NO843975L - Enzyminhibitorer - Google Patents
EnzyminhibitorerInfo
- Publication number
- NO843975L NO843975L NO843975A NO843975A NO843975L NO 843975 L NO843975 L NO 843975L NO 843975 A NO843975 A NO 843975A NO 843975 A NO843975 A NO 843975A NO 843975 L NO843975 L NO 843975L
- Authority
- NO
- Norway
- Prior art keywords
- compounds
- stated
- aminoacyl
- iii
- group
- Prior art date
Links
- 239000002532 enzyme inhibitor Substances 0.000 title description 4
- 150000001875 compounds Chemical class 0.000 claims description 124
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 30
- 108090000765 processed proteins & peptides Proteins 0.000 claims description 29
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 24
- 108090000783 Renin Proteins 0.000 claims description 23
- 102100028255 Renin Human genes 0.000 claims description 23
- 125000000217 alkyl group Chemical group 0.000 claims description 20
- -1 cyclohexylalanyl Chemical group 0.000 claims description 20
- 229910052757 nitrogen Inorganic materials 0.000 claims description 16
- 125000000266 alpha-aminoacyl group Chemical group 0.000 claims description 15
- 150000001413 amino acids Chemical class 0.000 claims description 14
- 125000003118 aryl group Chemical group 0.000 claims description 14
- 206010020772 Hypertension Diseases 0.000 claims description 13
- 108010016626 Dipeptides Proteins 0.000 claims description 12
- 229930194542 Keto Natural products 0.000 claims description 11
- 125000000468 ketone group Chemical group 0.000 claims description 10
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 9
- 150000002148 esters Chemical group 0.000 claims description 8
- 150000002430 hydrocarbons Chemical class 0.000 claims description 8
- 239000004215 Carbon black (E152) Substances 0.000 claims description 7
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 7
- 239000002253 acid Substances 0.000 claims description 7
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 7
- 229930195733 hydrocarbon Natural products 0.000 claims description 7
- 230000002401 inhibitory effect Effects 0.000 claims description 7
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 7
- 230000007704 transition Effects 0.000 claims description 7
- 229940121710 HMGCoA reductase inhibitor Drugs 0.000 claims description 6
- 229910052799 carbon Inorganic materials 0.000 claims description 6
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 6
- 150000003839 salts Chemical group 0.000 claims description 6
- ONIBWKKTOPOVIA-BYPYZUCNSA-N L-Proline Chemical compound OC(=O)[C@@H]1CCCN1 ONIBWKKTOPOVIA-BYPYZUCNSA-N 0.000 claims description 5
- 150000001408 amides Chemical group 0.000 claims description 5
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 4
- 125000002252 acyl group Chemical group 0.000 claims description 4
- 125000001033 ether group Chemical group 0.000 claims description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- 125000006239 protecting group Chemical group 0.000 claims description 4
- 125000001424 substituent group Chemical group 0.000 claims description 4
- 238000011282 treatment Methods 0.000 claims description 4
- YQTCQNIPQMJNTI-UHFFFAOYSA-N 2,2-dimethylpropan-1-one Chemical group CC(C)(C)[C]=O YQTCQNIPQMJNTI-UHFFFAOYSA-N 0.000 claims description 3
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 claims description 3
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 3
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 3
- DTGKSKDOIYIVQL-WEDXCCLWSA-N (+)-borneol Chemical group C1C[C@@]2(C)[C@@H](O)C[C@@H]1C2(C)C DTGKSKDOIYIVQL-WEDXCCLWSA-N 0.000 claims description 2
- QRZMXADUXZADTF-UHFFFAOYSA-N 4-aminoimidazole Chemical compound NC1=CNC=N1 QRZMXADUXZADTF-UHFFFAOYSA-N 0.000 claims description 2
- 239000004475 Arginine Substances 0.000 claims description 2
- MTCFGRXMJLQNBG-UWTATZPHSA-N D-Serine Chemical compound OC[C@@H](N)C(O)=O MTCFGRXMJLQNBG-UWTATZPHSA-N 0.000 claims description 2
- 229930195711 D-Serine Natural products 0.000 claims description 2
- KDXKERNSBIXSRK-RXMQYKEDSA-N D-lysine Chemical compound NCCCC[C@@H](N)C(O)=O KDXKERNSBIXSRK-RXMQYKEDSA-N 0.000 claims description 2
- OUYCCCASQSFEME-MRVPVSSYSA-N D-tyrosine Chemical compound OC(=O)[C@H](N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-MRVPVSSYSA-N 0.000 claims description 2
- KZSNJWFQEVHDMF-BYPYZUCNSA-N L-valine Chemical compound CC(C)[C@H](N)C(O)=O KZSNJWFQEVHDMF-BYPYZUCNSA-N 0.000 claims description 2
- 125000005073 adamantyl group Chemical group C12(CC3CC(CC(C1)C3)C2)* 0.000 claims description 2
- 150000001414 amino alcohols Chemical group 0.000 claims description 2
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 2
- 125000004391 aryl sulfonyl group Chemical group 0.000 claims description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 claims description 2
- 150000001602 bicycloalkyls Chemical group 0.000 claims description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 2
- 125000004210 cyclohexylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 2
- 238000002405 diagnostic procedure Methods 0.000 claims description 2
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims description 2
- 125000005842 heteroatom Chemical group 0.000 claims description 2
- 125000000623 heterocyclic group Chemical group 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 125000000814 indol-3-yl group Chemical group [H]C1=C([H])C([H])=C2N([H])C([H])=C([*])C2=C1[H] 0.000 claims description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 claims description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 2
