PH16594A - Ergoline derivatives - Google Patents
Ergoline derivativesInfo
- Publication number
- PH16594A PH16594A PH17392A PH17392A PH16594A PH 16594 A PH16594 A PH 16594A PH 17392 A PH17392 A PH 17392A PH 17392 A PH17392 A PH 17392A PH 16594 A PH16594 A PH 16594A
- Authority
- PH
- Philippines
- Prior art keywords
- ergoline derivatives
- ergoline
- derivatives
- Prior art date
Links
- AWFDCTXCTHGORH-HGHGUNKESA-N 6-[4-[(6ar,9r,10ar)-5-bromo-7-methyl-6,6a,8,9,10,10a-hexahydro-4h-indolo[4,3-fg]quinoline-9-carbonyl]piperazin-1-yl]-1-methylpyridin-2-one Chemical class O=C([C@H]1CN([C@H]2[C@@H](C=3C=CC=C4NC(Br)=C(C=34)C2)C1)C)N(CC1)CCN1C1=CC=CC(=O)N1C AWFDCTXCTHGORH-HGHGUNKESA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D457/00—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid
- C07D457/04—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 8
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D457/00—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid
- C07D457/02—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid with hydrocarbon or substituted hydrocarbon radicals, attached in position 8
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D457/00—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid
- C07D457/10—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid with hetero atoms directly attached in position 8
- C07D457/12—Nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH998374A CH605936A5 (en) | 1974-07-19 | 1974-07-19 | 8-Alpha-(Amino-or cyanomethyl)-ergoline derivs |
| CH1103174A CH605938A5 (en) | 1974-08-13 | 1974-08-13 | 8-Alpha-(Amino-or cyanomethyl)-ergoline derivs |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PH16594A true PH16594A (en) | 1983-11-22 |
Family
ID=25705648
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PH17392A PH16594A (en) | 1974-07-19 | 1975-07-17 | Ergoline derivatives |
Country Status (17)
| Country | Link |
|---|---|
| JP (1) | JPS5134199A (index.php) |
| AU (1) | AU505314B2 (index.php) |
| CA (1) | CA1073452A (index.php) |
| DD (1) | DD118635A5 (index.php) |
| DE (1) | DE2530577A1 (index.php) |
| DK (2) | DK143902C (index.php) |
| ES (1) | ES439548A1 (index.php) |
| FI (1) | FI61188C (index.php) |
| FR (1) | FR2282889A1 (index.php) |
| GB (3) | GB1517972A (index.php) |
| HK (2) | HK56980A (index.php) |
| IE (1) | IE41426B1 (index.php) |
| IL (1) | IL47735A (index.php) |
| MY (2) | MY8100215A (index.php) |
| NL (1) | NL7508416A (index.php) |
| NO (1) | NO752493L (index.php) |
| PH (1) | PH16594A (index.php) |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1573621A (en) * | 1976-01-02 | 1980-08-28 | Sandoz Ltd | Acylated 6-methyl-8a-amino-ergoline i compounds |
| DE2656344A1 (de) * | 1975-12-23 | 1977-07-07 | Sandoz Ag | Ergolinderivate, ihre verwendung und herstellung |
| IT1064473B (it) * | 1976-11-24 | 1985-02-18 | Simes | Sulfamoil derivati dell'8-beta-amminometilergolina |
| WO1982000463A1 (en) * | 1980-07-25 | 1982-02-18 | Ag Sandoz | Ergoline derivatives,method for their preparation,pharmaceutical compositions containing them and their therapeutic application |
| BE889713A (fr) * | 1980-07-25 | 1982-01-25 | Sandoz Sa | Nouveaux derives de l'ergoline, leur preparation et leur application comme medicaments |
| CH644606A5 (de) * | 1980-09-23 | 1984-08-15 | Sandoz Ag | Verfahren zur isomerisierung von 9,10-dihydrolysergsaeurederivaten. |
| DE3101535A1 (de) * | 1981-01-14 | 1982-08-12 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | Neue (2-halogen-ergolinyl)-n'.n'-diethyl-harnstoffderivate, verfahren zu ihrer herstellung und deren verwendung als arzneimittel |
| JPS58174081A (ja) * | 1982-04-05 | 1983-10-13 | Mitsubishi Heavy Ind Ltd | 船内機関室通風装置 |
| NL193541C (nl) * | 1984-01-12 | 2000-01-04 | Novartis Ag | 8 Alfa-acylaminoergolinen, werkwijzen voor de bereiding daarvan en preparaten die ze bevatten. |
| HU195810B (en) * | 1984-12-24 | 1988-07-28 | Sandoz Ag | Process for preparing new 8alpha-acyl-amino-ergoline derivatives and pharmaceutical compositions containing such compounds |
| HUT45248A (en) * | 1986-01-24 | 1988-06-28 | Sandoz Ag | Process for producing 8alpha-(acylamino)-ergoline derivatives and pharmaceuticals comprising such compounds |
| AT392945B (de) * | 1988-06-27 | 1991-07-10 | Gerhard Mader Ges M B H Ing | Lager- und transportbehaelter fuer schuettgueter und lose materialien |
| DE4033496A1 (de) * | 1990-10-20 | 1992-04-23 | Sandoz Ag | Neue ergolinderivate, ihre herstellung und verwendung |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3218323A (en) * | 1965-11-16 | Esters of i,g-dimethyl-b-ergolenyl carbamic acid | ||
