NO813153L - Nye karboksyalkylpeptider og tioetere og etere av peptider med antihypertensiv aktivitet - Google Patents
Nye karboksyalkylpeptider og tioetere og etere av peptider med antihypertensiv aktivitetInfo
- Publication number
- NO813153L NO813153L NO813153A NO813153A NO813153L NO 813153 L NO813153 L NO 813153L NO 813153 A NO813153 A NO 813153A NO 813153 A NO813153 A NO 813153A NO 813153 L NO813153 L NO 813153L
- Authority
- NO
- Norway
- Prior art keywords
- carbon atoms
- acid
- groups
- group
- methyl
- Prior art date
Links
- 108090000765 processed proteins & peptides Proteins 0.000 title description 9
- 102000004196 processed proteins & peptides Human genes 0.000 title description 7
- 150000002170 ethers Chemical class 0.000 title description 4
- 230000003276 anti-hypertensive effect Effects 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims description 166
- -1 -SH Chemical group 0.000 claims description 153
- 125000004432 carbon atom Chemical group C* 0.000 claims description 92
- 238000000034 method Methods 0.000 claims description 46
- 125000000217 alkyl group Chemical group 0.000 claims description 38
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 25
- 125000002947 alkylene group Chemical group 0.000 claims description 24
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 22
- 150000003839 salts Chemical class 0.000 claims description 22
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 20
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 16
- 229910052799 carbon Inorganic materials 0.000 claims description 15
- 229910052757 nitrogen Inorganic materials 0.000 claims description 14
- 125000004185 ester group Chemical group 0.000 claims description 11
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 10
- 125000003396 thiol group Chemical class [H]S* 0.000 claims description 10
- 125000000623 heterocyclic group Chemical group 0.000 claims description 9
- 125000001424 substituent group Chemical group 0.000 claims description 9
- 125000003545 alkoxy group Chemical group 0.000 claims description 8
- 229910052739 hydrogen Inorganic materials 0.000 claims description 8
- 125000004464 hydroxyphenyl group Chemical group 0.000 claims description 8
- 150000003568 thioethers Chemical class 0.000 claims description 8
- 229910052794 bromium Inorganic materials 0.000 claims description 7
- 150000001721 carbon Chemical group 0.000 claims description 7
- 229910052736 halogen Inorganic materials 0.000 claims description 7
- 150000002367 halogens Chemical group 0.000 claims description 7
- 125000003342 alkenyl group Chemical group 0.000 claims description 6
- 125000003806 alkyl carbonyl amino group Chemical group 0.000 claims description 6
- 125000004448 alkyl carbonyl group Chemical group 0.000 claims description 6
- 125000005130 alkyl carbonyl thio group Chemical group 0.000 claims description 6
- 125000005196 alkyl carbonyloxy group Chemical group 0.000 claims description 6
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 6
- 125000001188 haloalkyl group Chemical group 0.000 claims description 6
- 229910052740 iodine Inorganic materials 0.000 claims description 6
- 125000001544 thienyl group Chemical group 0.000 claims description 6
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 5
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 claims description 5
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 claims description 5
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 5
- 231100000252 nontoxic Toxicity 0.000 claims description 5
- 230000003000 nontoxic effect Effects 0.000 claims description 5
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 claims description 4
- 241000124008 Mammalia Species 0.000 claims description 4
- 125000006294 amino alkylene group Chemical group 0.000 claims description 4
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 claims description 4
- 150000001450 anions Chemical class 0.000 claims description 4
- 125000004429 atom Chemical group 0.000 claims description 4
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims description 4
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 4
- 125000004982 dihaloalkyl group Chemical group 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 4
- 125000002349 hydroxyamino group Chemical group [H]ON([H])[*] 0.000 claims description 4
- 125000002883 imidazolyl group Chemical group 0.000 claims description 4
- 125000005358 mercaptoalkyl group Chemical group 0.000 claims description 4
- 125000004953 trihalomethyl group Chemical group 0.000 claims description 4
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 4
- 150000003973 alkyl amines Chemical class 0.000 claims description 3
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 3
- 229910052731 fluorine Inorganic materials 0.000 claims description 3
- 125000004970 halomethyl group Chemical group 0.000 claims description 3
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 3
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 claims description 3
- 125000004372 methylthioethyl group Chemical group [H]C([H])([H])SC([H])([H])C([H])([H])* 0.000 claims description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 3
- 229920006395 saturated elastomer Polymers 0.000 claims description 3
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 claims description 2
- 125000006307 alkoxy benzyl group Chemical group 0.000 claims description 2
- 125000005036 alkoxyphenyl group Chemical group 0.000 claims description 2
- 125000005037 alkyl phenyl group Chemical group 0.000 claims description 2
- 125000004414 alkyl thio group Chemical group 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 125000005334 azaindolyl group Chemical group N1N=C(C2=CC=CC=C12)* 0.000 claims description 2
- 125000001231 benzoyloxy group Chemical group C(C1=CC=CC=C1)(=O)O* 0.000 claims description 2
- 238000005100 correlation spectroscopy Methods 0.000 claims description 2
- 125000004802 cyanophenyl group Chemical group 0.000 claims description 2
- 125000004981 cycloalkylmethyl group Chemical group 0.000 claims description 2
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims description 2
- 125000002541 furyl group Chemical group 0.000 claims description 2
- 125000005059 halophenyl group Chemical group 0.000 claims description 2
- 125000001041 indolyl group Chemical group 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- HRDXJKGNWSUIBT-UHFFFAOYSA-N methoxybenzene Chemical group [CH2]OC1=CC=CC=C1 HRDXJKGNWSUIBT-UHFFFAOYSA-N 0.000 claims description 2
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 claims description 2
- 125000004092 methylthiomethyl group Chemical group [H]C([H])([H])SC([H])([H])* 0.000 claims description 2
- 125000002757 morpholinyl group Chemical group 0.000 claims description 2
- 125000004998 naphthylethyl group Chemical group C1(=CC=CC2=CC=CC=C12)CC* 0.000 claims description 2
- 125000006501 nitrophenyl group Chemical group 0.000 claims description 2
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 2
- 125000004193 piperazinyl group Chemical group 0.000 claims description 2
- 125000003386 piperidinyl group Chemical group 0.000 claims description 2
- 229960005235 piperonyl butoxide Drugs 0.000 claims description 2
- 125000004591 piperonyl group Chemical group C(C1=CC=2OCOC2C=C1)* 0.000 claims description 2
- 125000001500 prolyl group Chemical group [H]N1C([H])(C(=O)[*])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 2
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 claims description 2
- 125000003373 pyrazinyl group Chemical group 0.000 claims description 2
- 125000004076 pyridyl group Chemical group 0.000 claims description 2
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 2
- 125000000719 pyrrolidinyl group Chemical group 0.000 claims description 2
- 125000000168 pyrrolyl group Chemical group 0.000 claims description 2
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 claims description 2
- 125000001984 thiazolidinyl group Chemical group 0.000 claims description 2
- 125000000335 thiazolyl group Chemical group 0.000 claims description 2
- 229920002554 vinyl polymer Polymers 0.000 claims description 2
- 125000000686 lactone group Chemical group 0.000 claims 2
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 claims 1
- 125000006371 dihalo methyl group Chemical group 0.000 claims 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 claims 1
- 239000000047 product Substances 0.000 description 169
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 127
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 117
- 238000003786 synthesis reaction Methods 0.000 description 107
- 230000015572 biosynthetic process Effects 0.000 description 106
- 239000000243 solution Substances 0.000 description 92
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 75
- 239000000203 mixture Substances 0.000 description 67
- 239000002904 solvent Substances 0.000 description 61
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 51
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 50
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 50
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 46
- 239000002253 acid Substances 0.000 description 45
- 235000019439 ethyl acetate Nutrition 0.000 description 40
- 235000019441 ethanol Nutrition 0.000 description 39
- 229960003767 alanine Drugs 0.000 description 37
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 36
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 33
- 230000002829 reductive effect Effects 0.000 description 32
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 31
- 229960002429 proline Drugs 0.000 description 31
- 239000011541 reaction mixture Substances 0.000 description 29
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 25
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 25
- 238000006243 chemical reaction Methods 0.000 description 25
- 239000002808 molecular sieve Substances 0.000 description 24
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 24
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 24
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 23
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 23
- 125000004494 ethyl ester group Chemical group 0.000 description 22
- 239000012074 organic phase Substances 0.000 description 22
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 21
- 239000003112 inhibitor Substances 0.000 description 21
- UUUHXMGGBIUAPW-UHFFFAOYSA-N 1-[1-[2-[[5-amino-2-[[1-[5-(diaminomethylideneamino)-2-[[1-[3-(1h-indol-3-yl)-2-[(5-oxopyrrolidine-2-carbonyl)amino]propanoyl]pyrrolidine-2-carbonyl]amino]pentanoyl]pyrrolidine-2-carbonyl]amino]-5-oxopentanoyl]amino]-3-methylpentanoyl]pyrrolidine-2-carbon Chemical compound C1CCC(C(=O)N2C(CCC2)C(O)=O)N1C(=O)C(C(C)CC)NC(=O)C(CCC(N)=O)NC(=O)C1CCCN1C(=O)C(CCCN=C(N)N)NC(=O)C1CCCN1C(=O)C(CC=1C2=CC=CC=C2NC=1)NC(=O)C1CCC(=O)N1 UUUHXMGGBIUAPW-UHFFFAOYSA-N 0.000 description 20
- 102000004270 Peptidyl-Dipeptidase A Human genes 0.000 description 20
- 108090000882 Peptidyl-Dipeptidase A Proteins 0.000 description 20
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 18
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 17
- 238000003756 stirring Methods 0.000 description 17
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 17
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 15
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 15
- 150000002148 esters Chemical class 0.000 description 15
- LCTONWCANYUPML-UHFFFAOYSA-N Pyruvic acid Chemical compound CC(=O)C(O)=O LCTONWCANYUPML-UHFFFAOYSA-N 0.000 description 14
- 235000004279 alanine Nutrition 0.000 description 14
- 102000004190 Enzymes Human genes 0.000 description 13
- 108090000790 Enzymes Proteins 0.000 description 13
- QNAYBMKLOCPYGJ-REOHCLBHSA-N L-alanine Chemical compound C[C@H](N)C(O)=O QNAYBMKLOCPYGJ-REOHCLBHSA-N 0.000 description 13
- 238000004587 chromatography analysis Methods 0.000 description 13
- 230000000694 effects Effects 0.000 description 13
- 239000000758 substrate Substances 0.000 description 13
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 12
- 102400000344 Angiotensin-1 Human genes 0.000 description 12
- 101800000734 Angiotensin-1 Proteins 0.000 description 12
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 12