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 claims description 2
- 125000001433 C-terminal amino-acid group Chemical group 0.000 claims 1
- 101100367084 Caenorhabditis elegans such-1 gene Proteins 0.000 claims 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 1
- 239000001257 hydrogen Substances 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 36
- 238000003786 synthesis reaction Methods 0.000 description 18
- 239000000243 solution Substances 0.000 description 16
- 230000015572 biosynthetic process Effects 0.000 description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 15
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 14
- 238000000034 method Methods 0.000 description 14
- 239000000203 mixture Substances 0.000 description 14
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 12
- 230000000694 effects Effects 0.000 description 12
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 11
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 10
- 239000012267 brine Substances 0.000 description 10
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 10
- 229940024606 amino acid Drugs 0.000 description 9
- 102400000344 Angiotensin-1 Human genes 0.000 description 8
- 101800000734 Angiotensin-1 Proteins 0.000 description 8
- ORWYRWWVDCYOMK-HBZPZAIKSA-N angiotensin I Chemical compound C([C@@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N[C@@H](CC(C)C)C(O)=O)NC(=O)[C@@H](NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H](N)CC(O)=O)C(C)C)C1=CC=C(O)C=C1 ORWYRWWVDCYOMK-HBZPZAIKSA-N 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 8
- 239000011541 reaction mixture Substances 0.000 description 8
- 239000000758 substrate Substances 0.000 description 8
- 210000004899 c-terminal region Anatomy 0.000 description 7
- 238000001727 in vivo Methods 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- 238000010561 standard procedure Methods 0.000 description 6
- 102000004881 Angiotensinogen Human genes 0.000 description 5
- 108090000790 Enzymes Proteins 0.000 description 5
- 102000004190 Enzymes Human genes 0.000 description 5
- ROHFNLRQFUQHCH-YFKPBYRVSA-N L-leucine Chemical compound CC(C)C[C@H](N)C(O)=O ROHFNLRQFUQHCH-YFKPBYRVSA-N 0.000 description 5
- 230000036772 blood pressure Effects 0.000 description 5
- 238000004587 chromatography analysis Methods 0.000 description 5
- 238000003776 cleavage reaction Methods 0.000 description 5
- 125000004122 cyclic group Chemical group 0.000 description 5
- 239000003112 inhibitor Substances 0.000 description 5
- 102000004196 processed proteins & peptides Human genes 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- 230000007017 scission Effects 0.000 description 5
- 239000000377 silicon dioxide Substances 0.000 description 5
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 5
- CUKWUWBLQQDQAC-VEQWQPCFSA-N (3s)-3-amino-4-[[(2s)-1-[[(2s)-1-[[(2s)-1-[[(2s,3s)-1-[[(2s)-1-[(2s)-2-[[(1s)-1-carboxyethyl]carbamoyl]pyrrolidin-1-yl]-3-(1h-imidazol-5-yl)-1-oxopropan-2-yl]amino]-3-methyl-1-oxopentan-2-yl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-3-methyl-1-ox Chemical compound C([C@@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](C)C(O)=O)NC(=O)[C@@H](NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H](N)CC(O)=O)C(C)C)C1=CC=C(O)C=C1 CUKWUWBLQQDQAC-VEQWQPCFSA-N 0.000 description 4
- 102400000345 Angiotensin-2 Human genes 0.000 description 4
- 101800000733 Angiotensin-2 Proteins 0.000 description 4
- 101000579218 Homo sapiens Renin Proteins 0.000 description 4
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 4
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 4
- VXDSLUMUNWTSDB-UHFFFAOYSA-N acetic acid;chloroform;methanol Chemical compound OC.CC(O)=O.ClC(Cl)Cl VXDSLUMUNWTSDB-UHFFFAOYSA-N 0.000 description 4
- 230000029936 alkylation Effects 0.000 description 4
- 238000005804 alkylation reaction Methods 0.000 description 4
- 229950006323 angiotensin ii Drugs 0.000 description 4
- 238000011835 investigation Methods 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 229910000104 sodium hydride Inorganic materials 0.000 description 4
- DYHSDKLCOJIUFX-UHFFFAOYSA-N tert-butoxycarbonyl anhydride Chemical compound CC(C)(C)OC(=O)OC(=O)OC(C)(C)C DYHSDKLCOJIUFX-UHFFFAOYSA-N 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- 108090001067 Angiotensinogen Proteins 0.000 description 3
- 241000282414 Homo sapiens Species 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 3
- 108091005804 Peptidases Proteins 0.000 description 3
- 102000035195 Peptidases Human genes 0.000 description 3
- ONIBWKKTOPOVIA-UHFFFAOYSA-N Proline Natural products OC(=O)C1CCCN1 ONIBWKKTOPOVIA-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 238000010511 deprotection reaction Methods 0.000 description 3
- AQEFLFZSWDEAIP-UHFFFAOYSA-N di-tert-butyl ether Chemical compound CC(C)(C)OC(C)(C)C AQEFLFZSWDEAIP-UHFFFAOYSA-N 0.000 description 3
- 230000006870 function Effects 0.000 description 3
- 238000010348 incorporation Methods 0.000 description 3
- 230000004048 modification Effects 0.000 description 3
- 238000012986 modification Methods 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 235000019198 oils Nutrition 0.000 description 3
- 238000010647 peptide synthesis reaction Methods 0.000 description 3
- 125000000612 phthaloyl group Chemical group C(C=1C(C(=O)*)=CC=CC1)(=O)* 0.000 description 3
