PL170751B1 - 4H-karbazolonu-4 PL - Google Patents
4H-karbazolonu-4 PLInfo
- Publication number
- PL170751B1 PL170751B1 PL93298037A PL29803793A PL170751B1 PL 170751 B1 PL170751 B1 PL 170751B1 PL 93298037 A PL93298037 A PL 93298037A PL 29803793 A PL29803793 A PL 29803793A PL 170751 B1 PL170751 B1 PL 170751B1
- Authority
- PL
- Poland
- Prior art keywords
- methyl
- formula
- acid
- carbazolone
- preparation
- Prior art date
Links
- 238000000034 method Methods 0.000 claims abstract description 17
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract description 11
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims abstract description 8
- 239000002904 solvent Substances 0.000 claims abstract description 7
- 230000003213 activating effect Effects 0.000 claims abstract description 3
- 238000007171 acid catalysis Methods 0.000 claims abstract 2
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 claims description 12
- 238000002360 preparation method Methods 0.000 claims description 12
- 150000001875 compounds Chemical class 0.000 claims description 9
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical group OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 8
- 238000007363 ring formation reaction Methods 0.000 claims description 6
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 claims description 5
- 239000003377 acid catalyst Substances 0.000 claims description 4
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims description 4
- 239000003960 organic solvent Substances 0.000 claims description 4
- 238000005863 Friedel-Crafts acylation reaction Methods 0.000 claims description 2
- 150000008064 anhydrides Chemical class 0.000 claims description 2
- 230000015572 biosynthetic process Effects 0.000 claims 1
- 239000012429 reaction media Substances 0.000 claims 1
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 abstract description 12
- 238000005727 Friedel-Crafts reaction Methods 0.000 abstract 1
- 238000005917 acylation reaction Methods 0.000 abstract 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- 125000003118 aryl group Chemical group 0.000 description 9
- 239000000203 mixture Substances 0.000 description 8
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- 239000007787 solid Substances 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 5
- 238000005160 1H NMR spectroscopy Methods 0.000 description 4
- LXBGSDVWAMZHDD-UHFFFAOYSA-N 2-methyl-1h-imidazole Chemical compound CC1=NC=CN1 LXBGSDVWAMZHDD-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- UJOBWOGCFQCDNV-UHFFFAOYSA-N 9H-carbazole Chemical compound C1=CC=C2C3=CC=CC=C3NC2=C1 UJOBWOGCFQCDNV-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 2
- QARVLSVVCXYDNA-UHFFFAOYSA-N bromobenzene Chemical compound BrC1=CC=CC=C1 QARVLSVVCXYDNA-UHFFFAOYSA-N 0.000 description 2
- AMLYRCOEFHJSFS-UHFFFAOYSA-N carbazol-1-one Chemical compound C1=CC=C2C3=CC=CC(=O)C3=NC2=C1 AMLYRCOEFHJSFS-UHFFFAOYSA-N 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- NOOYFQLPKUQDNE-UHFFFAOYSA-N 2-(bromomethyl)prop-2-enoic acid Chemical compound OC(=O)C(=C)CBr NOOYFQLPKUQDNE-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- 102000035037 5-HT3 receptors Human genes 0.000 description 1
- 108091005477 5-HT3 receptors Proteins 0.000 description 1
- 208000019901 Anxiety disease Diseases 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 1
- 125000006519 CCH3 Chemical group 0.000 description 1
- 206010019233 Headaches Diseases 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 206010026749 Mania Diseases 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 208000008589 Obesity Diseases 0.000 description 1
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 150000001266 acyl halides Chemical class 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 1
- 150000001448 anilines Chemical class 0.000 description 1
- 230000003474 anti-emetic effect Effects 0.000 description 1
