NO793411L - Fremgangsmaate for fremstilling av terapeutisk aktive imidazolderivater. - Google Patents
Fremgangsmaate for fremstilling av terapeutisk aktive imidazolderivater.Info
- Publication number
- NO793411L NO793411L NO793411A NO793411A NO793411L NO 793411 L NO793411 L NO 793411L NO 793411 A NO793411 A NO 793411A NO 793411 A NO793411 A NO 793411A NO 793411 L NO793411 L NO 793411L
- Authority
- NO
- Norway
- Prior art keywords
- halogen
- stated
- formula
- hydrogen
- procedure
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 30
- 238000002360 preparation method Methods 0.000 title abstract description 3
- 230000001225 therapeutic effect Effects 0.000 title 1
- 229910052736 halogen Inorganic materials 0.000 claims description 24
- 150000001875 compounds Chemical class 0.000 claims description 22
- 150000002367 halogens Chemical class 0.000 claims description 21
- 150000003839 salts Chemical class 0.000 claims description 20
- 229910052739 hydrogen Inorganic materials 0.000 claims description 19
- 239000001257 hydrogen Substances 0.000 claims description 19
- -1 ion salts Chemical class 0.000 claims description 17
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 14
- 239000000460 chlorine Substances 0.000 claims description 14
- 229910052801 chlorine Inorganic materials 0.000 claims description 14
- 239000002253 acid Substances 0.000 claims description 13
- 150000002431 hydrogen Chemical group 0.000 claims description 13
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 11
- 125000000217 alkyl group Chemical group 0.000 claims description 11
- 125000005843 halogen group Chemical group 0.000 claims description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 5
- 229910052794 bromium Inorganic materials 0.000 claims description 5
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 125000004414 alkyl thio group Chemical group 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 claims description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- 125000001309 chloro group Chemical group Cl* 0.000 claims 3
- 238000004519 manufacturing process Methods 0.000 claims 1
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 30
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 21
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 20
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 15
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 14
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 14
- 239000000203 mixture Substances 0.000 description 11
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- 239000000243 solution Substances 0.000 description 9
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 8
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 8
- 239000002585 base Substances 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridin-1-ium;chloride Chemical compound [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 description 6
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 5
- 239000012458 free base Substances 0.000 description 5
- 239000012280 lithium aluminium hydride Substances 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- VDXWCRIARMBDOX-UHFFFAOYSA-N (4,6-dichloropyridin-3-yl)methanol Chemical compound OCC1=CN=C(Cl)C=C1Cl VDXWCRIARMBDOX-UHFFFAOYSA-N 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- 238000001953 recrystallisation Methods 0.000 description 4
- 229910052938 sodium sulfate Inorganic materials 0.000 description 4
- 235000011152 sodium sulphate Nutrition 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- RWJSYVQOVOFTJQ-UHFFFAOYSA-N (4,6-dichloroquinolin-3-yl)methanol Chemical compound C1=CC(Cl)=CC2=C(Cl)C(CO)=CN=C21 RWJSYVQOVOFTJQ-UHFFFAOYSA-N 0.000 description 3
