PL105270B1 - Sposob wytwarzania bezwodnikow kwasow jednokarboksylowych - Google Patents
Sposob wytwarzania bezwodnikow kwasow jednokarboksylowych Download PDFInfo
- Publication number
- PL105270B1 PL105270B1 PL1974198641A PL19864174A PL105270B1 PL 105270 B1 PL105270 B1 PL 105270B1 PL 1974198641 A PL1974198641 A PL 1974198641A PL 19864174 A PL19864174 A PL 19864174A PL 105270 B1 PL105270 B1 PL 105270B1
- Authority
- PL
- Poland
- Prior art keywords
- parts
- iodide
- reaction
- carbon monoxide
- atm
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 28
- 150000002762 monocarboxylic acid derivatives Chemical class 0.000 title claims description 4
- 238000004519 manufacturing process Methods 0.000 title description 5
- 238000006243 chemical reaction Methods 0.000 claims description 49
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 claims description 48
- 229910002091 carbon monoxide Inorganic materials 0.000 claims description 48
- 239000011541 reaction mixture Substances 0.000 claims description 28
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 claims description 26
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 claims description 26
- 239000003054 catalyst Substances 0.000 claims description 19
- 150000008064 anhydrides Chemical class 0.000 claims description 16
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical group [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 15
- -1 alkane carboxylic acid Chemical class 0.000 claims description 15
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 claims description 14
- 229910000510 noble metal Inorganic materials 0.000 claims description 12
- 150000004820 halides Chemical class 0.000 claims description 11
- 229910052751 metal Inorganic materials 0.000 claims description 10
- 239000002184 metal Substances 0.000 claims description 10
- 239000004215 Carbon black (E152) Substances 0.000 claims description 8
- 229930195733 hydrocarbon Natural products 0.000 claims description 8
- 239000007791 liquid phase Substances 0.000 claims description 8
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 claims description 8
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 claims description 7
- 229910052804 chromium Inorganic materials 0.000 claims description 5
- 239000011651 chromium Substances 0.000 claims description 5
- 229910052741 iridium Inorganic materials 0.000 claims description 5
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 claims description 5
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 4
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 4
- 125000005907 alkyl ester group Chemical group 0.000 claims description 4
- 150000005215 alkyl ethers Chemical class 0.000 claims description 4
- 230000000737 periodic effect Effects 0.000 claims description 4
- 229910052697 platinum Inorganic materials 0.000 claims description 4
- 239000012429 reaction media Substances 0.000 claims description 4
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 claims description 3
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 3
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 3
- LEKJTGQWLAUGQA-UHFFFAOYSA-N acetyl iodide Chemical compound CC(I)=O LEKJTGQWLAUGQA-UHFFFAOYSA-N 0.000 claims description 3
- 229910052791 calcium Inorganic materials 0.000 claims description 3
- 239000011575 calcium Substances 0.000 claims description 3
- 229910052703 rhodium Inorganic materials 0.000 claims description 3
- 239000010948 rhodium Substances 0.000 claims description 3
- 239000010936 titanium Substances 0.000 claims description 3
- 229910052719 titanium Inorganic materials 0.000 claims description 3
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims description 2
- 229910052768 actinide Inorganic materials 0.000 claims description 2
