PL133589B1 - Method of obtaining dichloroacetamides - Google Patents
Method of obtaining dichloroacetamides Download PDFInfo
- Publication number
- PL133589B1 PL133589B1 PL1981230885A PL23088581A PL133589B1 PL 133589 B1 PL133589 B1 PL 133589B1 PL 1981230885 A PL1981230885 A PL 1981230885A PL 23088581 A PL23088581 A PL 23088581A PL 133589 B1 PL133589 B1 PL 133589B1
- Authority
- PL
- Poland
- Prior art keywords
- dichloroacetyl chloride
- sodium hydroxide
- reactor
- formula
- continuously
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 43
- WCGGWVOVFQNRRS-UHFFFAOYSA-N dichloroacetamide Chemical class NC(=O)C(Cl)Cl WCGGWVOVFQNRRS-UHFFFAOYSA-N 0.000 title claims abstract description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims abstract description 105
- FBCCMZVIWNDFMO-UHFFFAOYSA-N dichloroacetyl chloride Chemical compound ClC(Cl)C(Cl)=O FBCCMZVIWNDFMO-UHFFFAOYSA-N 0.000 claims abstract description 46
- 238000006243 chemical reaction Methods 0.000 claims abstract description 30
- WYNCHZVNFNFDNH-UHFFFAOYSA-N Oxazolidine Chemical compound C1COCN1 WYNCHZVNFNFDNH-UHFFFAOYSA-N 0.000 claims abstract description 17
- RLJHUAABUCHYNU-UHFFFAOYSA-N 2,2-dichloro-1-(1,3-oxazolidin-3-yl)ethanone Chemical class ClC(Cl)C(=O)N1CCOC1 RLJHUAABUCHYNU-UHFFFAOYSA-N 0.000 claims abstract description 13
- 239000007864 aqueous solution Substances 0.000 claims abstract description 12
- DYUWTXWIYMHBQS-UHFFFAOYSA-N n-prop-2-enylprop-2-en-1-amine Chemical compound C=CCNCC=C DYUWTXWIYMHBQS-UHFFFAOYSA-N 0.000 claims abstract description 11
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 5
- 239000012074 organic phase Substances 0.000 claims description 21
- 239000000243 solution Substances 0.000 claims description 18
- 238000002360 preparation method Methods 0.000 claims description 17
- 239000007788 liquid Substances 0.000 claims description 14
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 14
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 claims description 12
- 239000008346 aqueous phase Substances 0.000 claims description 11
- 239000000203 mixture Substances 0.000 claims description 10
- 150000002917 oxazolidines Chemical class 0.000 claims description 9
- 239000011541 reaction mixture Substances 0.000 claims description 9
- 239000012071 phase Substances 0.000 claims description 8
- 239000005416 organic matter Substances 0.000 claims description 6
- 239000011780 sodium chloride Substances 0.000 claims description 6
- 238000010924 continuous production Methods 0.000 claims description 5
- 238000002156 mixing Methods 0.000 claims description 5
- 239000000126 substance Substances 0.000 claims description 5
- 239000012429 reaction media Substances 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 229910052757 nitrogen Inorganic materials 0.000 claims description 3
- YRMLFORXOOIJDR-UHFFFAOYSA-N Dichlormid Chemical compound ClC(Cl)C(=O)N(CC=C)CC=C YRMLFORXOOIJDR-UHFFFAOYSA-N 0.000 abstract description 10
- 150000001408 amides Chemical class 0.000 abstract description 4
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 abstract 1
- 238000010923 batch production Methods 0.000 abstract 1
- 229910052739 hydrogen Inorganic materials 0.000 abstract 1
- 239000001257 hydrogen Substances 0.000 abstract 1
- 239000000047 product Substances 0.000 description 18
- 150000001412 amines Chemical class 0.000 description 14
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- -1 alkyl radical Chemical group 0.000 description 9
- 239000004009 herbicide Substances 0.000 description 9
- 239000002904 solvent Substances 0.000 description 9
- FZERHIULMFGESH-UHFFFAOYSA-N N-phenylacetamide Chemical compound CC(=O)NC1=CC=CC=C1 FZERHIULMFGESH-UHFFFAOYSA-N 0.000 description 8
- 238000004519 manufacturing process Methods 0.000 description 8
- 238000005191 phase separation Methods 0.000 description 7
- 229960001413 acetanilide Drugs 0.000 description 6