- DMZNIROKRAUMSD-UHFFFAOYSA-N (4,7-dichloroquinolin-3-yl)methanol Chemical compound C1=C(Cl)C=CC2=C(Cl)C(CO)=CN=C21 DMZNIROKRAUMSD-UHFFFAOYSA-N 0.000 description 3
- UKVLTPAGJIYSGN-UHFFFAOYSA-N 1-(2,4-dichlorophenyl)-2-imidazol-1-ylethanol Chemical compound C=1C=C(Cl)C=C(Cl)C=1C(O)CN1C=CN=C1 UKVLTPAGJIYSGN-UHFFFAOYSA-N 0.000 description 3
- PZHIYZLLIBBPFK-UHFFFAOYSA-N 2,4-dichloro-5-(chloromethyl)pyridine Chemical compound ClCC1=CN=C(Cl)C=C1Cl PZHIYZLLIBBPFK-UHFFFAOYSA-N 0.000 description 3
- NTWZHQAXJSJOIB-UHFFFAOYSA-N 2-imidazol-1-yl-1-phenylethanol Chemical class C=1C=CC=CC=1C(O)CN1C=CN=C1 NTWZHQAXJSJOIB-UHFFFAOYSA-N 0.000 description 3
- IHUNVPDCOXWLAH-UHFFFAOYSA-N 4,6-dichloro-3-(chloromethyl)quinoline Chemical compound C1=CC(Cl)=CC2=C(Cl)C(CCl)=CN=C21 IHUNVPDCOXWLAH-UHFFFAOYSA-N 0.000 description 3
- ZRYDYTAPOBOBIN-UHFFFAOYSA-N 4,7-dichloro-3-(chloromethyl)quinoline Chemical compound C1=C(Cl)C=CC2=C(Cl)C(CCl)=CN=C21 ZRYDYTAPOBOBIN-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 239000003610 charcoal Substances 0.000 description 3
- KWYQZEQRIMVMTH-UHFFFAOYSA-N ethyl 4,7-dichloroquinoline-3-carboxylate Chemical class C1=C(Cl)C=CC2=C(Cl)C(C(=O)OCC)=CN=C21 KWYQZEQRIMVMTH-UHFFFAOYSA-N 0.000 description 3
- PSXRWZBTVAZNSF-UHFFFAOYSA-N hydron;quinoline;chloride Chemical compound Cl.N1=CC=CC2=CC=CC=C21 PSXRWZBTVAZNSF-UHFFFAOYSA-N 0.000 description 3
- 150000007522 mineralic acids Chemical class 0.000 description 3
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- 229910002651 NO3 Inorganic materials 0.000 description 2
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 2
- KXHPPCXNWTUNSB-UHFFFAOYSA-M benzyl(trimethyl)azanium;chloride Chemical compound [Cl-].C[N+](C)(C)CC1=CC=CC=C1 KXHPPCXNWTUNSB-UHFFFAOYSA-M 0.000 description 2
- 239000003638 chemical reducing agent Substances 0.000 description 2
- AAUBVINEXCCXOK-UHFFFAOYSA-N ethyl 4,6-dichloropyridine-3-carboxylate Chemical compound CCOC(=O)C1=CN=C(Cl)C=C1Cl AAUBVINEXCCXOK-UHFFFAOYSA-N 0.000 description 2
- BSSNTDZRVNQGDF-UHFFFAOYSA-N ethyl 4,6-dichloroquinoline-3-carboxylate Chemical class C1=CC(Cl)=CC2=C(Cl)C(C(=O)OCC)=CN=C21 BSSNTDZRVNQGDF-UHFFFAOYSA-N 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 238000007429 general method Methods 0.000 description 2
- 150000002366 halogen compounds Chemical class 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 229910052987 metal hydride Inorganic materials 0.000 description 2
- 150000004681 metal hydrides Chemical class 0.000 description 2
- 231100000252 nontoxic Toxicity 0.000 description 2
- 230000003000 nontoxic effect Effects 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- CNQCWYFDIQSALX-UHFFFAOYSA-N 3-(chloromethyl)pyridine Chemical class ClCC1=CC=CN=C1 CNQCWYFDIQSALX-UHFFFAOYSA-N 0.000 description 1
- DSOGFOBIDOVCHN-UHFFFAOYSA-N 3-(chloromethyl)quinoline Chemical class C1=CC=CC2=CC(CCl)=CN=C21 DSOGFOBIDOVCHN-UHFFFAOYSA-N 0.000 description 1
- ANKGRWGYCWJARK-UHFFFAOYSA-N 4,6-dichloro-3-[[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethoxy]methyl]-2-methylpyridine Chemical compound CC1=NC(Cl)=CC(Cl)=C1COC(C=1C(=CC(Cl)=CC=1)Cl)CN1C=NC=C1 ANKGRWGYCWJARK-UHFFFAOYSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- BTBUEUYNUDRHOZ-UHFFFAOYSA-N Borate Chemical compound [O-]B([O-])[O-] BTBUEUYNUDRHOZ-UHFFFAOYSA-N 0.000 description 1
- 241000222122 Candida albicans Species 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- 241000700198 Cavia Species 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-M Methanesulfonate Chemical compound CS([O-])(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-M 0.000 description 1
- 241000699666 Mus <mouse, genus> Species 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 1
