PT643045E - Derivados de quinoleina como antagonistas de leucotrienos - Google Patents
Derivados de quinoleina como antagonistas de leucotrienos Download PDFInfo
- Publication number
- PT643045E PT643045E PT94810504T PT94810504T PT643045E PT 643045 E PT643045 E PT 643045E PT 94810504 T PT94810504 T PT 94810504T PT 94810504 T PT94810504 T PT 94810504T PT 643045 E PT643045 E PT 643045E
- Authority
- PT
- Portugal
- Prior art keywords
- lower alkyl
- quinolinylmethoxy
- acid
- formula
- compound
- Prior art date
Links
- 239000005557 antagonist Substances 0.000 title description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical class N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 title 1
- 229940027991 antiseptic and disinfectant quinoline derivative Drugs 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims abstract description 178
- 229910052786 argon Inorganic materials 0.000 claims abstract description 13
- 229910052727 yttrium Inorganic materials 0.000 claims abstract description 6
- 150000003839 salts Chemical class 0.000 claims description 66
- 125000000217 alkyl group Chemical group 0.000 claims description 50
- -1 7-Trifluoromethyl-2-quinolinylmethoxy Chemical group 0.000 claims description 46
- 125000003545 alkoxy group Chemical group 0.000 claims description 33
- 239000001257 hydrogen Substances 0.000 claims description 31
- 229910052739 hydrogen Inorganic materials 0.000 claims description 31
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 31
- 229910052760 oxygen Inorganic materials 0.000 claims description 19
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 18
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 17
- 229910052736 halogen Inorganic materials 0.000 claims description 16
- 150000002367 halogens Chemical class 0.000 claims description 16
- 239000000460 chlorine Substances 0.000 claims description 14
- 229910052717 sulfur Inorganic materials 0.000 claims description 14
- 125000001989 1,3-phenylene group Chemical group [H]C1=C([H])C([*:1])=C([H])C([*:2])=C1[H] 0.000 claims description 12
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 9
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 8
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 8
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 8
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 7
- 239000011737 fluorine Substances 0.000 claims description 7
- 229910052731 fluorine Inorganic materials 0.000 claims description 7
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 229910052801 chlorine Inorganic materials 0.000 claims description 6
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 3
- CCQQISILGFBECU-UHFFFAOYSA-N 2,2-diethyl-4-oxo-4-[3-(quinolin-2-ylmethoxy)anilino]butanoic acid Chemical compound CCC(CC)(C(O)=O)CC(=O)NC1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 CCQQISILGFBECU-UHFFFAOYSA-N 0.000 claims description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 2
- 239000003199 leukotriene receptor blocking agent Substances 0.000 abstract description 2
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 122
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 78
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 75
- 239000000243 solution Substances 0.000 description 60
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 57
- 239000013078 crystal Substances 0.000 description 46
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 45
- 239000000203 mixture Substances 0.000 description 42
- 239000004480 active ingredient Substances 0.000 description 41
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 40
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 31
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 28
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 26
- BTANRVKWQNVYAZ-UHFFFAOYSA-N butan-2-ol Chemical compound CCC(C)O BTANRVKWQNVYAZ-UHFFFAOYSA-N 0.000 description 24
- 239000007858 starting material Substances 0.000 description 24
- WKRCUUPMCASSBN-UHFFFAOYSA-N 2,2-diethylbutanedioic acid Chemical compound CCC(CC)(C(O)=O)CC(O)=O WKRCUUPMCASSBN-UHFFFAOYSA-N 0.000 description 22
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 22
- 239000000741 silica gel Substances 0.000 description 22
- 229910002027 silica gel Inorganic materials 0.000 description 22
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 21
- 239000002253 acid Substances 0.000 description 20
- 238000002425 crystallisation Methods 0.000 description 19
- 230000008025 crystallization Effects 0.000 description 19
- 238000000034 method Methods 0.000 description 19
- 238000002360 preparation method Methods 0.000 description 19
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 16
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 16
- 239000011734 sodium Substances 0.000 description 16
- 229910052938 sodium sulfate Inorganic materials 0.000 description 16
- 235000011152 sodium sulphate Nutrition 0.000 description 16
- 238000001704 evaporation Methods 0.000 description 15
- 230000008020 evaporation Effects 0.000 description 15
- 239000002244 precipitate Substances 0.000 description 15
- 239000000047 product Substances 0.000 description 15
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 14
- 239000007787 solid Substances 0.000 description 14
- CWLKGDAVCFYWJK-UHFFFAOYSA-N 3-aminophenol Chemical compound NC1=CC=CC(O)=C1 CWLKGDAVCFYWJK-UHFFFAOYSA-N 0.000 description 13
- 229940018563 3-aminophenol Drugs 0.000 description 13
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 12
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 12
- 238000010992 reflux Methods 0.000 description 12
- 239000002904 solvent Substances 0.000 description 12
- 239000000725 suspension Substances 0.000 description 12
- RLGTYGPIHUQRLV-UHFFFAOYSA-N 3-[(7-fluoroquinolin-2-yl)methoxy]aniline Chemical compound NC1=CC=CC(OCC=2N=C3C=C(F)C=CC3=CC=2)=C1 RLGTYGPIHUQRLV-UHFFFAOYSA-N 0.000 description 11
- 150000001412 amines Chemical class 0.000 description 11
- 238000006243 chemical reaction Methods 0.000 description 11
- 238000001914 filtration Methods 0.000 description 11
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Substances [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 11
- 239000011780 sodium chloride Substances 0.000 description 11
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 10
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 10
- 239000012346 acetyl chloride Substances 0.000 description 10
- 239000002585 base Substances 0.000 description 10
- 239000000825 pharmaceutical preparation Substances 0.000 description 10
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 9
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 9
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 9
- 241001465754 Metazoa Species 0.000 description 9
- 239000007864 aqueous solution Substances 0.000 description 9
- 239000008101 lactose Substances 0.000 description 9
- 239000003380 propellant Substances 0.000 description 9
- 239000011541 reaction mixture Substances 0.000 description 9
- 239000003826 tablet Substances 0.000 description 9
- 239000007832 Na2SO4 Substances 0.000 description 8
- SPWVRYZQLGQKGK-UHFFFAOYSA-N dichloromethane;hexane Chemical compound ClCCl.CCCCCC SPWVRYZQLGQKGK-UHFFFAOYSA-N 0.000 description 8
- YEESKJGWJFYOOK-IJHYULJSSA-N leukotriene D4 Chemical compound CCCCC\C=C/C\C=C/C=C/C=C/[C@H]([C@@H](O)CCCC(O)=O)SC[C@H](N)C(=O)NCC(O)=O YEESKJGWJFYOOK-IJHYULJSSA-N 0.000 description 8
- 239000000843 powder Substances 0.000 description 8
- 238000003756 stirring Methods 0.000 description 8
- 238000012360 testing method Methods 0.000 description 8
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 8
- 238000005160 1H NMR spectroscopy Methods 0.000 description 7