- ONIBWKKTOPOVIA-BYPYZUCNSA-N L-Proline Chemical compound OC(=O)[C@@H]1CCCN1 ONIBWKKTOPOVIA-BYPYZUCNSA-N 0.000 description 12
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 12
- ORWYRWWVDCYOMK-HBZPZAIKSA-N angiotensin I Chemical compound C([C@@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N[C@@H](CC(C)C)C(O)=O)NC(=O)[C@@H](NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H](N)CC(O)=O)C(C)C)C1=CC=C(O)C=C1 ORWYRWWVDCYOMK-HBZPZAIKSA-N 0.000 description 12
- FAKRSMQSSFJEIM-RQJHMYQMSA-N captopril Chemical compound SC[C@@H](C)C(=O)N1CCC[C@H]1C(O)=O FAKRSMQSSFJEIM-RQJHMYQMSA-N 0.000 description 12
- 229960000830 captopril Drugs 0.000 description 12
- 239000000543 intermediate Substances 0.000 description 12
- 125000006239 protecting group Chemical group 0.000 description 12
- 238000007127 saponification reaction Methods 0.000 description 11
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 10
- 102400000345 Angiotensin-2 Human genes 0.000 description 10
- 101800000733 Angiotensin-2 Proteins 0.000 description 10
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 10
- ONIBWKKTOPOVIA-UHFFFAOYSA-N Proline Natural products OC(=O)C1CCCN1 ONIBWKKTOPOVIA-UHFFFAOYSA-N 0.000 description 10
- 229940024606 amino acid Drugs 0.000 description 10
- 235000001014 amino acid Nutrition 0.000 description 10
- 229950006323 angiotensin ii Drugs 0.000 description 10
- 206010020772 Hypertension Diseases 0.000 description 9
- CZGUSIXMZVURDU-JZXHSEFVSA-N Ile(5)-angiotensin II Chemical compound C([C@@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CC=1C=CC=CC=1)C([O-])=O)NC(=O)[C@@H](NC(=O)[C@H](CCCNC(N)=[NH2+])NC(=O)[C@@H]([NH3+])CC([O-])=O)C(C)C)C1=CC=C(O)C=C1 CZGUSIXMZVURDU-JZXHSEFVSA-N 0.000 description 9
- COLNVLDHVKWLRT-QMMMGPOBSA-N L-phenylalanine Chemical compound OC(=O)[C@@H](N)CC1=CC=CC=C1 COLNVLDHVKWLRT-QMMMGPOBSA-N 0.000 description 9
- 150000001413 amino acids Chemical class 0.000 description 9
- 230000036772 blood pressure Effects 0.000 description 9
- 238000010168 coupling process Methods 0.000 description 9
- 238000001704 evaporation Methods 0.000 description 9
- 230000008020 evaporation Effects 0.000 description 9
- 229940107700 pyruvic acid Drugs 0.000 description 9
- 239000000376 reactant Substances 0.000 description 9
- 229930182821 L-proline Natural products 0.000 description 8
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 8
- 238000001914 filtration Methods 0.000 description 8
- 150000004702 methyl esters Chemical class 0.000 description 8
- 235000017557 sodium bicarbonate Nutrition 0.000 description 8
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 8
- ADFXKUOMJKEIND-UHFFFAOYSA-N 1,3-dicyclohexylurea Chemical compound C1CCCCC1NC(=O)NC1CCCCC1 ADFXKUOMJKEIND-UHFFFAOYSA-N 0.000 description 7
- WHUUTDBJXJRKMK-UHFFFAOYSA-N Glutamic acid Natural products OC(=O)C(N)CCC(O)=O WHUUTDBJXJRKMK-UHFFFAOYSA-N 0.000 description 7
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 7
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 7
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 7
- 239000004472 Lysine Substances 0.000 description 7
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Substances CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 7
- 230000009471 action Effects 0.000 description 7
- 238000001816 cooling Methods 0.000 description 7
- 229960005190 phenylalanine Drugs 0.000 description 7
- 229910052708 sodium Inorganic materials 0.000 description 7
- 239000011734 sodium Substances 0.000 description 7
- 238000004809 thin layer chromatography Methods 0.000 description 7
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N acetone Substances CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- 239000008346 aqueous phase Substances 0.000 description 6
- 210000004369 blood Anatomy 0.000 description 6
- 239000008280 blood Substances 0.000 description 6
- 239000000872 buffer Substances 0.000 description 6
- 239000003054 catalyst Substances 0.000 description 6
- 239000012043 crude product Substances 0.000 description 6
- 150000002596 lactones Chemical group 0.000 description 6
- 238000002360 preparation method Methods 0.000 description 6
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical compound SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 6
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 5
- NQTADLQHYWFPDB-UHFFFAOYSA-N N-Hydroxysuccinimide Chemical compound ON1C(=O)CCC1=O NQTADLQHYWFPDB-UHFFFAOYSA-N 0.000 description 5
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 5
- 150000007513 acids Chemical class 0.000 description 5
- 150000008064 anhydrides Chemical class 0.000 description 5
- 239000007864 aqueous solution Substances 0.000 description 5
- 230000037396 body weight Effects 0.000 description 5
- 229960002989 glutamic acid Drugs 0.000 description 5
- 238000000338 in vitro Methods 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- XJJBXZIKXFOMLP-ZETCQYMHSA-N tert-butyl (2s)-pyrrolidine-2-carboxylate Chemical compound CC(C)(C)OC(=O)[C@@H]1CCCN1 XJJBXZIKXFOMLP-ZETCQYMHSA-N 0.000 description 5
- OMGHIGVFLOPEHJ-UHFFFAOYSA-N 2,5-dihydro-1h-pyrrol-1-ium-2-carboxylate Chemical compound OC(=O)C1NCC=C1 OMGHIGVFLOPEHJ-UHFFFAOYSA-N 0.000 description 4
- PMNLUUOXGOOLSP-UHFFFAOYSA-N 2-mercaptopropanoic acid Chemical compound CC(S)C(O)=O PMNLUUOXGOOLSP-UHFFFAOYSA-N 0.000 description 4
- XMIIGOLPHOKFCH-UHFFFAOYSA-N 3-phenylpropionic acid Chemical compound OC(=O)CCC1=CC=CC=C1 XMIIGOLPHOKFCH-UHFFFAOYSA-N 0.000 description 4
- ODHCTXKNWHHXJC-VKHMYHEASA-N 5-oxo-L-proline Chemical compound OC(=O)[C@@H]1CCC(=O)N1 ODHCTXKNWHHXJC-VKHMYHEASA-N 0.000 description 4
- 239000005541 ACE inhibitor Substances 0.000 description 4
- 102000015427 Angiotensins Human genes 0.000 description 4
- 108010064733 Angiotensins Proteins 0.000 description 4
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- 229940044094 angiotensin-converting-enzyme inhibitor Drugs 0.000 description 4
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 238000005859 coupling reaction Methods 0.000 description 4
- 239000003085 diluting agent Substances 0.000 description 4
- 238000004108 freeze drying Methods 0.000 description 4
- 235000013922 glutamic acid Nutrition 0.000 description 4
- 239000004220 glutamic acid Substances 0.000 description 4
- BTNMPGBKDVTSJY-UHFFFAOYSA-N keto-phenylpyruvic acid Chemical compound OC(=O)C(=O)CC1=CC=CC=C1 BTNMPGBKDVTSJY-UHFFFAOYSA-N 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 239000012071 phase Substances 0.000 description 4
- COLNVLDHVKWLRT-UHFFFAOYSA-N phenylalanine Natural products OC(=O)C(N)CC1=CC=CC=C1 COLNVLDHVKWLRT-UHFFFAOYSA-N 0.000 description 4
- 235000008729 phenylalanine Nutrition 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- 125000001308 pyruvoyl group Chemical group O=C([*])C(=O)C([H])([H])[H] 0.000 description 4
- 229960001153 serine Drugs 0.000 description 4
- NDVLTYZPCACLMA-UHFFFAOYSA-N silver oxide Chemical compound [O-2].[Ag+].[Ag+] NDVLTYZPCACLMA-UHFFFAOYSA-N 0.000 description 4
- 159000000000 sodium salts Chemical class 0.000 description 4
- 238000012360 testing method Methods 0.000 description 4
- 239000011701 zinc Substances 0.000 description 4
- MTCFGRXMJLQNBG-REOHCLBHSA-N (2S)-2-Amino-3-hydroxypropansäure Chemical compound OC[C@H](N)C(O)=O MTCFGRXMJLQNBG-REOHCLBHSA-N 0.000 description 3
- IADUEWIQBXOCDZ-UHFFFAOYSA-N (2S)-azetidine-2-carboxylic acid Natural products OC(=O)C1CCN1 IADUEWIQBXOCDZ-UHFFFAOYSA-N 0.000 description 3
- PPKAIMDMNWBOKN-UHFFFAOYSA-N 2-Oxo-4-phenylbutyric acid Chemical compound OC(=O)C(=O)CCC1=CC=CC=C1 PPKAIMDMNWBOKN-UHFFFAOYSA-N 0.000 description 3
- 239000001903 2-oxo-3-phenylpropanoic acid Substances 0.000 description 3
- KPGXRSRHYNQIFN-UHFFFAOYSA-N 2-oxoglutaric acid Chemical compound OC(=O)CCC(=O)C(O)=O KPGXRSRHYNQIFN-UHFFFAOYSA-N 0.000 description 3
- HGIOOMCLOWLFTJ-UHFFFAOYSA-N 3-phenyl-2-sulfanylpropanoic acid Chemical compound OC(=O)C(S)CC1=CC=CC=C1 HGIOOMCLOWLFTJ-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- WPWUFUBLGADILS-WDSKDSINSA-N Ala-Pro Chemical compound C[C@H](N)C(=O)N1CCC[C@H]1C(O)=O WPWUFUBLGADILS-WDSKDSINSA-N 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 3
- 239000004475 Arginine Substances 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 101800004538 Bradykinin Proteins 0.000 description 3
- 239000004471 Glycine Substances 0.000 description 3
- QXZGBUJJYSLZLT-UHFFFAOYSA-N H-Arg-Pro-Pro-Gly-Phe-Ser-Pro-Phe-Arg-OH Natural products NC(N)=NCCCC(N)C(=O)N1CCCC1C(=O)N1C(C(=O)NCC(=O)NC(CC=2C=CC=CC=2)C(=O)NC(CO)C(=O)N2C(CCC2)C(=O)NC(CC=2C=CC=CC=2)C(=O)NC(CCCN=C(N)N)C(O)=O)CCC1 QXZGBUJJYSLZLT-UHFFFAOYSA-N 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 3
- 241000700159 Rattus Species 0.000 description 3
- 108090000783 Renin Proteins 0.000 description 3
- 229920005654 Sephadex Polymers 0.000 description 3
- 239000012507 Sephadex™ Substances 0.000 description 3
- MTCFGRXMJLQNBG-UHFFFAOYSA-N Serine Natural products OCC(N)C(O)=O MTCFGRXMJLQNBG-UHFFFAOYSA-N 0.000 description 3
- 235000008206 alpha-amino acids Nutrition 0.000 description 3
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 3
- 230000004872 arterial blood pressure Effects 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- QXZGBUJJYSLZLT-FDISYFBBSA-N bradykinin Chemical compound NC(=N)NCCC[C@H](N)C(=O)N1CCC[C@H]1C(=O)N1[C@H](C(=O)NCC(=O)N[C@@H](CC=2C=CC=CC=2)C(=O)N[C@@H](CO)C(=O)N2[C@@H](CCC2)C(=O)N[C@@H](CC=2C=CC=CC=2)C(=O)N[C@@H](CCCNC(N)=N)C(O)=O)CCC1 QXZGBUJJYSLZLT-FDISYFBBSA-N 0.000 description 3
- 239000002775 capsule Substances 0.000 description 3
- RBHJBMIOOPYDBQ-UHFFFAOYSA-N carbon dioxide;propan-2-one Chemical compound O=C=O.CC(C)=O RBHJBMIOOPYDBQ-UHFFFAOYSA-N 0.000 description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 3
- 238000004440 column chromatography Methods 0.000 description 3
- 230000008878 coupling Effects 0.000 description 3
- 238000006698 hydrazinolysis reaction Methods 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 3
- 235000019341 magnesium sulphate Nutrition 0.000 description 3
- XELZGAJCZANUQH-UHFFFAOYSA-N methyl 1-acetylthieno[3,2-c]pyrazole-5-carboxylate Chemical compound CC(=O)N1N=CC2=C1C=C(C(=O)OC)S2 XELZGAJCZANUQH-UHFFFAOYSA-N 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 235000019198 oils Nutrition 0.000 description 3
- 238000004810 partition chromatography Methods 0.000 description 3
- 210000002381 plasma Anatomy 0.000 description 3
- 229920001467 poly(styrenesulfonates) Polymers 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 239000003755 preservative agent Substances 0.000 description 3
- 235000019260 propionic acid Nutrition 0.000 description 3
- 230000009467 reduction Effects 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- DLYUQMMRRRQYAE-UHFFFAOYSA-N tetraphosphorus decaoxide Chemical compound O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 3
- DZLNHFMRPBPULJ-UHFFFAOYSA-N thioproline Chemical compound OC(=O)C1CSCN1 DZLNHFMRPBPULJ-UHFFFAOYSA-N 0.000 description 3
- UXWOYJLLMYKTQJ-VIFPVBQESA-N (2s)-2-amino-4-(cyclopentylmethylsulfanyl)butanoic acid Chemical compound OC(=O)[C@@H](N)CCSCC1CCCC1 UXWOYJLLMYKTQJ-VIFPVBQESA-N 0.000 description 2
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 2
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- WFIYPADYPQQLNN-UHFFFAOYSA-N 2-[2-(4-bromopyrazol-1-yl)ethyl]isoindole-1,3-dione Chemical compound C1=C(Br)C=NN1CCN1C(=O)C2=CC=CC=C2C1=O WFIYPADYPQQLNN-UHFFFAOYSA-N 0.000 description 2
- LTLQSMNFQOAELQ-UHFFFAOYSA-N 2-amino-1,3-dihydroindene-2,5-dicarboxylic acid Chemical compound C1=C(C(O)=O)C=C2CC(N)(C(O)=O)CC2=C1 LTLQSMNFQOAELQ-UHFFFAOYSA-N 0.000 description 2
- OQFSQFPPLPISGP-UHFFFAOYSA-N 2-aminoethane-1,1,2-tricarboxylic acid Chemical compound OC(=O)C(N)C(C(O)=O)C(O)=O OQFSQFPPLPISGP-UHFFFAOYSA-N 0.000 description 2
- YAQLSKVCTLCIIE-UHFFFAOYSA-N 2-bromobutyric acid Chemical compound CCC(Br)C(O)=O YAQLSKVCTLCIIE-UHFFFAOYSA-N 0.000 description 2
- MONMFXREYOKQTI-UHFFFAOYSA-N 2-bromopropanoic acid Chemical compound CC(Br)C(O)=O MONMFXREYOKQTI-UHFFFAOYSA-N 0.000 description 2
- RSUOYCBRWUTZAO-UHFFFAOYSA-N 2-oxo-3-phenoxypropanoic acid Chemical compound OC(=O)C(=O)COC1=CC=CC=C1 RSUOYCBRWUTZAO-UHFFFAOYSA-N 0.000 description 2
- MLHLDFLQSMZQNK-UHFFFAOYSA-N 2-oxo-3-phenylpropanethioic s-acid Chemical compound SC(=O)C(=O)CC1=CC=CC=C1 MLHLDFLQSMZQNK-UHFFFAOYSA-N 0.000 description 2