- 229910052782 aluminium Inorganic materials 0.000 claims description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 2
- 229910052742 iron Inorganic materials 0.000 claims description 2
- 229910052747 lanthanoid Inorganic materials 0.000 claims description 2
- 150000002602 lanthanoids Chemical class 0.000 claims description 2
- 229910052749 magnesium Inorganic materials 0.000 claims description 2
- 239000011777 magnesium Substances 0.000 claims description 2
- 229910052759 nickel Inorganic materials 0.000 claims description 2
- 229910052762 osmium Inorganic materials 0.000 claims description 2
- SYQBFIAQOQZEGI-UHFFFAOYSA-N osmium atom Chemical compound [Os] SYQBFIAQOQZEGI-UHFFFAOYSA-N 0.000 claims description 2
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 claims description 2
- 239000010953 base metal Substances 0.000 claims 1
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 84
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 28
- SONJTKJMTWTJCT-UHFFFAOYSA-K rhodium(iii) chloride Chemical compound [Cl-].[Cl-].[Cl-].[Rh+3] SONJTKJMTWTJCT-UHFFFAOYSA-K 0.000 description 20
- HSZCZNFXUDYRKD-UHFFFAOYSA-M lithium iodide Chemical compound [Li+].[I-] HSZCZNFXUDYRKD-UHFFFAOYSA-M 0.000 description 18
- 238000004817 gas chromatography Methods 0.000 description 17
- 229910021604 Rhodium(III) chloride Inorganic materials 0.000 description 16
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 15
- 239000012190 activator Substances 0.000 description 15
- 239000000376 reactant Substances 0.000 description 13
- 238000004458 analytical method Methods 0.000 description 12
- 150000002148 esters Chemical class 0.000 description 12
- 150000001875 compounds Chemical class 0.000 description 9
- 229910001220 stainless steel Inorganic materials 0.000 description 9
- 239000010935 stainless steel Substances 0.000 description 9
- 150000001266 acyl halides Chemical class 0.000 description 8
- 238000005810 carbonylation reaction Methods 0.000 description 7
- 150000003839 salts Chemical class 0.000 description 7
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 description 6
- 238000004821 distillation Methods 0.000 description 6
- 229910052736 halogen Inorganic materials 0.000 description 6
- 150000002367 halogens Chemical group 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- 239000000843 powder Substances 0.000 description 6
- 230000006315 carbonylation Effects 0.000 description 5
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 4
- 229910052794 bromium Inorganic materials 0.000 description 4
- 239000007789 gas Substances 0.000 description 4
- 150000002430 hydrocarbons Chemical class 0.000 description 4
- 229910052740 iodine Inorganic materials 0.000 description 4
- 239000011630 iodine Substances 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 3
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 239000003085 diluting agent Substances 0.000 description 3
- 229910052744 lithium Inorganic materials 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 230000035484 reaction time Effects 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 150000001350 alkyl halides Chemical class 0.000 description 2
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 239000003245 coal Substances 0.000 description 2
- 238000004508 fractional distillation Methods 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 150000008282 halocarbons Chemical class 0.000 description 2
- 150000005826 halohydrocarbons Chemical class 0.000 description 2
- 239000012433 hydrogen halide Substances 0.000 description 2
- 229910000039 hydrogen halide Inorganic materials 0.000 description 2