| FR1360618A (fr) * | 1963-06-17 | 1964-05-08 | Sandoz Sa | Nouveaux uréthanes de la série lysergique et leur préparation |
| BE712054A (index.php) * | 1967-03-16 | 1968-07-15 | ||
| NL6818658A (index.php) * | 1968-01-18 | 1969-07-22 | ||
| AR206772A1 (es) * | 1972-07-21 | 1976-08-23 | Lilly Co Eli | Procedimiento para preparar una nueva d-2-halo-6-metil-8-ciano(carboxamido)metil ergolina |
-
1975
- 1975-07-04 GB GB4648/78A patent/GB1517972A/en not_active Expired
- 1975-07-04 GB GB4649/78A patent/GB1517973A/en not_active Expired
- 1975-07-04 GB GB28238/75A patent/GB1517971A/en not_active Expired
- 1975-07-09 DE DE19752530577 patent/DE2530577A1/de active Granted
- 1975-07-10 FI FI752011A patent/FI61188C/fi not_active IP Right Cessation
- 1975-07-11 NO NO752493A patent/NO752493L/no unknown
- 1975-07-12 DK DK313175A patent/DK143902C/da not_active IP Right Cessation
- 1975-07-15 NL NL7508416A patent/NL7508416A/xx not_active Application Discontinuation
- 1975-07-16 DD DD187329A patent/DD118635A5/xx unknown
- 1975-07-17 PH PH17392A patent/PH16594A/en unknown
- 1975-07-17 AU AU83162/75A patent/AU505314B2/en not_active Expired
- 1975-07-17 ES ES439548A patent/ES439548A1/es not_active Expired
- 1975-07-17 IE IE1596/75A patent/IE41426B1/en unknown
- 1975-07-18 CA CA231,773A patent/CA1073452A/en not_active Expired
- 1975-07-18 IL IL47735A patent/IL47735A/xx unknown
- 1975-07-18 JP JP50087425A patent/JPS5134199A/ja active Pending
- 1975-07-18 FR FR7522484A patent/FR2282889A1/fr active Granted
-
1980
- 1980-07-10 DK DK298980A patent/DK145542C/da not_active IP Right Cessation
- 1980-10-09 HK HK569/80A patent/HK56980A/xx unknown
- 1980-10-09 HK HK568/80A patent/HK56880A/xx unknown
-
1981
- 1981-12-30 MY MY215/81A patent/MY8100215A/xx unknown
- 1981-12-30 MY MY217/81A patent/MY8100217A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DK145542B (da) | 1982-12-06 |
| HK56880A (en) | 1980-10-16 |
| AU8316275A (en) | 1977-01-20 |
| FI61188C (fi) | 1982-06-10 |
| DD118635A5 (index.php) | 1976-03-12 |
| IE41426L (en) | 1976-01-19 |
| DK145542C (da) | 1983-05-02 |
| DK298980A (da) | 1980-07-10 |
| IL47735A (en) | 1979-11-30 |
| DK313175A (da) | 1976-01-20 |
| IE41426B1 (en) | 1980-01-02 |
| FI61188B (fi) | 1982-02-26 |
| HK56980A (en) | 1980-10-16 |
| FR2282889A1 (fr) | 1976-03-26 |
| IL47735A0 (en) | 1975-10-15 |
| DK143902B (da) | 1981-10-26 |
| CA1073452A (en) | 1980-03-11 |
| AU505314B2 (en) | 1979-11-15 |
| DK143902C (da) | 1982-04-13 |
| DE2530577C2 (index.php) | 1990-11-08 |
| MY8100217A (en) | 1981-12-31 |
| DE2530577A1 (de) | 1976-01-29 |
| GB1517971A (en) | 1978-07-19 |
| GB1517972A (en) | 1978-07-19 |
| GB1517973A (en) | 1978-07-19 |
| JPS5134199A (index.php) | 1976-03-23 |
| NO752493L (index.php) | 1976-01-20 |
| NL7508416A (nl) | 1976-01-21 |
| FI752011A7 (index.php) | 1976-01-20 |
| ES439548A1 (es) | 1977-06-16 |
| MY8100215A (en) | 1981-12-31 |
| FR2282889B1 (index.php) | 1979-08-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PH11652A (en) | Arloxphenylpropylamines derivatives | |
| IL48592A0 (en) | Novel 1-substituted-4-benzylpiperidine derivatives | |
| IL48593A0 (en) | Novel 1-substituted-4-benzylidenepiperidine derivatives | |
| ZA753968B (en) | Novel benzimidazolinone derivatives | |
| IL46341A0 (en) | Alpha-aryl-4-substituted piperidinoalkanol derivatives | |
| PH12312A (en) | Thienothiazine derivatives | |
| GB1519811A (en) | Thienothaiazine derivatives | |
| AU1038176A (en) | 4-arylpiperidine derivatives | |
| ZA757828B (en) | 2-methoxy-benzamide derivatives | |
| PH16594A (en) | Ergoline derivatives | |
| GB1484049A (en) | 3-alkoxy-pyrazine-2-carboxamide derivatives | |
| AU7921975A (en) | Hexahydro-alpha-carboline derivatives | |
| GB1521320A (en) | Quinolisidine derivatives | |
| GB1535214A (en) | Ergoline derivatives | |
| ZA753315B (en) | Oxacyclohexane derivatives | |
| PH12265A (en) | Benzo-bicyclononene derivatives | |
| IL48573A (en) | 6-methyl-8-(substituted-methyl)ergoline derivatives | |
| ZA755543B (en) | Thiomethylcephem derivatives | |
| ZA753299B (en) | Amidino-hydrazone derivatives | |
| IL48409A0 (en) | Phenyl-pyridylamine derivatives | |
| AU8332175A (en) | New hydroxyphenyl-butazone derivatives | |
| AU8011475A (en) | Ergoline derivatives | |
| GB1486646A (en) | Thieno-pyridine derivatives | |
| JPS51115457A (en) | 166methyll9 alphaa halosteroid derivatives | |
| HK28879A (en) | 2-aminomethylphenol derivatives |