PL79149B1 - Polymerization of olefins[us3901863a] - Google Patents
Polymerization of olefins[us3901863a] Download PDFInfo
- Publication number
- PL79149B1 PL79149B1 PL1972159344A PL15934472A PL79149B1 PL 79149 B1 PL79149 B1 PL 79149B1 PL 1972159344 A PL1972159344 A PL 1972159344A PL 15934472 A PL15934472 A PL 15934472A PL 79149 B1 PL79149 B1 PL 79149B1
- Authority
- PL
- Poland
- Prior art keywords
- metal
- organic
- oxygen
- compound
- groups
- Prior art date
Links
- 238000006116 polymerization reaction Methods 0.000 title claims description 36
- 150000001336 alkenes Chemical class 0.000 title abstract description 7
- 230000003197 catalytic effect Effects 0.000 claims abstract description 83
- 229910052751 metal Inorganic materials 0.000 claims abstract description 64
- 239000002184 metal Substances 0.000 claims abstract description 64
- 150000001875 compounds Chemical class 0.000 claims abstract description 29
- 239000001301 oxygen Substances 0.000 claims abstract description 27
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 27
- 239000003054 catalyst Substances 0.000 claims abstract description 17
- 150000002894 organic compounds Chemical class 0.000 claims abstract description 16
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims abstract description 10
- 239000007787 solid Substances 0.000 claims abstract description 10
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 5
- -1 oxygen organic compound Chemical class 0.000 claims description 83
- 238000000034 method Methods 0.000 claims description 63
- 239000010936 titanium Substances 0.000 claims description 52
- 239000011777 magnesium Substances 0.000 claims description 48
- 238000006243 chemical reaction Methods 0.000 claims description 39
- 229910052782 aluminium Inorganic materials 0.000 claims description 35
- 229910052749 magnesium Inorganic materials 0.000 claims description 23
- 229910052719 titanium Inorganic materials 0.000 claims description 23
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 22
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims description 21
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 18
- 125000004432 carbon atom Chemical group C* 0.000 claims description 18
- 150000004831 organic oxygen compounds Chemical class 0.000 claims description 18
- 230000000737 periodic effect Effects 0.000 claims description 16
- 125000004429 atom Chemical group 0.000 claims description 10
- 150000002739 metals Chemical class 0.000 claims description 10
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 8
- 238000002360 preparation method Methods 0.000 claims description 8
- 150000004703 alkoxides Chemical class 0.000 claims description 7
- 229910052710 silicon Inorganic materials 0.000 claims description 7
- 239000010703 silicon Substances 0.000 claims description 7
- 229910052725 zinc Inorganic materials 0.000 claims description 7
- 239000011701 zinc Substances 0.000 claims description 7
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 6
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 6
- 150000002736 metal compounds Chemical class 0.000 claims description 6
- 239000011575 calcium Substances 0.000 claims description 5
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 claims description 4
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 claims description 4
- 229910052791 calcium Inorganic materials 0.000 claims description 4
- 229910052742 iron Inorganic materials 0.000 claims description 4
- 239000011135 tin Substances 0.000 claims description 4
- 229910052718 tin Inorganic materials 0.000 claims description 4
- 229910052726 zirconium Inorganic materials 0.000 claims description 4
- 239000004711 α-olefin Substances 0.000 claims description 4
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 3
- 229910017052 cobalt Inorganic materials 0.000 claims description 3
- 239000010941 cobalt Substances 0.000 claims description 3
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 3
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 claims description 3
- 229910052759 nickel Inorganic materials 0.000 claims description 3
- 239000002253 acid Substances 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 150000003839 salts Chemical class 0.000 claims description 2
- 229940125851 compound 27 Drugs 0.000 claims 1
- 239000011949 solid catalyst Substances 0.000 claims 1
- 239000000203 mixture Substances 0.000 abstract description 33
- 239000005977 Ethylene Substances 0.000 abstract description 16
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 abstract description 15
- 238000002156 mixing Methods 0.000 abstract description 5
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 abstract description 4
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 abstract description 4
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 abstract description 4
- 150000002899 organoaluminium compounds Chemical class 0.000 abstract description 3
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 abstract description 2
- 229910052796 boron Inorganic materials 0.000 abstract description 2
- POILWHVDKZOXJZ-ARJAWSKDSA-M (z)-4-oxopent-2-en-2-olate Chemical compound C\C([O-])=C\C(C)=O POILWHVDKZOXJZ-ARJAWSKDSA-M 0.000 abstract 1
- 229910019440 Mg(OH) Inorganic materials 0.000 abstract 1
- 229910003088 Ti−O−Ti Inorganic materials 0.000 abstract 1
