PL185834B1 - Sposób elektrolizy wodnego roztworu kwasu chlorowoSposób elektrolizy wodnego roztworu kwasu chlorowodorowego oraz elektrolizer do elektrolizy wodnegodorowego oraz elektrolizer do elektrolizy wodnegoroztworu kwasu chlorowodorowegoroztworu kwasu chlorowodorowego - Google Patents
Sposób elektrolizy wodnego roztworu kwasu chlorowoSposób elektrolizy wodnego roztworu kwasu chlorowodorowego oraz elektrolizer do elektrolizy wodnegodorowego oraz elektrolizer do elektrolizy wodnegoroztworu kwasu chlorowodorowegoroztworu kwasu chlorowodorowegoInfo
- Publication number
- PL185834B1 PL185834B1 PL97317988A PL31798897A PL185834B1 PL 185834 B1 PL185834 B1 PL 185834B1 PL 97317988 A PL97317988 A PL 97317988A PL 31798897 A PL31798897 A PL 31798897A PL 185834 B1 PL185834 B1 PL 185834B1
- Authority
- PL
- Poland
- Prior art keywords
- cathode
- anode
- hydrochloric acid
- compartment
- titanium
- Prior art date
Links
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 title claims abstract description 156
- 238000000034 method Methods 0.000 title claims abstract description 57
- 238000005868 electrolysis reaction Methods 0.000 title claims abstract description 22
- 239000007789 gas Substances 0.000 claims abstract description 44
- 239000000460 chlorine Substances 0.000 claims abstract description 39
- 238000009792 diffusion process Methods 0.000 claims abstract description 39
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims abstract description 37
- 239000000243 solution Substances 0.000 claims abstract description 37
- 239000010936 titanium Substances 0.000 claims abstract description 37
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims abstract description 35
- 229910052801 chlorine Inorganic materials 0.000 claims abstract description 34
- 229910052719 titanium Inorganic materials 0.000 claims abstract description 33
- 239000012528 membrane Substances 0.000 claims abstract description 32
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims abstract description 28
- 150000001875 compounds Chemical class 0.000 claims abstract description 28
- 239000001301 oxygen Substances 0.000 claims abstract description 28
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 28
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims abstract description 24
- 230000001590 oxidative effect Effects 0.000 claims abstract description 22
- 239000003014 ion exchange membrane Substances 0.000 claims abstract description 19
- 239000007864 aqueous solution Substances 0.000 claims abstract description 13
- 229910001069 Ti alloy Inorganic materials 0.000 claims abstract description 10
- 229910045601 alloy Inorganic materials 0.000 claims abstract description 10
- 239000000956 alloy Substances 0.000 claims abstract description 10
- 239000011248 coating agent Substances 0.000 claims abstract description 10
- 238000000576 coating method Methods 0.000 claims abstract description 10
- 239000000758 substrate Substances 0.000 claims abstract description 10
- 239000004035 construction material Substances 0.000 claims abstract description 9
- 230000008569 process Effects 0.000 claims description 28
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 26
- 229910052751 metal Inorganic materials 0.000 claims description 18
- 239000002184 metal Substances 0.000 claims description 18
- 229910052742 iron Inorganic materials 0.000 claims description 13
- 239000000463 material Substances 0.000 claims description 13
- -1 alkali metal salt Chemical class 0.000 claims description 12
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical group [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 claims description 10
- 238000005260 corrosion Methods 0.000 claims description 10
- 230000007797 corrosion Effects 0.000 claims description 10