- 239000006227 byproduct Substances 0.000 description 5
- 238000013019 agitation Methods 0.000 description 4
- 239000000729 antidote Substances 0.000 description 4
- 239000012267 brine Substances 0.000 description 4
- 239000012043 crude product Substances 0.000 description 4
- 150000003254 radicals Chemical class 0.000 description 4
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 241000196324 Embryophyta Species 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- GNVMUORYQLCPJZ-UHFFFAOYSA-M Thiocarbamate Chemical compound NC([S-])=O GNVMUORYQLCPJZ-UHFFFAOYSA-M 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 230000000052 comparative effect Effects 0.000 description 3
- 125000005843 halogen group Chemical group 0.000 description 3
- 230000002363 herbicidal effect Effects 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 238000007086 side reaction Methods 0.000 description 3
- MDBGGTQNNUOQRC-UHFFFAOYSA-N Allidochlor Chemical compound ClCC(=O)N(CC=C)CC=C MDBGGTQNNUOQRC-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- YNQSILKYZQZHFJ-UHFFFAOYSA-N R-29148 Chemical compound CC1CN(C(=O)C(Cl)Cl)C(C)(C)O1 YNQSILKYZQZHFJ-UHFFFAOYSA-N 0.000 description 2
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 2
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 2
- 229940075522 antidotes Drugs 0.000 description 2
- 229940053194 antiepileptics oxazolidine derivative Drugs 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 238000011437 continuous method Methods 0.000 description 2
- JXTHNDFMNIQAHM-UHFFFAOYSA-N dichloroacetic acid Chemical compound OC(=O)C(Cl)Cl JXTHNDFMNIQAHM-UHFFFAOYSA-N 0.000 description 2
- 125000001188 haloalkyl group Chemical group 0.000 description 2
- 229910052740 iodine Chemical group 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- 238000010926 purge Methods 0.000 description 2
- 239000012266 salt solution Substances 0.000 description 2
- 229940080263 sodium dichloroacetate Drugs 0.000 description 2
- LUPNKHXLFSSUGS-UHFFFAOYSA-M sodium;2,2-dichloroacetate Chemical compound [Na+].[O-]C(=O)C(Cl)Cl LUPNKHXLFSSUGS-UHFFFAOYSA-M 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- WNXJIVFYUVYPPR-UHFFFAOYSA-N 1,3-dioxolane Chemical compound C1COCO1 WNXJIVFYUVYPPR-UHFFFAOYSA-N 0.000 description 1
- XMPCGZCCOXWBKR-UHFFFAOYSA-N 2,2,5-trimethyl-1,3-oxazolidine Chemical compound CC1CNC(C)(C)O1 XMPCGZCCOXWBKR-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- UENGBOCGGKLVJJ-UHFFFAOYSA-N 2-chloro-1-(2,4-difluorophenyl)ethanone Chemical compound FC1=CC=C(C(=O)CCl)C(F)=C1 UENGBOCGGKLVJJ-UHFFFAOYSA-N 0.000 description 1
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical group [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 description 1
- BEUAJYGQNBUFLW-UHFFFAOYSA-N 4-methoxy-N-phenylbutanamide Chemical compound COCCCC(=O)NC1=CC=CC=C1 BEUAJYGQNBUFLW-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- BMTAFVWTTFSTOG-UHFFFAOYSA-N Butylate Chemical compound CCSC(=O)N(CC(C)C)CC(C)C BMTAFVWTTFSTOG-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- IGDGZEDBDKIKFO-UHFFFAOYSA-N ClC(C)Cl.[Na] Chemical compound ClC(C)Cl.[Na] IGDGZEDBDKIKFO-UHFFFAOYSA-N 0.000 description 1
- GUVLYNGULCJVDO-UHFFFAOYSA-N EPTC Chemical compound CCCN(CCC)C(=O)SCC GUVLYNGULCJVDO-UHFFFAOYSA-N 0.000 description 1
- OKUGPJPKMAEJOE-UHFFFAOYSA-N S-propyl dipropylcarbamothioate Chemical compound CCCSC(=O)N(CCC)CCC OKUGPJPKMAEJOE-UHFFFAOYSA-N 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000005078 alkoxycarbonylalkyl group Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 150000001728 carbonyl compounds Chemical class 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 125000004965 chloroalkyl group Chemical group 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- PDQRIMRBJSQRSL-UHFFFAOYSA-N di(propan-2-yl)carbamothioic s-acid Chemical compound CC(C)N(C(C)C)C(S)=O PDQRIMRBJSQRSL-UHFFFAOYSA-N 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 229960005215 dichloroacetic acid Drugs 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 125000005745 ethoxymethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])* 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 238000003780 insertion Methods 0.000 description 1