- 150000001399 aluminium compounds Chemical class 0.000 abstract 1
- 229920001296 polysiloxane Polymers 0.000 abstract 1
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 91
- 239000004698 Polyethylene Substances 0.000 description 50
- 229920000573 polyethylene Polymers 0.000 description 50
- 150000003254 radicals Chemical class 0.000 description 22
- 230000000694 effects Effects 0.000 description 19
- 239000003085 diluting agent Substances 0.000 description 17
- UAIZDWNSWGTKFZ-UHFFFAOYSA-L ethylaluminum(2+);dichloride Chemical compound CC[Al](Cl)Cl UAIZDWNSWGTKFZ-UHFFFAOYSA-L 0.000 description 16
- XDKQUSKHRIUJEO-UHFFFAOYSA-N magnesium;ethanolate Chemical compound [Mg+2].CC[O-].CC[O-] XDKQUSKHRIUJEO-UHFFFAOYSA-N 0.000 description 15
- 238000003756 stirring Methods 0.000 description 14
- 239000000243 solution Substances 0.000 description 13
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 12
- YHWCPXVTRSHPNY-UHFFFAOYSA-N butan-1-olate;titanium(4+) Chemical compound [Ti+4].CCCC[O-].CCCC[O-].CCCC[O-].CCCC[O-] YHWCPXVTRSHPNY-UHFFFAOYSA-N 0.000 description 12
- 239000000460 chlorine Substances 0.000 description 12
- 229910052801 chlorine Inorganic materials 0.000 description 12
- 229920000642 polymer Polymers 0.000 description 12
- 239000000376 reactant Substances 0.000 description 12
- 150000003624 transition metals Chemical class 0.000 description 12
- 239000007788 liquid Substances 0.000 description 11
- 229910052723 transition metal Inorganic materials 0.000 description 11
- 229910045601 alloy Inorganic materials 0.000 description 10
- 239000000956 alloy Substances 0.000 description 10
- 230000015572 biosynthetic process Effects 0.000 description 10
- 239000003153 chemical reaction reagent Substances 0.000 description 10
- 238000005755 formation reaction Methods 0.000 description 10
- 230000035939 shock Effects 0.000 description 10
- 238000000921 elemental analysis Methods 0.000 description 8
- 238000001914 filtration Methods 0.000 description 8
- 239000001257 hydrogen Substances 0.000 description 8
- 229910052739 hydrogen Inorganic materials 0.000 description 8
- 239000002244 precipitate Substances 0.000 description 8
- 238000004090 dissolution Methods 0.000 description 7
- 125000004430 oxygen atom Chemical group O* 0.000 description 7
- 229920000098 polyolefin Polymers 0.000 description 7
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 6
- 239000000155 melt Substances 0.000 description 6
- 150000002902 organometallic compounds Chemical class 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 5
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 5
- 125000000217 alkyl group Chemical group 0.000 description 5
- 238000004519 manufacturing process Methods 0.000 description 5
- 150000003623 transition metal compounds Chemical class 0.000 description 5
- MCULRUJILOGHCJ-UHFFFAOYSA-N triisobutylaluminium Chemical compound CC(C)C[Al](CC(C)C)CC(C)C MCULRUJILOGHCJ-UHFFFAOYSA-N 0.000 description 5
- BMTAFVWTTFSTOG-UHFFFAOYSA-N Butylate Chemical class CCSC(=O)N(CC(C)C)CC(C)C BMTAFVWTTFSTOG-UHFFFAOYSA-N 0.000 description 4
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 4
- 150000001335 aliphatic alkanes Chemical class 0.000 description 4
- 150000001924 cycloalkanes Chemical class 0.000 description 4
- YNLAOSYQHBDIKW-UHFFFAOYSA-M diethylaluminium chloride Chemical compound CC[Al](Cl)CC YNLAOSYQHBDIKW-UHFFFAOYSA-M 0.000 description 4
- 239000012535 impurity Substances 0.000 description 4
- UAEPNZWRGJTJPN-UHFFFAOYSA-N methylcyclohexane Chemical compound CC1CCCCC1 UAEPNZWRGJTJPN-UHFFFAOYSA-N 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 239000012429 reaction media Substances 0.000 description 4
- 238000000926 separation method Methods 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- 229910052720 vanadium Inorganic materials 0.000 description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- 239000004215 Carbon black (E152) Substances 0.000 description 3
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 3
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 3
- YRKCREAYFQTBPV-UHFFFAOYSA-N acetylacetone Chemical class CC(=O)CC(C)=O YRKCREAYFQTBPV-UHFFFAOYSA-N 0.000 description 3
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 3
- 125000003710 aryl alkyl group Chemical group 0.000 description 3
- 125000003118 aryl group Chemical group 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 125000000753 cycloalkyl group Chemical group 0.000 description 3
- 229910052731 fluorine Inorganic materials 0.000 description 3
- 239000011737 fluorine Substances 0.000 description 3
- 150000002367 halogens Chemical class 0.000 description 3
- 229930195733 hydrocarbon Natural products 0.000 description 3
- 239000011630 iodine Substances 0.000 description 3
- 229910052740 iodine Inorganic materials 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- JPUHCPXFQIXLMW-UHFFFAOYSA-N aluminium triethoxide Chemical compound CCO[Al](OCC)OCC JPUHCPXFQIXLMW-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- ZSWFCLXCOIISFI-UHFFFAOYSA-N cyclopentadiene Chemical compound C1C=CC=C1 ZSWFCLXCOIISFI-UHFFFAOYSA-N 0.000 description 2
- 238000001125 extrusion Methods 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 230000005484 gravity Effects 0.000 description 2
- 229920001519 homopolymer Polymers 0.000 description 2