- 229910052783 alkali metal Inorganic materials 0.000 claims description 8
- 229910001252 Pd alloy Inorganic materials 0.000 claims description 7
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical group [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 claims description 6
- 239000011253 protective coating Substances 0.000 claims description 6
- 239000011780 sodium chloride Substances 0.000 claims description 5
- 239000010955 niobium Substances 0.000 claims description 4
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 claims description 4
- BPUBBGLMJRNUCC-UHFFFAOYSA-N oxygen(2-);tantalum(5+) Chemical class [O-2].[O-2].[O-2].[O-2].[O-2].[Ta+5].[Ta+5] BPUBBGLMJRNUCC-UHFFFAOYSA-N 0.000 claims description 4
- 230000000087 stabilizing effect Effects 0.000 claims description 4
- 229910001936 tantalum oxide Inorganic materials 0.000 claims description 4
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 claims description 4
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 claims description 3
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 claims description 3
- 238000009434 installation Methods 0.000 claims description 3
- 229910000484 niobium oxide Inorganic materials 0.000 claims description 3
- 229910052707 ruthenium Inorganic materials 0.000 claims description 3
- 239000000523 sample Substances 0.000 claims description 3
- 229910001928 zirconium oxide Inorganic materials 0.000 claims description 3
- 239000012799 electrically-conductive coating Substances 0.000 claims description 2
- 150000002506 iron compounds Chemical class 0.000 claims description 2
- 238000005259 measurement Methods 0.000 claims description 2
- 150000002739 metals Chemical class 0.000 claims description 2
- 230000001105 regulatory effect Effects 0.000 claims 1
- 239000000126 substance Substances 0.000 abstract description 3
- 238000006243 chemical reaction Methods 0.000 description 27
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 15
- 238000004519 manufacturing process Methods 0.000 description 13
- 229910002804 graphite Inorganic materials 0.000 description 10
- 239000010439 graphite Substances 0.000 description 10
- 239000001257 hydrogen Substances 0.000 description 9
- 229910052739 hydrogen Inorganic materials 0.000 description 9
- 239000003054 catalyst Substances 0.000 description 8
- 238000007792 addition Methods 0.000 description 7
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 6
- 230000002378 acidificating effect Effects 0.000 description 6
- 239000011148 porous material Substances 0.000 description 6
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 5
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 5
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 5
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 5
- 239000002253 acid Substances 0.000 description 5
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical class ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 5
- 239000012948 isocyanate Substances 0.000 description 5
- 150000002513 isocyanates Chemical class 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- 230000020477 pH reduction Effects 0.000 description 5
- 229920000557 Nafion® Polymers 0.000 description 4
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 239000007791 liquid phase Substances 0.000 description 4
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 3
- 230000008901 benefit Effects 0.000 description 3
- 239000006227 byproduct Substances 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 3
- 239000002131 composite material Substances 0.000 description 3
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 3
- 150000002431 hydrogen Chemical class 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 3