- QDJVGSZTQJRNKQ-UHFFFAOYSA-N 2-oxo-4-(4-phenoxyphenyl)butanoic acid Chemical compound C1=CC(CCC(=O)C(=O)O)=CC=C1OC1=CC=CC=C1 QDJVGSZTQJRNKQ-UHFFFAOYSA-N 0.000 description 2
- TYEYBOSBBBHJIV-UHFFFAOYSA-N 2-oxobutanoic acid Chemical compound CCC(=O)C(O)=O TYEYBOSBBBHJIV-UHFFFAOYSA-N 0.000 description 2
- JTNCEQNHURODLX-UHFFFAOYSA-N 2-phenylethanimidamide Chemical compound NC(=N)CC1=CC=CC=C1 JTNCEQNHURODLX-UHFFFAOYSA-N 0.000 description 2
- YMOQJIWHKXKWDN-UHFFFAOYSA-N 3-(4-cyanophenyl)-2-oxopropanoic acid Chemical compound OC(=O)C(=O)CC1=CC=C(C#N)C=C1 YMOQJIWHKXKWDN-UHFFFAOYSA-N 0.000 description 2
- RSTKLPZEZYGQPY-UHFFFAOYSA-N 3-(indol-3-yl)pyruvic acid Chemical compound C1=CC=C2C(CC(=O)C(=O)O)=CNC2=C1 RSTKLPZEZYGQPY-UHFFFAOYSA-N 0.000 description 2
- BAQRRRYYSFQKIF-UHFFFAOYSA-N 3-methyl-2-oxobutanoyl chloride Chemical compound CC(C)C(=O)C(Cl)=O BAQRRRYYSFQKIF-UHFFFAOYSA-N 0.000 description 2
- ZKRDTNHGGOKJNM-UHFFFAOYSA-N 4-(3,4-dichlorophenyl)-2-oxobutanoic acid Chemical compound OC(=O)C(=O)CCC1=CC=C(Cl)C(Cl)=C1 ZKRDTNHGGOKJNM-UHFFFAOYSA-N 0.000 description 2
- HVCNXQOWACZAFN-UHFFFAOYSA-N 4-ethylmorpholine Chemical compound CCN1CCOCC1 HVCNXQOWACZAFN-UHFFFAOYSA-N 0.000 description 2
- BKAJNAXTPSGJCU-UHFFFAOYSA-N 4-methyl-2-oxopentanoic acid Chemical compound CC(C)CC(=O)C(O)=O BKAJNAXTPSGJCU-UHFFFAOYSA-N 0.000 description 2
- HFXAFXVXPMUQCQ-BYPYZUCNSA-N 4-oxo-L-proline Chemical compound OC(=O)[C@@H]1CC(=O)CN1 HFXAFXVXPMUQCQ-BYPYZUCNSA-N 0.000 description 2
- CIBNXHHWVVKRDY-UHFFFAOYSA-N 5-methyl-2-oxohexanoic acid Chemical compound CC(C)CCC(=O)C(O)=O CIBNXHHWVVKRDY-UHFFFAOYSA-N 0.000 description 2
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 2
- 241000167854 Bourreria succulenta Species 0.000 description 2
- 102400000967 Bradykinin Human genes 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- 229910014033 C-OH Inorganic materials 0.000 description 2
- 101100129088 Caenorhabditis elegans lys-2 gene Proteins 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- 229920002261 Corn starch Polymers 0.000 description 2
- 108010071840 Cytosol nonspecific dipeptidase Proteins 0.000 description 2
- 229910014570 C—OH Inorganic materials 0.000 description 2
- UQBOJOOOTLPNST-UHFFFAOYSA-N Dehydroalanine Chemical compound NC(=C)C(O)=O UQBOJOOOTLPNST-UHFFFAOYSA-N 0.000 description 2
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 description 2
- BWGNESOTFCXPMA-UHFFFAOYSA-N Dihydrogen disulfide Chemical compound SS BWGNESOTFCXPMA-UHFFFAOYSA-N 0.000 description 2
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 2
- 108010016626 Dipeptides Proteins 0.000 description 2
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical group CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 2
- FFFHZYDWPBMWHY-VKHMYHEASA-N L-homocysteine Chemical compound OC(=O)[C@@H](N)CCS FFFHZYDWPBMWHY-VKHMYHEASA-N 0.000 description 2
- ROHFNLRQFUQHCH-YFKPBYRVSA-N L-leucine Chemical compound CC(C)C[C@H](N)C(O)=O ROHFNLRQFUQHCH-YFKPBYRVSA-N 0.000 description 2
- AYFVYJQAPQTCCC-GBXIJSLDSA-N L-threonine Chemical compound C[C@@H](O)[C@H](N)C(O)=O AYFVYJQAPQTCCC-GBXIJSLDSA-N 0.000 description 2
- ROHFNLRQFUQHCH-UHFFFAOYSA-N Leucine Natural products CC(C)CC(N)C(O)=O ROHFNLRQFUQHCH-UHFFFAOYSA-N 0.000 description 2
- IDGQXGPQOGUGIX-VIFPVBQESA-N O-BENZYL-l-SERINE Chemical compound OC(=O)[C@@H](N)COCC1=CC=CC=C1 IDGQXGPQOGUGIX-VIFPVBQESA-N 0.000 description 2
- 239000004743 Polypropylene Substances 0.000 description 2
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- 229930006000 Sucrose Natural products 0.000 description 2
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 2
- AYFVYJQAPQTCCC-UHFFFAOYSA-N Threonine Natural products CC(O)C(N)C(O)=O AYFVYJQAPQTCCC-UHFFFAOYSA-N 0.000 description 2
- 239000004473 Threonine Substances 0.000 description 2
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- KZSNJWFQEVHDMF-UHFFFAOYSA-N Valine Chemical compound CC(C)C(N)C(O)=O KZSNJWFQEVHDMF-UHFFFAOYSA-N 0.000 description 2
- SORGEQQSQGNZFI-UHFFFAOYSA-N [azido(phenoxy)phosphoryl]oxybenzene Chemical compound C=1C=CC=CC=1OP(=O)(N=[N+]=[N-])OC1=CC=CC=C1 SORGEQQSQGNZFI-UHFFFAOYSA-N 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- 238000010306 acid treatment Methods 0.000 description 2
- ODHCTXKNWHHXJC-UHFFFAOYSA-N acide pyroglutamique Natural products OC(=O)C1CCC(=O)N1 ODHCTXKNWHHXJC-UHFFFAOYSA-N 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- 150000001371 alpha-amino acids Chemical class 0.000 description 2
- DEDGUGJNLNLJSR-UHFFFAOYSA-N alpha-hydroxycinnamic acid Natural products OC(=O)C(O)=CC1=CC=CC=C1 DEDGUGJNLNLJSR-UHFFFAOYSA-N 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 125000000539 amino acid group Chemical group 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 229940030600 antihypertensive agent Drugs 0.000 description 2
- 239000002220 antihypertensive agent Substances 0.000 description 2
- 239000003963 antioxidant agent Substances 0.000 description 2
- 235000006708 antioxidants Nutrition 0.000 description 2
- 229910052786 argon Inorganic materials 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 238000001574 biopsy Methods 0.000 description 2
- 230000000903 blocking effect Effects 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 230000015556 catabolic process Effects 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 239000003638 chemical reducing agent Substances 0.000 description 2
- 235000019693 cherries Nutrition 0.000 description 2
- 230000002860 competitive effect Effects 0.000 description 2
- 239000008120 corn starch Substances 0.000 description 2
- PFLHGSJLYNJIOF-UHFFFAOYSA-N diethyl 2-formamidopropanedioate Chemical compound CCOC(=O)C(NC=O)C(=O)OCC PFLHGSJLYNJIOF-UHFFFAOYSA-N 0.000 description 2
- 125000005982 diphenylmethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- 150000002019 disulfides Chemical class 0.000 description 2
- PMMYEEVYMWASQN-UHFFFAOYSA-N dl-hydroxyproline Natural products OC1C[NH2+]C(C([O-])=O)C1 PMMYEEVYMWASQN-UHFFFAOYSA-N 0.000 description 2
- 238000000921 elemental analysis Methods 0.000 description 2
- 230000002255 enzymatic effect Effects 0.000 description 2
- VZMQTNWZEYXCEH-KRWDZBQOSA-N ethyl (2S)-2-amino-3-(2-benzylphenyl)propanoate Chemical compound CCOC(=O)[C@@H](N)Cc1ccccc1Cc1ccccc1 VZMQTNWZEYXCEH-KRWDZBQOSA-N 0.000 description 2
- STPXIOGYOLJXMZ-UHFFFAOYSA-N ethyl 2-oxo-4-phenylbutanoate Chemical compound CCOC(=O)C(=O)CCC1=CC=CC=C1 STPXIOGYOLJXMZ-UHFFFAOYSA-N 0.000 description 2
- IIFWIQQBZUIBLR-UHFFFAOYSA-N ethyl 4-methyl-2-sulfanylhexanoate Chemical compound CCOC(=O)C(S)CC(C)CC IIFWIQQBZUIBLR-UHFFFAOYSA-N 0.000 description 2
- 210000003191 femoral vein Anatomy 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 239000012467 final product Substances 0.000 description 2
- 235000003599 food sweetener Nutrition 0.000 description 2
- 238000001640 fractional crystallisation Methods 0.000 description 2
- 125000000524 functional group Chemical group 0.000 description 2
- 125000000291 glutamic acid group Chemical group N[C@@H](CCC(O)=O)C(=O)* 0.000 description 2
- 125000002795 guanidino group Chemical group C(N)(=N)N* 0.000 description 2
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 2
- 108010016268 hippuryl-histidyl-leucine Proteins 0.000 description 2
- 150000003840 hydrochlorides Chemical class 0.000 description 2
- 238000007327 hydrogenolysis reaction Methods 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 230000001631 hypertensive effect Effects 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000013067 intermediate product Substances 0.000 description 2
- 210000000936 intestine Anatomy 0.000 description 2
- 238000007912 intraperitoneal administration Methods 0.000 description 2
- 238000001990 intravenous administration Methods 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 229960000310 isoleucine Drugs 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- GCHPUFAZSONQIV-UHFFFAOYSA-N isovaline Chemical compound CCC(C)(N)C(O)=O GCHPUFAZSONQIV-UHFFFAOYSA-N 0.000 description 2
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 125000001360 methionine group Chemical group N[C@@H](CCSC)C(=O)* 0.000 description 2
- IUXVIPGPIFGSEU-INIZCTEOSA-N methyl (2s)-2-amino-3-(4-phenylmethoxyphenyl)propanoate Chemical compound C1=CC(C[C@H](N)C(=O)OC)=CC=C1OCC1=CC=CC=C1 IUXVIPGPIFGSEU-INIZCTEOSA-N 0.000 description 2
- NKZNPRQIONEKPT-UHFFFAOYSA-N n,n-dimethyl-1-quinolin-2-ylmethanamine Chemical compound C1=CC=CC2=NC(CN(C)C)=CC=C21 NKZNPRQIONEKPT-UHFFFAOYSA-N 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 150000007530 organic bases Chemical class 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 229960003104 ornithine Drugs 0.000 description 2
- 230000001590 oxidative effect Effects 0.000 description 2
- 230000020477 pH reduction Effects 0.000 description 2
- 238000005192 partition Methods 0.000 description 2
- WEXRUCMBJFQVBZ-UHFFFAOYSA-N pentobarbital Chemical compound CCCC(C)C1(CC)C(=O)NC(=O)NC1=O WEXRUCMBJFQVBZ-UHFFFAOYSA-N 0.000 description 2
- 125000001151 peptidyl group Chemical group 0.000 description 2
- 229920001155 polypropylene Polymers 0.000 description 2
- 229910000343 potassium bisulfate Inorganic materials 0.000 description 2
- 230000003389 potentiating effect Effects 0.000 description 2
- 150000003140 primary amides Chemical class 0.000 description 2
- 235000018102 proteins Nutrition 0.000 description 2
- 102000004169 proteins and genes Human genes 0.000 description 2
- 108090000623 proteins and genes Proteins 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 230000009257 reactivity Effects 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 239000013557 residual solvent Substances 0.000 description 2
- 230000002441 reversible effect Effects 0.000 description 2
- DCKVNWZUADLDEH-UHFFFAOYSA-N sec-butyl acetate Chemical compound CCC(C)OC(C)=O DCKVNWZUADLDEH-UHFFFAOYSA-N 0.000 description 2
- 210000002966 serum Anatomy 0.000 description 2
- 229910001923 silver oxide Inorganic materials 0.000 description 2
- JHJLBTNAGRQEKS-UHFFFAOYSA-M sodium bromide Chemical compound [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 2
- 239000005720 sucrose Substances 0.000 description 2
- 150000003457 sulfones Chemical class 0.000 description 2
- 239000003765 sweetening agent Substances 0.000 description 2
- 238000001308 synthesis method Methods 0.000 description 2
- CANQRTXTMVVNCH-LBPRGKRZSA-N tert-butyl (2s)-2-amino-4-phenylbutanoate Chemical compound CC(C)(C)OC(=O)[C@@H](N)CCC1=CC=CC=C1 CANQRTXTMVVNCH-LBPRGKRZSA-N 0.000 description 2
- 150000007970 thio esters Chemical class 0.000 description 2
- 229960004441 tyrosine Drugs 0.000 description 2
- 238000005292 vacuum distillation Methods 0.000 description 2
- 229960004295 valine Drugs 0.000 description 2
- 239000004474 valine Substances 0.000 description 2
- QSLPNSWXUQHVLP-UHFFFAOYSA-N $l^{1}-sulfanylmethane Chemical compound [S]C QSLPNSWXUQHVLP-UHFFFAOYSA-N 0.000 description 1
- YSIRGMXKALGADV-LLVKDONJSA-N (2R)-4-hydroxy-2-methoxy-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butanoic acid Chemical compound C(=O)(OC(C)(C)C)N([C@@](CCO)(C(=O)O)OC)C YSIRGMXKALGADV-LLVKDONJSA-N 0.000 description 1
- BJBUEDPLEOHJGE-UHFFFAOYSA-N (2R,3S)-3-Hydroxy-2-pyrolidinecarboxylic acid Natural products OC1CCNC1C(O)=O BJBUEDPLEOHJGE-UHFFFAOYSA-N 0.000 description 1
- LTRAANAHCCCXHC-NTFOPCPOSA-N (2S)-2-amino-3-(2-hydroxy-5-methyl-6-oxo-1,2-dihydropyrimidin-3-yl)propanoic acid Chemical compound CC1=CN(C[C@H](N)C(O)=O)C(O)N=C1O LTRAANAHCCCXHC-NTFOPCPOSA-N 0.000 description 1
- SROIPITXZMZRRB-HNNXBMFYSA-N (2S)-3-[4-(4-hydroxyphenoxy)phenyl]-2-(methylamino)propanoic acid Chemical compound C1=CC(C[C@H](NC)C(O)=O)=CC=C1OC1=CC=C(O)C=C1 SROIPITXZMZRRB-HNNXBMFYSA-N 0.000 description 1
- MTQVURJWWKQMRZ-MQWKRIRWSA-N (2S)-5-(diaminomethylideneamino)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonyl-nitroamino]pentanoic acid Chemical compound C(=O)(OC(C)(C)C)N([C@@H](CC(CNC(N)=N)C)C(=O)O)[N+](=O)[O-] MTQVURJWWKQMRZ-MQWKRIRWSA-N 0.000 description 1
- MXPBQQXWXZWBMK-LLVKDONJSA-N (2r)-2,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid Chemical compound CC(C)[C@](C)(C(O)=O)NC(=O)OC(C)(C)C MXPBQQXWXZWBMK-LLVKDONJSA-N 0.000 description 1
- JAPMNWXYNYHZGZ-QMMMGPOBSA-N (2r)-2-amino-2-methyl-3-(2-methylpropylsulfanyl)propanoic acid Chemical compound CC(C)CSC[C@](C)(N)C(O)=O JAPMNWXYNYHZGZ-QMMMGPOBSA-N 0.000 description 1