- 150000004678 hydrides Chemical class 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- NNPPMTNAJDCUHE-UHFFFAOYSA-N isobutane Chemical compound CC(C)C NNPPMTNAJDCUHE-UHFFFAOYSA-N 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- 239000011572 manganese Substances 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- GYNNXHKOJHMOHS-UHFFFAOYSA-N methyl-cycloheptane Natural products CC1CCCCCC1 GYNNXHKOJHMOHS-UHFFFAOYSA-N 0.000 description 2
- 239000000178 monomer Substances 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- LEONUFNNVUYDNQ-UHFFFAOYSA-N vanadium atom Chemical compound [V] LEONUFNNVUYDNQ-UHFFFAOYSA-N 0.000 description 2
- PEIHRCIDUUJQCQ-UHFFFAOYSA-N 1,3-bis(ethenyl)cyclohexane Chemical compound C=CC1CCCC(C=C)C1 PEIHRCIDUUJQCQ-UHFFFAOYSA-N 0.000 description 1
- VYXHVRARDIDEHS-UHFFFAOYSA-N 1,5-cyclooctadiene Chemical compound C1CC=CCCC=C1 VYXHVRARDIDEHS-UHFFFAOYSA-N 0.000 description 1
- 239000004912 1,5-cyclooctadiene Substances 0.000 description 1
- CCFAKBRKTKVJPO-UHFFFAOYSA-N 1-anthroic acid Chemical class C1=CC=C2C=C3C(C(=O)O)=CC=CC3=CC2=C1 CCFAKBRKTKVJPO-UHFFFAOYSA-N 0.000 description 1
- HECLRDQVFMWTQS-RGOKHQFPSA-N 1755-01-7 Chemical compound C1[C@H]2[C@@H]3CC=C[C@@H]3[C@@H]1C=C2 HECLRDQVFMWTQS-RGOKHQFPSA-N 0.000 description 1
- NEAQRZUHTPSBBM-UHFFFAOYSA-N 2-hydroxy-3,3-dimethyl-7-nitro-4h-isoquinolin-1-one Chemical compound C1=C([N+]([O-])=O)C=C2C(=O)N(O)C(C)(C)CC2=C1 NEAQRZUHTPSBBM-UHFFFAOYSA-N 0.000 description 1
- VSYZXASVWVQEMR-UHFFFAOYSA-N 2-methylbuta-1,3-dienylalumane Chemical compound CC(=C[AlH2])C=C VSYZXASVWVQEMR-UHFFFAOYSA-N 0.000 description 1
- WSSSPWUEQFSQQG-UHFFFAOYSA-N 4-methyl-1-pentene Chemical compound CC(C)CC=C WSSSPWUEQFSQQG-UHFFFAOYSA-N 0.000 description 1
- WDYVUKGVKRZQNM-UHFFFAOYSA-N 6-phosphonohexylphosphonic acid Chemical compound OP(O)(=O)CCCCCCP(O)(O)=O WDYVUKGVKRZQNM-UHFFFAOYSA-N 0.000 description 1
- 239000005725 8-Hydroxyquinoline Substances 0.000 description 1
- 101100005001 Caenorhabditis elegans cah-5 gene Proteins 0.000 description 1
- 241000195493 Cryptophyta Species 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- IJHRFLJHRSNMGI-UHFFFAOYSA-N [Mg].C=C Chemical group [Mg].C=C IJHRFLJHRSNMGI-UHFFFAOYSA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 1
- 239000012190 activator Substances 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical class OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 1
- KGGVGTQEGGOZRN-UHFFFAOYSA-N butanal oxime Chemical class CCCC=NO KGGVGTQEGGOZRN-UHFFFAOYSA-N 0.000 description 1
- 239000001273 butane Substances 0.000 description 1
- 150000004648 butanoic acid derivatives Chemical class 0.000 description 1
- UJYLYGDHTIVYRI-UHFFFAOYSA-N cadmium(2+);ethane Chemical compound [Cd+2].[CH2-]C.[CH2-]C UJYLYGDHTIVYRI-UHFFFAOYSA-N 0.000 description 1
- 238000003490 calendering Methods 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 150000001734 carboxylic acid salts Chemical class 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 239000013522 chelant Chemical class 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 230000009918 complex formation Effects 0.000 description 1
- 238000007334 copolymerization reaction Methods 0.000 description 1
- HPXRVTGHNJAIIH-UHFFFAOYSA-N cyclohexanol Chemical compound OC1CCCCC1 HPXRVTGHNJAIIH-UHFFFAOYSA-N 0.000 description 1
- 238000010908 decantation Methods 0.000 description 1
- 150000001993 dienes Chemical class 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- CQYBWJYIKCZXCN-UHFFFAOYSA-N diethylaluminum Chemical compound CC[Al]CC CQYBWJYIKCZXCN-UHFFFAOYSA-N 0.000 description 1
- JGUQDUKBUKFFRO-CIIODKQPSA-N dimethylglyoxime Chemical class O/N=C(/C)\C(\C)=N\O JGUQDUKBUKFFRO-CIIODKQPSA-N 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N dodecane Chemical class CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- POULHZVOKOAJMA-UHFFFAOYSA-N dodecanoic acid Chemical class CCCCCCCCCCCC(O)=O POULHZVOKOAJMA-UHFFFAOYSA-N 0.000 description 1
- JBRVDBBLWMNHDA-UHFFFAOYSA-N ethane-1,2-diol;dihydrochloride Chemical compound Cl.Cl.OCCO JBRVDBBLWMNHDA-UHFFFAOYSA-N 0.000 description 1
- LDLDYFCCDKENPD-UHFFFAOYSA-N ethenylcyclohexane Chemical compound C=CC1CCCCC1 LDLDYFCCDKENPD-UHFFFAOYSA-N 0.000 description 1
- 239000010419 fine particle Substances 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 238000010528 free radical solution polymerization reaction Methods 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- 229920001903 high density polyethylene Polymers 0.000 description 1
- 238000000265 homogenisation Methods 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 150000002443 hydroxylamines Chemical class 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 238000001746 injection moulding Methods 0.000 description 1
- 239000001282 iso-butane Substances 0.000 description 1
- GMDNUWQNDQDBNQ-UHFFFAOYSA-L magnesium;diformate Chemical compound [Mg+2].[O-]C=O.[O-]C=O GMDNUWQNDQDBNQ-UHFFFAOYSA-L 0.000 description 1
- DLPASUVGCQPFFO-UHFFFAOYSA-N magnesium;ethane Chemical compound [Mg+2].[CH2-]C.[CH2-]C DLPASUVGCQPFFO-UHFFFAOYSA-N 0.000 description 1
- 150000002688 maleic acid derivatives Chemical class 0.000 description 1
- 150000002690 malonic acid derivatives Chemical class 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000003607 modifier Substances 0.000 description 1