- 238000012986 modification Methods 0.000 description 3
- 230000004048 modification Effects 0.000 description 3
- 230000002093 peripheral effect Effects 0.000 description 3
- 230000001681 protective effect Effects 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- QPLDLSVMHZLSFG-UHFFFAOYSA-N Copper oxide Chemical compound [Cu]=O QPLDLSVMHZLSFG-UHFFFAOYSA-N 0.000 description 2
- 239000005751 Copper oxide Substances 0.000 description 2
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 238000010276 construction Methods 0.000 description 2
- 229910000431 copper oxide Inorganic materials 0.000 description 2
- 230000005611 electricity Effects 0.000 description 2
- 238000005265 energy consumption Methods 0.000 description 2
- 238000005516 engineering process Methods 0.000 description 2
- RFHAOTPXVQNOHP-UHFFFAOYSA-N fluconazole Chemical compound C1=NC=NN1CC(C=1C(=CC(F)=CC=1)F)(O)CN1C=NC=N1 RFHAOTPXVQNOHP-UHFFFAOYSA-N 0.000 description 2
- 229910052741 iridium Inorganic materials 0.000 description 2
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 description 2
- 238000013508 migration Methods 0.000 description 2
- 230000005012 migration Effects 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 229910052697 platinum Inorganic materials 0.000 description 2
- 229920000915 polyvinyl chloride Polymers 0.000 description 2
- 239000004800 polyvinyl chloride Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 229910001925 ruthenium oxide Inorganic materials 0.000 description 2
- WOCIAKWEIIZHES-UHFFFAOYSA-N ruthenium(iv) oxide Chemical compound O=[Ru]=O WOCIAKWEIIZHES-UHFFFAOYSA-N 0.000 description 2
- 239000004408 titanium dioxide Substances 0.000 description 2
- 238000012546 transfer Methods 0.000 description 2
- OCJBOOLMMGQPQU-UHFFFAOYSA-N 1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C=C1 OCJBOOLMMGQPQU-UHFFFAOYSA-N 0.000 description 1
- 229920000049 Carbon (fiber) Polymers 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 238000007138 Deacon process reaction Methods 0.000 description 1
- 229920002943 EPDM rubber Polymers 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- 229910000566 Platinum-iridium alloy Inorganic materials 0.000 description 1
- WGLPBDUCMAPZCE-UHFFFAOYSA-N Trioxochromium Chemical compound O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 1
- 230000002159 abnormal effect Effects 0.000 description 1
- 238000005299 abrasion Methods 0.000 description 1
- 229910001514 alkali metal chloride Inorganic materials 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000010405 anode material Substances 0.000 description 1
- 230000002547 anomalous effect Effects 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 239000010406 cathode material Substances 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 238000003889 chemical engineering Methods 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- MAYPHUUCLRDEAZ-UHFFFAOYSA-N chlorine peroxide Inorganic materials ClOOCl MAYPHUUCLRDEAZ-UHFFFAOYSA-N 0.000 description 1
- 229910000423 chromium oxide Inorganic materials 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 238000013461 design Methods 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 229940117389 dichlorobenzene Drugs 0.000 description 1
- 229910001882 dioxygen Inorganic materials 0.000 description 1
- 230000005684 electric field Effects 0.000 description 1
- 238000003487 electrochemical reaction Methods 0.000 description 1
- 230000002708 enhancing effect Effects 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 229920002313 fluoropolymer Polymers 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 229910001385 heavy metal Inorganic materials 0.000 description 1
- 239000001307 helium Substances 0.000 description 1
- 229910052734 helium Inorganic materials 0.000 description 1
