PL100318B1 - Sposob wytwarzania nowych pochodnych indolopirydonaftyrydyny - Google Patents
Sposob wytwarzania nowych pochodnych indolopirydonaftyrydyny Download PDFInfo
- Publication number
- PL100318B1 PL100318B1 PL1975183607A PL18360775A PL100318B1 PL 100318 B1 PL100318 B1 PL 100318B1 PL 1975183607 A PL1975183607 A PL 1975183607A PL 18360775 A PL18360775 A PL 18360775A PL 100318 B1 PL100318 B1 PL 100318B1
- Authority
- PL
- Poland
- Prior art keywords
- compound
- formula
- general formula
- acid
- optionally
- Prior art date
Links
- 238000004519 manufacturing process Methods 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims description 44
- 238000000034 method Methods 0.000 claims description 35
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 30
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 claims description 27
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 claims description 27
- 239000002253 acid Substances 0.000 claims description 19
- VLTRZXGMWDSKGL-UHFFFAOYSA-M perchlorate Inorganic materials [O-]Cl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-M 0.000 claims description 18
- 238000006243 chemical reaction Methods 0.000 claims description 17
- -1 sodium hydroxide Chemical class 0.000 claims description 16
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 15
- 239000002585 base Substances 0.000 claims description 15
- 150000003839 salts Chemical class 0.000 claims description 13
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 10
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 7
- 229910052740 iodine Inorganic materials 0.000 claims description 7
- 239000003960 organic solvent Substances 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 150000001450 anions Chemical class 0.000 claims description 6
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 5
- VKTOXAGUZWAECL-RBUKOAKNSA-N eburnamenine Chemical class C1=CC=C2C(CCN3CCC4)=C5[C@H]3[C@@]4(CC)C=CN5C2=C1 VKTOXAGUZWAECL-RBUKOAKNSA-N 0.000 claims description 5
- 239000007864 aqueous solution Substances 0.000 claims description 4
- 125000004185 ester group Chemical group 0.000 claims description 4
- 150000008282 halocarbons Chemical class 0.000 claims description 4
- 230000007062 hydrolysis Effects 0.000 claims description 4
- 238000006460 hydrolysis reaction Methods 0.000 claims description 4
- 150000007529 inorganic bases Chemical class 0.000 claims description 4
- QQGHTKYBEOMIFE-UHFFFAOYSA-N N1=C2C=CC=CC2=C2C1=CC1=NC3=NC=CC=C3CC1=N2 Chemical compound N1=C2C=CC=CC2=C2C1=CC1=NC3=NC=CC=C3CC1=N2 QQGHTKYBEOMIFE-UHFFFAOYSA-N 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 claims description 2
- 150000002148 esters Chemical group 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims 2
- 239000012429 reaction media Substances 0.000 claims 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims 2
- 239000012442 inert solvent Substances 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 33
- 239000000243 solution Substances 0.000 description 23
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 16
- 239000000126 substance Substances 0.000 description 15
- 239000000203 mixture Substances 0.000 description 11
- 239000011541 reaction mixture Substances 0.000 description 11
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 10
- 239000000725 suspension Substances 0.000 description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- 229910052786 argon Inorganic materials 0.000 description 8
- 101100328518 Caenorhabditis elegans cnt-1 gene Proteins 0.000 description 7
- 229910052799 carbon Inorganic materials 0.000 description 6
- 229910052739 hydrogen Inorganic materials 0.000 description 6
- 229910052757 nitrogen Inorganic materials 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 238000002329 infrared spectrum Methods 0.000 description 5
- 239000012074 organic phase Substances 0.000 description 5
- 239000008188 pellet Substances 0.000 description 5
- 229910000027 potassium carbonate Inorganic materials 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- 239000013078 crystal Substances 0.000 description 4
