Drugs 0.000 description 3
- RCYLCZQGMUWCBV-JTQLQIEISA-N (2s)-2-azaniumyl-3-(3-iodophenyl)-2-methylpropanoate Chemical compound OC(=O)[C@](N)(C)CC1=CC=CC(I)=C1 RCYLCZQGMUWCBV-JTQLQIEISA-N 0.000 description 2
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 2
- OMGHIGVFLOPEHJ-UHFFFAOYSA-N 2,5-dihydro-1h-pyrrol-1-ium-2-carboxylate Chemical compound OC(=O)C1NCC=C1 OMGHIGVFLOPEHJ-UHFFFAOYSA-N 0.000 description 2
- WFIYPADYPQQLNN-UHFFFAOYSA-N 2-[2-(4-bromopyrazol-1-yl)ethyl]isoindole-1,3-dione Chemical compound C1=C(Br)C=NN1CCN1C(=O)C2=CC=CC=C2C1=O WFIYPADYPQQLNN-UHFFFAOYSA-N 0.000 description 2
- LUYLVPILJAHRJD-UHFFFAOYSA-N 2-aminohexa-4,5-dienoic acid Chemical compound OC(=O)C(N)CC=C=C LUYLVPILJAHRJD-UHFFFAOYSA-N 0.000 description 2
- YAQLSKVCTLCIIE-UHFFFAOYSA-N 2-bromobutyric acid Chemical compound CCC(Br)C(O)=O YAQLSKVCTLCIIE-UHFFFAOYSA-N 0.000 description 2
- FGSBNBBHOZHUBO-UHFFFAOYSA-N 2-oxoadipic acid Chemical compound OC(=O)CCCC(=O)C(O)=O FGSBNBBHOZHUBO-UHFFFAOYSA-N 0.000 description 2
- BAQRRRYYSFQKIF-UHFFFAOYSA-N 3-methyl-2-oxobutanoyl chloride Chemical compound CC(C)C(=O)C(Cl)=O BAQRRRYYSFQKIF-UHFFFAOYSA-N 0.000 description 2
- HGIOOMCLOWLFTJ-UHFFFAOYSA-N 3-phenyl-2-sulfanylpropanoic acid Chemical compound OC(=O)C(S)CC1=CC=CC=C1 HGIOOMCLOWLFTJ-UHFFFAOYSA-N 0.000 description 2
- HVCNXQOWACZAFN-UHFFFAOYSA-N 4-ethylmorpholine Chemical compound CCN1CCOCC1 HVCNXQOWACZAFN-UHFFFAOYSA-N 0.000 description 2
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- OWQJGHZBZCVNKT-UHFFFAOYSA-N 4-naphthalen-1-yl-2-oxobutanoic acid Chemical compound C1=CC=C2C(CCC(=O)C(=O)O)=CC=CC2=C1 OWQJGHZBZCVNKT-UHFFFAOYSA-N 0.000 description 2
- HFXAFXVXPMUQCQ-BYPYZUCNSA-N 4-oxo-L-proline Chemical compound OC(=O)[C@@H]1CC(=O)CN1 HFXAFXVXPMUQCQ-BYPYZUCNSA-N 0.000 description 2
- WPWUFUBLGADILS-WDSKDSINSA-N Ala-Pro Chemical compound C[C@H](N)C(=O)N1CCC[C@H]1C(O)=O WPWUFUBLGADILS-WDSKDSINSA-N 0.000 description 2
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 2
- UQBOJOOOTLPNST-UHFFFAOYSA-N Dehydroalanine Chemical compound NC(=C)C(O)=O UQBOJOOOTLPNST-UHFFFAOYSA-N 0.000 description 2
- BWGNESOTFCXPMA-UHFFFAOYSA-N Dihydrogen disulfide Chemical compound SS BWGNESOTFCXPMA-UHFFFAOYSA-N 0.000 description 2
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 2
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 2
- 229910003556 H2 SO4 Inorganic materials 0.000 description 2
- 108090000604 Hydrolases Proteins 0.000 description 2
- 102000004157 Hydrolases Human genes 0.000 description 2
- SNDPXSYFESPGGJ-UHFFFAOYSA-N L-norVal-OH Natural products CCCC(N)C(O)=O SNDPXSYFESPGGJ-UHFFFAOYSA-N 0.000 description 2
- AHLPHDHHMVZTML-UHFFFAOYSA-N Orn-delta-NH2 Natural products NCCCC(N)C(O)=O AHLPHDHHMVZTML-UHFFFAOYSA-N 0.000 description 2
- UTJLXEIPEHZYQJ-UHFFFAOYSA-N Ornithine Natural products OC(=O)C(C)CCCN UTJLXEIPEHZYQJ-UHFFFAOYSA-N 0.000 description 2
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 2
- 108090000783 Renin Proteins 0.000 description 2
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- ODHCTXKNWHHXJC-UHFFFAOYSA-N acide pyroglutamique Natural products OC(=O)C1CCC(=O)N1 ODHCTXKNWHHXJC-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 description 2
- 229940127088 antihypertensive drug Drugs 0.000 description 2
- 239000003963 antioxidant agent Substances 0.000 description 2
- 239000012300 argon atmosphere Substances 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 2
- 238000001574 biopsy Methods 0.000 description 2
- 125000001246 bromo group Chemical group Br* 0.000 description 2
- YTXNDJXECACZEL-QMMMGPOBSA-N butyl (2s)-pyrrolidine-2-carboxylate Chemical compound CCCCOC(=O)[C@@H]1CCCN1 YTXNDJXECACZEL-QMMMGPOBSA-N 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000001110 calcium chloride Substances 0.000 description 2
- 229910001628 calcium chloride Inorganic materials 0.000 description 2
- 235000011148 calcium chloride Nutrition 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 239000003610 charcoal Substances 0.000 description 2
- 239000003638 chemical reducing agent Substances 0.000 description 2
- 239000012230 colorless oil Substances 0.000 description 2
- 230000002860 competitive effect Effects 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- NZNMSOFKMUBTKW-UHFFFAOYSA-N cyclohexanecarboxylic acid Chemical compound OC(=O)C1CCCCC1 NZNMSOFKMUBTKW-UHFFFAOYSA-N 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- 235000018417 cysteine Nutrition 0.000 description 2
- XUJNEKJLAYXESH-UHFFFAOYSA-N cysteine Natural products SCC(N)C(O)=O XUJNEKJLAYXESH-UHFFFAOYSA-N 0.000 description 2
- 125000005982 diphenylmethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- MKRTXPORKIRPDG-UHFFFAOYSA-N diphenylphosphoryl azide Chemical compound C=1C=CC=CC=1P(=O)(N=[N+]=[N-])C1=CC=CC=C1 MKRTXPORKIRPDG-UHFFFAOYSA-N 0.000 description 2
- 150000002019 disulfides Chemical class 0.000 description 2
- PMMYEEVYMWASQN-UHFFFAOYSA-N dl-hydroxyproline Natural products OC1C[NH2+]C(C([O-])=O)C1 PMMYEEVYMWASQN-UHFFFAOYSA-N 0.000 description 2
- 238000000921 elemental analysis Methods 0.000 description 2
- 125000004185 ester group Chemical group 0.000 description 2
- JNTDLWHHJMGLGD-UHNVWZDZSA-N ethyl (2s,3r)-2-amino-3-hydroxybutanoate Chemical compound CCOC(=O)[C@@H](N)[C@@H](C)O JNTDLWHHJMGLGD-UHNVWZDZSA-N 0.000 description 2
- IIFWIQQBZUIBLR-UHFFFAOYSA-N ethyl 4-methyl-2-sulfanylhexanoate Chemical compound CCOC(=O)C(S)CC(C)CC IIFWIQQBZUIBLR-UHFFFAOYSA-N 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 210000003191 femoral vein Anatomy 0.000 description 2
- 238000001640 fractional crystallisation Methods 0.000 description 2
- 230000002496 gastric effect Effects 0.000 description 2
- 125000000291 glutamic acid group Chemical group N[C@@H](CCC(O)=O)C(=O)* 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 2
- 238000006698 hydrazinolysis reaction Methods 0.000 description 2
- 238000007327 hydrogenolysis reaction Methods 0.000 description 2
- 229960002591 hydroxyproline Drugs 0.000 description 2
- 239000005555 hypertensive agent Substances 0.000 description 2
- 239000003617 indole-3-acetic acid Substances 0.000 description 2
- 238000002329 infrared spectrum Methods 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 230000000968 intestinal effect Effects 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- HXEACLLIILLPRG-RXMQYKEDSA-N l-pipecolic acid Natural products OC(=O)[C@H]1CCCCN1 HXEACLLIILLPRG-RXMQYKEDSA-N 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- 125000001360 methionine group Chemical group N[C@@H](CCSC)C(=O)* 0.000 description 2
- IUXVIPGPIFGSEU-INIZCTEOSA-N methyl (2s)-2-amino-3-(4-phenylmethoxyphenyl)propanoate Chemical compound C1=CC(C[C@H](N)C(=O)OC)=CC=C1OCC1=CC=CC=C1 IUXVIPGPIFGSEU-INIZCTEOSA-N 0.000 description 2
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 2
- NKZNPRQIONEKPT-UHFFFAOYSA-N n,n-dimethyl-1-quinolin-2-ylmethanamine Chemical compound C1=CC=CC2=NC(CN(C)C)=CC=C21 NKZNPRQIONEKPT-UHFFFAOYSA-N 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 229960003104 ornithine Drugs 0.000 description 2
- 229960001639 penicillamine Drugs 0.000 description 2
- FDPIMTJIUBPUKL-UHFFFAOYSA-N pentan-3-one Chemical compound CCC(=O)CC FDPIMTJIUBPUKL-UHFFFAOYSA-N 0.000 description 2
- WEXRUCMBJFQVBZ-UHFFFAOYSA-N pentobarbital Chemical compound CCCC(C)C1(CC)C(=O)NC(=O)NC1=O WEXRUCMBJFQVBZ-UHFFFAOYSA-N 0.000 description 2
- LCPDWSOZIOUXRV-UHFFFAOYSA-N phenoxyacetic acid Chemical compound OC(=O)COC1=CC=CC=C1 LCPDWSOZIOUXRV-UHFFFAOYSA-N 0.000 description 2
- COLNVLDHVKWLRT-UHFFFAOYSA-N phenylalanine Natural products OC(=O)C(N)CC1=CC=CC=C1 COLNVLDHVKWLRT-UHFFFAOYSA-N 0.000 description 2
- 229920001467 poly(styrenesulfonates) Polymers 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000003755 preservative agent Substances 0.000 description 2
- 229940002612 prodrug Drugs 0.000 description 2
- 239000000651 prodrug Substances 0.000 description 2
- 235000019260 propionic acid Nutrition 0.000 description 2
- 229940095574 propionic acid Drugs 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical group CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- 235000018102 proteins Nutrition 0.000 description 2
- 102000004169 proteins and genes Human genes 0.000 description 2
- 108090000623 proteins and genes Proteins 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 229940076788 pyruvate Drugs 0.000 description 2