- 239000002461 renin inhibitor Substances 0.000 description 3
- 229940086526 renin-inhibitors Drugs 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- QMMRCKSBBNJCMR-KMZPNFOHSA-N Angiotensin III Chemical compound C([C@@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CC=1C=CC=CC=1)C(O)=O)NC(=O)[C@@H](NC(=O)[C@@H](N)CCCN=C(N)N)C(C)C)C1=CC=C(O)C=C1 QMMRCKSBBNJCMR-KMZPNFOHSA-N 0.000 description 2
- 102400000348 Angiotensin-3 Human genes 0.000 description 2
- 101800000738 Angiotensin-3 Proteins 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- IYXGSMUGOJNHAZ-UHFFFAOYSA-N Ethyl malonate Chemical compound CCOC(=O)CC(=O)OCC IYXGSMUGOJNHAZ-UHFFFAOYSA-N 0.000 description 2
- 102000018389 Exopeptidases Human genes 0.000 description 2
- 108010091443 Exopeptidases Proteins 0.000 description 2
- 241000282412 Homo Species 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- WMDZARSFSMZOQO-DRZSPHRISA-N Ile-Phe Chemical group CC[C@H](C)[C@H](N)C(=O)N[C@H](C(O)=O)CC1=CC=CC=C1 WMDZARSFSMZOQO-DRZSPHRISA-N 0.000 description 2
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical compound CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- YCFJXOFFQLPCHD-UHFFFAOYSA-N Spinacin Natural products C1NC(C(=O)O)CC2=C1NC=N2 YCFJXOFFQLPCHD-UHFFFAOYSA-N 0.000 description 2
- 239000007983 Tris buffer Substances 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- 125000000539 amino acid group Chemical group 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 239000008280 blood Substances 0.000 description 2
- 210000004369 blood Anatomy 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- 239000000872 buffer Substances 0.000 description 2
- 239000012230 colorless oil Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- XXTZHYXQVWRADW-UHFFFAOYSA-N diazomethanone Chemical compound [N]N=C=O XXTZHYXQVWRADW-UHFFFAOYSA-N 0.000 description 2
- MHDVGSVTJDSBDK-UHFFFAOYSA-N dibenzyl ether Chemical class C=1C=CC=CC=1COCC1=CC=CC=C1 MHDVGSVTJDSBDK-UHFFFAOYSA-N 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 238000010828 elution Methods 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 125000000524 functional group Chemical group 0.000 description 2
- 108010092114 histidylphenylalanine Proteins 0.000 description 2
- 238000000338 in vitro Methods 0.000 description 2
- FMKOJHQHASLBPH-UHFFFAOYSA-N isopropyl iodide Chemical compound CC(C)I FMKOJHQHASLBPH-UHFFFAOYSA-N 0.000 description 2
- 210000003734 kidney Anatomy 0.000 description 2
- 229960003136 leucine Drugs 0.000 description 2
- 239000006225 natural substrate Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 235000019833 protease Nutrition 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- AOSZTAHDEDLTLQ-AZKQZHLXSA-N (1S,2S,4R,8S,9S,11S,12R,13S,19S)-6-[(3-chlorophenyl)methyl]-12,19-difluoro-11-hydroxy-8-(2-hydroxyacetyl)-9,13-dimethyl-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one Chemical compound C([C@@H]1C[C@H]2[C@H]3[C@]([C@]4(C=CC(=O)C=C4[C@@H](F)C3)C)(F)[C@@H](O)C[C@@]2([C@@]1(C1)C(=O)CO)C)N1CC1=CC=CC(Cl)=C1 AOSZTAHDEDLTLQ-AZKQZHLXSA-N 0.000 description 1
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- ZYJPUMXJBDHSIF-NSHDSACASA-N (2s)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoic acid Chemical compound CC(C)(C)OC(=O)N[C@H](C(O)=O)CC1=CC=CC=C1 ZYJPUMXJBDHSIF-NSHDSACASA-N 0.000 description 1
- AYMLQYFMYHISQO-QMMMGPOBSA-N (2s)-3-(1h-imidazol-3-ium-5-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate Chemical compound CC(C)(C)OC(=O)N[C@H](C(O)=O)CC1=CN=CN1 AYMLQYFMYHISQO-QMMMGPOBSA-N 0.000 description 1
- KZMNTAYHNCLVKA-BQBZGAKWSA-N (3s,4s)-4-hydrazinyl-3-hydroxy-6-methylheptanoic acid Chemical compound CC(C)C[C@H](NN)[C@@H](O)CC(O)=O KZMNTAYHNCLVKA-BQBZGAKWSA-N 0.000 description 1
- IADUEWIQBXOCDZ-VKHMYHEASA-N (S)-azetidine-2-carboxylic acid Chemical compound OC(=O)[C@@H]1CCN1 IADUEWIQBXOCDZ-VKHMYHEASA-N 0.000 description 1
- WORJRXHJTUTINR-UHFFFAOYSA-N 1,4-dioxane;hydron;chloride Chemical compound Cl.C1COCCO1 WORJRXHJTUTINR-UHFFFAOYSA-N 0.000 description 1
- DNUTZBZXLPWRJG-UHFFFAOYSA-N 1-Piperidine carboxylic acid Chemical compound OC(=O)N1CCCCC1 DNUTZBZXLPWRJG-UHFFFAOYSA-N 0.000 description 1
- YOETUEMZNOLGDB-UHFFFAOYSA-N 2-methylpropyl carbonochloridate Chemical compound CC(C)COC(Cl)=O YOETUEMZNOLGDB-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- ZMRJOEYFFDMQTN-UHFFFAOYSA-N 3,4-diamino-6-methylheptanoic acid Chemical compound CC(C)CC(N)C(N)CC(O)=O ZMRJOEYFFDMQTN-UHFFFAOYSA-N 0.000 description 1
- HAEQAUJYNHQVHV-UHFFFAOYSA-N 3-[4-(aminomethyl)-6-(trifluoromethyl)pyridin-2-yl]oxy-N-phenylbenzamide Chemical compound NCC1=CC(=NC(=C1)C(F)(F)F)OC=1C=C(C(=O)NC2=CC=CC=C2)C=CC=1 HAEQAUJYNHQVHV-UHFFFAOYSA-N 0.000 description 1
- FCSKOFQQCWLGMV-UHFFFAOYSA-N 5-{5-[2-chloro-4-(4,5-dihydro-1,3-oxazol-2-yl)phenoxy]pentyl}-3-methylisoxazole Chemical compound O1N=C(C)C=C1CCCCCOC1=CC=C(C=2OCCN=2)C=C1Cl FCSKOFQQCWLGMV-UHFFFAOYSA-N 0.000 description 1
- PQSUYGKTWSAVDQ-ZVIOFETBSA-N Aldosterone Chemical compound C([C@@]1([C@@H](C(=O)CO)CC[C@H]1[C@@H]1CC2)C=O)[C@H](O)[C@@H]1[C@]1(C)C2=CC(=O)CC1 PQSUYGKTWSAVDQ-ZVIOFETBSA-N 0.000 description 1
- PQSUYGKTWSAVDQ-UHFFFAOYSA-N Aldosterone Natural products C1CC2C3CCC(C(=O)CO)C3(C=O)CC(O)C2C2(C)C1=CC(=O)CC2 PQSUYGKTWSAVDQ-UHFFFAOYSA-N 0.000 description 1
- 108010017640 Aspartic Acid Proteases Proteins 0.000 description 1
- 102000004580 Aspartic Acid Proteases Human genes 0.000 description 1
- 108010017384 Blood Proteins Proteins 0.000 description 1