- 239000012153 distilled water Substances 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 229910052736 halogen Inorganic materials 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 239000002274 desiccant Substances 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 150000002367 halogens Chemical group 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 239000003208 petroleum Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 239000000758 substrate Substances 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- 102100030550 Menin Human genes 0.000 description 2
- 101710169972 Menin Proteins 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 2
- 239000011261 inert gas Substances 0.000 description 2
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 2
- 150000004702 methyl esters Chemical class 0.000 description 2
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 230000001225 therapeutic effect Effects 0.000 description 2
- APJYDQYYACXCRM-UHFFFAOYSA-N tryptamine Chemical compound C1=CC=C2C(CCN)=CNC2=C1 APJYDQYYACXCRM-UHFFFAOYSA-N 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- SXJRKBCWIMZFHC-UHFFFAOYSA-N 2-(3-bromopropyl)propanedioic acid Chemical compound OC(=O)C(C(O)=O)CCCBr SXJRKBCWIMZFHC-UHFFFAOYSA-N 0.000 description 1
- HMENQNSSJFLQOP-UHFFFAOYSA-N 2-bromoprop-2-enoic acid Chemical compound OC(=O)C(Br)=C HMENQNSSJFLQOP-UHFFFAOYSA-N 0.000 description 1
- OYUNTGBISCIYPW-UHFFFAOYSA-N 2-chloroprop-2-enenitrile Chemical compound ClC(=C)C#N OYUNTGBISCIYPW-UHFFFAOYSA-N 0.000 description 1
- VGUWZCUCNQXGBU-UHFFFAOYSA-N 3-[(4-methylpiperazin-1-yl)methyl]-5-nitro-1h-indole Chemical compound C1CN(C)CCN1CC1=CNC2=CC=C([N+]([O-])=O)C=C12 VGUWZCUCNQXGBU-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 239000004677 Nylon Substances 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 1
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 1
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 238000006114 decarboxylation reaction Methods 0.000 description 1
- RCJVRSBWZCNNQT-UHFFFAOYSA-N dichloridooxygen Chemical compound ClOCl RCJVRSBWZCNNQT-UHFFFAOYSA-N 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- UCDOJQCUOURTPS-UHFFFAOYSA-N ethyl 2-bromoprop-2-enoate Chemical compound CCOC(=O)C(Br)=C UCDOJQCUOURTPS-UHFFFAOYSA-N 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 229910052738 indium Inorganic materials 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 125000005929 isobutyloxycarbonyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])OC(*)=O 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229910000000 metal hydroxide Inorganic materials 0.000 description 1
- 150000004692 metal hydroxides Chemical class 0.000 description 1
- ZXRXCAZCLFGQFZ-UHFFFAOYSA-N methyl 5-bromo-2-ethylpentanoate Chemical compound COC(=O)C(CC)CCCBr ZXRXCAZCLFGQFZ-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 125000002950 monocyclic group Chemical group 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000005487 naphthalate group Chemical group 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 229920001778 nylon Polymers 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- LLYCMZGLHLKPPU-UHFFFAOYSA-N perbromic acid Chemical class OBr(=O)(=O)=O LLYCMZGLHLKPPU-UHFFFAOYSA-N 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 125000003367 polycyclic group Chemical group 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000007790 scraping Methods 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D461/00—Heterocyclic compounds containing indolo [3,2,1-d,e] pyrido [3,2,1,j] [1,5]-naphthyridine ring systems, e.g. vincamine
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HU74RI00000546A HU170886B (hu) | 1974-09-27 | 1974-09-27 | Sposob poluchenija proizvodnykh eburnamenina |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL100318B1 true PL100318B1 (pl) | 1978-09-30 |
Family
ID=11000957
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1975183607A PL100318B1 (pl) | 1974-09-27 | 1975-09-26 | Sposob wytwarzania nowych pochodnych indolopirydonaftyrydyny |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US4054571A (enExample) |
| JP (1) | JPS5951551B2 (enExample) |
| AT (1) | AT347049B (enExample) |
| AU (1) | AU497266B2 (enExample) |
| BE (1) | BE833526A (enExample) |
| BG (1) | BG30775A3 (enExample) |
| CA (1) | CA1066705A (enExample) |
| CS (1) | CS189721B2 (enExample) |
| DD (1) | DD122822A5 (enExample) |
| DE (1) | DE2539866C2 (enExample) |
| DK (1) | DK139681B (enExample) |
| FR (1) | FR2285878A1 (enExample) |
| GB (1) | GB1514306A (enExample) |
| HU (1) | HU170886B (enExample) |