- IJDNQMDRQITEOD-UHFFFAOYSA-N n-butane Chemical compound CCCC IJDNQMDRQITEOD-UHFFFAOYSA-N 0.000 description 1
- 125000005609 naphthenate group Chemical group 0.000 description 1
- SJYNFBVQFBRSIB-UHFFFAOYSA-N norbornadiene Chemical compound C1=CC2C=CC1C2 SJYNFBVQFBRSIB-UHFFFAOYSA-N 0.000 description 1
- 150000002927 oxygen compounds Chemical class 0.000 description 1
- 229960003540 oxyquinoline Drugs 0.000 description 1
- 238000004806 packaging method and process Methods 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- GYUPBLLGIHQRGT-UHFFFAOYSA-N pentane-2,4-dione;titanium Chemical compound [Ti].CC(=O)CC(C)=O GYUPBLLGIHQRGT-UHFFFAOYSA-N 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 239000002530 phenolic antioxidant Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical class OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 125000005498 phthalate group Chemical class 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 125000005547 pivalate group Chemical group 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- RPDAUEIUDPHABB-UHFFFAOYSA-N potassium ethoxide Chemical compound [K+].CC[O-] RPDAUEIUDPHABB-UHFFFAOYSA-N 0.000 description 1
- 238000010926 purge Methods 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- MCJGNVYPOGVAJF-UHFFFAOYSA-N quinolin-8-ol Chemical compound C1=CN=C2C(O)=CC=CC2=C1 MCJGNVYPOGVAJF-UHFFFAOYSA-N 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- CXMXRPHRNRROMY-UHFFFAOYSA-N sebacic acid Chemical class OC(=O)CCCCCCCCC(O)=O CXMXRPHRNRROMY-UHFFFAOYSA-N 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 239000010802 sludge Substances 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 238000001179 sorption measurement Methods 0.000 description 1
- 238000010557 suspension polymerization reaction Methods 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- AFCAKJKUYFLYFK-UHFFFAOYSA-N tetrabutyltin Chemical compound CCCC[Sn](CCCC)(CCCC)CCCC AFCAKJKUYFLYFK-UHFFFAOYSA-N 0.000 description 1
- RWWNQEOPUOCKGR-UHFFFAOYSA-N tetraethyltin Chemical compound CC[Sn](CC)(CC)CC RWWNQEOPUOCKGR-UHFFFAOYSA-N 0.000 description 1
- MYWQGROTKMBNKN-UHFFFAOYSA-N tributoxyalumane Chemical compound [Al+3].CCCC[O-].CCCC[O-].CCCC[O-] MYWQGROTKMBNKN-UHFFFAOYSA-N 0.000 description 1
- SQBBHCOIQXKPHL-UHFFFAOYSA-N tributylalumane Chemical compound CCCC[Al](CCCC)CCCC SQBBHCOIQXKPHL-UHFFFAOYSA-N 0.000 description 1
- VOITXYVAKOUIBA-UHFFFAOYSA-N triethylaluminium Chemical compound CC[Al](CC)CC VOITXYVAKOUIBA-UHFFFAOYSA-N 0.000 description 1
- ORYGRKHDLWYTKX-UHFFFAOYSA-N trihexylalumane Chemical compound CCCCCC[Al](CCCCCC)CCCCCC ORYGRKHDLWYTKX-UHFFFAOYSA-N 0.000 description 1
- JLTRXTDYQLMHGR-UHFFFAOYSA-N trimethylaluminium Chemical compound C[Al](C)C JLTRXTDYQLMHGR-UHFFFAOYSA-N 0.000 description 1
- UKHQRARQNZOXRL-UHFFFAOYSA-N trimethyltin Chemical compound C[SnH](C)C UKHQRARQNZOXRL-UHFFFAOYSA-N 0.000 description 1
- 238000011144 upstream manufacturing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F10/00—Homopolymers and copolymers of unsaturated aliphatic hydrocarbons having only one carbon-to-carbon double bond
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F2410/00—Features related to the catalyst preparation, the catalyst use or to the deactivation of the catalyst
- C08F2410/03—Multinuclear procatalyst, i.e. containing two or more metals, being different or not
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F2410/00—Features related to the catalyst preparation, the catalyst use or to the deactivation of the catalyst
- C08F2410/04—Dual catalyst, i.e. use of two different catalysts, where none of the catalysts is a metallocene
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Transition And Organic Metals Composition Catalysts For Addition Polymerization (AREA)
- Polymerization Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| LU64420 | 1971-12-08 | ||
| LU65445A LU65445A1 (show.php) | 1972-06-01 | 1972-06-01 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL79149B1 true PL79149B1 (en) | 1975-06-30 |
Family
ID=26640097
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1972159344A PL79149B1 (en) | 1971-12-08 | 1972-12-06 | Polymerization of olefins[us3901863a] |
Country Status (23)
| Country | Link |
|---|---|
| US (1) | US3901863A (show.php) |
| JP (2) | JPS5227677B2 (show.php) |
| AR (1) | AR194289A1 (show.php) |
| BE (1) | BE791676A (show.php) |
| BG (1) | BG26814A3 (show.php) |
| CA (1) | CA1002696A (show.php) |
| CH (1) | CH563413A5 (show.php) |
| DD (1) | DD102389A5 (show.php) |
| DE (1) | DE2259516C2 (show.php) |
| DK (1) | DK144274C (show.php) |
| ES (1) | ES408382A1 (show.php) |
| FI (1) | FI56192C (show.php) |
| FR (1) | FR2162395B1 (show.php) |
| GB (1) | GB1394378A (show.php) |
| HK (1) | HK59878A (show.php) |
| IT (1) | IT971200B (show.php) |
| MY (1) | MY7800410A (show.php) |
| NL (1) | NL150805B (show.php) |
| NO (1) | NO141557C (show.php) |
| PL (1) | PL79149B1 (show.php) |
| RO (1) | RO63528A (show.php) |
| SE (1) | SE407412B (show.php) |
| YU (1) | YU34487B (show.php) |
Families Citing this family (105)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5077357A (en) * | 1990-10-22 | 1991-12-31 | Shell Oil Company | Olefin polymerization catalyst |
| US5066737A (en) * | 1990-10-22 | 1991-11-19 | Shell Oil Company | Olefin polymerization catalyst |