- 102000004506 Blood Proteins Human genes 0.000 description 1
- 108091003079 Bovine Serum Albumin Proteins 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-N Carbamic acid Chemical class NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 1
- 229940126657 Compound 17 Drugs 0.000 description 1
- 229920002307 Dextran Polymers 0.000 description 1
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- 101710088235 Envelope glycoprotein C homolog Proteins 0.000 description 1
- 206010019280 Heart failures Diseases 0.000 description 1
- 206010020571 Hyperaldosteronism Diseases 0.000 description 1
- QNBYCZTZNOVDMI-HGNGGELXSA-N Ile-His Chemical compound CC[C@H](C)[C@H](N)C(=O)N[C@H](C(O)=O)CC1=CN=CN1 QNBYCZTZNOVDMI-HGNGGELXSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 150000008575 L-amino acids Chemical class 0.000 description 1
- 239000004395 L-leucine Substances 0.000 description 1
- LCPYQJIKPJDLLB-UWVGGRQHSA-N Leu-Leu Chemical compound CC(C)C[C@H](N)C(=O)N[C@H](C(O)=O)CC(C)C LCPYQJIKPJDLLB-UWVGGRQHSA-N 0.000 description 1
- ROHFNLRQFUQHCH-UHFFFAOYSA-N Leucine Natural products CC(C)CC(N)C(O)=O ROHFNLRQFUQHCH-UHFFFAOYSA-N 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- MDXGYYOJGPFFJL-QMMMGPOBSA-N N(alpha)-t-butoxycarbonyl-L-leucine Chemical compound CC(C)C[C@@H](C(O)=O)NC(=O)OC(C)(C)C MDXGYYOJGPFFJL-QMMMGPOBSA-N 0.000 description 1
- 235000019502 Orange oil Nutrition 0.000 description 1
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium on carbon Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 1
- 241000282520 Papio Species 0.000 description 1
- OHUXOEXBXPZKPT-STQMWFEESA-N Phe-His Chemical group C([C@H](N)C(=O)N[C@@H](CC=1N=CNC=1)C(O)=O)C1=CC=CC=C1 OHUXOEXBXPZKPT-STQMWFEESA-N 0.000 description 1
- VADLTGVIOIOKGM-BZSNNMDCSA-N Phe-His-Leu Chemical compound C([C@@H](C(=O)N[C@@H](CC(C)C)C(O)=O)NC(=O)[C@@H](N)CC=1C=CC=CC=1)C1=CN=CN1 VADLTGVIOIOKGM-BZSNNMDCSA-N 0.000 description 1
- GKZIWHRNKRBEOH-HOTGVXAUSA-N Phe-Phe Chemical compound C([C@H]([NH3+])C(=O)N[C@@H](CC=1C=CC=CC=1)C([O-])=O)C1=CC=CC=C1 GKZIWHRNKRBEOH-HOTGVXAUSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 239000004365 Protease Substances 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- 201000003099 Renovascular Hypertension Diseases 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 210000004100 adrenal gland Anatomy 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229960002478 aldosterone Drugs 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 230000003276 anti-hypertensive effect Effects 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000005002 aryl methyl group Chemical group 0.000 description 1
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 1
- 238000005574 benzylation reaction Methods 0.000 description 1
- 125000002619 bicyclic group Chemical group 0.000 description 1
- 229940098773 bovine serum albumin Drugs 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- MOIPGXQKZSZOQX-UHFFFAOYSA-N carbonyl bromide Chemical compound BrC(Br)=O MOIPGXQKZSZOQX-UHFFFAOYSA-N 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 208000028831 congenital heart disease Diseases 0.000 description 1
- 229920001577 copolymer Chemical group 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 238000006114 decarboxylation reaction Methods 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 150000002009 diols Chemical class 0.000 description 1
- CLPHAYNBNTVRDI-UHFFFAOYSA-N ditert-butyl propanedioate Chemical compound CC(C)(C)OC(=O)CC(=O)OC(C)(C)C CLPHAYNBNTVRDI-UHFFFAOYSA-N 0.000 description 1
- 230000007515 enzymatic degradation Effects 0.000 description 1
- 238000006911 enzymatic reaction Methods 0.000 description 1
- 229940125532 enzyme inhibitor Drugs 0.000 description 1
- GKIPXFAANLTWBM-UHFFFAOYSA-N epibromohydrin Chemical compound BrCC1CO1 GKIPXFAANLTWBM-UHFFFAOYSA-N 0.000 description 1
- 238000011067 equilibration Methods 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 210000003722 extracellular fluid Anatomy 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000003944 halohydrins Chemical class 0.000 description 1
- 125000005283 haloketone group Chemical group 0.000 description 1
- 229940088597 hormone Drugs 0.000 description 1
- 239000005556 hormone Substances 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- BTJRKNUKPQBLAL-UHFFFAOYSA-N hydron;4-methylmorpholine;chloride Chemical compound Cl.CN1CCOCC1 BTJRKNUKPQBLAL-UHFFFAOYSA-N 0.000 description 1
- NPZTUJOABDZTLV-UHFFFAOYSA-N hydroxybenzotriazole Substances O=C1C=CC=C2NNN=C12 NPZTUJOABDZTLV-UHFFFAOYSA-N 0.000 description 1
- 230000001631 hypertensive effect Effects 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 125000001841 imino group Chemical group [H]N=* 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 125000006302 indol-3-yl methyl group Chemical group [H]N1C([H])=C(C2=C([H])C([H])=C([H])C([H])=C12)C([H])([H])* 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 210000000936 intestine Anatomy 0.000 description 1
- 125000001909 leucine group Chemical group [H]N(*)C(C(*)=O)C([H])([H])C(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 108010091798 leucylleucine Proteins 0.000 description 1
- 239000003446 ligand Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 150000002641 lithium Chemical class 0.000 description 1
- 230000004904 long-term response Effects 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000002950 monocyclic group Chemical group 0.000 description 1