- 230000009257 reactivity Effects 0.000 description 2
- 229910001923 silver oxide Inorganic materials 0.000 description 2
- 239000012279 sodium borohydride Substances 0.000 description 2
- 229910000033 sodium borohydride Inorganic materials 0.000 description 2
- JHJLBTNAGRQEKS-UHFFFAOYSA-M sodium bromide Chemical compound [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 241000894007 species Species 0.000 description 2
- 150000003457 sulfones Chemical class 0.000 description 2
- 125000003375 sulfoxide group Chemical group 0.000 description 2
- 210000004243 sweat Anatomy 0.000 description 2
- DZLNHFMRPBPULJ-UHFFFAOYSA-N thioproline Chemical compound OC(=O)C1CSCN1 DZLNHFMRPBPULJ-UHFFFAOYSA-N 0.000 description 2
- 238000005292 vacuum distillation Methods 0.000 description 2
- 229960004295 valine Drugs 0.000 description 2
- 239000004474 valine Substances 0.000 description 2
- RILPIWOPNGRASR-UHFFFAOYSA-N (2R,3S)-2-Hydroxy-3-methylpentanoic acid Natural products CCC(C)C(O)C(O)=O RILPIWOPNGRASR-UHFFFAOYSA-N 0.000 description 1
- BJBUEDPLEOHJGE-UHFFFAOYSA-N (2R,3S)-3-Hydroxy-2-pyrolidinecarboxylic acid Natural products OC1CCNC1C(O)=O BJBUEDPLEOHJGE-UHFFFAOYSA-N 0.000 description 1
- MTCFGRXMJLQNBG-REOHCLBHSA-N (2S)-2-Amino-3-hydroxypropansäure Chemical compound OC[C@H](N)C(O)=O MTCFGRXMJLQNBG-REOHCLBHSA-N 0.000 description 1
- MXPBQQXWXZWBMK-LLVKDONJSA-N (2r)-2,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid Chemical compound CC(C)[C@](C)(C(O)=O)NC(=O)OC(C)(C)C MXPBQQXWXZWBMK-LLVKDONJSA-N 0.000 description 1
- PPNFGVZDIOCWDK-QMMMGPOBSA-N (2r)-2-amino-3-butylsulfanyl-2-methylpropanoic acid Chemical compound CCCCSC[C@](C)(N)C(O)=O PPNFGVZDIOCWDK-QMMMGPOBSA-N 0.000 description 1
- GJKFEQPZRZBOJH-JJNLEZRASA-N (2r,3s,4r,5r)-2-(hydroxymethyl)-5-[(4-methoxypyrimido[5,4-d]pyrimidin-8-yl)amino]oxolane-3,4-diol Chemical compound N1=CN=C2C(OC)=NC=NC2=C1N[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O GJKFEQPZRZBOJH-JJNLEZRASA-N 0.000 description 1
- DAOGFHQPAHSMQS-LURJTMIESA-N (2s)-1-propanoylpyrrolidine-2-carboxylic acid Chemical compound CCC(=O)N1CCC[C@H]1C(O)=O DAOGFHQPAHSMQS-LURJTMIESA-N 0.000 description 1
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- CVOSKVCEVPENOC-BYPYZUCNSA-N (2s)-2-[(4-amino-2-oxopyrimidin-1-yl)amino]propanoic acid Chemical compound OC(=O)[C@H](C)NN1C=CC(N)=NC1=O CVOSKVCEVPENOC-BYPYZUCNSA-N 0.000 description 1
- BYXRWAYRLQEIRT-VKHMYHEASA-N (2s)-2-amino-3-(2-amino-6-oxo-3h-purin-9-yl)propanoic acid Chemical compound N1=C(N)N=C2N(C[C@H](N)C(O)=O)C=NC2=C1O BYXRWAYRLQEIRT-VKHMYHEASA-N 0.000 description 1
- SUZCEFCFAIWLGL-VKHMYHEASA-N (2s)-2-amino-3-(2-amino-6-sulfanylidene-3h-purin-9-yl)propanoic acid Chemical compound N1=C(N)N=C2N(C[C@H](N)C(O)=O)C=NC2=C1S SUZCEFCFAIWLGL-VKHMYHEASA-N 0.000 description 1
- WVXAXDTZEMZHQB-BYPYZUCNSA-N (2s)-2-amino-3-(2-aminoethylamino)propanoic acid Chemical compound NCCNC[C@H](N)C(O)=O WVXAXDTZEMZHQB-BYPYZUCNSA-N 0.000 description 1
- LHQLWGWKBFFKJA-LURJTMIESA-N (2s)-2-amino-3-(2-chloropyridin-4-yl)propanoic acid Chemical compound OC(=O)[C@@H](N)CC1=CC=NC(Cl)=C1 LHQLWGWKBFFKJA-LURJTMIESA-N 0.000 description 1
- MXXMBZQIPZDATA-ZETCQYMHSA-N (2s)-2-amino-3-(3,4,5-triiodophenyl)propanoic acid Chemical compound OC(=O)[C@@H](N)CC1=CC(I)=C(I)C(I)=C1 MXXMBZQIPZDATA-ZETCQYMHSA-N 0.000 description 1
- NSCSKUVWGVFCLY-JTQLQIEISA-N (2s)-2-amino-3-(3-bromophenyl)-2-methylpropanoic acid Chemical compound OC(=O)[C@](N)(C)CC1=CC=CC(Br)=C1 NSCSKUVWGVFCLY-JTQLQIEISA-N 0.000 description 1
- IYEPWXAPHDCHBS-ZETCQYMHSA-N (2s)-2-amino-3-(3h-benzimidazol-5-yl)propanoic acid Chemical compound OC(=O)[C@@H](N)CC1=CC=C2N=CNC2=C1 IYEPWXAPHDCHBS-ZETCQYMHSA-N 0.000 description 1
- YTWNUUSHKAQWDZ-VKZKZBKNSA-N (2s)-2-amino-3-(4-nitroimidazol-4-yl)propanoic acid Chemical compound OC(=O)[C@@H](N)CC1([N+]([O-])=O)C=NC=N1 YTWNUUSHKAQWDZ-VKZKZBKNSA-N 0.000 description 1
- DKZIJCYVZNQMAU-QMMMGPOBSA-N (2s)-2-amino-3-(4-sulfanylphenyl)propanoic acid Chemical compound OC(=O)[C@@H](N)CC1=CC=C(S)C=C1 DKZIJCYVZNQMAU-QMMMGPOBSA-N 0.000 description 1
- AIEUDZOXAAZXGL-XFMWISLNSA-N (2s)-2-amino-3-[3,5-di(butan-2-yl)-4-(4-hydroxyphenoxy)phenyl]propanoic acid Chemical compound CCC(C)C1=CC(C[C@H](N)C(O)=O)=CC(C(C)CC)=C1OC1=CC=C(O)C=C1 AIEUDZOXAAZXGL-XFMWISLNSA-N 0.000 description 1
- XLZGQPNBZQUBNI-QMMMGPOBSA-N (2s)-2-amino-3-[3-[(2-chloroacetyl)amino]-4-fluorophenyl]propanoic acid Chemical compound OC(=O)[C@@H](N)CC1=CC=C(F)C(NC(=O)CCl)=C1 XLZGQPNBZQUBNI-QMMMGPOBSA-N 0.000 description 1
- LARNBHANOBFOGY-VIFPVBQESA-N (2s)-2-amino-3-[3-[(2-chloroacetyl)amino]phenyl]propanoic acid Chemical compound OC(=O)[C@@H](N)CC1=CC=CC(NC(=O)CCl)=C1 LARNBHANOBFOGY-VIFPVBQESA-N 0.000 description 1
- RECHJOLMOMKLOH-VIFPVBQESA-N (2s)-2-amino-3-[4-(2-bromoacetyl)phenyl]propanoic acid Chemical compound OC(=O)[C@@H](N)CC1=CC=C(C(=O)CBr)C=C1 RECHJOLMOMKLOH-VIFPVBQESA-N 0.000 description 1
- YLBUWMSKPUVSQD-SFHVURJKSA-N (2s)-2-amino-3-[4-(4-hydroxy-3-iodophenoxy)-3,5-di(propan-2-yl)phenyl]propanoic acid Chemical compound CC(C)C1=CC(C[C@H](N)C(O)=O)=CC(C(C)C)=C1OC1=CC=C(O)C(I)=C1 YLBUWMSKPUVSQD-SFHVURJKSA-N 0.000 description 1
- JTWXADIBIPMHML-IBGZPJMESA-N (2s)-2-amino-3-[4-(4-hydroxy-3-methylphenoxy)-3,5-di(propan-2-yl)phenyl]propanoic acid Chemical compound CC(C)C1=CC(C[C@H](N)C(O)=O)=CC(C(C)C)=C1OC1=CC=C(O)C(C)=C1 JTWXADIBIPMHML-IBGZPJMESA-N 0.000 description 1
- OXNUZCWFCJRJSU-VIFPVBQESA-N (2s)-2-amino-3-[4-(hydroxymethyl)phenyl]propanoic acid Chemical compound OC(=O)[C@@H](N)CC1=CC=C(CO)C=C1 OXNUZCWFCJRJSU-VIFPVBQESA-N 0.000 description 1
- YNLOZYCMUQNFNZ-VIFPVBQESA-N (2s)-2-amino-3-[4-[(2-bromoacetyl)amino]phenyl]propanoic acid Chemical compound OC(=O)[C@@H](N)CC1=CC=C(NC(=O)CBr)C=C1 YNLOZYCMUQNFNZ-VIFPVBQESA-N 0.000 description 1
- UAMWJYRYDNTFAQ-VKHMYHEASA-N (2s)-2-amino-3-methylidenebutanedioic acid Chemical compound OC(=O)[C@@H](N)C(=C)C(O)=O UAMWJYRYDNTFAQ-VKHMYHEASA-N 0.000 description 1
- KDNVHOLSAKGLRN-MQWKRIRWSA-N (2s)-2-amino-3-phenylbutanedioic acid Chemical compound OC(=O)[C@@H](N)C(C(O)=O)C1=CC=CC=C1 KDNVHOLSAKGLRN-MQWKRIRWSA-N 0.000 description 1
- DFZVZEMNPGABKO-ZETCQYMHSA-N (2s)-2-amino-3-pyridin-3-ylpropanoic acid Chemical compound OC(=O)[C@@H](N)CC1=CC=CN=C1 DFZVZEMNPGABKO-ZETCQYMHSA-N 0.000 description 1
- VWTFNYVAFGYEKI-QMMMGPOBSA-N (2s)-2-azaniumyl-3-(3,4-dimethoxyphenyl)propanoate Chemical compound COC1=CC=C(C[C@H](N)C(O)=O)C=C1OC VWTFNYVAFGYEKI-QMMMGPOBSA-N 0.000 description 1
- NZUDYFHZLHYSNU-LBPRGKRZSA-N (2s)-3-(1h-imidazol-5-yl)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid Chemical compound CC(C)(C)OC(=O)N[C@](C)(C(O)=O)CC1=CN=CN1 NZUDYFHZLHYSNU-LBPRGKRZSA-N 0.000 description 1
- VGMXFLMVEWSURV-MLWJPKLSSA-N (2s)-3-acetyl-2,6-diaminohexanoic acid Chemical compound OC(=O)[C@@H](N)C(C(=O)C)CCCN VGMXFLMVEWSURV-MLWJPKLSSA-N 0.000 description 1
- IAYDKLHSZNCWJF-SECBINFHSA-N (2s)-3-fluoro-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid Chemical compound CC(C)(C)OC(=O)N[C@](C)(CF)C(O)=O IAYDKLHSZNCWJF-SECBINFHSA-N 0.000 description 1
- RNXKXUOGQKYKTH-AKGZTFGVSA-N (2s)-4-methoxypyrrolidine-2-carboxylic acid Chemical compound COC1CN[C@H](C(O)=O)C1 RNXKXUOGQKYKTH-AKGZTFGVSA-N 0.000 description 1
- VVNYDCGZZSTUBC-LURJTMIESA-N (2s)-5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid Chemical compound CC(C)(C)OC(=O)N[C@H](C(O)=O)CCC(N)=O VVNYDCGZZSTUBC-LURJTMIESA-N 0.000 description 1
- SBAXTNNTHGLNJX-VKHMYHEASA-N (2s)-5-sulfanylidenepyrrolidine-2-carboxylic acid Chemical compound OC(=O)[C@@H]1CCC(=S)N1 SBAXTNNTHGLNJX-VKHMYHEASA-N 0.000 description 1
- JGFVXTWHJFFUJZ-QMMMGPOBSA-N (2s)-6-amino-2-(2-cyanoethylamino)hexanoic acid Chemical compound NCCCC[C@@H](C(O)=O)NCCC#N JGFVXTWHJFFUJZ-QMMMGPOBSA-N 0.000 description 1
- LJRDOKAZOAKLDU-UDXJMMFXSA-N (2s,3s,4r,5r,6r)-5-amino-2-(aminomethyl)-6-[(2r,3s,4r,5s)-5-[(1r,2r,3s,5r,6s)-3,5-diamino-2-[(2s,3r,4r,5s,6r)-3-amino-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-hydroxycyclohexyl]oxy-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl]oxyoxane-3,4-diol;sulfuric ac Chemical compound OS(O)(=O)=O.N[C@@H]1[C@@H](O)[C@H](O)[C@H](CN)O[C@@H]1O[C@H]1[C@@H](O)[C@H](O[C@H]2[C@@H]([C@@H](N)C[C@@H](N)[C@@H]2O)O[C@@H]2[C@@H]([C@@H](O)[C@H](O)[C@@H](CO)O2)N)O[C@@H]1CO LJRDOKAZOAKLDU-UDXJMMFXSA-N 0.000 description 1