| US5082907A (en) * | 1990-10-18 | 1992-01-21 | Shell Oil Company | Olefin polymerization catalyst |
| LU65587A1 (show.php) * | 1972-06-22 | 1973-12-27 | ||
| JPS515384A (en) * | 1974-07-02 | 1976-01-17 | Yozo Kondo | Horiorefuinno seizohoho |
| JPS5146387A (en) * | 1974-10-18 | 1976-04-20 | Yozo Kondo | Horiorefuinno seizohoho |
| US4192772A (en) * | 1975-04-14 | 1980-03-11 | Solvay & Cie | Solid catalyst and process for the preparation thereof |
| LU72278A1 (show.php) * | 1975-04-14 | 1977-02-03 | ||
| IT1038179B (it) * | 1975-05-16 | 1979-11-20 | Montedison Spa | Procedimento di polimerizzazione di alfa olefine con almeno treatoni di carbonto |
| NL7613855A (nl) * | 1975-12-18 | 1977-06-21 | Sumitomo Chemical Co | Werkwijze voor het polymeriseren van olefinen. |
| NL171273C (nl) * | 1976-05-24 | 1983-03-01 | Stamicarbon | Werkwijze voor het polymeriseren van alkenen en werkwijze voor het bereiden van een chroomoxyde-op drager-katalysator. |
| US4242479A (en) * | 1976-12-23 | 1980-12-30 | Showa Yuka Kabushiki Kaisha | Process for producing an improved ethylenic polymer |
| LU77489A1 (show.php) * | 1977-06-06 | 1979-01-19 | ||
| US4105846A (en) * | 1977-08-25 | 1978-08-08 | Standard Oil Company (Indiana) | Increasing the particle size of as formed polyethylene or ethylene copolymer |
| DE2752577A1 (de) * | 1977-11-25 | 1979-06-07 | Hoechst Ag | Verfahren zur herstellung eines mischkatalysators |
| US4232138A (en) * | 1977-12-19 | 1980-11-04 | Standard Oil Company (Indiana) | Olefin polymerization catalyst |
| IT1110494B (it) * | 1978-08-02 | 1985-12-23 | Montedison Spa | Polimeri dell etilene e procedimento per la loro preparazione |
| US4199476A (en) * | 1978-08-23 | 1980-04-22 | Standard Oil Company (Indiana) | Olefin polymerization catalyst |
| US4233182A (en) * | 1978-12-26 | 1980-11-11 | Standard Oil Company (Indiana) | High activity catalyst for the polymerization of alpha-olefins |
| US4240929A (en) * | 1979-01-15 | 1980-12-23 | Phillips Petroleum Company | Polymerization of olefins |
| US4238354A (en) * | 1979-01-15 | 1980-12-09 | Phillips Petroleum Company | Polymerization of olefins |
| US4235746A (en) * | 1979-01-17 | 1980-11-25 | Phillips Petroleum Company | Polymerization of olefins |
| US4277370A (en) * | 1979-02-15 | 1981-07-07 | Standard Oil Company (Indiana) | Alpha-olefin polymerization catalyst |
| US4324690A (en) * | 1979-02-15 | 1982-04-13 | Standard Oil Company (Indiana) | Alpha-olefin polymerization catalyst |
| DE2906639C2 (de) * | 1979-02-21 | 1982-03-25 | Chemische Werke Hüls AG, 4370 Marl | Verfahren zur Herstellung von weitgehend amorphen Ho mo- und/oder Copolymerisaten von α-Olefinen mit 3-3 2 Kohlenstoffatomen |
| US4363746A (en) * | 1979-05-29 | 1982-12-14 | Phillips Petroleum Company | Composition of matter and method of preparing same, catalyst, method of producing the catalyst and polymerization process employing the catalyst |
| US4246383A (en) * | 1979-06-25 | 1981-01-20 | The Dow Chemical Company | Process for polymerizing olefins in the presence of a catalyst prepared from an organomagnesium component which does not reduce TiCl4 |
| US4244838A (en) * | 1979-06-25 | 1981-01-13 | The Dow Chemical Company | High efficiency catalyst for polymerizing olefins |
| US4313850A (en) * | 1979-10-15 | 1982-02-02 | Standard Oil Company (Indiana) | Catalyst for the polymerization of alpha-olefins |
| DE3004650A1 (de) * | 1980-02-08 | 1981-08-13 | Chemische Werke Hüls AG, 4370 Marl | Verfahren zur polymerisation von ethylen sowie zu dessen copolymerisation mit bis zu 30 gewichtsprozent eines hoeheren (alpha) -olefins |
| US4429087A (en) | 1980-08-04 | 1984-01-31 | Phillips Petroleum Company | Polymerization catalyst and process |
| US4328121A (en) * | 1980-08-04 | 1982-05-04 | Phillips Petroleum Company | Polymerization catalyst and process |
| US4326988A (en) * | 1980-08-12 | 1982-04-27 | Phillips Petroleum Company | Catalyst, method of producing the catalyst, and polymerization process employing the catalyst |
| US4325837A (en) * | 1980-08-12 | 1982-04-20 | Phillips Petroleum Company | Catalyst, method of producing the catalyst, and polymerization process employing the catalyst |
| US4410671A (en) * | 1980-08-12 | 1983-10-18 | Phillips Petroleum Company | Catalyst, method of producing the catalyst, and polymerization process employing the catalyst |
| US4311612A (en) * | 1980-08-25 | 1982-01-19 | Standard Oil Company (Indiana) | Olefin polymerization catalyst |
| US4496660A (en) * | 1980-10-01 | 1985-01-29 | The Dow Chemical Company | Catalyst prepared from organo-magnesium compound; oxygen- or nitrogen-containing compound; halide source; transition metal compound and reducing agent |
| US4513095A (en) * | 1980-11-24 | 1985-04-23 | National Distillers And Chemical Corporation | Intermetallic compounds of polymeric transition metal oxide alkoxides and catalytic use thereof |
| US4329255A (en) * | 1980-12-29 | 1982-05-11 | Gulf Research & Development Company | Catalyst composition |
| US4330432A (en) * | 1980-12-29 | 1982-05-18 | Gulf Research & Development Company | Catalyst composition |
| US4394291A (en) * | 1981-03-04 | 1983-07-19 | Phillips Petroleum Company | Polyolefin polymerization process and catalyst |
| US4525554A (en) * | 1981-03-04 | 1985-06-25 | Mitsubishi Chemical Industries Ltd. | Process for polymerizing olefin |