- JQZCNHYREAEVKK-VIFPVBQESA-N (2r)-2-amino-2-methyl-3-(3-methylbutylsulfanyl)propanoic acid Chemical compound CC(C)CCSC[C@](C)(N)C(O)=O JQZCNHYREAEVKK-VIFPVBQESA-N 0.000 description 1
- LWKUSWORIVQIAU-YFKPBYRVSA-N (2r)-2-amino-2-methyl-3-methylsulfanylpropanoic acid Chemical compound CSC[C@](C)(N)C(O)=O LWKUSWORIVQIAU-YFKPBYRVSA-N 0.000 description 1
- DKKTXYCCRGEHPC-VIFPVBQESA-N (2r)-2-amino-2-methyl-3-pentylsulfanylpropanoic acid Chemical compound CCCCCSC[C@](C)(N)C(O)=O DKKTXYCCRGEHPC-VIFPVBQESA-N 0.000 description 1
- ZRBBFADVPJQXFF-ZETCQYMHSA-N (2r)-2-amino-2-methyl-3-propan-2-ylsulfanylpropanoic acid Chemical compound CC(C)SC[C@](C)(N)C(O)=O ZRBBFADVPJQXFF-ZETCQYMHSA-N 0.000 description 1
- LFLCENOSUFBYGP-ZETCQYMHSA-N (2r)-2-amino-2-methyl-3-propylsulfanylpropanoic acid Chemical compound CCCSC[C@](C)(N)C(O)=O LFLCENOSUFBYGP-ZETCQYMHSA-N 0.000 description 1
- PPNFGVZDIOCWDK-QMMMGPOBSA-N (2r)-2-amino-3-butylsulfanyl-2-methylpropanoic acid Chemical compound CCCCSC[C@](C)(N)C(O)=O PPNFGVZDIOCWDK-QMMMGPOBSA-N 0.000 description 1
- LZDAORHYUMEQGT-LURJTMIESA-N (2r)-2-amino-3-ethylsulfanyl-2-methylpropanoic acid Chemical compound CCSC[C@](C)(N)C(O)=O LZDAORHYUMEQGT-LURJTMIESA-N 0.000 description 1
- NMJNPLIFGMSGNZ-QMMMGPOBSA-N (2r)-2-amino-3-tert-butylsulfanyl-2-methylpropanoic acid Chemical compound CC(C)(C)SC[C@](C)(N)C(O)=O NMJNPLIFGMSGNZ-QMMMGPOBSA-N 0.000 description 1
- KIPDMPPOTUGMPW-SNVBAGLBSA-N (2r)-2-amino-4-benzylsulfanylbutanoic acid Chemical compound OC(=O)[C@H](N)CCSCC1=CC=CC=C1 KIPDMPPOTUGMPW-SNVBAGLBSA-N 0.000 description 1
- YOFPFYYTUIARDI-ZCFIWIBFSA-N (2r)-2-aminooctanedioic acid Chemical compound OC(=O)[C@H](N)CCCCCC(O)=O YOFPFYYTUIARDI-ZCFIWIBFSA-N 0.000 description 1
- UXODLFPSCPTZAE-JTQLQIEISA-N (2r)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-methylsulfanylpropanoic acid Chemical compound CSC[C@@](C)(C(O)=O)NC(=O)OC(C)(C)C UXODLFPSCPTZAE-JTQLQIEISA-N 0.000 description 1
- HRTQWVNNCOTUNZ-ZDUSSCGKSA-N (2r)-3-tert-butylsulfanyl-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid Chemical compound CC(C)(C)OC(=O)N[C@](C)(C(O)=O)CSC(C)(C)C HRTQWVNNCOTUNZ-ZDUSSCGKSA-N 0.000 description 1
- GKCBQPXKGNTQKX-VDGAXYAQSA-N (2s)-1-[(2s)-2-[[(2s)-2-benzamido-3-phenylpropanoyl]amino]propanoyl]pyrrolidine-2-carboxylic acid Chemical compound C([C@@H](C(=O)N[C@@H](C)C(=O)N1[C@@H](CCC1)C(O)=O)NC(=O)C=1C=CC=CC=1)C1=CC=CC=C1 GKCBQPXKGNTQKX-VDGAXYAQSA-N 0.000 description 1
- DAOGFHQPAHSMQS-LURJTMIESA-N (2s)-1-propanoylpyrrolidine-2-carboxylic acid Chemical compound CCC(=O)N1CCC[C@H]1C(O)=O DAOGFHQPAHSMQS-LURJTMIESA-N 0.000 description 1
- OMGHIGVFLOPEHJ-BYPYZUCNSA-N (2s)-2,5-dihydro-1h-pyrrole-2-carboxylic acid Chemical compound OC(=O)[C@H]1NCC=C1 OMGHIGVFLOPEHJ-BYPYZUCNSA-N 0.000 description 1
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- QTOUZGRCRVLFHQ-BYPYZUCNSA-N (2s)-2-(2,4,5-trihydroxyanilino)propanoic acid Chemical compound OC(=O)[C@H](C)NC1=CC(O)=C(O)C=C1O QTOUZGRCRVLFHQ-BYPYZUCNSA-N 0.000 description 1
- FOYXZVHDLXZETB-LBPRGKRZSA-N (2s)-2-(benzylazaniumyl)-3-(1h-imidazol-5-yl)propanoate Chemical compound C([C@@H](C(=O)O)NCC=1C=CC=CC=1)C1=CNC=N1 FOYXZVHDLXZETB-LBPRGKRZSA-N 0.000 description 1
- UBZLAKLDZOATNF-YFKPBYRVSA-N (2s)-2-(dihydroxyamino)-4-methylpentanoic acid Chemical compound CC(C)C[C@H](N(O)O)C(O)=O UBZLAKLDZOATNF-YFKPBYRVSA-N 0.000 description 1
- HSPALBCOMMFFNI-YFKXAPIDSA-N (2s)-2-(dimethylamino)-3-[4-(4-hydroxyphenoxy)phenyl]-2-methylbutanoic acid Chemical compound C1=CC(C(C)[C@](C)(N(C)C)C(O)=O)=CC=C1OC1=CC=C(O)C=C1 HSPALBCOMMFFNI-YFKXAPIDSA-N 0.000 description 1
- QVHJQCGUWFKTSE-YFKPBYRVSA-N (2s)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid Chemical compound OC(=O)[C@H](C)NC(=O)OC(C)(C)C QVHJQCGUWFKTSE-YFKPBYRVSA-N 0.000 description 1
- HBFHGJUIEHIHFT-MACXSXHHSA-N (2s)-2-[[(2r,3s,4r,5r)-5-(2-amino-6-oxo-3h-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylamino]-4-sulfanylbutanoic acid Chemical compound C1=2NC(N)=NC(=O)C=2N=CN1[C@@H]1O[C@H](CN[C@@H](CCS)C(O)=O)[C@@H](O)[C@H]1O HBFHGJUIEHIHFT-MACXSXHHSA-N 0.000 description 1
- FICCYWIDRZLXIS-ZETCQYMHSA-N (2s)-2-amino-3-(1h-pyrrolo[3,2-b]pyridin-3-yl)propanoic acid Chemical compound C1=CN=C2C(C[C@H](N)C(O)=O)=CNC2=C1 FICCYWIDRZLXIS-ZETCQYMHSA-N 0.000 description 1
- YYTDJPUFAVPHQA-VKHMYHEASA-N (2s)-2-amino-3-(2,3,4,5,6-pentafluorophenyl)propanoic acid Chemical compound OC(=O)[C@@H](N)CC1=C(F)C(F)=C(F)C(F)=C1F YYTDJPUFAVPHQA-VKHMYHEASA-N 0.000 description 1
- JFDDIQNKNLUINS-LURJTMIESA-N (2s)-2-amino-3-(2,3,5,6-tetrafluorophenyl)propanoic acid Chemical compound OC(=O)[C@@H](N)CC1=C(F)C(F)=CC(F)=C1F JFDDIQNKNLUINS-LURJTMIESA-N 0.000 description 1
- YHYQITHAFYELNW-QMMMGPOBSA-N (2s)-2-amino-3-(2,5-difluorophenyl)propanoic acid Chemical compound OC(=O)[C@@H](N)CC1=CC(F)=CC=C1F YHYQITHAFYELNW-QMMMGPOBSA-N 0.000 description 1
- MWCDQZBPLTYYSP-VIFPVBQESA-N (2s)-2-amino-3-(2,5-dimethoxy-4-methylphenyl)propanoic acid Chemical compound COC1=CC(C[C@H](N)C(O)=O)=C(OC)C=C1C MWCDQZBPLTYYSP-VIFPVBQESA-N 0.000 description 1
- WVXAXDTZEMZHQB-BYPYZUCNSA-N (2s)-2-amino-3-(2-aminoethylamino)propanoic acid Chemical compound NCCNC[C@H](N)C(O)=O WVXAXDTZEMZHQB-BYPYZUCNSA-N 0.000 description 1
- BRONSICUNQRLFP-QMMMGPOBSA-N (2s)-2-amino-3-(2-ethyl-4,5-dihydroxyphenyl)propanoic acid Chemical compound CCC1=CC(O)=C(O)C=C1C[C@H](N)C(O)=O BRONSICUNQRLFP-QMMMGPOBSA-N 0.000 description 1
- XAFNUWVLFYOQSL-ZETCQYMHSA-N (2s)-2-amino-3-(2-hydroxy-5-nitrophenyl)propanoic acid Chemical compound OC(=O)[C@@H](N)CC1=CC([N+]([O-])=O)=CC=C1O XAFNUWVLFYOQSL-ZETCQYMHSA-N 0.000 description 1
- IOYWTNNHQPFPDP-VIFPVBQESA-N (2s)-2-amino-3-(2-tert-butyl-4,5-dihydroxyphenyl)propanoic acid Chemical compound CC(C)(C)C1=CC(O)=C(O)C=C1C[C@H](N)C(O)=O IOYWTNNHQPFPDP-VIFPVBQESA-N 0.000 description 1
- MXXMBZQIPZDATA-ZETCQYMHSA-N (2s)-2-amino-3-(3,4,5-triiodophenyl)propanoic acid Chemical compound OC(=O)[C@@H](N)CC1=CC(I)=C(I)C(I)=C1 MXXMBZQIPZDATA-ZETCQYMHSA-N 0.000 description 1
- QFGMPXZFCIHYIR-QMMMGPOBSA-N (2s)-2-amino-3-(3,5-difluorophenyl)propanoic acid Chemical compound OC(=O)[C@@H](N)CC1=CC(F)=CC(F)=C1 QFGMPXZFCIHYIR-QMMMGPOBSA-N 0.000 description 1
- NSCSKUVWGVFCLY-JTQLQIEISA-N (2s)-2-amino-3-(3-bromophenyl)-2-methylpropanoic acid Chemical compound OC(=O)[C@](N)(C)CC1=CC=CC(Br)=C1 NSCSKUVWGVFCLY-JTQLQIEISA-N 0.000 description 1
- GLWVGMMAPQLEKR-LBPRGKRZSA-N (2s)-2-amino-3-(3-ethyl-4-hydroxyphenyl)-2-methylpropanoic acid Chemical compound CCC1=CC(C[C@](C)(N)C(O)=O)=CC=C1O GLWVGMMAPQLEKR-LBPRGKRZSA-N 0.000 description 1
- FQZGACCJFXQSCQ-JTQLQIEISA-N (2s)-2-amino-3-(3-fluorophenyl)-2-methylpropanoic acid Chemical compound OC(=O)[C@](N)(C)CC1=CC=CC(F)=C1 FQZGACCJFXQSCQ-JTQLQIEISA-N 0.000 description 1
- JFAXKBVMETZAFM-AWEZNQCLSA-N (2s)-2-amino-3-(3-tert-butyl-4-hydroxyphenyl)-2-methylpropanoic acid Chemical compound CC(C)(C)C1=CC(C[C@](C)(N)C(O)=O)=CC=C1O JFAXKBVMETZAFM-AWEZNQCLSA-N 0.000 description 1
- ZQCYJCMADFAKAA-ZETCQYMHSA-N (2s)-2-amino-3-(4,5-dihydroxy-2-methylphenyl)propanoic acid Chemical compound CC1=CC(O)=C(O)C=C1C[C@H](N)C(O)=O ZQCYJCMADFAKAA-ZETCQYMHSA-N 0.000 description 1
- JDWSIKUNMDDGCF-VIFPVBQESA-N (2s)-2-amino-3-(4,5-dihydroxy-2-propan-2-ylphenyl)propanoic acid Chemical compound CC(C)C1=CC(O)=C(O)C=C1C[C@H](N)C(O)=O JDWSIKUNMDDGCF-VIFPVBQESA-N 0.000 description 1
- XPRCPVGCTGELMN-QMMMGPOBSA-N (2s)-2-amino-3-(4-carbamimidoylphenyl)propanoic acid Chemical compound OC(=O)[C@@H](N)CC1=CC=C(C(N)=N)C=C1 XPRCPVGCTGELMN-QMMMGPOBSA-N 0.000 description 1
- VYGOZODJYPOFTR-ZDUSSCGKSA-N (2s)-2-amino-3-(4-hydroxy-3-propan-2-ylphenyl)-2-methylpropanoic acid Chemical compound CC(C)C1=CC(C[C@](C)(N)C(O)=O)=CC=C1O VYGOZODJYPOFTR-ZDUSSCGKSA-N 0.000 description 1
- DQLHSFUMICQIMB-VIFPVBQESA-N (2s)-2-amino-3-(4-methylphenyl)propanoic acid Chemical compound CC1=CC=C(C[C@H](N)C(O)=O)C=C1 DQLHSFUMICQIMB-VIFPVBQESA-N 0.000 description 1
- YTWNUUSHKAQWDZ-VKZKZBKNSA-N (2s)-2-amino-3-(4-nitroimidazol-4-yl)propanoic acid Chemical compound OC(=O)[C@@H](N)CC1([N+]([O-])=O)C=NC=N1 YTWNUUSHKAQWDZ-VKZKZBKNSA-N 0.000 description 1
- DKZIJCYVZNQMAU-QMMMGPOBSA-N (2s)-2-amino-3-(4-sulfanylphenyl)propanoic acid Chemical compound OC(=O)[C@@H](N)CC1=CC=C(S)C=C1 DKZIJCYVZNQMAU-QMMMGPOBSA-N 0.000 description 1
- PPHXPZMIUIDJKV-ZETCQYMHSA-N (2s)-2-amino-3-(6-chloro-4-methyl-1h-pyrrolo[2,3-b]pyridin-3-yl)propanoic acid Chemical compound CC1=CC(Cl)=NC2=C1C(C[C@H](N)C(O)=O)=CN2 PPHXPZMIUIDJKV-ZETCQYMHSA-N 0.000 description 1
- BZTOZLYJRLNNAY-BYPYZUCNSA-N (2s)-2-amino-3-(6-oxo-3h-purin-9-yl)propanoic acid Chemical compound N1=CN=C2N(C[C@H](N)C(O)=O)C=NC2=C1O BZTOZLYJRLNNAY-BYPYZUCNSA-N 0.000 description 1
- ZQTURUOHWQFTNS-DHRDCHLVSA-N (2s)-2-amino-3-[3,5-di(butan-2-yl)-4-(4-hydroxy-3-iodophenoxy)phenyl]propanoic acid Chemical compound CCC(C)C1=CC(C[C@H](N)C(O)=O)=CC(C(C)CC)=C1OC1=CC=C(O)C(I)=C1 ZQTURUOHWQFTNS-DHRDCHLVSA-N 0.000 description 1
- XLZGQPNBZQUBNI-QMMMGPOBSA-N (2s)-2-amino-3-[3-[(2-chloroacetyl)amino]-4-fluorophenyl]propanoic acid Chemical compound OC(=O)[C@@H](N)CC1=CC=C(F)C(NC(=O)CCl)=C1 XLZGQPNBZQUBNI-QMMMGPOBSA-N 0.000 description 1
- LYNSNQULPIJXAO-DHRDCHLVSA-N (2s)-2-amino-3-[4-(3-bromo-4-hydroxyphenoxy)-3,5-di(butan-2-yl)phenyl]propanoic acid Chemical compound CCC(C)C1=CC(C[C@H](N)C(O)=O)=CC(C(C)CC)=C1OC1=CC=C(O)C(Br)=C1 LYNSNQULPIJXAO-DHRDCHLVSA-N 0.000 description 1
- YZTKBJWKYGBVPL-SFHVURJKSA-N (2s)-2-amino-3-[4-(3-bromo-4-hydroxyphenoxy)-3,5-di(propan-2-yl)phenyl]propanoic acid Chemical compound CC(C)C1=CC(C[C@H](N)C(O)=O)=CC(C(C)C)=C1OC1=CC=C(O)C(Br)=C1 YZTKBJWKYGBVPL-SFHVURJKSA-N 0.000 description 1
- QHHWMOKQVCJRPS-KRWDZBQOSA-N (2s)-2-amino-3-[4-(4-hydroxy-3-propan-2-ylphenoxy)-3,5-dimethylphenyl]propanoic acid Chemical compound C1=C(O)C(C(C)C)=CC(OC=2C(=CC(C[C@H](N)C(O)=O)=CC=2C)C)=C1 QHHWMOKQVCJRPS-KRWDZBQOSA-N 0.000 description 1
- FLSWNGNXLWAVMK-IBGZPJMESA-N (2s)-2-amino-3-[4-(4-hydroxyphenoxy)-3,5-di(propan-2-yl)phenyl]propanoic acid Chemical compound CC(C)C1=CC(C[C@H](N)C(O)=O)=CC(C(C)C)=C1OC1=CC=C(O)C=C1 FLSWNGNXLWAVMK-IBGZPJMESA-N 0.000 description 1
- FYMNTAQFDTZISY-QMMMGPOBSA-N (2s)-2-amino-3-[4-(diaminomethylideneamino)phenyl]propanoic acid Chemical compound OC(=O)[C@@H](N)CC1=CC=C(N=C(N)N)C=C1 FYMNTAQFDTZISY-QMMMGPOBSA-N 0.000 description 1
- OXNUZCWFCJRJSU-VIFPVBQESA-N (2s)-2-amino-3-[4-(hydroxymethyl)phenyl]propanoic acid Chemical compound OC(=O)[C@@H](N)CC1=CC=C(CO)C=C1 OXNUZCWFCJRJSU-VIFPVBQESA-N 0.000 description 1
- YNLOZYCMUQNFNZ-VIFPVBQESA-N (2s)-2-amino-3-[4-[(2-bromoacetyl)amino]phenyl]propanoic acid Chemical compound OC(=O)[C@@H](N)CC1=CC=C(NC(=O)CBr)C=C1 YNLOZYCMUQNFNZ-VIFPVBQESA-N 0.000 description 1
- GHBAYRBVXCRIHT-SECBINFHSA-N (2s)-2-amino-3-benzylsulfanylpropanoic acid Chemical compound OC(=O)[C@H](N)CSCC1=CC=CC=C1 GHBAYRBVXCRIHT-SECBINFHSA-N 0.000 description 1
- LXRUAYBIUSUULX-NFJMKROFSA-N (2s)-2-amino-3-methylbutanedioic acid Chemical compound OC(=O)C(C)[C@H](N)C(O)=O LXRUAYBIUSUULX-NFJMKROFSA-N 0.000 description 1
- CXIYBDIJKQJUMN-QMMMGPOBSA-N (2s)-2-anilino-3-hydroxypropanoic acid Chemical compound OC[C@@H](C(O)=O)NC1=CC=CC=C1 CXIYBDIJKQJUMN-QMMMGPOBSA-N 0.000 description 1
- UEFLPVKMPDEMFW-QMMMGPOBSA-N (2s)-2-azaniumyl-3-(2,4-difluorophenyl)propanoate Chemical compound [O-]C(=O)[C@@H]([NH3+])CC1=CC=C(F)C=C1F UEFLPVKMPDEMFW-QMMMGPOBSA-N 0.000 description 1
- RCYLCZQGMUWCBV-JTQLQIEISA-N (2s)-2-azaniumyl-3-(3-iodophenyl)-2-methylpropanoate Chemical compound OC(=O)[C@](N)(C)CC1=CC=CC(I)=C1 RCYLCZQGMUWCBV-JTQLQIEISA-N 0.000 description 1
- VSWSDTLXDWESGZ-AWEZNQCLSA-N (2s)-3-[4-(4-hydroxyphenoxy)phenyl]-2-(iodoamino)propanoic acid Chemical compound C1=CC(C[C@@H](C(=O)O)NI)=CC=C1OC1=CC=C(O)C=C1 VSWSDTLXDWESGZ-AWEZNQCLSA-N 0.000 description 1
- RUQLVQSODALTBB-KRWDZBQOSA-N (2s)-3-[4-(4-hydroxyphenoxy)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid Chemical compound C1=CC(C[C@H](NC(=O)OC(C)(C)C)C(O)=O)=CC=C1OC1=CC=C(O)C=C1 RUQLVQSODALTBB-KRWDZBQOSA-N 0.000 description 1
- IAYDKLHSZNCWJF-SECBINFHSA-N (2s)-3-fluoro-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid Chemical compound CC(C)(C)OC(=O)N[C@](C)(CF)C(O)=O IAYDKLHSZNCWJF-SECBINFHSA-N 0.000 description 1
- HEGVMKCCKXABPX-ZDUSSCGKSA-N (2s)-4-(3-acetamido-2,4,6-triiodophenyl)-2-amino-2-methylbutanoic acid Chemical compound CC(=O)NC1=C(I)C=C(I)C(CC[C@](C)(N)C(O)=O)=C1I HEGVMKCCKXABPX-ZDUSSCGKSA-N 0.000 description 1