| IL (1) | IL48029A (enExample) |
| NL (1) | NL7511182A (enExample) |
| PL (1) | PL100318B1 (enExample) |
| SE (1) | SE424327B (enExample) |
| SU (1) | SU582765A3 (enExample) |
| YU (1) | YU241275A (enExample) |
-
1974
- 1974-09-27 HU HU74RI00000546A patent/HU170886B/hu unknown
-
1975
- 1975-09-01 AU AU84443/75A patent/AU497266B2/en not_active Expired
- 1975-09-02 IL IL48029A patent/IL48029A/xx unknown
- 1975-09-08 DE DE2539866A patent/DE2539866C2/de not_active Expired
- 1975-09-10 AT AT696675A patent/AT347049B/de not_active IP Right Cessation
- 1975-09-11 CA CA235,273A patent/CA1066705A/en not_active Expired
- 1975-09-17 BE BE160135A patent/BE833526A/xx not_active IP Right Cessation
- 1975-09-17 US US05/614,151 patent/US4054571A/en not_active Expired - Lifetime
- 1975-09-22 DD DD188476A patent/DD122822A5/xx unknown
- 1975-09-23 FR FR7529074A patent/FR2285878A1/fr active Granted
- 1975-09-23 NL NL7511182A patent/NL7511182A/xx not_active Application Discontinuation
- 1975-09-24 SU SU7502175252A patent/SU582765A3/ru active
- 1975-09-25 SE SE7510786A patent/SE424327B/xx not_active IP Right Cessation
- 1975-09-25 BG BG031069A patent/BG30775A3/xx unknown
- 1975-09-25 YU YU02412/75A patent/YU241275A/xx unknown
- 1975-09-26 JP JP50117086A patent/JPS5951551B2/ja not_active Expired
- 1975-09-26 DK DK432975AA patent/DK139681B/da unknown
- 1975-09-26 PL PL1975183607A patent/PL100318B1/pl unknown
- 1975-09-26 GB GB39506/75A patent/GB1514306A/en not_active Expired
- 1975-09-26 CS CS756525A patent/CS189721B2/cs unknown
Also Published As
| Publication number | Publication date |
|---|---|
| US4054571A (en) | 1977-10-18 |
| AU8444375A (en) | 1977-03-10 |
| SE7510786L (sv) | 1976-03-29 |
| SU582765A3 (ru) | 1977-11-30 |
| DK139681B (da) | 1979-03-26 |
| BE833526A (fr) | 1976-01-16 |
| JPS5951551B2 (ja) | 1984-12-14 |
| HU170886B (hu) | 1977-09-28 |
| DD122822A5 (enExample) | 1976-11-05 |
| IL48029A (en) | 1980-09-16 |
| NL7511182A (nl) | 1976-03-30 |
| AT347049B (de) | 1978-12-11 |
| GB1514306A (en) | 1978-06-14 |
| JPS5159899A (enExample) | 1976-05-25 |
| AU497266B2 (en) | 1978-12-07 |
| CS189721B2 (en) | 1979-04-30 |
| ATA696675A (de) | 1978-04-15 |
| FR2285878A1 (fr) | 1976-04-23 |
| DE2539866A1 (de) | 1976-04-22 |
| CA1066705A (en) | 1979-11-20 |
| FR2285878B1 (enExample) | 1978-11-17 |
| DK139681C (enExample) | 1979-10-01 |
| DK432975A (enExample) | 1976-03-28 |
| IL48029A0 (en) | 1975-11-25 |
| DE2539866C2 (de) | 1983-07-14 |
| SE424327B (sv) | 1982-07-12 |
| BG30775A3 (en) | 1981-08-14 |
| YU241275A (en) | 1982-06-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPH0236595B2 (enExample) | ||
| PL196216B1 (pl) | Sposób wytwarzania 5-podstawionych związków pirolo[2,3-d]pirymidyny | |
| PL181219B1 (pl) | Sposób wytwarzania pochodnych puryny | |
| AU2016380892A1 (en) | Process for preparing 1,1,3-trioxo-1,2-benzothiazole-6-carboxamide | |
| PL100318B1 (pl) | Sposob wytwarzania nowych pochodnych indolopirydonaftyrydyny | |
| US2701252A (en) | Isoindolenine compounds | |
| US5650514A (en) | 3-substituted quinoline-5-carboxylic acid derivatives and processes for their preparation | |
| JPS6087251A (ja) | 置換ベンズアミド誘導体の製造法 | |
| JPS6254112B2 (enExample) | ||
| JPS585199B2 (ja) | 置換ペニシリン類の製造方法 | |
| US4929730A (en) | Bis(1,2,5)thiadiazolo(3,4-b:3',4'-E) pyrazine, a process for the preparation thereof and a method of using same | |
| JPS6242989A (ja) | 溶接電極の自動整形および交換装置 | |
| JPH0759564B2 (ja) | 5−アミノ−1h−ピラゾ−ル系化合物 | |
| PL165452B1 (pl) | Sposób wytwarzania nowej soli chinoliniowej PL PL PL | |
| Neilands et al. | Tosyiate of ethyl 3-amino-2-phenyliodoniocrotonate: Synthesis, crystal structure, and synthesis of heterocyclic compounds based on it | |
| SU619106A3 (ru) | Способ получени производных 1,2,3,4,6,7-гексагидроиндол (2,3-а) хинолизина или их солей | |
| US3555046A (en) | Plicatin tetra-acetate and process for its production | |
| JPS63280084A (ja) | 1−アルキル−3−カルボキシ−4−シンノロン類の製造方法 | |
| SU240565A1 (ru) | Способ получения пенициллина | |
| KR860001087B1 (ko) | 7-아미노-3-(5-메틸-1,3,4-티아디아졸-2-일) 티오메틸-3-세펨-4-카르복실산의 제조방법 | |
| JP3711625B2 (ja) | 1H−ピラゾロ[3,2−c]−1,2,4−トリアゾール系化合物の製造方法 | |
| US4016352A (en) | 2,3-O-sulfinyl-cytidine-5-phosphate | |
| SU1203089A1 (ru) | Способ получени @ -алкил-2-ацетонилиден-1,2-дигидрохинолинов | |
| JPH0556350B2 (enExample) | ||
| JPS5951534B2 (ja) | 2−アミノ−3−ヒドロキシピリジン誘導体の製造法 |