- SWQJXJOGLNCZEY-UHFFFAOYSA-N helium atom Chemical compound [He] SWQJXJOGLNCZEY-UHFFFAOYSA-N 0.000 description 1
- 238000007731 hot pressing Methods 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 230000002209 hydrophobic effect Effects 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 238000003780 insertion Methods 0.000 description 1
- 230000037431 insertion Effects 0.000 description 1
- 230000010354 integration Effects 0.000 description 1
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 1
- 238000002386 leaching Methods 0.000 description 1
- 230000001404 mediated effect Effects 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 229940050176 methyl chloride Drugs 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 229910052758 niobium Inorganic materials 0.000 description 1
- 238000005457 optimization Methods 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- KDLHZDBZIXYQEI-UHFFFAOYSA-N palladium Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- HWLDNSXPUQTBOD-UHFFFAOYSA-N platinum-iridium alloy Chemical class [Ir].[Pt] HWLDNSXPUQTBOD-UHFFFAOYSA-N 0.000 description 1
- 239000002574 poison Substances 0.000 description 1
- 231100000614 poison Toxicity 0.000 description 1
- 239000004417 polycarbonate Substances 0.000 description 1
- 229920000515 polycarbonate Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000010970 precious metal Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 238000004064 recycling Methods 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 230000035939 shock Effects 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000011949 solid catalyst Substances 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 230000003068 static effect Effects 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 229910052715 tantalum Inorganic materials 0.000 description 1
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- 238000004227 thermal cracking Methods 0.000 description 1
- 229920001169 thermoplastic Polymers 0.000 description 1
- 239000004416 thermosoftening plastic Substances 0.000 description 1
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C25—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES; APPARATUS THEREFOR
- C25B—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES FOR THE PRODUCTION OF COMPOUNDS OR NON-METALS; APPARATUS THEREFOR
- C25B1/00—Electrolytic production of inorganic compounds or non-metals
- C25B1/01—Products
- C25B1/24—Halogens or compounds thereof
- C25B1/26—Chlorine; Compounds thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Inorganic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Electrochemistry (AREA)
- Materials Engineering (AREA)
- Metallurgy (AREA)
- Organic Chemistry (AREA)
- Electrolytic Production Of Non-Metals, Compounds, Apparatuses Therefor (AREA)
- Electrodes For Compound Or Non-Metal Manufacture (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT96MI000086A IT1282367B1 (it) | 1996-01-19 | 1996-01-19 | Migliorato metodo per l'elettrolisi di soluzioni acquose di acido cloridrico |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| PL317988A1 PL317988A1 (en) | 1997-07-21 |
| PL185834B1 true PL185834B1 (pl) | 2003-08-29 |
Family
ID=11372956
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL97317988A PL185834B1 (pl) | 1996-01-19 | 1997-01-16 | Sposób elektrolizy wodnego roztworu kwasu chlorowoSposób elektrolizy wodnego roztworu kwasu chlorowodorowego oraz elektrolizer do elektrolizy wodnegodorowego oraz elektrolizer do elektrolizy wodnegoroztworu kwasu chlorowodorowegoroztworu kwasu chlorowodorowego |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US5770035A (OSRAM) |
| EP (1) | EP0785294B1 (OSRAM) |
| JP (1) | JP3851397B2 (OSRAM) |
| CN (1) | CN1084395C (OSRAM) |