- 239000002111 antiemetic agent Substances 0.000 description 1
- 230000036506 anxiety Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 238000002512 chemotherapy Methods 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- RQRUAENQOVZHNW-UHFFFAOYSA-N ethyl 1,2-dimethylindole-3-carboxylate Chemical compound C1=CC=C2C(C(=O)OCC)=C(C)N(C)C2=C1 RQRUAENQOVZHNW-UHFFFAOYSA-N 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 229910052736 halogen Chemical group 0.000 description 1
- 150000002367 halogens Chemical group 0.000 description 1
- 125000004970 halomethyl group Chemical group 0.000 description 1
- 231100000869 headache Toxicity 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 229910003002 lithium salt Inorganic materials 0.000 description 1
- 159000000002 lithium salts Chemical class 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 235000020824 obesity Nutrition 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- HKOOXMFOFWEVGF-UHFFFAOYSA-N phenylhydrazine Chemical compound NNC1=CC=CC=C1 HKOOXMFOFWEVGF-UHFFFAOYSA-N 0.000 description 1
- 229940067157 phenylhydrazine Drugs 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 201000000980 schizophrenia Diseases 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- WJKHJLXJJJATHN-UHFFFAOYSA-N triflic anhydride Chemical compound FC(F)(F)S(=O)(=O)OS(=O)(=O)C(F)(F)F WJKHJLXJJJATHN-UHFFFAOYSA-N 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/06—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Indole Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| ES09200552A ES2043535B1 (es) | 1992-03-13 | 1992-03-13 | Procedimiento para la obtencion de la 1,2,3,9-tetrahidro-9-metil-3-(2-metil-1h-imidazol-1-il)metil*-4h-carbazol-4-ona. |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| PL298037A1 PL298037A1 (en) | 1993-12-27 |
| PL170751B1 true PL170751B1 (pl) | 1997-01-31 |
Family
ID=8276385
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL93298037A PL170751B1 (pl) | 1992-03-13 | 1993-03-12 | 4H-karbazolonu-4 PL |
Country Status (15)
| Country | Link |
|---|---|
| KR (1) | KR100277414B1 (pt) |
| AR (1) | AR248019A1 (pt) |
| AT (1) | AT402730B (pt) |
| CZ (1) | CZ281753B6 (pt) |
| EG (1) | EG20262A (pt) |
| ES (1) | ES2043535B1 (pt) |
| FI (1) | FI105098B (pt) |
| GR (1) | GR930100094A (pt) |
| HU (1) | HU210775B (pt) |
| IS (1) | IS1783B (pt) |
| NO (1) | NO300973B1 (pt) |
| PL (1) | PL170751B1 (pt) |
| PT (1) | PT101216B (pt) |
| RU (1) | RU2109741C1 (pt) |
| SK (1) | SK278786B6 (pt) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| KR100368895B1 (ko) * | 2000-03-30 | 2003-01-24 | 하나제약 주식회사 | 1,2,3,9-테트라하이드로-9-메틸-3-[(2-메틸-1h-이미다졸-1-일)메틸]-4h-카바졸-4-온의 제조방법 |
| RU2207340C2 (ru) * | 2001-08-10 | 2003-06-27 | Ципла Лтд. | Способ получения 1,2,3,9-тетрагидро-9-метил-3-[(2-метил-1н-имидазол-1-ил)метил]-4н-карбазол -4-она или его фармацевтически приемлемых солей |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| LU88268I2 (pt) * | 1984-01-25 | 1994-02-03 | ||
| GB8518743D0 (en) * | 1985-07-24 | 1985-08-29 | Glaxo Group Ltd | Heterocyclic compounds |
| GB8518742D0 (en) * | 1985-07-24 | 1985-08-29 | Glaxo Group Ltd | Process |
| GB8518741D0 (en) * | 1985-07-24 | 1985-08-29 | Glaxo Group Ltd | Process |
| GB8617994D0 (en) * | 1986-07-23 | 1986-08-28 | Glaxo Group Ltd | Heterocyclic compounds |
-
1992
- 1992-03-13 ES ES09200552A patent/ES2043535B1/es not_active Expired - Fee Related
-
1993
- 1993-03-08 SK SK169-93A patent/SK278786B6/sk not_active IP Right Cessation
- 1993-03-09 GR GR930100094A patent/GR930100094A/el not_active IP Right Cessation
- 1993-03-10 CZ CZ93396A patent/CZ281753B6/cs not_active IP Right Cessation
- 1993-03-10 EG EG14493A patent/EG20262A/xx active
- 1993-03-11 IS IS3985A patent/IS1783B/is unknown
- 1993-03-11 KR KR1019930003609A patent/KR100277414B1/ko not_active Expired - Fee Related
- 1993-03-11 PT PT101216A patent/PT101216B/pt not_active IP Right Cessation
