PL50959B1 - - Google Patents
Download PDFInfo
- Publication number
- PL50959B1 PL50959B1 PL103621A PL10362164A PL50959B1 PL 50959 B1 PL50959 B1 PL 50959B1 PL 103621 A PL103621 A PL 103621A PL 10362164 A PL10362164 A PL 10362164A PL 50959 B1 PL50959 B1 PL 50959B1
- Authority
- PL
- Poland
- Prior art keywords
- naphthol
- aminophenol
- dyes
- dye
- black
- Prior art date
Links
- 239000000975 dye Substances 0.000 claims description 15
- JWAZRIHNYRIHIV-UHFFFAOYSA-N 2-naphthol Chemical compound C1=CC=CC2=CC(O)=CC=C21 JWAZRIHNYRIHIV-UHFFFAOYSA-N 0.000 claims description 8
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 claims description 6
- 210000002268 wool Anatomy 0.000 claims description 5
- AVQFHKYAVVQYQO-UHFFFAOYSA-N 3-amino-4-hydroxybenzenesulfonamide Chemical compound NC1=CC(S(N)(=O)=O)=CC=C1O AVQFHKYAVVQYQO-UHFFFAOYSA-N 0.000 claims description 4
- 229950011260 betanaphthol Drugs 0.000 claims description 4
- ALNWQAFPXMGLTJ-UHFFFAOYSA-N n-(7-hydroxynaphthalen-1-yl)acetamide Chemical compound C1=C(O)C=C2C(NC(=O)C)=CC=CC2=C1 ALNWQAFPXMGLTJ-UHFFFAOYSA-N 0.000 claims description 4
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052804 chromium Inorganic materials 0.000 claims description 3
- 150000001875 compounds Chemical class 0.000 claims description 3
- 238000004043 dyeing Methods 0.000 claims description 2
- 238000000034 method Methods 0.000 claims 1
- 238000007747 plating Methods 0.000 claims 1
- 230000008878 coupling Effects 0.000 description 5
- 238000010168 coupling process Methods 0.000 description 5
- 238000005859 coupling reaction Methods 0.000 description 5
- VLZVIIYRNMWPSN-UHFFFAOYSA-N 2-Amino-4-nitrophenol Chemical compound NC1=CC([N+]([O-])=O)=CC=C1O VLZVIIYRNMWPSN-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 239000011651 chromium Substances 0.000 description 2
- 238000001465 metallisation Methods 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- 239000004952 Polyamide Substances 0.000 description 1
- 241000872198 Serjania polyphylla Species 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 238000004532 chromating Methods 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical group [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000434 metal complex dye Substances 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000009938 salting Methods 0.000 description 1
- 235000002639 sodium chloride Nutrition 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL50959B1 true PL50959B1 (cs) | 1966-02-25 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US2610175A (en) | Complex chromium compounds of monoazo-dyestuffs | |
| PL50959B1 (cs) | ||
| GB764051A (en) | Brown tetrakisazo dyestuff and its iron complex compounds | |
| US2784179A (en) | Metalliferous azo-dyestuffs | |
| DE634195C (de) | Verfahren zum Faerben von Leder | |
| US2852502A (en) | Half metal complexes of acylacetonitrile azo dyes containing the sulfonamide group | |
| DE896187C (de) | Verfahren zur Herstellung echter Faerbungen | |
| SU448654A3 (ru) | Способ крашени полиамидных и шерст ных волокон | |
| DE520242C (de) | Verfahren zur Darstellung chromhaltiger o-Oxyazofarbstoffe | |
| AT117029B (de) | Verfahren zur Darstellung von Dis- und Polyazofarbstoffen. | |
| DE515030C (de) | Verfahren zum Faerben von Viscose | |
| GB513233A (en) | Manufacture of metalliferous azo-dyestuffs | |
| AT141859B (de) | Verfahren zum Färben von Leder. | |
| DE459989C (de) | Verfahren zur Darstellung von o-Oxyazofarbstoffen | |
| SU445213A1 (ru) | Способ крашени полиамидных и шерст ных волокон | |
| CH261841A (de) | Verfahren zur Herstellung eines metallisierbaren o-Oxymonoazofarbstoffes. | |
| DE745412C (de) | Verfahren zur Herstellung von chromhaltigen Monoazofarbstoffen | |
| GB879523A (en) | New complex chromium monoazo dyestuffs and their production | |
| PL45016B1 (cs) | ||
| DE889043C (de) | Verfahren zur Herstellung von Azofarbstoffen | |
| AT91280B (de) | Verfahren zur Darstellung von substantiven Azofarbstoffen. | |
| DE863971C (de) | Verfahren zur Herstellung von chromierbaren Monoazofarbstoffen | |
| CH198340A (de) | Verfahren zur Darstellung eines Azofarbstoffes. | |
| JPH02261864A (ja) | 非対称1:2型金属錯塩染料の製造方法 | |
| DE1151078B (de) | Verfahren zur Herstellung chromhaltiger Azofarbstoffkomplex-verbindungen |