- 239000007788 liquid Substances 0.000 description 7
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 7
- 239000000126 substance Substances 0.000 description 7
- 239000000454 talc Substances 0.000 description 7
- 235000012222 talc Nutrition 0.000 description 7
- 229910052623 talc Inorganic materials 0.000 description 7
- LIBJDZLMEPZABX-UHFFFAOYSA-N 3,3-diethyloxolane-2,5-dione Chemical compound CCC1(CC)CC(=O)OC1=O LIBJDZLMEPZABX-UHFFFAOYSA-N 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 6
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 6
- 239000000443 aerosol Substances 0.000 description 6
- 150000008064 anhydrides Chemical class 0.000 description 6
- 235000019359 magnesium stearate Nutrition 0.000 description 6
- 229910052708 sodium Inorganic materials 0.000 description 6
- 239000001632 sodium acetate Substances 0.000 description 6
- 235000017281 sodium acetate Nutrition 0.000 description 6
- UGPQPVWABPCSIP-UHFFFAOYSA-N 2-(bromomethyl)-6-fluoroquinoline Chemical compound N1=C(CBr)C=CC2=CC(F)=CC=C21 UGPQPVWABPCSIP-UHFFFAOYSA-N 0.000 description 5
- YHUBQGZOSVRSJN-UHFFFAOYSA-N 2-(bromomethyl)-7-fluoroquinoline Chemical compound C1=CC(CBr)=NC2=CC(F)=CC=C21 YHUBQGZOSVRSJN-UHFFFAOYSA-N 0.000 description 5
- 229920002261 Corn starch Polymers 0.000 description 5
- 239000008120 corn starch Substances 0.000 description 5
- 239000008298 dragée Substances 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 239000000839 emulsion Substances 0.000 description 5
- 239000003921 oil Substances 0.000 description 5
- 229920001223 polyethylene glycol Polymers 0.000 description 5
- 239000003381 stabilizer Substances 0.000 description 5
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 5
- 238000005406 washing Methods 0.000 description 5
- VQONZJTWIQNLSW-UHFFFAOYSA-N 2-(bromomethyl)-8-fluoroquinoline Chemical compound C1=C(CBr)N=C2C(F)=CC=CC2=C1 VQONZJTWIQNLSW-UHFFFAOYSA-N 0.000 description 4
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 4
- KDRJGJOSRASMJK-UHFFFAOYSA-N 3-ethyl-3-methoxycarbonylpentanoic acid Chemical compound OC(=O)CC(CC)(CC)C(=O)OC KDRJGJOSRASMJK-UHFFFAOYSA-N 0.000 description 4
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 4
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 4
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 4
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 4
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- 229920002472 Starch Polymers 0.000 description 4
- 239000002775 capsule Substances 0.000 description 4
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 230000008602 contraction Effects 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 229920000159 gelatin Polymers 0.000 description 4
- 239000007903 gelatin capsule Substances 0.000 description 4
- 235000019322 gelatine Nutrition 0.000 description 4
- 239000008187 granular material Substances 0.000 description 4
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 4
- 239000000543 intermediate Substances 0.000 description 4
- 238000005342 ion exchange Methods 0.000 description 4
- 150000002617 leukotrienes Chemical class 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- 235000019198 oils Nutrition 0.000 description 4
- 239000002674 ointment Substances 0.000 description 4
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 4
- 239000008194 pharmaceutical composition Substances 0.000 description 4
- 239000000546 pharmaceutical excipient Substances 0.000 description 4
- OAHKWDDSKCRNFE-UHFFFAOYSA-N phenylmethanesulfonyl chloride Chemical compound ClS(=O)(=O)CC1=CC=CC=C1 OAHKWDDSKCRNFE-UHFFFAOYSA-N 0.000 description 4
- 229920001592 potato starch Polymers 0.000 description 4
- 235000011121 sodium hydroxide Nutrition 0.000 description 4
- 235000019698 starch Nutrition 0.000 description 4
- 230000000699 topical effect Effects 0.000 description 4
- KFFUEVDMVNIOHA-UHFFFAOYSA-N 3-aminobenzenethiol Chemical compound NC1=CC=CC(S)=C1 KFFUEVDMVNIOHA-UHFFFAOYSA-N 0.000 description 3
- WSUYONLKFXZZRV-UHFFFAOYSA-N 7-aminonaphthalen-2-ol Chemical compound C1=CC(O)=CC2=CC(N)=CC=C21 WSUYONLKFXZZRV-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- 208000009079 Bronchial Spasm Diseases 0.000 description 3
- 206010006482 Bronchospasm Diseases 0.000 description 3
- 241000700199 Cavia porcellus Species 0.000 description 3
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 3
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 3
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 3
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 239000008346 aqueous phase Substances 0.000 description 3
- 125000003118 aryl group Chemical group 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- 244000309464 bull Species 0.000 description 3
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical compound [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 3
- 235000013539 calcium stearate Nutrition 0.000 description 3
- 239000008116 calcium stearate Substances 0.000 description 3
- 125000001589 carboacyl group Chemical group 0.000 description 3
- 229950005499 carbon tetrachloride Drugs 0.000 description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 3
- 150000001735 carboxylic acids Chemical class 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000000576 coating method Methods 0.000 description 3
- MLUCVPSAIODCQM-NSCUHMNNSA-N crotonaldehyde Chemical compound C\C=C\C=O MLUCVPSAIODCQM-NSCUHMNNSA-N 0.000 description 3
- MLUCVPSAIODCQM-UHFFFAOYSA-N crotonaldehyde Natural products CC=CC=O MLUCVPSAIODCQM-UHFFFAOYSA-N 0.000 description 3
- 125000000753 cycloalkyl group Chemical group 0.000 description 3
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 230000032050 esterification Effects 0.000 description 3
- 238000005886 esterification reaction Methods 0.000 description 3
- 125000004438 haloalkoxy group Chemical group 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 229910052740 iodine Inorganic materials 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- OFBQJSOFQDEBGM-UHFFFAOYSA-N n-pentane Natural products CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- 238000007911 parenteral administration Methods 0.000 description 3
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 3
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 3
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 3
- 229910052700 potassium Inorganic materials 0.000 description 3
- 239000003755 preservative agent Substances 0.000 description 3
- 125000006239 protecting group Chemical group 0.000 description 3
- 235000012239 silicon dioxide Nutrition 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- 239000000600 sorbitol Substances 0.000 description 3
- 239000007921 spray Substances 0.000 description 3
- 239000000829 suppository Substances 0.000 description 3
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 3
- 230000001225 therapeutic effect Effects 0.000 description 3
- 150000003626 triacylglycerols Chemical class 0.000 description 3
- PDVFSPNIEOYOQL-UHFFFAOYSA-N (4-methylphenyl)sulfonyl 4-methylbenzenesulfonate Chemical compound C1=CC(C)=CC=C1S(=O)(=O)OS(=O)(=O)C1=CC=C(C)C=C1 PDVFSPNIEOYOQL-UHFFFAOYSA-N 0.000 description 2
- BOSAWIQFTJIYIS-UHFFFAOYSA-N 1,1,1-trichloro-2,2,2-trifluoroethane Chemical compound FC(F)(F)C(Cl)(Cl)Cl BOSAWIQFTJIYIS-UHFFFAOYSA-N 0.000 description 2
- CZEPGSHEVIBKCM-UHFFFAOYSA-N 1-[2-[3-[(7-fluoroquinolin-2-yl)methoxy]anilino]-2-oxoethyl]cyclopentane-1-carboxylic acid Chemical compound C=1C=CC(OCC=2N=C3C=C(F)C=CC3=CC=2)=CC=1NC(=O)CC1(C(=O)O)CCCC1 CZEPGSHEVIBKCM-UHFFFAOYSA-N 0.000 description 2
- RQHJEIJNOAWGCP-UHFFFAOYSA-N 2,2-diethyl-4-[3-[(7-methoxyquinolin-2-yl)methoxy]anilino]-4-oxobutanoic acid Chemical compound CCC(CC)(C(O)=O)CC(=O)NC1=CC=CC(OCC=2N=C3C=C(OC)C=CC3=CC=2)=C1 RQHJEIJNOAWGCP-UHFFFAOYSA-N 0.000 description 2