- NYIODHFKZFKMSU-UHFFFAOYSA-N n,n-bis(methylamino)ethanamine Chemical compound CCN(NC)NC NYIODHFKZFKMSU-UHFFFAOYSA-N 0.000 description 1
- 239000010502 orange oil Substances 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 239000008194 pharmaceutical composition Substances 0.000 description 1
- 108010073025 phenylalanylphenylalanine Proteins 0.000 description 1
- 230000004962 physiological condition Effects 0.000 description 1
- 229920001184 polypeptide Polymers 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 201000009395 primary hyperaldosteronism Diseases 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 238000005086 pumping Methods 0.000 description 1
- 238000003127 radioimmunoassay Methods 0.000 description 1
- 239000002287 radioligand Substances 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 230000036454 renin-angiotensin system Effects 0.000 description 1
- DUIOPKIIICUYRZ-UHFFFAOYSA-N semicarbazide Chemical compound NNC(N)=O DUIOPKIIICUYRZ-UHFFFAOYSA-N 0.000 description 1
- 230000004905 short-term response Effects 0.000 description 1
- 238000004904 shortening Methods 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 150000003385 sodium Chemical class 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 230000004936 stimulating effect Effects 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 238000011477 surgical intervention Methods 0.000 description 1
- 238000001308 synthesis method Methods 0.000 description 1
- 238000010189 synthetic method Methods 0.000 description 1
- LCZVKKUAUWQDPX-UHFFFAOYSA-N tert-butyl 2-[(2-acetyloxyphenyl)methyl-[2-[(2-acetyloxyphenyl)methyl-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]ethyl]amino]acetate Chemical compound CC(=O)OC1=CC=CC=C1CN(CC(=O)OC(C)(C)C)CCN(CC(=O)OC(C)(C)C)CC1=CC=CC=C1OC(C)=O LCZVKKUAUWQDPX-UHFFFAOYSA-N 0.000 description 1
- TYSZETYVESRFNT-UHFFFAOYSA-N tert-butyl n-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate Chemical compound CC(C)(C)OC(=O)NNC(=O)OC(C)(C)C TYSZETYVESRFNT-UHFFFAOYSA-N 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 238000002424 x-ray crystallography Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07K—PEPTIDES
- C07K5/00—Peptides containing up to four amino acids in a fully defined sequence; Derivatives thereof
- C07K5/02—Peptides containing up to four amino acids in a fully defined sequence; Derivatives thereof containing at least one abnormal peptide link
- C07K5/0227—Peptides containing up to four amino acids in a fully defined sequence; Derivatives thereof containing at least one abnormal peptide link containing the (partial) peptide sequence -Phe-His-NH-(X)2-C(=0)-, e.g. Renin-inhibitors with n = 2 - 6; for n > 6 see C07K5/06 - C07K5/10
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07K—PEPTIDES
- C07K7/00—Peptides having 5 to 20 amino acids in a fully defined sequence; Derivatives thereof
- C07K7/04—Linear peptides containing only normal peptide links
- C07K7/14—Angiotensins: Related peptides
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Molecular Biology (AREA)
- Biophysics (AREA)
- General Health & Medical Sciences (AREA)
- Genetics & Genomics (AREA)
- Medicinal Chemistry (AREA)
- Biochemistry (AREA)
- Proteomics, Peptides & Aminoacids (AREA)
- Life Sciences & Earth Sciences (AREA)
- Vascular Medicine (AREA)
- Peptides Or Proteins (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Medicines Containing Material From Animals Or Micro-Organisms (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US46954083A | 1983-02-07 | 1983-02-07 | |
| GB838322414A GB8322414D0 (en) | 1983-08-19 | 1983-08-19 | Renin inhibitors |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO843975L true NO843975L (no) | 1984-10-02 |
Family
ID=26286781
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO843975A NO843975L (no) | 1983-02-07 | 1984-10-02 | Enzyminhibitorer |
Country Status (8)
| Country | Link |
|---|---|
| EP (2) | EP0316965A3 (da) |
| AU (2) | AU573735B2 (da) |
| DK (1) | DK478684D0 (da) |
| ES (4) | ES8602847A1 (da) |
| FI (1) | FI843837L (da) |
| MY (1) | MY102058A (da) |
| NO (1) | NO843975L (da) |
| WO (1) | WO1984003044A1 (da) |
Families Citing this family (103)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4613676A (en) * | 1983-11-23 | 1986-09-23 | Ciba-Geigy Corporation | Substituted 5-amino-4-hydroxyvaleryl derivatives |
| EP0144290A3 (de) * | 1983-12-01 | 1987-05-27 | Ciba-Geigy Ag | Substituierte Aethylendiaminderivate |
| JPS60163899A (ja) * | 1984-02-03 | 1985-08-26 | Sankyo Co Ltd | レニン阻害ペプチド類 |
| FI850948L (fi) * | 1984-03-12 | 1985-09-13 | Pfizer | Renin inhibitorer som innehaoller statin eller dess derivat. |
| US4636491A (en) * | 1984-03-27 | 1987-01-13 | Merck & Co., Inc. | Renin inhibitory peptides having improved solubility |
| US4661473A (en) * | 1984-03-27 | 1987-04-28 | Merck & Co., Inc. | Renin inhibitors containing peptide isosteres |
| US4663310A (en) * | 1984-04-04 | 1987-05-05 | Merck & Co., Inc. | Renin inhibitors containing 2-substituted statine |
| DE3418491A1 (de) * | 1984-05-18 | 1985-11-21 | Merck Patent Gmbh, 6100 Darmstadt | Diaminosaeurederivate |
| EP0163237A3 (en) * | 1984-05-29 | 1988-04-27 | Merck & Co. Inc. | Di- and tri-peptidal renin inhibitors |
| FI88400C (fi) * | 1984-08-06 | 1993-05-10 | Upjohn Co | Foerfarande foer framstaellning av renin inhiberande peptider |
| US4880781A (en) * | 1984-08-06 | 1989-11-14 | The Upjohn Company | Renin inhibitory peptides containing an N-alkyl-histidine moiety |
