PL40842B1 - - Google Patents
Download PDFInfo
- Publication number
- PL40842B1 PL40842B1 PL40842A PL4084256A PL40842B1 PL 40842 B1 PL40842 B1 PL 40842B1 PL 40842 A PL40842 A PL 40842A PL 4084256 A PL4084256 A PL 4084256A PL 40842 B1 PL40842 B1 PL 40842B1
- Authority
- PL
- Poland
- Prior art keywords
- clupeine
- clupein
- solution
- methyl ester
- metaphosphate
- Prior art date
Links
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 18
- 238000000034 method Methods 0.000 claims description 12
- 125000005341 metaphosphate group Chemical group 0.000 claims description 11
- 238000002360 preparation method Methods 0.000 claims description 11
- 239000000243 solution Substances 0.000 claims description 11
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 7
- 238000010253 intravenous injection Methods 0.000 claims description 7
- 108010007568 Protamines Proteins 0.000 claims description 6
- 102000007327 Protamines Human genes 0.000 claims description 6
- 150000004702 methyl esters Chemical class 0.000 claims description 6
- 229940048914 protamine Drugs 0.000 claims description 5
- 238000001816 cooling Methods 0.000 claims description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 3
- 150000003839 salts Chemical class 0.000 claims 1
- 108010040512 Clupeine Proteins 0.000 description 20
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 9
- OXNIZHLAWKMVMX-UHFFFAOYSA-N picric acid Chemical compound OC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O OXNIZHLAWKMVMX-UHFFFAOYSA-N 0.000 description 5
- 229910021653 sulphate ion Inorganic materials 0.000 description 5
- -1 methyl ester hydrochloride Chemical class 0.000 description 4
- 238000000746 purification Methods 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Natural products CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 229940075930 picrate Drugs 0.000 description 3
- OXNIZHLAWKMVMX-UHFFFAOYSA-M picrate anion Chemical compound [O-]C1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O OXNIZHLAWKMVMX-UHFFFAOYSA-M 0.000 description 3
- 241000252203 Clupea harengus Species 0.000 description 2
- HTTJABKRGRZYRN-UHFFFAOYSA-N Heparin Chemical compound OC1C(NC(=O)C)C(O)OC(COS(O)(=O)=O)C1OC1C(OS(O)(=O)=O)C(O)C(OC2C(C(OS(O)(=O)=O)C(OC3C(C(O)C(O)C(O3)C(O)=O)OS(O)(=O)=O)C(CO)O2)NS(O)(=O)=O)C(C(O)=O)O1 HTTJABKRGRZYRN-UHFFFAOYSA-N 0.000 description 2
- 206010037660 Pyrexia Diseases 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 239000003929 acidic solution Substances 0.000 description 2
- 230000002429 anti-coagulating effect Effects 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 229960002897 heparin Drugs 0.000 description 2
- 229920000669 heparin Polymers 0.000 description 2
- 235000019514 herring Nutrition 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 235000013336 milk Nutrition 0.000 description 2
- 210000004080 milk Anatomy 0.000 description 2
- 231100000614 poison Toxicity 0.000 description 2
- 230000007096 poisonous effect Effects 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- 102000005237 Isophane Insulin Human genes 0.000 description 1
- 108010081368 Isophane Insulin Proteins 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000003146 anticoagulant agent Substances 0.000 description 1
- 229940127219 anticoagulant drug Drugs 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 108010016290 deoxyribonucleoprotamine Proteins 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 208000035475 disorder Diseases 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 239000008267 milk Substances 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 230000035479 physiological effects, processes and functions Effects 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 229940070353 protamines Drugs 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000007790 solid phase Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL40842B1 true PL40842B1 (OSRAM) | 1958-02-15 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP2619951B2 (ja) | ガバペンチン1水化物およびその製法 | |
| US3451996A (en) | Method for the preparation of heparin | |
| US4617296A (en) | 3-O-acylated derivatives of (+)-cyanidan-3-ol | |
| US1995709A (en) | Hydroxyphenylpropanolamine hydrochloride | |
| US2989438A (en) | Process of purifying heparin, and product produced therefrom | |
| PL40842B1 (OSRAM) | ||
| US2723977A (en) | 5, 6-disubstituted 2-amino-4-pyrimidols | |
| US2463943A (en) | Production of penicillin salts | |
| US2558923A (en) | Process of purifying ethylene diamine di-acetic acid | |
| GB280969A (en) | Improved process for the purification of lactic acid | |
| US3557212A (en) | Ethyl auramine process | |
| US2580195A (en) | Method of purifying 4-aminosalicylic acid | |
| JPH05500205A (ja) | ヘミンの精製法、新規なヘミン誘導体及びその製造方法 | |
| US2767196A (en) | Water-soluble derivatives of phenolphthalein | |
| US1971393A (en) | Bromine substituted allylester of 2-phenylquinoline-4-carboxylic acid | |
| SU634747A1 (ru) | Способ получени тропановых алкалоидов | |
| SU1535829A1 (ru) | Способ получени сульфида одновалентной меди | |
| US5011974A (en) | Process for the preparation of derivative of 2-diethylamino-1-methylethyl-1-hydroxy-(bicyclohexyl)-2-carboxylate | |
| US1336952A (en) | Chmical | |
| US2983753A (en) | Process of preparing 5beta-hydroxy-8-oxo-1, 4, 4aalpha, 5, 8, 8aalpha-hexahydronaphthalene-1beta-carboxylic acid | |
| US2331711A (en) | Method of preparing alphanaphthylacetamide | |
| SU585242A1 (ru) | Способ регенерации осадительной ванны вискозного производства | |
| US1062203A (en) | Manufacture and production of alkyl derivatives and substituted alkyl derivatives of hydrocupreine. | |
| Levi et al. | LXX.—Derivatives of 1: 2-dihydroxythioxanthone | |
| Wilson et al. | XCVIII.—The action of amines on semicarbazones. Part I. Preparation of an optically active semicarbazide |