- GOHPTLYPQCTZSE-UHFFFAOYSA-N 2,2-dimethylsuccinic acid Chemical compound OC(=O)C(C)(C)CC(O)=O GOHPTLYPQCTZSE-UHFFFAOYSA-N 0.000 description 2
- MJOYKACXPLERED-UHFFFAOYSA-N 2,6,7-trimethyl-1-oxidoquinolin-1-ium Chemical compound C1=C(C)[N+]([O-])=C2C=C(C)C(C)=CC2=C1 MJOYKACXPLERED-UHFFFAOYSA-N 0.000 description 2
- YDVKOULLPVLOGY-UHFFFAOYSA-N 2,7-dimethyl-1-oxidoquinolin-1-ium Chemical compound C1=CC(C)=[N+]([O-])C2=CC(C)=CC=C21 YDVKOULLPVLOGY-UHFFFAOYSA-N 0.000 description 2
- QXKPLNCZSFACPU-UHFFFAOYSA-N 2,7-dimethylquinoline Chemical compound C1=CC(C)=NC2=CC(C)=CC=C21 QXKPLNCZSFACPU-UHFFFAOYSA-N 0.000 description 2
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 2
- RNXIYNKGEXJYEG-UHFFFAOYSA-N 2-(bromomethyl)-7-(trifluoromethyl)quinoline Chemical compound C1=CC(CBr)=NC2=CC(C(F)(F)F)=CC=C21 RNXIYNKGEXJYEG-UHFFFAOYSA-N 0.000 description 2
- NYISCBIGJMZCBZ-UHFFFAOYSA-N 2-(chloromethyl)-6,7-dimethylquinoline Chemical compound C1=C(CCl)N=C2C=C(C)C(C)=CC2=C1 NYISCBIGJMZCBZ-UHFFFAOYSA-N 0.000 description 2
- VZWLTKVUQAEJHC-UHFFFAOYSA-N 2-(chloromethyl)-7-(trifluoromethoxy)quinoline Chemical compound C1=CC(CCl)=NC2=CC(OC(F)(F)F)=CC=C21 VZWLTKVUQAEJHC-UHFFFAOYSA-N 0.000 description 2
- YPSOTJHBUAMSGH-UHFFFAOYSA-N 2-(chloromethyl)-7-fluoroquinoline Chemical compound C1=CC(CCl)=NC2=CC(F)=CC=C21 YPSOTJHBUAMSGH-UHFFFAOYSA-N 0.000 description 2
- OROJLIMKSCWUMK-UHFFFAOYSA-N 2-(chloromethyl)-7-methoxyquinoline Chemical compound C1=CC(CCl)=NC2=CC(OC)=CC=C21 OROJLIMKSCWUMK-UHFFFAOYSA-N 0.000 description 2
- LMYOLCBSTGQMIB-UHFFFAOYSA-N 2-(chloromethyl)-7-methylquinoline Chemical compound C1=CC(CCl)=NC2=CC(C)=CC=C21 LMYOLCBSTGQMIB-UHFFFAOYSA-N 0.000 description 2
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 2
- FDYJJKHDNNVUDR-UHFFFAOYSA-N 2-ethyl-2-methylbutanedioic acid Chemical compound CCC(C)(C(O)=O)CC(O)=O FDYJJKHDNNVUDR-UHFFFAOYSA-N 0.000 description 2
- YQYIWHRGNDTJSV-UHFFFAOYSA-N 2-methyl-1-oxido-7-(trifluoromethoxy)quinolin-1-ium Chemical compound C1=CC(OC(F)(F)F)=CC2=[N+]([O-])C(C)=CC=C21 YQYIWHRGNDTJSV-UHFFFAOYSA-N 0.000 description 2
- CMJJWBHSEYVYSR-UHFFFAOYSA-N 2-methyl-7-(trifluoromethoxy)quinoline Chemical compound C1=CC(OC(F)(F)F)=CC2=NC(C)=CC=C21 CMJJWBHSEYVYSR-UHFFFAOYSA-N 0.000 description 2
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 2
- ALAIVNWYFMIGHG-UHFFFAOYSA-N 3-[(6,7-dimethylquinolin-2-yl)methoxy]aniline Chemical compound N1=C2C=C(C)C(C)=CC2=CC=C1COC1=CC=CC(N)=C1 ALAIVNWYFMIGHG-UHFFFAOYSA-N 0.000 description 2
- INQYIFALUQJTBA-UHFFFAOYSA-N 3-[(6-fluoroquinolin-2-yl)methoxy]aniline Chemical compound NC1=CC=CC(OCC=2N=C3C=CC(F)=CC3=CC=2)=C1 INQYIFALUQJTBA-UHFFFAOYSA-N 0.000 description 2
- ZNTIHXYKKQCUCM-UHFFFAOYSA-N 3-[(6-methylquinolin-2-yl)methoxy]aniline Chemical compound C1=CC2=CC(C)=CC=C2N=C1COC1=CC=CC(N)=C1 ZNTIHXYKKQCUCM-UHFFFAOYSA-N 0.000 description 2
- DNPGAUZIUVMWJV-UHFFFAOYSA-N 3-[(7-bromoquinolin-2-yl)methoxy]aniline Chemical compound NC1=CC=CC(OCC=2N=C3C=C(Br)C=CC3=CC=2)=C1 DNPGAUZIUVMWJV-UHFFFAOYSA-N 0.000 description 2
- XIJMYORWZNADJV-UHFFFAOYSA-N 3-[(7-chloroquinolin-2-yl)methoxy]aniline Chemical compound NC1=CC=CC(OCC=2N=C3C=C(Cl)C=CC3=CC=2)=C1 XIJMYORWZNADJV-UHFFFAOYSA-N 0.000 description 2
- XZQNDKPFUNIQDN-UHFFFAOYSA-N 3-[(7-methoxyquinolin-2-yl)methoxy]aniline Chemical compound N=1C2=CC(OC)=CC=C2C=CC=1COC1=CC=CC(N)=C1 XZQNDKPFUNIQDN-UHFFFAOYSA-N 0.000 description 2
- HJLFBAIQNOBZMK-UHFFFAOYSA-N 3-[(7-methylquinolin-2-yl)methoxy]aniline Chemical compound N=1C2=CC(C)=CC=C2C=CC=1COC1=CC=CC(N)=C1 HJLFBAIQNOBZMK-UHFFFAOYSA-N 0.000 description 2
- FNLWOMSUFBVVRB-UHFFFAOYSA-N 3-[(8-fluoroquinolin-2-yl)methoxy]aniline Chemical compound NC1=CC=CC(OCC=2N=C3C(F)=CC=CC3=CC=2)=C1 FNLWOMSUFBVVRB-UHFFFAOYSA-N 0.000 description 2
- FZKAPFAZLLNWNF-UHFFFAOYSA-N 3-[(8-fluoroquinolin-2-yl)methylsulfanyl]aniline Chemical compound NC1=CC=CC(SCC=2N=C3C(F)=CC=CC3=CC=2)=C1 FZKAPFAZLLNWNF-UHFFFAOYSA-N 0.000 description 2
- SSRVHKLPBOUGGC-UHFFFAOYSA-N 3-[[7-(trifluoromethyl)quinolin-2-yl]methoxy]aniline Chemical compound NC1=CC=CC(OCC=2N=C3C=C(C=CC3=CC=2)C(F)(F)F)=C1 SSRVHKLPBOUGGC-UHFFFAOYSA-N 0.000 description 2
- KTFGFGGLCMGYTP-UHFFFAOYSA-N 4-Anilino-4-oxobutanoic acid Chemical class OC(=O)CCC(=O)NC1=CC=CC=C1 KTFGFGGLCMGYTP-UHFFFAOYSA-N 0.000 description 2
- XKPRBHVTNOLIBA-UHFFFAOYSA-N 4-[3-[(7-fluoroquinolin-2-yl)methoxy]anilino]-2,2-dimethyl-4-oxobutanoic acid Chemical compound OC(=O)C(C)(C)CC(=O)NC1=CC=CC(OCC=2N=C3C=C(F)C=CC3=CC=2)=C1 XKPRBHVTNOLIBA-UHFFFAOYSA-N 0.000 description 2
- FJKROLUGYXJWQN-UHFFFAOYSA-N 4-hydroxybenzoic acid Chemical compound OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 2
- YWMOOBWNYVFLKH-UHFFFAOYSA-N 6,7-difluoro-2-methylquinoline Chemical compound C1=C(F)C(F)=CC2=NC(C)=CC=C21 YWMOOBWNYVFLKH-UHFFFAOYSA-N 0.000 description 2
- GUBQPALMKUPKGM-UHFFFAOYSA-N 7-bromo-2-(chloromethyl)quinoline Chemical compound C1=CC(Br)=CC2=NC(CCl)=CC=C21 GUBQPALMKUPKGM-UHFFFAOYSA-N 0.000 description 2
- ZRSCSAVBQFPQJP-UHFFFAOYSA-N 7-fluoro-2-methyl-1-oxidoquinolin-1-ium Chemical compound C1=CC(F)=CC2=[N+]([O-])C(C)=CC=C21 ZRSCSAVBQFPQJP-UHFFFAOYSA-N 0.000 description 2
- AYSKNDXTWPNRKG-UHFFFAOYSA-N 7-fluoro-2-methylquinoline Chemical compound C1=CC(F)=CC2=NC(C)=CC=C21 AYSKNDXTWPNRKG-UHFFFAOYSA-N 0.000 description 2
- DGXRZWBEMNKADR-UHFFFAOYSA-N 7-methoxy-2-methyl-1-oxidoquinolin-1-ium Chemical compound C1=CC(C)=[N+]([O-])C2=CC(OC)=CC=C21 DGXRZWBEMNKADR-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- FCWGDMOACPXUGJ-UHFFFAOYSA-N 8-fluoro-2-[(3-nitrophenoxy)methyl]quinoline Chemical compound [O-][N+](=O)C1=CC=CC(OCC=2N=C3C(F)=CC=CC3=CC=2)=C1 FCWGDMOACPXUGJ-UHFFFAOYSA-N 0.000 description 2
- HJHYMLQMBHHNRJ-UHFFFAOYSA-N 8-fluoro-2-methylquinoline Chemical compound C1=CC=C(F)C2=NC(C)=CC=C21 HJHYMLQMBHHNRJ-UHFFFAOYSA-N 0.000 description 2
- 244000215068 Acacia senegal Species 0.000 description 2
- 206010001052 Acute respiratory distress syndrome Diseases 0.000 description 2
- 206010027654 Allergic conditions Diseases 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- 241000416162 Astragalus gummifer Species 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- ZGTMUACCHSMWAC-UHFFFAOYSA-L EDTA disodium salt (anhydrous) Chemical compound [Na+].[Na+].OC(=O)CN(CC([O-])=O)CCN(CC(O)=O)CC([O-])=O ZGTMUACCHSMWAC-UHFFFAOYSA-L 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- 108010010803 Gelatin Proteins 0.000 description 2
- 239000001828 Gelatine Substances 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- 229920000084 Gum arabic Polymers 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- OTZRAYGBFWZKMX-SHSCPDMUSA-N Leukotriene E4 Natural products CCCCCC=C/CC=C/C=C/C=C/C(SCC(N)C(=O)O)C(O)CCCC(=O)O OTZRAYGBFWZKMX-SHSCPDMUSA-N 0.000 description 2
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- HSHXDCVZWHOWCS-UHFFFAOYSA-N N'-hexadecylthiophene-2-carbohydrazide Chemical compound CCCCCCCCCCCCCCCCNNC(=O)c1cccs1 HSHXDCVZWHOWCS-UHFFFAOYSA-N 0.000 description 2
- 235000019502 Orange oil Nutrition 0.000 description 2
- 239000005662 Paraffin oil Substances 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- 239000002202 Polyethylene glycol Substances 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- 208000013616 Respiratory Distress Syndrome Diseases 0.000 description 2
- 229920001800 Shellac Polymers 0.000 description 2
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 2
- 239000004147 Sorbitan trioleate Substances 0.000 description 2
- PRXRUNOAOLTIEF-ADSICKODSA-N Sorbitan trioleate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OC[C@@H](OC(=O)CCCCCCC\C=C/CCCCCCCC)[C@H]1OC[C@H](O)[C@H]1OC(=O)CCCCCCC\C=C/CCCCCCCC PRXRUNOAOLTIEF-ADSICKODSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- 229920001615 Tragacanth Polymers 0.000 description 2
