PL49449B1 - - Google Patents
Download PDFInfo
- Publication number
- PL49449B1 PL49449B1 PL100685A PL10068563A PL49449B1 PL 49449 B1 PL49449 B1 PL 49449B1 PL 100685 A PL100685 A PL 100685A PL 10068563 A PL10068563 A PL 10068563A PL 49449 B1 PL49449 B1 PL 49449B1
- Authority
- PL
- Poland
- Prior art keywords
- mixture
- water
- dyes
- ethylene glycol
- organic compounds
- Prior art date
Links
- 239000000975 dye Substances 0.000 claims description 14
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 claims description 12
- 238000000034 method Methods 0.000 claims description 9
- 239000000203 mixture Substances 0.000 claims description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 7
- 238000001465 metallisation Methods 0.000 claims description 6
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 4
- 150000002894 organic compounds Chemical class 0.000 claims description 4
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 3
- 239000004202 carbamide Substances 0.000 claims description 3
- 230000015572 biosynthetic process Effects 0.000 claims description 2
- 229910052804 chromium Inorganic materials 0.000 claims description 2
- 239000011651 chromium Substances 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- -1 monoazo compound Chemical class 0.000 claims description 2
- 150000003839 salts Chemical class 0.000 claims description 2
- VKADNWSKNBWCNT-UHFFFAOYSA-M [Cl+].CC([O-])=O Chemical compound [Cl+].CC([O-])=O VKADNWSKNBWCNT-UHFFFAOYSA-M 0.000 claims 1
- 239000007795 chemical reaction product Substances 0.000 claims 1
- 229910017052 cobalt Inorganic materials 0.000 claims 1
- 239000010941 cobalt Substances 0.000 claims 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims 1
- 239000011505 plaster Substances 0.000 claims 1
- 239000012451 post-reaction mixture Substances 0.000 claims 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 description 5
- 238000004043 dyeing Methods 0.000 description 4
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 239000000434 metal complex dye Substances 0.000 description 3
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 3
- KJCVRFUGPWSIIH-UHFFFAOYSA-N 1-naphthol Chemical compound C1=CC=C2C(O)=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- 239000004952 Polyamide Substances 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 229920002647 polyamide Polymers 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 1
- 239000005695 Ammonium acetate Substances 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 235000019257 ammonium acetate Nutrition 0.000 description 1
- 229940043376 ammonium acetate Drugs 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- WYYQVWLEPYFFLP-UHFFFAOYSA-K chromium(3+);triacetate Chemical compound [Cr+3].CC([O-])=O.CC([O-])=O.CC([O-])=O WYYQVWLEPYFFLP-UHFFFAOYSA-K 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 150000001868 cobalt Chemical class 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- IQFVPQOLBLOTPF-HKXUKFGYSA-L congo red Chemical compound [Na+].[Na+].C1=CC=CC2=C(N)C(/N=N/C3=CC=C(C=C3)C3=CC=C(C=C3)/N=N/C3=C(C4=CC=CC=C4C(=C3)S([O-])(=O)=O)N)=CC(S([O-])(=O)=O)=C21 IQFVPQOLBLOTPF-HKXUKFGYSA-L 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 238000007747 plating Methods 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000005185 salting out Methods 0.000 description 1
- ORFSSYGWXNGVFB-UHFFFAOYSA-N sodium 4-amino-6-[[4-[4-[(8-amino-1-hydroxy-5,7-disulfonaphthalen-2-yl)diazenyl]-3-methoxyphenyl]-2-methoxyphenyl]diazenyl]-5-hydroxynaphthalene-1,3-disulfonic acid Chemical compound COC1=C(C=CC(=C1)C2=CC(=C(C=C2)N=NC3=C(C4=C(C=C3)C(=CC(=C4N)S(=O)(=O)O)S(=O)(=O)O)O)OC)N=NC5=C(C6=C(C=C5)C(=CC(=C6N)S(=O)(=O)O)S(=O)(=O)O)O.[Na+] ORFSSYGWXNGVFB-UHFFFAOYSA-N 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL49449B1 true PL49449B1 (en:Method) | 1965-02-15 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2500062C2 (de) | Faserreaktive Tetrazofarbstoffe und ihre Verwendung | |
| DE1544539C3 (de) | Metallkomplex-Disazofarbstoffe und Verfahren zu ihrer Herstellung | |
| PL86475B1 (en:Method) | ||
| PL49449B1 (en:Method) | ||
| US2865908A (en) | Stilbene azo dyes | |
| US3301847A (en) | Reactive disazo dyestuffs | |
| US3169951A (en) | Chromhjm-containing azo dyestuffs | |
| KR950007220B1 (ko) | 구리 착염 디스아조 화합물의 제조방법 | |
| US2280072A (en) | Substituted phthalocyanines | |
| EP0041919B1 (de) | Verfahren zur Herstellung von Amino-fluor-s-triazin-Farbstoffen | |
| US1856796A (en) | Azo-dyestuffs containing chromium and process of making same | |
| US2256096A (en) | Polyazo compounds | |
| DE1444568C (de) | Azometallkomplexfarbstoffe und Verfahren zu deren Herstellung | |
| PL136774B1 (en:Method) | ||
| DE812809C (de) | Verfahren zur Herstellung von sauren Disazofarbstoffen | |
| SU368284A1 (ru) | Способ получения дисазокрасителей | |
| DE1288710B (de) | Verfahren zur Herstellung von faserreaktiven 1:2-Chrom- oder Kobaltkomplexverbindungen von Azofarbstoffen | |
| PL135793B1 (en) | Method of obtaining diazo reactive dyes | |
| PL59829B1 (en:Method) | ||
| PL136766B1 (en:Method) | ||
| NO124983B (en:Method) | ||
| DE1419791A1 (de) | Verfahren zur Herstellung neuer Disazofarbstoffe | |
| DE1130950B (de) | Verfahren zur Herstellung kupferhaltiger Disazofarbstoffe | |
| PL11356B1 (pl) | Sposób otrzymywania dis - i poliazobarwników. | |
| CH303900A (de) | Verfahren zur Herstellung eines kupferhaltigen Trisazofarbstoffes. |