- MPDDTAJMJCESGV-CTUHWIOQSA-M (3r,5r)-7-[2-(4-fluorophenyl)-5-[methyl-[(1r)-1-phenylethyl]carbamoyl]-4-propan-2-ylpyrazol-3-yl]-3,5-dihydroxyheptanoate Chemical compound C1([C@@H](C)N(C)C(=O)C2=NN(C(CC[C@@H](O)C[C@@H](O)CC([O-])=O)=C2C(C)C)C=2C=CC(F)=CC=2)=CC=CC=C1 MPDDTAJMJCESGV-CTUHWIOQSA-M 0.000 description 1
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 1
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 description 1
- GRZHHTYDZVRPIC-UHFFFAOYSA-N (benzyloxy)acetic acid Chemical compound OC(=O)COCC1=CC=CC=C1 GRZHHTYDZVRPIC-UHFFFAOYSA-N 0.000 description 1
- OVBFMEVBMNZIBR-UHFFFAOYSA-N -2-Methylpentanoic acid Natural products CCCC(C)C(O)=O OVBFMEVBMNZIBR-UHFFFAOYSA-N 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- FJQZXCPWAGYPSD-UHFFFAOYSA-N 1,3,4,6-tetrachloro-3a,6a-diphenylimidazo[4,5-d]imidazole-2,5-dione Chemical compound ClN1C(=O)N(Cl)C2(C=3C=CC=CC=3)N(Cl)C(=O)N(Cl)C12C1=CC=CC=C1 FJQZXCPWAGYPSD-UHFFFAOYSA-N 0.000 description 1
- USWVWJSAJAEEHQ-UHFFFAOYSA-N 1,3-benzodioxolyl-n-methylbutanamine Chemical compound CCC(NC)CC1=CC=C2OCOC2=C1 USWVWJSAJAEEHQ-UHFFFAOYSA-N 0.000 description 1
- ILROLYQPRYHHFG-UHFFFAOYSA-N 1-$l^{1}-oxidanylprop-2-en-1-one Chemical group [O]C(=O)C=C ILROLYQPRYHHFG-UHFFFAOYSA-N 0.000 description 1
- CWZUTHDJLNZLCM-DFBGVHRSSA-N 1-[2-[(1r,3s,5r)-3-[(6-bromopyridin-2-yl)carbamoyl]-2-azabicyclo[3.1.0]hexan-2-yl]-2-oxoethyl]indazole-3-carboxamide Chemical compound O=C([C@@H]1C[C@H]2C[C@H]2N1C(=O)CN1N=C(C2=CC=CC=C21)C(=O)N)NC1=CC=CC(Br)=N1 CWZUTHDJLNZLCM-DFBGVHRSSA-N 0.000 description 1
- APAZZDBYJISGLX-UHFFFAOYSA-N 1-bromo-4-phenylbutan-2-one Chemical compound BrCC(=O)CCC1=CC=CC=C1 APAZZDBYJISGLX-UHFFFAOYSA-N 0.000 description 1
- CYXGZZFAAUDHQL-UHFFFAOYSA-N 1-n,1-n'-dimethylpropane-1,1-diamine Chemical compound CCC(NC)NC CYXGZZFAAUDHQL-UHFFFAOYSA-N 0.000 description 1
- RZYHXKLKJRGJGP-UHFFFAOYSA-N 2,2,2-trifluoro-n,n-bis(trimethylsilyl)acetamide Chemical compound C[Si](C)(C)N([Si](C)(C)C)C(=O)C(F)(F)F RZYHXKLKJRGJGP-UHFFFAOYSA-N 0.000 description 1
- YXCLGWARFUDEKP-UHFFFAOYSA-N 2,3-dihydro-1H-indene-2,5-dicarboxylic acid Chemical compound C1C(CC2=CC(=CC=C12)C(=O)O)C(=O)O YXCLGWARFUDEKP-UHFFFAOYSA-N 0.000 description 1
- 125000004215 2,4-difluorophenyl group Chemical group [H]C1=C([H])C(*)=C(F)C([H])=C1F 0.000 description 1
- MFYDWPYKWOVTBO-UHFFFAOYSA-N 2,4-dihydroxypentan-3-one Chemical compound CC(O)C(=O)C(C)O MFYDWPYKWOVTBO-UHFFFAOYSA-N 0.000 description 1
- LYBUHXDWRMVACI-UHFFFAOYSA-N 2-(3-amino-3-carboxypropyl)-1,3-thiazole-4-carboxylic acid Chemical compound OC(=O)C(N)CCC1=NC(C(O)=O)=CS1 LYBUHXDWRMVACI-UHFFFAOYSA-N 0.000 description 1
- ZKJQQSJYTFEAPX-UHFFFAOYSA-N 2-(5-hydroxy-6-oxocyclohexa-2,4-dien-1-yl)propanoic acid Chemical compound O=C1C(C=CC=C1O)C(C(=O)O)C ZKJQQSJYTFEAPX-UHFFFAOYSA-N 0.000 description 1
- CXLSDGHWWXDHEE-UHFFFAOYSA-N 2-(dimethylazaniumyl)hexanoate Chemical compound CCCCC(N(C)C)C(O)=O CXLSDGHWWXDHEE-UHFFFAOYSA-N 0.000 description 1
- PPKAIMDMNWBOKN-UHFFFAOYSA-N 2-Oxo-4-phenylbutyric acid Chemical compound OC(=O)C(=O)CCC1=CC=CC=C1 PPKAIMDMNWBOKN-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- JKMHFZQWWAIEOD-UHFFFAOYSA-N 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid Chemical compound OCC[NH+]1CCN(CCS([O-])(=O)=O)CC1 JKMHFZQWWAIEOD-UHFFFAOYSA-N 0.000 description 1
- LLBKEUTWJFQRJU-UHFFFAOYSA-N 2-[4-(4-aminophenyl)sulfonylanilino]ethanol Chemical group C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(NCCO)C=C1 LLBKEUTWJFQRJU-UHFFFAOYSA-N 0.000 description 1
- LTLQSMNFQOAELQ-UHFFFAOYSA-N 2-amino-1,3-dihydroindene-2,5-dicarboxylic acid Chemical compound C1=C(C(O)=O)C=C2CC(N)(C(O)=O)CC2=C1 LTLQSMNFQOAELQ-UHFFFAOYSA-N 0.000 description 1
- YZLMTHNLBVMABH-UHFFFAOYSA-N 2-amino-2-bromo-6-[(2-methylpropan-2-yl)oxy]-6-oxohexanoic acid Chemical compound CC(C)(C)OC(=O)CCCC(N)(Br)C(O)=O YZLMTHNLBVMABH-UHFFFAOYSA-N 0.000 description 1
- QHSCIWIRXWFIGH-UHFFFAOYSA-N 2-amino-2-methylpentanedioic acid Chemical compound OC(=O)C(N)(C)CCC(O)=O QHSCIWIRXWFIGH-UHFFFAOYSA-N 0.000 description 1
- BEFUFPUMGNJZEV-UHFFFAOYSA-N 2-amino-3,3-dimethylhexa-4,5-dienoic acid Chemical compound C=C=CC(C)(C)C(N)C(O)=O BEFUFPUMGNJZEV-UHFFFAOYSA-N 0.000 description 1
- FNEBZSUXWSCLSN-UHFFFAOYSA-N 2-amino-3,3-dimethylnona-4,5-dienoic acid Chemical compound CCCC=C=CC(C)(C)C(N)C(O)=O FNEBZSUXWSCLSN-UHFFFAOYSA-N 0.000 description 1
- XNLKIKNNGCSKQU-UHFFFAOYSA-N 2-amino-3-(4-fluoroimidazol-4-yl)propanoic acid Chemical compound OC(=O)C(N)CC1(F)C=NC=N1 XNLKIKNNGCSKQU-UHFFFAOYSA-N 0.000 description 1
- QAAAJCNONHZRTG-UHFFFAOYSA-N 2-amino-3-chloropentanedioic acid Chemical compound OC(=O)C(N)C(Cl)CC(O)=O QAAAJCNONHZRTG-UHFFFAOYSA-N 0.000 description 1
- GOJUJUVQIVIZAV-UHFFFAOYSA-N 2-amino-4,6-dichloropyrimidine-5-carbaldehyde Chemical group NC1=NC(Cl)=C(C=O)C(Cl)=N1 GOJUJUVQIVIZAV-UHFFFAOYSA-N 0.000 description 1
- AKOINERHKFEQLT-UHFFFAOYSA-N 2-amino-4-(1h-pyrrol-2-yl)butanoic acid Chemical compound OC(=O)C(N)CCC1=CC=CN1 AKOINERHKFEQLT-UHFFFAOYSA-N 0.000 description 1
- GTUZDCUWVAGCRP-UHFFFAOYSA-N 2-amino-5,6-dihydroxy-1,3-dihydroindene-2-carboxylic acid Chemical compound OC1=C(O)C=C2CC(N)(C(O)=O)CC2=C1 GTUZDCUWVAGCRP-UHFFFAOYSA-N 0.000 description 1
- RKVIDZZUVZAELE-UHFFFAOYSA-N 2-amino-5-tert-butyl-6,6-dimethylhepta-3,4-dienoic acid Chemical compound CC(C)(C)C(C(C)(C)C)=C=CC(N)C(O)=O RKVIDZZUVZAELE-UHFFFAOYSA-N 0.000 description 1
- RCNXUZQBDZWLQS-UHFFFAOYSA-N 2-amino-7-[(2-methylpropan-2-yl)oxy]-7-oxo-2-sulfanylheptanoic acid Chemical compound C(=O)(OC(C)(C)C)CCCCC(C(=O)O)(S)N RCNXUZQBDZWLQS-UHFFFAOYSA-N 0.000 description 1
- OZELAETXNOXZOK-UHFFFAOYSA-N 2-aminodecanedioic acid Chemical compound OC(=O)C(N)CCCCCCCC(O)=O OZELAETXNOXZOK-UHFFFAOYSA-N 0.000 description 1
- CHXSDCXDWAXIBR-UHFFFAOYSA-N 2-aminohept-4-en-6-ynoic acid Chemical compound OC(=O)C(N)CC=CC#C CHXSDCXDWAXIBR-UHFFFAOYSA-N 0.000 description 1
- PHWDBZCRUNKABS-UHFFFAOYSA-N 2-aminohepta-4,5-dienoic acid Chemical compound CC=C=CCC(N)C(O)=O PHWDBZCRUNKABS-UHFFFAOYSA-N 0.000 description 1
- BKMMTJMQCTUHRP-UHFFFAOYSA-N 2-aminopropan-1-ol Chemical compound CC(N)CO BKMMTJMQCTUHRP-UHFFFAOYSA-N 0.000 description 1
- DEBQMEYEKKWIKC-UHFFFAOYSA-N 2-azaniumyl-3-(4-fluoro-1h-indol-3-yl)propanoate Chemical compound C1=CC(F)=C2C(CC(N)C(O)=O)=CNC2=C1 DEBQMEYEKKWIKC-UHFFFAOYSA-N 0.000 description 1
- XRARHOAIGIRUNR-UHFFFAOYSA-N 2-azaniumyl-5-methylhex-4-enoate Chemical compound CC(C)=CCC(N)C(O)=O XRARHOAIGIRUNR-UHFFFAOYSA-N 0.000 description 1
- GXQWQJTWVARFQS-UHFFFAOYSA-N 2-benzamidoacetic acid Chemical compound OC(=O)CNC(=O)C1=CC=CC=C1.OC(=O)CNC(=O)C1=CC=CC=C1 GXQWQJTWVARFQS-UHFFFAOYSA-N 0.000 description 1
- VKJQJNVYWGDEQN-UHFFFAOYSA-N 2-bromo-3-phenylmethoxypropanoic acid Chemical compound OC(=O)C(Br)COCC1=CC=CC=C1 VKJQJNVYWGDEQN-UHFFFAOYSA-N 0.000 description 1
- WDRSCFNERFONKU-UHFFFAOYSA-N 2-bromo-3-phenylpropanoic acid Chemical compound OC(=O)C(Br)CC1=CC=CC=C1 WDRSCFNERFONKU-UHFFFAOYSA-N 0.000 description 1
- MONMFXREYOKQTI-UHFFFAOYSA-N 2-bromopropanoic acid Chemical compound CC(Br)C(O)=O MONMFXREYOKQTI-UHFFFAOYSA-N 0.000 description 1
- SFWQHFXRVMKCLS-UHFFFAOYSA-N 2-imidazol-1-ylpropanoic acid Chemical compound OC(=O)C(C)N1C=CN=C1 SFWQHFXRVMKCLS-UHFFFAOYSA-N 0.000 description 1
- IASIQPSVWNZTGZ-UHFFFAOYSA-N 2-methyl-2-sulfanylpentanedioic acid Chemical compound OC(=O)C(S)(C)CCC(O)=O IASIQPSVWNZTGZ-UHFFFAOYSA-N 0.000 description 1
- YOETUEMZNOLGDB-UHFFFAOYSA-N 2-methylpropyl carbonochloridate Chemical compound CC(C)COC(Cl)=O YOETUEMZNOLGDB-UHFFFAOYSA-N 0.000 description 1
- 125000004810 2-methylpropylene group Chemical group [H]C([H])([H])C([H])(C([H])([H])[*:2])C([H])([H])[*:1] 0.000 description 1
- RSUOYCBRWUTZAO-UHFFFAOYSA-N 2-oxo-3-phenoxypropanoic acid Chemical compound OC(=O)C(=O)COC1=CC=CC=C1 RSUOYCBRWUTZAO-UHFFFAOYSA-N 0.000 description 1
- MLHLDFLQSMZQNK-UHFFFAOYSA-N 2-oxo-3-phenylpropanethioic s-acid Chemical compound SC(=O)C(=O)CC1=CC=CC=C1 MLHLDFLQSMZQNK-UHFFFAOYSA-N 0.000 description 1
- VUSMENNBCBGZQI-UHFFFAOYSA-N 2-oxopentanedial Chemical class O=CCCC(=O)C=O VUSMENNBCBGZQI-UHFFFAOYSA-N 0.000 description 1
- AUUTXOKCFQTKPL-UHFFFAOYSA-N 2-oxopropanoyl chloride Chemical compound CC(=O)C(Cl)=O AUUTXOKCFQTKPL-UHFFFAOYSA-N 0.000 description 1
- JTNCEQNHURODLX-UHFFFAOYSA-N 2-phenylethanimidamide Chemical compound NC(=N)CC1=CC=CC=C1 JTNCEQNHURODLX-UHFFFAOYSA-N 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- KETLEKPFYHJPIN-UHFFFAOYSA-N 3-(4-nitrophenyl)-2-sulfanylpropanoic acid Chemical compound OC(=O)C(S)CC1=CC=C([N+]([O-])=O)C=C1 KETLEKPFYHJPIN-UHFFFAOYSA-N 0.000 description 1