- 235000010489 acacia gum Nutrition 0.000 description 2
- 239000000205 acacia gum Substances 0.000 description 2
- 150000008065 acid anhydrides Chemical class 0.000 description 2
- 239000002671 adjuvant Substances 0.000 description 2
- 208000011341 adult acute respiratory distress syndrome Diseases 0.000 description 2
- 201000000028 adult respiratory distress syndrome Diseases 0.000 description 2
- 125000003302 alkenyloxy group Chemical group 0.000 description 2
- 230000003042 antagnostic effect Effects 0.000 description 2
- 238000003556 assay Methods 0.000 description 2
- 229960000686 benzalkonium chloride Drugs 0.000 description 2
- CADWTSSKOVRVJC-UHFFFAOYSA-N benzyl(dimethyl)azanium;chloride Chemical compound [Cl-].C[NH+](C)CC1=CC=CC=C1 CADWTSSKOVRVJC-UHFFFAOYSA-N 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 239000012267 brine Substances 0.000 description 2
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 2
- 229910000024 caesium carbonate Inorganic materials 0.000 description 2
- 239000001506 calcium phosphate Substances 0.000 description 2
- 229910002092 carbon dioxide Inorganic materials 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 239000006071 cream Substances 0.000 description 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 2
- 208000035475 disorder Diseases 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 239000000975 dye Substances 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 239000010685 fatty oil Substances 0.000 description 2
- 239000000945 filler Substances 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 210000004051 gastric juice Anatomy 0.000 description 2
- 239000008273 gelatin Substances 0.000 description 2
- 229940014259 gelatin Drugs 0.000 description 2
- 235000011852 gelatine desserts Nutrition 0.000 description 2
- 239000003292 glue Substances 0.000 description 2
- 125000001188 haloalkyl group Chemical group 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 125000000623 heterocyclic group Chemical group 0.000 description 2
- BXWNKGSJHAJOGX-UHFFFAOYSA-N hexadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCO BXWNKGSJHAJOGX-UHFFFAOYSA-N 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 2
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 description 2
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- OTZRAYGBFWZKMX-JUDRUQEKSA-N leukotriene E4 Chemical compound CCCCCC=CCC=C\C=C\C=C\[C@@H](SC[C@H](N)C(O)=O)[C@@H](O)CCCC(O)=O OTZRAYGBFWZKMX-JUDRUQEKSA-N 0.000 description 2
- 239000007791 liquid phase Substances 0.000 description 2
- 239000000314 lubricant Substances 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- 229920000609 methyl cellulose Polymers 0.000 description 2
- 235000010981 methylcellulose Nutrition 0.000 description 2
- 239000001923 methylcellulose Substances 0.000 description 2
- 229940016286 microcrystalline cellulose Drugs 0.000 description 2
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 2
- 239000008108 microcrystalline cellulose Substances 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 231100000219 mutagenic Toxicity 0.000 description 2
- 230000003505 mutagenic effect Effects 0.000 description 2
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 239000010502 orange oil Substances 0.000 description 2
- 210000000056 organ Anatomy 0.000 description 2
- 230000007170 pathology Effects 0.000 description 2
- FDPIMTJIUBPUKL-UHFFFAOYSA-N pentan-3-one Chemical compound CCC(=O)CC FDPIMTJIUBPUKL-UHFFFAOYSA-N 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 239000008055 phosphate buffer solution Substances 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 230000002335 preservative effect Effects 0.000 description 2
- 230000002685 pulmonary effect Effects 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 230000002829 reductive effect Effects 0.000 description 2
- 239000004208 shellac Substances 0.000 description 2
- 235000013874 shellac Nutrition 0.000 description 2
- 229940113147 shellac Drugs 0.000 description 2
- ZLGIYFNHBLSMPS-ATJNOEHPSA-N shellac Chemical compound OCCCCCC(O)C(O)CCCCCCCC(O)=O.C1C23[C@H](C(O)=O)CCC2[C@](C)(CO)[C@@H]1C(C(O)=O)=C[C@@H]3O ZLGIYFNHBLSMPS-ATJNOEHPSA-N 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 2
- 235000019337 sorbitan trioleate Nutrition 0.000 description 2
- 229960000391 sorbitan trioleate Drugs 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- AKEJUJNQAAGONA-UHFFFAOYSA-N sulfur trioxide Chemical compound O=S(=O)=O AKEJUJNQAAGONA-UHFFFAOYSA-N 0.000 description 2
- UGNWTBMOAKPKBL-UHFFFAOYSA-N tetrachloro-1,4-benzoquinone Chemical compound ClC1=C(Cl)C(=O)C(Cl)=C(Cl)C1=O UGNWTBMOAKPKBL-UHFFFAOYSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 238000011200 topical administration Methods 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical class [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical group CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- 239000003981 vehicle Substances 0.000 description 2
- CUNWUEBNSZSNRX-RKGWDQTMSA-N (2r,3r,4r,5s)-hexane-1,2,3,4,5,6-hexol;(z)-octadec-9-enoic acid Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.CCCCCCCC\C=C/CCCCCCCC(O)=O.CCCCCCCC\C=C/CCCCCCCC(O)=O.CCCCCCCC\C=C/CCCCCCCC(O)=O CUNWUEBNSZSNRX-RKGWDQTMSA-N 0.000 description 1
- DDMOUSALMHHKOS-UHFFFAOYSA-N 1,2-dichloro-1,1,2,2-tetrafluoroethane Chemical compound FC(F)(Cl)C(F)(F)Cl DDMOUSALMHHKOS-UHFFFAOYSA-N 0.000 description 1
- SDAXMMUAZRUWNL-UHFFFAOYSA-N 1-(carboxymethyl)cyclohexane-1-carboxylic acid Chemical compound OC(=O)CC1(C(O)=O)CCCCC1 SDAXMMUAZRUWNL-UHFFFAOYSA-N 0.000 description 1
- DJUIQOUBGNHWPP-UHFFFAOYSA-N 1-(carboxymethyl)cyclopentane-1-carboxylic acid Chemical compound OC(=O)CC1(C(O)=O)CCCC1 DJUIQOUBGNHWPP-UHFFFAOYSA-N 0.000 description 1
- XMNUZONDBJTDKN-UHFFFAOYSA-N 1-[2-[2-(1-carboxycyclopentyl)acetyl]oxy-2-oxoethyl]cyclopentane-1-carboxylic acid Chemical compound C1CCCC1(C(O)=O)CC(=O)OC(=O)CC1(C(=O)O)CCCC1 XMNUZONDBJTDKN-UHFFFAOYSA-N 0.000 description 1
- PQBWZIFOPYSMTQ-UHFFFAOYSA-N 1-[2-[3-[(7-fluoroquinolin-2-yl)methoxy]anilino]-2-oxoethyl]cyclohexane-1-carboxylic acid Chemical compound C=1C=CC(OCC=2N=C3C=C(F)C=CC3=CC=2)=CC=1NC(=O)CC1(C(=O)O)CCCCC1 PQBWZIFOPYSMTQ-UHFFFAOYSA-N 0.000 description 1
- IXPNQXFRVYWDDI-UHFFFAOYSA-N 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide Chemical compound CN1CC(C(N)=N)C(=O)NC1=O IXPNQXFRVYWDDI-UHFFFAOYSA-N 0.000 description 1
- NRQPBWTZSUTFDI-UHFFFAOYSA-N 2,2-diethyl-4-[3-[(6-fluoroquinolin-2-yl)methoxy]anilino]-4-oxobutanoic acid Chemical compound CCC(CC)(C(O)=O)CC(=O)NC1=CC=CC(OCC=2N=C3C=CC(F)=CC3=CC=2)=C1 NRQPBWTZSUTFDI-UHFFFAOYSA-N 0.000 description 1
- DTTJNQIXBBYPDF-UHFFFAOYSA-N 2,2-diethyl-4-[3-[(6-methoxyquinolin-2-yl)methoxy]anilino]-4-oxobutanoic acid Chemical compound CCC(CC)(C(O)=O)CC(=O)NC1=CC=CC(OCC=2N=C3C=CC(OC)=CC3=CC=2)=C1 DTTJNQIXBBYPDF-UHFFFAOYSA-N 0.000 description 1
- OBGPJXBAEABRDU-UHFFFAOYSA-N 2,2-diethyl-4-[3-[(6-methylquinolin-2-yl)methoxy]anilino]-4-oxobutanoic acid Chemical compound CCC(CC)(C(O)=O)CC(=O)NC1=CC=CC(OCC=2N=C3C=CC(C)=CC3=CC=2)=C1 OBGPJXBAEABRDU-UHFFFAOYSA-N 0.000 description 1
- BFNAFTJCDGWFMQ-UHFFFAOYSA-N 2,2-diethyl-4-[3-[(7-fluoroquinolin-2-yl)methoxy]anilino]-4-oxobutanoic acid Chemical compound CCC(CC)(C(O)=O)CC(=O)NC1=CC=CC(OCC=2N=C3C=C(F)C=CC3=CC=2)=C1 BFNAFTJCDGWFMQ-UHFFFAOYSA-N 0.000 description 1
- VFXGMPUTFGTYBV-UHFFFAOYSA-N 2,2-diethyl-4-[3-[(7-fluoroquinolin-2-yl)methylsulfanyl]anilino]-4-oxobutanoic acid Chemical compound CCC(CC)(C(O)=O)CC(=O)NC1=CC=CC(SCC=2N=C3C=C(F)C=CC3=CC=2)=C1 VFXGMPUTFGTYBV-UHFFFAOYSA-N 0.000 description 1