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 241000276498 Pollachius virens Species 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 241000224527 Trichomonas vaginalis Species 0.000 description 1
- 241001045770 Trichophyton mentagrophytes Species 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 230000000843 anti-fungal effect Effects 0.000 description 1
- 239000003429 antifungal agent Substances 0.000 description 1
- 229940072107 ascorbate Drugs 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- RQPZNWPYLFFXCP-UHFFFAOYSA-L barium dihydroxide Chemical compound [OH-].[OH-].[Ba+2] RQPZNWPYLFFXCP-UHFFFAOYSA-L 0.000 description 1
- 229910001863 barium hydroxide Inorganic materials 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229940095731 candida albicans Drugs 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000002026 chloroform extract Substances 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- ZHGASCUQXLPSDT-UHFFFAOYSA-N cyclohexanesulfonic acid Chemical compound OS(=O)(=O)C1CCCCC1 ZHGASCUQXLPSDT-UHFFFAOYSA-N 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- LNIMLSAAPISOEC-UHFFFAOYSA-N ethyl 4,6-dichloro-2-methylpyridine-3-carboxylate Chemical compound CCOC(=O)C1=C(C)N=C(Cl)C=C1Cl LNIMLSAAPISOEC-UHFFFAOYSA-N 0.000 description 1
- NZELFGGFSIVWAG-UHFFFAOYSA-N ethyl 4,6-dichloroquinoline-5-carboxylate Chemical compound C1=CC(Cl)=C2C(C(=O)OCC)=C(Cl)C=CC2=N1 NZELFGGFSIVWAG-UHFFFAOYSA-N 0.000 description 1
- ABZXBXREXPKTCN-UHFFFAOYSA-N ethyl 6-chloro-4-oxo-1h-quinoline-3-carboxylate Chemical compound C1=C(Cl)C=C2C(=O)C(C(=O)OCC)=CNC2=C1 ABZXBXREXPKTCN-UHFFFAOYSA-N 0.000 description 1
- XWMCHSWUDMFGSW-UHFFFAOYSA-N ethyl 7-chloro-4-oxo-1h-quinoline-3-carboxylate Chemical compound ClC1=CC=C2C(=O)C(C(=O)OCC)=CNC2=C1 XWMCHSWUDMFGSW-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 125000004970 halomethyl group Chemical group 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- NIXKBAZVOQAHGC-UHFFFAOYSA-N phenylmethanesulfonic acid Chemical compound OS(=O)(=O)CC1=CC=CC=C1 NIXKBAZVOQAHGC-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- UXCDUFKZSUBXGM-UHFFFAOYSA-N phosphoric tribromide Chemical compound BrP(Br)(Br)=O UXCDUFKZSUBXGM-UHFFFAOYSA-N 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- FLGKQMOTLCGOQH-UHFFFAOYSA-N quinolin-3-ylmethanol Chemical class C1=CC=CC2=CC(CO)=CN=C21 FLGKQMOTLCGOQH-UHFFFAOYSA-N 0.000 description 1
- DJXNJVFEFSWHLY-UHFFFAOYSA-N quinoline-3-carboxylic acid Chemical compound C1=CC=CC2=CC(C(=O)O)=CN=C21 DJXNJVFEFSWHLY-UHFFFAOYSA-N 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000011833 salt mixture Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- 229910052717 sulfur Chemical group 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 230000007306 turnover Effects 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/61—Halogen atoms or nitro radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/954,728 US4202985A (en) | 1978-10-25 | 1978-10-25 | Imidazolylethoxy derivatives of quinoline-3-methanols |
| US05/954,730 US4191831A (en) | 1978-10-25 | 1978-10-25 | Imidazolylethoxy derivatives of pyridin-5-methanols |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO793411L true NO793411L (no) | 1980-04-28 |
Family
ID=27130354
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO793411A NO793411L (no) | 1978-10-25 | 1979-10-24 | Fremgangsmaate for fremstilling av terapeutisk aktive imidazolderivater. |
Country Status (12)
| Country | Link |
|---|---|
| AU (1) | AU5136879A (nl) |
| DE (1) | DE2943151A1 (nl) |
| DK (1) | DK448379A (nl) |
| FR (1) | FR2439781A1 (nl) |
| GB (1) | GB2033384B (nl) |
| HU (1) | HU178748B (nl) |
| IE (1) | IE49081B1 (nl) |
| IT (1) | IT1125592B (nl) |
| LU (1) | LU81814A1 (nl) |
| NL (1) | NL7907349A (nl) |
| NO (1) | NO793411L (nl) |