- HSQIYOPBCOPMSS-ZETCQYMHSA-N (2s)-5-(diaminomethylideneamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid Chemical compound CC(C)(C)OC(=O)N[C@H](C(O)=O)CCCN=C(N)N HSQIYOPBCOPMSS-ZETCQYMHSA-N 0.000 description 1
- DCUQRNAKJBVFDN-ZETCQYMHSA-N (2s)-5-(diaminomethylideneazaniumyl)-2-[(2-methylpropan-2-yl)oxycarbonyl-nitroamino]pentanoate Chemical compound CC(C)(C)OC(=O)N([N+]([O-])=O)[C@H](C(O)=O)CCCNC(N)=N DCUQRNAKJBVFDN-ZETCQYMHSA-N 0.000 description 1
- VVNYDCGZZSTUBC-LURJTMIESA-N (2s)-5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid Chemical compound CC(C)(C)OC(=O)N[C@H](C(O)=O)CCC(N)=O VVNYDCGZZSTUBC-LURJTMIESA-N 0.000 description 1
- QJCNLJWUIOIMMF-YUMQZZPRSA-N (2s,3s)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid Chemical compound CC[C@H](C)[C@@H](C(O)=O)NC(=O)OC(C)(C)C QJCNLJWUIOIMMF-YUMQZZPRSA-N 0.000 description 1
- HGRWHBQLRXWSLV-DEOSSOPVSA-N (4s)-3'-(3,6-dihydro-2h-pyran-5-yl)-1'-fluoro-7'-(3-fluoropyridin-2-yl)spiro[5h-1,3-oxazole-4,5'-chromeno[2,3-c]pyridine]-2-amine Chemical compound C1OC(N)=N[C@]21C1=CC(C=3COCCC=3)=NC(F)=C1OC1=CC=C(C=3C(=CC=CN=3)F)C=C12 HGRWHBQLRXWSLV-DEOSSOPVSA-N 0.000 description 1
- FJQZXCPWAGYPSD-UHFFFAOYSA-N 1,3,4,6-tetrachloro-3a,6a-diphenylimidazo[4,5-d]imidazole-2,5-dione Chemical compound ClN1C(=O)N(Cl)C2(C=3C=CC=CC=3)N(Cl)C(=O)N(Cl)C12C1=CC=CC=C1 FJQZXCPWAGYPSD-UHFFFAOYSA-N 0.000 description 1
- CWZUTHDJLNZLCM-DFBGVHRSSA-N 1-[2-[(1r,3s,5r)-3-[(6-bromopyridin-2-yl)carbamoyl]-2-azabicyclo[3.1.0]hexan-2-yl]-2-oxoethyl]indazole-3-carboxamide Chemical compound O=C([C@@H]1C[C@H]2C[C@H]2N1C(=O)CN1N=C(C2=CC=CC=C21)C(=O)N)NC1=CC=CC(Br)=N1 CWZUTHDJLNZLCM-DFBGVHRSSA-N 0.000 description 1
- APAZZDBYJISGLX-UHFFFAOYSA-N 1-bromo-4-phenylbutan-2-one Chemical compound BrCC(=O)CCC1=CC=CC=C1 APAZZDBYJISGLX-UHFFFAOYSA-N 0.000 description 1
- RZYHXKLKJRGJGP-UHFFFAOYSA-N 2,2,2-trifluoro-n,n-bis(trimethylsilyl)acetamide Chemical compound C[Si](C)(C)N([Si](C)(C)C)C(=O)C(F)(F)F RZYHXKLKJRGJGP-UHFFFAOYSA-N 0.000 description 1
- VXFFUPQANCMCHK-UHFFFAOYSA-N 2-(2-amino-4-oxocyclohexa-1,5-dien-1-yl)hexanoic acid Chemical compound CCCCC(C(O)=O)C1=C(N)CC(=O)C=C1 VXFFUPQANCMCHK-UHFFFAOYSA-N 0.000 description 1
- AUYIERBBYROJDD-UHFFFAOYSA-N 2-(2-aminoindol-2-yl)acetic acid Chemical compound C1=CC=CC2=NC(N)(CC(O)=O)C=C21 AUYIERBBYROJDD-UHFFFAOYSA-N 0.000 description 1
- APAUAYLVDHNFBF-UHFFFAOYSA-N 2-(2-hydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid Chemical compound N1C(C(=O)O)CSC1C1=CC=CC=C1O APAUAYLVDHNFBF-UHFFFAOYSA-N 0.000 description 1
- LYBUHXDWRMVACI-UHFFFAOYSA-N 2-(3-amino-3-carboxypropyl)-1,3-thiazole-4-carboxylic acid Chemical compound OC(=O)C(N)CCC1=NC(C(O)=O)=CS1 LYBUHXDWRMVACI-UHFFFAOYSA-N 0.000 description 1
- PRNFQNXJCUGXNZ-UHFFFAOYSA-N 2-(6-oxocyclohexa-2,4-dien-1-yl)butanoic acid Chemical compound CCC(C(O)=O)C1C=CC=CC1=O PRNFQNXJCUGXNZ-UHFFFAOYSA-N 0.000 description 1
- UZAGRLZNUCTZIT-UHFFFAOYSA-N 2-(dimethylamino)ethyl 2-oxo-4-phenylbutanoate Chemical compound CN(C)CCOC(=O)C(=O)CCC1=CC=CC=C1 UZAGRLZNUCTZIT-UHFFFAOYSA-N 0.000 description 1
- LUQBDMIQOXUAEQ-UHFFFAOYSA-N 2-[2-bromo-4-[(2-methylpropan-2-yl)oxy]phenyl]acetic acid Chemical compound CC(C)(C)OC1=CC=C(CC(O)=O)C(Br)=C1 LUQBDMIQOXUAEQ-UHFFFAOYSA-N 0.000 description 1
- JKMHFZQWWAIEOD-UHFFFAOYSA-N 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid Chemical compound OCC[NH+]1CCN(CCS([O-])(=O)=O)CC1 JKMHFZQWWAIEOD-UHFFFAOYSA-N 0.000 description 1
- LLBKEUTWJFQRJU-UHFFFAOYSA-N 2-[4-(4-aminophenyl)sulfonylanilino]ethanol Chemical group C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(NCCO)C=C1 LLBKEUTWJFQRJU-UHFFFAOYSA-N 0.000 description 1
- LQIVQJXEBHFIRB-UHFFFAOYSA-N 2-[carbamimidoyl(nitro)amino]pentanoic acid Chemical compound CCCC(C(O)=O)N(C(N)=N)[N+]([O-])=O LQIVQJXEBHFIRB-UHFFFAOYSA-N 0.000 description 1
- VWZZNLSWJZJYCQ-UHFFFAOYSA-N 2-acetamidoethyl 2-oxo-4-phenylbutanoate Chemical compound CC(=O)NCCOC(=O)C(=O)CCC1=CC=CC=C1 VWZZNLSWJZJYCQ-UHFFFAOYSA-N 0.000 description 1
- YZLMTHNLBVMABH-UHFFFAOYSA-N 2-amino-2-bromo-6-[(2-methylpropan-2-yl)oxy]-6-oxohexanoic acid Chemical compound CC(C)(C)OC(=O)CCCC(N)(Br)C(O)=O YZLMTHNLBVMABH-UHFFFAOYSA-N 0.000 description 1
- LTDTUZSHTIJYIF-UHFFFAOYSA-N 2-amino-2-methyl-4-oxo-6-phenylhexanoic acid Chemical compound OC(=O)C(N)(C)CC(=O)CCC1=CC=CC=C1 LTDTUZSHTIJYIF-UHFFFAOYSA-N 0.000 description 1
- QHSCIWIRXWFIGH-UHFFFAOYSA-N 2-amino-2-methylpentanedioic acid Chemical compound OC(=O)C(N)(C)CCC(O)=O QHSCIWIRXWFIGH-UHFFFAOYSA-N 0.000 description 1
- ATGSPCNBGHEKRW-UHFFFAOYSA-N 2-amino-3,3-dimethylhex-5-enoic acid Chemical compound C=CCC(C)(C)C(N)C(O)=O ATGSPCNBGHEKRW-UHFFFAOYSA-N 0.000 description 1
- BEFUFPUMGNJZEV-UHFFFAOYSA-N 2-amino-3,3-dimethylhexa-4,5-dienoic acid Chemical compound C=C=CC(C)(C)C(N)C(O)=O BEFUFPUMGNJZEV-UHFFFAOYSA-N 0.000 description 1
- FNEBZSUXWSCLSN-UHFFFAOYSA-N 2-amino-3,3-dimethylnona-4,5-dienoic acid Chemical compound CCCC=C=CC(C)(C)C(N)C(O)=O FNEBZSUXWSCLSN-UHFFFAOYSA-N 0.000 description 1
- XNLKIKNNGCSKQU-UHFFFAOYSA-N 2-amino-3-(4-fluoroimidazol-4-yl)propanoic acid Chemical compound OC(=O)C(N)CC1(F)C=NC=N1 XNLKIKNNGCSKQU-UHFFFAOYSA-N 0.000 description 1
- VBCSMZMAPIIUJQ-UHFFFAOYSA-N 2-amino-3-[4-(4-hydroxy-3-propan-2-ylphenoxy)-3,5-di(propan-2-yl)phenyl]propanoic acid Chemical compound C1=C(O)C(C(C)C)=CC(OC=2C(=CC(CC(N)C(O)=O)=CC=2C(C)C)C(C)C)=C1 VBCSMZMAPIIUJQ-UHFFFAOYSA-N 0.000 description 1
- QAAAJCNONHZRTG-UHFFFAOYSA-N 2-amino-3-chloropentanedioic acid Chemical compound OC(=O)C(N)C(Cl)CC(O)=O QAAAJCNONHZRTG-UHFFFAOYSA-N 0.000 description 1
- LIAMCTICNTVEHD-UHFFFAOYSA-N 2-amino-3-hydroxy-6-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexanoic acid Chemical compound CC(C)(C)OC(=O)CCC(O)C(N)(C(O)=O)NC(=O)OC(C)(C)C LIAMCTICNTVEHD-UHFFFAOYSA-N 0.000 description 1
- DJJDVURDQUREHS-UHFFFAOYSA-N 2-amino-3-methoxy-3-oxopropanoic acid Chemical compound COC(=O)C(N)C(O)=O DJJDVURDQUREHS-UHFFFAOYSA-N 0.000 description 1
- RAQYONYLNDYWKY-UHFFFAOYSA-N 2-amino-3-methylhepta-5,6-dienoic acid Chemical compound OC(=O)C(N)C(C)CC=C=C RAQYONYLNDYWKY-UHFFFAOYSA-N 0.000 description 1
- AKOINERHKFEQLT-UHFFFAOYSA-N 2-amino-4-(1h-pyrrol-2-yl)butanoic acid Chemical compound OC(=O)C(N)CCC1=CC=CN1 AKOINERHKFEQLT-UHFFFAOYSA-N 0.000 description 1
- IFPQOXNWLSRZKX-UHFFFAOYSA-N 2-amino-4-(diaminomethylideneamino)butanoic acid Chemical compound OC(=O)C(N)CCN=C(N)N IFPQOXNWLSRZKX-UHFFFAOYSA-N 0.000 description 1
- OZIXMSIQZYAGGK-UHFFFAOYSA-N 2-amino-4-(methylamino)butanoic acid Chemical compound CNCCC(N)C(O)=O OZIXMSIQZYAGGK-UHFFFAOYSA-N 0.000 description 1
- KUPUYBKLZDKJSY-UHFFFAOYSA-N 2-amino-4-oxo-6-phenylhexanoic acid Chemical compound OC(=O)C(N)CC(=O)CCC1=CC=CC=C1 KUPUYBKLZDKJSY-UHFFFAOYSA-N 0.000 description 1
- GTUZDCUWVAGCRP-UHFFFAOYSA-N 2-amino-5,6-dihydroxy-1,3-dihydroindene-2-carboxylic acid Chemical compound OC1=C(O)C=C2CC(N)(C(O)=O)CC2=C1 GTUZDCUWVAGCRP-UHFFFAOYSA-N 0.000 description 1
- ZSXABAHJUIZMEM-UHFFFAOYSA-N 2-amino-5-(1h-pyrrol-2-yl)pentanoic acid Chemical compound OC(=O)C(N)CCCC1=CC=CN1 ZSXABAHJUIZMEM-UHFFFAOYSA-N 0.000 description 1
- WMXIVLBPMFZRLM-UHFFFAOYSA-N 2-amino-5-bromo-1,3-dihydroindene-2-carboxylic acid Chemical compound C1=C(Br)C=C2CC(N)(C(O)=O)CC2=C1 WMXIVLBPMFZRLM-UHFFFAOYSA-N 0.000 description 1
- HBEFHUVCZDCVQM-UHFFFAOYSA-N 2-amino-5-chloro-1,3-dihydroindene-2-carboxylic acid Chemical compound C1=C(Cl)C=C2CC(N)(C(O)=O)CC2=C1 HBEFHUVCZDCVQM-UHFFFAOYSA-N 0.000 description 1
- XJTXTAXBACZMBN-UHFFFAOYSA-N 2-amino-5-hydroxy-1,3-dihydroindene-2-carboxylic acid Chemical compound C1=C(O)C=C2CC(N)(C(O)=O)CC2=C1 XJTXTAXBACZMBN-UHFFFAOYSA-N 0.000 description 1
- DZDAHNSLONRHLW-UHFFFAOYSA-N 2-amino-5-iodo-1,3-dihydroindene-2-carboxylic acid Chemical compound C1=C(I)C=C2CC(N)(C(O)=O)CC2=C1 DZDAHNSLONRHLW-UHFFFAOYSA-N 0.000 description 1
- XITCRIZJHHQTCH-UHFFFAOYSA-N 2-amino-5-methoxy-1,3-dihydroindene-2-carboxylic acid Chemical compound COC1=CC=C2CC(N)(C(O)=O)CC2=C1 XITCRIZJHHQTCH-UHFFFAOYSA-N 0.000 description 1
- DYCMDRVZQOLIMD-UHFFFAOYSA-N 2-amino-5-methylhepta-3,4-dienoic acid Chemical compound CCC(C)=C=CC(N)C(O)=O DYCMDRVZQOLIMD-UHFFFAOYSA-N 0.000 description 1
- OZELAETXNOXZOK-UHFFFAOYSA-N 2-aminodecanedioic acid Chemical compound OC(=O)C(N)CCCCCCCC(O)=O OZELAETXNOXZOK-UHFFFAOYSA-N 0.000 description 1
- CHXSDCXDWAXIBR-UHFFFAOYSA-N 2-aminohept-4-en-6-ynoic acid Chemical compound OC(=O)C(N)CC=CC#C CHXSDCXDWAXIBR-UHFFFAOYSA-N 0.000 description 1
- PHWDBZCRUNKABS-UHFFFAOYSA-N 2-aminohepta-4,5-dienoic acid Chemical compound CC=C=CCC(N)C(O)=O PHWDBZCRUNKABS-UHFFFAOYSA-N 0.000 description 1
- NMNDMLQYTWPKSA-UHFFFAOYSA-N 2-aminohepta-5,6-dienoic acid Chemical compound OC(=O)C(N)CCC=C=C NMNDMLQYTWPKSA-UHFFFAOYSA-N 0.000 description 1
- VDWGCMRALYSYJV-UHFFFAOYSA-N 2-aminohex-4-ynoic acid Chemical compound CC#CCC(N)C(O)=O VDWGCMRALYSYJV-UHFFFAOYSA-N 0.000 description 1
- LUYLVPILJAHRJD-UHFFFAOYSA-N 2-aminohexa-4,5-dienoic acid Chemical compound OC(=O)C(N)CC=C=C LUYLVPILJAHRJD-UHFFFAOYSA-N 0.000 description 1
- PEATYEGLPLYRIN-UHFFFAOYSA-N 2-aminononanedioic acid Chemical compound OC(=O)C(N)CCCCCCC(O)=O PEATYEGLPLYRIN-UHFFFAOYSA-N 0.000 description 1
- BKMMTJMQCTUHRP-UHFFFAOYSA-N 2-aminopropan-1-ol Chemical compound CC(N)CO BKMMTJMQCTUHRP-UHFFFAOYSA-N 0.000 description 1
- DQLYTFPAEVJTFM-UHFFFAOYSA-N 2-azaniumyl-2-(3-hydroxyphenyl)acetate Chemical compound OC(=O)C(N)C1=CC=CC(O)=C1 DQLYTFPAEVJTFM-UHFFFAOYSA-N 0.000 description 1
- DEBQMEYEKKWIKC-UHFFFAOYSA-N 2-azaniumyl-3-(4-fluoro-1h-indol-3-yl)propanoate Chemical compound C1=CC(F)=C2C(CC(N)C(O)=O)=CNC2=C1 DEBQMEYEKKWIKC-UHFFFAOYSA-N 0.000 description 1
- XRARHOAIGIRUNR-UHFFFAOYSA-N 2-azaniumyl-5-methylhex-4-enoate Chemical compound CC(C)=CCC(N)C(O)=O XRARHOAIGIRUNR-UHFFFAOYSA-N 0.000 description 1
- GXQWQJTWVARFQS-UHFFFAOYSA-N 2-benzamidoacetic acid Chemical compound OC(=O)CNC(=O)C1=CC=CC=C1.OC(=O)CNC(=O)C1=CC=CC=C1 GXQWQJTWVARFQS-UHFFFAOYSA-N 0.000 description 1
- XXSPGBOGLXKMDU-UHFFFAOYSA-N 2-bromo-2-methylpropanoic acid Chemical compound CC(C)(Br)C(O)=O XXSPGBOGLXKMDU-UHFFFAOYSA-N 0.000 description 1
- UEBARDWJXBGYEJ-UHFFFAOYSA-N 2-bromo-3-methylbutanoic acid Chemical compound CC(C)C(Br)C(O)=O UEBARDWJXBGYEJ-UHFFFAOYSA-N 0.000 description 1
- VKJQJNVYWGDEQN-UHFFFAOYSA-N 2-bromo-3-phenylmethoxypropanoic acid Chemical compound OC(=O)C(Br)COCC1=CC=CC=C1 VKJQJNVYWGDEQN-UHFFFAOYSA-N 0.000 description 1
- WDRSCFNERFONKU-UHFFFAOYSA-N 2-bromo-3-phenylpropanoic acid Chemical compound OC(=O)C(Br)CC1=CC=CC=C1 WDRSCFNERFONKU-UHFFFAOYSA-N 0.000 description 1
- MBEFIKGMUFCNOV-UHFFFAOYSA-N 2-bromo-4-oxopentanoic acid Chemical compound CC(=O)CC(Br)C(O)=O MBEFIKGMUFCNOV-UHFFFAOYSA-N 0.000 description 1
- OZGMODDEIHYPRY-UHFFFAOYSA-N 2-bromopropanoyl chloride Chemical compound CC(Br)C(Cl)=O OZGMODDEIHYPRY-UHFFFAOYSA-N 0.000 description 1
- 125000001731 2-cyanoethyl group Chemical group [H]C([H])(*)C([H])([H])C#N 0.000 description 1
- SFWQHFXRVMKCLS-UHFFFAOYSA-N 2-imidazol-1-ylpropanoic acid Chemical compound OC(=O)C(C)N1C=CN=C1 SFWQHFXRVMKCLS-UHFFFAOYSA-N 0.000 description 1
- IASIQPSVWNZTGZ-UHFFFAOYSA-N 2-methyl-2-sulfanylpentanedioic acid Chemical compound OC(=O)C(S)(C)CCC(O)=O IASIQPSVWNZTGZ-UHFFFAOYSA-N 0.000 description 1
- YOETUEMZNOLGDB-UHFFFAOYSA-N 2-methylpropyl carbonochloridate Chemical compound CC(C)COC(Cl)=O YOETUEMZNOLGDB-UHFFFAOYSA-N 0.000 description 1
- WSLKBSIXZCTCJG-UHFFFAOYSA-N 2-oxo-3-phenylmethoxypropanoic acid Chemical compound OC(=O)C(=O)COCC1=CC=CC=C1 WSLKBSIXZCTCJG-UHFFFAOYSA-N 0.000 description 1
- HXVYSVJVIUDSBN-UHFFFAOYSA-N 2-oxo-4-phenylbutanethioic s-acid Chemical compound SC(=O)C(=O)CCC1=CC=CC=C1 HXVYSVJVIUDSBN-UHFFFAOYSA-N 0.000 description 1
- AUUTXOKCFQTKPL-UHFFFAOYSA-N 2-oxopropanoyl chloride Chemical compound CC(=O)C(Cl)=O AUUTXOKCFQTKPL-UHFFFAOYSA-N 0.000 description 1
- VOOLHWPXPFEYAH-UHFFFAOYSA-N 3,3-dimethyl-2-oxopentanoic acid Chemical compound CCC(C)(C)C(=O)C(O)=O VOOLHWPXPFEYAH-UHFFFAOYSA-N 0.000 description 1
- 125000002774 3,4-dimethoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C(OC([H])([H])[H])=C1OC([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000003762 3,4-dimethoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1* 0.000 description 1
- MWOOKDULMBMMPN-UHFFFAOYSA-N 3-(2-ethyl-1,2-oxazol-2-ium-5-yl)benzenesulfonate Chemical compound O1[N+](CC)=CC=C1C1=CC=CC(S([O-])(=O)=O)=C1 MWOOKDULMBMMPN-UHFFFAOYSA-N 0.000 description 1
- KETLEKPFYHJPIN-UHFFFAOYSA-N 3-(4-nitrophenyl)-2-sulfanylpropanoic acid Chemical compound OC(=O)C(S)CC1=CC=C([N+]([O-])=O)C=C1 KETLEKPFYHJPIN-UHFFFAOYSA-N 0.000 description 1