- 230000037431 insertion Effects 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 239000011630 iodine Chemical group 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- BGQJNGISTPIALH-UHFFFAOYSA-N n,n-bis(prop-2-enyl)acetamide Chemical compound C=CCN(C(=O)C)CC=C BGQJNGISTPIALH-UHFFFAOYSA-N 0.000 description 1
- PZNOBXVHZYGUEX-UHFFFAOYSA-N n-prop-2-enylprop-2-en-1-amine;hydrochloride Chemical compound Cl.C=CCNCC=C PZNOBXVHZYGUEX-UHFFFAOYSA-N 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 238000006053 organic reaction Methods 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 230000003134 recirculating effect Effects 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 150000003558 thiocarbamic acid derivatives Chemical class 0.000 description 1
- 238000011144 upstream manufacturing Methods 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/02—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings
- C07D263/04—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/144,500 US4278799A (en) | 1980-04-28 | 1980-04-28 | Continuous process for the production of dichloroacetamides |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| PL230885A1 PL230885A1 (enExample) | 1981-12-23 |
| PL133589B1 true PL133589B1 (en) | 1985-06-29 |
Family
ID=22508885
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1981230885A PL133589B1 (en) | 1980-04-28 | 1981-04-28 | Method of obtaining dichloroacetamides |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US4278799A (enExample) |
| EP (1) | EP0039166B1 (enExample) |
| JP (1) | JPS56167672A (enExample) |
| KR (1) | KR840002443B1 (enExample) |
| AT (1) | ATE8875T1 (enExample) |
| BR (1) | BR8102388A (enExample) |
| CA (1) | CA1157867A (enExample) |
| CS (1) | CS226428B2 (enExample) |
| DD (1) | DD158643A5 (enExample) |
| DE (1) | DE3165344D1 (enExample) |
| DK (1) | DK158465C (enExample) |
| HU (1) | HU186408B (enExample) |
| IL (1) | IL62721A (enExample) |
| PL (1) | PL133589B1 (enExample) |
| ZA (1) | ZA812763B (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BR8907771A (pt) * | 1988-11-14 | 1991-08-27 | Ici America Inc | Processo para fabricacao de composto e processo para fabricacao e purificacao de composto |
| JPH0376060A (ja) * | 1989-08-16 | 1991-04-02 | Nec Corp | 磁気ディスク装置のヘッド位置決め装置 |
| WO1991012229A1 (en) * | 1990-02-12 | 1991-08-22 | National Research Council Of Canada | Process for preparing acyl derivatives of acylatable compounds |
| CN114213271A (zh) * | 2021-12-30 | 2022-03-22 | 徐州彰梁生化科技有限公司 | 一种二氯丙烯胺的制备方法 |
| CN117247328B (zh) * | 2023-09-13 | 2025-04-22 | 无锡颐景丰科技有限公司 | 一种二氯丙烯胺的合成方法 |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3268324A (en) * | 1965-10-11 | 1966-08-23 | Monsanto Co | Herbicidal composition and method employing oxa aliphatic acetamide |
| US3647876A (en) * | 1969-08-14 | 1972-03-07 | Virginia Chemicals Inc | Process in the preparation of n n-di-n-propyl-alpha-chloroacetamid |
| US3884671A (en) * | 1972-08-15 | 1975-05-20 | Scm Corp | Herbicidal n-haloacyl (2-alkylated) oxazolidines |
| US4186130A (en) * | 1973-05-02 | 1980-01-29 | Stauffer Chemical Company | N-(haloalkanoyl) oxazolidines |
| US3914302A (en) * | 1974-01-31 | 1975-10-21 | Stauffer Chemical Co | Process for the production of N,N-diallyldichloroacetamide |
| US3959304A (en) * | 1974-07-01 | 1976-05-25 | Stauffer Chemical Company | Certain 3-haloacyl-2,2,5-trimethyl-oxazolidines |
| US4072688A (en) * | 1975-02-14 | 1978-02-07 | Stauffer Chemical Company | Haloacyl and thiohaloacyl aryl-substituted oxazolidines and thiazolidines-herbicidal antidotes |
