PL104364B1 - Srodek do zwalczania drobnoustrojow - Google Patents
Srodek do zwalczania drobnoustrojow Download PDFInfo
- Publication number
- PL104364B1 PL104364B1 PL1976193058A PL19305876A PL104364B1 PL 104364 B1 PL104364 B1 PL 104364B1 PL 1976193058 A PL1976193058 A PL 1976193058A PL 19305876 A PL19305876 A PL 19305876A PL 104364 B1 PL104364 B1 PL 104364B1
- Authority
- PL
- Poland
- Prior art keywords
- formula
- disease
- control
- parts
- compound
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 20
- 239000000460 chlorine Substances 0.000 claims description 10
- 239000004480 active ingredient Substances 0.000 claims description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- 239000004599 antimicrobial Substances 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 201000010099 disease Diseases 0.000 description 23
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 23
- -1 iSphaerotheca fuligea Species 0.000 description 12
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 10
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 230000000855 fungicidal effect Effects 0.000 description 7
- 239000000417 fungicide Substances 0.000 description 7
- 150000003949 imides Chemical class 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- 240000008067 Cucumis sativus Species 0.000 description 6
- 239000000428 dust Substances 0.000 description 6
- 239000004495 emulsifiable concentrate Substances 0.000 description 6
- 238000002360 preparation method Methods 0.000 description 6
- 239000004563 wettable powder Substances 0.000 description 6
- 235000009849 Cucumis sativus Nutrition 0.000 description 5
- 241000196324 Embryophyta Species 0.000 description 5
- 241000233866 Fungi Species 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- 150000008064 anhydrides Chemical class 0.000 description 4
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 4
- 239000008187 granular material Substances 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 238000011282 treatment Methods 0.000 description 4
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000003085 diluting agent Substances 0.000 description 3
- 238000000921 elemental analysis Methods 0.000 description 3
- 238000003359 percent control normalization Methods 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 239000008096 xylene Substances 0.000 description 3
- UQRLKWGPEVNVHT-UHFFFAOYSA-N 3,5-dichloroaniline Chemical compound NC1=CC(Cl)=CC(Cl)=C1 UQRLKWGPEVNVHT-UHFFFAOYSA-N 0.000 description 2
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 2
- 229920001817 Agar Polymers 0.000 description 2
- 241000123650 Botrytis cinerea Species 0.000 description 2
- 241001133184 Colletotrichum agaves Species 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 240000006365 Vitis vinifera Species 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 239000008272 agar Substances 0.000 description 2
- 230000000845 anti-microbial effect Effects 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 239000004927 clay Substances 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- FDKLLWKMYAMLIF-UHFFFAOYSA-N cyclopropane-1,1-dicarboxylic acid Chemical compound OC(=O)C1(C(O)=O)CC1 FDKLLWKMYAMLIF-UHFFFAOYSA-N 0.000 description 2
- 238000010410 dusting Methods 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 208000015181 infectious disease Diseases 0.000 description 2