| AT (1) | ATE207136T1 (OSRAM) |
| BR (1) | BR9700712A (OSRAM) |
| CA (1) | CA2194115C (OSRAM) |
| DE (1) | DE69707320T2 (OSRAM) |
| ES (1) | ES2166016T3 (OSRAM) |
| HU (1) | HUP9700038A3 (OSRAM) |
| IT (1) | IT1282367B1 (OSRAM) |
| PL (1) | PL185834B1 (OSRAM) |
| RU (1) | RU2169795C2 (OSRAM) |
| TW (1) | TW351731B (OSRAM) |
Families Citing this family (41)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE19755636A1 (de) * | 1997-12-15 | 1999-06-17 | Bayer Ag | Verfahren zur elektrochemischen Aufarbeitung von HCl-Gas zu hochreinem Chlor |
| US6402930B1 (en) * | 1999-05-27 | 2002-06-11 | De Nora Elettrodi S.P.A. | Process for the electrolysis of technical-grade hydrochloric acid contaminated with organic substances using oxygen-consuming cathodes |
| US6149782A (en) * | 1999-05-27 | 2000-11-21 | De Nora S.P.A | Rhodium electrocatalyst and method of preparation |
| ITMI20010401A1 (it) * | 2001-02-28 | 2002-08-28 | Nora Tecnologie Elettrochimich | Nuovo assieme bipolare per elettrolizzatore a filtro-pressa |
| ITMI20010402A1 (it) * | 2001-02-28 | 2002-08-28 | De Nora Elettrodi Spa | Nuova composizione elettrocatalitica per catodo depolarizzato ad ossigeno |
| DE10138214A1 (de) * | 2001-08-03 | 2003-02-20 | Bayer Ag | Elektrolysezelle und Verfahren zur elektrochemischen Herstellung von Chlor |
| DE10138215A1 (de) * | 2001-08-03 | 2003-02-20 | Bayer Ag | Verfahren zur elektrochemischen Herstellung von Chlor aus wässrigen Lösungen von Chlorwasserstoff |
| DE10148600A1 (de) * | 2001-10-02 | 2003-04-10 | Bayer Ag | Einbau einer Gasdiffusionselektrode in einen Elektrolyseur |
| DE10149779A1 (de) | 2001-10-09 | 2003-04-10 | Bayer Ag | Verfahren zur Rückführung von Prozessgas in elektrochemischen Prozessen |
| DE10152275A1 (de) * | 2001-10-23 | 2003-04-30 | Bayer Ag | Verfahren zur Elektrolyse von wässrigen Lösungen aus Chlorwasserstoff |
| DE10200072A1 (de) * | 2002-01-03 | 2003-07-31 | Bayer Ag | Elektroden für die Elektrolyse in sauren Medien |
| DE10201291A1 (de) * | 2002-01-15 | 2003-07-31 | Krauss Maffei Kunststofftech | Verfahren zum Herstellen von schlagzähmodifizierten Thermoplast-Kunststoffteilen |
| DE10203689A1 (de) * | 2002-01-31 | 2003-08-07 | Bayer Ag | Kathodischer Stromverteiler für Elektrolysezellen |
| DE10234806A1 (de) * | 2002-07-31 | 2004-02-19 | Bayer Ag | Elektrochemische Zelle |
| US20040035696A1 (en) * | 2002-08-21 | 2004-02-26 | Reinhard Fred P. | Apparatus and method for membrane electrolysis for process chemical recycling |
| CA2408951C (en) * | 2002-10-18 | 2008-12-16 | Kvaerner Canada Inc. | Mediated hydrohalic acid electrolysis |
| DE10335184A1 (de) * | 2003-07-30 | 2005-03-03 | Bayer Materialscience Ag | Elektrochemische Zelle |
| DE10342148A1 (de) * | 2003-09-12 | 2005-04-07 | Bayer Materialscience Ag | Verfahren zur Elektrolyse einer wässrigen Lösung von Chlorwasserstoff oder Alkalichlorid |
| DE10347703A1 (de) * | 2003-10-14 | 2005-05-12 | Bayer Materialscience Ag | Konstruktionseinheit für bipolare Elektrolyseure |
| DE102007044171A1 (de) * | 2007-09-15 | 2009-03-19 | Bayer Materialscience Ag | Verfahren zur Herstellung von Graphitelektroden für elektrolytische Prozesse |
| DE102008011473A1 (de) * | 2008-02-27 | 2009-09-03 | Bayer Materialscience Ag | Verfahren zur Herstellung von Polycarbonat |
| DE102008015901A1 (de) * | 2008-03-27 | 2009-10-01 | Bayer Technology Services Gmbh | Elektrolysezelle zur Chlorwasserstoffelektrolyse |
| JP5437651B2 (ja) * | 2009-01-30 | 2014-03-12 | 東ソー株式会社 | イオン交換膜法電解槽及びその製造方法 |
| DE102009023539B4 (de) | 2009-05-30 | 2012-07-19 | Bayer Materialscience Aktiengesellschaft | Verfahren und Vorrichtung zur Elektrolyse einer wässerigen Lösung von Chlorwasserstoff oder Alkalichlorid in einer Elektrolysezelle |