- 239000003701 inert diluent Substances 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 150000004694 iodide salts Chemical class 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 150000002763 monocarboxylic acids Chemical class 0.000 description 2
- 150000002894 organic compounds Chemical class 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 150000003284 rhodium compounds Chemical class 0.000 description 2
- FVUHGTQDOMGZOT-NTSWFWBYSA-N (1s,3r)-3-methoxycarbonylcyclopentane-1-carboxylic acid Chemical compound COC(=O)[C@@H]1CC[C@H](C(O)=O)C1 FVUHGTQDOMGZOT-NTSWFWBYSA-N 0.000 description 1
- NOGFHTGYPKWWRX-UHFFFAOYSA-N 2,2,6,6-tetramethyloxan-4-one Chemical compound CC1(C)CC(=O)CC(C)(C)O1 NOGFHTGYPKWWRX-UHFFFAOYSA-N 0.000 description 1
- GOKCJCODOLGYQD-UHFFFAOYSA-N 4,6-dichloro-2-imidazol-1-ylpyrimidine Chemical group ClC1=CC(Cl)=NC(N2C=NC=C2)=N1 GOKCJCODOLGYQD-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 241001292396 Cirrhitidae Species 0.000 description 1
- 241000344110 Erysimum rhodium Species 0.000 description 1
- 241000490229 Eucephalus Species 0.000 description 1
- 239000004606 Fillers/Extenders Substances 0.000 description 1
- GYHNNYVSQQEPJS-UHFFFAOYSA-N Gallium Chemical compound [Ga] GYHNNYVSQQEPJS-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 229910021638 Iridium(III) chloride Inorganic materials 0.000 description 1
- 241000234435 Lilium Species 0.000 description 1
- 244000171726 Scotch broom Species 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 150000001255 actinides Chemical class 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- CECABOMBVQNBEC-UHFFFAOYSA-K aluminium iodide Chemical compound I[Al](I)I CECABOMBVQNBEC-UHFFFAOYSA-K 0.000 description 1
- YCOXTKKNXUZSKD-UHFFFAOYSA-N as-o-xylenol Natural products CC1=CC=C(O)C=C1C YCOXTKKNXUZSKD-UHFFFAOYSA-N 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 229910001570 bauxite Inorganic materials 0.000 description 1
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 150000004648 butanoic acid derivatives Chemical class 0.000 description 1
- QAWBXZYPFCFQLA-UHFFFAOYSA-N butanoyl bromide Chemical class CCCC(Br)=O QAWBXZYPFCFQLA-UHFFFAOYSA-N 0.000 description 1
- ZEEDSWFDNIDARI-UHFFFAOYSA-N butanoyl iodide Chemical class CCCC(I)=O ZEEDSWFDNIDARI-UHFFFAOYSA-N 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- XWDKRVSSHIJNJP-UHFFFAOYSA-N carbon monoxide;iridium Chemical group [Ir].[Ir].[Ir].[Ir].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-] XWDKRVSSHIJNJP-UHFFFAOYSA-N 0.000 description 1
- 150000001728 carbonyl compounds Chemical class 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 150000001734 carboxylic acid salts Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- ZEDZJUDTPVFRNB-UHFFFAOYSA-K cerium(3+);triiodide Chemical compound I[Ce](I)I ZEDZJUDTPVFRNB-UHFFFAOYSA-K 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- PPUZYFWVBLIDMP-UHFFFAOYSA-K chromium(3+);triiodide Chemical compound I[Cr](I)I PPUZYFWVBLIDMP-UHFFFAOYSA-K 0.000 description 1
- 238000010924 continuous production Methods 0.000 description 1
- 125000005534 decanoate group Chemical class 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 229910052733 gallium Inorganic materials 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 230000006698 induction Effects 0.000 description 1
- 229910001502 inorganic halide Inorganic materials 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- SNHMUERNLJLMHN-UHFFFAOYSA-N iodobenzene Chemical compound IC1=CC=CC=C1 SNHMUERNLJLMHN-UHFFFAOYSA-N 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- BLQJIBCZHWBKSL-UHFFFAOYSA-L magnesium iodide Chemical compound [Mg+2].[I-].[I-] BLQJIBCZHWBKSL-UHFFFAOYSA-L 0.000 description 1
- 229910001641 magnesium iodide Inorganic materials 0.000 description 1
- 230000010534 mechanism of action Effects 0.000 description 1