| DE3438545A1 (de) * | 1984-10-20 | 1986-04-24 | Merck Patent Gmbh, 6100 Darmstadt | Peptide |
| US4616088A (en) * | 1984-10-29 | 1986-10-07 | E. R. Squibb & Sons, Inc. | Amino acid ester and amide renin inhibitor |
| US4727060A (en) * | 1984-11-13 | 1988-02-23 | Ciba-Geigy Corporation | Novel 5-amino-4-hydroxyvaleryl derivatives |
| US4629724A (en) * | 1984-12-03 | 1986-12-16 | E. R. Squibb & Sons, Inc. | Amino acid ester and amide renin inhibitors |
| DE3512128A1 (de) * | 1985-04-03 | 1986-10-09 | Merck Patent Gmbh, 6100 Darmstadt | Peptide |
| US4882420A (en) * | 1985-04-19 | 1989-11-21 | The Upjohn Company | Dihalo-statine substituted renin inhibitors |
| WO1986006379A1 (en) | 1985-04-19 | 1986-11-06 | The Upjohn Company | Dihalo-statine substituted renin inhibitors |
| US4777286A (en) * | 1985-06-18 | 1988-10-11 | The Upjohn Company | Certain aryl or hetero-hydroxamic acid esters useful as renin inhibitors |
| CA1290097C (en) * | 1985-07-24 | 1991-10-01 | Merck & Co., Inc. | Peptide enzyme inhibitors |
| US4599198A (en) * | 1985-08-02 | 1986-07-08 | Pfizer Inc. | Intermediates in polypeptide synthesis |
| US4992562A (en) * | 1985-08-09 | 1991-02-12 | Pfizer Inc. | Renin inhibitors containing 5-amino-2,5-disubstituted-4-hydroxypentanoic acid residues |
| US4729985A (en) * | 1985-08-09 | 1988-03-08 | Pfizer Inc. | Renin inhibitors containing 5-amino-2,5-disubstituted-4-hydroxypentanoic acid residues |
| US4749781A (en) * | 1985-11-12 | 1988-06-07 | E. R. Squibb & Sons, Inc. | Aminocarbonyl renin inhibitors |
| WO1987002986A1 (en) * | 1985-11-15 | 1987-05-21 | The Upjohn Company | Novel renin inhibiting polypeptide analogs containing s-aryl-d- or l- or dl-cysteinyl, 3-(arylthio)lactic acid or 3-(arylthio)alkyl moieties |
| US4894437A (en) * | 1985-11-15 | 1990-01-16 | The Upjohn Company | Novel renin inhibiting polypeptide analogs containing S-aryl-D- or L- or DL-cysteinyl, 3-(arylthio)lactic acid or 3-(arylthio)alkyl moieties |
| DE3540495A1 (de) * | 1985-11-15 | 1987-05-21 | Merck Patent Gmbh | Aminosaeurederivate |
| KR870005013A (ko) * | 1985-11-29 | 1987-06-04 | 가와무라 요시부미 | 레닌-억제 올리고펩티드, 그의 제조방법 및 용도 |
| CA1297631C (en) * | 1985-12-23 | 1992-03-17 | Sesha I. Natarajan | Ureido renin inhibitors |
| US4757050A (en) * | 1985-12-23 | 1988-07-12 | E. R. Squibb Sons, Inc. | Ureido renin inhibitors |
| DE3601248A1 (de) * | 1986-01-17 | 1987-07-23 | Hoechst Ag | Substituierte 4-amino-3-hydroxybuttersaeure-derivate, verfahren zu deren herstellung, diese enthaltende mittel und ihre verwendung |
| FI870474A (fi) * | 1986-02-07 | 1987-08-08 | Ciba Geigy Ag | Med svavelhaltiga grupper substituerade 5-amino-4-hydroxivalerylderivat. |
| US4705846A (en) * | 1986-03-27 | 1987-11-10 | The Upjohn Company | Novel renin inhibiting peptides having a gamma lactam pseudo dipeptide insert |
| US4999186A (en) * | 1986-06-27 | 1991-03-12 | The Procter & Gamble Company | Novel sunscreen agents, sunscreen compositions and methods for preventing sunburn |
| DE3626130A1 (de) * | 1986-08-01 | 1988-02-11 | Merck Patent Gmbh | Aminosaeurederivate |
| US4743585A (en) * | 1986-11-21 | 1988-05-10 | Warner-Lambert Company | Renin inhibitors |
| DE3640535A1 (de) * | 1986-11-27 | 1988-06-01 | Merck Patent Gmbh | Peptide |
| SE8605573D0 (sv) * | 1986-12-29 | 1986-12-29 | Haessle Ab | Novel compounds |
| US5032577A (en) * | 1986-12-31 | 1991-07-16 | Abbott Laboratories | Peptidylaminodiols |
| US4804743A (en) * | 1987-01-29 | 1989-02-14 | Warner-Lambert Copmany | Proline-containing renin inhibitors |
| US4863905A (en) * | 1987-02-04 | 1989-09-05 | Warner-Lambert Company | Renin inhibitors II |
| US4758584A (en) * | 1987-02-05 | 1988-07-19 | Ciba-Geigy Corporation | Antihypertensive 5-amino-4-hydroxyvaleryl derivatives substituted by sulphur-containing groups |
| WO1989000161A1 (en) * | 1987-06-29 | 1989-01-12 | The Upjohn Company | Malic acid derivative containing renin inhibiting peptides |
| US5055466A (en) * | 1987-11-23 | 1991-10-08 | E. R. Squibb & Sons, Inc. | N-morpholino derivatives and their use as anti-hypertensive agents |
| GB8728560D0 (en) * | 1987-12-07 | 1988-01-13 | Glaxo Group Ltd | Chemical compounds |
| GB8728561D0 (en) * | 1987-12-07 | 1988-01-13 | Glaxo Group Ltd | Chemical compounds |
| FR2624513A1 (fr) * | 1987-12-15 | 1989-06-16 | Sandoz Sa | Peptides contenant du silicium, leur preparation et leur utilisation comme medicaments |
| IL90872A0 (en) * | 1988-07-08 | 1990-02-09 | Smithkline Beckman Corp | Retroviral protease binding peptides |
| DE3840289A1 (de) * | 1988-11-30 | 1990-05-31 | Merck Patent Gmbh | Aminosaeurederivate |
| EP0374097A3 (de) * | 1988-12-15 | 1991-06-12 | Ciba-Geigy Ag | Verwendung von Peptidisosteren als retrovirale Proteasehemmer |
| US5126326A (en) * | 1989-06-06 | 1992-06-30 | Bio-Mega, Inc. | Enzyme inhibiting peptide derivatives |
| GB8927915D0 (en) * | 1989-12-11 | 1990-02-14 | Hoffmann La Roche | Novel alcohols |
| DE4014421A1 (de) * | 1990-05-05 | 1991-11-07 | Merck Patent Gmbh | Aminosaeurederivate |
| US5510378A (en) * | 1990-11-19 | 1996-04-23 | G.D. Searle & Co. | Retroviral protease inhibitors |
| US5648511A (en) * | 1990-11-19 | 1997-07-15 | G.D. Searle & Co. | Method for making intermediates useful in the synthesis of retroviral protease inhibitors |
| US5482947A (en) | 1990-11-19 | 1996-01-09 | Talley; John J. | Retroviral protease inhibitors |