| US4038284A (en) * | 1975-07-28 | 1977-07-26 | Stauffer Chemical Company | N-acylation of oxazolidines |
| GB1538318A (en) * | 1976-08-09 | 1979-01-17 | Stauffer Chemical Co | Preparation of n-substituted oxazolidines |
-
1980
- 1980-04-28 US US06/144,500 patent/US4278799A/en not_active Expired - Lifetime
-
1981
- 1981-04-13 EP EP81301619A patent/EP0039166B1/en not_active Expired
- 1981-04-13 DE DE8181301619T patent/DE3165344D1/de not_active Expired
- 1981-04-13 AT AT81301619T patent/ATE8875T1/de active
- 1981-04-20 BR BR8102388A patent/BR8102388A/pt not_active IP Right Cessation
- 1981-04-24 JP JP6153781A patent/JPS56167672A/ja active Granted
- 1981-04-24 CA CA000376175A patent/CA1157867A/en not_active Expired
- 1981-04-27 KR KR1019810001442A patent/KR840002443B1/ko not_active Expired
- 1981-04-27 ZA ZA00812763A patent/ZA812763B/xx unknown
- 1981-04-27 HU HU811086A patent/HU186408B/hu not_active IP Right Cessation
- 1981-04-27 DK DK186381A patent/DK158465C/da not_active IP Right Cessation
- 1981-04-27 DD DDAPC07D/2295311A patent/DD158643A5/de not_active IP Right Cessation
- 1981-04-27 IL IL62721A patent/IL62721A/xx not_active IP Right Cessation
- 1981-04-28 PL PL1981230885A patent/PL133589B1/pl unknown
- 1981-04-28 CS CS813167A patent/CS226428B2/cs unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DK158465C (da) | 1990-10-08 |
| EP0039166B1 (en) | 1984-08-08 |
| HU186408B (en) | 1985-07-29 |
| US4278799A (en) | 1981-07-14 |
| KR840002443B1 (ko) | 1984-12-28 |
| DE3165344D1 (en) | 1984-09-13 |
| IL62721A (en) | 1984-05-31 |
| CA1157867A (en) | 1983-11-29 |
| PL230885A1 (enExample) | 1981-12-23 |
| CS226428B2 (en) | 1984-03-19 |
| BR8102388A (pt) | 1981-12-22 |
| IL62721A0 (en) | 1981-06-29 |
| DK158465B (da) | 1990-05-21 |
| JPS56167672A (en) | 1981-12-23 |
| ZA812763B (en) | 1982-06-30 |
| JPS6412265B2 (enExample) | 1989-02-28 |
| DK186381A (da) | 1981-10-29 |
| EP0039166A1 (en) | 1981-11-04 |
| DD158643A5 (de) | 1983-01-26 |
| ATE8875T1 (de) | 1984-08-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0095907B1 (en) | Biocidal or biostatic compositions containing 3-isothiazolones, their method of preparation and their uses | |
| CZ111295A3 (en) | Process for preparing derivatives of n-acyl-alpha-amino acids | |
| DE69214911T2 (de) | Bromat als Hemmer der Nitrosamin-Bildung in Nitrat-stabilisierten Isothiazolonen | |
| PL133589B1 (en) | Method of obtaining dichloroacetamides | |
| DE69501487T2 (de) | Herstellung von Thioamiden | |
| SI9300607A (en) | Insecticidal n'-substituted-n,n'-diacylhydrazines | |
| US2569549A (en) | Imidohalides and process of preparing them and their hydrolysis products | |
| EP0508191B1 (de) | Verfahren zur Herstellung von 1-Carbamoyl-pyrazolen | |
| DE68902658T2 (de) | Verfahren zur herstellung von fluoroaromatischen verbindungen. | |
| US2548428A (en) | Preparation of quaternary amines from tertiary amines and betalactones | |
| DE2156761A1 (de) | Verfahren zur herstellung von isocyanaten | |
| US4742176A (en) | Process for 2-[(2-chlorophenyl)methyl]-4,4-dimethyl-3-isoxazolidinone | |
| JPS6399051A (ja) | イソチアゾロン化合物の製造方法 | |
| EP0169375A2 (en) | Process for producing 2-tert.-butyl-4,5-dichloro-3(2H)-pyridazinone | |
| DE3015834C2 (de) | Verfahren zur Herstellung von 5-Amino-1,2,3-thiadiazolen | |
| KR102079639B1 (ko) | 아크롤레인 시아노히드린을 제조하는 방법 | |
| CS196286B2 (en) | Method of producing phenylhydrazine | |
| CH655304A5 (fr) | Procede de preparation de la diamino-3,3' ou -3,4' benzophenone. | |
| US4328369A (en) | Process for the production of 2,6-dinitro-N-alkyl-anilines | |
| PL121520B1 (en) | Process for preparing n,n-disubstituted halogenacylamides | |
| DE102005025992A1 (de) | Verfahren zur Herstellung von substituierten Azolen | |
| CN1538949A (zh) | 连续制备2-溴-2-硝基-1,3-丙二醇的方法 | |
| EP0031645B1 (en) | Process for the production of azo compounds | |
| JPH0318631B2 (enExample) | ||
| WO2025109600A1 (en) | Process for preparation of sulfonyl pyrazolones |