- YASMWUYVDFUVPO-UHFFFAOYSA-N 3-amino-6-[(2-methylpropan-2-yl)oxy]-2,6-dioxohexanoic acid Chemical compound CC(C)(C)OC(=O)CCC(N)C(=O)C(O)=O YASMWUYVDFUVPO-UHFFFAOYSA-N 0.000 description 1
- NEGBRWMBIHKZDW-UHFFFAOYSA-N 3-benzylsulfanyl-3-methyl-2-oxobutanoic acid Chemical compound OC(=O)C(=O)C(C)(C)SCC1=CC=CC=C1 NEGBRWMBIHKZDW-UHFFFAOYSA-N 0.000 description 1
- FLOKBGAYTGLYGR-UHFFFAOYSA-N 3-bromo-5-methyloxolan-2-one Chemical compound CC1CC(Br)C(=O)O1 FLOKBGAYTGLYGR-UHFFFAOYSA-N 0.000 description 1
- 125000006305 3-iodophenyl group Chemical group [H]C1=C([H])C(I)=C([H])C(*)=C1[H] 0.000 description 1
- QHKABHOOEWYVLI-UHFFFAOYSA-N 3-methyl-2-oxobutanoic acid Chemical compound CC(C)C(=O)C(O)=O QHKABHOOEWYVLI-UHFFFAOYSA-N 0.000 description 1
- AYZZGFLBVPUZQH-UHFFFAOYSA-N 4-(1h-indol-3-yl)-2-oxobutanoic acid Chemical compound C1=CC=C2C(CCC(=O)C(=O)O)=CNC2=C1 AYZZGFLBVPUZQH-UHFFFAOYSA-N 0.000 description 1
- HNZMKKXVFZVKII-UHFFFAOYSA-N 4-(4-chlorophenyl)-2-oxobutanoic acid Chemical compound OC(=O)C(=O)CCC1=CC=C(Cl)C=C1 HNZMKKXVFZVKII-UHFFFAOYSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- 125000003143 4-hydroxybenzyl group Chemical group [H]C([*])([H])C1=C([H])C([H])=C(O[H])C([H])=C1[H] 0.000 description 1
- KKADPXVIOXHVKN-UHFFFAOYSA-N 4-hydroxyphenylpyruvic acid Chemical compound OC(=O)C(=O)CC1=CC=C(O)C=C1 KKADPXVIOXHVKN-UHFFFAOYSA-N 0.000 description 1
- 239000001142 4-methyl-2-oxopentanoic acid Substances 0.000 description 1
- SFJWLUAGMZINFE-UHFFFAOYSA-N 4-methyl-2-oxopentanoyl chloride Chemical compound CC(C)CC(=O)C(Cl)=O SFJWLUAGMZINFE-UHFFFAOYSA-N 0.000 description 1
- DKCOYWUJPJQANX-UHFFFAOYSA-N 4-phenyl-2-sulfanylbutanoic acid Chemical compound OC(=O)C(S)CCC1=CC=CC=C1 DKCOYWUJPJQANX-UHFFFAOYSA-N 0.000 description 1
- QNNOXNDUPDUGTC-UHFFFAOYSA-N 4-piperazin-1-ylbut-2-ynoic acid Chemical compound OC(=O)C#CCN1CCNCC1 QNNOXNDUPDUGTC-UHFFFAOYSA-N 0.000 description 1
- ITGDMPWPIYDICY-UHFFFAOYSA-N 4-piperidin-1-ylbut-2-ynoic acid Chemical compound OC(=O)C#CCN1CCCCC1 ITGDMPWPIYDICY-UHFFFAOYSA-N 0.000 description 1
- BJFBOTPLASYWPD-UHFFFAOYSA-N 4-pyrrolidin-1-ylbut-2-ynoic acid Chemical compound OC(=O)C#CCN1CCCC1 BJFBOTPLASYWPD-UHFFFAOYSA-N 0.000 description 1
- OYNANFOWNSGDJL-UHFFFAOYSA-N 4-sulfanylpyrrolidin-1-ium-2-carboxylate Chemical compound OC(=O)C1CC(S)CN1 OYNANFOWNSGDJL-UHFFFAOYSA-N 0.000 description 1
- INPQIVHQSQUEAJ-UHFFFAOYSA-N 5-fluorotryptophan Chemical compound C1=C(F)C=C2C(CC(N)C(O)=O)=CNC2=C1 INPQIVHQSQUEAJ-UHFFFAOYSA-N 0.000 description 1
- YMEXGEAJNZRQEH-UHFFFAOYSA-N 6-Fluoro-DL-tryptophan Chemical compound FC1=CC=C2C(CC(N)C(O)=O)=CNC2=C1 YMEXGEAJNZRQEH-UHFFFAOYSA-N 0.000 description 1
- UZSNAHYKHTVGRZ-UHFFFAOYSA-N 6-ethoxy-4-hydroxy-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexanoic acid Chemical compound CCOC(=O)CC(O)CC(C)(C(O)=O)NC(=O)OC(C)(C)C UZSNAHYKHTVGRZ-UHFFFAOYSA-N 0.000 description 1
- VIJOIFCZOYEASP-UHFFFAOYSA-N 6-methoxy-2,6-dioxohexanoic acid Chemical compound COC(=O)CCCC(=O)C(O)=O VIJOIFCZOYEASP-UHFFFAOYSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- PQSUYGKTWSAVDQ-ZVIOFETBSA-N Aldosterone Chemical compound C([C@@]1([C@@H](C(=O)CO)CC[C@H]1[C@@H]1CC2)C=O)[C@H](O)[C@@H]1[C@]1(C)C2=CC(=O)CC1 PQSUYGKTWSAVDQ-ZVIOFETBSA-N 0.000 description 1
- PQSUYGKTWSAVDQ-UHFFFAOYSA-N Aldosterone Natural products C1CC2C3CCC(C(=O)CO)C3(C=O)CC(O)C2C2(C)C1=CC(=O)CC2 PQSUYGKTWSAVDQ-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 102000004881 Angiotensinogen Human genes 0.000 description 1
- 108090001067 Angiotensinogen Proteins 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- IADUEWIQBXOCDZ-VKHMYHEASA-N Azetidine-2-carboxylic acid Natural products OC(=O)[C@@H]1CCN1 IADUEWIQBXOCDZ-VKHMYHEASA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 125000001433 C-terminal amino-acid group Chemical group 0.000 description 1
- YOKDVWWESDBOGV-QMMMGPOBSA-N CC(C)CN[C@@H](CCC(=O)O)C(=O)OC Chemical compound CC(C)CN[C@@H](CCC(=O)O)C(=O)OC YOKDVWWESDBOGV-QMMMGPOBSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 102000000496 Carboxypeptidases A Human genes 0.000 description 1
- 108010080937 Carboxypeptidases A Proteins 0.000 description 1
- CKLJMWTZIZZHCS-UWTATZPHSA-N D-aspartic acid Chemical compound OC(=O)[C@H](N)CC(O)=O CKLJMWTZIZZHCS-UWTATZPHSA-N 0.000 description 1
- VVNCNSJFMMFHPL-VKHMYHEASA-N D-penicillamine Chemical compound CC(C)(S)[C@@H](N)C(O)=O VVNCNSJFMMFHPL-VKHMYHEASA-N 0.000 description 1
- 235000019739 Dicalciumphosphate Nutrition 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical compound C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- LVGKNOAMLMIIKO-UHFFFAOYSA-N Elaidinsaeure-aethylester Natural products CCCCCCCCC=CCCCCCCCC(=O)OCC LVGKNOAMLMIIKO-UHFFFAOYSA-N 0.000 description 1
- 108010059378 Endopeptidases Proteins 0.000 description 1
- 102000005593 Endopeptidases Human genes 0.000 description 1
- 208000010201 Exanthema Diseases 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 102000006395 Globulins Human genes 0.000 description 1
- 108010044091 Globulins Proteins 0.000 description 1
- HTTJABKRGRZYRN-UHFFFAOYSA-N Heparin Chemical group OC1C(NC(=O)C)C(O)OC(COS(O)(=O)=O)C1OC1C(OS(O)(=O)=O)C(O)C(OC2C(C(OS(O)(=O)=O)C(OC3C(C(O)C(O)C(O3)C(O)=O)OS(O)(=O)=O)C(CO)O2)NS(O)(=O)=O)C(C(O)=O)O1 HTTJABKRGRZYRN-UHFFFAOYSA-N 0.000 description 1
- MMFKFJORZBJVNF-UWVGGRQHSA-N His-Leu Chemical compound CC(C)C[C@@H](C(O)=O)NC(=O)[C@@H](N)CC1=CN=CN1 MMFKFJORZBJVNF-UWVGGRQHSA-N 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- 101000909641 Homo sapiens Transcription factor COE2 Proteins 0.000 description 1
- PMMYEEVYMWASQN-DMTCNVIQSA-N Hydroxyproline Chemical compound O[C@H]1CN[C@H](C(O)=O)C1 PMMYEEVYMWASQN-DMTCNVIQSA-N 0.000 description 1
- JUQLUIFNNFIIKC-YFKPBYRVSA-N L-2-aminopimelic acid Chemical compound OC(=O)[C@@H](N)CCCCC(O)=O JUQLUIFNNFIIKC-YFKPBYRVSA-N 0.000 description 1
- AHLPHDHHMVZTML-BYPYZUCNSA-N L-Ornithine Chemical compound NCCC[C@H](N)C(O)=O AHLPHDHHMVZTML-BYPYZUCNSA-N 0.000 description 1
- DCXYFEDJOCDNAF-REOHCLBHSA-N L-asparagine Chemical compound OC(=O)[C@@H](N)CC(N)=O DCXYFEDJOCDNAF-REOHCLBHSA-N 0.000 description 1
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 1
- SEWIYICDCVPBEW-BYPYZUCNSA-N L-glutamate methyl ester Chemical compound COC(=O)[C@@H](N)CCC(O)=O SEWIYICDCVPBEW-BYPYZUCNSA-N 0.000 description 1
- AGPKZVBTJJNPAG-WHFBIAKZSA-N L-isoleucine Chemical compound CC[C@H](C)[C@H](N)C(O)=O AGPKZVBTJJNPAG-WHFBIAKZSA-N 0.000 description 1
- FORGMRSGVSYZQR-YFKPBYRVSA-N L-leucinamide Chemical compound CC(C)C[C@H](N)C(N)=O FORGMRSGVSYZQR-YFKPBYRVSA-N 0.000 description 1
- HXEACLLIILLPRG-YFKPBYRVSA-N L-pipecolic acid Chemical compound [O-]C(=O)[C@@H]1CCCC[NH2+]1 HXEACLLIILLPRG-YFKPBYRVSA-N 0.000 description 1
- VLJNHYLEOZPXFW-BYPYZUCNSA-N L-prolinamide Chemical compound NC(=O)[C@@H]1CCCN1 VLJNHYLEOZPXFW-BYPYZUCNSA-N 0.000 description 1
- DZLNHFMRPBPULJ-VKHMYHEASA-N L-thioproline Chemical compound OC(=O)[C@@H]1CSCN1 DZLNHFMRPBPULJ-VKHMYHEASA-N 0.000 description 1
- KKCIOUWDFWQUBT-AWEZNQCLSA-N L-thyronine Chemical compound C1=CC(C[C@H](N)C(O)=O)=CC=C1OC1=CC=C(O)C=C1 KKCIOUWDFWQUBT-AWEZNQCLSA-N 0.000 description 1
- OUYCCCASQSFEME-QMMMGPOBSA-N L-tyrosine Chemical compound OC(=O)[C@@H](N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-QMMMGPOBSA-N 0.000 description 1
- RQVLGLPAZTUBKX-VKHMYHEASA-N L-vinylglycine Chemical compound C=C[C@H](N)C(O)=O RQVLGLPAZTUBKX-VKHMYHEASA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 241000272168 Laridae Species 0.000 description 1
- 240000007472 Leucaena leucocephala Species 0.000 description 1
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- MDXGYYOJGPFFJL-QMMMGPOBSA-N N(alpha)-t-butoxycarbonyl-L-leucine Chemical compound CC(C)C[C@@H](C(O)=O)NC(=O)OC(C)(C)C MDXGYYOJGPFFJL-QMMMGPOBSA-N 0.000 description 1
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 1
- AHLPHDHHMVZTML-UHFFFAOYSA-N Orn-delta-NH2 Natural products NCCCC(N)C(O)=O AHLPHDHHMVZTML-UHFFFAOYSA-N 0.000 description 1
- UTJLXEIPEHZYQJ-UHFFFAOYSA-N Ornithine Natural products OC(=O)C(C)CCCN UTJLXEIPEHZYQJ-UHFFFAOYSA-N 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 206010037660 Pyrexia Diseases 0.000 description 1
- ODHCTXKNWHHXJC-GSVOUGTGSA-N Pyroglutamic acid Natural products OC(=O)[C@H]1CCC(=O)N1 ODHCTXKNWHHXJC-GSVOUGTGSA-N 0.000 description 1
- 241000700157 Rattus norvegicus Species 0.000 description 1
- 102100028255 Renin Human genes 0.000 description 1
- 102000005686 Serum Globulins Human genes 0.000 description 1
- 108010045362 Serum Globulins Proteins 0.000 description 1
- MSCCTZZBYHQMQJ-AZAGJHQNSA-N Tocopheryl nicotinate Chemical compound C([C@@](OC1=C(C)C=2C)(C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C)CC1=C(C)C=2OC(=O)C1=CC=CN=C1 MSCCTZZBYHQMQJ-AZAGJHQNSA-N 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- 102100024204 Transcription factor COE2 Human genes 0.000 description 1
- QIVBCDIJIAJPQS-UHFFFAOYSA-N Tryptophan Natural products C1=CC=C2C(CC(N)C(O)=O)=CNC2=C1 QIVBCDIJIAJPQS-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical group [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 108010087924 alanylproline Proteins 0.000 description 1
- 229960002478 aldosterone Drugs 0.000 description 1
- 239000000783 alginic acid Substances 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 229960001126 alginic acid Drugs 0.000 description 1
- 150000004781 alginic acids Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 238000005904 alkaline hydrolysis reaction Methods 0.000 description 1
- 230000000172 allergic effect Effects 0.000 description 1
- 125000003275 alpha amino acid group Chemical group 0.000 description 1
- 150000001370 alpha-amino acid derivatives Chemical class 0.000 description 1
- HWXBTNAVRSUOJR-UHFFFAOYSA-N alpha-hydroxyglutaric acid Natural products OC(=O)C(O)CCC(O)=O HWXBTNAVRSUOJR-UHFFFAOYSA-N 0.000 description 1
- 229940009533 alpha-ketoglutaric acid Drugs 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 230000000890 antigenic effect Effects 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- 235000003704 aspartic acid Nutrition 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 208000010668 atopic eczema Diseases 0.000 description 1
- 125000002393 azetidinyl group Chemical group 0.000 description 1
- JUHORIMYRDESRB-UHFFFAOYSA-N benzathine Chemical compound C=1C=CC=CC=1CNCCNCC1=CC=CC=C1 JUHORIMYRDESRB-UHFFFAOYSA-N 0.000 description 1
- 108010001822 benzoylphenylalanyl-alanyl-proline Proteins 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 230000031709 bromination Effects 0.000 description 1
- 238000005893 bromination reaction Methods 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 210000004899 c-terminal region Anatomy 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- JYYOBHFYCIDXHH-UHFFFAOYSA-N carbonic acid;hydrate Chemical compound O.OC(O)=O JYYOBHFYCIDXHH-UHFFFAOYSA-N 0.000 description 1
- 125000004181 carboxyalkyl group Chemical group 0.000 description 1
- 210000001715 carotid artery Anatomy 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 239000003729 cation exchange resin Substances 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 230000001413 cellular effect Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000007958 cherry flavor Substances 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 230000015271 coagulation Effects 0.000 description 1
- 238000005345 coagulation Methods 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000003240 coconut oil Substances 0.000 description 1
- 235000019864 coconut oil Nutrition 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 235000012343 cottonseed oil Nutrition 0.000 description 1
- 239000002385 cottonseed oil Substances 0.000 description 1
- 239000007822 coupling agent Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 235000018417 cysteine Nutrition 0.000 description 1
- XUJNEKJLAYXESH-UHFFFAOYSA-N cysteine Natural products SCC(N)C(O)=O XUJNEKJLAYXESH-UHFFFAOYSA-N 0.000 description 1
- 125000000847 cytosin-1-yl group Chemical group [*]N1C(=O)N=C(N([H])[H])C([H])=C1[H] 0.000 description 1
- 238000010908 decantation Methods 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- NEFBYIFKOOEVPA-UHFFFAOYSA-K dicalcium phosphate Chemical compound [Ca+2].[Ca+2].[O-]P([O-])([O-])=O NEFBYIFKOOEVPA-UHFFFAOYSA-K 0.000 description 1
