PL31574B1 - - Google Patents
Download PDFInfo
- Publication number
- PL31574B1 PL31574B1 PL31574A PL3157439A PL31574B1 PL 31574 B1 PL31574 B1 PL 31574B1 PL 31574 A PL31574 A PL 31574A PL 3157439 A PL3157439 A PL 3157439A PL 31574 B1 PL31574 B1 PL 31574B1
- Authority
- PL
- Poland
- Prior art keywords
- ethers
- amino
- esters
- cellulose esters
- naphthol
- Prior art date
Links
- 229920002678 cellulose Polymers 0.000 claims description 10
- 150000002170 ethers Chemical class 0.000 claims description 10
- 229920003086 cellulose ether Polymers 0.000 claims description 7
- QPKNFEVLZVJGBM-UHFFFAOYSA-N 2-aminonaphthalen-1-ol Chemical class C1=CC=CC2=C(O)C(N)=CC=C21 QPKNFEVLZVJGBM-UHFFFAOYSA-N 0.000 claims description 4
- 239000003795 chemical substances by application Substances 0.000 claims description 3
- 150000002148 esters Chemical class 0.000 claims description 3
- 238000000034 method Methods 0.000 claims description 3
- 238000006467 substitution reaction Methods 0.000 claims description 3
- 239000002253 acid Substances 0.000 claims description 2
- 239000003086 colorant Substances 0.000 claims description 2
- 125000001624 naphthyl group Chemical group 0.000 claims description 2
- 210000002268 wool Anatomy 0.000 description 6
- 239000000835 fiber Substances 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 4
- 239000001913 cellulose Substances 0.000 description 3
- 239000000975 dye Substances 0.000 description 3
- 238000004043 dyeing Methods 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 239000004744 fabric Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- SMEGJBVQLJJKKX-HOTMZDKISA-N [(2R,3S,4S,5R,6R)-5-acetyloxy-3,4,6-trihydroxyoxan-2-yl]methyl acetate Chemical compound CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)O)OC(=O)C)O)O SMEGJBVQLJJKKX-HOTMZDKISA-N 0.000 description 2
- 229940081735 acetylcellulose Drugs 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 239000000987 azo dye Substances 0.000 description 2
- 229920002301 cellulose acetate Polymers 0.000 description 2
- 230000008878 coupling Effects 0.000 description 2
- 238000010168 coupling process Methods 0.000 description 2
- 238000005859 coupling reaction Methods 0.000 description 2
- 238000006193 diazotization reaction Methods 0.000 description 2
- 150000007530 organic bases Chemical class 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 235000010288 sodium nitrite Nutrition 0.000 description 2
- KJCVRFUGPWSIIH-UHFFFAOYSA-N 1-naphthol Chemical compound C1=CC=C2C(O)=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-N 0.000 description 1
- GXJQMKFJQFGQKV-KHPPLWFESA-N 2-[methyl-[(z)-octadec-9-enoyl]amino]ethanesulfonic acid Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)N(C)CCS(O)(=O)=O GXJQMKFJQFGQKV-KHPPLWFESA-N 0.000 description 1
- FSBRKZMSECKELY-UHFFFAOYSA-N 5-aminonaphthalen-2-ol Chemical compound OC1=CC=C2C(N)=CC=CC2=C1 FSBRKZMSECKELY-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 229920000297 Rayon Polymers 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- 239000000159 acid neutralizing agent Substances 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 1
- 239000001166 ammonium sulphate Substances 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- 229940069428 antacid Drugs 0.000 description 1
- 239000003159 antacid agent Substances 0.000 description 1
- 239000003637 basic solution Substances 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 159000000011 group IA salts Chemical class 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000010446 mirabilite Substances 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 239000004627 regenerated cellulose Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- RSIJVJUOQBWMIM-UHFFFAOYSA-L sodium sulfate decahydrate Chemical compound O.O.O.O.O.O.O.O.O.O.[Na+].[Na+].[O-]S([O-])(=O)=O RSIJVJUOQBWMIM-UHFFFAOYSA-L 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 125000001174 sulfone group Chemical group 0.000 description 1
- 235000021419 vinegar Nutrition 0.000 description 1
- 239000000052 vinegar Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL31574B1 true PL31574B1 (cs) | 1943-03-31 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US2339739A (en) | Dyeing cellulosic fiber with phthalocyanines | |
| BRPI0914939B1 (pt) | Tintas ácidas, seus usos e processo para preparação das mesmas | |
| PL31574B1 (cs) | ||
| CN109370255B (zh) | 一种深色活性染料组合物及染料制品 | |
| KR880000499B1 (ko) | 1:1형 금속 착염 염료로 천연 또는 합성 폴리아미드 섬유물질의 염색방법 | |
| DE886293C (de) | Verfahren zum Faerben von Gebilden aus Superpolyamiden oder -urethanen | |
| US2368690A (en) | Process for the improvement of the properties of artificial masses and fibers manufactured from proteinlike substances | |
| KR960003085B1 (ko) | 천연 폴리아미드 섬유재료의 염색방법 및 이러한 방법에 사용하기 위한 조성물 | |
| BRPI0613688B1 (pt) | corantes de complexo de cromo | |
| US3971625A (en) | Basic dyeing | |
| DE624374C (de) | Verfahren zum Faerben und Drucken von Pflanzenfasern oder kuenstlichen Faserstoffen aus regenerierter Cellulose mit Schwefelsaeureestern von Leukokuepenfarbstoffen oder deren Salzen | |
| DE617644C (de) | Verfahren zur Verminderung der Aufnahmefaehigkeit der Fasern tierischen Ursprungs fuer Farbstoffe | |
| DE722729C (de) | Verfahren zur Verbesserung der Nassechtheiten von Eisfarben | |
| DE973954C (de) | Verfahren zum Verbessern der Echtheitseigenschaften von gefaerbtem Textilmaterial | |
| DE645735C (de) | Verfahren zum Faerben von cellulosehaltigen Textilstoffen | |
| DE735769C (de) | Verfahren zur Herstellung von Faerbungen auf Mischungen aus tierischen Fasern und Cellulosefasern | |
| DE697184C (de) | Verfahren zum Faerben von Mischgespinsten oder Mischgeweben aus natuerlichen Cellulosefasern und Fasasern und tierischen Fasern | |
| SU92292A1 (ru) | Способ крашени шерсти, шелка и искусственного волокна, например, капрона | |
| DE591223C (de) | Verfahren zur Herstellung von Azofarbstoffen | |
| DE1136034B (de) | Verfahren zur Herstellung von metallhaltigen, wasserunloeslichen Azofarbstoffen | |
| AT202103B (de) | Verfahren zum Färben und Drucken von aus Cellulose bestehenden Textilmaterialien | |
| DE711328C (de) | Verfahren zur Herstellung von Azofarbstoffen auf Celluloseestern und -aethern oder diese enthaltenden Faserstoffen | |
| PL28121B1 (pl) | Sposób zwiekszania zdolnosci zabarwiania sie produktów wytworzonych z celulozy, pochodnych celulozy albo innych organofilowych wysokich polimerów. | |
| DE739750C (de) | Verfahren zum Faerben von Gebilden aus polymeren Kohlenwasserstoffen oder deren chlorhaltigen Abkoemmlingen | |
| AT205451B (de) | Verfahren und Zubereitungen zum Färben bzw. Bedrucken Hydroxylgruppen-enthaltender Materialien |