- CAOMCZAIALVUPA-UHFFFAOYSA-N 3-(methylthio)propionic acid Chemical compound CSCCC(O)=O CAOMCZAIALVUPA-UHFFFAOYSA-N 0.000 description 1
- VOIZNVUXCQLQHS-UHFFFAOYSA-N 3-bromobenzoic acid Chemical compound OC(=O)C1=CC=CC(Br)=C1 VOIZNVUXCQLQHS-UHFFFAOYSA-N 0.000 description 1
- 125000006305 3-iodophenyl group Chemical group [H]C1=C([H])C(I)=C([H])C(*)=C1[H] 0.000 description 1
- 125000004207 3-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(OC([H])([H])[H])=C1[H] 0.000 description 1
- 239000001388 3-methyl-2-oxobutanoic acid Substances 0.000 description 1
- 239000001668 3-methyl-2-oxopentanoic acid Substances 0.000 description 1
- JVQYSWDUAOAHFM-UHFFFAOYSA-N 3-methyl-2-oxovaleric acid Chemical compound CCC(C)C(=O)C(O)=O JVQYSWDUAOAHFM-UHFFFAOYSA-N 0.000 description 1
- AYZZGFLBVPUZQH-UHFFFAOYSA-N 4-(1h-indol-3-yl)-2-oxobutanoic acid Chemical compound C1=CC=C2C(CCC(=O)C(=O)O)=CNC2=C1 AYZZGFLBVPUZQH-UHFFFAOYSA-N 0.000 description 1
- ZKRDTNHGGOKJNM-UHFFFAOYSA-N 4-(3,4-dichlorophenyl)-2-oxobutanoic acid Chemical compound OC(=O)C(=O)CCC1=CC=C(Cl)C(Cl)=C1 ZKRDTNHGGOKJNM-UHFFFAOYSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- IKUXQTVUAQTSJA-UHFFFAOYSA-N 4-benzylsulfanylbutanoyl chloride Chemical compound ClC(=O)CCCSCC1=CC=CC=C1 IKUXQTVUAQTSJA-UHFFFAOYSA-N 0.000 description 1
- KKADPXVIOXHVKN-UHFFFAOYSA-N 4-hydroxyphenylpyruvic acid Chemical group OC(=O)C(=O)CC1=CC=C(O)C=C1 KKADPXVIOXHVKN-UHFFFAOYSA-N 0.000 description 1
- SFJWLUAGMZINFE-UHFFFAOYSA-N 4-methyl-2-oxopentanoyl chloride Chemical compound CC(C)CC(=O)C(Cl)=O SFJWLUAGMZINFE-UHFFFAOYSA-N 0.000 description 1
- DKCOYWUJPJQANX-UHFFFAOYSA-N 4-phenyl-2-sulfanylbutanoic acid Chemical compound OC(=O)C(S)CCC1=CC=CC=C1 DKCOYWUJPJQANX-UHFFFAOYSA-N 0.000 description 1
- BJFBOTPLASYWPD-UHFFFAOYSA-N 4-pyrrolidin-1-ylbut-2-ynoic acid Chemical compound OC(=O)C#CCN1CCCC1 BJFBOTPLASYWPD-UHFFFAOYSA-N 0.000 description 1
- OYNANFOWNSGDJL-UHFFFAOYSA-N 4-sulfanylpyrrolidin-1-ium-2-carboxylate Chemical compound OC(=O)C1CC(S)CN1 OYNANFOWNSGDJL-UHFFFAOYSA-N 0.000 description 1
- GIAPJCXSKMCTML-UHFFFAOYSA-N 5-amino-6-ethoxy-6-oxohexanoic acid Chemical compound CCOC(=O)C(N)CCCC(O)=O GIAPJCXSKMCTML-UHFFFAOYSA-N 0.000 description 1
- INPQIVHQSQUEAJ-UHFFFAOYSA-N 5-fluorotryptophan Chemical compound C1=C(F)C=C2C(CC(N)C(O)=O)=CNC2=C1 INPQIVHQSQUEAJ-UHFFFAOYSA-N 0.000 description 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- UIJIQXGRFSPYQW-UHFFFAOYSA-N 6-methylthiopurine Chemical group CSC1=NC=NC2=C1N=CN2 UIJIQXGRFSPYQW-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- 239000004925 Acrylic resin Substances 0.000 description 1
- 241000272514 Apteryx haastii Species 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 241000167854 Bourreria succulenta Species 0.000 description 1
- 101800004538 Bradykinin Proteins 0.000 description 1
- 102400000967 Bradykinin Human genes 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 229910014033 C-OH Inorganic materials 0.000 description 1
- 125000001433 C-terminal amino-acid group Chemical group 0.000 description 1
- OFFQJOKXZRRBQI-NSHDSACASA-N CC(C)(C)C1=C(C=CC(=C1)C[C@@H](C(=O)O)NC)O Chemical compound CC(C)(C)C1=C(C=CC(=C1)C[C@@H](C(=O)O)NC)O OFFQJOKXZRRBQI-NSHDSACASA-N 0.000 description 1
- YOKDVWWESDBOGV-QMMMGPOBSA-N CC(C)CN[C@@H](CCC(=O)O)C(=O)OC Chemical compound CC(C)CN[C@@H](CCC(=O)O)C(=O)OC YOKDVWWESDBOGV-QMMMGPOBSA-N 0.000 description 1
- 101150108928 CCC1 gene Proteins 0.000 description 1
- 101100350185 Caenorhabditis elegans odd-1 gene Proteins 0.000 description 1
- 102000000496 Carboxypeptidases A Human genes 0.000 description 1
- 108010080937 Carboxypeptidases A Proteins 0.000 description 1
- 241000238366 Cephalopoda Species 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- 206010011224 Cough Diseases 0.000 description 1
- 241000270311 Crocodylus niloticus Species 0.000 description 1
- 229910014570 C—OH Inorganic materials 0.000 description 1
- VVNCNSJFMMFHPL-VKHMYHEASA-N D-penicillamine Chemical compound CC(C)(S)[C@@H](N)C(O)=O VVNCNSJFMMFHPL-VKHMYHEASA-N 0.000 description 1
- XUIIKFGFIJCVMT-GFCCVEGCSA-N D-thyroxine Chemical compound IC1=CC(C[C@@H](N)C(O)=O)=CC(I)=C1OC1=CC(I)=C(O)C(I)=C1 XUIIKFGFIJCVMT-GFCCVEGCSA-N 0.000 description 1
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 description 1
- 108010016626 Dipeptides Proteins 0.000 description 1
- LVGKNOAMLMIIKO-UHFFFAOYSA-N Elaidinsaeure-aethylester Natural products CCCCCCCCC=CCCCCCCCC(=O)OCC LVGKNOAMLMIIKO-UHFFFAOYSA-N 0.000 description 1
- 108010059378 Endopeptidases Proteins 0.000 description 1
- 102000005593 Endopeptidases Human genes 0.000 description 1
- IYXGSMUGOJNHAZ-UHFFFAOYSA-N Ethyl malonate Chemical compound CCOC(=O)CC(=O)OCC IYXGSMUGOJNHAZ-UHFFFAOYSA-N 0.000 description 1
- 208000010201 Exanthema Diseases 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 102100040782 Glycerophosphodiester phosphodiesterase domain-containing protein 5 Human genes 0.000 description 1
- QXZGBUJJYSLZLT-UHFFFAOYSA-N H-Arg-Pro-Pro-Gly-Phe-Ser-Pro-Phe-Arg-OH Natural products NC(N)=NCCCC(N)C(=O)N1CCCC1C(=O)N1C(C(=O)NCC(=O)NC(CC=2C=CC=CC=2)C(=O)NC(CO)C(=O)N2C(CCC2)C(=O)NC(CC=2C=CC=CC=2)C(=O)NC(CCCN=C(N)N)C(O)=O)CCC1 QXZGBUJJYSLZLT-UHFFFAOYSA-N 0.000 description 1
- HTTJABKRGRZYRN-UHFFFAOYSA-N Heparin Chemical group OC1C(NC(=O)C)C(O)OC(COS(O)(=O)=O)C1OC1C(OS(O)(=O)=O)C(O)C(OC2C(C(OS(O)(=O)=O)C(OC3C(C(O)C(O)C(O3)C(O)=O)OS(O)(=O)=O)C(CO)O2)NS(O)(=O)=O)C(C(O)=O)O1 HTTJABKRGRZYRN-UHFFFAOYSA-N 0.000 description 1
- MMFKFJORZBJVNF-UWVGGRQHSA-N His-Leu Chemical group CC(C)C[C@@H](C(O)=O)NC(=O)[C@@H](N)CC1=CN=CN1 MMFKFJORZBJVNF-UWVGGRQHSA-N 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- 101001038855 Homo sapiens Glycerophosphodiester phosphodiesterase domain-containing protein 5 Proteins 0.000 description 1
- PMMYEEVYMWASQN-DMTCNVIQSA-N Hydroxyproline Chemical compound O[C@H]1CN[C@H](C(O)=O)C1 PMMYEEVYMWASQN-DMTCNVIQSA-N 0.000 description 1
- 229920002153 Hydroxypropyl cellulose Polymers 0.000 description 1
- 206010020751 Hypersensitivity Diseases 0.000 description 1
- SNDPXSYFESPGGJ-BYPYZUCNSA-N L-2-aminopentanoic acid Chemical compound CCC[C@H](N)C(O)=O SNDPXSYFESPGGJ-BYPYZUCNSA-N 0.000 description 1
- AHLPHDHHMVZTML-BYPYZUCNSA-N L-Ornithine Chemical compound NCCC[C@H](N)C(O)=O AHLPHDHHMVZTML-BYPYZUCNSA-N 0.000 description 1
- AGPKZVBTJJNPAG-UHNVWZDZSA-N L-allo-Isoleucine Chemical compound CC[C@@H](C)[C@H](N)C(O)=O AGPKZVBTJJNPAG-UHNVWZDZSA-N 0.000 description 1
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 1
- JTTHKOPSMAVJFE-VIFPVBQESA-N L-homophenylalanine Chemical compound OC(=O)[C@@H](N)CCC1=CC=CC=C1 JTTHKOPSMAVJFE-VIFPVBQESA-N 0.000 description 1
- FORGMRSGVSYZQR-YFKPBYRVSA-N L-leucinamide Chemical compound CC(C)C[C@H](N)C(N)=O FORGMRSGVSYZQR-YFKPBYRVSA-N 0.000 description 1
- HXEACLLIILLPRG-YFKPBYRVSA-N L-pipecolic acid Chemical compound [O-]C(=O)[C@@H]1CCCC[NH2+]1 HXEACLLIILLPRG-YFKPBYRVSA-N 0.000 description 1
- VLJNHYLEOZPXFW-BYPYZUCNSA-N L-prolinamide Chemical compound NC(=O)[C@@H]1CCCN1 VLJNHYLEOZPXFW-BYPYZUCNSA-N 0.000 description 1
- VHVGNTVUSQUXPS-YUMQZZPRSA-N L-threo-3-phenylserine Chemical group [O-]C(=O)[C@@H]([NH3+])[C@@H](O)C1=CC=CC=C1 VHVGNTVUSQUXPS-YUMQZZPRSA-N 0.000 description 1
- OUYCCCASQSFEME-QMMMGPOBSA-N L-tyrosine Chemical compound OC(=O)[C@@H](N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-QMMMGPOBSA-N 0.000 description 1
- KZSNJWFQEVHDMF-BYPYZUCNSA-N L-valine Chemical compound CC(C)[C@H](N)C(O)=O KZSNJWFQEVHDMF-BYPYZUCNSA-N 0.000 description 1
- RQVLGLPAZTUBKX-VKHMYHEASA-N L-vinylglycine Chemical compound C=C[C@H](N)C(O)=O RQVLGLPAZTUBKX-VKHMYHEASA-N 0.000 description 1
- 240000007472 Leucaena leucocephala Species 0.000 description 1
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 1
- ROHFNLRQFUQHCH-UHFFFAOYSA-N Leucine Natural products CC(C)CC(N)C(O)=O ROHFNLRQFUQHCH-UHFFFAOYSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-L Malonate Chemical compound [O-]C(=O)CC([O-])=O OFOBLEOULBTSOW-UHFFFAOYSA-L 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- MGJKQDOBUOMPEZ-UHFFFAOYSA-N N,N'-dimethylurea Chemical compound CNC(=O)NC MGJKQDOBUOMPEZ-UHFFFAOYSA-N 0.000 description 1
- MMOXZBCLCQITDF-UHFFFAOYSA-N N,N-diethyl-m-toluamide Chemical compound CCN(CC)C(=O)C1=CC=CC(C)=C1 MMOXZBCLCQITDF-UHFFFAOYSA-N 0.000 description 1