- NBTOZLQBSIZIKS-UHFFFAOYSA-N methoxide Chemical compound [O-]C NBTOZLQBSIZIKS-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 229910052756 noble gas Inorganic materials 0.000 description 1
- 150000002835 noble gases Chemical class 0.000 description 1
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 1
- RAFYDKXYXRZODZ-UHFFFAOYSA-N octanoyl octanoate Chemical compound CCCCCCCC(=O)OC(=O)CCCCCCC RAFYDKXYXRZODZ-UHFFFAOYSA-N 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- DUCKXCGALKOSJF-UHFFFAOYSA-N pentanoyl pentanoate Chemical class CCCCC(=O)OC(=O)CCCC DUCKXCGALKOSJF-UHFFFAOYSA-N 0.000 description 1
- FCJSHPDYVMKCHI-UHFFFAOYSA-N phenyl benzoate Chemical compound C=1C=CC=CC=1C(=O)OC1=CC=CC=C1 FCJSHPDYVMKCHI-UHFFFAOYSA-N 0.000 description 1
- 239000012255 powdered metal Substances 0.000 description 1
- RIBFXMJCUYXJDZ-UHFFFAOYSA-N propanoyl bromide Chemical compound CCC(Br)=O RIBFXMJCUYXJDZ-UHFFFAOYSA-N 0.000 description 1
- WYVAMUWZEOHJOQ-UHFFFAOYSA-N propionic anhydride Chemical compound CCC(=O)OC(=O)CC WYVAMUWZEOHJOQ-UHFFFAOYSA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 238000004064 recycling Methods 0.000 description 1
- 150000003304 ruthenium compounds Chemical class 0.000 description 1
- 238000009738 saturating Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- HBMJWWWQQXIZIP-UHFFFAOYSA-N silicon carbide Chemical compound [Si+]#[C-] HBMJWWWQQXIZIP-UHFFFAOYSA-N 0.000 description 1
- 229910010271 silicon carbide Inorganic materials 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 238000001577 simple distillation Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- DANYXEHCMQHDNX-UHFFFAOYSA-K trichloroiridium Chemical compound Cl[Ir](Cl)Cl DANYXEHCMQHDNX-UHFFFAOYSA-K 0.000 description 1
- HSSMNYDDDSNUKH-UHFFFAOYSA-K trichlororhodium;hydrate Chemical compound O.Cl[Rh](Cl)Cl HSSMNYDDDSNUKH-UHFFFAOYSA-K 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/54—Preparation of carboxylic acid anhydrides
- C07C51/56—Preparation of carboxylic acid anhydrides from organic acids, their salts, their esters or their halides, e.g. by carboxylation
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US39422073A | 1973-09-04 | 1973-09-04 | |
| US46797774A | 1974-05-08 | 1974-05-08 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL105270B1 true PL105270B1 (pl) | 1979-10-31 |
Family
ID=27014635
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1974198641A PL105270B1 (pl) | 1973-09-04 | 1974-08-30 | Sposob wytwarzania bezwodnikow kwasow jednokarboksylowych |
Country Status (21)
| Country | Link |
|---|---|
| JP (1) | JPS5550932B2 (enExample) |
| BG (1) | BG25203A3 (enExample) |
| BR (1) | BR7407075D0 (enExample) |
| CA (1) | CA1033761A (enExample) |
| CH (2) | CH609321A5 (enExample) |
| DD (1) | DD113521A5 (enExample) |
| DE (3) | DE2462910C2 (enExample) |
| DK (1) | DK466674A (enExample) |
| EG (1) | EG11306A (enExample) |
| ES (3) | ES429764A1 (enExample) |
| FR (1) | FR2242362B1 (enExample) |
| GB (1) | GB1468940A (enExample) |
| HU (1) | HU171902B (enExample) |
| IL (1) | IL45453A (enExample) |
| IT (1) | IT1019121B (enExample) |
| LU (1) | LU70831A1 (enExample) |
| NL (1) | NL169580C (enExample) |
| NO (1) | NO147183C (enExample) |
| PL (1) | PL105270B1 (enExample) |
| RO (1) | RO65730A (enExample) |
| SE (1) | SE413891B (enExample) |
Families Citing this family (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4002678A (en) * | 1975-12-22 | 1977-01-11 | Halcon International, Inc. | Preparation of carboxylic acid anhydrides |
| US4374070A (en) * | 1980-11-21 | 1983-02-15 | Eastman Kodak Company | Preparation of acetic anhydride |
| US4340569A (en) | 1981-03-06 | 1982-07-20 | The Halcon Sd Group, Inc. | Treatment of carbonylation residues |