| US9551076B2 (en) * | 2011-05-31 | 2017-01-24 | Clean Chemistry, Inc. | Electrochemical reactor and process |
| US8562810B2 (en) | 2011-07-26 | 2013-10-22 | Ecolab Usa Inc. | On site generation of alkalinity boost for ware washing applications |
| US20170107128A1 (en) | 2012-09-07 | 2017-04-20 | Clean Chemistry, Inc. | System and method for generation of reactive oxygen species and applications thereof |
| ITMI20130563A1 (it) * | 2013-04-10 | 2014-10-11 | Uhdenora Spa | Metodo di adeguamento di celle elettrolitiche aventi distanze interelettrodiche finite |
| DE102013009230A1 (de) | 2013-05-31 | 2014-12-04 | Otto-von-Guericke-Universität | Verfahren und Membranreaktor zur Herstellung von Chlor aus Chlorwasserstoffgas |
| CA2960104C (en) | 2014-09-04 | 2023-05-02 | Clean Chemistry, Inc. | Method of water treatment utilizing a peracetate oxidant solution |
| CA2981034C (en) | 2015-03-26 | 2024-06-25 | Clean Chemistry, Inc. | Systems and methods of reducing a bacteria population in high hydrogen sulfide water |
| EP3386948B1 (en) | 2015-12-07 | 2025-03-05 | Clean Chemistry, Inc. | Methods of pulp fiber treatment |
| US10883224B2 (en) | 2015-12-07 | 2021-01-05 | Clean Chemistry, Inc. | Methods of pulp fiber treatment |
| US11136714B2 (en) | 2016-07-25 | 2021-10-05 | Clean Chemistry, Inc. | Methods of optical brightening agent removal |
| CN106216360A (zh) * | 2016-08-16 | 2016-12-14 | 南京格洛特环境工程股份有限公司 | 一种副产品盐的精制及资源化利用方法 |
| EP3351513A1 (de) * | 2017-01-20 | 2018-07-25 | Covestro Deutschland AG | Verfahren und vorrichtung zur kontinuierlichen salzsäureneutralisation |
| EP3351505A1 (de) * | 2017-01-20 | 2018-07-25 | Covestro Deutschland AG | Verfahren zur flexiblen steuerung der verwendung von salzsäure aus chemischer produktion |
| US11311012B1 (en) | 2017-09-07 | 2022-04-26 | Clean Chemistry, Inc. | Bacterial control in fermentation systems |
| US11001864B1 (en) | 2017-09-07 | 2021-05-11 | Clean Chemistry, Inc. | Bacterial control in fermentation systems |
| TWI883100B (zh) | 2020-01-24 | 2025-05-11 | 英商億諾斯技術有限公司 | 電極總成、電解器、用於電解之製程、在電極上之電催化層的用途、及產生氫之方法 |
| CN113388849B (zh) * | 2021-06-18 | 2024-02-13 | 蓝星(北京)化工机械有限公司 | 离子膜法盐酸电解方法 |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2468766A (en) * | 1944-04-07 | 1949-05-03 | Fmc Corp | Recovery of chlorine from hydrogen chloride |
| DE1277216B (de) * | 1966-01-03 | 1968-09-12 | Hoechst Ag | Verfahren zur Foerderung der Rueckoxydation von kathodisch reduzierten Metallverbindungen bei der Elektrolyse von waessriger Salzsaeure |
| US3485707A (en) * | 1966-05-31 | 1969-12-23 | Goodrich Co B F | Belt |
| US3711385A (en) * | 1970-09-25 | 1973-01-16 | Chemnor Corp | Electrode having platinum metal oxide coating thereon,and method of use thereof |
| US4191618A (en) * | 1977-12-23 | 1980-03-04 | General Electric Company | Production of halogens in an electrolysis cell with catalytic electrodes bonded to an ion transporting membrane and an oxygen depolarized cathode |
| JPS6039757B2 (ja) * | 1979-02-02 | 1985-09-07 | クロリンエンジニアズ株式会社 | 塩酸の電解方法 |
| JPS57194284A (en) * | 1981-05-27 | 1982-11-29 | Asahi Glass Co Ltd | Electrolyzing method |
| IT1151365B (it) | 1982-03-26 | 1986-12-17 | Oronzio De Nora Impianti | Anodo per procedimenti elettrilitici |
| US5411641A (en) * | 1993-11-22 | 1995-05-02 | E. I. Du Pont De Nemours And Company | Electrochemical conversion of anhydrous hydrogen halide to halogen gas using a cation-transporting membrane |
-
1996
- 1996-01-19 IT IT96MI000086A patent/IT1282367B1/it active IP Right Grant
- 1996-12-18 US US08/769,483 patent/US5770035A/en not_active Expired - Lifetime
- 1996-12-20 TW TW085115739A patent/TW351731B/zh not_active IP Right Cessation
- 1996-12-30 CA CA002194115A patent/CA2194115C/en not_active Expired - Lifetime
-
1997