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-diisopropylethylamine Substances CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 1
- SUAKHGWARZSWIH-UHFFFAOYSA-N N,N‐diethylformamide Chemical compound CCN(CC)C=O SUAKHGWARZSWIH-UHFFFAOYSA-N 0.000 description 1
- NPKSPKHJBVJUKB-UHFFFAOYSA-N N-phenylglycine Chemical compound OC(=O)CNC1=CC=CC=C1 NPKSPKHJBVJUKB-UHFFFAOYSA-N 0.000 description 1
- KNTFCRCCPLEUQZ-VKHMYHEASA-N O-methylserine Chemical compound COC[C@H](N)C(O)=O KNTFCRCCPLEUQZ-VKHMYHEASA-N 0.000 description 1
- GEJCIRQLMVVEDX-UHFFFAOYSA-N OOPO Chemical compound OOPO GEJCIRQLMVVEDX-UHFFFAOYSA-N 0.000 description 1
- 101150004094 PRO2 gene Proteins 0.000 description 1
- 229910021078 Pd—O Inorganic materials 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- 241000036848 Porzana carolina Species 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 206010037660 Pyrexia Diseases 0.000 description 1
- ODHCTXKNWHHXJC-GSVOUGTGSA-N Pyroglutamic acid Natural products OC(=O)[C@H]1CCC(=O)N1 ODHCTXKNWHHXJC-GSVOUGTGSA-N 0.000 description 1
- 208000001647 Renal Insufficiency Diseases 0.000 description 1
- MTCFGRXMJLQNBG-UHFFFAOYSA-N Serine Natural products OCC(N)C(O)=O MTCFGRXMJLQNBG-UHFFFAOYSA-N 0.000 description 1
- 241000270295 Serpentes Species 0.000 description 1
- 102000005686 Serum Globulins Human genes 0.000 description 1
- 108010045362 Serum Globulins Proteins 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- AYFVYJQAPQTCCC-UHFFFAOYSA-N Threonine Natural products CC(O)C(N)C(O)=O AYFVYJQAPQTCCC-UHFFFAOYSA-N 0.000 description 1
- MSCCTZZBYHQMQJ-AZAGJHQNSA-N Tocopheryl nicotinate Chemical compound C([C@@](OC1=C(C)C=2C)(C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C)CC1=C(C)C=2OC(=O)C1=CC=CN=C1 MSCCTZZBYHQMQJ-AZAGJHQNSA-N 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- 102100031083 Uteroglobin Human genes 0.000 description 1
- 108090000203 Uteroglobin Proteins 0.000 description 1
- KZSNJWFQEVHDMF-UHFFFAOYSA-N Valine Natural products CC(C)C(N)C(O)=O KZSNJWFQEVHDMF-UHFFFAOYSA-N 0.000 description 1
- 101000870345 Vasconcellea cundinamarcensis Cysteine proteinase 1 Proteins 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical group [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- SORGEQQSQGNZFI-UHFFFAOYSA-N [azido(phenoxy)phosphoryl]oxybenzene Chemical compound C=1C=CC=CC=1OP(=O)(N=[N+]=[N-])OC1=CC=CC=C1 SORGEQQSQGNZFI-UHFFFAOYSA-N 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- WDJHALXBUFZDSR-UHFFFAOYSA-N acetoacetic acid Chemical compound CC(=O)CC(O)=O WDJHALXBUFZDSR-UHFFFAOYSA-N 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 238000005904 alkaline hydrolysis reaction Methods 0.000 description 1
- 125000006350 alkyl thio alkyl group Chemical group 0.000 description 1
- 239000000956 alloy Substances 0.000 description 1
- 229910045601 alloy Inorganic materials 0.000 description 1
- 150000001370 alpha-amino acid derivatives Chemical class 0.000 description 1
- 150000001371 alpha-amino acids Chemical class 0.000 description 1
- 230000002862 amidating effect Effects 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- JINBYESILADKFW-UHFFFAOYSA-N aminomalonic acid Chemical compound OC(=O)C(N)C(O)=O JINBYESILADKFW-UHFFFAOYSA-N 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 239000003674 animal food additive Substances 0.000 description 1
- 230000000890 antigenic effect Effects 0.000 description 1
- 235000006708 antioxidants Nutrition 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 150000007860 aryl ester derivatives Chemical class 0.000 description 1
- 235000003704 aspartic acid Nutrition 0.000 description 1
- 239000012131 assay buffer Substances 0.000 description 1
- 125000002393 azetidinyl group Chemical group 0.000 description 1
- 125000000649 benzylidene group Chemical group [H]C(=[*])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- RTGHRDFWYQHVFW-UHFFFAOYSA-N beta-Ketoadipic acid Natural products OC(=O)CCC(=O)CC(O)=O RTGHRDFWYQHVFW-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 238000004166 bioassay Methods 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- QXZGBUJJYSLZLT-FDISYFBBSA-N bradykinin Chemical compound NC(=N)NCCC[C@H](N)C(=O)N1CCC[C@H]1C(=O)N1[C@H](C(=O)NCC(=O)N[C@@H](CC=2C=CC=CC=2)C(=O)N[C@@H](CO)C(=O)N2[C@@H](CCC2)C(=O)N[C@@H](CC=2C=CC=CC=2)C(=O)N[C@@H](CCCNC(N)=N)C(O)=O)CCC1 QXZGBUJJYSLZLT-FDISYFBBSA-N 0.000 description 1
- 230000031709 bromination Effects 0.000 description 1
- 238000005893 bromination reaction Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- RBHJBMIOOPYDBQ-UHFFFAOYSA-N carbon dioxide;propan-2-one Chemical compound O=C=O.CC(C)=O RBHJBMIOOPYDBQ-UHFFFAOYSA-N 0.000 description 1
- JYYOBHFYCIDXHH-UHFFFAOYSA-N carbonic acid;hydrate Chemical compound O.OC(O)=O JYYOBHFYCIDXHH-UHFFFAOYSA-N 0.000 description 1
- 125000004181 carboxyalkyl group Chemical group 0.000 description 1
- 210000001715 carotid artery Anatomy 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 239000003729 cation exchange resin Substances 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 101150091908 cdiA gene Proteins 0.000 description 1
- 230000001413 cellular effect Effects 0.000 description 1
- 235000019693 cherries Nutrition 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- FZFAMSAMCHXGEF-UHFFFAOYSA-N chloro formate Chemical compound ClOC=O FZFAMSAMCHXGEF-UHFFFAOYSA-N 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 230000015271 coagulation Effects 0.000 description 1
- 238000005345 coagulation Methods 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000003240 coconut oil Substances 0.000 description 1
- 235000019864 coconut oil Nutrition 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- JNGZXGGOCLZBFB-IVCQMTBJSA-N compound E Chemical compound N([C@@H](C)C(=O)N[C@@H]1C(N(C)C2=CC=CC=C2C(C=2C=CC=CC=2)=N1)=O)C(=O)CC1=CC(F)=CC(F)=C1 JNGZXGGOCLZBFB-IVCQMTBJSA-N 0.000 description 1
- 235000009508 confectionery Nutrition 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 239000007822 coupling agent Substances 0.000 description 1
- 125000004802 cyanophenyl group Chemical group 0.000 description 1
- VZFUCHSFHOYXIS-UHFFFAOYSA-N cycloheptane carboxylic acid Natural products OC(=O)C1CCCCCC1 VZFUCHSFHOYXIS-UHFFFAOYSA-N 0.000 description 1
- 125000002150 cyclohexa-1,4-dienyl group Chemical group [H]C1=C([H])C([H])(*)C([H])=C([H])C1([H])[H] 0.000 description 1
- WUESWDIHTKHGQA-UHFFFAOYSA-N cyclohexylurea Chemical compound NC(=O)NC1CCCCC1 WUESWDIHTKHGQA-UHFFFAOYSA-N 0.000 description 1
- 125000004851 cyclopentylmethyl group Chemical group C1(CCCC1)C* 0.000 description 1
- 238000010908 decantation Methods 0.000 description 1
- 239000007857 degradation product Substances 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 230000000994 depressogenic effect Effects 0.000 description 1
- 238000010511 deprotection reaction Methods 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- WVPKAWVFTPWPDB-UHFFFAOYSA-M dichlorophosphinate Chemical compound [O-]P(Cl)(Cl)=O WVPKAWVFTPWPDB-UHFFFAOYSA-M 0.000 description 1
- NGRAIMFUWGFAEM-UHFFFAOYSA-N diethyl 2-oxopentanedioate Chemical compound CCOC(=O)CCC(=O)C(=O)OCC NGRAIMFUWGFAEM-UHFFFAOYSA-N 0.000 description 1
- 125000004212 difluorophenyl group Chemical group 0.000 description 1
- 125000006371 dihalo methyl group Chemical group 0.000 description 1
- 239000000539 dimer Substances 0.000 description 1
- 238000006471 dimerization reaction Methods 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- AZBNFLZFSZDPQF-UHFFFAOYSA-L disodium;[4-[4-(sulfinatomethylamino)phenyl]sulfonylanilino]methanesulfinate Chemical compound [Na+].[Na+].C1=CC(NCS(=O)[O-])=CC=C1S(=O)(=O)C1=CC=C(NCS([O-])=O)C=C1 AZBNFLZFSZDPQF-UHFFFAOYSA-L 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000001962 electrophoresis Methods 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 230000002255 enzymatic effect Effects 0.000 description 1
- HHFAWKCIHAUFRX-UHFFFAOYSA-N ethoxide Chemical compound CC[O-] HHFAWKCIHAUFRX-UHFFFAOYSA-N 0.000 description 1
- VZMQTNWZEYXCEH-KRWDZBQOSA-N ethyl (2S)-2-amino-3-(2-benzylphenyl)propanoate Chemical compound CCOC(=O)[C@@H](N)Cc1ccccc1Cc1ccccc1 VZMQTNWZEYXCEH-KRWDZBQOSA-N 0.000 description 1
- YVKSGVDJQXLXDV-BYPYZUCNSA-N ethyl (2r)-2-amino-3-sulfanylpropanoate Chemical compound CCOC(=O)[C@@H](N)CS YVKSGVDJQXLXDV-BYPYZUCNSA-N 0.000 description 1