| US4341741A (en) | 1981-03-06 | 1982-07-27 | The Halcon Sd Group, Inc. | Recovery of rhodium from carbonylation residues |
| US4340570A (en) | 1981-03-06 | 1982-07-20 | The Halcon Sd Group, Inc. | Recovery of rhodium from carbonylation residues |
| US4476238A (en) * | 1981-05-28 | 1984-10-09 | The Halcon Sd Group, Inc. | Separation of tars from carbonylation reaction mixtures |
| US4476237A (en) * | 1981-05-28 | 1984-10-09 | The Halcon Sd Group, Inc. | Separation of tars from carbonylation reaction mixtures |
| FR2507597B1 (fr) * | 1981-06-12 | 1985-12-13 | Rhone Poulenc Chim Base | Procede de carbonylation de l'acetate de methyle |
| NL8204901A (nl) * | 1981-12-30 | 1983-07-18 | Halcon Sd Group Inc | Zuivering van carbonyleringsprodukten. |
| EP0097978B1 (en) * | 1982-06-18 | 1985-12-18 | Shell Internationale Researchmaatschappij B.V. | A process for the co-production of carboxylic acids |
| JPS6016950A (ja) * | 1983-07-08 | 1985-01-28 | Daicel Chem Ind Ltd | カルボン酸無水物の製造法 |
| GB8320358D0 (en) * | 1983-07-28 | 1983-09-01 | Shell Int Research | Preparation of carboxylic acids |
| JPS6054334A (ja) * | 1983-09-02 | 1985-03-28 | Daicel Chem Ind Ltd | カルボン酸の製造法 |
| US5144068A (en) * | 1984-05-03 | 1992-09-01 | Hoechst Celanese Corporation | Methanol carbonylation process |
| US5026908A (en) * | 1984-05-03 | 1991-06-25 | Hoechst Celanese Corporation | Methanol carbonylation process |
| US4563309A (en) * | 1984-08-16 | 1986-01-07 | Union Carbide Corporation | Production of carboxylic anhydrides from methyl carboxlyates using rhodium complex catalysts |
| DE3660719D1 (en) * | 1985-03-27 | 1988-10-20 | Hoechst Ag | Supported catalyst and procedure for the production of monocarboxylic acid anhydrides |
| GB9218346D0 (en) * | 1992-08-28 | 1992-10-14 | Bp Chem Int Ltd | Process |
| GB9503382D0 (en) * | 1995-02-21 | 1995-04-12 | Bp Chem Int Ltd | Process |
| GB9816385D0 (en) | 1998-07-29 | 1998-09-23 | Bp Chem Int Ltd | Process |
| DE10138778A1 (de) | 2001-08-07 | 2003-02-20 | Basf Ag | Flexibles Verfahren zur gemeinsamen Herstellung von Ameisensäure sowie einer Carbonsäure mit mindestens zwei Kohlenstoffatomen und/oder deren Derivaten |
| MY179688A (en) | 2013-12-24 | 2020-11-11 | Bp Plc | Process |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1939216A (en) | 1931-01-21 | 1933-12-12 | Monsanto Chemicals | Chemical treatment of organic acid halides |
| GB682174A (en) * | 1949-05-05 | 1952-11-05 | Hermann Teegen | Improvements in or relating to internal combustion engines for propelling pedal bicycles |
| DE921987C (de) * | 1952-06-12 | 1955-01-07 | Basf Ag | Verfahren zur Herstellung sauerstoffhaltiger organischer Verbindungen |
| DE1767151U (de) | 1958-03-03 | 1958-05-22 | Konrad Hellmich | Camping-kofferkochtisch. |
| SE364255B (enExample) * | 1967-04-05 | 1974-02-18 | Monsanto Co | |
| SE364254B (enExample) | 1967-04-05 | 1974-02-18 | Monsanto Co | |
| DE1966695U (de) | 1967-05-13 | 1967-08-17 | Karl Schwehr | Einschlaghilfsgeraet. |
| US3717670A (en) | 1968-08-02 | 1973-02-20 | Monsanto Co | Production of carboxylic acids and esters |
| US3579552A (en) | 1968-08-15 | 1971-05-18 | Monsanto Co | Production of carboxylic acids |
| US3579551A (en) | 1968-08-15 | 1971-05-18 | Monsanto Co | Production of carboxylic acids |
| US3845121A (en) | 1971-11-10 | 1974-10-29 | Monsanto Co | Process for separating carbonylation products from reaction mixture without catalyst decomposition |
| JPS5030820U (enExample) * | 1973-07-16 | 1975-04-05 | ||
| DE2450965C2 (de) | 1974-10-26 | 1983-06-09 | Hoechst Ag, 6230 Frankfurt | Verfahren zur Herstellung von Essigsäureanhydrid |
| DE3016900A1 (de) * | 1980-05-02 | 1981-11-05 | Hoechst Ag, 6000 Frankfurt | Verfahren zur herstellung von acetylchlorid |