- 1997-01-07 HU HU9700038A patent/HUP9700038A3/hu unknown
- 1997-01-16 PL PL97317988A patent/PL185834B1/pl unknown
- 1997-01-17 CN CN97102270A patent/CN1084395C/zh not_active Expired - Lifetime
- 1997-01-17 AT AT97100742T patent/ATE207136T1/de active
- 1997-01-17 BR BR9700712A patent/BR9700712A/pt not_active IP Right Cessation
- 1997-01-17 ES ES97100742T patent/ES2166016T3/es not_active Expired - Lifetime
- 1997-01-17 EP EP97100742A patent/EP0785294B1/en not_active Expired - Lifetime
- 1997-01-17 RU RU97100560/12A patent/RU2169795C2/ru active
- 1997-01-17 DE DE69707320T patent/DE69707320T2/de not_active Expired - Lifetime
- 1997-01-20 JP JP00743397A patent/JP3851397B2/ja not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| ITMI960086A0 (OSRAM) | 1996-01-19 |
| EP0785294A1 (en) | 1997-07-23 |
| PL317988A1 (en) | 1997-07-21 |
| JP3851397B2 (ja) | 2006-11-29 |
| HU9700038D0 (en) | 1997-02-28 |
| CA2194115A1 (en) | 1997-07-20 |
| IT1282367B1 (it) | 1998-03-20 |
| RU2169795C2 (ru) | 2001-06-27 |
| HUP9700038A3 (en) | 1998-07-28 |
| ITMI960086A1 (it) | 1997-07-19 |
| JPH09195078A (ja) | 1997-07-29 |
| BR9700712A (pt) | 1998-09-01 |
| ATE207136T1 (de) | 2001-11-15 |
| US5770035A (en) | 1998-06-23 |
| EP0785294B1 (en) | 2001-10-17 |
| MX9700478A (es) | 1997-07-31 |
| ES2166016T3 (es) | 2002-04-01 |
| CN1084395C (zh) | 2002-05-08 |
| CN1172868A (zh) | 1998-02-11 |
| CA2194115C (en) | 2005-07-26 |
| DE69707320T2 (de) | 2002-07-04 |
| DE69707320D1 (de) | 2001-11-22 |
| TW351731B (en) | 1999-02-01 |
| HUP9700038A2 (en) | 1997-10-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL185834B1 (pl) | Sposób elektrolizy wodnego roztworu kwasu chlorowoSposób elektrolizy wodnego roztworu kwasu chlorowodorowego oraz elektrolizer do elektrolizy wodnegodorowego oraz elektrolizer do elektrolizy wodnegoroztworu kwasu chlorowodorowegoroztworu kwasu chlorowodorowego | |
| US7341654B2 (en) | Mediated hydrohalic acid electrolysis | |
| EP0507862B1 (en) | Electrochemical chlorine dioxide generator | |
| US6402930B1 (en) | Process for the electrolysis of technical-grade hydrochloric acid contaminated with organic substances using oxygen-consuming cathodes | |
| RU97100560A (ru) | Способ электролиза водных растворов хлористоводородной кислоты | |
| EP0730675A1 (en) | Electrochemical conversion of anhydrous hydrogen halide to halogen gas using a cation-transporting membrane | |
| US5158658A (en) | Electrochemical chlorine dioxide generator | |
| US5868912A (en) | Electrochemical cell having an oxide growth resistant current distributor | |
| US5071516A (en) | Process for converting ionic valence number | |
| US5181993A (en) | Process for converting ferrous ions to ferric ions | |
| Barmashenko et al. | Recovery of chlorine from dilute hydrochloric acid by electrolysis using a chlorine resistant anion exchange membrane | |
| MXPA97000478A (en) | Improved method for the electrolysis of aqueous solutions of acid clorhidr | |
| EP0828865A1 (en) | Electrochemical conversion of anhydrous hydrogen halide to halogen gas using a cation-transporting membrane | |
| WO1996035003A1 (en) | Electrochemical cell having a self-regulating gas diffusion layer | |
| SA97170635B1 (ar) | طريقة محسنة للتحليل الكهربي electrolysis لمحاليل مائية من حمض الهيدروكلوريك HYDROCHLORIC ACID | |
| Kurzweil | Electrochemical Devices| Electrolyzers | |
| Wendt et al. | Electrochemical Cell and Plant Engineering | |
| Wendt et al. | Industrial processes | |
| WO1996035004A1 (en) | Electrochemical cell having an oxide growth resistant current distributor | |
| WO1996035005A1 (en) | Electrochemical cell having a current distributor comprising a carbonaceous material | |
| Hine | Configuration of Electrolyzers | |
| WO1996035001A1 (en) | Electrochemical cell having a resilient flow field |