| US4376064A (en) * | 1981-05-26 | 1983-03-08 | Standard Oil Co. (Indiana) | Catalyst and process for production of polyolefins of improved morphology |
| US4384983A (en) * | 1981-05-26 | 1983-05-24 | Standard Oil Company (Indiana) | Catalyst and process for production of polyolefins of improved morphology |
| US4408025A (en) * | 1981-11-12 | 1983-10-04 | The Dow Chemical Company | Process for polymerizing olefins |
| US4544647A (en) * | 1982-07-29 | 1985-10-01 | The Dow Chemical Company | Catalyst prepared from organomagnesium compound, organic hydroxyl-containing compound, reducing halide source and transition metal compound |
| US4526943A (en) * | 1982-07-29 | 1985-07-02 | The Dow Chemical Company | Process for polymerizing olefins in the presence of a catalyst prepared from organomagnesium compound, organic hydroxyl-containing compound, reducing halide source and transition metal compound |
| US4529715A (en) * | 1983-10-17 | 1985-07-16 | The Dow Chemical Company | Catalyst prepared from organomagnesium compound, carbon dioxide, reducing aluminum source, transition metal compound and zinc compound |
| US4426316A (en) | 1982-09-10 | 1984-01-17 | The Dow Chemical Company | Catalyst prepared from organomagnesium compound, organic hydroxyl-containing compound, reducing halide source and transition metal compound |
| US4604374A (en) * | 1982-09-20 | 1986-08-05 | The Dow Chemical Company | Catalyst prepared from organomagnesium compound, epihalohydrin reducing halide source and transition metal compound |
| US4605715A (en) * | 1982-09-20 | 1986-08-12 | The Dow Chemical Company | Process for polymerizing olefins in the presence of a catalyst prepared from organomagnesium compound, epihalohydrin reducing halide source and transition metal compound |
| US4699961A (en) * | 1982-09-30 | 1987-10-13 | E. I. Du Pont De Nemours & Co. | High efficiency catalysts for varying olefin polymer molecular weight distribution |
| US4675368A (en) * | 1982-10-04 | 1987-06-23 | Solvay & Cie. | Process for inhibiting crust formation in reactors during alpha-olefin prepolymerization modification of Ziegler catalyst |
| US4434282A (en) | 1982-10-04 | 1984-02-28 | The Dow Chemical Company | Process for polymerizing olefins |
| US4456547A (en) * | 1982-10-21 | 1984-06-26 | Fuentes Jr Ricardo | Catalyst prepared from organomagnesium compound, organic hydroxyl-containing compound, reducing halide source and complex formed from admixture of a transition metal compound and an organozinc compound |
| US4506029A (en) * | 1982-12-20 | 1985-03-19 | Stauffer Chemical Company | Supported catalyst for polymerization of olefins |
| US4472521A (en) * | 1982-12-20 | 1984-09-18 | Stauffer Chemical Company | Supported catalyst for polymerization of olefins |
| US4770902A (en) * | 1983-05-23 | 1988-09-13 | National Distillers And Chemical Corporation | Method for covering an electrical conducting means |
| US4548969A (en) * | 1983-05-23 | 1985-10-22 | Maringer Melvin F | Cross-linkable rotational molding compositions |
| US4555379A (en) * | 1983-05-23 | 1985-11-26 | National Distillers And Chemical Corporation | Cross-linkable rotational molding compositions |
| US4603183A (en) * | 1983-08-18 | 1986-07-29 | E. I. Du Pont De Nemours & Co. | Hydrocarbon soluble catalyst supports and resultant polymerization catalysts |
| DE3335823A1 (de) * | 1983-10-01 | 1985-04-18 | Ruhrchemie Ag, 4200 Oberhausen | Verfahren zur homo- und mischpolymerisation von ethylen |
| JPS60110704A (ja) * | 1983-11-22 | 1985-06-17 | Idemitsu Kosan Co Ltd | ポリオレフインの製造方法 |
| US4569975A (en) * | 1984-03-19 | 1986-02-11 | The Dow Chemical Company | Polymerization of olefins in presence of a catalyst prepared from organomagnesium compound, carbon dioxide compound, reducing halide source and transition metal compound |
| US4618662A (en) * | 1984-04-23 | 1986-10-21 | Mobil Oil Corporation | Catalyst composition for polymerizing alpha-olefins |
| US4861846A (en) * | 1985-03-22 | 1989-08-29 | Union Carbidae Corporation | Process for simultaneously dimerizing ethylene and copolymerizing ethylene with the dimerized product |
| US4783512A (en) * | 1985-05-20 | 1988-11-08 | The Dow Chemical Company | Process for polymerizing olefins in the presence of a catalyst prepared from organomagnesium compound, organic hydroxyl-containing compound, reducing halide source and transition metal compound |
| US4661465A (en) * | 1985-10-31 | 1987-04-28 | The Dow Chemical Company | Method for preparing transition metal component of Ziegler-Natta catalysts |
| JPH0721024B2 (ja) * | 1986-03-04 | 1995-03-08 | 出光石油化学株式会社 | エチレン重合体または共重合体の製造方法 |
| JPH0717714B2 (ja) * | 1986-06-25 | 1995-03-01 | 出光石油化学株式会社 | 直鎖状低密度ポリエチレンの製造方法 |
| FR2627495B1 (fr) * | 1988-02-22 | 1992-01-17 | Solvay | Solide catalytique utilisable pour la polymerisation des alpha-olefines, procede pour sa preparation et procede de polymerisation des alpha-olefines en presence d'un systeme catalytique comprenant ce solide |
| JP2936168B2 (ja) * | 1988-12-27 | 1999-08-23 | 東ソー株式会社 | ポリオレフィンの製造法 |
| JP2850427B2 (ja) * | 1989-12-25 | 1999-01-27 | 東ソー株式会社 | ポリオレフィンの製造方法 |
| US5045612A (en) * | 1990-04-18 | 1991-09-03 | The Dow Chemical Company | Catalyst and process for polymerizing olefins |
| US5114897A (en) * | 1990-04-18 | 1992-05-19 | The Dow Chemical Company | Catalyst and process for polymerizing olefins |