- 1993-03-11 NO NO930887A patent/NO300973B1/no not_active IP Right Cessation
- 1993-03-11 AR AR93324474A patent/AR248019A1/es active
- 1993-03-12 AT AT0048793A patent/AT402730B/de not_active IP Right Cessation
- 1993-03-12 HU HU9300718A patent/HU210775B/hu not_active IP Right Cessation
- 1993-03-12 FI FI931104A patent/FI105098B/fi not_active IP Right Cessation
- 1993-03-12 PL PL93298037A patent/PL170751B1/pl not_active IP Right Cessation
- 1993-03-12 RU RU93004833/04A patent/RU2109741C1/ru not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| NO930887L (no) | 1993-09-14 |
| HU210775B (en) | 1995-07-28 |
| FI931104A0 (fi) | 1993-03-12 |
| GR930100094A (el) | 1993-11-30 |
| NO300973B1 (no) | 1997-08-25 |
| AT402730B (de) | 1997-08-25 |
| RU2109741C1 (ru) | 1998-04-27 |
| IS1783B (is) | 2001-10-22 |
| IS3985A (is) | 1993-09-14 |
| HUT64537A (en) | 1994-01-28 |
| PL298037A1 (en) | 1993-12-27 |
| SK278786B6 (sk) | 1998-02-04 |
| PT101216B (pt) | 1999-10-29 |
| ES2043535B1 (es) | 1994-08-01 |
| EG20262A (en) | 1998-05-31 |
| AR248019A1 (es) | 1995-05-31 |
| PT101216A (pt) | 1994-03-31 |
| ES2043535A1 (es) | 1993-12-16 |
| FI931104L (fi) | 1993-09-14 |
| FI105098B (fi) | 2000-06-15 |
| HU9300718D0 (en) | 1993-05-28 |
| KR100277414B1 (ko) | 2001-01-15 |
| KR930019665A (ko) | 1993-10-18 |
| CZ39693A3 (en) | 1994-01-19 |
| CZ281753B6 (cs) | 1997-01-15 |
| ATA48793A (de) | 1996-12-15 |
| SK16993A3 (en) | 1993-11-10 |
| NO930887D0 (no) | 1993-03-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU707282B2 (en) | Benzopyran derivatives having leukotriene-antagonistic action | |
| HU198905B (en) | Process for production of derivatives of 4-/alkyl-sulphonil/-3-hydroxi-2-chlor bensoic acid | |
| US4739072A (en) | Process for preparing tetrahydrocarbazolones | |
| ITMI981670A1 (it) | Derivati ftalazinici inibitori della fosfodiesterasi 4 | |
| US5478949A (en) | Process for preparing ondansetron | |
| US4263437A (en) | Acetic acid derivatives of 5,6-dihydrobenzo[b]pyrido[3,2-f]thiepine and oxepine | |
| HU195488B (en) | Process for producing quinolon-carboxylic acid-nitril derivatives | |
| US4910212A (en) | Heterocyclic compounds | |
| Baraznenok et al. | 3‐Trifloxy‐3‐trifluoromethylpropeniminium Triflate: Reaction with Aromatic Amines–An Efficient Synthesis of 2‐Trifluoromethylquinolines | |
| US3784600A (en) | 4-substituted coumarins | |
| PL170751B1 (pl) | 4H-karbazolonu-4 PL | |
| US4350813A (en) | Process for producing 7-alkoxycarbonyl-6,8-dimethyl-4-hydroxymethyl-1-phthalazone and its intermediates | |
| SU1739848A3 (ru) | Способ получени производных тианафтена или их фармацевтически приемлемых солей | |
| US3004983A (en) | 4-aminopyrazolo [3, 4-a] indene derivatives | |
| CS214806B2 (en) | Method of making the derivatives of the auron | |
| EP0142754A2 (en) | 2-Substituted-benzoic acid imidazoles, process for preparing them and pharmaceutical compositions containing them | |
| KR870001922B1 (ko) | 이미다졸 유도체의 제조방법 | |
| US4464532A (en) | Intermediates of 7-alkoxycarbonyl-6,8-dimethyl-4-hydroxymethyl-1-phthalazone | |
| EP0255178A2 (en) | Process for preparing hetero aryl and aryl alkanoic acids | |
| US4677228A (en) | Chemical process | |
| US20060058532A1 (en) | Process for the scalable synthesis of 1,3,4,9-tetrahydropyrano[3,4-b]-indole derivatives | |
| PL114404B1 (en) | Process for manufacturing novel pyrrole derivatives | |
| EP0125937A2 (fr) | Dérivés d'(indényl-2)-2 imidazoline, procédé pour les préparer, et compositions pharmaceutiques qui les contiennent | |
| Zepeda et al. | Fischer indole synthesis of (β-oxo) indol-3-yl ketones using protected 1, 3-dicarbonyl compounds | |
| PL198521B1 (pl) | Sposób wytwarzania pochodnych spiro [(4-cykloheksanono)-[3H]indol]-2'[1'H]-onu oraz związki pośrednie |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| LAPS | Decisions on the lapse of the protection rights |
Effective date: 20110312 |