- RCUYHYDTFXMONZ-RGURZIINSA-N ethyl (2s)-2-amino-3-hydroxy-3-phenylpropanoate Chemical compound CCOC(=O)[C@@H](N)C(O)C1=CC=CC=C1 RCUYHYDTFXMONZ-RGURZIINSA-N 0.000 description 1
- NQAGYKGGQHDABK-NSHDSACASA-N ethyl (2s)-2-amino-3-phenylmethoxypropanoate Chemical compound CCOC(=O)[C@@H](N)COCC1=CC=CC=C1 NQAGYKGGQHDABK-NSHDSACASA-N 0.000 description 1
- ROBXZHNBBCHEIQ-BYPYZUCNSA-N ethyl (2s)-2-aminopropanoate Chemical compound CCOC(=O)[C@H](C)N ROBXZHNBBCHEIQ-BYPYZUCNSA-N 0.000 description 1
- ZRBNETYZYOXTLS-YFKPBYRVSA-N ethyl (4r)-1,3-thiazolidine-4-carboxylate Chemical compound CCOC(=O)[C@@H]1CSCN1 ZRBNETYZYOXTLS-YFKPBYRVSA-N 0.000 description 1
- XIMFCGSNSKXPBO-UHFFFAOYSA-N ethyl 2-bromobutanoate Chemical compound CCOC(=O)C(Br)CC XIMFCGSNSKXPBO-UHFFFAOYSA-N 0.000 description 1
- HBOGUIFRIAXYNB-UHFFFAOYSA-N ethyl 2-hydroxy-3-phenylpropanoate Chemical compound CCOC(=O)C(O)CC1=CC=CC=C1 HBOGUIFRIAXYNB-UHFFFAOYSA-N 0.000 description 1
- 239000002024 ethyl acetate extract Substances 0.000 description 1
- DNJIEGIFACGWOD-UHFFFAOYSA-N ethyl mercaptane Natural products CCS DNJIEGIFACGWOD-UHFFFAOYSA-N 0.000 description 1
- LVGKNOAMLMIIKO-QXMHVHEDSA-N ethyl oleate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OCC LVGKNOAMLMIIKO-QXMHVHEDSA-N 0.000 description 1
- 229940093471 ethyl oleate Drugs 0.000 description 1
- 125000004705 ethylthio group Chemical group C(C)S* 0.000 description 1
- 201000005884 exanthem Diseases 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 210000003722 extracellular fluid Anatomy 0.000 description 1
- 239000010685 fatty oil Substances 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000019634 flavors Nutrition 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 101150110969 gap1 gene Proteins 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 230000001434 glomerular Effects 0.000 description 1
- 125000003630 glycyl group Chemical group [H]N([H])C([H])([H])C(*)=O 0.000 description 1
- 125000002795 guanidino group Chemical group C(N)(=N)N* 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229960002897 heparin Drugs 0.000 description 1
- 229920000669 heparin Polymers 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- IPCSVZSSVZVIGE-UHFFFAOYSA-M hexadecanoate Chemical compound CCCCCCCCCCCCCCCC([O-])=O IPCSVZSSVZVIGE-UHFFFAOYSA-M 0.000 description 1
- HNDVDQJCIGZPNO-UHFFFAOYSA-N histidine Natural products OC(=O)C(N)CC1=CN=CN1 HNDVDQJCIGZPNO-UHFFFAOYSA-N 0.000 description 1
- 108010025306 histidylleucine Proteins 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 239000001863 hydroxypropyl cellulose Substances 0.000 description 1
- 235000010977 hydroxypropyl cellulose Nutrition 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 230000003053 immunization Effects 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 238000000099 in vitro assay Methods 0.000 description 1
- 230000002779 inactivation Effects 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000007912 intraperitoneal administration Methods 0.000 description 1
- 239000007928 intraperitoneal injection Substances 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 229960000310 isoleucine Drugs 0.000 description 1
- 235000014705 isoleucine Nutrition 0.000 description 1
- AGPKZVBTJJNPAG-UHFFFAOYSA-N isoleucine Natural products CCC(C)C(N)C(O)=O AGPKZVBTJJNPAG-UHFFFAOYSA-N 0.000 description 1
- 125000000741 isoleucyl group Chemical group [H]N([H])C(C(C([H])([H])[H])C([H])([H])C([H])([H])[H])C(=O)O* 0.000 description 1
- GCHPUFAZSONQIV-UHFFFAOYSA-N isovaline Chemical compound CCC(C)(N)C(O)=O GCHPUFAZSONQIV-UHFFFAOYSA-N 0.000 description 1
- 125000000468 ketone group Chemical group 0.000 description 1
- 210000003734 kidney Anatomy 0.000 description 1
- 238000011862 kidney biopsy Methods 0.000 description 1
- 201000006370 kidney failure Diseases 0.000 description 1
- 125000001909 leucine group Chemical group [H]N(*)C(C(*)=O)C([H])([H])C(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 230000010534 mechanism of action Effects 0.000 description 1
- VHRYZQNGTZXDNX-UHFFFAOYSA-N methacryloyl chloride Chemical compound CC(=C)C(Cl)=O VHRYZQNGTZXDNX-UHFFFAOYSA-N 0.000 description 1
- 229930182817 methionine Natural products 0.000 description 1
- MBOJFMMTOKMYMT-QMMMGPOBSA-N methyl (2s)-2-amino-3-(4-hydroxy-3-iodophenyl)propanoate Chemical group COC(=O)[C@@H](N)CC1=CC=C(O)C(I)=C1 MBOJFMMTOKMYMT-QMMMGPOBSA-N 0.000 description 1
- ACEONLNNWKIPTM-UHFFFAOYSA-N methyl 2-bromopropanoate Chemical compound COC(=O)C(C)Br ACEONLNNWKIPTM-UHFFFAOYSA-N 0.000 description 1
- RMAHPRNLQIRHIJ-UHFFFAOYSA-N methyl carbamimidate Chemical compound COC(N)=N RMAHPRNLQIRHIJ-UHFFFAOYSA-N 0.000 description 1
- 125000004092 methylthiomethyl group Chemical group [H]C([H])([H])SC([H])([H])* 0.000 description 1
- DUWWHGPELOTTOE-UHFFFAOYSA-N n-(5-chloro-2,4-dimethoxyphenyl)-3-oxobutanamide Chemical compound COC1=CC(OC)=C(NC(=O)CC(C)=O)C=C1Cl DUWWHGPELOTTOE-UHFFFAOYSA-N 0.000 description 1
- HWYHDWGGACRVEH-UHFFFAOYSA-N n-methyl-n-(4-pyrrolidin-1-ylbut-2-ynyl)acetamide Chemical compound CC(=O)N(C)CC#CCN1CCCC1 HWYHDWGGACRVEH-UHFFFAOYSA-N 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 229940127073 nucleoside analogue Drugs 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 150000002892 organic cations Chemical class 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 238000010525 oxidative degradation reaction Methods 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- HFHZKZSRXITVMK-UHFFFAOYSA-N oxyphenbutazone Chemical compound O=C1C(CCCC)C(=O)N(C=2C=CC=CC=2)N1C1=CC=C(O)C=C1 HFHZKZSRXITVMK-UHFFFAOYSA-N 0.000 description 1
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 230000008506 pathogenesis Effects 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 229940049954 penicillin Drugs 0.000 description 1
- OTIJNTWWDCIUNM-UHFFFAOYSA-N pentanethioic s-acid Chemical compound CCCCC(S)=O OTIJNTWWDCIUNM-UHFFFAOYSA-N 0.000 description 1
- 229960001412 pentobarbital Drugs 0.000 description 1
- 150000004965 peroxy acids Chemical class 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 239000003279 phenylacetic acid Substances 0.000 description 1
- 229960003424 phenylacetic acid Drugs 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 1
- 125000000612 phthaloyl group Chemical group C(C=1C(C(=O)*)=CC=CC1)(=O)* 0.000 description 1
- 230000035479 physiological effects, processes and functions Effects 0.000 description 1
- 230000006461 physiological response Effects 0.000 description 1
- HXEACLLIILLPRG-UHFFFAOYSA-N pipecolic acid Chemical compound OC(=O)C1CCCCN1 HXEACLLIILLPRG-UHFFFAOYSA-N 0.000 description 1
- 235000013446 pixi Nutrition 0.000 description 1
- 229920001184 polypeptide Polymers 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910000343 potassium bisulfate Inorganic materials 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- OTYBMLCTZGSZBG-UHFFFAOYSA-L potassium sulfate Chemical compound [K+].[K+].[O-]S([O-])(=O)=O OTYBMLCTZGSZBG-UHFFFAOYSA-L 0.000 description 1
- 229910052939 potassium sulfate Inorganic materials 0.000 description 1
- 235000011151 potassium sulphates Nutrition 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 230000002335 preservative effect Effects 0.000 description 1
- 150000003140 primary amides Chemical class 0.000 description 1
- MFDFERRIHVXMIY-UHFFFAOYSA-N procaine Chemical class CCN(CC)CCOC(=O)C1=CC=C(N)C=C1 MFDFERRIHVXMIY-UHFFFAOYSA-N 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- MWWATHDPGQKSAR-UHFFFAOYSA-N propyne Chemical group CC#C MWWATHDPGQKSAR-UHFFFAOYSA-N 0.000 description 1
- 239000012264 purified product Substances 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 238000010791 quenching Methods 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 206010037844 rash Diseases 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 230000002207 retinal effect Effects 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- 238000012552 review Methods 0.000 description 1
- 239000011435 rock Substances 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 150000003354 serine derivatives Chemical class 0.000 description 1
- 125000003607 serino group Chemical group [H]N([H])[C@]([H])(C(=O)[*])C(O[H])([H])[H] 0.000 description 1
- 239000008159 sesame oil Substances 0.000 description 1
- 235000011803 sesame oil Nutrition 0.000 description 1
- WBHQBSYUUJJSRZ-UHFFFAOYSA-M sodium bisulfate Chemical compound [Na+].OS([O-])(=O)=O WBHQBSYUUJJSRZ-UHFFFAOYSA-M 0.000 description 1