| US5141910A (en) * | 1990-10-18 | 1992-08-25 | Shell Oil Company | Olefin polymerization catalyst |
| US5132263A (en) * | 1990-10-22 | 1992-07-21 | Shell Oil Company | Olefin polymerization catalyst |
| US5124298A (en) * | 1990-10-22 | 1992-06-23 | Shell Oil Company | Olefin polymerization catalyst |
| US6730627B1 (en) | 1991-07-12 | 2004-05-04 | Ecp Enichem Polimeri S.R.L. | Solid component of catalyst for the (co) polymerization of ethylene and α-olefins |
| IT1251785B (it) * | 1991-07-12 | 1995-05-26 | Enichem Polimeri | Procedimento per la preparazione di un componente solido di catalizzatore per la (co)polimerizzazione di etilene |
| EP0530814B1 (en) * | 1991-09-05 | 1998-12-16 | Tosoh Corporation | Method for producing a stereospecific polyolefin |
| IT1252069B (it) * | 1991-11-25 | 1995-05-29 | Enichem Elastomers | Processo per la preparazione di copolimeri elastomerici dell'etilene |
| BE1006438A3 (fr) * | 1992-12-17 | 1994-08-30 | Solvay | Systeme catalytique, utilisation de ce systeme catalytique pour la (co)polymerisation d'olefines, procede de preparation de ce systeme catalytique et procede de (co)polymerisation d'olefines. |
| BE1007040A3 (fr) * | 1993-05-25 | 1995-02-28 | Solvay | Support de catalyseur et catalyseur de polymerisation des alpha-olefines; procedes pour leur obtention et polymerisation des alpha-olefines en presence du catalyseur. |
| JP3319051B2 (ja) * | 1993-07-28 | 2002-08-26 | 東ソー株式会社 | ポリオレフィンの製造方法 |
| BE1011333A3 (fr) | 1997-08-20 | 1999-07-06 | Solvay | Procede de fabrication d'une composition de polymeres d'ethylene. |
| KR20020019476A (ko) * | 1999-06-30 | 2002-03-12 | 조셉 에스. 바이크 | 마그네슘-지르코늄 알콕사이드 착물 및 이로부터 제조된중합 촉매 |
| CA2369208A1 (en) | 1999-06-30 | 2001-01-04 | Robert Charles Job | Methods of making magnesium/transition metal alkoxide complexes and polymerization catalysts made therefrom |
| AR025187A1 (es) | 1999-06-30 | 2002-11-13 | Poration Union Carbide Chemicals & Plastics Technology Cor | Un precursor de complejo de metales mixtos, un metodo para elaborarlo, un procatalizador de la polimerizacion preparado mediante la halogenacion delprecursor y un metodo para polimerizar una olefina |
| EP1630178A1 (en) | 2004-08-10 | 2006-03-01 | Innovene Manufacturing Belgium NV | Polymerisation process |
| EP1820820A1 (en) | 2006-02-15 | 2007-08-22 | INEOS Manufacturing Belgium NV | Polyethylene composition |
| ES2356545B1 (es) * | 2008-11-19 | 2012-02-22 | Sumitomo Chemical Company, Limited | Proceso para producir un precursor de un componente de catalizador sólido para la polimerización de olefinas. |
| PL2382246T3 (pl) | 2009-01-23 | 2014-01-31 | Evonik Degussa Gmbh | Polimeryzacja poliolefin w fazie gazowej z 3-podstawionym C4-10 alkenem |
| SG173099A1 (en) | 2009-01-23 | 2011-08-29 | Evonik Oxeno Gmbh | Pe mib film zn/cr |
| IT1397080B1 (it) | 2009-11-23 | 2012-12-28 | Polimeri Europa Spa | Catalizzatore di tipo ziegler-natta per la (co)polimerizzazione delle alfa-olefine con elevata produttivita' |
| EP2410011A1 (en) | 2010-07-23 | 2012-01-25 | INEOS Manufacturing Belgium NV | Polyethylene composition |
| IT1403278B1 (it) | 2010-12-20 | 2013-10-17 | Polimeri Europa Spa | Precursore di catalizzatore e catalizzatore per la (co)polimerizzazione delle alfa-olefine ad alta temperatura |
| RU2636660C2 (ru) | 2012-04-19 | 2017-11-27 | Инеос Юроуп Аг | Катализатор, предназначенный для полимеризации олефинов, способ его получения и применение |
| BR112014029739B1 (pt) | 2012-05-30 | 2021-01-12 | Ineos Europe Ag | composição polimérica para moldagem por sopro |
| BR112014032628B1 (pt) | 2012-06-26 | 2021-06-22 | Ineos Europe Ag | Película formada por uma composição de polietileno |
| DE102015212930B4 (de) * | 2015-07-10 | 2019-05-23 | Heraeus Deutschland GmbH & Co. KG | Verfahren zur Herstellung supraleitender Dichtungsringe |
| US20240043580A1 (en) | 2020-12-22 | 2024-02-08 | Ineos Europe Ag | Polymer composition for caps and closures |
| WO2023012125A1 (en) | 2021-08-03 | 2023-02-09 | Ineos Europe Ag | Polyethylene film |
| US20250109218A1 (en) | 2023-09-29 | 2025-04-03 | Formosa Plastics Corporation, U.S.A. | Method for preparing catalyst component for polymerization of polyolefin without the use of internal electron donors |
| US20250115687A1 (en) | 2023-10-06 | 2025-04-10 | Formosa Plastics Corporation, U.S.A. | Production method for solid catalyst component for polymerizing olefins, and catalyst for polymerizaing olefins |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3326877A (en) * | 1963-11-13 | 1967-06-20 | Cabot Corp | Catalysts and process for polymerization |
| GB1077397A (en) * | 1965-06-21 | 1967-07-26 | Internat Synthetic Rubber Comp | Ethylene copolymerisation catalyst |
| NL137056C (show.php) * | 1966-10-21 | |||
| US3544533A (en) * | 1967-08-03 | 1970-12-01 | Goodrich Co B F | Process and modified catalyst for the polymerization of alpha-olefins |
| NL153555B (nl) * | 1968-05-15 | 1977-06-15 | Stamicarbon | Werkwijze ter bereiding van alkeenpolymeren. |
| US3676415A (en) * | 1968-06-27 | 1972-07-11 | Hoechst Ag | Process for polymerizing {60 -olefins |
| NL136668C (show.php) * | 1969-01-24 | |||
| FR2093306A6 (fr) * | 1970-06-09 | 1972-01-28 | Solvay | Catalyseurs et procede perfectionnes pour la polymerisation et la copolymerisation des olefines |