| US5583238A (en) * | 1990-11-19 | 1996-12-10 | G. D. Searle & Co. | Method for making intermediates useful in synthesis of retroviral protease inhibitors |
| US5614522A (en) * | 1990-11-19 | 1997-03-25 | G.D. Searle & Co. | Retroviral protease inhibitors |
| US5475027A (en) * | 1990-11-19 | 1995-12-12 | G.D. Searle & Co. | Retroviral protease inhibitors |
| US5475013A (en) * | 1990-11-19 | 1995-12-12 | Monsanto Company | Retroviral protease inhibitors |
| US5278326A (en) * | 1991-03-18 | 1994-01-11 | Warner-Lambert Company | Substituted beta-ketoamide ACAT inhibitors |
| US5643878A (en) * | 1991-09-12 | 1997-07-01 | Ciba-Geigy Corporation | 5-amino-4-hydroxyhexanoic acid derivatives |
| TW217410B (da) * | 1992-04-01 | 1993-12-11 | Ciba Geigy | |
| ATE199545T1 (de) * | 1992-05-21 | 2001-03-15 | Monsanto Co | Inhibitoren retroviraler proteasen |
| US7141609B2 (en) | 1992-08-25 | 2006-11-28 | G.D. Searle & Co. | α- and β-amino acid hydroxyethylamino sulfonamides useful as retroviral protease inhibitors |
| KR100296461B1 (ko) * | 1992-08-25 | 2001-11-14 | 죤 에이치. 뷰센 | 레트로바이러스프로테아제저해제로서유용한n-(알카노일아미노-2-히드록시프로필)-술폰아미드 |
| US5760076A (en) * | 1992-08-25 | 1998-06-02 | G.D Searle & Co. | Succinoylamino hydroxyethylamino sulfonamides useful as retroviral protease inhibitors |
| US5968942A (en) | 1992-08-25 | 1999-10-19 | G. D. Searle & Co. | α- and β-amino acid hydroxyethylamino sulfonamides useful as retroviral protease inhibitors |
| US6022994A (en) | 1992-08-25 | 2000-02-08 | G. D. Searle &. Co. | Succinoylamino hydroxyethylamino sulfonamides useful as retroviral protease inhibitors |
| KR100336699B1 (ko) | 1992-08-25 | 2002-05-13 | 윌리암스 로저 에이 | 레트로바이러스 프로테아제 저해제로서 유용한히드록시에틸아미노 술폰아미드 |
| US6046190A (en) * | 1992-08-25 | 2000-04-04 | G.D. Searle & Co. | Hydroxyethylamino sulphonamides useful as retroviral protease inhibitors |
| US6743929B1 (en) | 1992-08-25 | 2004-06-01 | G. D. Searle & Co. | Sulfonylalkanoylamino hydroxyethylamino sulfonamides useful as retroviral protease inhibitors |
| US5521219A (en) * | 1992-08-25 | 1996-05-28 | G. D. Searle & Co. | Sulfonylalkanoylamino hydroxyethylamino sulfonamides useful as retroviral protease inhibitors |
| US5830897A (en) * | 1992-08-27 | 1998-11-03 | G. D. Searle & Co. | α- and β-amino acid hydroxyethylamino sulfonamides useful as retroviral protease inhibitors |
| US6337398B1 (en) | 1992-10-30 | 2002-01-08 | G.D. Searle & Co. | Succinoylamino hydroxyethylamino sulfonyl urea derivatives useful as retroviral protease inhibitors |
| US5756498A (en) * | 1992-10-30 | 1998-05-26 | G.D. Searle & Co. | Sulfonylalkanoylamino hydroxyethylamino sulfonyl urea derivatives useful as retroviral protease inhibitors |
| PT885881E (pt) * | 1992-10-30 | 2003-07-31 | Searle & Co | Acidos sulfonilalcanoilamino hidroxietilamino sulfamicos uteis como inibidores de protease retroviral |
| DE69331421T2 (de) | 1992-10-30 | 2002-08-01 | G.D. SEARLE & CO., CHICAGO | N-substituierte Hydroxyethylaminosulfamidsäure-Derivate verwendbar als Inhibitoren retroviraler Proteasen |
| US5578606A (en) | 1992-10-30 | 1996-11-26 | G. D. Searle & Co. | α- and β-amino acid hydroxyethylamino sulfonyl urea derivatives useful as retroviral protease inhibitors |
| US5514801A (en) | 1992-12-29 | 1996-05-07 | Monsanto Company | Cyclic sulfone containing retroviral protease inhibitors |
| US5750648A (en) * | 1993-08-20 | 1998-05-12 | G.D. Searle & Co. | Retroviral protease inhibitors and combinations thereof |
| US5602119A (en) * | 1993-10-29 | 1997-02-11 | Vazquez; Michael L. | Succinoylamino hydroxyethylamino sulfamic acid derivatives useful as retroviral protease inhibitors |
| US6133444A (en) * | 1993-12-22 | 2000-10-17 | Perseptive Biosystems, Inc. | Synthons for the synthesis and deprotection of peptide nucleic acids under mild conditions |
| US5831117A (en) | 1995-01-20 | 1998-11-03 | G. D. Searle & Co. | Method of preparing retroviral protease inhibitor intermediates |
| CA2210889C (en) * | 1995-01-20 | 2007-08-28 | G.D. Searle & Co. | Bis-sulfonamide hydroxyethylamino retroviral protease inhibitors |
| US5756533A (en) * | 1995-03-10 | 1998-05-26 | G.D. Searle & Co. | Amino acid hydroxyethylamino sulfonamide retroviral protease inhibitors |
| US6140505A (en) | 1995-03-10 | 2000-10-31 | G. D. Searle & Co. | Synthesis of benzo fused heterocyclic sulfonyl chlorides |
| US6861539B1 (en) | 1995-03-10 | 2005-03-01 | G. D. Searle & Co. | Bis-amino acid hydroxyethylamino sulfonamide retroviral protease inhibitors |
| EP1188766A1 (en) | 1995-03-10 | 2002-03-20 | G.D. Searle & Co. | Bis-amino acid hydroxyethylamino sulfonamide retroviral protease inhibitors |
| US7339078B2 (en) | 1995-03-10 | 2008-03-04 | G.D. Searle Llc | Bis-amino acid hydroxyethylamino sulfonamide retroviral protease inhibitors |
| US5776971A (en) * | 1995-03-10 | 1998-07-07 | G.D. Searle & Co. | Heterocyclecarbonyl amino acid hydroxyethylamino sulfonamide retroviral protease inhibitors |
| US5705500A (en) * | 1995-03-10 | 1998-01-06 | G.D. Searle & Co. | Sulfonylalkanoylamino hydroxyethylamino sulfonamide retroviral protease inhibitors |
| US6150556A (en) * | 1995-03-10 | 2000-11-21 | G. D. Dearle & Co. | Bis-amino acid hydroxyethylamino sulfonamide retroviral protease inhibitors |
| US5985870A (en) * | 1995-03-10 | 1999-11-16 | G.D. Searle & Co. | Sulfonylalkanoylamino hydroxyethylamino sulfonamide retroviral protease inhibitors |
| US6407134B1 (en) | 1995-03-10 | 2002-06-18 | G. D. Searle & Co. | Heterocyclecarbonyl amino acid hydroxyethylamino sulfonamide retroviral protease inhibitors |