- 229940038472 dicalcium phosphate Drugs 0.000 description 1
- 229910000390 dicalcium phosphate Inorganic materials 0.000 description 1
- FBWIRBFZWNIGJC-UHFFFAOYSA-N dihomomethionine Chemical compound CSCCCCC([NH3+])C([O-])=O FBWIRBFZWNIGJC-UHFFFAOYSA-N 0.000 description 1
- 239000000539 dimer Substances 0.000 description 1
- 238000006471 dimerization reaction Methods 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- MKRTXPORKIRPDG-UHFFFAOYSA-N diphenylphosphoryl azide Chemical compound C=1C=CC=CC=1P(=O)(N=[N+]=[N-])C1=CC=CC=C1 MKRTXPORKIRPDG-UHFFFAOYSA-N 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 231100000673 dose–response relationship Toxicity 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000001962 electrophoresis Methods 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 239000002532 enzyme inhibitor Substances 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-N ethanesulfonic acid Chemical compound CCS(O)(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-N 0.000 description 1
- HHFAWKCIHAUFRX-UHFFFAOYSA-N ethoxide Chemical compound CC[O-] HHFAWKCIHAUFRX-UHFFFAOYSA-N 0.000 description 1
- HBOGUIFRIAXYNB-UHFFFAOYSA-N ethyl 2-hydroxy-3-phenylpropanoate Chemical compound CCOC(=O)C(O)CC1=CC=CC=C1 HBOGUIFRIAXYNB-UHFFFAOYSA-N 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- DNJIEGIFACGWOD-UHFFFAOYSA-N ethyl mercaptane Natural products CCS DNJIEGIFACGWOD-UHFFFAOYSA-N 0.000 description 1
- LVGKNOAMLMIIKO-QXMHVHEDSA-N ethyl oleate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OCC LVGKNOAMLMIIKO-QXMHVHEDSA-N 0.000 description 1
- 229940093471 ethyl oleate Drugs 0.000 description 1
- 201000005884 exanthem Diseases 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000010685 fatty oil Substances 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 210000004051 gastric juice Anatomy 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 238000007429 general method Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 210000000585 glomerular basement membrane Anatomy 0.000 description 1
- 125000003630 glycyl group Chemical group [H]N([H])C([H])([H])C(*)=O 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229960002897 heparin Drugs 0.000 description 1
- 229920000669 heparin Polymers 0.000 description 1
- IPCSVZSSVZVIGE-UHFFFAOYSA-M hexadecanoate Chemical compound CCCCCCCCCCCCCCCC([O-])=O IPCSVZSSVZVIGE-UHFFFAOYSA-M 0.000 description 1
- HNDVDQJCIGZPNO-UHFFFAOYSA-N histidine Natural products OC(=O)C(N)CC1=CN=CN1 HNDVDQJCIGZPNO-UHFFFAOYSA-N 0.000 description 1
- 108010025306 histidylleucine Proteins 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-M hydrosulfide Chemical compound [SH-] RWSOTUBLDIXVET-UHFFFAOYSA-M 0.000 description 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 1
- 229960002591 hydroxyproline Drugs 0.000 description 1
- 230000000415 inactivating effect Effects 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- AGPKZVBTJJNPAG-UHFFFAOYSA-N isoleucine Natural products CCC(C)C(N)C(O)=O AGPKZVBTJJNPAG-UHFFFAOYSA-N 0.000 description 1
- 125000000741 isoleucyl group Chemical group [H]N([H])C(C(C([H])([H])[H])C([H])([H])C([H])([H])[H])C(=O)O* 0.000 description 1
- 229950003188 isovaleryl diethylamide Drugs 0.000 description 1
- 125000000468 ketone group Chemical group 0.000 description 1
- 238000011862 kidney biopsy Methods 0.000 description 1
- HXEACLLIILLPRG-RXMQYKEDSA-N l-pipecolic acid Natural products OC(=O)[C@H]1CCCCN1 HXEACLLIILLPRG-RXMQYKEDSA-N 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 125000001909 leucine group Chemical group [H]N(*)C(C(*)=O)C([H])([H])C(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 230000000670 limiting effect Effects 0.000 description 1
- XMGQYMWWDOXHJM-UHFFFAOYSA-N limonene Chemical compound CC(=C)C1CCC(C)=CC1 XMGQYMWWDOXHJM-UHFFFAOYSA-N 0.000 description 1
- 210000004185 liver Anatomy 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 125000003588 lysine group Chemical group [H]N([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])(N([H])[H])C(*)=O 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 239000001525 mentha piperita l. herb oil Substances 0.000 description 1
- VHRYZQNGTZXDNX-UHFFFAOYSA-N methacryloyl chloride Chemical compound CC(=C)C(Cl)=O VHRYZQNGTZXDNX-UHFFFAOYSA-N 0.000 description 1
- 229930182817 methionine Natural products 0.000 description 1
- RMAHPRNLQIRHIJ-UHFFFAOYSA-N methyl carbamimidate Chemical compound COC(N)=N RMAHPRNLQIRHIJ-UHFFFAOYSA-N 0.000 description 1
- 235000010270 methyl p-hydroxybenzoate Nutrition 0.000 description 1
- OSWPMRLSEDHDFF-UHFFFAOYSA-N methyl salicylate Chemical compound COC(=O)C1=CC=CC=C1O OSWPMRLSEDHDFF-UHFFFAOYSA-N 0.000 description 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- DUWWHGPELOTTOE-UHFFFAOYSA-N n-(5-chloro-2,4-dimethoxyphenyl)-3-oxobutanamide Chemical compound COC1=CC(OC)=C(NC(=O)CC(C)=O)C=C1Cl DUWWHGPELOTTOE-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 239000007968 orange flavor Substances 0.000 description 1
- 150000002892 organic cations Chemical class 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 230000008506 pathogenesis Effects 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 229960001639 penicillamine Drugs 0.000 description 1
- 235000019371 penicillin G benzathine Nutrition 0.000 description 1
- FDPIMTJIUBPUKL-UHFFFAOYSA-N pentan-3-one Chemical compound CCC(=O)CC FDPIMTJIUBPUKL-UHFFFAOYSA-N 0.000 description 1
- 229960001412 pentobarbital Drugs 0.000 description 1
- 235000019477 peppermint oil Nutrition 0.000 description 1
- 125000001484 phenothiazinyl group Chemical group C1(=CC=CC=2SC3=CC=CC=C3NC12)* 0.000 description 1
- 125000003884 phenylalkyl group Chemical group 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- WNHWUSVXJSPDTE-JTQLQIEISA-N phenylsulfanyl (2s)-pyrrolidine-2-carboxylate Chemical compound O=C([C@H]1NCCC1)OSC1=CC=CC=C1 WNHWUSVXJSPDTE-JTQLQIEISA-N 0.000 description 1
- NMHMNPHRMNGLLB-UHFFFAOYSA-N phloretic acid Chemical compound OC(=O)CCC1=CC=C(O)C=C1 NMHMNPHRMNGLLB-UHFFFAOYSA-N 0.000 description 1
- 125000000612 phthaloyl group Chemical group C(C=1C(C(=O)*)=CC=CC1)(=O)* 0.000 description 1
- 230000035479 physiological effects, processes and functions Effects 0.000 description 1
- 229920000172 poly(styrenesulfonic acid) Polymers 0.000 description 1
- 229920001184 polypeptide Polymers 0.000 description 1
- 229940005642 polystyrene sulfonic acid Drugs 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- OTYBMLCTZGSZBG-UHFFFAOYSA-L potassium sulfate Chemical compound [K+].[K+].[O-]S([O-])(=O)=O OTYBMLCTZGSZBG-UHFFFAOYSA-L 0.000 description 1
- 229910052939 potassium sulfate Inorganic materials 0.000 description 1
- 235000011151 potassium sulphates Nutrition 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- MFDFERRIHVXMIY-UHFFFAOYSA-N procaine Chemical class CCN(CC)CCOC(=O)C1=CC=C(N)C=C1 MFDFERRIHVXMIY-UHFFFAOYSA-N 0.000 description 1
- 125000001325 propanoyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 235000010232 propyl p-hydroxybenzoate Nutrition 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 239000012264 purified product Substances 0.000 description 1
- 206010037844 rash Diseases 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 206010038464 renal hypertension Diseases 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 230000002207 retinal effect Effects 0.000 description 1
- 102220067365 rs143592561 Human genes 0.000 description 1
- CVHZOJJKTDOEJC-UHFFFAOYSA-N saccharin Chemical compound C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-N 0.000 description 1
- 229940081974 saccharin Drugs 0.000 description 1
- 235000019204 saccharin Nutrition 0.000 description 1
- 239000000901 saccharin and its Na,K and Ca salt Substances 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 125000003607 serino group Chemical group [H]N([H])[C@]([H])(C(=O)[*])C(O[H])([H])[H] 0.000 description 1
- 239000008159 sesame oil Substances 0.000 description 1
- 235000011803 sesame oil Nutrition 0.000 description 1
- 239000003998 snake venom Substances 0.000 description 1
- HYHCSLBZRBJJCH-UHFFFAOYSA-M sodium hydrosulfide Chemical compound [Na+].[SH-] HYHCSLBZRBJJCH-UHFFFAOYSA-M 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- 239000012064 sodium phosphate buffer Substances 0.000 description 1
- 229910052979 sodium sulfide Inorganic materials 0.000 description 1
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000008174 sterile solution Substances 0.000 description 1
- 210000002784 stomach Anatomy 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000003375 sulfoxide group Chemical group 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 238000010189 synthetic method Methods 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- PGFHBPAUWNEKSM-MQWKRIRWSA-N tert-butyl (2s)-4-methoxypyrrolidine-2-carboxylate Chemical compound COC1CN[C@H](C(=O)OC(C)(C)C)C1 PGFHBPAUWNEKSM-MQWKRIRWSA-N 0.000 description 1
- FDIUCOJHQOLBPR-UHFFFAOYSA-N tert-butyl 3-phenylmethoxy-2-sulfanylpropanoate Chemical compound CC(C)(C)OC(=O)C(S)COCC1=CC=CC=C1 FDIUCOJHQOLBPR-UHFFFAOYSA-N 0.000 description 1
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000004014 thioethyl group Chemical group [H]SC([H])([H])C([H])([H])* 0.000 description 1
- 150000003573 thiols Chemical class 0.000 description 1
- NJRXVEJTAYWCQJ-UHFFFAOYSA-N thiomalic acid Chemical compound OC(=O)CC(S)C(O)=O NJRXVEJTAYWCQJ-UHFFFAOYSA-N 0.000 description 1
- 125000004055 thiomethyl group Chemical group [H]SC([H])([H])* 0.000 description 1
- LLSXISZUAPHAJQ-ZETCQYMHSA-N thiophen-2-yl (2s)-pyrrolidine-2-carboxylate Chemical compound O=C([C@H]1NCCC1)OC1=CC=CS1 LLSXISZUAPHAJQ-ZETCQYMHSA-N 0.000 description 1
- 125000000341 threoninyl group Chemical group [H]OC([H])(C([H])([H])[H])C([H])(N([H])[H])C(*)=O 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
- 229950009883 tocopheryl nicotinate Drugs 0.000 description 1
- 125000002088 tosyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])S(*)(=O)=O 0.000 description 1
- BJBUEDPLEOHJGE-IMJSIDKUSA-N trans-3-hydroxy-L-proline Chemical compound O[C@H]1CC[NH2+][C@@H]1C([O-])=O BJBUEDPLEOHJGE-IMJSIDKUSA-N 0.000 description 1
- 125000000430 tryptophan group Chemical group [H]N([H])C(C(=O)O*)C([H])([H])C1=C([H])N([H])C2=C([H])C([H])=C([H])C([H])=C12 0.000 description 1
- OUYCCCASQSFEME-UHFFFAOYSA-N tyrosine Natural products OC(=O)C(N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-UHFFFAOYSA-N 0.000 description 1
- 125000001493 tyrosinyl group Chemical group [H]OC1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])(N([H])[H])C(*)=O 0.000 description 1
- 210000002700 urine Anatomy 0.000 description 1
- 239000002966 varnish Substances 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 235000019155 vitamin A Nutrition 0.000 description 1
- 239000011719 vitamin A Substances 0.000 description 1
- 235000019154 vitamin C Nutrition 0.000 description 1
- 239000011718 vitamin C Substances 0.000 description 1
- 235000019165 vitamin E Nutrition 0.000 description 1
- 239000011709 vitamin E Substances 0.000 description 1
- 150000003712 vitamin E derivatives Chemical class 0.000 description 1
- 239000009637 wintergreen oil Substances 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- DGVVWUTYPXICAM-UHFFFAOYSA-N β‐Mercaptoethanol Chemical compound OCCS DGVVWUTYPXICAM-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07K—PEPTIDES
- C07K5/00—Peptides containing up to four amino acids in a fully defined sequence; Derivatives thereof
- C07K5/02—Peptides containing up to four amino acids in a fully defined sequence; Derivatives thereof containing at least one abnormal peptide link
- C07K5/022—Peptides containing up to four amino acids in a fully defined sequence; Derivatives thereof containing at least one abnormal peptide link containing the structure -X-C(=O)-(C)n-N-C-C(=O)-Y-; X and Y being heteroatoms; n being 1 or 2
- C07K5/0222—Peptides containing up to four amino acids in a fully defined sequence; Derivatives thereof containing at least one abnormal peptide link containing the structure -X-C(=O)-(C)n-N-C-C(=O)-Y-; X and Y being heteroatoms; n being 1 or 2 with the first amino acid being heterocyclic, e.g. Pro, Trp
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K38/00—Medicinal preparations containing peptides
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Genetics & Genomics (AREA)