- 238000011081 inoculation Methods 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- IZUPBVBPLAPZRR-UHFFFAOYSA-N pentachlorophenol Chemical compound OC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl IZUPBVBPLAPZRR-UHFFFAOYSA-N 0.000 description 2
- 239000010452 phosphate Substances 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000001632 sodium acetate Substances 0.000 description 2
- 235000017281 sodium acetate Nutrition 0.000 description 2
- 239000002689 soil Substances 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- UCSJYZPVAKXKNQ-HZYVHMACSA-N streptomycin Chemical compound CN[C@H]1[C@H](O)[C@@H](O)[C@H](CO)O[C@H]1O[C@@H]1[C@](C=O)(O)[C@H](C)O[C@H]1O[C@@H]1[C@@H](NC(N)=N)[C@H](O)[C@@H](NC(N)=N)[C@H](O)[C@H]1O UCSJYZPVAKXKNQ-HZYVHMACSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- SDHXFKBMHSJXHA-UHFFFAOYSA-N 1-carbamoylcyclopropane-1-carboxylic acid Chemical compound NC(=O)C1(C(O)=O)CC1 SDHXFKBMHSJXHA-UHFFFAOYSA-N 0.000 description 1
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 description 1
- RVCKCEDKBVEEHL-UHFFFAOYSA-N 2,3,4,5,6-pentachlorobenzyl alcohol Chemical compound OCC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl RVCKCEDKBVEEHL-UHFFFAOYSA-N 0.000 description 1
- SVPKNMBRVBMTLB-UHFFFAOYSA-N 2,3-dichloronaphthalene-1,4-dione Chemical compound C1=CC=C2C(=O)C(Cl)=C(Cl)C(=O)C2=C1 SVPKNMBRVBMTLB-UHFFFAOYSA-N 0.000 description 1
- JMZRZEXRYJUHEB-UHFFFAOYSA-N 2-carbamothioylsulfanylethyl carbamodithioate;zinc Chemical compound [Zn].NC(=S)SCCSC(N)=S JMZRZEXRYJUHEB-UHFFFAOYSA-N 0.000 description 1
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 1
- RVNUUWJGSOHMRR-UHFFFAOYSA-N 3,5-dibromoaniline Chemical compound NC1=CC(Br)=CC(Br)=C1 RVNUUWJGSOHMRR-UHFFFAOYSA-N 0.000 description 1
- NUGSYKWYMDKABM-UHFFFAOYSA-N 3-(3,5-dichlorophenyl)pyrrolidine-2,5-dione Chemical compound Clc1cc(Cl)cc(c1)C1CC(=O)NC1=O NUGSYKWYMDKABM-UHFFFAOYSA-N 0.000 description 1
- GWYFCOCPABKNJV-UHFFFAOYSA-M 3-Methylbutanoic acid Natural products CC(C)CC([O-])=O GWYFCOCPABKNJV-UHFFFAOYSA-M 0.000 description 1
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 description 1
- GKOFFGQUWTYEDQ-UHFFFAOYSA-N 5-oxaspiro[2.3]hexane-4,6-dione Chemical compound O=C1OC(=O)C11CC1 GKOFFGQUWTYEDQ-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 1
- 241000251468 Actinopterygii Species 0.000 description 1
- 241000228245 Aspergillus niger Species 0.000 description 1
- 241001530056 Athelia rolfsii Species 0.000 description 1
- 241001465180 Botrytis Species 0.000 description 1
- WLILFGDBBMIGOP-UHFFFAOYSA-L CO[As]([O-])([O-])=O.[Fe+2] Chemical compound CO[As]([O-])([O-])=O.[Fe+2] WLILFGDBBMIGOP-UHFFFAOYSA-L 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 1
- 241000221955 Chaetomium Species 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 241000688200 Cingulata Species 0.000 description 1
- 241000222235 Colletotrichum orbiculare Species 0.000 description 1
- 241001529717 Corticium <basidiomycota> Species 0.000 description 1
- 235000010799 Cucumis sativus var sativus Nutrition 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- 206010061818 Disease progression Diseases 0.000 description 1
- 241000221778 Fusarium fujikuroi Species 0.000 description 1
- 241000223221 Fusarium oxysporum Species 0.000 description 1
- 241001620302 Glomerella <beetle> Species 0.000 description 1
- DYMNZCGFRHLNMT-UHFFFAOYSA-N Glyodin Chemical compound CC(O)=O.CCCCCCCCCCCCCCCCCC1=NCCN1 DYMNZCGFRHLNMT-UHFFFAOYSA-N 0.000 description 1