| US6169085B1 (en) | 1995-03-10 | 2001-01-02 | G. D. Searle & Company | Sulfonylalkanoylamino hydroxyethylamino sulfonamide retroviral protease inhibitors |
| US6667307B2 (en) | 1997-12-19 | 2003-12-23 | G.D. Searle & Co. | Sulfonylalkanoylamino hydroxyethylamino sulfonamide retroviral protease inhibitors |
| DE69625183T2 (de) * | 1995-03-10 | 2003-10-09 | G.D. Searle & Co., Chicago | Heterocyclocarbonyl-aminosäure-hydroxyethylamino-sulfonamid inhibitoren retroviraler proteasen |
| AU7722296A (en) * | 1995-11-15 | 1997-06-05 | G.D. Searle & Co. | Substituted sulfonylalkanoylamino hydroxyethylamino sulfonamide retroviral protease inhibitors |
| US7132568B2 (en) | 2002-06-17 | 2006-11-07 | Sunesis Pharmaceuticals, Inc. | Aspartyl protease inhibitors |
| US7115652B2 (en) | 2002-06-17 | 2006-10-03 | Sunesis Pharmaceuticals, Inc. | Aspartyl protease inhibitors |
| WO2005005374A1 (en) * | 2003-06-16 | 2005-01-20 | Sunesis Pharmaceuticals, Inc. | Aspartyl protease inhibitors |
| WO2005113582A1 (en) * | 2004-05-22 | 2005-12-01 | Boehringer Ingelheim International Gmbh | Substituted ethane-1,2-diamines for the treatment of alzheimer's disease |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB2058077B (en) * | 1979-06-08 | 1983-03-09 | Szelke M | Enkephalin analogues |
| NO812612L (no) * | 1980-08-06 | 1982-02-08 | Ferring Pharma Ltd | Enzym-inhibitorer. |
| HU184368B (en) * | 1981-01-13 | 1984-08-28 | Gyogyszerkutato Intezet | Process for preparing d-phenyl-alanyl-l-propyl-l-arginine-ald ehyde-shulphate |
| CA1245217A (en) * | 1981-12-10 | 1988-11-22 | Joshua S. Boger | Renin inhibitory peptides having phe su13 xx deletion |
| IT1212508B (it) * | 1981-12-22 | 1989-11-22 | Anic Spa | Analoghi retro - invertiti dei penta - ed esapeptidi c - terminali della sostanza p. utili come vasodilatatori |
| IT1190891B (it) * | 1982-06-24 | 1988-02-24 | Anic Spa | Metodo per la sintesi in fase solida di polipeptidi retroinvertiti |
-
1984
- 1984-02-06 EP EP88121223A patent/EP0316965A3/en not_active Withdrawn
- 1984-02-06 AU AU24944/84A patent/AU573735B2/en not_active Ceased
- 1984-02-06 EP EP84300733A patent/EP0118223A1/en not_active Withdrawn
- 1984-02-06 WO PCT/GB1984/000032 patent/WO1984003044A1/en active Application Filing
- 1984-02-07 ES ES529523A patent/ES8602847A1/es not_active Expired
- 1984-09-28 FI FI843837A patent/FI843837L/fi not_active Application Discontinuation
- 1984-10-02 NO NO843975A patent/NO843975L/no unknown
- 1984-10-05 DK DK478684A patent/DK478684D0/da not_active Application Discontinuation
-
1985
- 1985-06-17 ES ES544297A patent/ES8604111A1/es not_active Expired
- 1985-06-17 ES ES544296A patent/ES8802393A1/es not_active Expired
- 1985-06-17 ES ES544295A patent/ES8802129A1/es not_active Expired
-
1987
- 1987-09-28 MY MYPI87001994A patent/MY102058A/en unknown
-
1988
- 1988-04-26 AU AU15167/88A patent/AU1516788A/en not_active Abandoned
Also Published As
| Publication number | Publication date |
|---|---|
| ES544296A0 (es) | 1988-05-16 |
| ES529523A0 (es) | 1985-12-01 |
| ES8604111A1 (es) | 1986-01-16 |
| WO1984003044A1 (en) | 1984-08-16 |
| EP0316965A2 (en) | 1989-05-24 |
| AU573735B2 (en) | 1988-06-23 |
| FI843837A0 (fi) | 1984-09-28 |
| MY102058A (en) | 1992-03-31 |
| ES8602847A1 (es) | 1985-12-01 |
| ES544297A0 (es) | 1986-01-16 |
| DK478684A (da) | 1984-10-05 |
| EP0316965A3 (en) | 1989-08-09 |
| ES544295A0 (es) | 1988-04-01 |
| DK478684D0 (da) | 1984-10-05 |
| AU1516788A (en) | 1988-09-08 |
| FI843837L (fi) | 1984-09-28 |
| ES8802393A1 (es) | 1988-05-16 |
| EP0118223A1 (en) | 1984-09-12 |
| ES8802129A1 (es) | 1988-04-01 |
| AU2494484A (en) | 1984-08-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO843975L (no) | Enzyminhibitorer | |
| US4997950A (en) | Novel C-terminal gastrin antagonists | |
| US4477441A (en) | Renin inhibitors containing a C-terminal disulfide cycle | |
| US5034512A (en) | Branched backbone renin inhibitors | |
| US4737487A (en) | VIP type peptides | |
| AU606312B2 (en) | Peptide derivatives which inhibit renin and acid proteases | |
| NO169543B (no) | Analogifremgangsmaate ved fremstilling av terapeutisk aktive peptidaseinhibitorer | |
| AU8438791A (en) | Kininogenase inhibitors | |
| US4692459A (en) | Anti-hypertensive agents | |
| NO812612L (no) | Enzym-inhibitorer. | |
| US4713445A (en) | Renin inhibitors and treatments using them | |
| US4745124A (en) | Orally effective anti-hypertensive agents | |
| EP0155809A2 (en) | Renin inhibitors containing statine or derivatives thereof | |
| CA1283499C (en) | Peptides | |
| GB2058079A (en) | TRH analogues | |
| AU627156B2 (en) | Amino acid derivatives | |
| US4687759A (en) | Tripeptide and tetrapeptide esters which inhibit gastric secretion, process for their preparation and pharmaceutical compositions in which they are present | |
| US5811548A (en) | Tri-and tetracyclic compounds | |
| CHATURVEDI et al. | Topochemically related hormone structures: synthesis of partial retro‐inverso analogs of LH‐RH | |
| US5225528A (en) | Cyclic hexapeptide oxytocin antagonists | |
| US3862927A (en) | Process for preparation of vasoactive intestinal peptide | |
| US3812091A (en) | D-analogs of secretin | |
| Camble et al. | Amino-acids and peptides. Part XXX. Facilitation of peptide synthesis by the use of 4-picolyl esters for carboxy-group protection | |
| SE407215B (sv) | Forfarande for framstellning av peptider med psykofarmakologiska egenskaper | |
| US4247543A (en) | Organic compounds |