- MINFQFJDELKPIC-UHFFFAOYSA-N 2,2-diethyl-4-[3-[(7-methylquinolin-2-yl)methoxy]anilino]-4-oxobutanoic acid Chemical compound CCC(CC)(C(O)=O)CC(=O)NC1=CC=CC(OCC=2N=C3C=C(C)C=CC3=CC=2)=C1 MINFQFJDELKPIC-UHFFFAOYSA-N 0.000 description 1
- DJGUHTJMEJTYSH-UHFFFAOYSA-N 2,2-diethyl-4-[3-[(8-fluoroquinolin-2-yl)methoxy]anilino]-4-oxobutanoic acid Chemical compound CCC(CC)(C(O)=O)CC(=O)NC1=CC=CC(OCC=2N=C3C(F)=CC=CC3=CC=2)=C1 DJGUHTJMEJTYSH-UHFFFAOYSA-N 0.000 description 1
- KHWZLQVIGILUKO-UHFFFAOYSA-N 2,2-diethyl-4-[3-[(8-methoxyquinolin-2-yl)methoxy]anilino]-4-oxobutanoic acid Chemical compound CCC(CC)(C(O)=O)CC(=O)NC1=CC=CC(OCC=2N=C3C(OC)=CC=CC3=CC=2)=C1 KHWZLQVIGILUKO-UHFFFAOYSA-N 0.000 description 1
- NGPOKKAOTYUOAT-UHFFFAOYSA-N 2,2-diethyl-4-[3-[(8-methylquinolin-2-yl)methoxy]anilino]-4-oxobutanoic acid Chemical compound CCC(CC)(C(O)=O)CC(=O)NC1=CC=CC(OCC=2N=C3C(C)=CC=CC3=CC=2)=C1 NGPOKKAOTYUOAT-UHFFFAOYSA-N 0.000 description 1
- YQTCQNIPQMJNTI-UHFFFAOYSA-N 2,2-dimethylpropan-1-one Chemical group CC(C)(C)[C]=O YQTCQNIPQMJNTI-UHFFFAOYSA-N 0.000 description 1
- STNKMPGKHRERRZ-UHFFFAOYSA-N 2,2-dipropylbutanedioic acid Chemical compound CCCC(CCC)(CC(O)=O)C(O)=O STNKMPGKHRERRZ-UHFFFAOYSA-N 0.000 description 1
- SVPKNMBRVBMTLB-UHFFFAOYSA-N 2,3-dichloronaphthalene-1,4-dione Chemical compound C1=CC=C2C(=O)C(Cl)=C(Cl)C(=O)C2=C1 SVPKNMBRVBMTLB-UHFFFAOYSA-N 0.000 description 1
- KJXMXCRSMLOXBM-UHFFFAOYSA-N 2,3-diethylbutanedioic acid Chemical compound CCC(C(O)=O)C(CC)C(O)=O KJXMXCRSMLOXBM-UHFFFAOYSA-N 0.000 description 1
- MMRWJFACJFPXEI-UHFFFAOYSA-N 2,6,7-trimethylquinoline Chemical compound C1=C(C)C(C)=CC2=NC(C)=CC=C21 MMRWJFACJFPXEI-UHFFFAOYSA-N 0.000 description 1
- WJOPLBNTJYROCF-UHFFFAOYSA-N 2-(bromomethyl)-7-chloroquinoline Chemical compound C1=CC(CBr)=NC2=CC(Cl)=CC=C21 WJOPLBNTJYROCF-UHFFFAOYSA-N 0.000 description 1
- CSLGYHQUXRUXPX-UHFFFAOYSA-N 2-(chloromethyl)-6-methylquinoline Chemical compound N1=C(CCl)C=CC2=CC(C)=CC=C21 CSLGYHQUXRUXPX-UHFFFAOYSA-N 0.000 description 1
- XNMYNYSCEJBRPZ-UHFFFAOYSA-N 2-[(3-butyl-1-isoquinolinyl)oxy]-N,N-dimethylethanamine Chemical class C1=CC=C2C(OCCN(C)C)=NC(CCCC)=CC2=C1 XNMYNYSCEJBRPZ-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- QEEABBYVACOPMZ-UHFFFAOYSA-N 2-[2-oxo-2-[3-(quinolin-2-ylmethoxy)anilino]ethyl]-2-propylpentanoic acid Chemical compound CCCC(CCC)(C(O)=O)CC(=O)NC1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 QEEABBYVACOPMZ-UHFFFAOYSA-N 0.000 description 1
- MSWZFWKMSRAUBD-IVMDWMLBSA-N 2-amino-2-deoxy-D-glucopyranose Chemical compound N[C@H]1C(O)O[C@H](CO)[C@@H](O)[C@@H]1O MSWZFWKMSRAUBD-IVMDWMLBSA-N 0.000 description 1
- QRKNZQKHKDESCU-UHFFFAOYSA-N 2-cyclopropyl-1,3-thiazole Chemical class C1CC1C1=NC=CS1 QRKNZQKHKDESCU-UHFFFAOYSA-N 0.000 description 1
- FTZQXOJYPFINKJ-UHFFFAOYSA-N 2-fluoroaniline Chemical compound NC1=CC=CC=C1F FTZQXOJYPFINKJ-UHFFFAOYSA-N 0.000 description 1
- HZLCGUXUOFWCCN-UHFFFAOYSA-N 2-hydroxynonadecane-1,2,3-tricarboxylic acid Chemical compound CCCCCCCCCCCCCCCCC(C(O)=O)C(O)(C(O)=O)CC(O)=O HZLCGUXUOFWCCN-UHFFFAOYSA-N 0.000 description 1
- VIBTYGFMDABZCD-UHFFFAOYSA-N 2-methyl-7-(trifluoromethyl)quinoline Chemical compound C1=CC(C(F)(F)F)=CC2=NC(C)=CC=C21 VIBTYGFMDABZCD-UHFFFAOYSA-N 0.000 description 1
- PPDBLOYWXIRTQX-UHFFFAOYSA-N 3,3-dibutyloxolane-2,5-dione Chemical compound CCCCC1(CCCC)CC(=O)OC1=O PPDBLOYWXIRTQX-UHFFFAOYSA-N 0.000 description 1
- ACJPFLIEHGFXGP-UHFFFAOYSA-N 3,3-dimethyloxolane-2,5-dione Chemical compound CC1(C)CC(=O)OC1=O ACJPFLIEHGFXGP-UHFFFAOYSA-N 0.000 description 1
- AIWSGDIPUUXZLT-UHFFFAOYSA-N 3,3-dipropyloxolane-2,5-dione Chemical compound CCCC1(CCC)CC(=O)OC1=O AIWSGDIPUUXZLT-UHFFFAOYSA-N 0.000 description 1
- AXNUZKSSQHTNPZ-UHFFFAOYSA-N 3,4-difluoroaniline Chemical compound NC1=CC=C(F)C(F)=C1 AXNUZKSSQHTNPZ-UHFFFAOYSA-N 0.000 description 1
- JKUCRMPGEDWMLA-UHFFFAOYSA-N 3-(quinolin-2-ylmethoxy)aniline Chemical compound NC1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 JKUCRMPGEDWMLA-UHFFFAOYSA-N 0.000 description 1
- SADHVOSOZBAAGL-UHFFFAOYSA-N 3-(trifluoromethoxy)aniline Chemical compound NC1=CC=CC(OC(F)(F)F)=C1 SADHVOSOZBAAGL-UHFFFAOYSA-N 0.000 description 1
- MCNYJOGJPWNHCX-UHFFFAOYSA-N 3-[(6,7-difluoroquinolin-2-yl)methoxy]aniline Chemical compound NC1=CC=CC(OCC=2N=C3C=C(F)C(F)=CC3=CC=2)=C1 MCNYJOGJPWNHCX-UHFFFAOYSA-N 0.000 description 1
- BSWNIPGRZMQKGK-UHFFFAOYSA-N 3-[(6-fluoroquinolin-2-yl)methylsulfanyl]aniline Chemical compound NC1=CC=CC(SCC=2N=C3C=CC(F)=CC3=CC=2)=C1 BSWNIPGRZMQKGK-UHFFFAOYSA-N 0.000 description 1
- FHNMFZQIBAJQNG-UHFFFAOYSA-N 3-[(7-fluoroquinolin-2-yl)methylsulfanyl]aniline Chemical compound NC1=CC=CC(SCC=2N=C3C=C(F)C=CC3=CC=2)=C1 FHNMFZQIBAJQNG-UHFFFAOYSA-N 0.000 description 1
- CYRVLWSGGJYJIH-UHFFFAOYSA-N 3-[[3-[(7-fluoroquinolin-2-yl)methoxy]anilino]methyl]benzoic acid Chemical compound OC(=O)C1=CC=CC(CNC=2C=C(OCC=3N=C4C=C(F)C=CC4=CC=3)C=CC=2)=C1 CYRVLWSGGJYJIH-UHFFFAOYSA-N 0.000 description 1
- YBDAATKHDNWJFV-UHFFFAOYSA-N 3-[[7-(trifluoromethoxy)quinolin-2-yl]methoxy]aniline Chemical compound NC1=CC=CC(OCC=2N=C3C=C(OC(F)(F)F)C=CC3=CC=2)=C1 YBDAATKHDNWJFV-UHFFFAOYSA-N 0.000 description 1
- RTZZCYNQPHTPPL-UHFFFAOYSA-N 3-nitrophenol Chemical compound OC1=CC=CC([N+]([O-])=O)=C1 RTZZCYNQPHTPPL-UHFFFAOYSA-N 0.000 description 1
- CQQSQBRPAJSTFB-UHFFFAOYSA-N 4-(bromomethyl)benzoic acid Chemical compound OC(=O)C1=CC=C(CBr)C=C1 CQQSQBRPAJSTFB-UHFFFAOYSA-N 0.000 description 1
- UIUJIQZEACWQSV-UHFFFAOYSA-N 4-Oxobutanoic acid Natural products OC(=O)CCC=O UIUJIQZEACWQSV-UHFFFAOYSA-N 0.000 description 1
- DGUXLXDTCHULNE-UHFFFAOYSA-N 4-[3-[(6,7-difluoroquinolin-2-yl)methoxy]anilino]-2,2-diethyl-4-oxobutanoic acid Chemical compound CCC(CC)(C(O)=O)CC(=O)NC1=CC=CC(OCC=2N=C3C=C(F)C(F)=CC3=CC=2)=C1 DGUXLXDTCHULNE-UHFFFAOYSA-N 0.000 description 1
- NXMVUMPPOABACO-UHFFFAOYSA-N 4-[3-[(6,7-dimethylquinolin-2-yl)methoxy]anilino]-2,2-diethyl-4-oxobutanoic acid Chemical compound CCC(CC)(C(O)=O)CC(=O)NC1=CC=CC(OCC=2N=C3C=C(C)C(C)=CC3=CC=2)=C1 NXMVUMPPOABACO-UHFFFAOYSA-N 0.000 description 1
- PNLTZBAMMSREAI-UHFFFAOYSA-N 4-[3-[(6-chloroquinolin-2-yl)methoxy]anilino]-2,2-diethyl-4-oxobutanoic acid Chemical compound CCC(CC)(C(O)=O)CC(=O)NC1=CC=CC(OCC=2N=C3C=CC(Cl)=CC3=CC=2)=C1 PNLTZBAMMSREAI-UHFFFAOYSA-N 0.000 description 1
- ICYLDMBMBLPBFJ-UHFFFAOYSA-N 4-[3-[(7-bromoquinolin-2-yl)methoxy]anilino]-2,2-diethyl-4-oxobutanoic acid Chemical compound CCC(CC)(C(O)=O)CC(=O)NC1=CC=CC(OCC=2N=C3C=C(Br)C=CC3=CC=2)=C1 ICYLDMBMBLPBFJ-UHFFFAOYSA-N 0.000 description 1
- DZILGDKUTSXBJO-UHFFFAOYSA-N 4-[3-[(7-chloroquinolin-2-yl)methoxy]anilino]-2,2-dimethyl-4-oxobutanoic acid Chemical compound OC(=O)C(C)(C)CC(=O)NC1=CC=CC(OCC=2N=C3C=C(Cl)C=CC3=CC=2)=C1 DZILGDKUTSXBJO-UHFFFAOYSA-N 0.000 description 1
- UADSTBHLKBSVPM-UHFFFAOYSA-N 4-[3-[(7-chloroquinolin-2-yl)methylsulfanyl]anilino]-2,2-diethyl-4-oxobutanoic acid Chemical compound CCC(CC)(C(O)=O)CC(=O)NC1=CC=CC(SCC=2N=C3C=C(Cl)C=CC3=CC=2)=C1 UADSTBHLKBSVPM-UHFFFAOYSA-N 0.000 description 1
- SIYCPYRSUXPGJY-UHFFFAOYSA-N 4-[3-[(8-chloroquinolin-2-yl)methoxy]anilino]-2,2-diethyl-4-oxobutanoic acid Chemical compound CCC(CC)(C(O)=O)CC(=O)NC1=CC=CC(OCC=2N=C3C(Cl)=CC=CC3=CC=2)=C1 SIYCPYRSUXPGJY-UHFFFAOYSA-N 0.000 description 1
- SQTFJHDWSIQIHP-UHFFFAOYSA-N 4-[[3-[(7-fluoroquinolin-2-yl)methoxy]anilino]methyl]benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1CNC1=CC=CC(OCC=2N=C3C=C(F)C=CC3=CC=2)=C1 SQTFJHDWSIQIHP-UHFFFAOYSA-N 0.000 description 1
- ZLVBGZSYVSPGHC-UHFFFAOYSA-N 4-[[n-(3-ethyl-3-methoxycarbonylpentanoyl)-3-[(7-fluoroquinolin-2-yl)methoxy]anilino]methyl]benzoic acid Chemical compound C=1C=CC(OCC=2N=C3C=C(F)C=CC3=CC=2)=CC=1N(C(=O)CC(CC)(CC)C(=O)OC)CC1=CC=C(C(O)=O)C=C1 ZLVBGZSYVSPGHC-UHFFFAOYSA-N 0.000 description 1
- 229940090248 4-hydroxybenzoic acid Drugs 0.000 description 1