- 241000238631 Hexapoda Species 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 241001330975 Magnaporthe oryzae Species 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- 229930182764 Polyoxin Natural products 0.000 description 1
- 241001361634 Rhizoctonia Species 0.000 description 1
- 241000235546 Rhizopus stolonifer Species 0.000 description 1
- 241000221696 Sclerotinia sclerotiorum Species 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- 241001617088 Thanatephorus sasakii Species 0.000 description 1
- 241000082085 Verticillium <Phyllachorales> Species 0.000 description 1
- 241000219094 Vitaceae Species 0.000 description 1
- 235000014787 Vitis vinifera Nutrition 0.000 description 1
- 241000607479 Yersinia pestis Species 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 239000003905 agrochemical Substances 0.000 description 1
- JFCQEDHGNNZCLN-UHFFFAOYSA-N anhydrous glutaric acid Natural products OC(=O)CCCC(O)=O JFCQEDHGNNZCLN-UHFFFAOYSA-N 0.000 description 1
- JXLHNMVSKXFWAO-UHFFFAOYSA-N azane;7-fluoro-2,1,3-benzoxadiazole-4-sulfonic acid Chemical compound N.OS(=O)(=O)C1=CC=C(F)C2=NON=C12 JXLHNMVSKXFWAO-UHFFFAOYSA-N 0.000 description 1
- RIOXQFHNBCKOKP-UHFFFAOYSA-N benomyl Chemical compound C1=CC=C2N(C(=O)NCCCC)C(NC(=O)OC)=NC2=C1 RIOXQFHNBCKOKP-UHFFFAOYSA-N 0.000 description 1
- SLUNEGLMXGHOLY-UHFFFAOYSA-N benzene;hexane Chemical compound CCCCCC.C1=CC=CC=C1 SLUNEGLMXGHOLY-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- YMGUBTXCNDTFJI-UHFFFAOYSA-M cyclopropanecarboxylate Chemical compound [O-]C(=O)C1CC1 YMGUBTXCNDTFJI-UHFFFAOYSA-M 0.000 description 1
- 239000012024 dehydrating agents Substances 0.000 description 1
- BIXZHMJUSMUDOQ-UHFFFAOYSA-N dichloran Chemical compound NC1=C(Cl)C=C([N+]([O-])=O)C=C1Cl BIXZHMJUSMUDOQ-UHFFFAOYSA-N 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- FPAFDBFIGPHWGO-UHFFFAOYSA-N dioxosilane;oxomagnesium;hydrate Chemical compound O.[Mg]=O.[Mg]=O.[Mg]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O FPAFDBFIGPHWGO-UHFFFAOYSA-N 0.000 description 1
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 1
- 230000005750 disease progression Effects 0.000 description 1
- 229940075933 dithionate Drugs 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- LRMHFDNWKCSEQU-UHFFFAOYSA-N ethoxyethane;phenol Chemical compound CCOCC.OC1=CC=CC=C1 LRMHFDNWKCSEQU-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 230000002538 fungal effect Effects 0.000 description 1
- 235000021021 grapes Nutrition 0.000 description 1
- 230000009931 harmful effect Effects 0.000 description 1
- CKAPSXZOOQJIBF-UHFFFAOYSA-N hexachlorobenzene Chemical compound ClC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl CKAPSXZOOQJIBF-UHFFFAOYSA-N 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 230000000749 insecticidal effect Effects 0.000 description 1
- GWYFCOCPABKNJV-UHFFFAOYSA-N isovaleric acid Chemical compound CC(C)CC(O)=O GWYFCOCPABKNJV-UHFFFAOYSA-N 0.000 description 1
- PVTHJAPFENJVNC-MHRBZPPQSA-N kasugamycin Chemical compound N[C@H]1C[C@H](NC(=N)C(O)=O)[C@@H](C)O[C@@H]1O[C@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)[C@@H]1O PVTHJAPFENJVNC-MHRBZPPQSA-N 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 1
- 229940043265 methyl isobutyl ketone Drugs 0.000 description 1
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 1
- LVHBHZANLOWSRM-UHFFFAOYSA-N methylenebutanedioic acid Natural products OC(=O)CC(=C)C(O)=O LVHBHZANLOWSRM-UHFFFAOYSA-N 0.000 description 1
- 244000005700 microbiome Species 0.000 description 1