| DE3248468A1 (de) * | 1982-12-29 | 1984-07-12 | Hoechst Ag, 6230 Frankfurt | Verfahren zur herstellung von carbonsaeurehalogeniden |
-
1974
- 1974-08-07 SE SE7410099A patent/SE413891B/xx not_active IP Right Cessation
- 1974-08-12 IL IL45453A patent/IL45453A/xx unknown
- 1974-08-26 BR BR7075/74A patent/BR7407075D0/pt unknown
- 1974-08-27 IT IT52756/74A patent/IT1019121B/it active
- 1974-08-27 RO RO7479863A patent/RO65730A/ro unknown
- 1974-08-27 NL NLAANVRAGE7411385,A patent/NL169580C/xx not_active IP Right Cessation
- 1974-08-27 EG EG368/74A patent/EG11306A/xx active
- 1974-08-29 HU HU74HA00000973A patent/HU171902B/hu unknown
- 1974-08-30 BG BG027597A patent/BG25203A3/xx unknown
- 1974-08-30 LU LU70831*A patent/LU70831A1/xx unknown
- 1974-08-30 CH CH1185674A patent/CH609321A5/xx not_active IP Right Cessation
- 1974-08-30 DE DE2462910A patent/DE2462910C2/de not_active Expired
- 1974-08-30 DE DE2441502A patent/DE2441502B2/de not_active Ceased
- 1974-08-30 PL PL1974198641A patent/PL105270B1/pl unknown
- 1974-08-30 DD DD180813A patent/DD113521A5/xx unknown
- 1974-08-30 DE DE2462444A patent/DE2462444B2/de not_active Withdrawn
- 1974-09-03 DK DK466674A patent/DK466674A/da not_active Application Discontinuation
- 1974-09-03 GB GB3851174A patent/GB1468940A/en not_active Expired
- 1974-09-03 NO NO743165A patent/NO147183C/no unknown
- 1974-09-03 FR FR7429944A patent/FR2242362B1/fr not_active Expired
- 1974-09-03 CA CA208,347A patent/CA1033761A/en not_active Expired
- 1974-09-04 JP JP10182674A patent/JPS5550932B2/ja not_active Expired
- 1974-09-04 ES ES429764A patent/ES429764A1/es not_active Expired
-
1976
- 1976-01-26 ES ES444609A patent/ES444609A1/es not_active Expired
- 1976-01-26 ES ES444608A patent/ES444608A1/es not_active Expired
-
1978
- 1978-03-08 CH CH253778A patent/CH614688A5/xx not_active IP Right Cessation
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL105270B1 (pl) | Sposob wytwarzania bezwodnikow kwasow jednokarboksylowych | |
| US5488143A (en) | Processes for the carbonylation of methanol to form acetic acid, methyl acetate and acetic anhydride | |
| US3772380A (en) | Production of carboxylic acids and esters | |
| US4301253A (en) | Process for the selective production of ethanol and methanol directly from synthesis gas | |
| US4374070A (en) | Preparation of acetic anhydride | |
| Yanji et al. | Synthesis of dimethyl carbonate by gas-phase oxidative carbonylation of methanol on the supported solid catalyst I. Catalyst preparation and catalytic properties | |
| US5625094A (en) | Rhodium/iridium catalyzed synthesis of carboxylic acids or esters thereof | |
| US4559183A (en) | Preparation of carboxylic acid anhydrides | |
| NZ203697A (en) | Production of ethanol from methanol and carbon monoxide | |
| US4659518A (en) | Preparation of carboxylic acids | |
| NO148712B (no) | Fremgangsmaate ved fremstilling av etylidendiacetat | |
| JPS6237025B2 (enExample) | ||
| GB1567360A (en) | Preparation of carboxylic acids | |
| EP0087869B1 (en) | Process for the coproduction of carboxylic acids and acid anhydrides | |
| US4335059A (en) | Preparation of carboxylic acid anhydrides | |
| US4251458A (en) | Process for preparing carboxylic acid anhydrides | |
| US4482497A (en) | Preparation of carboxylic acids | |
| US3876695A (en) | Production of adipic acid | |
| US4323697A (en) | Process for preparing ethylidene diacetate | |
| US4483804A (en) | Preparation of carboxylic acid anhydrides | |
| EP0077116B1 (en) | Preparation of alkylidene diesters | |
| US4698187A (en) | Preparation of carboxylic acid anhydrides | |
| US4625055A (en) | Preparation of carboxylic acids | |
| US3536739A (en) | Reaction of allyl derivatives with carbon monoxide and 1,3 - dienic olefins | |
| US4328362A (en) | Conversion of acetic anhydride to ethylidene diacetate |