| SE (1) | SE7908820L (nl) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4282230A (en) * | 1979-11-15 | 1981-08-04 | E. R. Squibb & Sons, Inc. | Imidazolylethoxy derivatives of quinoline-2- or 4-methanols, antimicrobial compositions containing them and method for treating bacterial or fungal infections with them |
-
1979
- 1979-09-28 FR FR7924279A patent/FR2439781A1/fr not_active Withdrawn
- 1979-10-02 AU AU51368/79A patent/AU5136879A/en not_active Abandoned
- 1979-10-03 NL NL7907349A patent/NL7907349A/nl not_active Application Discontinuation
- 1979-10-04 GB GB7934486A patent/GB2033384B/en not_active Expired
- 1979-10-05 IE IE1894/79A patent/IE49081B1/en unknown
- 1979-10-24 HU HU79SU1038A patent/HU178748B/hu unknown
- 1979-10-24 LU LU81814A patent/LU81814A1/fr unknown
- 1979-10-24 DK DK448379A patent/DK448379A/da unknown
- 1979-10-24 NO NO793411A patent/NO793411L/no unknown
- 1979-10-24 SE SE7908820A patent/SE7908820L/xx not_active Application Discontinuation
- 1979-10-24 IT IT26765/79A patent/IT1125592B/it active
- 1979-10-25 DE DE19792943151 patent/DE2943151A1/de not_active Withdrawn
Also Published As
| Publication number | Publication date |
|---|---|
| GB2033384B (en) | 1982-08-25 |
| AU5136879A (en) | 1980-05-01 |
| FR2439781A1 (fr) | 1980-05-23 |
| IE791894L (en) | 1980-04-25 |
| IT1125592B (it) | 1986-05-14 |
| DE2943151A1 (de) | 1980-05-08 |
| SE7908820L (sv) | 1980-04-26 |
| GB2033384A (en) | 1980-05-21 |
| HU178748B (en) | 1982-06-28 |
| NL7907349A (nl) | 1980-04-29 |
| DK448379A (da) | 1980-04-26 |
| LU81814A1 (fr) | 1980-01-25 |
| IE49081B1 (en) | 1985-07-24 |
| IT7926765A0 (it) | 1979-10-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US5747486A (en) | Thienopyridine or thienopyrimidine derivatives and their use | |
| JPS6089474A (ja) | モルフイナン誘導体，その製造方法，及び該化合物を含有する抗腫瘍剤 | |
| DD215546A5 (de) | Verfahren zur herstellung bicyclischer thromboxansynthetase-inhibitoren | |
| CN103781783A (zh) | 作为抗精神病药物的哌嗪取代的苯并噻吩衍生物 | |
| DK162629B (da) | 2-substituerede 1-aralkyl-imidazoler og farmaceutiske midler der indeholder disse, anvendelse heraf til fremstilling af farmaceutiske midler samt fremgangsmaade til fremstilling heraf | |
| PL101468B1 (pl) | Sposob wytwarzania nowych acyloaminopochodnych 5-czlonowych zwiazkow heterocyklicznych | |
| US4062966A (en) | 1-Aryl-2-(1-imidazolyl) alkyl ethers and thioethers | |
| JPS6253504B2 (nl) | ||
| US4910212A (en) | Heterocyclic compounds | |
| KR870000358B1 (ko) | 트리아졸 항진균제의 제조방법 | |
| IE48820B1 (en) | Imidazolyl vinyl ethers having fungicidal and bactericidal activity | |
| JP3057095B2 (ja) | イサチン誘導体、その製造方法及びその使用方法 | |
| DK168010B1 (da) | Tetrahydroisoquinolinforbindelser og farmaceutisk middel indeholdende en saadan forbindelse | |
| KR20150134731A (ko) | 오로라 키나아제 억제 활성을 갖는 신규한 트리아졸일살리실아마이드 유도체 | |
| NO793411L (no) | Fremgangsmaate for fremstilling av terapeutisk aktive imidazolderivater. | |
| US4282230A (en) | Imidazolylethoxy derivatives of quinoline-2- or 4-methanols, antimicrobial compositions containing them and method for treating bacterial or fungal infections with them | |
| US4234589A (en) | Imidazolylethoxymethyl derivatives of 1,3-dioxolo quinolines | |
| US4202985A (en) | Imidazolylethoxy derivatives of quinoline-3-methanols | |
| CN108558833A (zh) | 吡唑醇类化合物、其药物组合物及其在药物中的应用 | |
| NO792275L (no) | Fremgangsmaate for fremstilling av farmakologisk aktive pyrazolo-pyridinderivater | |
| IE51951B1 (en) | Pyrazoline derivatives | |
| PT889891E (pt) | Derivados de 4-¬(tien-2-il)metil}imidazole com actividade agonista de alfa2-adrenorreceptores | |
| US4191831A (en) | Imidazolylethoxy derivatives of pyridin-5-methanols | |
| CA1258264A (en) | .beta.-METHYLENETHIOPHENETHANAMINES | |
| US4260616A (en) | Antimicrobial imidazolylethoxymethyl derivatives of 1,3-dioxolo quinolines |