- PNMGPRJUKKTPSV-UHFFFAOYSA-N n-[(2,3,4,5,6-pentachlorophenyl)methylidene]hydroxylamine Chemical compound ON=CC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl PNMGPRJUKKTPSV-UHFFFAOYSA-N 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 1
- YEBIHIICWDDQOL-YBHNRIQQSA-N polyoxin Polymers O[C@@H]1[C@H](O)[C@@H](C(C=O)N)O[C@H]1N1C(=O)NC(=O)C(C(O)=O)=C1 YEBIHIICWDDQOL-YBHNRIQQSA-N 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- XOVSRHHCHKUFKM-UHFFFAOYSA-N s-methylthiohydroxylamine Chemical compound CSN XOVSRHHCHKUFKM-UHFFFAOYSA-N 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 229960005322 streptomycin Drugs 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- UGNWTBMOAKPKBL-UHFFFAOYSA-N tetrachloro-1,4-benzoquinone Chemical compound ClC1=C(Cl)C(=O)C(Cl)=C(Cl)C1=O UGNWTBMOAKPKBL-UHFFFAOYSA-N 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- RYYWUUFWQRZTIU-UHFFFAOYSA-K thiophosphate Chemical compound [O-]P([O-])([O-])=S RYYWUUFWQRZTIU-UHFFFAOYSA-K 0.000 description 1
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 1
- 238000002255 vaccination Methods 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/52—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring condensed with a ring other than six-membered
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Indole Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP50124670A JPS5247918A (en) | 1975-10-15 | 1975-10-15 | Non-medical fungicides and method of making the same |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL104364B1 true PL104364B1 (pl) | 1979-08-31 |
Family
ID=14891140
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1976193058A PL104364B1 (pl) | 1975-10-15 | 1976-10-15 | Srodek do zwalczania drobnoustrojow |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4082849A (enExample) |
| JP (1) | JPS5247918A (enExample) |
| BE (1) | BE847341A (enExample) |
| CH (1) | CH626342A5 (enExample) |
| DE (1) | DE2646188A1 (enExample) |
| DK (1) | DK461376A (enExample) |
| FR (1) | FR2327989A1 (enExample) |
| GB (1) | GB1521452A (enExample) |
| NL (1) | NL7611237A (enExample) |
| PL (1) | PL104364B1 (enExample) |
| SU (1) | SU661992A3 (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4183857A (en) * | 1978-07-06 | 1980-01-15 | Shell Oil Company | 3-Benzyl-3-azabicyclo(3.1.0)hexane-2,4-dione |
| US4225499A (en) * | 1978-07-06 | 1980-09-30 | Shell Oil Company | Process for preparing 3-azabicyclo(3.1.0)hexane-2-carbonitrile |
| CA1121355A (en) * | 1978-10-27 | 1982-04-06 | Ronald F. Mason | Pyrrolidine derivatives and process for the preparation of such compounds |
| ES2086857T3 (es) * | 1992-12-04 | 1996-07-01 | Mitsui Toatsu Chemicals | Derivados de 3-azabiciclo(3.1.0)hexano-2-ona y composiciones herbicidas que los contienen como ingredientes herbicidamente activos. |
| CN106470973B (zh) * | 2014-06-12 | 2020-08-04 | 阿罗赛特制药公司 | 小分子lfa-1抑制剂 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3166571A (en) * | 1962-06-06 | 1965-01-19 | American Cyanamid Co | 1-phenyl-1, 2-cyclopropane dicarboximides |
| US3344026A (en) * | 1966-05-16 | 1967-09-26 | American Cyanamid Co | Dosage unit composition of 1-(p-chlorophenyl)-1, 2-cyclopropanedicarboximide for relief of depression |
| US3549655A (en) * | 1967-12-21 | 1970-12-22 | Dow Chemical Co | N-(substituted phenyl) cyclobutanedicarboximides |
| US3745170A (en) * | 1969-03-19 | 1973-07-10 | Sumitomo Chemical Co | Novel n-(3,5-dihalophenyl)-imide compounds |
-
1975
- 1975-10-15 JP JP50124670A patent/JPS5247918A/ja active Granted