- GPIARMSVZOEZCV-UHFFFAOYSA-N 6-fluoro-2-methylquinoline Chemical compound C1=C(F)C=CC2=NC(C)=CC=C21 GPIARMSVZOEZCV-UHFFFAOYSA-N 0.000 description 1
- LCEHEHGWCCBSGJ-UHFFFAOYSA-N 7-bromo-2-methyl-1-oxidoquinolin-1-ium Chemical compound C1=CC(Br)=CC2=[N+]([O-])C(C)=CC=C21 LCEHEHGWCCBSGJ-UHFFFAOYSA-N 0.000 description 1
- VEKOCCXFMXGRTF-UHFFFAOYSA-N 7-bromo-2-methylquinoline Chemical compound C1=CC(Br)=CC2=NC(C)=CC=C21 VEKOCCXFMXGRTF-UHFFFAOYSA-N 0.000 description 1
- INUDCYQHCQTJFV-UHFFFAOYSA-N 7-bromo-4-methyl-1-oxidoquinolin-1-ium Chemical compound BrC1=CC=C2C(=CC=[N+](C2=C1)[O-])C INUDCYQHCQTJFV-UHFFFAOYSA-N 0.000 description 1
- QEVADHKTNBIYSD-UHFFFAOYSA-N 7-methoxy-2-methylquinoline Chemical compound C1=CC(C)=NC2=CC(OC)=CC=C21 QEVADHKTNBIYSD-UHFFFAOYSA-N 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- 208000035285 Allergic Seasonal Rhinitis Diseases 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- JFJSGFMSPKVAKI-UHFFFAOYSA-N CCC(CC)(CC(=O)N(CC1=CC=CC=C1C(=O)O)C2=CC(=CC=C2)OCC3=NC4=C(C=CC(=C4)F)C=C3)C(=O)O Chemical compound CCC(CC)(CC(=O)N(CC1=CC=CC=C1C(=O)O)C2=CC(=CC=C2)OCC3=NC4=C(C=CC(=C4)F)C=C3)C(=O)O JFJSGFMSPKVAKI-UHFFFAOYSA-N 0.000 description 1
- 241000700198 Cavia Species 0.000 description 1
- 206010009900 Colitis ulcerative Diseases 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical class [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 208000011231 Crohn disease Diseases 0.000 description 1
- 201000003883 Cystic fibrosis Diseases 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- 229920002307 Dextran Polymers 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 239000004338 Dichlorodifluoromethane Substances 0.000 description 1
- LVGKNOAMLMIIKO-UHFFFAOYSA-N Elaidinsaeure-aethylester Natural products CCCCCCCCC=CCCCCCCCC(=O)OCC LVGKNOAMLMIIKO-UHFFFAOYSA-N 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- 238000007126 N-alkylation reaction Methods 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 1
- 240000007594 Oryza sativa Species 0.000 description 1
- 235000007164 Oryza sativa Nutrition 0.000 description 1
- 201000004681 Psoriasis Diseases 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- 206010040070 Septic Shock Diseases 0.000 description 1
- 229910021607 Silver chloride Inorganic materials 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- 235000021307 Triticum Nutrition 0.000 description 1
- 244000098338 Triticum aestivum Species 0.000 description 1
- 201000006704 Ulcerative Colitis Diseases 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical class [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- SMEGJBVQLJJKKX-HOTMZDKISA-N [(2R,3S,4S,5R,6R)-5-acetyloxy-3,4,6-trihydroxyoxan-2-yl]methyl acetate Chemical compound CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)O)OC(=O)C)O)O SMEGJBVQLJJKKX-HOTMZDKISA-N 0.000 description 1
- 239000002250 absorbent Substances 0.000 description 1
- 230000002745 absorbent Effects 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 229940081735 acetylcellulose Drugs 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 235000010419 agar Nutrition 0.000 description 1
- 229940040563 agaric acid Drugs 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 239000000783 alginic acid Substances 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 229960001126 alginic acid Drugs 0.000 description 1
- 150000004781 alginic acids Chemical class 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 230000000172 allergic effect Effects 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 239000003708 ampul Substances 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 239000003945 anionic surfactant Substances 0.000 description 1
- 230000008485 antagonism Effects 0.000 description 1
- 230000003266 anti-allergic effect Effects 0.000 description 1
- 239000000043 antiallergic agent Substances 0.000 description 1
- 208000006673 asthma Diseases 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 208000010668 atopic eczema Diseases 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- 235000013871 bee wax Nutrition 0.000 description 1
- 239000012166 beeswax Substances 0.000 description 1
- 150000008107 benzenesulfonic acids Chemical class 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- MSWZFWKMSRAUBD-UHFFFAOYSA-N beta-D-galactosamine Natural products NC1C(O)OC(CO)C(O)C1O MSWZFWKMSRAUBD-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 230000031709 bromination Effects 0.000 description 1
- 238000005893 bromination reaction Methods 0.000 description 1
- 239000001273 butane Substances 0.000 description 1
- FUFJGUQYACFECW-UHFFFAOYSA-L calcium hydrogenphosphate Chemical compound [Ca+2].OP([O-])([O-])=O FUFJGUQYACFECW-UHFFFAOYSA-L 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical class OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 229960000541 cetyl alcohol Drugs 0.000 description 1
- 238000012512 characterization method Methods 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 238000011097 chromatography purification Methods 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 229910052802 copper Chemical class 0.000 description 1
- 239000010949 copper Chemical class 0.000 description 1
- 229940099112 cornstarch Drugs 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 150000001924 cycloalkanes Chemical class 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 235000019700 dicalcium phosphate Nutrition 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- PXBRQCKWGAHEHS-UHFFFAOYSA-N dichlorodifluoromethane Chemical compound FC(F)(Cl)Cl PXBRQCKWGAHEHS-UHFFFAOYSA-N 0.000 description 1
- 235000019404 dichlorodifluoromethane Nutrition 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 229940043279 diisopropylamine Drugs 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- LVGKNOAMLMIIKO-QXMHVHEDSA-N ethyl oleate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OCC LVGKNOAMLMIIKO-QXMHVHEDSA-N 0.000 description 1
- 229940093471 ethyl oleate Drugs 0.000 description 1
- 239000003889 eye drop Substances 0.000 description 1
- 229940012356 eye drops Drugs 0.000 description 1
- 239000003885 eye ointment Substances 0.000 description 1
- 235000013861 fat-free Nutrition 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000006261 foam material Substances 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 230000002496 gastric effect Effects 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 229960002442 glucosamine Drugs 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 230000026030 halogenation Effects 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 229940031704 hydroxypropyl methylcellulose phthalate Drugs 0.000 description 1
- 229920003132 hydroxypropyl methylcellulose phthalate Polymers 0.000 description 1
- 210000003405 ileum Anatomy 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 230000004968 inflammatory condition Effects 0.000 description 1
- 230000002757 inflammatory effect Effects 0.000 description 1
- 230000004054 inflammatory process Effects 0.000 description 1
- 239000003978 infusion fluid Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 229910017053 inorganic salt Inorganic materials 0.000 description 1
- 230000002452 interceptive effect Effects 0.000 description 1
- 125000002346 iodo group Chemical group I* 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 239000002563 ionic surfactant Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 239000004922 lacquer Substances 0.000 description 1
- 238000012417 linear regression Methods 0.000 description 1
- 239000006210 lotion Substances 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- 238000012792 lyophilization process Methods 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- GRWIABMEEKERFV-UHFFFAOYSA-N methanol;oxolane Chemical compound OC.C1CCOC1 GRWIABMEEKERFV-UHFFFAOYSA-N 0.000 description 1
