PL47841B1 - - Google Patents
Download PDFInfo
- Publication number
- PL47841B1 PL47841B1 PL47841A PL4784162A PL47841B1 PL 47841 B1 PL47841 B1 PL 47841B1 PL 47841 A PL47841 A PL 47841A PL 4784162 A PL4784162 A PL 4784162A PL 47841 B1 PL47841 B1 PL 47841B1
- Authority
- PL
- Poland
- Prior art keywords
- weight
- sulfonated
- parts
- tannin
- temperature
- Prior art date
Links
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 claims description 27
- 235000018553 tannin Nutrition 0.000 claims description 25
- 229920001864 tannin Polymers 0.000 claims description 25
- 239000001648 tannin Substances 0.000 claims description 25
- 239000007864 aqueous solution Substances 0.000 claims description 11
- JWAZRIHNYRIHIV-UHFFFAOYSA-N 2-naphthol Chemical class C1=CC=CC2=CC(O)=CC=C21 JWAZRIHNYRIHIV-UHFFFAOYSA-N 0.000 claims description 8
- 239000007859 condensation product Substances 0.000 claims description 8
- 239000007800 oxidant agent Substances 0.000 claims description 6
- 238000000034 method Methods 0.000 claims description 5
- 150000002989 phenols Chemical class 0.000 claims description 5
- 239000000243 solution Substances 0.000 claims description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 4
- 239000001301 oxygen Substances 0.000 claims description 4
- 229910052760 oxygen Inorganic materials 0.000 claims description 4
- 229920001568 phenolic resin Polymers 0.000 claims description 4
- SLGWESQGEUXWJQ-UHFFFAOYSA-N formaldehyde;phenol Chemical class O=C.OC1=CC=CC=C1 SLGWESQGEUXWJQ-UHFFFAOYSA-N 0.000 claims description 3
- JOPOVCBBYLSVDA-UHFFFAOYSA-N chromium(6+) Chemical class [Cr+6] JOPOVCBBYLSVDA-UHFFFAOYSA-N 0.000 claims description 2
- 239000000463 material Substances 0.000 claims 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 10
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 8
- 239000000203 mixture Substances 0.000 description 6
- 230000003647 oxidation Effects 0.000 description 6
- 238000007254 oxidation reaction Methods 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- 239000010985 leather Substances 0.000 description 5
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 229960000583 acetic acid Drugs 0.000 description 4
- 229910021529 ammonia Inorganic materials 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- 230000006378 damage Effects 0.000 description 3
- -1 for example Chemical class 0.000 description 3
- 229940093915 gynecological organic acid Drugs 0.000 description 3
- 150000007524 organic acids Chemical class 0.000 description 3
- 235000005985 organic acids Nutrition 0.000 description 3
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 230000020477 pH reduction Effects 0.000 description 2
- KMUONIBRACKNSN-UHFFFAOYSA-N potassium dichromate Chemical compound [K+].[K+].[O-][Cr](=O)(=O)O[Cr]([O-])(=O)=O KMUONIBRACKNSN-UHFFFAOYSA-N 0.000 description 2
- 238000006277 sulfonation reaction Methods 0.000 description 2
- 235000013311 vegetables Nutrition 0.000 description 2
- JHWIEAWILPSRMU-UHFFFAOYSA-N 2-methyl-3-pyrimidin-4-ylpropanoic acid Chemical compound OC(=O)C(C)CC1=CC=NC=N1 JHWIEAWILPSRMU-UHFFFAOYSA-N 0.000 description 1
- LMWMTSCFTPQVCJ-UHFFFAOYSA-N 2-methylphenol;phenol Chemical compound OC1=CC=CC=C1.CC1=CC=CC=C1O LMWMTSCFTPQVCJ-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 229950011260 betanaphthol Drugs 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- ZCDOYSPFYFSLEW-UHFFFAOYSA-N chromate(2-) Chemical class [O-][Cr]([O-])(=O)=O ZCDOYSPFYFSLEW-UHFFFAOYSA-N 0.000 description 1