- 229910000342 sodium bisulfate Inorganic materials 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- HYHCSLBZRBJJCH-UHFFFAOYSA-M sodium hydrosulfide Chemical compound [Na+].[SH-] HYHCSLBZRBJJCH-UHFFFAOYSA-M 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 239000012064 sodium phosphate buffer Substances 0.000 description 1
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical class O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 239000008279 sol Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 238000012289 standard assay Methods 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 239000008174 sterile solution Substances 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 125000003107 substituted aryl group Chemical group 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 238000010189 synthetic method Methods 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- NPDBDJFLKKQMCM-UHFFFAOYSA-N tert-butylglycine Chemical compound CC(C)(C)C(N)C(O)=O NPDBDJFLKKQMCM-UHFFFAOYSA-N 0.000 description 1
- WROMPOXWARCANT-UHFFFAOYSA-N tfa trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.OC(=O)C(F)(F)F WROMPOXWARCANT-UHFFFAOYSA-N 0.000 description 1
- 150000007970 thio esters Chemical class 0.000 description 1
- 150000003573 thiols Chemical class 0.000 description 1
- NJRXVEJTAYWCQJ-UHFFFAOYSA-N thiomalic acid Chemical compound OC(=O)CC(S)C(O)=O NJRXVEJTAYWCQJ-UHFFFAOYSA-N 0.000 description 1
- LLSXISZUAPHAJQ-ZETCQYMHSA-N thiophen-2-yl (2s)-pyrrolidine-2-carboxylate Chemical compound O=C([C@H]1NCCC1)OC1=CC=CS1 LLSXISZUAPHAJQ-ZETCQYMHSA-N 0.000 description 1
- SSHZPMNEJZUOKK-UHFFFAOYSA-N thiophen-2-yl propanoate Chemical compound CCC(=O)OC1=CC=CS1 SSHZPMNEJZUOKK-UHFFFAOYSA-N 0.000 description 1
- 229940034208 thyroxine Drugs 0.000 description 1
- XUIIKFGFIJCVMT-UHFFFAOYSA-N thyroxine-binding globulin Natural products IC1=CC(CC([NH3+])C([O-])=O)=CC(I)=C1OC1=CC(I)=C(O)C(I)=C1 XUIIKFGFIJCVMT-UHFFFAOYSA-N 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
- 229950009883 tocopheryl nicotinate Drugs 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- BJBUEDPLEOHJGE-IMJSIDKUSA-N trans-3-hydroxy-L-proline Chemical compound O[C@H]1CC[NH2+][C@@H]1C([O-])=O BJBUEDPLEOHJGE-IMJSIDKUSA-N 0.000 description 1
- ZBZJXHCVGLJWFG-UHFFFAOYSA-N trichloromethyl(.) Chemical compound Cl[C](Cl)Cl ZBZJXHCVGLJWFG-UHFFFAOYSA-N 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- OUYCCCASQSFEME-UHFFFAOYSA-N tyrosine Natural products OC(=O)C(N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-UHFFFAOYSA-N 0.000 description 1
- 125000001493 tyrosinyl group Chemical group [H]OC1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])(N([H])[H])C(*)=O 0.000 description 1
- 210000002700 urine Anatomy 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 239000002435 venom Substances 0.000 description 1
- 210000001048 venom Anatomy 0.000 description 1
- 231100000611 venom Toxicity 0.000 description 1
- 239000011782 vitamin Substances 0.000 description 1
- 235000013343 vitamin Nutrition 0.000 description 1
- 229940088594 vitamin Drugs 0.000 description 1
- 229930003231 vitamin Natural products 0.000 description 1
- 235000019155 vitamin A Nutrition 0.000 description 1
- 239000011719 vitamin A Substances 0.000 description 1
- 150000003722 vitamin derivatives Chemical class 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- DGVVWUTYPXICAM-UHFFFAOYSA-N β‐Mercaptoethanol Chemical compound OCCS DGVVWUTYPXICAM-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07K—PEPTIDES
- C07K5/00—Peptides containing up to four amino acids in a fully defined sequence; Derivatives thereof
- C07K5/02—Peptides containing up to four amino acids in a fully defined sequence; Derivatives thereof containing at least one abnormal peptide link
- C07K5/022—Peptides containing up to four amino acids in a fully defined sequence; Derivatives thereof containing at least one abnormal peptide link containing the structure -X-C(=O)-(C)n-N-C-C(=O)-Y-; X and Y being heteroatoms; n being 1 or 2
- C07K5/0222—Peptides containing up to four amino acids in a fully defined sequence; Derivatives thereof containing at least one abnormal peptide link containing the structure -X-C(=O)-(C)n-N-C-C(=O)-Y-; X and Y being heteroatoms; n being 1 or 2 with the first amino acid being heterocyclic, e.g. Pro, Trp
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K38/00—Medicinal preparations containing peptides
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Genetics & Genomics (AREA)
- Biochemistry (AREA)
- Biophysics (AREA)
- General Health & Medical Sciences (AREA)
- Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Molecular Biology (AREA)
- Proteomics, Peptides & Aminoacids (AREA)
- Life Sciences & Earth Sciences (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Peptides Or Proteins (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US18799280A | 1980-09-17 | 1980-09-17 | |
| US29513581A | 1981-08-21 | 1981-08-21 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| PT73685A PT73685A (en) | 1981-10-01 |
| PT73685B true PT73685B (pt) | 2003-12-31 |
Family
ID=26883623
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PT73685A PT73685B (pt) | 1980-09-17 | 1981-09-16 | Processo para a preparacao de novos peptidos de carboxialquilo e tioesteres e eteres de peptidos como agentes antihipertensivos |
Country Status (8)
| Country | Link |
|---|---|
| EP (1) | EP0048159A3 (OSRAM) |
| AU (1) | AU7529581A (OSRAM) |
| DD (1) | DD201777A5 (OSRAM) |
| ES (2) | ES514672A0 (OSRAM) |
| GR (1) | GR75019B (OSRAM) |
| NO (1) | NO813153L (OSRAM) |
| PL (4) | PL238472A1 (OSRAM) |
| PT (1) | PT73685B (OSRAM) |
Families Citing this family (56)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2480747A1 (fr) * | 1980-04-17 | 1981-10-23 | Roques Bernard | Derives d'acides amines et leur application therapeutique |
| IE54551B1 (en) * | 1982-01-22 | 1989-11-22 | Ici Plc | Amide derivatives |
| JPS6058233B2 (ja) * | 1982-05-24 | 1985-12-19 | 田辺製薬株式会社 | 2−オキソイミダゾリジン誘導体及びその製法 |
| AU1643283A (en) * | 1982-07-19 | 1984-01-26 | E.R. Squibb & Sons, Inc. | Substituted peptides |
| US4500713A (en) * | 1982-09-23 | 1985-02-19 | Usv Pharmaceutical Corporation | Therapeutic dipeptides |
| FI841052A7 (fi) * | 1983-03-16 | 1984-09-17 | Usv Pharma Corp | Foereningar foer behandling av blodtryckssjukdomar. |
| EP0127124A3 (en) * | 1983-05-23 | 1987-04-08 | Usv Pharmaceutical Corporation | Compounds for treating hypertension |
| US4574079A (en) * | 1983-05-27 | 1986-03-04 | Gavras Haralambos P | Radiolabeled angiotensin converting enzyme inhibitors for radiolabeling mammalian organ sites |
| IT1165464B (it) * | 1983-07-29 | 1987-04-22 | Montedison Spa | Composti ad attivita' antidotica per la difesa di colture di interesse agrario dall'azione di erbicidi non selettivi |
| US4665052A (en) * | 1984-03-27 | 1987-05-12 | Merck & Co., Inc. | Renin inhibitors containing homophe8 and a C-terminal amide cycle |
| US4668663A (en) * | 1984-03-27 | 1987-05-26 | Merck & Co., Inc. | Renin inhibitors containing homophe8 |
| DE3413710A1 (de) * | 1984-04-12 | 1985-10-24 | Hoechst Ag, 6230 Frankfurt | Verfahren zur behandlung der herzinsuffizienz |
| US5684016A (en) * | 1984-04-12 | 1997-11-04 | Hoechst Aktiengesellschaft | Method of treating cardiac insufficiency |
| US4500518A (en) * | 1984-04-19 | 1985-02-19 | E. R. Squibb & Sons, Inc. | Amino thiol dipeptides |
| US4560506A (en) * | 1984-05-25 | 1985-12-24 | E. R. Squibb & Sons, Inc. | Mercaptocycloalkylcarbonyl and mercaptoarylcarbonyl dipeptides |
| GB8422165D0 (en) * | 1984-09-01 | 1984-10-03 | Wellcome Found | Compounds |
| AU578489B2 (en) * | 1984-09-12 | 1988-10-27 | Rorer Pharmaceutical Corporation | Proline derivatives |
| DE3436386A1 (de) * | 1984-10-04 | 1986-04-10 | Merck Patent Gmbh, 6100 Darmstadt | (thio)morpholine |
| IT1176983B (it) * | 1984-10-16 | 1987-08-26 | Zambon Spa | Dipeptidi ad attivita' farmacologica |
| CH672792A5 (OSRAM) * | 1985-02-19 | 1989-12-29 | Sandoz Ag | |
| ATE72431T1 (de) * | 1985-08-31 | 1992-02-15 | Fisons Plc | 5-gliedrige heterocyclische angiotensinumwandlungsenzym-inhibitoren. |
| US5231080A (en) * | 1985-10-15 | 1993-07-27 | Hoechst Aktiengesellschaft | Method for the treatment of atherosclerosis, thrombosis, and peripheral vessel disease |