| US3687910A (en) * | 1970-03-20 | 1972-08-29 | Du Pont | Transition metal oxide catalysts |
-
0
- BE BE791676D patent/BE791676A/xx not_active IP Right Cessation
-
1972
- 1972-11-08 ES ES408382A patent/ES408382A1/es not_active Expired
- 1972-11-09 YU YU2778/72A patent/YU34487B/xx unknown
- 1972-11-21 CH CH1696172A patent/CH563413A5/xx not_active IP Right Cessation
- 1972-11-24 IT IT32078/72A patent/IT971200B/it active
- 1972-11-24 AR AR245316A patent/AR194289A1/es active
- 1972-11-28 BG BG021979A patent/BG26814A3/xx unknown
- 1972-11-29 FR FR7242518A patent/FR2162395B1/fr not_active Expired
- 1972-11-29 NL NL727216195A patent/NL150805B/xx not_active IP Right Cessation
- 1972-12-01 CA CA158,027A patent/CA1002696A/en not_active Expired
- 1972-12-05 DE DE2259516A patent/DE2259516C2/de not_active Expired
- 1972-12-06 NO NO4487/72A patent/NO141557C/no unknown
- 1972-12-06 DD DD167440A patent/DD102389A5/xx unknown
- 1972-12-06 US US312744A patent/US3901863A/en not_active Expired - Lifetime
- 1972-12-06 RO RO7273057A patent/RO63528A/ro unknown
- 1972-12-06 PL PL1972159344A patent/PL79149B1/pl unknown
- 1972-12-07 SE SE7215951A patent/SE407412B/sv unknown
- 1972-12-07 DK DK609972A patent/DK144274C/da not_active IP Right Cessation
- 1972-12-08 GB GB5671972A patent/GB1394378A/en not_active Expired
- 1972-12-08 JP JP47123270A patent/JPS5227677B2/ja not_active Expired
- 1972-12-08 FI FI3483/72A patent/FI56192C/fi active
-
1975
- 1975-09-20 JP JP50114216A patent/JPS5154889A/ja active Granted
-
1978
- 1978-10-12 HK HK598/78A patent/HK59878A/xx unknown
- 1978-12-30 MY MY410/78A patent/MY7800410A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DK144274B (da) | 1982-02-01 |
| YU277872A (en) | 1979-02-28 |
| NO141557C (no) | 1980-04-09 |
| IT971200B (it) | 1974-04-30 |
| JPS5154889A (en) | 1976-05-14 |
| US3901863A (en) | 1975-08-26 |
| SE407412B (sv) | 1979-03-26 |
| FR2162395A1 (show.php) | 1973-07-20 |
| JPS4866178A (show.php) | 1973-09-11 |
| FI56192C (fi) | 1979-12-10 |
| NL150805B (nl) | 1976-09-15 |
| BG26814A3 (bg) | 1979-06-12 |
| AR194289A1 (es) | 1973-06-29 |
| FI56192B (fi) | 1979-08-31 |
| FR2162395B1 (show.php) | 1975-03-28 |
| NL7216195A (show.php) | 1973-06-13 |
| JPS5227677B2 (show.php) | 1977-07-21 |
| YU34487B (en) | 1979-09-10 |
| DE2259516A1 (de) | 1973-06-14 |
| JPS568842B2 (show.php) | 1981-02-26 |
| RO63528A (fr) | 1979-02-15 |
| NO141557B (no) | 1979-12-27 |
| ES408382A1 (es) | 1975-11-16 |
| DE2259516C2 (de) | 1987-03-05 |
| CA1002696A (en) | 1976-12-28 |
| DK144274C (da) | 1982-07-05 |
| HK59878A (en) | 1978-10-20 |
| CH563413A5 (show.php) | 1975-06-30 |
| GB1394378A (en) | 1975-05-14 |
| BE791676A (fr) | 1973-05-21 |
| MY7800410A (en) | 1978-12-31 |
| DD102389A5 (show.php) | 1973-12-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL79149B1 (en) | Polymerization of olefins[us3901863a] | |
| US4296223A (en) | Polymerization of olefins | |
| US4244838A (en) | High efficiency catalyst for polymerizing olefins | |
| US4246383A (en) | Process for polymerizing olefins in the presence of a catalyst prepared from an organomagnesium component which does not reduce TiCl4 | |
| US4431568A (en) | Catalyst for polymerization of olefins and polymerization process employing such catalyst | |
| US4496660A (en) | Catalyst prepared from organo-magnesium compound; oxygen- or nitrogen-containing compound; halide source; transition metal compound and reducing agent | |
| EP0186658A4 (en) | NEW TITANIUM CATALYSTS. | |
| US4426316A (en) | Catalyst prepared from organomagnesium compound, organic hydroxyl-containing compound, reducing halide source and transition metal compound | |
| US4292200A (en) | Catalyst composition for polymerization of olefins | |
| KR950007986B1 (ko) | 에틸렌 및 α-올레핀의 (공)중합을 위한 고체 성분의 촉매 | |
| US4387200A (en) | Process for polymerizing olefins employing a catalyst prepared from organomagnesium compound; oxygen- or nitrogen- containing compound; halide source; transition metal compound and reducing agent | |
| JPH07650B2 (ja) | オレフィン重合用触媒成分の製造方法 | |
| WO1998040421A1 (en) | Cationic group 13 complexes incorporating bidentate ligands as polymerization catalysts | |
| US4203867A (en) | Transition metal composition and production thereof | |
| US4783512A (en) | Process for polymerizing olefins in the presence of a catalyst prepared from organomagnesium compound, organic hydroxyl-containing compound, reducing halide source and transition metal compound | |
| PL74181B1 (show.php) | ||
| US3989879A (en) | Process and catalysts for the polymerization and copolymerization of olefins | |
| US4504637A (en) | Olefin polymerization catalysts and process for producing olefin polymers by using such catalysts | |
| US5322911A (en) | Polymerization process employing metal halide catalyst and polymer produced | |
| US4313850A (en) | Catalyst for the polymerization of alpha-olefins | |
| JPH0623215B2 (ja) | オレフィン重合触媒成分の製造方法 | |
| EP0014338A1 (en) | Catalyst, catalyst component and process for the polymerization of olefins | |
| EP0030438B1 (en) | Olefin polymerization catalyst and olefin polymerization method and products using such catalyst | |
| JPS5835601B2 (ja) | オレフインの重合および共重合法 | |
| US5401816A (en) | Transition metal catalyst, method of preparing catalyst, polymerization process employing catalyst, and polymer produced |