- 150000001844 chromium Chemical class 0.000 description 1
- 229940117975 chromium trioxide Drugs 0.000 description 1
- WGLPBDUCMAPZCE-UHFFFAOYSA-N chromium trioxide Inorganic materials O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 1
- GAMDZJFZMJECOS-UHFFFAOYSA-N chromium(6+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[Cr+6] GAMDZJFZMJECOS-UHFFFAOYSA-N 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- KZTYYGOKRVBIMI-UHFFFAOYSA-N diphenyl sulfone Chemical compound C=1C=CC=CC=1S(=O)(=O)C1=CC=CC=C1 KZTYYGOKRVBIMI-UHFFFAOYSA-N 0.000 description 1
- HFTNNOZFRQLFQB-UHFFFAOYSA-N ethenoxy(trimethyl)silane Chemical compound C[Si](C)(C)OC=C HFTNNOZFRQLFQB-UHFFFAOYSA-N 0.000 description 1
- 230000009931 harmful effect Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 229920003986 novolac Polymers 0.000 description 1
- 239000005416 organic matter Substances 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 239000005011 phenolic resin Substances 0.000 description 1
- 235000020238 sunflower seed Nutrition 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL47841B1 true PL47841B1 (Direct) | 1963-12-15 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0139309B1 (de) | Mehrkomponenten-Bindemittel mit verlängerter Verarbeitbarkeitszeit | |
| EP0717114A2 (de) | Wässrige Zusammensetzung zum Vorgerben von Hautblössen oder Nachgerben von Leder | |
| PL47841B1 (Direct) | ||
| EP1693393B1 (de) | Säuregruppenhaltige Kondensationsprodukte | |
| DE2834121C2 (de) | Kondensationsprodukte aus Terphenylsulfonsäuren, Naphthalinsulfonsäuren, Bis-(4-hydroxyphenyl)-sulfon und Formaldehyd | |
| DE1142173B (de) | Verfahren zur Herstellung lichtechter Kondensationsprodukte aus Phenolsulfonsaeuren, Phenolen, Harnstoff und Formaldehyd | |
| DE10140551A1 (de) | Verfahren zur Herstellung sulfonhaltiger Gerbstoffe | |
| DE1494841C3 (de) | Verfahren zum Schnellgerben von Häuten | |
| DE818050C (de) | Verfahren zur Herstellung wasserloeslicher Kondensationsprodukte | |
| US2045049A (en) | Process for the manufacture of new tanning materials | |
| US1945461A (en) | Method of retanning of chrome leather | |
| DE1669341B1 (de) | Pulverfoermige Gerbstoffe | |
| AT138005B (de) | Verfahren zum Gerben tierischer Häute. | |
| AT222792B (de) | Verfahren zur Herstellung von Gerbharzen | |
| DE291457C (Direct) | ||
| US1695655A (en) | Material for tanning and process of making the same | |
| DE860551C (de) | Verfahren zur Herstellung von haertbaren wasserloeslichen Kunstharzen | |
| DE731192C (de) | Verfahren zur Herstellung von Gerbstoffen | |
| AT226873B (de) | Verfahren zur Herstellung lichtechter Kondensationsprodukte | |
| AT220280B (de) | Verfahren zur Herstellung lichtechter Kondensationsprodukte | |
| DE1720270C (de) | Verfahren zur Herstellung von hoher molekularen Kondensationsprodukten für Gerb zwecke | |
| DE1670178A1 (de) | Verfahren zur Herstellung lichtechter anionischer Harzgerbstoffe auf Melaminbasis | |
| DE1183510B (de) | Verfahren zur Herstellung von Kondensationsprodukten durch Nachbehandlung von Sulfonsaeuregruppen enthaltenden Naphthol-Formaldehyd-Kondensaten mit Phenolen und Formaldehyd | |
| CH243515A (de) | Verfahren zur Herstellung eines Kondensationsproduktes. | |
| CH215949A (de) | Verfahren zur Herstellung synthetischer Gerbstoffe. |