-
1976
- 1976-10-08 US US05/730,984 patent/US4082849A/en not_active Expired - Lifetime
- 1976-10-11 NL NL7611237A patent/NL7611237A/xx not_active Application Discontinuation
- 1976-10-13 GB GB42604/76A patent/GB1521452A/en not_active Expired
- 1976-10-13 DK DK461376A patent/DK461376A/da not_active Application Discontinuation
- 1976-10-13 CH CH1295376A patent/CH626342A5/de not_active IP Right Cessation
- 1976-10-13 SU SU762408803A patent/SU661992A3/ru active
- 1976-10-13 DE DE19762646188 patent/DE2646188A1/de not_active Withdrawn
- 1976-10-14 FR FR7630969A patent/FR2327989A1/fr active Granted
- 1976-10-15 PL PL1976193058A patent/PL104364B1/pl unknown
- 1976-10-15 BE BE171551A patent/BE847341A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DK461376A (da) | 1977-04-16 |
| JPS537500B2 (enExample) | 1978-03-18 |
| JPS5247918A (en) | 1977-04-16 |
| BE847341A (fr) | 1977-04-15 |
| NL7611237A (nl) | 1977-04-19 |
| SU661992A3 (ru) | 1979-05-05 |
| FR2327989A1 (fr) | 1977-05-13 |
| GB1521452A (en) | 1978-08-16 |
| DE2646188A1 (de) | 1977-04-28 |
| CH626342A5 (enExample) | 1981-11-13 |
| FR2327989B1 (enExample) | 1979-03-02 |
| US4082849A (en) | 1978-04-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL112140B1 (en) | Insecticide | |
| JPS6052146B2 (ja) | N−ピリジルアニリン系化合物、それらの製造方法及びそれらを含有する有害生物防除剤 | |
| PL78373B1 (en) | 3-(3{40 ,5{40 -dihalogenophenyl)imidazolidine-2,4-dione derivatives [us3668217a] | |
| GB1581124A (en) | Hydantoin n-methyl esters having pesticidal properties | |
| EP0190755B1 (en) | An n-substituted-phenylteraconimide compound, herbicidal composition, and method for the destruction of undesirable weeds | |
| PL104364B1 (pl) | Srodek do zwalczania drobnoustrojow | |
| US3414607A (en) | Novel cyclopropanecarboxylic acid esters | |
| US3725554A (en) | Benzimidazole compound, method of use, and compositions | |
| US4484942A (en) | N-Benzylphenylacetamide derivatives, and their production and use as herbicides | |
| KR100439078B1 (ko) | 살충화합물,이를함유하는조성물및이의제조방법 | |
| US4081267A (en) | Pyridyltriazinone herbicidal compositions | |
| EP0003430B1 (en) | Novel 2,6-dinitrobenzenamines, their preparation, composition containing them and their use as fungicides | |
| CA1077514A (en) | Derivatives of n-(2,2-dichlorovinyl) salicylamide and use thereof as bactericide, fungicide and algicide for industry | |
| CA1046061A (en) | Pyridyltriazinone compounds | |
| US4151290A (en) | Fungicidal 1-cycloalkylcarbonyl-3-(3,5-dihalophenyl)imidazolidine-2,4-diones | |
| US5070211A (en) | Dioxo heterocyclic compounds, composition containing same and process for plant growth regulation using same | |
| US4055640A (en) | Compositions and methods for controlling the growth of bacteria, fungi and algae using certain derivatives of N-(2,2-dichlorovinyl)salicylamides | |
| US3356486A (en) | Benzene hexachloride as a preemergence herbicide | |
| EP0061713B1 (en) | Cyclopropanecarboxylic acid esters, their production and insecticidal and acaricidal compositions containing them | |
| US5131940A (en) | Dioxo heterocyclic compounds, composition containing same and process for plant growth regulation using same | |
| PL100076B1 (pl) | Srodek grzybobojczy | |
| JPS611665A (ja) | ピリジルヒドラジン系化合物及びそれらを含有する有害生物防除剤 | |
| US3591605A (en) | Thiophene derivatives | |
| US4798618A (en) | Novel chloroacetanilide derivatives and herbicides containing the same for use in paddy field | |
| JP2567251B2 (ja) | テトラヒドロフタルイミド誘導体 |