- SSPKWGYLQQZXJF-UHFFFAOYSA-N methyl 2,2-diethyl-4-[3-[(7-fluoroquinolin-2-yl)methoxy]-n-methylanilino]-4-oxobutanoate Chemical compound COC(=O)C(CC)(CC)CC(=O)N(C)C1=CC=CC(OCC=2N=C3C=C(F)C=CC3=CC=2)=C1 SSPKWGYLQQZXJF-UHFFFAOYSA-N 0.000 description 1
- WPXKHHMPUNTOLJ-UHFFFAOYSA-N methyl 2,2-diethyl-4-oxo-4-[3-(quinolin-2-ylmethoxy)anilino]butanoate Chemical compound COC(=O)C(CC)(CC)CC(=O)NC1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 WPXKHHMPUNTOLJ-UHFFFAOYSA-N 0.000 description 1
- UXSNXOMMJXTFEG-UHFFFAOYSA-N methyl 4-(bromomethyl)-3-methoxybenzoate Chemical compound COC(=O)C1=CC=C(CBr)C(OC)=C1 UXSNXOMMJXTFEG-UHFFFAOYSA-N 0.000 description 1
- RBIRGHLZDLUTKB-UHFFFAOYSA-N methyl 4-[3-[(7-chloroquinolin-2-yl)methoxy]anilino]-2,2-diethyl-4-oxobutanoate Chemical compound COC(=O)C(CC)(CC)CC(=O)NC1=CC=CC(OCC=2N=C3C=C(Cl)C=CC3=CC=2)=C1 RBIRGHLZDLUTKB-UHFFFAOYSA-N 0.000 description 1
- FNMAUDJWXKRBRN-UHFFFAOYSA-N methyl 4-[[3-[(7-fluoroquinolin-2-yl)methoxy]anilino]methyl]-3-methoxybenzoate Chemical compound COC1=CC(C(=O)OC)=CC=C1CNC1=CC=CC(OCC=2N=C3C=C(F)C=CC3=CC=2)=C1 FNMAUDJWXKRBRN-UHFFFAOYSA-N 0.000 description 1
- KWMZKEYRUAAKNW-UHFFFAOYSA-N methyl 4-[n-hydroxy-3-(quinolin-2-ylmethoxy)anilino]-4-oxobutanoate Chemical compound COC(=O)CCC(=O)N(O)C1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 KWMZKEYRUAAKNW-UHFFFAOYSA-N 0.000 description 1
- YMLLITAADRUCSB-UHFFFAOYSA-N methyl 4-oxo-4-[3-(quinolin-2-ylmethoxy)anilino]butanoate Chemical compound COC(=O)CCC(=O)NC1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 YMLLITAADRUCSB-UHFFFAOYSA-N 0.000 description 1
- 229960002900 methylcellulose Drugs 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- ULWOJODHECIZAU-UHFFFAOYSA-N n,n-diethylpropan-2-amine Chemical group CCN(CC)C(C)C ULWOJODHECIZAU-UHFFFAOYSA-N 0.000 description 1
- IJDNQMDRQITEOD-UHFFFAOYSA-N n-butane Chemical compound CCCC IJDNQMDRQITEOD-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- QHCCDDQKNUYGNC-UHFFFAOYSA-N n-ethylbutan-1-amine Chemical group CCCCNCC QHCCDDQKNUYGNC-UHFFFAOYSA-N 0.000 description 1
- 125000003136 n-heptyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000007923 nasal drop Substances 0.000 description 1
- 229940100662 nasal drops Drugs 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 239000002736 nonionic surfactant Substances 0.000 description 1
- 230000000269 nucleophilic effect Effects 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 239000008183 oral pharmaceutical preparation Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 238000004806 packaging method and process Methods 0.000 description 1
- 230000036961 partial effect Effects 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 230000001575 pathological effect Effects 0.000 description 1
- XNGIFLGASWRNHJ-UHFFFAOYSA-L phthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC=C1C([O-])=O XNGIFLGASWRNHJ-UHFFFAOYSA-L 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 229940116317 potato starch Drugs 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 150000003142 primary aromatic amines Chemical class 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000012264 purified product Substances 0.000 description 1
- SMUQFGGVLNAIOZ-UHFFFAOYSA-N quinaldine Chemical class C1=CC=CC2=NC(C)=CC=C21 SMUQFGGVLNAIOZ-UHFFFAOYSA-N 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 230000000241 respiratory effect Effects 0.000 description 1
- 230000029058 respiratory gaseous exchange Effects 0.000 description 1
- 210000002345 respiratory system Anatomy 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- 229940100486 rice starch Drugs 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000003336 secondary aromatic amines Chemical class 0.000 description 1
- 230000036303 septic shock Effects 0.000 description 1
- 239000008159 sesame oil Substances 0.000 description 1
- 235000011803 sesame oil Nutrition 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- CQLFBEKRDQMJLZ-UHFFFAOYSA-M silver acetate Chemical compound [Ag+].CC([O-])=O CQLFBEKRDQMJLZ-UHFFFAOYSA-M 0.000 description 1
- 229940071536 silver acetate Drugs 0.000 description 1
- HKZLPVFGJNLROG-UHFFFAOYSA-M silver monochloride Chemical compound [Cl-].[Ag+] HKZLPVFGJNLROG-UHFFFAOYSA-M 0.000 description 1
- 210000000813 small intestine Anatomy 0.000 description 1
- 235000010413 sodium alginate Nutrition 0.000 description 1
- 239000000661 sodium alginate Substances 0.000 description 1
- 229940005550 sodium alginate Drugs 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- RPACBEVZENYWOL-XFULWGLBSA-M sodium;(2r)-2-[6-(4-chlorophenoxy)hexyl]oxirane-2-carboxylate Chemical compound [Na+].C=1C=C(Cl)C=CC=1OCCCCCC[C@]1(C(=O)[O-])CO1 RPACBEVZENYWOL-XFULWGLBSA-M 0.000 description 1
- GGCZERPQGJTIQP-UHFFFAOYSA-N sodium;9,10-dioxoanthracene-2-sulfonic acid Chemical compound [Na+].C1=CC=C2C(=O)C3=CC(S(=O)(=O)O)=CC=C3C(=O)C2=C1 GGCZERPQGJTIQP-UHFFFAOYSA-N 0.000 description 1
- 239000007901 soft capsule Substances 0.000 description 1
- 239000008275 solid aerosol Substances 0.000 description 1
- 229960005078 sorbitan sesquioleate Drugs 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 238000012289 standard assay Methods 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 239000008174 sterile solution Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- PXQLVRUNWNTZOS-UHFFFAOYSA-N sulfanyl Chemical class [SH] PXQLVRUNWNTZOS-UHFFFAOYSA-N 0.000 description 1
- 239000002511 suppository base Substances 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- YBRBMKDOPFTVDT-UHFFFAOYSA-N tert-butylamine Chemical compound CC(C)(C)N YBRBMKDOPFTVDT-UHFFFAOYSA-N 0.000 description 1
- BRNULMACUQOKMR-UHFFFAOYSA-N thiomorpholine Chemical compound C1CSCCN1 BRNULMACUQOKMR-UHFFFAOYSA-N 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- 230000001131 transforming effect Effects 0.000 description 1
- 229910052723 transition metal Inorganic materials 0.000 description 1
- 150000003624 transition metals Chemical class 0.000 description 1
- 229940078499 tricalcium phosphate Drugs 0.000 description 1
- 235000019731 tricalcium phosphate Nutrition 0.000 description 1
- 229910000391 tricalcium phosphate Inorganic materials 0.000 description 1
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 description 1
- 239000005051 trimethylchlorosilane Substances 0.000 description 1
- 229940099259 vaseline Drugs 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 229940100445 wheat starch Drugs 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/12—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D215/14—Radicals substituted by oxygen atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P29/00—Non-central analgesic, antipyretic or antiinflammatory agents, e.g. antirheumatic agents; Non-steroidal antiinflammatory drugs [NSAID]
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
- A61P37/08—Antiallergic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/18—Halogen atoms or nitro radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D221/00—Heterocyclic compounds containing six-membered rings having one nitrogen atom as the only ring hetero atom, not provided for by groups C07D211/00 - C07D219/00
- C07D221/02—Heterocyclic compounds containing six-membered rings having one nitrogen atom as the only ring hetero atom, not provided for by groups C07D211/00 - C07D219/00 condensed with carbocyclic rings or ring systems
- C07D221/04—Ortho- or peri-condensed ring systems
- C07D221/06—Ring systems of three rings
- C07D221/16—Ring systems of three rings containing carbocyclic rings other than six-membered