- Biochemistry (AREA)
- Biophysics (AREA)
- General Health & Medical Sciences (AREA)
- Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Molecular Biology (AREA)
- Proteomics, Peptides & Aminoacids (AREA)
- Life Sciences & Earth Sciences (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Peptides Or Proteins (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US18799280A | 1980-09-17 | 1980-09-17 | |
| US29513581A | 1981-08-21 | 1981-08-21 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO813153L true NO813153L (no) | 1982-03-18 |
Family
ID=26883623
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO813153A NO813153L (no) | 1980-09-17 | 1981-09-16 | Nye karboksyalkylpeptider og tioetere og etere av peptider med antihypertensiv aktivitet |
Country Status (8)
| Country | Link |
|---|---|
| EP (1) | EP0048159A3 (forum.php) |
| AU (1) | AU7529581A (forum.php) |
| DD (1) | DD201777A5 (forum.php) |
| ES (2) | ES8306098A1 (forum.php) |
| GR (1) | GR75019B (forum.php) |
| NO (1) | NO813153L (forum.php) |
| PL (4) | PL238472A1 (forum.php) |
| PT (1) | PT73685B (forum.php) |
Families Citing this family (56)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2480747A1 (fr) * | 1980-04-17 | 1981-10-23 | Roques Bernard | Derives d'acides amines et leur application therapeutique |
| IE54551B1 (en) * | 1982-01-22 | 1989-11-22 | Ici Plc | Amide derivatives |
| JPS6058233B2 (ja) * | 1982-05-24 | 1985-12-19 | 田辺製薬株式会社 | 2−オキソイミダゾリジン誘導体及びその製法 |
| AU1643283A (en) * | 1982-07-19 | 1984-01-26 | E.R. Squibb & Sons, Inc. | Substituted peptides |
| US4500713A (en) * | 1982-09-23 | 1985-02-19 | Usv Pharmaceutical Corporation | Therapeutic dipeptides |
| FI841052A7 (fi) * | 1983-03-16 | 1984-09-17 | Usv Pharma Corp | Foereningar foer behandling av blodtryckssjukdomar. |
| EP0127124A3 (en) * | 1983-05-23 | 1987-04-08 | Usv Pharmaceutical Corporation | Compounds for treating hypertension |
| US4574079A (en) * | 1983-05-27 | 1986-03-04 | Gavras Haralambos P | Radiolabeled angiotensin converting enzyme inhibitors for radiolabeling mammalian organ sites |
| IT1165464B (it) * | 1983-07-29 | 1987-04-22 | Montedison Spa | Composti ad attivita' antidotica per la difesa di colture di interesse agrario dall'azione di erbicidi non selettivi |
| US4665052A (en) * | 1984-03-27 | 1987-05-12 | Merck & Co., Inc. | Renin inhibitors containing homophe8 and a C-terminal amide cycle |
| US4668663A (en) * | 1984-03-27 | 1987-05-26 | Merck & Co., Inc. | Renin inhibitors containing homophe8 |
| US5684016A (en) * | 1984-04-12 | 1997-11-04 | Hoechst Aktiengesellschaft | Method of treating cardiac insufficiency |
| DE3413710A1 (de) * | 1984-04-12 | 1985-10-24 | Hoechst Ag, 6230 Frankfurt | Verfahren zur behandlung der herzinsuffizienz |
| US4500518A (en) * | 1984-04-19 | 1985-02-19 | E. R. Squibb & Sons, Inc. | Amino thiol dipeptides |
| US4560506A (en) * | 1984-05-25 | 1985-12-24 | E. R. Squibb & Sons, Inc. | Mercaptocycloalkylcarbonyl and mercaptoarylcarbonyl dipeptides |
| GB8422165D0 (en) * | 1984-09-01 | 1984-10-03 | Wellcome Found | Compounds |
| EP0175266B1 (en) * | 1984-09-12 | 1996-03-20 | Rhone-Poulenc Rorer Pharmaceuticals Inc. | Antihypertensive derivatives |
| DE3436386A1 (de) * | 1984-10-04 | 1986-04-10 | Merck Patent Gmbh, 6100 Darmstadt | (thio)morpholine |
| IT1176983B (it) * | 1984-10-16 | 1987-08-26 | Zambon Spa | Dipeptidi ad attivita' farmacologica |
| CH672792A5 (forum.php) * | 1985-02-19 | 1989-12-29 | Sandoz Ag | |
| ATE72431T1 (de) * | 1985-08-31 | 1992-02-15 | Fisons Plc | 5-gliedrige heterocyclische angiotensinumwandlungsenzym-inhibitoren. |
| US5231080A (en) * | 1985-10-15 | 1993-07-27 | Hoechst Aktiengesellschaft | Method for the treatment of atherosclerosis, thrombosis, and peripheral vessel disease |
| US5231084A (en) * | 1986-03-27 | 1993-07-27 | Hoechst Aktiengesellschaft | Compounds having a cognition adjuvant action, agents containing them, and the use thereof for the treatment and prophylaxis of cognitive dysfuncitons |
| IT1206078B (it) * | 1987-06-03 | 1989-04-14 | Polifarma Spa | Procedimento per la produzione di acido 3-indolpiruvico e suoi derivati loro uso farmaceutico |
| DE3803225A1 (de) * | 1988-02-04 | 1989-08-17 | Hoechst Ag | Aminosaeureamide mit psychotroper wirkung, verfahren zu ihrer herstellung, sie enthaltende mittel und deren verwendung |
| US5563277A (en) * | 1994-12-21 | 1996-10-08 | Eli Lilly And Company | Process for preparing benzyl-substituted rhodanine derivatives |
| GB2324527B (en) * | 1995-06-07 | 1999-12-22 | Guilford Pharm Inc | Small molecule inhibitors of rotamase enzyme activity |
| US7056935B2 (en) | 1995-06-07 | 2006-06-06 | Gpi Nil Holdings, Inc. | Rotamase enzyme activity inhibitors |
| US5859031A (en) | 1995-06-07 | 1999-01-12 | Gpi Nil Holdings, Inc. | Small molecule inhibitors of rotamase enzyme activity |
| US5801197A (en) * | 1995-10-31 | 1998-09-01 | Gpi Nil Holdings, Inc. | Rotamase enzyme activity inhibitors |
| US6218424B1 (en) | 1996-09-25 | 2001-04-17 | Gpi Nil Holdings, Inc. | Heterocyclic ketone and thioester compounds and uses |
| US5801187A (en) * | 1996-09-25 | 1998-09-01 | Gpi-Nil Holdings, Inc. | Heterocyclic esters and amides |
| US5786378A (en) * | 1996-09-25 | 1998-07-28 | Gpi Nil Holdings, Inc. | Heterocyclic thioesters |
| US6187784B1 (en) | 1998-06-03 | 2001-02-13 | Gpi Nil Holdings, Inc. | Pipecolic acid derivative hair growth compositions and uses |
| US20010049381A1 (en) | 1997-06-04 | 2001-12-06 | Gpl Nil Holdings, Inc., | Pyrrolidine derivative hair growth compositions and uses |
| US6187796B1 (en) | 1998-06-03 | 2001-02-13 | Gpi Nil Holdings, Inc. | Sulfone hair growth compositions and uses |
| US6271244B1 (en) | 1998-06-03 | 2001-08-07 | Gpi Nil Holdings, Inc. | N-linked urea or carbamate of heterocyclic thioester hair growth compositions and uses |
| US5945441A (en) | 1997-06-04 | 1999-08-31 | Gpi Nil Holdings, Inc. | Pyrrolidine carboxylate hair revitalizing agents |
| US6274602B1 (en) | 1998-06-03 | 2001-08-14 | Gpi Nil Holdings, Inc. | Heterocyclic thioester and ketone hair growth compositions and uses |
| CZ291417B6 (cs) * | 1997-08-06 | 2003-03-12 | Dsm Fine Chemicals Austria Nfg Gmbh & Co Kg | Způsob výroby 1-pyruvyl-L-prolinu |
| US6429215B1 (en) | 1998-06-03 | 2002-08-06 | Gpi Nil Holdings, Inc. | N-oxide of heterocyclic ester, amide, thioester, or ketone hair growth compositions and uses |
| JP2002516843A (ja) | 1998-06-03 | 2002-06-11 | ジー・ピー・アイ ニイル ホールディングス インコーポレィティッド | ヘテロサイクリックエステルおよびアミド発毛組成物およびその使用 |
| US6331537B1 (en) | 1998-06-03 | 2001-12-18 | Gpi Nil Holdings, Inc. | Carboxylic acids and carboxylic acid isosteres of N-heterocyclic compounds |
| US6172087B1 (en) | 1998-06-03 | 2001-01-09 | Gpi Nil Holding, Inc. | N-oxide of heterocyclic ester, amide, thioester, or ketone hair growth compositions and uses |
| US7338976B1 (en) | 1998-08-14 | 2008-03-04 | Gpi Nil Holdings, Inc. | Heterocyclic esters or amides for vision and memory disorders |
| US6395758B1 (en) | 1998-08-14 | 2002-05-28 | Gpi Nil Holdings, Inc. | Small molecule carbamates or ureas for vision and memory disorders |
| US6333340B1 (en) | 1998-08-14 | 2001-12-25 | Gpi Nil Holdings, Inc. | Small molecule sulfonamides for vision and memory disorders |
| US6376517B1 (en) | 1998-08-14 | 2002-04-23 | Gpi Nil Holdings, Inc. | Pipecolic acid derivatives for vision and memory disorders |
| US6399648B1 (en) | 1998-08-14 | 2002-06-04 | Gpi Nil Holdings, Inc. | N-oxides of heterocyclic ester, amide, thioester, or ketone for vision and memory disorders |
| US6337340B1 (en) | 1998-08-14 | 2002-01-08 | Gpi Nil Holdings, Inc. | Carboxylic acids and isosteres of heterocyclic ring compounds having multiple heteroatoms for vision and memory disorders |
| US6335348B1 (en) | 1998-08-14 | 2002-01-01 | Gpi Nil Holdings, Inc. | Nitrogen-containing linear and azepinyl/ compositions and uses for vision and memory disorders |
| US6339101B1 (en) | 1998-08-14 | 2002-01-15 | Gpi Nil Holdings, Inc. | N-linked sulfonamides of N-heterocyclic carboxylic acids or isosteres for vision and memory disorders |
| US6506788B1 (en) | 1998-08-14 | 2003-01-14 | Gpi Nil Holdings, Inc. | N-linked urea or carbamate of heterocyclic thioesters for vision and memory disorders |
| US6218423B1 (en) | 1998-08-14 | 2001-04-17 | Gpi Nil Holdings, Inc. | Pyrrolidine derivatives for vision and memory disorders |
| US6384056B1 (en) | 1998-08-14 | 2002-05-07 | Gpi Nil Holdings, Inc. | Heterocyclic thioesters or ketones for vision and memory disorders |
| US6462072B1 (en) | 1998-09-21 | 2002-10-08 | Gpi Nil Holdings, Inc. | Cyclic ester or amide derivatives |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IL58849A (en) * | 1978-12-11 | 1983-03-31 | Merck & Co Inc | Carboxyalkyl dipeptides and derivatives thereof,their preparation and pharmaceutical compositions containing them |
| JPS5683483A (en) * | 1979-12-13 | 1981-07-08 | Santen Pharmaceut Co Ltd | Thiazolidine compound |
-
1981
- 1981-09-15 GR GR66073A patent/GR75019B/el unknown
- 1981-09-15 EP EP81304210A patent/EP0048159A3/en not_active Withdrawn
- 1981-09-16 NO NO813153A patent/NO813153L/no unknown
- 1981-09-16 AU AU75295/81A patent/AU7529581A/en not_active Abandoned
- 1981-09-16 PT PT73685A patent/PT73685B/pt not_active IP Right Cessation
- 1981-09-17 PL PL23847281A patent/PL238472A1/xx unknown
- 1981-09-17 PL PL23847181A patent/PL238471A1/xx unknown
- 1981-09-17 PL PL23847081A patent/PL238470A1/xx unknown
- 1981-09-17 PL PL23306081A patent/PL233060A1/xx unknown
- 1981-09-17 DD DD81233368A patent/DD201777A5/de unknown
-
1982
- 1982-08-02 ES ES514672A patent/ES8306098A1/es not_active Expired
- 1982-08-02 ES ES514664A patent/ES514664A0/es active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| PL238471A1 (en) | 1983-08-29 |
| EP0048159A2 (en) | 1982-03-24 |
| EP0048159A3 (en) | 1982-05-12 |
| ES514672A0 (es) | 1983-05-01 |
| GR75019B (forum.php) | 1984-07-12 |
| AU7529581A (en) | 1982-03-25 |
| ES8306097A1 (es) | 1983-05-01 |
| PL233060A1 (en) | 1983-01-31 |
| PT73685A (en) | 1981-10-01 |
| PL238472A1 (en) | 1983-08-29 |
| DD201777A5 (de) | 1983-08-10 |
| ES8306098A1 (es) | 1983-05-01 |
| PL238470A1 (en) | 1983-08-29 |
| PT73685B (pt) | 2003-12-31 |
| ES514664A0 (es) | 1983-05-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO813153L (no) | Nye karboksyalkylpeptider og tioetere og etere av peptider med antihypertensiv aktivitet | |
| EP0073143B1 (en) | Novel complex amido and imido derivatives of carboxyalkyl peptides and thioethers and ethers of peptides | |
| US4692458A (en) | Anti-hypertensive agents | |
| KR940001769B1 (ko) | 중성 메탈로엔도펩티다제 억제제 | |
| EP0007477B1 (en) | 1-(3-mercapto-2-methylpropanoyl)prolyl amino acid derivatives and salts thereof, processes for their preparation, and pharmaceutical compositions containing such compounds | |
| RU2298559C2 (ru) | Дипептиды, содержащие на n-концевом аминокислотном остатке 2-тиоацильную группу, в качестве ингибиторов вазопептидазы | |
| US4745124A (en) | Orally effective anti-hypertensive agents | |
| FI76558B (fi) | Foerfarande foer framstaellning av en vid blodtrycksjukdom anvaendbar inhibition foer angiotensinomvandlande enzym. | |
| IE48922B1 (en) | Carboxyalkyl dipeptide derivatives,process for preparing them and pharmaceutical composition containing them | |
| JP3647914B2 (ja) | 環式アミノ酸誘導体 | |
| US5432186A (en) | Cyclic amino acid derivatives | |
| US4500467A (en) | Benzoylthio compounds, their preparation and their use as drugs | |
| EP0036713B1 (en) | Angiotensin converting enzyme inhibitors | |
| US4734420A (en) | Anti-hypertensive agents | |
| US4833152A (en) | Anti-hypertensive agents | |
| US4690936A (en) | Anti-hypertensive agents | |
| US6426354B1 (en) | Certain heteroaryl substituted thiol inhibitors of endothelin-converting enzyme | |
| KR850001629B1 (ko) | 아미노산-및 아실아미노산-치환 티올에스테르 프롤린류의 제조방법 | |
| EP0181644B1 (en) | Amino thiol peptides | |
| HU199786B (en) | Process for producing peptide derivatives suitable for treating high blood pressure | |
| JPH0419228B2 (forum.php) | ||
| NO168306B (no) | Analogifremgangsmaate til fremstilling av en inhibitor forangiotensin-omdannende enzym | |
| GB2114561A (en) | Anti-hypertensive agents | |
| IE51739B1 (en) | Anti-hypertensive agents | |
| IT8224313A1 (it) | N-carbossialchiltioacil derivati di amminoacidi utili come antiipertensivi |