| US5231084A (en) * | 1986-03-27 | 1993-07-27 | Hoechst Aktiengesellschaft | Compounds having a cognition adjuvant action, agents containing them, and the use thereof for the treatment and prophylaxis of cognitive dysfuncitons |
| IT1206078B (it) * | 1987-06-03 | 1989-04-14 | Polifarma Spa | Procedimento per la produzione di acido 3-indolpiruvico e suoi derivati loro uso farmaceutico |
| DE3803225A1 (de) * | 1988-02-04 | 1989-08-17 | Hoechst Ag | Aminosaeureamide mit psychotroper wirkung, verfahren zu ihrer herstellung, sie enthaltende mittel und deren verwendung |
| US5563277A (en) * | 1994-12-21 | 1996-10-08 | Eli Lilly And Company | Process for preparing benzyl-substituted rhodanine derivatives |
| US5859031A (en) | 1995-06-07 | 1999-01-12 | Gpi Nil Holdings, Inc. | Small molecule inhibitors of rotamase enzyme activity |
| GB2324527B (en) * | 1995-06-07 | 1999-12-22 | Guilford Pharm Inc | Small molecule inhibitors of rotamase enzyme activity |
| US7056935B2 (en) | 1995-06-07 | 2006-06-06 | Gpi Nil Holdings, Inc. | Rotamase enzyme activity inhibitors |
| US5801197A (en) * | 1995-10-31 | 1998-09-01 | Gpi Nil Holdings, Inc. | Rotamase enzyme activity inhibitors |
| US5801187A (en) * | 1996-09-25 | 1998-09-01 | Gpi-Nil Holdings, Inc. | Heterocyclic esters and amides |
| US6218424B1 (en) | 1996-09-25 | 2001-04-17 | Gpi Nil Holdings, Inc. | Heterocyclic ketone and thioester compounds and uses |
| US5786378A (en) * | 1996-09-25 | 1998-07-28 | Gpi Nil Holdings, Inc. | Heterocyclic thioesters |
| US6271244B1 (en) | 1998-06-03 | 2001-08-07 | Gpi Nil Holdings, Inc. | N-linked urea or carbamate of heterocyclic thioester hair growth compositions and uses |
| US6187784B1 (en) | 1998-06-03 | 2001-02-13 | Gpi Nil Holdings, Inc. | Pipecolic acid derivative hair growth compositions and uses |
| US20010049381A1 (en) | 1997-06-04 | 2001-12-06 | Gpl Nil Holdings, Inc., | Pyrrolidine derivative hair growth compositions and uses |
| US6274602B1 (en) | 1998-06-03 | 2001-08-14 | Gpi Nil Holdings, Inc. | Heterocyclic thioester and ketone hair growth compositions and uses |
| US6187796B1 (en) | 1998-06-03 | 2001-02-13 | Gpi Nil Holdings, Inc. | Sulfone hair growth compositions and uses |
| US5945441A (en) | 1997-06-04 | 1999-08-31 | Gpi Nil Holdings, Inc. | Pyrrolidine carboxylate hair revitalizing agents |
| CZ291417B6 (cs) * | 1997-08-06 | 2003-03-12 | Dsm Fine Chemicals Austria Nfg Gmbh & Co Kg | Způsob výroby 1-pyruvyl-L-prolinu |
| US6331537B1 (en) | 1998-06-03 | 2001-12-18 | Gpi Nil Holdings, Inc. | Carboxylic acids and carboxylic acid isosteres of N-heterocyclic compounds |
| US6429215B1 (en) | 1998-06-03 | 2002-08-06 | Gpi Nil Holdings, Inc. | N-oxide of heterocyclic ester, amide, thioester, or ketone hair growth compositions and uses |
| US6172087B1 (en) | 1998-06-03 | 2001-01-09 | Gpi Nil Holding, Inc. | N-oxide of heterocyclic ester, amide, thioester, or ketone hair growth compositions and uses |
| US6274617B1 (en) | 1998-06-03 | 2001-08-14 | Gpi Nil Holdings, Inc. | Heterocyclic ester and amide hair growth compositions and uses |
| US6376517B1 (en) | 1998-08-14 | 2002-04-23 | Gpi Nil Holdings, Inc. | Pipecolic acid derivatives for vision and memory disorders |
| US6384056B1 (en) | 1998-08-14 | 2002-05-07 | Gpi Nil Holdings, Inc. | Heterocyclic thioesters or ketones for vision and memory disorders |
| US6395758B1 (en) | 1998-08-14 | 2002-05-28 | Gpi Nil Holdings, Inc. | Small molecule carbamates or ureas for vision and memory disorders |
| US6506788B1 (en) | 1998-08-14 | 2003-01-14 | Gpi Nil Holdings, Inc. | N-linked urea or carbamate of heterocyclic thioesters for vision and memory disorders |
| US6399648B1 (en) | 1998-08-14 | 2002-06-04 | Gpi Nil Holdings, Inc. | N-oxides of heterocyclic ester, amide, thioester, or ketone for vision and memory disorders |
| US6218423B1 (en) | 1998-08-14 | 2001-04-17 | Gpi Nil Holdings, Inc. | Pyrrolidine derivatives for vision and memory disorders |
| US6337340B1 (en) | 1998-08-14 | 2002-01-08 | Gpi Nil Holdings, Inc. | Carboxylic acids and isosteres of heterocyclic ring compounds having multiple heteroatoms for vision and memory disorders |
| US6339101B1 (en) | 1998-08-14 | 2002-01-15 | Gpi Nil Holdings, Inc. | N-linked sulfonamides of N-heterocyclic carboxylic acids or isosteres for vision and memory disorders |
| US6333340B1 (en) | 1998-08-14 | 2001-12-25 | Gpi Nil Holdings, Inc. | Small molecule sulfonamides for vision and memory disorders |
| US6335348B1 (en) | 1998-08-14 | 2002-01-01 | Gpi Nil Holdings, Inc. | Nitrogen-containing linear and azepinyl/ compositions and uses for vision and memory disorders |
| US7338976B1 (en) | 1998-08-14 | 2008-03-04 | Gpi Nil Holdings, Inc. | Heterocyclic esters or amides for vision and memory disorders |
| US6462072B1 (en) | 1998-09-21 | 2002-10-08 | Gpi Nil Holdings, Inc. | Cyclic ester or amide derivatives |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IL58849A (en) * | 1978-12-11 | 1983-03-31 | Merck & Co Inc | Carboxyalkyl dipeptides and derivatives thereof,their preparation and pharmaceutical compositions containing them |
| JPS5683483A (en) * | 1979-12-13 | 1981-07-08 | Santen Pharmaceut Co Ltd | Thiazolidine compound |
-
1981
- 1981-09-15 GR GR66073A patent/GR75019B/el unknown
- 1981-09-15 EP EP81304210A patent/EP0048159A3/en not_active Withdrawn
- 1981-09-16 NO NO813153A patent/NO813153L/no unknown
- 1981-09-16 PT PT73685A patent/PT73685B/pt not_active IP Right Cessation
- 1981-09-16 AU AU75295/81A patent/AU7529581A/en not_active Abandoned
- 1981-09-17 PL PL23847281A patent/PL238472A1/xx unknown
- 1981-09-17 PL PL23306081A patent/PL233060A1/xx unknown
- 1981-09-17 DD DD81233368A patent/DD201777A5/de unknown
- 1981-09-17 PL PL23847181A patent/PL238471A1/xx unknown
- 1981-09-17 PL PL23847081A patent/PL238470A1/xx unknown
-
1982
- 1982-08-02 ES ES514672A patent/ES514672A0/es active Granted
- 1982-08-02 ES ES514664A patent/ES8306097A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| ES8306098A1 (es) | 1983-05-01 |
| PL238470A1 (en) | 1983-08-29 |
| AU7529581A (en) | 1982-03-25 |
| ES514664A0 (es) | 1983-05-01 |
| PL238471A1 (en) | 1983-08-29 |
| PL238472A1 (en) | 1983-08-29 |
| PL233060A1 (en) | 1983-01-31 |
| EP0048159A3 (en) | 1982-05-12 |
| ES8306097A1 (es) | 1983-05-01 |
| GR75019B (OSRAM) | 1984-07-12 |
| EP0048159A2 (en) | 1982-03-24 |
| DD201777A5 (de) | 1983-08-10 |
| ES514672A0 (es) | 1983-05-01 |
| NO813153L (no) | 1982-03-18 |
| PT73685A (en) | 1981-10-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PT73685B (pt) | Processo para a preparacao de novos peptidos de carboxialquilo e tioesteres e eteres de peptidos como agentes antihipertensivos | |
| JP2700511B2 (ja) | Hivプロテアーゼ阻害剤 | |
| US4692458A (en) | Anti-hypertensive agents | |
| US4692459A (en) | Anti-hypertensive agents | |
| US4745124A (en) | Orally effective anti-hypertensive agents | |
| SU1433415A3 (ru) | Способ получени пептидов | |
| PT701568E (pt) | Novos derivados de peptidos | |
| WO1992022523A2 (en) | Peptide derivatives of collagenase inhibitor | |
| JP2586942B2 (ja) | 哺乳動物コラゲナーゼの合成阻止剤 | |
| PT100563A (pt) | Ligandos tri-tetra- e pentapeptidicos do receptor da anafilatoxina, terminalmente modificados, composicoes farmaceuticas e uso | |
| IE49653B1 (en) | Mercaptoacyldipeptides | |
| US6313094B1 (en) | β-amino-α-hydroxycarboxylic acid derivatives and HIV protease inhibitors | |
| EP0322633B1 (en) | Mercapto-acylamino acid antihypertensives | |
| US4496540A (en) | Therapeutic compounds | |
| EP0036713B1 (en) | Angiotensin converting enzyme inhibitors | |
| US4734420A (en) | Anti-hypertensive agents | |
| US5190921A (en) | Amino acids and peptides having a modified tyrosine residue, their preparation and their application as medicaments | |
| US4833152A (en) | Anti-hypertensive agents | |
| US4690936A (en) | Anti-hypertensive agents | |
| US4636560A (en) | Amino thiol peptides | |
| PT723974E (pt) | Derivados de mercaptoalcanoildipeptidos processo para a sua preparacao e as composicoes farmaceuticas que os contem | |
| JPH01246257A (ja) | 3―チオプロピオン酸誘導体の製造法 | |
| US4690940A (en) | Anti-hypertensive agents | |
| JPH0419228B2 (OSRAM) | ||
| JPH0730020B2 (ja) | N置換アミノ酸イミド誘導体、製法並びに用途 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| FG3A | Patent granted, date of granting |
Effective date: 20031031 |
|
| MM3A | Annulment or lapse |
Effective date: 20060502 |