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Public Health (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Pulmonology (AREA)
- Immunology (AREA)
- Pain & Pain Management (AREA)
- Rheumatology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Quinoline Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Other In-Based Heterocyclic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| EP93810645 | 1993-09-10 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PT643045E true PT643045E (pt) | 2000-08-31 |
Family
ID=8215029
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PT94810504T PT643045E (pt) | 1993-09-10 | 1994-09-01 | Derivados de quinoleina como antagonistas de leucotrienos |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US5508408A (show.php) |
| JP (1) | JP3652721B2 (show.php) |
| KR (1) | KR950008483A (show.php) |
| CN (1) | CN1054845C (show.php) |
| AT (1) | ATE190307T1 (show.php) |
| AU (1) | AU683481B2 (show.php) |
| CA (1) | CA2131644C (show.php) |
| CZ (1) | CZ284006B6 (show.php) |
| DE (1) | DE59409179D1 (show.php) |
| ES (1) | ES2144501T3 (show.php) |
| FI (1) | FI944120A7 (show.php) |
| HU (1) | HUT70556A (show.php) |
| IL (1) | IL110864A0 (show.php) |
| NO (1) | NO301639B1 (show.php) |
| NZ (1) | NZ264420A (show.php) |
| PH (1) | PH31094A (show.php) |
| PT (1) | PT643045E (show.php) |
| SK (1) | SK107394A3 (show.php) |
| TW (1) | TW249802B (show.php) |
| ZA (1) | ZA946957B (show.php) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA2371308A1 (en) | 1999-04-28 | 2000-11-02 | Aventis Pharma Deutschland Gmbh | Tri-aryl acid derivatives as ppar receptor ligands |
| IT1320162B1 (it) | 2000-02-09 | 2003-11-18 | Rotta Research Lab | Derivati della tirosina ad attivita' anti leucotrienica, procedimentoper la loro preparazione e loro uso farmaceutico. |
| US6531494B1 (en) * | 2001-08-29 | 2003-03-11 | Pharmacia Corporation | Gem-substituted αvβ3 antagonists |
| US7056917B2 (en) * | 2001-04-26 | 2006-06-06 | Daiichi Pharmaceutical Co., Ltd. | Drug efflux pump inhibitor |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5109009A (en) * | 1985-03-08 | 1992-04-28 | Leo Pharmaceutical Products Ltd. | Quinoline and pyridine compounds and inhibition of 5-lipoxygenases therewith |
| IE58870B1 (en) * | 1985-03-08 | 1993-11-17 | Leo Pharm Prod Ltd | Pyridine derivatives |
| US4962203A (en) * | 1985-06-18 | 1990-10-09 | Merck Frost Canada, Inc. | 2-substituted quinolines useful as leukotriene antagonists |
| JPS62142168A (ja) * | 1985-10-16 | 1987-06-25 | Mitsubishi Chem Ind Ltd | チアゾ−ル誘導体及びそれを有効成分とするロイコトリエンきつ抗剤 |
| EP0219308B1 (en) * | 1985-10-16 | 1991-10-23 | Merck Frosst Canada Inc. | 2-substituted quinolines |
| EP0219307A3 (en) * | 1985-10-16 | 1987-10-14 | Merck Frosst Canada Inc. | 2-substituted quinolines |
| JPS62145049A (ja) * | 1985-12-18 | 1987-06-29 | Mitsubishi Chem Ind Ltd | アミノスチリル化合物及びそれを有効成分とするロイコトリエンきつ抗剤 |
| JPS63258854A (ja) * | 1987-04-16 | 1988-10-26 | Mitsubishi Kasei Corp | カルボキシスチレン誘導体およびそれを有効成分とする薬剤 |
| EP0355353B1 (en) * | 1988-07-15 | 1994-03-16 | F. Hoffmann-La Roche Ag | Cycloalkylthiazole derivatives |
| JPH02275857A (ja) * | 1989-01-13 | 1990-11-09 | Yoshitomi Pharmaceut Ind Ltd | ピリジン誘導体 |
| CN1078151A (zh) * | 1993-01-01 | 1993-11-10 | 周礼伯 | 天然药物成分的蚕药 |
| CN1050999C (zh) * | 1993-02-16 | 2000-04-05 | 胡祖良 | 抗病毒性蚕病的蚕药 |
-
1994
- 1994-08-10 US US08/288,537 patent/US5508408A/en not_active Expired - Lifetime
- 1994-08-13 TW TW083107418A patent/TW249802B/zh active
- 1994-08-23 PH PH48841A patent/PH31094A/en unknown
- 1994-09-01 AU AU71617/94A patent/AU683481B2/en not_active Ceased
- 1994-09-01 ES ES94810504T patent/ES2144501T3/es not_active Expired - Lifetime
- 1994-09-01 PT PT94810504T patent/PT643045E/pt unknown
- 1994-09-01 AT AT94810504T patent/ATE190307T1/de not_active IP Right Cessation
- 1994-09-01 DE DE59409179T patent/DE59409179D1/de not_active Expired - Lifetime
- 1994-09-05 IL IL11086494A patent/IL110864A0/xx unknown
- 1994-09-07 FI FI944120A patent/FI944120A7/fi not_active Application Discontinuation
- 1994-09-08 CA CA002131644A patent/CA2131644C/en not_active Expired - Fee Related
- 1994-09-08 SK SK1073-94A patent/SK107394A3/sk unknown
- 1994-09-08 NZ NZ264420A patent/NZ264420A/en unknown
- 1994-09-08 CZ CZ942187A patent/CZ284006B6/cs not_active IP Right Cessation
- 1994-09-08 HU HU9402585A patent/HUT70556A/hu unknown
- 1994-09-09 KR KR1019940022688A patent/KR950008483A/ko not_active Withdrawn
- 1994-09-09 NO NO943336A patent/NO301639B1/no unknown
- 1994-09-09 CN CN94115157A patent/CN1054845C/zh not_active Expired - Fee Related
- 1994-09-09 ZA ZA946957A patent/ZA946957B/xx unknown
- 1994-09-12 JP JP21747594A patent/JP3652721B2/ja not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| AU683481B2 (en) | 1997-11-13 |
| TW249802B (show.php) | 1995-06-21 |
| ZA946957B (en) | 1995-04-18 |
| JPH07179426A (ja) | 1995-07-18 |
| CA2131644A1 (en) | 1995-03-11 |
| FI944120A7 (fi) | 1995-03-11 |
| HUT70556A (en) | 1995-10-30 |
| CA2131644C (en) | 2007-04-24 |
| NO301639B1 (no) | 1997-11-24 |
| NO943336D0 (no) | 1994-09-09 |
| CZ284006B6 (cs) | 1998-07-15 |
| CN1105991A (zh) | 1995-08-02 |
| AU7161794A (en) | 1995-03-23 |
| DE59409179D1 (de) | 2000-04-13 |
| ES2144501T3 (es) | 2000-06-16 |
| HU9402585D0 (en) | 1994-11-28 |
| NO943336L (no) | 1995-03-13 |
| JP3652721B2 (ja) | 2005-05-25 |
| ATE190307T1 (de) | 2000-03-15 |
| IL110864A0 (en) | 1994-11-28 |
| SK107394A3 (en) | 1995-05-10 |
| FI944120A0 (fi) | 1994-09-07 |
| CN1054845C (zh) | 2000-07-26 |
| CZ218794A3 (en) | 1995-03-15 |
| KR950008483A (ko) | 1995-04-17 |
| NZ264420A (en) | 1996-06-25 |
| US5508408A (en) | 1996-04-16 |
| PH31094A (en) | 1998-02-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| ES2359564T3 (es) | Derivados de benzamida útiles como inductores de diferenciación celular. | |
| JP4490911B2 (ja) | β−2アゴニストとしてのインドール誘導体 | |
| RU2354646C2 (ru) | Нафталиновые производные | |
| ES2289691T3 (es) | Derivados de sulfonamida para el tratamiento de enfermedades. | |
| EP0316630A1 (en) | Novel fenamic acid hydroxamate derivatives having cyclooxygenase and 5-lipoxygenase inhibition | |
| JPH03500890A (ja) | ロイコトリエンd4の拮抗薬としてのキノリン誘導体 | |
| CZ401397A3 (cs) | Bicyklické aminoderiváty a antagonist PGD2, který je obsahuje | |
| JPS6197256A (ja) | アルキルスルホンアミドフエニルアルキルアミン類 | |
| NL8700026A (nl) | Indoolderivaten, werkwijze ter bereiding daarvan, alsmede daarop gebaseerde farmaceutische preparaten. | |
| PL154186B1 (en) | Method for manufacturing arylic derivatives of the hydroxamic acid | |
| US5248693A (en) | Acetylene compounds and pharmaceutical compositions and methods of using the same | |
| HU219241B (en) | Amide derivatives, their preparation, intermediates and pharmaceutical compns. contg. the said amide derivatives | |
| SU1195903A3 (ru) | Способ получени 1-фенил- 2-аминокарбонилиндольных соединений или их солей присоединени кислот | |
| JP3353301B2 (ja) | Pla▲下2▼阻害剤としてのエステル類およびアミド類 | |
| EP0929521B1 (en) | Nmda (n-methyl-d-aspartate) antagonists | |
| EP0326106A2 (en) | Alkylene diamines | |
| PT643045E (pt) | Derivados de quinoleina como antagonistas de leucotrienos | |
| HU210683B (en) | Process for producing n-benzyl-n1-(phenyl-alkyl)-thiourea derivatives and pharmaceutical compositions containing the same | |
| FI98519C (fi) | Menetelmä substituoitujen indolien valmistamiseksi | |
| PL103682B1 (pl) | Sposob wytwarzania nowych pochodnych indazoliloksy-4-propanoloaminy | |
| JPH09510718A (ja) | 5ht1dアンタゴニストとしてのビフェニル誘導体 | |
| US4912135A (en) | Amide compounds | |
| JPS6335623B2 (show.php) | ||
| EP0736526B1 (en) | Pyrazolidine derivative, radical scavenger, brain-infarction depressant, and brain-edema depressant | |
| JP2002502414A (ja) | 細胞中のNa▲上+▼/H▲上+▼交換の阻害剤としてのグアニジン誘導体 |